// ==UserScript==
// @name nHentai Helper
// @name:zh-CN nHentai 助手
// @name:zh-TW nHentai 助手
// @namespace https://github.com/Tsuk1ko
// @version 3.8.1
// @author Jindai Kirin
// @description Download nHentai manga as compression file easily, and add some useful features. Also support some mirror sites.
// @description:zh-CN 为 nHentai 增加压缩打包下载方式以及一些辅助功能,同时还支持一些镜像站
// @description:zh-TW 爲 nHentai 增加壓縮打包下載方式以及一些輔助功能,同時還支援一些鏡像站
// @license GPL-3.0
// @icon https://nhentai.net/favicon.ico
// @homepageURL https://github.com/Tsuk1ko/nhentai-helper
// @supportURL https://github.com/Tsuk1ko/nhentai-helper/issues
// @include /^https:\/\/([^/]*\.)?(nya|dog|cat|bug|qq|fox|ee|yy)hentai[0-9]*\./
// @match https://nhentai.net/*
// @match https://nhentai.xxx/*
// @match https://nhentai.to/*
// @match https://nhentai.website/*
// @connect nhentai.net
// @connect i.nhentai.net
// @connect i2.nhentai.net
// @connect i3.nhentai.net
// @connect i5.nhentai.net
// @connect i7.nhentai.net
// @connect cdn.nhentai.xxx
// @connect cdn.nload.xyz
// @grant GM_addStyle
// @grant GM_getResourceText
// @grant GM_getValue
// @grant GM_registerMenuCommand
// @grant GM_setValue
// @grant GM_xmlhttpRequest
// @grant unsafeWindow
// @run-at document-end
// @noframes
// ==/UserScript==
(o=>{const e=document.createElement("style");e.dataset.source="vite-plugin-monkey",e.textContent=o,document.head.append(e)})(` @charset "UTF-8";.nhentai-helper-btn:disabled{cursor:wait}.gallery>.nhentai-helper-btn{position:absolute;top:0;min-width:42px;opacity:.8}.gallery:hover>.nhentai-helper-btn{opacity:1}.gallery .download-zip-btn{left:0}.gallery .ignore-btn{right:0}#page-container{position:relative}@media screen and (max-width: 768px){#page-container{padding-top:40px}}#online-view-mode-btn{position:absolute;right:0;top:0;margin:0}.btn-noty-green{background-color:#66bb6a!important}.btn-noty-blue{background-color:#42a5f5!important}.btn-noty:hover{filter:brightness(1.15)}.noty_buttons{padding-top:0!important}.pages-input{-webkit-appearance:none;display:inline-block;border-radius:3px;padding:0 .1em 0 1em;font-size:1em;width:100%;height:40px;border:0;vertical-align:top;margin-top:5px}.gallery.downloaded .caption{color:#999}.noty_layout_mixin,#noty_layout__top,#noty_layout__topLeft,#noty_layout__topCenter,#noty_layout__topRight,#noty_layout__bottom,#noty_layout__bottomLeft,#noty_layout__bottomCenter,#noty_layout__bottomRight,#noty_layout__center,#noty_layout__centerLeft,#noty_layout__centerRight{position:fixed;margin:0;padding:0;z-index:9999999;-webkit-transform:translateZ(0) scale(1,1);transform:translateZ(0) scale(1);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-font-smoothing:subpixel-antialiased;filter:blur(0);-webkit-filter:blur(0);max-width:90%}#noty_layout__top{top:0;left:5%;width:90%}#noty_layout__topLeft{top:20px;left:20px;width:325px}#noty_layout__topCenter{top:5%;left:50%;width:325px;-webkit-transform:translate(-webkit-calc(-50% - .5px)) translateZ(0) scale(1,1);transform:translate(calc(-50% - .5px)) translateZ(0) scale(1)}#noty_layout__topRight{top:20px;right:20px;width:325px}#noty_layout__bottom{bottom:0;left:5%;width:90%}#noty_layout__bottomLeft{bottom:20px;left:20px;width:325px}#noty_layout__bottomCenter{bottom:5%;left:50%;width:325px;-webkit-transform:translate(-webkit-calc(-50% - .5px)) translateZ(0) scale(1,1);transform:translate(calc(-50% - .5px)) translateZ(0) scale(1)}#noty_layout__bottomRight{bottom:20px;right:20px;width:325px}#noty_layout__center{top:50%;left:50%;width:325px;-webkit-transform:translate(-webkit-calc(-50% - .5px),-webkit-calc(-50% - .5px)) translateZ(0) scale(1,1);transform:translate(calc(-50% - .5px),calc(-50% - .5px)) translateZ(0) scale(1)}#noty_layout__centerLeft{top:50%;left:20px;width:325px;-webkit-transform:translate(0,-webkit-calc(-50% - .5px)) translateZ(0) scale(1,1);transform:translateY(calc(-50% - .5px)) translateZ(0) scale(1)}#noty_layout__centerRight{top:50%;right:20px;width:325px;-webkit-transform:translate(0,-webkit-calc(-50% - .5px)) translateZ(0) scale(1,1);transform:translateY(calc(-50% - .5px)) translateZ(0) scale(1)}.noty_progressbar{display:none}.noty_has_timeout.noty_has_progressbar .noty_progressbar{display:block;position:absolute;left:0;bottom:0;height:3px;width:100%;background-color:#646464;opacity:.2;filter:alpha(opacity=10)}.noty_bar{-webkit-backface-visibility:hidden;-webkit-transform:translate(0,0) translateZ(0) scale(1,1);-ms-transform:translate(0,0) scale(1,1);transform:translate(0) scale(1);-webkit-font-smoothing:subpixel-antialiased;overflow:hidden}.noty_effects_open{opacity:0;-webkit-transform:translate(50%);-ms-transform:translate(50%);transform:translate(50%);-webkit-animation:noty_anim_in .5s cubic-bezier(.68,-.55,.265,1.55);animation:noty_anim_in .5s cubic-bezier(.68,-.55,.265,1.55);-webkit-animation-fill-mode:forwards;animation-fill-mode:forwards}.noty_effects_close{-webkit-animation:noty_anim_out .5s cubic-bezier(.68,-.55,.265,1.55);animation:noty_anim_out .5s cubic-bezier(.68,-.55,.265,1.55);-webkit-animation-fill-mode:forwards;animation-fill-mode:forwards}.noty_fix_effects_height{-webkit-animation:noty_anim_height 75ms ease-out;animation:noty_anim_height 75ms ease-out}.noty_close_with_click{cursor:pointer}.noty_close_button{position:absolute;top:2px;right:2px;font-weight:700;width:20px;height:20px;text-align:center;line-height:20px;background-color:#0000000d;border-radius:2px;cursor:pointer;-webkit-transition:all .2s ease-out;transition:all .2s ease-out}.noty_close_button:hover{background-color:#0000001a}.noty_modal{position:fixed;width:100%;height:100%;background-color:#000;z-index:10000;opacity:.3;left:0;top:0}.noty_modal.noty_modal_open{opacity:0;-webkit-animation:noty_modal_in .3s ease-out;animation:noty_modal_in .3s ease-out}.noty_modal.noty_modal_close{-webkit-animation:noty_modal_out .3s ease-out;animation:noty_modal_out .3s ease-out;-webkit-animation-fill-mode:forwards;animation-fill-mode:forwards}@-webkit-keyframes noty_modal_in{to{opacity:.3}}@keyframes noty_modal_in{to{opacity:.3}}@-webkit-keyframes noty_modal_out{to{opacity:0}}@keyframes noty_modal_out{to{opacity:0}}@-webkit-keyframes noty_anim_in{to{-webkit-transform:translate(0);transform:translate(0);opacity:1}}@keyframes noty_anim_in{to{-webkit-transform:translate(0);transform:translate(0);opacity:1}}@-webkit-keyframes noty_anim_out{to{-webkit-transform:translate(50%);transform:translate(50%);opacity:0}}@keyframes noty_anim_out{to{-webkit-transform:translate(50%);transform:translate(50%);opacity:0}}@-webkit-keyframes noty_anim_height{to{height:0}}@keyframes noty_anim_height{to{height:0}}.noty_theme__relax.noty_bar{margin:4px 0;overflow:hidden;border-radius:2px;position:relative}.noty_theme__relax.noty_bar .noty_body{padding:10px}.noty_theme__relax.noty_bar .noty_buttons{border-top:1px solid #e7e7e7;padding:5px 10px}.noty_theme__relax.noty_type__alert,.noty_theme__relax.noty_type__notification{background-color:#fff;border:1px solid #dedede;color:#444}.noty_theme__relax.noty_type__warning{background-color:#ffeaa8;border:1px solid #FFC237;color:#826200}.noty_theme__relax.noty_type__warning .noty_buttons{border-color:#dfaa30}.noty_theme__relax.noty_type__error{background-color:#ff8181;border:1px solid #e25353;color:#fff}.noty_theme__relax.noty_type__error .noty_buttons{border-color:#8b0000}.noty_theme__relax.noty_type__info,.noty_theme__relax.noty_type__information{background-color:#78c5e7;border:1px solid #3badd6;color:#fff}.noty_theme__relax.noty_type__info .noty_buttons,.noty_theme__relax.noty_type__information .noty_buttons{border-color:#0b90c4}.noty_theme__relax.noty_type__success{background-color:#bcf5bc;border:1px solid #7cdd77;color:#006400}.noty_theme__relax.noty_type__success .noty_buttons{border-color:#50c24e}.noty_theme__metroui.noty_bar{margin:4px 0;overflow:hidden;position:relative;box-shadow:#0000004c 0 0 5px}.noty_theme__metroui.noty_bar .noty_progressbar{position:absolute;left:0;bottom:0;height:3px;width:100%;background-color:#000;opacity:.2;filter:alpha(opacity=20)}.noty_theme__metroui.noty_bar .noty_body{padding:1.25em;font-size:14px}.noty_theme__metroui.noty_bar .noty_buttons{padding:0 10px .5em}.noty_theme__metroui.noty_type__alert,.noty_theme__metroui.noty_type__notification{background-color:#fff;color:#1d1d1d}.noty_theme__metroui.noty_type__warning{background-color:#fa6800;color:#fff}.noty_theme__metroui.noty_type__error{background-color:#ce352c;color:#fff}.noty_theme__metroui.noty_type__info,.noty_theme__metroui.noty_type__information{background-color:#1ba1e2;color:#fff}.noty_theme__metroui.noty_type__success{background-color:#60a917;color:#fff}.noty_theme__mint.noty_bar{margin:4px 0;overflow:hidden;border-radius:2px;position:relative}.noty_theme__mint.noty_bar .noty_body{padding:10px;font-size:14px}.noty_theme__mint.noty_bar .noty_buttons{padding:10px}.noty_theme__mint.noty_type__alert,.noty_theme__mint.noty_type__notification{background-color:#fff;border-bottom:1px solid #D1D1D1;color:#2f2f2f}.noty_theme__mint.noty_type__warning{background-color:#ffae42;border-bottom:1px solid #E89F3C;color:#fff}.noty_theme__mint.noty_type__error{background-color:#de636f;border-bottom:1px solid #CA5A65;color:#fff}.noty_theme__mint.noty_type__info,.noty_theme__mint.noty_type__information{background-color:#7f7eff;border-bottom:1px solid #7473E8;color:#fff}.noty_theme__mint.noty_type__success{background-color:#afc765;border-bottom:1px solid #A0B55C;color:#fff}.noty_theme__sunset.noty_bar{margin:4px 0;overflow:hidden;border-radius:2px;position:relative}.noty_theme__sunset.noty_bar .noty_body{padding:10px;font-size:14px;text-shadow:1px 1px 1px rgba(0,0,0,.1)}.noty_theme__sunset.noty_bar .noty_buttons{padding:10px}.noty_theme__sunset.noty_type__alert,.noty_theme__sunset.noty_type__notification{background-color:#073b4c;color:#fff}.noty_theme__sunset.noty_type__alert .noty_progressbar,.noty_theme__sunset.noty_type__notification .noty_progressbar{background-color:#fff}.noty_theme__sunset.noty_type__warning{background-color:#ffd166;color:#fff}.noty_theme__sunset.noty_type__error{background-color:#ef476f;color:#fff}.noty_theme__sunset.noty_type__error .noty_progressbar{opacity:.4}.noty_theme__sunset.noty_type__info,.noty_theme__sunset.noty_type__information{background-color:#118ab2;color:#fff}.noty_theme__sunset.noty_type__info .noty_progressbar,.noty_theme__sunset.noty_type__information .noty_progressbar{opacity:.6}.noty_theme__sunset.noty_type__success{background-color:#06d6a0;color:#fff}.noty_theme__bootstrap-v3.noty_bar{margin:4px 0;overflow:hidden;position:relative;border:1px solid transparent;border-radius:4px}.noty_theme__bootstrap-v3.noty_bar .noty_body{padding:15px}.noty_theme__bootstrap-v3.noty_bar .noty_buttons{padding:10px}.noty_theme__bootstrap-v3.noty_bar .noty_close_button{font-size:21px;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2;background:transparent}.noty_theme__bootstrap-v3.noty_bar .noty_close_button:hover{background:transparent;text-decoration:none;cursor:pointer;filter:alpha(opacity=50);opacity:.5}.noty_theme__bootstrap-v3.noty_type__alert,.noty_theme__bootstrap-v3.noty_type__notification{background-color:#fff;color:inherit}.noty_theme__bootstrap-v3.noty_type__warning{background-color:#fcf8e3;color:#8a6d3b;border-color:#faebcc}.noty_theme__bootstrap-v3.noty_type__error{background-color:#f2dede;color:#a94442;border-color:#ebccd1}.noty_theme__bootstrap-v3.noty_type__info,.noty_theme__bootstrap-v3.noty_type__information{background-color:#d9edf7;color:#31708f;border-color:#bce8f1}.noty_theme__bootstrap-v3.noty_type__success{background-color:#dff0d8;color:#3c763d;border-color:#d6e9c6}.noty_theme__bootstrap-v4.noty_bar{margin:4px 0;overflow:hidden;position:relative;border:1px solid transparent;border-radius:.25rem}.noty_theme__bootstrap-v4.noty_bar .noty_body{padding:.75rem 1.25rem}.noty_theme__bootstrap-v4.noty_bar .noty_buttons{padding:10px}.noty_theme__bootstrap-v4.noty_bar .noty_close_button{font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.5;background:transparent}.noty_theme__bootstrap-v4.noty_bar .noty_close_button:hover{background:transparent;text-decoration:none;cursor:pointer;filter:alpha(opacity=50);opacity:.75}.noty_theme__bootstrap-v4.noty_type__alert,.noty_theme__bootstrap-v4.noty_type__notification{background-color:#fff;color:inherit}.noty_theme__bootstrap-v4.noty_type__warning{background-color:#fcf8e3;color:#8a6d3b;border-color:#faebcc}.noty_theme__bootstrap-v4.noty_type__error{background-color:#f2dede;color:#a94442;border-color:#ebccd1}.noty_theme__bootstrap-v4.noty_type__info,.noty_theme__bootstrap-v4.noty_type__information{background-color:#d9edf7;color:#31708f;border-color:#bce8f1}.noty_theme__bootstrap-v4.noty_type__success{background-color:#dff0d8;color:#3c763d;border-color:#d6e9c6}.noty_theme__semanticui.noty_bar{margin:4px 0;overflow:hidden;position:relative;border:1px solid transparent;font-size:1em;border-radius:.28571429rem;box-shadow:0 0 0 1px #22242638 inset,0 0 0 0 transparent}.noty_theme__semanticui.noty_bar .noty_body{padding:1em 1.5em;line-height:1.4285em}.noty_theme__semanticui.noty_bar .noty_buttons{padding:10px}.noty_theme__semanticui.noty_type__alert,.noty_theme__semanticui.noty_type__notification{background-color:#f8f8f9;color:#000000de}.noty_theme__semanticui.noty_type__warning{background-color:#fffaf3;color:#573a08;box-shadow:0 0 0 1px #c9ba9b inset,0 0 0 0 transparent}.noty_theme__semanticui.noty_type__error{background-color:#fff6f6;color:#9f3a38;box-shadow:0 0 0 1px #e0b4b4 inset,0 0 0 0 transparent}.noty_theme__semanticui.noty_type__info,.noty_theme__semanticui.noty_type__information{background-color:#f8ffff;color:#276f86;box-shadow:0 0 0 1px #a9d5de inset,0 0 0 0 transparent}.noty_theme__semanticui.noty_type__success{background-color:#fcfff5;color:#2c662d;box-shadow:0 0 0 1px #a3c293 inset,0 0 0 0 transparent}.noty_theme__nest.noty_bar{margin:0 0 15px;overflow:hidden;border-radius:2px;position:relative;box-shadow:#00000019 5px 4px 10px}.noty_theme__nest.noty_bar .noty_body{padding:10px;font-size:14px;text-shadow:1px 1px 1px rgba(0,0,0,.1)}.noty_theme__nest.noty_bar .noty_buttons{padding:10px}.noty_layout .noty_theme__nest.noty_bar{z-index:5}.noty_layout .noty_theme__nest.noty_bar:nth-child(2){position:absolute;top:0;margin-top:4px;margin-right:-4px;margin-left:4px;z-index:4;width:100%}.noty_layout .noty_theme__nest.noty_bar:nth-child(3){position:absolute;top:0;margin-top:8px;margin-right:-8px;margin-left:8px;z-index:3;width:100%}.noty_layout .noty_theme__nest.noty_bar:nth-child(4){position:absolute;top:0;margin-top:12px;margin-right:-12px;margin-left:12px;z-index:2;width:100%}.noty_layout .noty_theme__nest.noty_bar:nth-child(5){position:absolute;top:0;margin-top:16px;margin-right:-16px;margin-left:16px;z-index:1;width:100%}.noty_layout .noty_theme__nest.noty_bar:nth-child(n+6){position:absolute;top:0;margin-top:20px;margin-right:-20px;margin-left:20px;z-index:-1;width:100%}#noty_layout__bottomLeft .noty_theme__nest.noty_bar:nth-child(2),#noty_layout__topLeft .noty_theme__nest.noty_bar:nth-child(2){margin-top:4px;margin-left:-4px;margin-right:4px}#noty_layout__bottomLeft .noty_theme__nest.noty_bar:nth-child(3),#noty_layout__topLeft .noty_theme__nest.noty_bar:nth-child(3){margin-top:8px;margin-left:-8px;margin-right:8px}#noty_layout__bottomLeft .noty_theme__nest.noty_bar:nth-child(4),#noty_layout__topLeft .noty_theme__nest.noty_bar:nth-child(4){margin-top:12px;margin-left:-12px;margin-right:12px}#noty_layout__bottomLeft .noty_theme__nest.noty_bar:nth-child(5),#noty_layout__topLeft .noty_theme__nest.noty_bar:nth-child(5){margin-top:16px;margin-left:-16px;margin-right:16px}#noty_layout__bottomLeft .noty_theme__nest.noty_bar:nth-child(n+6),#noty_layout__topLeft .noty_theme__nest.noty_bar:nth-child(n+6){margin-top:20px;margin-left:-20px;margin-right:20px}.noty_theme__nest.noty_type__alert,.noty_theme__nest.noty_type__notification{background-color:#073b4c;color:#fff}.noty_theme__nest.noty_type__alert .noty_progressbar,.noty_theme__nest.noty_type__notification .noty_progressbar{background-color:#fff}.noty_theme__nest.noty_type__warning{background-color:#ffd166;color:#fff}.noty_theme__nest.noty_type__error{background-color:#ef476f;color:#fff}.noty_theme__nest.noty_type__error .noty_progressbar{opacity:.4}.noty_theme__nest.noty_type__info,.noty_theme__nest.noty_type__information{background-color:#118ab2;color:#fff}.noty_theme__nest.noty_type__info .noty_progressbar,.noty_theme__nest.noty_type__information .noty_progressbar{opacity:.6}.noty_theme__nest.noty_type__success{background-color:#06d6a0;color:#fff}.noty_theme__light.noty_bar{margin:4px 0;overflow:hidden;border-radius:2px;position:relative}.noty_theme__light.noty_bar .noty_body{padding:10px}.noty_theme__light.noty_bar .noty_buttons{border-top:1px solid #e7e7e7;padding:5px 10px}.noty_theme__light.noty_type__alert,.noty_theme__light.noty_type__notification{background-color:#fff;border:1px solid #dedede;color:#444}.noty_theme__light.noty_type__warning{background-color:#ffeaa8;border:1px solid #FFC237;color:#826200}.noty_theme__light.noty_type__warning .noty_buttons{border-color:#dfaa30}.noty_theme__light.noty_type__error{background-color:#ed7000;border:1px solid #e25353;color:#fff}.noty_theme__light.noty_type__error .noty_buttons{border-color:#8b0000}.noty_theme__light.noty_type__info,.noty_theme__light.noty_type__information{background-color:#78c5e7;border:1px solid #3badd6;color:#fff}.noty_theme__light.noty_type__info .noty_buttons,.noty_theme__light.noty_type__information .noty_buttons{border-color:#0b90c4}.noty_theme__light.noty_type__success{background-color:#57c880;border:1px solid #7cdd77;color:#006400}.noty_theme__light.noty_type__success .noty_buttons{border-color:#50c24e}.download-item[data-v-83b954f2]{position:relative;white-space:nowrap;padding:2px;overflow:visible}.download-item--can-cancel[data-v-83b954f2]:hover{width:calc(100% - 30px)}.download-item__cancel[data-v-83b954f2]{cursor:pointer;position:absolute;top:0;right:-30px;color:#f44336;font-size:20px;line-height:30px;width:30px}.download-item__title[data-v-83b954f2]{overflow:hidden;text-overflow:ellipsis;text-align:left}.download-item__progress[data-v-83b954f2]{background-color:#0000ff80;line-height:10px}.download-item--error .download-item__progress[data-v-83b954f2]{background-color:#ff000080}.download-item--compressing .download-item__progress[data-v-83b954f2]{background-color:#00ff0080}.download-item__progress-text[data-v-83b954f2]{transform:scale(.8)}#download-panel[data-v-f37e74c3]{overflow-x:hidden;position:fixed;top:20vh;right:0;width:calc(50vw - 620px);max-width:300px;min-width:150px;max-height:60vh;background-color:#000000b3;z-index:100;font-size:12px;overflow-y:scroll}#download-panel[data-v-f37e74c3]::-webkit-scrollbar{width:6px;background-color:#000000b3}#download-panel[data-v-f37e74c3]::-webkit-scrollbar-thumb{background-color:#fff9}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\\5fae\\8f6f\\96c5\\9ed1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645, .045, .355, 1);--el-transition-function-fast-bezier:cubic-bezier(.23, 1, .32, 1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px}:root{color-scheme:light;--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0, 0, 0, .04),0px 8px 20px rgba(0, 0, 0, .08);--el-box-shadow-light:0px 0px 12px rgba(0, 0, 0, .12);--el-box-shadow-lighter:0px 0px 6px rgba(0, 0, 0, .12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0, 0, 0, .08),0px 12px 32px rgba(0, 0, 0, .12),0px 8px 16px -8px rgba(0, 0, 0, .16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0, 0, 0, .8);--el-overlay-color-light:rgba(0, 0, 0, .7);--el-overlay-color-lighter:rgba(0, 0, 0, .5);--el-mask-color:rgba(255, 255, 255, .9);--el-mask-color-extra-light:rgba(255, 255, 255, .3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-icon-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@-webkit-keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.el-icon{--color:inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{-webkit-animation:v-modal-in var(--el-transition-duration-fast) ease;animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{-webkit-animation:v-modal-out var(--el-transition-duration-fast) ease forwards;animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@-webkit-keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-in{0%{opacity:0}}@-webkit-keyframes v-modal-out{to{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:20px;--el-dialog-border-radius:var(--el-border-radius-small);position:relative;margin:var(--el-dialog-margin-top,15vh) auto 50px;background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;width:var(--el-dialog-width,50%)}.el-dialog:focus{outline:0!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;margin-bottom:0;height:100%;overflow:auto}.el-dialog__wrapper{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto;margin:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-dialog__header{padding:var(--el-dialog-padding-primary);padding-bottom:10px;margin-right:16px}.el-dialog__headerbtn{position:absolute;top:6px;right:0;padding:0;width:54px;height:54px;background:0 0;border:none;outline:0;cursor:pointer;font-size:var(--el-message-close-size,16px)}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{line-height:var(--el-dialog-font-line-height);font-size:var(--el-dialog-title-font-size);color:var(--el-text-color-primary)}.el-dialog__body{padding:calc(var(--el-dialog-padding-primary) + 10px) var(--el-dialog-padding-primary);color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{padding:var(--el-dialog-padding-primary);padding-top:10px;text-align:right;box-sizing:border-box}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial;padding:25px calc(var(--el-dialog-padding-primary) + 5px) 30px}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.dialog-fade-enter-active{-webkit-animation:modal-fade-in var(--el-transition-duration);animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{-webkit-animation:dialog-fade-in var(--el-transition-duration);animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{-webkit-animation:modal-fade-out var(--el-transition-duration);animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{-webkit-animation:dialog-fade-out var(--el-transition-duration);animation:dialog-fade-out var(--el-transition-duration)}@-webkit-keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@-webkit-keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@-webkit-keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@-webkit-keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:var(--el-overlay-color-lighter);overflow:auto}.el-overlay .el-overlay-root{height:0}.el-popconfirm__main{display:flex;align-items:center}.el-popconfirm__icon{margin-right:5px}.el-popconfirm__action{text-align:right;margin-top:8px}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius, 4px)}.el-popper{position:absolute;border-radius:var(--el-popper-border-radius);padding:5px 11px;z-index:2000;font-size:12px;line-height:20px;min-width:10px;word-wrap:break-word;visibility:visible}.el-popper.is-dark{color:var(--el-bg-color);background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow:before{border:1px solid var(--el-text-color-primary);background:var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{border:1px solid var(--el-border-color-light);background:var(--el-bg-color-overlay);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{position:absolute;width:10px;height:10px;z-index:-1}.el-popper__arrow:before{position:absolute;width:10px;height:10px;z-index:-1;content:" ";transform:rotate(45deg);background:var(--el-text-color-primary);box-sizing:border-box}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent!important;border-bottom-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-popover{--el-popover-bg-color:var(--el-bg-color-overlay);--el-popover-font-size:var(--el-font-size-base);--el-popover-border-color:var(--el-border-color-lighter);--el-popover-padding:12px;--el-popover-padding-large:18px 20px;--el-popover-title-font-size:16px;--el-popover-title-text-color:var(--el-text-color-primary);--el-popover-border-radius:4px}.el-popover.el-popper{background:var(--el-popover-bg-color);min-width:150px;border-radius:var(--el-popover-border-radius);border:1px solid var(--el-popover-border-color);padding:var(--el-popover-padding);z-index:var(--el-index-popper);color:var(--el-text-color-regular);line-height:1.4;text-align:justify;font-size:var(--el-popover-font-size);box-shadow:var(--el-box-shadow-light);word-break:break-all;box-sizing:border-box}.el-popover.el-popper--plain{padding:var(--el-popover-padding-large)}.el-popover__title{color:var(--el-popover-title-text-color);font-size:var(--el-popover-title-font-size);line-height:1;margin-bottom:12px}.el-popover__reference:focus:hover,.el-popover__reference:focus:not(.focusing){outline-width:0}.el-popover.el-popper.is-dark{--el-popover-bg-color:var(--el-text-color-primary);--el-popover-border-color:var(--el-text-color-primary);--el-popover-title-text-color:var(--el-bg-color);color:var(--el-bg-color)}.el-popover.el-popper:focus,.el-popover.el-popper:focus:active{outline-width:0}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255, 255, 255, .5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-hover-link-text-color:var(--el-color-info);--el-button-active-color:var(--el-text-color-primary)}.el-button{display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;color:var(--el-button-text-color);text-align:center;box-sizing:border-box;outline:0;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);padding:8px 15px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button:focus,.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color);background-color:var(--el-button-hover-bg-color);outline:0}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button.is-disabled,.el-button.is-disabled:focus,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{z-index:1;pointer-events:none;content:"";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:var(--el-mask-color-extra-light)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px}.el-button.is-text{color:var(--el-button-text-color);border:0 solid transparent;background-color:transparent}.el-button.is-text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important}.el-button.is-text:not(.is-disabled):focus,.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:focus,.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{border-color:transparent;color:var(--el-button-text-color);background:0 0;padding:2px;height:auto}.el-button.is-link:focus,.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button.is-link:not(.is-disabled):focus,.el-button.is-link:not(.is-disabled):hover{border-color:transparent;background-color:transparent}.el-button.is-link:not(.is-disabled):active{color:var(--el-button-active-color);border-color:transparent;background-color:transparent}.el-button--text{border-color:transparent;background:0 0;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button--text:not(.is-disabled):focus,.el-button--text:not(.is-disabled):hover{color:var(--el-color-primary-light-3);border-color:transparent;background-color:transparent}.el-button--text:not(.is-disabled):active{color:var(--el-color-primary-dark-2);border-color:transparent;background-color:transparent}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-active-color:var(--el-color-primary-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{color:var(--el-color-primary-light-5);background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-outline-color:var(--el-color-success-light-5);--el-button-active-color:var(--el-color-success-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{color:var(--el-color-success-light-5);background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-outline-color:var(--el-color-warning-light-5);--el-button-active-color:var(--el-color-warning-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{color:var(--el-color-warning-light-5);background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-outline-color:var(--el-color-danger-light-5);--el-button-active-color:var(--el-color-danger-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{color:var(--el-color-danger-light-5);background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-outline-color:var(--el-color-info-light-5);--el-button-active-color:var(--el-color-info-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{color:var(--el-color-info-light-5);background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8)}.el-button--large{--el-button-size:40px;height:var(--el-button-size);padding:12px 19px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size:24px;height:var(--el-button-size);padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}.el-form{--el-form-label-font-size:var(--el-font-size-base)}.el-form--label-left .el-form-item__label{justify-content:flex-start}.el-form--label-top .el-form-item{display:block}.el-form--label-top .el-form-item .el-form-item__label{display:block;height:auto;text-align:left;margin-bottom:8px;line-height:22px}.el-form--inline .el-form-item{display:inline-flex;vertical-align:middle;margin-right:32px}.el-form--inline.el-form--label-top{display:flex;flex-wrap:wrap}.el-form--inline.el-form--label-top .el-form-item{display:block}.el-form--large.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:12px;line-height:22px}.el-form--default.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:8px;line-height:22px}.el-form--small.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:4px;line-height:20px}.el-form-item{display:flex;--font-size:14px;margin-bottom:18px}.el-form-item .el-form-item{margin-bottom:0}.el-form-item .el-input__validateIcon{display:none}.el-form-item--large{--font-size:14px;--el-form-label-font-size:var(--font-size);margin-bottom:22px}.el-form-item--large .el-form-item__label{height:40px;line-height:40px}.el-form-item--large .el-form-item__content{line-height:40px}.el-form-item--large .el-form-item__error{padding-top:4px}.el-form-item--default{--font-size:14px;--el-form-label-font-size:var(--font-size);margin-bottom:18px}.el-form-item--default .el-form-item__label{height:32px;line-height:32px}.el-form-item--default .el-form-item__content{line-height:32px}.el-form-item--default .el-form-item__error{padding-top:2px}.el-form-item--small{--font-size:12px;--el-form-label-font-size:var(--font-size);margin-bottom:18px}.el-form-item--small .el-form-item__label{height:24px;line-height:24px}.el-form-item--small .el-form-item__content{line-height:24px}.el-form-item--small .el-form-item__error{padding-top:2px}.el-form-item__label-wrap{display:flex}.el-form-item__label{display:inline-flex;justify-content:flex-end;align-items:flex-start;flex:0 0 auto;font-size:var(--el-form-label-font-size);color:var(--el-text-color-regular);height:32px;line-height:32px;padding:0 12px 0 0;box-sizing:border-box}.el-form-item__content{display:flex;flex-wrap:wrap;align-items:center;flex:1;line-height:32px;position:relative;font-size:var(--font-size);min-width:0}.el-form-item__content .el-input-group{vertical-align:top}.el-form-item__error{color:var(--el-color-danger);font-size:12px;line-height:1;padding-top:2px;position:absolute;top:100%;left:0}.el-form-item__error--inline{position:relative;top:auto;left:auto;display:inline-block;margin-left:10px}.el-form-item.is-required:not(.is-no-asterisk).asterisk-left>.el-form-item__label-wrap>.el-form-item__label:before,.el-form-item.is-required:not(.is-no-asterisk).asterisk-left>.el-form-item__label:before{content:"*";color:var(--el-color-danger);margin-right:4px}.el-form-item.is-required:not(.is-no-asterisk).asterisk-right>.el-form-item__label-wrap>.el-form-item__label:after,.el-form-item.is-required:not(.is-no-asterisk).asterisk-right>.el-form-item__label:after{content:"*";color:var(--el-color-danger);margin-left:4px}.el-form-item.is-error .el-select-v2__wrapper,.el-form-item.is-error .el-select-v2__wrapper:focus,.el-form-item.is-error .el-textarea__inner,.el-form-item.is-error .el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-form-item.is-error .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-form-item.is-error .el-input-group__append .el-input__wrapper,.el-form-item.is-error .el-input-group__prepend .el-input__wrapper{box-shadow:0 0 0 1px transparent inset}.el-form-item.is-error .el-input__validateIcon{color:var(--el-color-danger)}.el-form-item--feedback .el-input__validateIcon{display:inline-flex}.el-divider{position:relative}.el-divider--horizontal{display:block;height:1px;width:100%;margin:24px 0;border-top:1px var(--el-border-color) var(--el-border-style)}.el-divider--vertical{display:inline-block;width:1px;height:1em;margin:0 8px;vertical-align:middle;position:relative;border-left:1px var(--el-border-color) var(--el-border-style)}.el-divider__text{position:absolute;background-color:var(--el-bg-color);padding:0 20px;font-weight:500;color:var(--el-text-color-primary);font-size:14px}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-fill-color-blank);--el-checkbox-input-border:var(--el-border);--el-checkbox-disabled-border-color:var(--el-border-color);--el-checkbox-disabled-input-fill:var(--el-fill-color-light);--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-color-white);--el-checkbox-input-border-color-hover:var(--el-color-primary)}.el-checkbox{color:var(--el-checkbox-text-color);font-weight:var(--el-checkbox-font-weight);font-size:var(--el-font-size-base);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;margin-right:30px;height:32px}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{padding:0 11px 0 7px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px;border-radius:var(--el-checkbox-border-radius)}.el-checkbox__input{white-space:nowrap;cursor:pointer;outline:0;display:inline-flex;position:relative}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{cursor:not-allowed;border-color:var(--el-checkbox-disabled-icon-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{content:"";position:absolute;display:block;background-color:var(--el-checkbox-checked-icon-color);height:2px;transform:scale(.5);left:0;right:0;top:5px}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{display:inline-block;position:relative;border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;width:var(--el-checkbox-input-width);height:var(--el-checkbox-input-height);background-color:var(--el-checkbox-bg-color);z-index:var(--el-index-normal);transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{box-sizing:content-box;content:"";border:1px solid var(--el-checkbox-checked-icon-color);border-left:0;border-top:0;height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);width:3px;transition:transform .15s ease-in 50ms;transform-origin:center}.el-checkbox__original{opacity:0;outline:0;position:absolute;margin:0;width:0;height:0;z-index:-1}.el-checkbox__label{display:inline-block;padding-left:8px;line-height:1;font-size:var(--el-checkbox-font-size)}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{width:14px;height:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{width:12px;height:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{width:2px;height:6px}.el-checkbox:last-of-type{margin-right:0}.el-input-number{position:relative;display:inline-flex;width:150px;line-height:30px}.el-input-number .el-input__wrapper{padding-left:42px;padding-right:42px}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;text-align:center;line-height:1}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{margin:0;-webkit-appearance:none}.el-input-number__decrease,.el-input-number__increase{display:flex;justify-content:center;align-items:center;height:auto;position:absolute;z-index:1;top:1px;bottom:1px;width:32px;background:var(--el-fill-color-light);color:var(--el-text-color-regular);cursor:pointer;font-size:13px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-input-number__decrease:hover,.el-input-number__increase:hover{color:var(--el-color-primary)}.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input_wrapper,.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input_wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color,var(--el-color-primary)) inset}.el-input-number__decrease.is-disabled,.el-input-number__increase.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{right:1px;border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;border-left:var(--el-border)}.el-input-number__decrease{left:1px;border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border)}.el-input-number.is-disabled .el-input-number__decrease,.el-input-number.is-disabled .el-input-number__increase{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__decrease:hover,.el-input-number.is-disabled .el-input-number__increase:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{width:180px;line-height:38px}.el-input-number--large .el-input-number__decrease,.el-input-number--large .el-input-number__increase{width:40px;font-size:14px}.el-input-number--large .el-input__wrapper{padding-left:47px;padding-right:47px}.el-input-number--small{width:120px;line-height:22px}.el-input-number--small .el-input-number__decrease,.el-input-number--small .el-input-number__increase{width:24px;font-size:12px}.el-input-number--small .el-input__wrapper{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__decrease [class*=el-icon],.el-input-number--small .el-input-number__increase [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__wrapper{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__wrapper{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__decrease,.el-input-number.is-controls-right .el-input-number__increase{--el-input-number-controls-height:15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon],.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{bottom:auto;left:auto;border-radius:0 var(--el-border-radius-base) 0 0;border-bottom:var(--el-border)}.el-input-number.is-controls-right .el-input-number__decrease{right:1px;top:auto;left:auto;border-right:none;border-left:var(--el-border);border-radius:0 0 var(--el-border-radius-base) 0}.el-input-number.is-controls-right[class*=large] [class*=decrease],.el-input-number.is-controls-right[class*=large] [class*=increase]{--el-input-number-controls-height:19px}.el-input-number.is-controls-right[class*=small] [class*=decrease],.el-input-number.is-controls-right[class*=small] [class*=increase]{--el-input-number-controls-height:11px}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary)}.el-textarea{position:relative;display:inline-block;width:100%;vertical-align:bottom;font-size:var(--el-font-size-base)}.el-textarea__inner{position:relative;display:block;resize:vertical;padding:5px 11px;line-height:1.5;box-sizing:border-box;width:100%;font-size:inherit;font-family:inherit;color:var(--el-input-text-color,var(--el-text-color-regular));background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;-webkit-appearance:none;box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));transition:var(--el-transition-box-shadow);border:none}.el-textarea__inner::-moz-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:-ms-input-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{outline:0;box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-textarea .el-input__count{color:var(--el-color-info);background:var(--el-fill-color-blank);position:absolute;font-size:12px;line-height:14px;bottom:5px;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::-moz-placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-disabled .el-textarea__inner:-ms-input-placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary)}.el-input{--el-input-height:var(--el-component-size);position:relative;font-size:var(--el-font-size-base);display:inline-flex;width:100%;line-height:var(--el-input-height);box-sizing:border-box;vertical-align:middle}.el-input::-webkit-scrollbar{z-index:11;width:6px}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{border-radius:5px;width:6px;background:var(--el-text-color-disabled)}.el-input::-webkit-scrollbar-corner{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);font-size:14px;cursor:pointer}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{height:100%;display:inline-flex;align-items:center;color:var(--el-color-info);font-size:12px}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);line-height:initial;display:inline-block;padding-left:8px}.el-input__wrapper{display:inline-flex;flex-grow:1;align-items:center;justify-content:center;padding:1px 11px;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));transition:var(--el-transition-box-shadow);transform:translateZ(0);box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);width:100%;flex-grow:1;-webkit-appearance:none;color:var(--el-input-text-color,var(--el-text-color-regular));font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);padding:0;outline:0;border:none;background:0 0;box-sizing:border-box}.el-input__inner:focus{outline:0}.el-input__inner::-moz-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner:-ms-input-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__prefix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__prefix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__suffix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{height:inherit;line-height:inherit;display:flex;justify-content:center;align-items:center;transition:all var(--el-transition-duration);margin-left:8px}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color,) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::-moz-placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__inner:-ms-input-placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{display:inline-flex;width:100%;align-items:stretch}.el-input-group__append,.el-input-group__prepend{background-color:var(--el-fill-color-light);color:var(--el-color-info);position:relative;display:inline-flex;align-items:center;justify-content:center;min-height:100%;border-radius:var(--el-input-border-radius);padding:0 20px;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:0}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-input__wrapper,.el-input-group__append div.el-select:hover .el-input__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-input__wrapper,.el-input-group__prepend div.el-select:hover .el-input__wrapper{border-color:transparent;background-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-right:0;border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-left:0;border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-input .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select .el-input .el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__wrapper{box-shadow:1px 0 0 0 var(--el-input-focus-border-color) inset,1px 0 0 0 var(--el-input-focus-border-color),0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important;z-index:2}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__wrapper:focus{outline:0;z-index:2;box-shadow:1px 0 0 0 var(--el-input-focus-border-color) inset,1px 0 0 0 var(--el-input-focus-border-color),0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important}.el-input-group--prepend .el-input-group__prepend .el-select:hover .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select:hover .el-input__wrapper{z-index:1;box-shadow:1px 0 0 0 var(--el-input-hover-border-color) inset,1px 0 0 0 var(--el-input-hover-border-color),0 1px 0 0 var(--el-input-hover-border-color) inset,0 -1px 0 0 var(--el-input-hover-border-color) inset!important}.el-input-group--append>.el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-input .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select .el-input .el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--append .el-input-group__append .el-select .el-input.is-focus .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select .el-input.is-focus .el-input__wrapper{z-index:2;box-shadow:-1px 0 0 0 var(--el-input-focus-border-color),-1px 0 0 0 var(--el-input-focus-border-color) inset,0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important}.el-input-group--append .el-input-group__append .el-select:hover .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select:hover .el-input__wrapper{z-index:1;box-shadow:-1px 0 0 0 var(--el-input-hover-border-color),-1px 0 0 0 var(--el-input-hover-border-color) inset,0 1px 0 0 var(--el-input-hover-border-color) inset,0 -1px 0 0 var(--el-input-hover-border-color) inset!important}.el-switch{--el-switch-on-color:var(--el-color-primary);--el-switch-off-color:var(--el-border-color)}.el-switch{display:inline-flex;align-items:center;position:relative;font-size:14px;line-height:20px;height:32px;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{transition:var(--el-transition-duration-fast);height:20px;display:inline-block;font-size:14px;font-weight:500;cursor:pointer;vertical-align:middle;color:var(--el-text-color-primary)}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{line-height:1;font-size:14px;display:inline-block}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{position:absolute;width:0;height:0;opacity:0;margin:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{display:inline-flex;position:relative;align-items:center;min-width:40px;height:20px;border:1px solid var(--el-switch-border-color,var(--el-switch-off-color));outline:0;border-radius:10px;box-sizing:border-box;background:var(--el-switch-off-color);cursor:pointer;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{width:100%;transition:all var(--el-transition-duration);height:16px;display:flex;justify-content:center;align-items:center;overflow:hidden;padding:0 4px 0 18px}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{font-size:12px;color:var(--el-color-white);-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-switch__core .el-switch__action{position:absolute;left:1px;border-radius:var(--el-border-radius-circle);transition:all var(--el-transition-duration);width:16px;height:16px;background-color:var(--el-color-white);display:flex;justify-content:center;align-items:center;color:var(--el-switch-off-color)}.el-switch.is-checked .el-switch__core{border-color:var(--el-switch-border-color,var(--el-switch-on-color));background-color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__action{left:calc(100% - 17px);color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;line-height:24px;height:40px}.el-switch--large .el-switch__label{height:24px;font-size:14px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{min-width:50px;height:24px;border-radius:12px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{width:20px;height:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;line-height:16px;height:24px}.el-switch--small .el-switch__label{height:16px;font-size:12px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{min-width:30px;height:16px;border-radius:8px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{width:12px;height:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px}.el-slider{--el-slider-main-bg-color:var(--el-color-primary);--el-slider-runway-bg-color:var(--el-border-color-light);--el-slider-stop-bg-color:var(--el-color-white);--el-slider-disabled-color:var(--el-text-color-placeholder);--el-slider-border-radius:3px;--el-slider-height:6px;--el-slider-button-size:20px;--el-slider-button-wrapper-size:36px;--el-slider-button-wrapper-offset:-15px}.el-slider{width:100%;height:32px;display:flex;align-items:center}.el-slider__runway{flex:1;height:var(--el-slider-height);background-color:var(--el-slider-runway-bg-color);border-radius:var(--el-slider-border-radius);position:relative;cursor:pointer}.el-slider__runway.show-input{margin-right:30px;width:auto}.el-slider__runway.is-disabled{cursor:default}.el-slider__runway.is-disabled .el-slider__bar{background-color:var(--el-slider-disabled-color)}.el-slider__runway.is-disabled .el-slider__button{border-color:var(--el-slider-disabled-color)}.el-slider__runway.is-disabled .el-slider__button-wrapper.hover,.el-slider__runway.is-disabled .el-slider__button-wrapper:hover,.el-slider__runway.is-disabled .el-slider__button-wrapper.dragging{cursor:not-allowed}.el-slider__runway.is-disabled .el-slider__button.dragging,.el-slider__runway.is-disabled .el-slider__button.hover,.el-slider__runway.is-disabled .el-slider__button:hover{transform:scale(1)}.el-slider__runway.is-disabled .el-slider__button.hover,.el-slider__runway.is-disabled .el-slider__button:hover,.el-slider__runway.is-disabled .el-slider__button.dragging{cursor:not-allowed}.el-slider__input{flex-shrink:0;width:130px}.el-slider__bar{height:var(--el-slider-height);background-color:var(--el-slider-main-bg-color);border-top-left-radius:var(--el-slider-border-radius);border-bottom-left-radius:var(--el-slider-border-radius);position:absolute}.el-slider__button-wrapper{height:var(--el-slider-button-wrapper-size);width:var(--el-slider-button-wrapper-size);position:absolute;z-index:1;top:var(--el-slider-button-wrapper-offset);transform:translate(-50%);background-color:transparent;text-align:center;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;line-height:normal;outline:0}.el-slider__button-wrapper:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-slider__button-wrapper.hover,.el-slider__button-wrapper:hover{cursor:-webkit-grab;cursor:grab}.el-slider__button-wrapper.dragging{cursor:-webkit-grabbing;cursor:grabbing}.el-slider__button{display:inline-block;width:var(--el-slider-button-size);height:var(--el-slider-button-size);vertical-align:middle;border:solid 2px var(--el-slider-main-bg-color);background-color:var(--el-color-white);border-radius:50%;box-sizing:border-box;transition:var(--el-transition-duration-fast);-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-slider__button.dragging,.el-slider__button.hover,.el-slider__button:hover{transform:scale(1.2)}.el-slider__button.hover,.el-slider__button:hover{cursor:-webkit-grab;cursor:grab}.el-slider__button.dragging{cursor:-webkit-grabbing;cursor:grabbing}.el-slider__stop{position:absolute;height:var(--el-slider-height);width:var(--el-slider-height);border-radius:var(--el-border-radius-circle);background-color:var(--el-slider-stop-bg-color);transform:translate(-50%)}.el-slider__marks{top:0;left:12px;width:18px;height:100%}.el-slider__marks-text{position:absolute;transform:translate(-50%);font-size:14px;color:var(--el-color-info);margin-top:15px;white-space:pre}.el-slider.is-vertical{position:relative;display:inline-flex;width:auto;height:100%;flex:0}.el-slider.is-vertical .el-slider__runway{width:var(--el-slider-height);height:100%;margin:0 16px}.el-slider.is-vertical .el-slider__bar{width:var(--el-slider-height);height:auto;border-radius:0 0 3px 3px}.el-slider.is-vertical .el-slider__button-wrapper{top:auto;left:var(--el-slider-button-wrapper-offset);transform:translateY(50%)}.el-slider.is-vertical .el-slider__stop{transform:translateY(50%)}.el-slider.is-vertical .el-slider__marks-text{margin-top:0;left:15px;transform:translateY(50%)}.el-slider--large{height:40px}.el-slider--small{height:24px}.el-tag{--el-tag-font-size:12px;--el-tag-border-radius:4px;--el-tag-border-radius-rounded:9999px}.el-tag{--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary);--el-tag-text-color:var(--el-color-primary);background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color);display:inline-flex;justify-content:center;align-items:center;height:24px;padding:0 9px;font-size:var(--el-tag-font-size);line-height:1;border-width:1px;border-style:solid;border-radius:var(--el-tag-border-radius);box-sizing:border-box;white-space:nowrap;--el-icon-size:14px}.el-tag.el-tag--primary{--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color:var(--el-color-success-light-9);--el-tag-border-color:var(--el-color-success-light-8);--el-tag-hover-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color:var(--el-color-warning-light-9);--el-tag-border-color:var(--el-color-warning-light-8);--el-tag-hover-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color:var(--el-color-danger-light-9);--el-tag-border-color:var(--el-color-danger-light-8);--el-tag-hover-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color:var(--el-color-error-light-9);--el-tag-border-color:var(--el-color-error-light-8);--el-tag-hover-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color:var(--el-color-info-light-9);--el-tag-border-color:var(--el-color-info-light-8);--el-tag-hover-color:var(--el-color-info)}.el-tag.el-tag--primary{--el-tag-text-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color:var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{color:var(--el-tag-text-color)}.el-tag .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3);--el-tag-text-color:var(--el-color-white)}.el-tag--dark.el-tag--primary{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color:var(--el-color-success);--el-tag-border-color:var(--el-color-success);--el-tag-hover-color:var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color:var(--el-color-warning);--el-tag-border-color:var(--el-color-warning);--el-tag-hover-color:var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color:var(--el-color-danger);--el-tag-border-color:var(--el-color-danger);--el-tag-hover-color:var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color:var(--el-color-error);--el-tag-border-color:var(--el-color-error);--el-tag-hover-color:var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color:var(--el-color-info);--el-tag-border-color:var(--el-color-info);--el-tag-hover-color:var(--el-color-info-light-3)}.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning,.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info{--el-tag-text-color:var(--el-color-white)}.el-tag--plain{--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary);--el-tag-bg-color:var(--el-fill-color-blank)}.el-tag--plain.el-tag--primary{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-success-light-5);--el-tag-hover-color:var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-warning-light-5);--el-tag-hover-color:var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-danger-light-5);--el-tag-hover-color:var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-error-light-5);--el-tag-hover-color:var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-info-light-5);--el-tag-hover-color:var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{padding:0 11px;height:32px;--el-icon-size:16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{padding:0 7px;height:20px;--el-icon-size:12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.el-select-dropdown__item{font-size:var(--el-font-size-base);padding:0 32px 0 20px;position:relative;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;color:var(--el-text-color-regular);height:34px;line-height:34px;box-sizing:border-box;cursor:pointer}.el-select-dropdown__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-select-dropdown__item.hover,.el-select-dropdown__item:hover{background-color:var(--el-fill-color-light)}.el-select-dropdown__item.selected{color:var(--el-color-primary);font-weight:700}.el-select-group{margin:0;padding:0}.el-select-group__wrap{position:relative;list-style:none;margin:0;padding:0}.el-select-group__wrap:not(:last-of-type){padding-bottom:24px}.el-select-group__wrap:not(:last-of-type):after{content:"";position:absolute;display:block;left:20px;right:20px;bottom:12px;height:1px;background:var(--el-border-color-light)}.el-select-group__split-dash{position:absolute;left:20px;right:20px;height:1px;background:var(--el-border-color-light)}.el-select-group__title{padding-left:20px;font-size:12px;color:var(--el-color-info);line-height:30px}.el-select-group .el-select-dropdown__item{padding-left:20px}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary)}.el-scrollbar{overflow:hidden;position:relative;height:100%}.el-scrollbar__wrap{overflow:auto;height:100%}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{position:relative;display:block;width:0;height:0;cursor:pointer;border-radius:inherit;background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));transition:var(--el-transition-duration) background-color;opacity:var(--el-scrollbar-opacity,.3)}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{position:absolute;right:2px;bottom:2px;z-index:1;border-radius:4px}.el-scrollbar__bar.is-vertical{width:6px;top:2px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-select-dropdown{z-index:calc(var(--el-index-top) + 1);border-radius:var(--el-border-radius-base);box-sizing:border-box}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay)}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected.hover{background-color:var(--el-fill-color-light)}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected:after{content:"";position:absolute;top:50%;right:20px;border-top:none;border-right:none;background-repeat:no-repeat;background-position:center;background-color:var(--el-color-primary);-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;transform:translateY(-50%);width:12px;height:12px}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected.is-disabled:after{background-color:var(--el-text-color-disabled)}.el-select-dropdown .el-select-dropdown__option-item.is-selected:after{content:"";position:absolute;top:50%;right:20px;border-top:none;border-right:none;background-repeat:no-repeat;background-position:center;background-color:var(--el-color-primary);-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;transform:translateY(-50%);width:12px;height:12px}.el-select-dropdown .el-scrollbar.is-empty .el-select-dropdown__list{padding:0}.el-select-dropdown .el-select-dropdown__item.is-disabled:hover{background-color:unset}.el-select-dropdown .el-select-dropdown__item.is-disabled.selected{color:var(--el-text-color-disabled)}.el-select-dropdown__empty{padding:10px 0;margin:0;text-align:center;color:var(--el-text-color-secondary);font-size:var(--el-select-font-size)}.el-select-dropdown__wrap{max-height:274px}.el-select-dropdown__list{list-style:none;padding:6px 0;margin:0;box-sizing:border-box}.el-select{--el-select-border-color-hover:var(--el-border-color-hover);--el-select-disabled-border:var(--el-disabled-border-color);--el-select-font-size:var(--el-font-size-base);--el-select-close-hover-color:var(--el-text-color-secondary);--el-select-input-color:var(--el-text-color-placeholder);--el-select-multiple-input-color:var(--el-text-color-regular);--el-select-input-focus-border-color:var(--el-color-primary);--el-select-input-font-size:14px}.el-select{display:inline-block;position:relative;vertical-align:middle;line-height:32px}.el-select__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-box-shadow-light)}.el-select__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-select__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-select__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-select__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-select__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-select .el-select-tags-wrapper.has-prefix{margin-left:6px}.el-select--large{line-height:40px}.el-select--large .el-select-tags-wrapper.has-prefix{margin-left:8px}.el-select--small{line-height:24px}.el-select--small .el-select-tags-wrapper.has-prefix{margin-left:4px}.el-select .el-select__tags>span{display:inline-block}.el-select:hover:not(.el-select--disabled) .el-input__wrapper{box-shadow:0 0 0 1px var(--el-select-border-color-hover) inset}.el-select .el-select__tags-text{display:inline-block;line-height:normal;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-select .el-input__wrapper{cursor:pointer}.el-select .el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-select-input-focus-border-color) inset!important}.el-select .el-input__inner{cursor:pointer}.el-select .el-input{display:flex}.el-select .el-input .el-select__caret{color:var(--el-select-input-color);font-size:var(--el-select-input-font-size);transition:transform var(--el-transition-duration);transform:rotate(0);cursor:pointer}.el-select .el-input .el-select__caret.is-reverse{transform:rotate(-180deg)}.el-select .el-input .el-select__caret.is-show-close{font-size:var(--el-select-font-size);text-align:center;transform:rotate(0);border-radius:var(--el-border-radius-circle);color:var(--el-select-input-color);transition:var(--el-transition-color)}.el-select .el-input .el-select__caret.is-show-close:hover{color:var(--el-select-close-hover-color)}.el-select .el-input .el-select__caret.el-icon{position:relative;height:inherit;z-index:2}.el-select .el-input.is-disabled .el-input__wrapper{cursor:not-allowed}.el-select .el-input.is-disabled .el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-select-disabled-border) inset}.el-select .el-input.is-disabled .el-input__inner,.el-select .el-input.is-disabled .el-select__caret{cursor:not-allowed}.el-select .el-input.is-focus .el-input__wrapper{box-shadow:0 0 0 1px var(--el-select-input-focus-border-color) inset!important}.el-select__input{border:none;outline:0;padding:0;margin-left:15px;color:var(--el-select-multiple-input-color);font-size:var(--el-select-font-size);-webkit-appearance:none;-moz-appearance:none;appearance:none;height:28px;background-color:transparent}.el-select__input.is-disabled{cursor:not-allowed}.el-select__input--iOS{position:absolute;left:0;top:0;z-index:6}.el-select__input.is-small{height:14px}.el-select__close{cursor:pointer;position:absolute;top:8px;z-index:var(--el-index-top);right:25px;color:var(--el-select-input-color);line-height:18px;font-size:var(--el-select-input-font-size)}.el-select__close:hover{color:var(--el-select-close-hover-color)}.el-select__tags{position:absolute;line-height:normal;top:50%;transform:translateY(-50%);white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap;cursor:pointer}.el-select__tags .el-tag{box-sizing:border-box;border-color:transparent;margin:2px 6px 2px 0}.el-select__tags .el-tag:last-child{margin-right:0}.el-select__tags .el-tag .el-icon-close{background-color:var(--el-text-color-placeholder);right:-7px;top:0;color:#fff}.el-select__tags .el-tag .el-icon-close:hover{background-color:var(--el-text-color-secondary)}.el-select__tags .el-tag .el-icon-close:before{display:block;transform:translateY(.5px)}.el-select__tags .el-tag--info{background-color:var(--el-fill-color)}.el-select__tags.is-disabled{cursor:not-allowed}.el-select__collapse-tags{white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap;cursor:pointer}.el-select__collapse-tags .el-tag{box-sizing:border-box;border-color:transparent;margin:2px 6px 2px 0}.el-select__collapse-tags .el-tag:last-child{margin-right:0}.el-select__collapse-tags .el-tag .el-icon-close{background-color:var(--el-text-color-placeholder);right:-7px;top:0;color:#fff}.el-select__collapse-tags .el-tag .el-icon-close:hover{background-color:var(--el-text-color-secondary)}.el-select__collapse-tags .el-tag .el-icon-close:before{display:block;transform:translateY(.5px)}.el-select__collapse-tags .el-tag--info{background-color:var(--el-fill-color)}.el-select__collapse-tag{line-height:inherit;height:inherit;display:flex}.nhentai-helper-setting-help-buttons[data-v-0007f4fb]{float:left;position:absolute}.inline-item[data-v-0007f4fb]{display:inline-block}.inline-item[data-v-0007f4fb]:not(:last-of-type){margin-right:8px}.inline-item__name[data-v-0007f4fb]{margin-right:4px;user-select:none}#nhentai-helper-setting-dialog .asterisk-example:before{content:"*";color:var(--el-color-danger);margin-right:4px}#nhentai-helper-setting-dialog label{font-weight:unset}#nhentai-helper-setting-dialog input:not([type="file"]):not([type="checkbox"]){background:inherit;color:var(--el-input-text-color, var(--el-text-color-regular))}#nhentai-helper-setting-dialog .el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color)}#nhentai-helper-setting-dialog .el-slider__stop{border:solid 1px var(--el-slider-runway-bg-color)}#nhentai-helper-setting-dialog .el-form-item:last-of-type{margin-bottom:0}#nhentai-helper-setting-dialog .el-form-item.refresh-required>.el-form-item__label-wrap>.el-form-item__label:after{content:"*";color:var(--el-color-danger);margin-left:4px}#nhentai-helper-setting-dialog .el-divider__text{color:var(--el-text-color-secondary);user-select:none}#nhentai-helper-setting-dialog .m-l-16{margin-left:16px}#nhentai-helper-setting-dialog .m-b-32{margin-bottom:32px}#nhentai-helper-setting-dialog .no-sl,#nhentai-helper-setting-dialog .el-form-item__label{user-select:none}.language-filter[data-v-6873bccd]{padding:0 10px;user-select:none} `);
(function () {
'use strict';
var __defProp2 = Object.defineProperty;
var __getOwnPropNames = Object.getOwnPropertyNames;
var __defNormalProp2 = (obj, key, value) => key in obj ? __defProp2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __commonJS = (cb, mod) => function __require() {
return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
};
var __publicField = (obj, key, value) => {
__defNormalProp2(obj, typeof key !== "symbol" ? key + "" : key, value);
return value;
};
var require_main_001 = __commonJS({
"main-f6e1cb3a.js"(exports, module) {
var _GM_getValue = /* @__PURE__ */ (() => typeof GM_getValue != "undefined" ? GM_getValue : void 0)();
var _GM_registerMenuCommand = /* @__PURE__ */ (() => typeof GM_registerMenuCommand != "undefined" ? GM_registerMenuCommand : void 0)();
var _GM_setValue = /* @__PURE__ */ (() => typeof GM_setValue != "undefined" ? GM_setValue : void 0)();
var _GM_xmlhttpRequest = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)();
var _unsafeWindow = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)();
var _monkeyWindow = /* @__PURE__ */ (() => window)();
const WORKER_THREAD_NUM = Math.max(navigator.hardwareConcurrency - 1, 1);
const { pathname, host } = location;
const IS_PAGE_MANGA_DETAIL = /^\/g\/[0-9]+\/?(\?.*)?$/.test(pathname);
const IS_PAGE_ONLINE_VIEW = /^\/g\/[0-9]+(\/list)?\/[0-9]+\/?(\?.*)?$/.test(pathname);
const IS_PAGE_MANGA_LIST = !IS_PAGE_MANGA_DETAIL && !IS_PAGE_ONLINE_VIEW && document.getElementsByClassName("gallery").length > 0;
const IS_NHENTAI = host === "nhentai.net";
const IS_NHENTAI_TO = host === "nhentai.to" || host === "nhentai.website";
const isNodeOrElement = typeof Node === "function" ? (val) => val instanceof Node : (val) => val && typeof val === "object" && typeof val.nodeType === "number" && typeof val.nodeName === "string";
if (IS_NHENTAI) {
if (_GM_getValue("prevent_console_clear", false) || localStorage.getItem("NHENTAI_HELPER_DEBUG")) {
const c = _unsafeWindow.console;
c._clear = c.clear;
c.clear = () => {
};
c._log = c.log;
c.log = (...args) => {
if (args.length === 1 && isNodeOrElement(args[0]))
return;
c._log(...args);
};
}
}
const logger = {
log: (...args) => {
console.log("[nhentai-helper]", ...args);
},
warn: (...args) => {
console.warn("[nhentai-helper]", ...args);
},
error: (...args) => {
console.error("[nhentai-helper]", ...args);
}
};
var commonjsGlobal = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
function getDefaultExportFromCjs(x) {
return x && x.__esModule && Object.prototype.hasOwnProperty.call(x, "default") ? x["default"] : x;
}
var jquery = { exports: {} };
/*!
* jQuery JavaScript Library v3.6.4
* https://jquery.com/
*
* Includes Sizzle.js
* https://sizzlejs.com/
*
* Copyright OpenJS Foundation and other contributors
* Released under the MIT license
* https://jquery.org/license
*
* Date: 2023-03-08T15:28Z
*/
(function(module2) {
(function(global2, factory) {
{
module2.exports = global2.document ? factory(global2, true) : function(w) {
if (!w.document) {
throw new Error("jQuery requires a window with a document");
}
return factory(w);
};
}
})(typeof window !== "undefined" ? window : commonjsGlobal, function(window2, noGlobal) {
var arr = [];
var getProto2 = Object.getPrototypeOf;
var slice = arr.slice;
var flat = arr.flat ? function(array2) {
return arr.flat.call(array2);
} : function(array2) {
return arr.concat.apply([], array2);
};
var push = arr.push;
var indexOf = arr.indexOf;
var class2type = {};
var toString2 = class2type.toString;
var hasOwn2 = class2type.hasOwnProperty;
var fnToString = hasOwn2.toString;
var ObjectFunctionString = fnToString.call(Object);
var support = {};
var isFunction2 = function isFunction3(obj) {
return typeof obj === "function" && typeof obj.nodeType !== "number" && typeof obj.item !== "function";
};
var isWindow = function isWindow2(obj) {
return obj != null && obj === obj.window;
};
var document2 = window2.document;
var preservedScriptAttributes = {
type: true,
src: true,
nonce: true,
noModule: true
};
function DOMEval(code2, node, doc2) {
doc2 = doc2 || document2;
var i, val, script = doc2.createElement("script");
script.text = code2;
if (node) {
for (i in preservedScriptAttributes) {
val = node[i] || node.getAttribute && node.getAttribute(i);
if (val) {
script.setAttribute(i, val);
}
}
}
doc2.head.appendChild(script).parentNode.removeChild(script);
}
function toType(obj) {
if (obj == null) {
return obj + "";
}
return typeof obj === "object" || typeof obj === "function" ? class2type[toString2.call(obj)] || "object" : typeof obj;
}
var version2 = "3.6.4", jQuery2 = function(selector, context) {
return new jQuery2.fn.init(selector, context);
};
jQuery2.fn = jQuery2.prototype = {
// The current version of jQuery being used
jquery: version2,
constructor: jQuery2,
// The default length of a jQuery object is 0
length: 0,
toArray: function() {
return slice.call(this);
},
// Get the Nth element in the matched element set OR
// Get the whole matched element set as a clean array
get: function(num) {
if (num == null) {
return slice.call(this);
}
return num < 0 ? this[num + this.length] : this[num];
},
// Take an array of elements and push it onto the stack
// (returning the new matched element set)
pushStack: function(elems) {
var ret = jQuery2.merge(this.constructor(), elems);
ret.prevObject = this;
return ret;
},
// Execute a callback for every element in the matched set.
each: function(callback) {
return jQuery2.each(this, callback);
},
map: function(callback) {
return this.pushStack(jQuery2.map(this, function(elem, i) {
return callback.call(elem, i, elem);
}));
},
slice: function() {
return this.pushStack(slice.apply(this, arguments));
},
first: function() {
return this.eq(0);
},
last: function() {
return this.eq(-1);
},
even: function() {
return this.pushStack(jQuery2.grep(this, function(_elem, i) {
return (i + 1) % 2;
}));
},
odd: function() {
return this.pushStack(jQuery2.grep(this, function(_elem, i) {
return i % 2;
}));
},
eq: function(i) {
var len = this.length, j = +i + (i < 0 ? len : 0);
return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
},
end: function() {
return this.prevObject || this.constructor();
},
// For internal use only.
// Behaves like an Array's method, not like a jQuery method.
push,
sort: arr.sort,
splice: arr.splice
};
jQuery2.extend = jQuery2.fn.extend = function() {
var options, name, src, copy, copyIsArray, clone2, target = arguments[0] || {}, i = 1, length = arguments.length, deep = false;
if (typeof target === "boolean") {
deep = target;
target = arguments[i] || {};
i++;
}
if (typeof target !== "object" && !isFunction2(target)) {
target = {};
}
if (i === length) {
target = this;
i--;
}
for (; i < length; i++) {
if ((options = arguments[i]) != null) {
for (name in options) {
copy = options[name];
if (name === "__proto__" || target === copy) {
continue;
}
if (deep && copy && (jQuery2.isPlainObject(copy) || (copyIsArray = Array.isArray(copy)))) {
src = target[name];
if (copyIsArray && !Array.isArray(src)) {
clone2 = [];
} else if (!copyIsArray && !jQuery2.isPlainObject(src)) {
clone2 = {};
} else {
clone2 = src;
}
copyIsArray = false;
target[name] = jQuery2.extend(deep, clone2, copy);
} else if (copy !== void 0) {
target[name] = copy;
}
}
}
}
return target;
};
jQuery2.extend({
// Unique for each copy of jQuery on the page
expando: "jQuery" + (version2 + Math.random()).replace(/\D/g, ""),
// Assume jQuery is ready without the ready module
isReady: true,
error: function(msg) {
throw new Error(msg);
},
noop: function() {
},
isPlainObject: function(obj) {
var proto, Ctor;
if (!obj || toString2.call(obj) !== "[object Object]") {
return false;
}
proto = getProto2(obj);
if (!proto) {
return true;
}
Ctor = hasOwn2.call(proto, "constructor") && proto.constructor;
return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString;
},
isEmptyObject: function(obj) {
var name;
for (name in obj) {
return false;
}
return true;
},
// Evaluates a script in a provided context; falls back to the global one
// if not specified.
globalEval: function(code2, options, doc2) {
DOMEval(code2, { nonce: options && options.nonce }, doc2);
},
each: function(obj, callback) {
var length, i = 0;
if (isArrayLike2(obj)) {
length = obj.length;
for (; i < length; i++) {
if (callback.call(obj[i], i, obj[i]) === false) {
break;
}
}
} else {
for (i in obj) {
if (callback.call(obj[i], i, obj[i]) === false) {
break;
}
}
}
return obj;
},
// results is for internal usage only
makeArray: function(arr2, results) {
var ret = results || [];
if (arr2 != null) {
if (isArrayLike2(Object(arr2))) {
jQuery2.merge(
ret,
typeof arr2 === "string" ? [arr2] : arr2
);
} else {
push.call(ret, arr2);
}
}
return ret;
},
inArray: function(elem, arr2, i) {
return arr2 == null ? -1 : indexOf.call(arr2, elem, i);
},
// Support: Android <=4.0 only, PhantomJS 1 only
// push.apply(_, arraylike) throws on ancient WebKit
merge: function(first, second) {
var len = +second.length, j = 0, i = first.length;
for (; j < len; j++) {
first[i++] = second[j];
}
first.length = i;
return first;
},
grep: function(elems, callback, invert2) {
var callbackInverse, matches = [], i = 0, length = elems.length, callbackExpect = !invert2;
for (; i < length; i++) {
callbackInverse = !callback(elems[i], i);
if (callbackInverse !== callbackExpect) {
matches.push(elems[i]);
}
}
return matches;
},
// arg is for internal usage only
map: function(elems, callback, arg) {
var length, value, i = 0, ret = [];
if (isArrayLike2(elems)) {
length = elems.length;
for (; i < length; i++) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
} else {
for (i in elems) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
}
return flat(ret);
},
// A global GUID counter for objects
guid: 1,
// jQuery.support is not used in Core but other projects attach their
// properties to it so it needs to exist.
support
});
if (typeof Symbol === "function") {
jQuery2.fn[Symbol.iterator] = arr[Symbol.iterator];
}
jQuery2.each(
"Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),
function(_i, name) {
class2type["[object " + name + "]"] = name.toLowerCase();
}
);
function isArrayLike2(obj) {
var length = !!obj && "length" in obj && obj.length, type2 = toType(obj);
if (isFunction2(obj) || isWindow(obj)) {
return false;
}
return type2 === "array" || length === 0 || typeof length === "number" && length > 0 && length - 1 in obj;
}
var Sizzle = (
/*!
* Sizzle CSS Selector Engine v2.3.10
* https://sizzlejs.com/
*
* Copyright JS Foundation and other contributors
* Released under the MIT license
* https://js.foundation/
*
* Date: 2023-02-14
*/
function(window3) {
var i, support2, Expr, getText2, isXML, tokenize, compile2, select, outermostContext, sortInput, hasDuplicate, setDocument, document3, docElem, documentIsHTML, rbuggyQSA, rbuggyMatches, matches, contains, expando = "sizzle" + 1 * /* @__PURE__ */ new Date(), preferredDoc = window3.document, dirruns = 0, done = 0, classCache = createCache(), tokenCache = createCache(), compilerCache = createCache(), nonnativeSelectorCache = createCache(), sortOrder = function(a, b) {
if (a === b) {
hasDuplicate = true;
}
return 0;
}, hasOwn3 = {}.hasOwnProperty, arr2 = [], pop = arr2.pop, pushNative = arr2.push, push2 = arr2.push, slice2 = arr2.slice, indexOf2 = function(list, elem) {
var i2 = 0, len = list.length;
for (; i2 < len; i2++) {
if (list[i2] === elem) {
return i2;
}
}
return -1;
}, booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", whitespace3 = "[\\x20\\t\\r\\n\\f]", identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace3 + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", attributes = "\\[" + whitespace3 + "*(" + identifier + ")(?:" + whitespace3 + // Operator (capture 2)
"*([*^$|!~]?=)" + whitespace3 + // "Attribute values must be CSS identifiers [capture 5]
// or strings [capture 3 or capture 4]"
`*(?:'((?:\\\\.|[^\\\\'])*)'|"((?:\\\\.|[^\\\\"])*)"|(` + identifier + "))|)" + whitespace3 + "*\\]", pseudos = ":(" + identifier + `)(?:\\((('((?:\\\\.|[^\\\\'])*)'|"((?:\\\\.|[^\\\\"])*)")|((?:\\\\.|[^\\\\()[\\]]|` + attributes + ")*)|.*)\\)|)", rwhitespace = new RegExp(whitespace3 + "+", "g"), rtrim2 = new RegExp("^" + whitespace3 + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace3 + "+$", "g"), rcomma = new RegExp("^" + whitespace3 + "*," + whitespace3 + "*"), rleadingCombinator = new RegExp("^" + whitespace3 + "*([>+~]|" + whitespace3 + ")" + whitespace3 + "*"), rdescend = new RegExp(whitespace3 + "|>"), rpseudo = new RegExp(pseudos), ridentifier = new RegExp("^" + identifier + "$"), matchExpr = {
"ID": new RegExp("^#(" + identifier + ")"),
"CLASS": new RegExp("^\\.(" + identifier + ")"),
"TAG": new RegExp("^(" + identifier + "|[*])"),
"ATTR": new RegExp("^" + attributes),
"PSEUDO": new RegExp("^" + pseudos),
"CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace3 + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace3 + "*(?:([+-]|)" + whitespace3 + "*(\\d+)|))" + whitespace3 + "*\\)|)", "i"),
"bool": new RegExp("^(?:" + booleans + ")$", "i"),
// For use in libraries implementing .is()
// We use this for POS matching in `select`
"needsContext": new RegExp("^" + whitespace3 + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace3 + "*((?:-\\d)?\\d*)" + whitespace3 + "*\\)|)(?=[^-]|$)", "i")
}, rhtml2 = /HTML$/i, rinputs = /^(?:input|select|textarea|button)$/i, rheader = /^h\d$/i, rnative = /^[^{]+\{\s*\[native \w/, rquickExpr2 = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, rsibling = /[+~]/, runescape = new RegExp("\\\\[\\da-fA-F]{1,6}" + whitespace3 + "?|\\\\([^\\r\\n\\f])", "g"), funescape = function(escape2, nonHex) {
var high = "0x" + escape2.slice(1) - 65536;
return nonHex ? (
// Strip the backslash prefix from a non-hex escape sequence
nonHex
) : (
// Replace a hexadecimal escape sequence with the encoded Unicode code point
// Support: IE <=11+
// For values outside the Basic Multilingual Plane (BMP), manually construct a
// surrogate pair
high < 0 ? String.fromCharCode(high + 65536) : String.fromCharCode(high >> 10 | 55296, high & 1023 | 56320)
);
}, rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, fcssescape = function(ch, asCodePoint) {
if (asCodePoint) {
if (ch === "\0") {
return "�";
}
return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
}
return "\\" + ch;
}, unloadHandler = function() {
setDocument();
}, inDisabledFieldset = addCombinator(
function(elem) {
return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset";
},
{ dir: "parentNode", next: "legend" }
);
try {
push2.apply(
arr2 = slice2.call(preferredDoc.childNodes),
preferredDoc.childNodes
);
arr2[preferredDoc.childNodes.length].nodeType;
} catch (e) {
push2 = {
apply: arr2.length ? (
// Leverage slice if possible
function(target, els) {
pushNative.apply(target, slice2.call(els));
}
) : (
// Support: IE<9
// Otherwise append directly
function(target, els) {
var j = target.length, i2 = 0;
while (target[j++] = els[i2++]) {
}
target.length = j - 1;
}
)
};
}
function Sizzle2(selector, context, results, seed2) {
var m, i2, elem, nid, match2, groups, newSelector, newContext = context && context.ownerDocument, nodeType = context ? context.nodeType : 9;
results = results || [];
if (typeof selector !== "string" || !selector || nodeType !== 1 && nodeType !== 9 && nodeType !== 11) {
return results;
}
if (!seed2) {
setDocument(context);
context = context || document3;
if (documentIsHTML) {
if (nodeType !== 11 && (match2 = rquickExpr2.exec(selector))) {
if (m = match2[1]) {
if (nodeType === 9) {
if (elem = context.getElementById(m)) {
if (elem.id === m) {
results.push(elem);
return results;
}
} else {
return results;
}
} else {
if (newContext && (elem = newContext.getElementById(m)) && contains(context, elem) && elem.id === m) {
results.push(elem);
return results;
}
}
} else if (match2[2]) {
push2.apply(results, context.getElementsByTagName(selector));
return results;
} else if ((m = match2[3]) && support2.getElementsByClassName && context.getElementsByClassName) {
push2.apply(results, context.getElementsByClassName(m));
return results;
}
}
if (support2.qsa && !nonnativeSelectorCache[selector + " "] && (!rbuggyQSA || !rbuggyQSA.test(selector)) && // Support: IE 8 only
// Exclude object elements
(nodeType !== 1 || context.nodeName.toLowerCase() !== "object")) {
newSelector = selector;
newContext = context;
if (nodeType === 1 && (rdescend.test(selector) || rleadingCombinator.test(selector))) {
newContext = rsibling.test(selector) && testContext(context.parentNode) || context;
if (newContext !== context || !support2.scope) {
if (nid = context.getAttribute("id")) {
nid = nid.replace(rcssescape, fcssescape);
} else {
context.setAttribute("id", nid = expando);
}
}
groups = tokenize(selector);
i2 = groups.length;
while (i2--) {
groups[i2] = (nid ? "#" + nid : ":scope") + " " + toSelector(groups[i2]);
}
newSelector = groups.join(",");
}
try {
push2.apply(
results,
newContext.querySelectorAll(newSelector)
);
return results;
} catch (qsaError) {
nonnativeSelectorCache(selector, true);
} finally {
if (nid === expando) {
context.removeAttribute("id");
}
}
}
}
}
return select(selector.replace(rtrim2, "$1"), context, results, seed2);
}
function createCache() {
var keys2 = [];
function cache2(key, value) {
if (keys2.push(key + " ") > Expr.cacheLength) {
delete cache2[keys2.shift()];
}
return cache2[key + " "] = value;
}
return cache2;
}
function markFunction(fn2) {
fn2[expando] = true;
return fn2;
}
function assert(fn2) {
var el = document3.createElement("fieldset");
try {
return !!fn2(el);
} catch (e) {
return false;
} finally {
if (el.parentNode) {
el.parentNode.removeChild(el);
}
el = null;
}
}
function addHandle(attrs, handler) {
var arr3 = attrs.split("|"), i2 = arr3.length;
while (i2--) {
Expr.attrHandle[arr3[i2]] = handler;
}
}
function siblingCheck(a, b) {
var cur = b && a, diff = cur && a.nodeType === 1 && b.nodeType === 1 && a.sourceIndex - b.sourceIndex;
if (diff) {
return diff;
}
if (cur) {
while (cur = cur.nextSibling) {
if (cur === b) {
return -1;
}
}
}
return a ? 1 : -1;
}
function createInputPseudo(type2) {
return function(elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === type2;
};
}
function createButtonPseudo(type2) {
return function(elem) {
var name = elem.nodeName.toLowerCase();
return (name === "input" || name === "button") && elem.type === type2;
};
}
function createDisabledPseudo(disabled) {
return function(elem) {
if ("form" in elem) {
if (elem.parentNode && elem.disabled === false) {
if ("label" in elem) {
if ("label" in elem.parentNode) {
return elem.parentNode.disabled === disabled;
} else {
return elem.disabled === disabled;
}
}
return elem.isDisabled === disabled || // Where there is no isDisabled, check manually
/* jshint -W018 */
elem.isDisabled !== !disabled && inDisabledFieldset(elem) === disabled;
}
return elem.disabled === disabled;
} else if ("label" in elem) {
return elem.disabled === disabled;
}
return false;
};
}
function createPositionalPseudo(fn2) {
return markFunction(function(argument) {
argument = +argument;
return markFunction(function(seed2, matches2) {
var j, matchIndexes = fn2([], seed2.length, argument), i2 = matchIndexes.length;
while (i2--) {
if (seed2[j = matchIndexes[i2]]) {
seed2[j] = !(matches2[j] = seed2[j]);
}
}
});
});
}
function testContext(context) {
return context && typeof context.getElementsByTagName !== "undefined" && context;
}
support2 = Sizzle2.support = {};
isXML = Sizzle2.isXML = function(elem) {
var namespace = elem && elem.namespaceURI, docElem2 = elem && (elem.ownerDocument || elem).documentElement;
return !rhtml2.test(namespace || docElem2 && docElem2.nodeName || "HTML");
};
setDocument = Sizzle2.setDocument = function(node) {
var hasCompare, subWindow, doc2 = node ? node.ownerDocument || node : preferredDoc;
if (doc2 == document3 || doc2.nodeType !== 9 || !doc2.documentElement) {
return document3;
}
document3 = doc2;
docElem = document3.documentElement;
documentIsHTML = !isXML(document3);
if (preferredDoc != document3 && (subWindow = document3.defaultView) && subWindow.top !== subWindow) {
if (subWindow.addEventListener) {
subWindow.addEventListener("unload", unloadHandler, false);
} else if (subWindow.attachEvent) {
subWindow.attachEvent("onunload", unloadHandler);
}
}
support2.scope = assert(function(el) {
docElem.appendChild(el).appendChild(document3.createElement("div"));
return typeof el.querySelectorAll !== "undefined" && !el.querySelectorAll(":scope fieldset div").length;
});
support2.cssHas = assert(function() {
try {
document3.querySelector(":has(*,:jqfake)");
return false;
} catch (e) {
return true;
}
});
support2.attributes = assert(function(el) {
el.className = "i";
return !el.getAttribute("className");
});
support2.getElementsByTagName = assert(function(el) {
el.appendChild(document3.createComment(""));
return !el.getElementsByTagName("*").length;
});
support2.getElementsByClassName = rnative.test(document3.getElementsByClassName);
support2.getById = assert(function(el) {
docElem.appendChild(el).id = expando;
return !document3.getElementsByName || !document3.getElementsByName(expando).length;
});
if (support2.getById) {
Expr.filter["ID"] = function(id) {
var attrId = id.replace(runescape, funescape);
return function(elem) {
return elem.getAttribute("id") === attrId;
};
};
Expr.find["ID"] = function(id, context) {
if (typeof context.getElementById !== "undefined" && documentIsHTML) {
var elem = context.getElementById(id);
return elem ? [elem] : [];
}
};
} else {
Expr.filter["ID"] = function(id) {
var attrId = id.replace(runescape, funescape);
return function(elem) {
var node2 = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
return node2 && node2.value === attrId;
};
};
Expr.find["ID"] = function(id, context) {
if (typeof context.getElementById !== "undefined" && documentIsHTML) {
var node2, i2, elems, elem = context.getElementById(id);
if (elem) {
node2 = elem.getAttributeNode("id");
if (node2 && node2.value === id) {
return [elem];
}
elems = context.getElementsByName(id);
i2 = 0;
while (elem = elems[i2++]) {
node2 = elem.getAttributeNode("id");
if (node2 && node2.value === id) {
return [elem];
}
}
}
return [];
}
};
}
Expr.find["TAG"] = support2.getElementsByTagName ? function(tag, context) {
if (typeof context.getElementsByTagName !== "undefined") {
return context.getElementsByTagName(tag);
} else if (support2.qsa) {
return context.querySelectorAll(tag);
}
} : function(tag, context) {
var elem, tmp = [], i2 = 0, results = context.getElementsByTagName(tag);
if (tag === "*") {
while (elem = results[i2++]) {
if (elem.nodeType === 1) {
tmp.push(elem);
}
}
return tmp;
}
return results;
};
Expr.find["CLASS"] = support2.getElementsByClassName && function(className, context) {
if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) {
return context.getElementsByClassName(className);
}
};
rbuggyMatches = [];
rbuggyQSA = [];
if (support2.qsa = rnative.test(document3.querySelectorAll)) {
assert(function(el) {
var input;
docElem.appendChild(el).innerHTML = "<a id='" + expando + "'></a><select id='" + expando + "-\r\\' msallowcapture=''><option selected=''></option></select>";
if (el.querySelectorAll("[msallowcapture^='']").length) {
rbuggyQSA.push("[*^$]=" + whitespace3 + `*(?:''|"")`);
}
if (!el.querySelectorAll("[selected]").length) {
rbuggyQSA.push("\\[" + whitespace3 + "*(?:value|" + booleans + ")");
}
if (!el.querySelectorAll("[id~=" + expando + "-]").length) {
rbuggyQSA.push("~=");
}
input = document3.createElement("input");
input.setAttribute("name", "");
el.appendChild(input);
if (!el.querySelectorAll("[name='']").length) {
rbuggyQSA.push("\\[" + whitespace3 + "*name" + whitespace3 + "*=" + whitespace3 + `*(?:''|"")`);
}
if (!el.querySelectorAll(":checked").length) {
rbuggyQSA.push(":checked");
}
if (!el.querySelectorAll("a#" + expando + "+*").length) {
rbuggyQSA.push(".#.+[+~]");
}
el.querySelectorAll("\\\f");
rbuggyQSA.push("[\\r\\n\\f]");
});
assert(function(el) {
el.innerHTML = "<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";
var input = document3.createElement("input");
input.setAttribute("type", "hidden");
el.appendChild(input).setAttribute("name", "D");
if (el.querySelectorAll("[name=d]").length) {
rbuggyQSA.push("name" + whitespace3 + "*[*^$|!~]?=");
}
if (el.querySelectorAll(":enabled").length !== 2) {
rbuggyQSA.push(":enabled", ":disabled");
}
docElem.appendChild(el).disabled = true;
if (el.querySelectorAll(":disabled").length !== 2) {
rbuggyQSA.push(":enabled", ":disabled");
}
el.querySelectorAll("*,:x");
rbuggyQSA.push(",.*:");
});
}
if (support2.matchesSelector = rnative.test(matches = docElem.matches || docElem.webkitMatchesSelector || docElem.mozMatchesSelector || docElem.oMatchesSelector || docElem.msMatchesSelector)) {
assert(function(el) {
support2.disconnectedMatch = matches.call(el, "*");
matches.call(el, "[s!='']:x");
rbuggyMatches.push("!=", pseudos);
});
}
if (!support2.cssHas) {
rbuggyQSA.push(":has");
}
rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
hasCompare = rnative.test(docElem.compareDocumentPosition);
contains = hasCompare || rnative.test(docElem.contains) ? function(a, b) {
var adown = a.nodeType === 9 && a.documentElement || a, bup = b && b.parentNode;
return a === bup || !!(bup && bup.nodeType === 1 && (adown.contains ? adown.contains(bup) : a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16));
} : function(a, b) {
if (b) {
while (b = b.parentNode) {
if (b === a) {
return true;
}
}
}
return false;
};
sortOrder = hasCompare ? function(a, b) {
if (a === b) {
hasDuplicate = true;
return 0;
}
var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
if (compare) {
return compare;
}
compare = (a.ownerDocument || a) == (b.ownerDocument || b) ? a.compareDocumentPosition(b) : (
// Otherwise we know they are disconnected
1
);
if (compare & 1 || !support2.sortDetached && b.compareDocumentPosition(a) === compare) {
if (a == document3 || a.ownerDocument == preferredDoc && contains(preferredDoc, a)) {
return -1;
}
if (b == document3 || b.ownerDocument == preferredDoc && contains(preferredDoc, b)) {
return 1;
}
return sortInput ? indexOf2(sortInput, a) - indexOf2(sortInput, b) : 0;
}
return compare & 4 ? -1 : 1;
} : function(a, b) {
if (a === b) {
hasDuplicate = true;
return 0;
}
var cur, i2 = 0, aup = a.parentNode, bup = b.parentNode, ap = [a], bp = [b];
if (!aup || !bup) {
return a == document3 ? -1 : b == document3 ? 1 : (
/* eslint-enable eqeqeq */
aup ? -1 : bup ? 1 : sortInput ? indexOf2(sortInput, a) - indexOf2(sortInput, b) : 0
);
} else if (aup === bup) {
return siblingCheck(a, b);
}
cur = a;
while (cur = cur.parentNode) {
ap.unshift(cur);
}
cur = b;
while (cur = cur.parentNode) {
bp.unshift(cur);
}
while (ap[i2] === bp[i2]) {
i2++;
}
return i2 ? (
// Do a sibling check if the nodes have a common ancestor
siblingCheck(ap[i2], bp[i2])
) : (
// Otherwise nodes in our document sort first
// Support: IE 11+, Edge 17 - 18+
// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
// two documents; shallow comparisons work.
/* eslint-disable eqeqeq */
ap[i2] == preferredDoc ? -1 : bp[i2] == preferredDoc ? 1 : (
/* eslint-enable eqeqeq */
0
)
);
};
return document3;
};
Sizzle2.matches = function(expr, elements) {
return Sizzle2(expr, null, null, elements);
};
Sizzle2.matchesSelector = function(elem, expr) {
setDocument(elem);
if (support2.matchesSelector && documentIsHTML && !nonnativeSelectorCache[expr + " "] && (!rbuggyMatches || !rbuggyMatches.test(expr)) && (!rbuggyQSA || !rbuggyQSA.test(expr))) {
try {
var ret = matches.call(elem, expr);
if (ret || support2.disconnectedMatch || // As well, disconnected nodes are said to be in a document
// fragment in IE 9
elem.document && elem.document.nodeType !== 11) {
return ret;
}
} catch (e) {
nonnativeSelectorCache(expr, true);
}
}
return Sizzle2(expr, document3, null, [elem]).length > 0;
};
Sizzle2.contains = function(context, elem) {
if ((context.ownerDocument || context) != document3) {
setDocument(context);
}
return contains(context, elem);
};
Sizzle2.attr = function(elem, name) {
if ((elem.ownerDocument || elem) != document3) {
setDocument(elem);
}
var fn2 = Expr.attrHandle[name.toLowerCase()], val = fn2 && hasOwn3.call(Expr.attrHandle, name.toLowerCase()) ? fn2(elem, name, !documentIsHTML) : void 0;
return val !== void 0 ? val : support2.attributes || !documentIsHTML ? elem.getAttribute(name) : (val = elem.getAttributeNode(name)) && val.specified ? val.value : null;
};
Sizzle2.escape = function(sel) {
return (sel + "").replace(rcssescape, fcssescape);
};
Sizzle2.error = function(msg) {
throw new Error("Syntax error, unrecognized expression: " + msg);
};
Sizzle2.uniqueSort = function(results) {
var elem, duplicates = [], j = 0, i2 = 0;
hasDuplicate = !support2.detectDuplicates;
sortInput = !support2.sortStable && results.slice(0);
results.sort(sortOrder);
if (hasDuplicate) {
while (elem = results[i2++]) {
if (elem === results[i2]) {
j = duplicates.push(i2);
}
}
while (j--) {
results.splice(duplicates[j], 1);
}
}
sortInput = null;
return results;
};
getText2 = Sizzle2.getText = function(elem) {
var node, ret = "", i2 = 0, nodeType = elem.nodeType;
if (!nodeType) {
while (node = elem[i2++]) {
ret += getText2(node);
}
} else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
if (typeof elem.textContent === "string") {
return elem.textContent;
} else {
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
ret += getText2(elem);
}
}
} else if (nodeType === 3 || nodeType === 4) {
return elem.nodeValue;
}
return ret;
};
Expr = Sizzle2.selectors = {
// Can be adjusted by the user
cacheLength: 50,
createPseudo: markFunction,
match: matchExpr,
attrHandle: {},
find: {},
relative: {
">": { dir: "parentNode", first: true },
" ": { dir: "parentNode" },
"+": { dir: "previousSibling", first: true },
"~": { dir: "previousSibling" }
},
preFilter: {
"ATTR": function(match2) {
match2[1] = match2[1].replace(runescape, funescape);
match2[3] = (match2[3] || match2[4] || match2[5] || "").replace(runescape, funescape);
if (match2[2] === "~=") {
match2[3] = " " + match2[3] + " ";
}
return match2.slice(0, 4);
},
"CHILD": function(match2) {
match2[1] = match2[1].toLowerCase();
if (match2[1].slice(0, 3) === "nth") {
if (!match2[3]) {
Sizzle2.error(match2[0]);
}
match2[4] = +(match2[4] ? match2[5] + (match2[6] || 1) : 2 * (match2[3] === "even" || match2[3] === "odd"));
match2[5] = +(match2[7] + match2[8] || match2[3] === "odd");
} else if (match2[3]) {
Sizzle2.error(match2[0]);
}
return match2;
},
"PSEUDO": function(match2) {
var excess, unquoted = !match2[6] && match2[2];
if (matchExpr["CHILD"].test(match2[0])) {
return null;
}
if (match2[3]) {
match2[2] = match2[4] || match2[5] || "";
} else if (unquoted && rpseudo.test(unquoted) && // Get excess from tokenize (recursively)
(excess = tokenize(unquoted, true)) && // advance to the next closing parenthesis
(excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
match2[0] = match2[0].slice(0, excess);
match2[2] = unquoted.slice(0, excess);
}
return match2.slice(0, 3);
}
},
filter: {
"TAG": function(nodeNameSelector) {
var nodeName2 = nodeNameSelector.replace(runescape, funescape).toLowerCase();
return nodeNameSelector === "*" ? function() {
return true;
} : function(elem) {
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName2;
};
},
"CLASS": function(className) {
var pattern2 = classCache[className + " "];
return pattern2 || (pattern2 = new RegExp("(^|" + whitespace3 + ")" + className + "(" + whitespace3 + "|$)")) && classCache(
className,
function(elem) {
return pattern2.test(
typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || ""
);
}
);
},
"ATTR": function(name, operator, check) {
return function(elem) {
var result = Sizzle2.attr(elem, name);
if (result == null) {
return operator === "!=";
}
if (!operator) {
return true;
}
result += "";
return operator === "=" ? result === check : operator === "!=" ? result !== check : operator === "^=" ? check && result.indexOf(check) === 0 : operator === "*=" ? check && result.indexOf(check) > -1 : operator === "$=" ? check && result.slice(-check.length) === check : operator === "~=" ? (" " + result.replace(rwhitespace, " ") + " ").indexOf(check) > -1 : operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" : false;
};
},
"CHILD": function(type2, what, _argument, first, last2) {
var simple = type2.slice(0, 3) !== "nth", forward = type2.slice(-4) !== "last", ofType = what === "of-type";
return first === 1 && last2 === 0 ? (
// Shortcut for :nth-*(n)
function(elem) {
return !!elem.parentNode;
}
) : function(elem, _context, xml) {
var cache2, uniqueCache, outerCache, node, nodeIndex, start, dir2 = simple !== forward ? "nextSibling" : "previousSibling", parent = elem.parentNode, name = ofType && elem.nodeName.toLowerCase(), useCache = !xml && !ofType, diff = false;
if (parent) {
if (simple) {
while (dir2) {
node = elem;
while (node = node[dir2]) {
if (ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) {
return false;
}
}
start = dir2 = type2 === "only" && !start && "nextSibling";
}
return true;
}
start = [forward ? parent.firstChild : parent.lastChild];
if (forward && useCache) {
node = parent;
outerCache = node[expando] || (node[expando] = {});
uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
cache2 = uniqueCache[type2] || [];
nodeIndex = cache2[0] === dirruns && cache2[1];
diff = nodeIndex && cache2[2];
node = nodeIndex && parent.childNodes[nodeIndex];
while (node = ++nodeIndex && node && node[dir2] || // Fallback to seeking `elem` from the start
(diff = nodeIndex = 0) || start.pop()) {
if (node.nodeType === 1 && ++diff && node === elem) {
uniqueCache[type2] = [dirruns, nodeIndex, diff];
break;
}
}
} else {
if (useCache) {
node = elem;
outerCache = node[expando] || (node[expando] = {});
uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
cache2 = uniqueCache[type2] || [];
nodeIndex = cache2[0] === dirruns && cache2[1];
diff = nodeIndex;
}
if (diff === false) {
while (node = ++nodeIndex && node && node[dir2] || (diff = nodeIndex = 0) || start.pop()) {
if ((ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) && ++diff) {
if (useCache) {
outerCache = node[expando] || (node[expando] = {});
uniqueCache = outerCache[node.uniqueID] || (outerCache[node.uniqueID] = {});
uniqueCache[type2] = [dirruns, diff];
}
if (node === elem) {
break;
}
}
}
}
}
diff -= last2;
return diff === first || diff % first === 0 && diff / first >= 0;
}
};
},
"PSEUDO": function(pseudo, argument) {
var args, fn2 = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] || Sizzle2.error("unsupported pseudo: " + pseudo);
if (fn2[expando]) {
return fn2(argument);
}
if (fn2.length > 1) {
args = [pseudo, pseudo, "", argument];
return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ? markFunction(function(seed2, matches2) {
var idx, matched = fn2(seed2, argument), i2 = matched.length;
while (i2--) {
idx = indexOf2(seed2, matched[i2]);
seed2[idx] = !(matches2[idx] = matched[i2]);
}
}) : function(elem) {
return fn2(elem, 0, args);
};
}
return fn2;
}
},
pseudos: {
// Potentially complex pseudos
"not": markFunction(function(selector) {
var input = [], results = [], matcher = compile2(selector.replace(rtrim2, "$1"));
return matcher[expando] ? markFunction(function(seed2, matches2, _context, xml) {
var elem, unmatched = matcher(seed2, null, xml, []), i2 = seed2.length;
while (i2--) {
if (elem = unmatched[i2]) {
seed2[i2] = !(matches2[i2] = elem);
}
}
}) : function(elem, _context, xml) {
input[0] = elem;
matcher(input, null, xml, results);
input[0] = null;
return !results.pop();
};
}),
"has": markFunction(function(selector) {
return function(elem) {
return Sizzle2(selector, elem).length > 0;
};
}),
"contains": markFunction(function(text) {
text = text.replace(runescape, funescape);
return function(elem) {
return (elem.textContent || getText2(elem)).indexOf(text) > -1;
};
}),
// "Whether an element is represented by a :lang() selector
// is based solely on the element's language value
// being equal to the identifier C,
// or beginning with the identifier C immediately followed by "-".
// The matching of C against the element's language value is performed case-insensitively.
// The identifier C does not have to be a valid language name."
// http://www.w3.org/TR/selectors/#lang-pseudo
"lang": markFunction(function(lang) {
if (!ridentifier.test(lang || "")) {
Sizzle2.error("unsupported lang: " + lang);
}
lang = lang.replace(runescape, funescape).toLowerCase();
return function(elem) {
var elemLang;
do {
if (elemLang = documentIsHTML ? elem.lang : elem.getAttribute("xml:lang") || elem.getAttribute("lang")) {
elemLang = elemLang.toLowerCase();
return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
}
} while ((elem = elem.parentNode) && elem.nodeType === 1);
return false;
};
}),
// Miscellaneous
"target": function(elem) {
var hash = window3.location && window3.location.hash;
return hash && hash.slice(1) === elem.id;
},
"root": function(elem) {
return elem === docElem;
},
"focus": function(elem) {
return elem === document3.activeElement && (!document3.hasFocus || document3.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
},
// Boolean properties
"enabled": createDisabledPseudo(false),
"disabled": createDisabledPseudo(true),
"checked": function(elem) {
var nodeName2 = elem.nodeName.toLowerCase();
return nodeName2 === "input" && !!elem.checked || nodeName2 === "option" && !!elem.selected;
},
"selected": function(elem) {
if (elem.parentNode) {
elem.parentNode.selectedIndex;
}
return elem.selected === true;
},
// Contents
"empty": function(elem) {
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
if (elem.nodeType < 6) {
return false;
}
}
return true;
},
"parent": function(elem) {
return !Expr.pseudos["empty"](elem);
},
// Element/input types
"header": function(elem) {
return rheader.test(elem.nodeName);
},
"input": function(elem) {
return rinputs.test(elem.nodeName);
},
"button": function(elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === "button" || name === "button";
},
"text": function(elem) {
var attr;
return elem.nodeName.toLowerCase() === "input" && elem.type === "text" && // Support: IE <10 only
// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text");
},
// Position-in-collection
"first": createPositionalPseudo(function() {
return [0];
}),
"last": createPositionalPseudo(function(_matchIndexes, length) {
return [length - 1];
}),
"eq": createPositionalPseudo(function(_matchIndexes, length, argument) {
return [argument < 0 ? argument + length : argument];
}),
"even": createPositionalPseudo(function(matchIndexes, length) {
var i2 = 0;
for (; i2 < length; i2 += 2) {
matchIndexes.push(i2);
}
return matchIndexes;
}),
"odd": createPositionalPseudo(function(matchIndexes, length) {
var i2 = 1;
for (; i2 < length; i2 += 2) {
matchIndexes.push(i2);
}
return matchIndexes;
}),
"lt": createPositionalPseudo(function(matchIndexes, length, argument) {
var i2 = argument < 0 ? argument + length : argument > length ? length : argument;
for (; --i2 >= 0; ) {
matchIndexes.push(i2);
}
return matchIndexes;
}),
"gt": createPositionalPseudo(function(matchIndexes, length, argument) {
var i2 = argument < 0 ? argument + length : argument;
for (; ++i2 < length; ) {
matchIndexes.push(i2);
}
return matchIndexes;
})
}
};
Expr.pseudos["nth"] = Expr.pseudos["eq"];
for (i in { radio: true, checkbox: true, file: true, password: true, image: true }) {
Expr.pseudos[i] = createInputPseudo(i);
}
for (i in { submit: true, reset: true }) {
Expr.pseudos[i] = createButtonPseudo(i);
}
function setFilters() {
}
setFilters.prototype = Expr.filters = Expr.pseudos;
Expr.setFilters = new setFilters();
tokenize = Sizzle2.tokenize = function(selector, parseOnly) {
var matched, match2, tokens, type2, soFar, groups, preFilters, cached = tokenCache[selector + " "];
if (cached) {
return parseOnly ? 0 : cached.slice(0);
}
soFar = selector;
groups = [];
preFilters = Expr.preFilter;
while (soFar) {
if (!matched || (match2 = rcomma.exec(soFar))) {
if (match2) {
soFar = soFar.slice(match2[0].length) || soFar;
}
groups.push(tokens = []);
}
matched = false;
if (match2 = rleadingCombinator.exec(soFar)) {
matched = match2.shift();
tokens.push({
value: matched,
// Cast descendant combinators to space
type: match2[0].replace(rtrim2, " ")
});
soFar = soFar.slice(matched.length);
}
for (type2 in Expr.filter) {
if ((match2 = matchExpr[type2].exec(soFar)) && (!preFilters[type2] || (match2 = preFilters[type2](match2)))) {
matched = match2.shift();
tokens.push({
value: matched,
type: type2,
matches: match2
});
soFar = soFar.slice(matched.length);
}
}
if (!matched) {
break;
}
}
return parseOnly ? soFar.length : soFar ? Sizzle2.error(selector) : (
// Cache the tokens
tokenCache(selector, groups).slice(0)
);
};
function toSelector(tokens) {
var i2 = 0, len = tokens.length, selector = "";
for (; i2 < len; i2++) {
selector += tokens[i2].value;
}
return selector;
}
function addCombinator(matcher, combinator, base2) {
var dir2 = combinator.dir, skip = combinator.next, key = skip || dir2, checkNonElements = base2 && key === "parentNode", doneName = done++;
return combinator.first ? (
// Check against closest ancestor/preceding element
function(elem, context, xml) {
while (elem = elem[dir2]) {
if (elem.nodeType === 1 || checkNonElements) {
return matcher(elem, context, xml);
}
}
return false;
}
) : (
// Check against all ancestor/preceding elements
function(elem, context, xml) {
var oldCache, uniqueCache, outerCache, newCache = [dirruns, doneName];
if (xml) {
while (elem = elem[dir2]) {
if (elem.nodeType === 1 || checkNonElements) {
if (matcher(elem, context, xml)) {
return true;
}
}
}
} else {
while (elem = elem[dir2]) {
if (elem.nodeType === 1 || checkNonElements) {
outerCache = elem[expando] || (elem[expando] = {});
uniqueCache = outerCache[elem.uniqueID] || (outerCache[elem.uniqueID] = {});
if (skip && skip === elem.nodeName.toLowerCase()) {
elem = elem[dir2] || elem;
} else if ((oldCache = uniqueCache[key]) && oldCache[0] === dirruns && oldCache[1] === doneName) {
return newCache[2] = oldCache[2];
} else {
uniqueCache[key] = newCache;
if (newCache[2] = matcher(elem, context, xml)) {
return true;
}
}
}
}
}
return false;
}
);
}
function elementMatcher(matchers2) {
return matchers2.length > 1 ? function(elem, context, xml) {
var i2 = matchers2.length;
while (i2--) {
if (!matchers2[i2](elem, context, xml)) {
return false;
}
}
return true;
} : matchers2[0];
}
function multipleContexts(selector, contexts, results) {
var i2 = 0, len = contexts.length;
for (; i2 < len; i2++) {
Sizzle2(selector, contexts[i2], results);
}
return results;
}
function condense(unmatched, map2, filter2, context, xml) {
var elem, newUnmatched = [], i2 = 0, len = unmatched.length, mapped = map2 != null;
for (; i2 < len; i2++) {
if (elem = unmatched[i2]) {
if (!filter2 || filter2(elem, context, xml)) {
newUnmatched.push(elem);
if (mapped) {
map2.push(i2);
}
}
}
}
return newUnmatched;
}
function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
if (postFilter && !postFilter[expando]) {
postFilter = setMatcher(postFilter);
}
if (postFinder && !postFinder[expando]) {
postFinder = setMatcher(postFinder, postSelector);
}
return markFunction(function(seed2, results, context, xml) {
var temp, i2, elem, preMap = [], postMap = [], preexisting = results.length, elems = seed2 || multipleContexts(
selector || "*",
context.nodeType ? [context] : context,
[]
), matcherIn = preFilter && (seed2 || !selector) ? condense(elems, preMap, preFilter, context, xml) : elems, matcherOut = matcher ? (
// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
postFinder || (seed2 ? preFilter : preexisting || postFilter) ? (
// ...intermediate processing is necessary
[]
) : (
// ...otherwise use results directly
results
)
) : matcherIn;
if (matcher) {
matcher(matcherIn, matcherOut, context, xml);
}
if (postFilter) {
temp = condense(matcherOut, postMap);
postFilter(temp, [], context, xml);
i2 = temp.length;
while (i2--) {
if (elem = temp[i2]) {
matcherOut[postMap[i2]] = !(matcherIn[postMap[i2]] = elem);
}
}
}
if (seed2) {
if (postFinder || preFilter) {
if (postFinder) {
temp = [];
i2 = matcherOut.length;
while (i2--) {
if (elem = matcherOut[i2]) {
temp.push(matcherIn[i2] = elem);
}
}
postFinder(null, matcherOut = [], temp, xml);
}
i2 = matcherOut.length;
while (i2--) {
if ((elem = matcherOut[i2]) && (temp = postFinder ? indexOf2(seed2, elem) : preMap[i2]) > -1) {
seed2[temp] = !(results[temp] = elem);
}
}
}
} else {
matcherOut = condense(
matcherOut === results ? matcherOut.splice(preexisting, matcherOut.length) : matcherOut
);
if (postFinder) {
postFinder(null, results, matcherOut, xml);
} else {
push2.apply(results, matcherOut);
}
}
});
}
function matcherFromTokens(tokens) {
var checkContext, matcher, j, len = tokens.length, leadingRelative = Expr.relative[tokens[0].type], implicitRelative = leadingRelative || Expr.relative[" "], i2 = leadingRelative ? 1 : 0, matchContext = addCombinator(function(elem) {
return elem === checkContext;
}, implicitRelative, true), matchAnyContext = addCombinator(function(elem) {
return indexOf2(checkContext, elem) > -1;
}, implicitRelative, true), matchers2 = [function(elem, context, xml) {
var ret = !leadingRelative && (xml || context !== outermostContext) || ((checkContext = context).nodeType ? matchContext(elem, context, xml) : matchAnyContext(elem, context, xml));
checkContext = null;
return ret;
}];
for (; i2 < len; i2++) {
if (matcher = Expr.relative[tokens[i2].type]) {
matchers2 = [addCombinator(elementMatcher(matchers2), matcher)];
} else {
matcher = Expr.filter[tokens[i2].type].apply(null, tokens[i2].matches);
if (matcher[expando]) {
j = ++i2;
for (; j < len; j++) {
if (Expr.relative[tokens[j].type]) {
break;
}
}
return setMatcher(
i2 > 1 && elementMatcher(matchers2),
i2 > 1 && toSelector(
// If the preceding token was a descendant combinator, insert an implicit any-element `*`
tokens.slice(0, i2 - 1).concat({ value: tokens[i2 - 2].type === " " ? "*" : "" })
).replace(rtrim2, "$1"),
matcher,
i2 < j && matcherFromTokens(tokens.slice(i2, j)),
j < len && matcherFromTokens(tokens = tokens.slice(j)),
j < len && toSelector(tokens)
);
}
matchers2.push(matcher);
}
}
return elementMatcher(matchers2);
}
function matcherFromGroupMatchers(elementMatchers, setMatchers) {
var bySet = setMatchers.length > 0, byElement = elementMatchers.length > 0, superMatcher = function(seed2, context, xml, results, outermost) {
var elem, j, matcher, matchedCount = 0, i2 = "0", unmatched = seed2 && [], setMatched = [], contextBackup = outermostContext, elems = seed2 || byElement && Expr.find["TAG"]("*", outermost), dirrunsUnique = dirruns += contextBackup == null ? 1 : Math.random() || 0.1, len = elems.length;
if (outermost) {
outermostContext = context == document3 || context || outermost;
}
for (; i2 !== len && (elem = elems[i2]) != null; i2++) {
if (byElement && elem) {
j = 0;
if (!context && elem.ownerDocument != document3) {
setDocument(elem);
xml = !documentIsHTML;
}
while (matcher = elementMatchers[j++]) {
if (matcher(elem, context || document3, xml)) {
results.push(elem);
break;
}
}
if (outermost) {
dirruns = dirrunsUnique;
}
}
if (bySet) {
if (elem = !matcher && elem) {
matchedCount--;
}
if (seed2) {
unmatched.push(elem);
}
}
}
matchedCount += i2;
if (bySet && i2 !== matchedCount) {
j = 0;
while (matcher = setMatchers[j++]) {
matcher(unmatched, setMatched, context, xml);
}
if (seed2) {
if (matchedCount > 0) {
while (i2--) {
if (!(unmatched[i2] || setMatched[i2])) {
setMatched[i2] = pop.call(results);
}
}
}
setMatched = condense(setMatched);
}
push2.apply(results, setMatched);
if (outermost && !seed2 && setMatched.length > 0 && matchedCount + setMatchers.length > 1) {
Sizzle2.uniqueSort(results);
}
}
if (outermost) {
dirruns = dirrunsUnique;
outermostContext = contextBackup;
}
return unmatched;
};
return bySet ? markFunction(superMatcher) : superMatcher;
}
compile2 = Sizzle2.compile = function(selector, match2) {
var i2, setMatchers = [], elementMatchers = [], cached = compilerCache[selector + " "];
if (!cached) {
if (!match2) {
match2 = tokenize(selector);
}
i2 = match2.length;
while (i2--) {
cached = matcherFromTokens(match2[i2]);
if (cached[expando]) {
setMatchers.push(cached);
} else {
elementMatchers.push(cached);
}
}
cached = compilerCache(
selector,
matcherFromGroupMatchers(elementMatchers, setMatchers)
);
cached.selector = selector;
}
return cached;
};
select = Sizzle2.select = function(selector, context, results, seed2) {
var i2, tokens, token, type2, find, compiled = typeof selector === "function" && selector, match2 = !seed2 && tokenize(selector = compiled.selector || selector);
results = results || [];
if (match2.length === 1) {
tokens = match2[0] = match2[0].slice(0);
if (tokens.length > 2 && (token = tokens[0]).type === "ID" && context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) {
context = (Expr.find["ID"](token.matches[0].replace(runescape, funescape), context) || [])[0];
if (!context) {
return results;
} else if (compiled) {
context = context.parentNode;
}
selector = selector.slice(tokens.shift().value.length);
}
i2 = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
while (i2--) {
token = tokens[i2];
if (Expr.relative[type2 = token.type]) {
break;
}
if (find = Expr.find[type2]) {
if (seed2 = find(
token.matches[0].replace(runescape, funescape),
rsibling.test(tokens[0].type) && testContext(context.parentNode) || context
)) {
tokens.splice(i2, 1);
selector = seed2.length && toSelector(tokens);
if (!selector) {
push2.apply(results, seed2);
return results;
}
break;
}
}
}
}
(compiled || compile2(selector, match2))(
seed2,
context,
!documentIsHTML,
results,
!context || rsibling.test(selector) && testContext(context.parentNode) || context
);
return results;
};
support2.sortStable = expando.split("").sort(sortOrder).join("") === expando;
support2.detectDuplicates = !!hasDuplicate;
setDocument();
support2.sortDetached = assert(function(el) {
return el.compareDocumentPosition(document3.createElement("fieldset")) & 1;
});
if (!assert(function(el) {
el.innerHTML = "<a href='#'></a>";
return el.firstChild.getAttribute("href") === "#";
})) {
addHandle("type|href|height|width", function(elem, name, isXML2) {
if (!isXML2) {
return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2);
}
});
}
if (!support2.attributes || !assert(function(el) {
el.innerHTML = "<input/>";
el.firstChild.setAttribute("value", "");
return el.firstChild.getAttribute("value") === "";
})) {
addHandle("value", function(elem, _name, isXML2) {
if (!isXML2 && elem.nodeName.toLowerCase() === "input") {
return elem.defaultValue;
}
});
}
if (!assert(function(el) {
return el.getAttribute("disabled") == null;
})) {
addHandle(booleans, function(elem, name, isXML2) {
var val;
if (!isXML2) {
return elem[name] === true ? name.toLowerCase() : (val = elem.getAttributeNode(name)) && val.specified ? val.value : null;
}
});
}
return Sizzle2;
}(window2)
);
jQuery2.find = Sizzle;
jQuery2.expr = Sizzle.selectors;
jQuery2.expr[":"] = jQuery2.expr.pseudos;
jQuery2.uniqueSort = jQuery2.unique = Sizzle.uniqueSort;
jQuery2.text = Sizzle.getText;
jQuery2.isXMLDoc = Sizzle.isXML;
jQuery2.contains = Sizzle.contains;
jQuery2.escapeSelector = Sizzle.escape;
var dir = function(elem, dir2, until) {
var matched = [], truncate = until !== void 0;
while ((elem = elem[dir2]) && elem.nodeType !== 9) {
if (elem.nodeType === 1) {
if (truncate && jQuery2(elem).is(until)) {
break;
}
matched.push(elem);
}
}
return matched;
};
var siblings = function(n, elem) {
var matched = [];
for (; n; n = n.nextSibling) {
if (n.nodeType === 1 && n !== elem) {
matched.push(n);
}
}
return matched;
};
var rneedsContext = jQuery2.expr.match.needsContext;
function nodeName(elem, name) {
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
}
var rsingleTag = /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;
function winnow(elements, qualifier, not) {
if (isFunction2(qualifier)) {
return jQuery2.grep(elements, function(elem, i) {
return !!qualifier.call(elem, i, elem) !== not;
});
}
if (qualifier.nodeType) {
return jQuery2.grep(elements, function(elem) {
return elem === qualifier !== not;
});
}
if (typeof qualifier !== "string") {
return jQuery2.grep(elements, function(elem) {
return indexOf.call(qualifier, elem) > -1 !== not;
});
}
return jQuery2.filter(qualifier, elements, not);
}
jQuery2.filter = function(expr, elems, not) {
var elem = elems[0];
if (not) {
expr = ":not(" + expr + ")";
}
if (elems.length === 1 && elem.nodeType === 1) {
return jQuery2.find.matchesSelector(elem, expr) ? [elem] : [];
}
return jQuery2.find.matches(expr, jQuery2.grep(elems, function(elem2) {
return elem2.nodeType === 1;
}));
};
jQuery2.fn.extend({
find: function(selector) {
var i, ret, len = this.length, self2 = this;
if (typeof selector !== "string") {
return this.pushStack(jQuery2(selector).filter(function() {
for (i = 0; i < len; i++) {
if (jQuery2.contains(self2[i], this)) {
return true;
}
}
}));
}
ret = this.pushStack([]);
for (i = 0; i < len; i++) {
jQuery2.find(selector, self2[i], ret);
}
return len > 1 ? jQuery2.uniqueSort(ret) : ret;
},
filter: function(selector) {
return this.pushStack(winnow(this, selector || [], false));
},
not: function(selector) {
return this.pushStack(winnow(this, selector || [], true));
},
is: function(selector) {
return !!winnow(
this,
// If this is a positional/relative selector, check membership in the returned set
// so $("p:first").is("p:last") won't return true for a doc with two "p".
typeof selector === "string" && rneedsContext.test(selector) ? jQuery2(selector) : selector || [],
false
).length;
}
});
var rootjQuery, rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, init = jQuery2.fn.init = function(selector, context, root2) {
var match2, elem;
if (!selector) {
return this;
}
root2 = root2 || rootjQuery;
if (typeof selector === "string") {
if (selector[0] === "<" && selector[selector.length - 1] === ">" && selector.length >= 3) {
match2 = [null, selector, null];
} else {
match2 = rquickExpr.exec(selector);
}
if (match2 && (match2[1] || !context)) {
if (match2[1]) {
context = context instanceof jQuery2 ? context[0] : context;
jQuery2.merge(this, jQuery2.parseHTML(
match2[1],
context && context.nodeType ? context.ownerDocument || context : document2,
true
));
if (rsingleTag.test(match2[1]) && jQuery2.isPlainObject(context)) {
for (match2 in context) {
if (isFunction2(this[match2])) {
this[match2](context[match2]);
} else {
this.attr(match2, context[match2]);
}
}
}
return this;
} else {
elem = document2.getElementById(match2[2]);
if (elem) {
this[0] = elem;
this.length = 1;
}
return this;
}
} else if (!context || context.jquery) {
return (context || root2).find(selector);
} else {
return this.constructor(context).find(selector);
}
} else if (selector.nodeType) {
this[0] = selector;
this.length = 1;
return this;
} else if (isFunction2(selector)) {
return root2.ready !== void 0 ? root2.ready(selector) : (
// Execute immediately if ready is not present
selector(jQuery2)
);
}
return jQuery2.makeArray(selector, this);
};
init.prototype = jQuery2.fn;
rootjQuery = jQuery2(document2);
var rparentsprev = /^(?:parents|prev(?:Until|All))/, guaranteedUnique = {
children: true,
contents: true,
next: true,
prev: true
};
jQuery2.fn.extend({
has: function(target) {
var targets = jQuery2(target, this), l = targets.length;
return this.filter(function() {
var i = 0;
for (; i < l; i++) {
if (jQuery2.contains(this, targets[i])) {
return true;
}
}
});
},
closest: function(selectors, context) {
var cur, i = 0, l = this.length, matched = [], targets = typeof selectors !== "string" && jQuery2(selectors);
if (!rneedsContext.test(selectors)) {
for (; i < l; i++) {
for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
if (cur.nodeType < 11 && (targets ? targets.index(cur) > -1 : (
// Don't pass non-elements to Sizzle
cur.nodeType === 1 && jQuery2.find.matchesSelector(cur, selectors)
))) {
matched.push(cur);
break;
}
}
}
}
return this.pushStack(matched.length > 1 ? jQuery2.uniqueSort(matched) : matched);
},
// Determine the position of an element within the set
index: function(elem) {
if (!elem) {
return this[0] && this[0].parentNode ? this.first().prevAll().length : -1;
}
if (typeof elem === "string") {
return indexOf.call(jQuery2(elem), this[0]);
}
return indexOf.call(
this,
// If it receives a jQuery object, the first element is used
elem.jquery ? elem[0] : elem
);
},
add: function(selector, context) {
return this.pushStack(
jQuery2.uniqueSort(
jQuery2.merge(this.get(), jQuery2(selector, context))
)
);
},
addBack: function(selector) {
return this.add(
selector == null ? this.prevObject : this.prevObject.filter(selector)
);
}
});
function sibling(cur, dir2) {
while ((cur = cur[dir2]) && cur.nodeType !== 1) {
}
return cur;
}
jQuery2.each({
parent: function(elem) {
var parent = elem.parentNode;
return parent && parent.nodeType !== 11 ? parent : null;
},
parents: function(elem) {
return dir(elem, "parentNode");
},
parentsUntil: function(elem, _i, until) {
return dir(elem, "parentNode", until);
},
next: function(elem) {
return sibling(elem, "nextSibling");
},
prev: function(elem) {
return sibling(elem, "previousSibling");
},
nextAll: function(elem) {
return dir(elem, "nextSibling");
},
prevAll: function(elem) {
return dir(elem, "previousSibling");
},
nextUntil: function(elem, _i, until) {
return dir(elem, "nextSibling", until);
},
prevUntil: function(elem, _i, until) {
return dir(elem, "previousSibling", until);
},
siblings: function(elem) {
return siblings((elem.parentNode || {}).firstChild, elem);
},
children: function(elem) {
return siblings(elem.firstChild);
},
contents: function(elem) {
if (elem.contentDocument != null && // Support: IE 11+
// <object> elements with no `data` attribute has an object
// `contentDocument` with a `null` prototype.
getProto2(elem.contentDocument)) {
return elem.contentDocument;
}
if (nodeName(elem, "template")) {
elem = elem.content || elem;
}
return jQuery2.merge([], elem.childNodes);
}
}, function(name, fn2) {
jQuery2.fn[name] = function(until, selector) {
var matched = jQuery2.map(this, fn2, until);
if (name.slice(-5) !== "Until") {
selector = until;
}
if (selector && typeof selector === "string") {
matched = jQuery2.filter(selector, matched);
}
if (this.length > 1) {
if (!guaranteedUnique[name]) {
jQuery2.uniqueSort(matched);
}
if (rparentsprev.test(name)) {
matched.reverse();
}
}
return this.pushStack(matched);
};
});
var rnothtmlwhite = /[^\x20\t\r\n\f]+/g;
function createOptions(options) {
var object2 = {};
jQuery2.each(options.match(rnothtmlwhite) || [], function(_, flag) {
object2[flag] = true;
});
return object2;
}
jQuery2.Callbacks = function(options) {
options = typeof options === "string" ? createOptions(options) : jQuery2.extend({}, options);
var firing, memory, fired, locked, list = [], queue2 = [], firingIndex = -1, fire = function() {
locked = locked || options.once;
fired = firing = true;
for (; queue2.length; firingIndex = -1) {
memory = queue2.shift();
while (++firingIndex < list.length) {
if (list[firingIndex].apply(memory[0], memory[1]) === false && options.stopOnFalse) {
firingIndex = list.length;
memory = false;
}
}
}
if (!options.memory) {
memory = false;
}
firing = false;
if (locked) {
if (memory) {
list = [];
} else {
list = "";
}
}
}, self2 = {
// Add a callback or a collection of callbacks to the list
add: function() {
if (list) {
if (memory && !firing) {
firingIndex = list.length - 1;
queue2.push(memory);
}
(function add2(args) {
jQuery2.each(args, function(_, arg) {
if (isFunction2(arg)) {
if (!options.unique || !self2.has(arg)) {
list.push(arg);
}
} else if (arg && arg.length && toType(arg) !== "string") {
add2(arg);
}
});
})(arguments);
if (memory && !firing) {
fire();
}
}
return this;
},
// Remove a callback from the list
remove: function() {
jQuery2.each(arguments, function(_, arg) {
var index2;
while ((index2 = jQuery2.inArray(arg, list, index2)) > -1) {
list.splice(index2, 1);
if (index2 <= firingIndex) {
firingIndex--;
}
}
});
return this;
},
// Check if a given callback is in the list.
// If no argument is given, return whether or not list has callbacks attached.
has: function(fn2) {
return fn2 ? jQuery2.inArray(fn2, list) > -1 : list.length > 0;
},
// Remove all callbacks from the list
empty: function() {
if (list) {
list = [];
}
return this;
},
// Disable .fire and .add
// Abort any current/pending executions
// Clear all callbacks and values
disable: function() {
locked = queue2 = [];
list = memory = "";
return this;
},
disabled: function() {
return !list;
},
// Disable .fire
// Also disable .add unless we have memory (since it would have no effect)
// Abort any pending executions
lock: function() {
locked = queue2 = [];
if (!memory && !firing) {
list = memory = "";
}
return this;
},
locked: function() {
return !!locked;
},
// Call all callbacks with the given context and arguments
fireWith: function(context, args) {
if (!locked) {
args = args || [];
args = [context, args.slice ? args.slice() : args];
queue2.push(args);
if (!firing) {
fire();
}
}
return this;
},
// Call all the callbacks with the given arguments
fire: function() {
self2.fireWith(this, arguments);
return this;
},
// To know if the callbacks have already been called at least once
fired: function() {
return !!fired;
}
};
return self2;
};
function Identity(v) {
return v;
}
function Thrower(ex) {
throw ex;
}
function adoptValue(value, resolve2, reject, noValue) {
var method2;
try {
if (value && isFunction2(method2 = value.promise)) {
method2.call(value).done(resolve2).fail(reject);
} else if (value && isFunction2(method2 = value.then)) {
method2.call(value, resolve2, reject);
} else {
resolve2.apply(void 0, [value].slice(noValue));
}
} catch (value2) {
reject.apply(void 0, [value2]);
}
}
jQuery2.extend({
Deferred: function(func) {
var tuples = [
// action, add listener, callbacks,
// ... .then handlers, argument index, [final state]
[
"notify",
"progress",
jQuery2.Callbacks("memory"),
jQuery2.Callbacks("memory"),
2
],
[
"resolve",
"done",
jQuery2.Callbacks("once memory"),
jQuery2.Callbacks("once memory"),
0,
"resolved"
],
[
"reject",
"fail",
jQuery2.Callbacks("once memory"),
jQuery2.Callbacks("once memory"),
1,
"rejected"
]
], state = "pending", promise = {
state: function() {
return state;
},
always: function() {
deferred.done(arguments).fail(arguments);
return this;
},
"catch": function(fn2) {
return promise.then(null, fn2);
},
// Keep pipe for back-compat
pipe: function() {
var fns = arguments;
return jQuery2.Deferred(function(newDefer) {
jQuery2.each(tuples, function(_i, tuple) {
var fn2 = isFunction2(fns[tuple[4]]) && fns[tuple[4]];
deferred[tuple[1]](function() {
var returned = fn2 && fn2.apply(this, arguments);
if (returned && isFunction2(returned.promise)) {
returned.promise().progress(newDefer.notify).done(newDefer.resolve).fail(newDefer.reject);
} else {
newDefer[tuple[0] + "With"](
this,
fn2 ? [returned] : arguments
);
}
});
});
fns = null;
}).promise();
},
then: function(onFulfilled, onRejected, onProgress) {
var maxDepth = 0;
function resolve2(depth, deferred2, handler, special) {
return function() {
var that = this, args = arguments, mightThrow = function() {
var returned, then;
if (depth < maxDepth) {
return;
}
returned = handler.apply(that, args);
if (returned === deferred2.promise()) {
throw new TypeError("Thenable self-resolution");
}
then = returned && // Support: Promises/A+ section 2.3.4
// https://promisesaplus.com/#point-64
// Only check objects and functions for thenability
(typeof returned === "object" || typeof returned === "function") && returned.then;
if (isFunction2(then)) {
if (special) {
then.call(
returned,
resolve2(maxDepth, deferred2, Identity, special),
resolve2(maxDepth, deferred2, Thrower, special)
);
} else {
maxDepth++;
then.call(
returned,
resolve2(maxDepth, deferred2, Identity, special),
resolve2(maxDepth, deferred2, Thrower, special),
resolve2(
maxDepth,
deferred2,
Identity,
deferred2.notifyWith
)
);
}
} else {
if (handler !== Identity) {
that = void 0;
args = [returned];
}
(special || deferred2.resolveWith)(that, args);
}
}, process2 = special ? mightThrow : function() {
try {
mightThrow();
} catch (e) {
if (jQuery2.Deferred.exceptionHook) {
jQuery2.Deferred.exceptionHook(
e,
process2.stackTrace
);
}
if (depth + 1 >= maxDepth) {
if (handler !== Thrower) {
that = void 0;
args = [e];
}
deferred2.rejectWith(that, args);
}
}
};
if (depth) {
process2();
} else {
if (jQuery2.Deferred.getStackHook) {
process2.stackTrace = jQuery2.Deferred.getStackHook();
}
window2.setTimeout(process2);
}
};
}
return jQuery2.Deferred(function(newDefer) {
tuples[0][3].add(
resolve2(
0,
newDefer,
isFunction2(onProgress) ? onProgress : Identity,
newDefer.notifyWith
)
);
tuples[1][3].add(
resolve2(
0,
newDefer,
isFunction2(onFulfilled) ? onFulfilled : Identity
)
);
tuples[2][3].add(
resolve2(
0,
newDefer,
isFunction2(onRejected) ? onRejected : Thrower
)
);
}).promise();
},
// Get a promise for this deferred
// If obj is provided, the promise aspect is added to the object
promise: function(obj) {
return obj != null ? jQuery2.extend(obj, promise) : promise;
}
}, deferred = {};
jQuery2.each(tuples, function(i, tuple) {
var list = tuple[2], stateString = tuple[5];
promise[tuple[1]] = list.add;
if (stateString) {
list.add(
function() {
state = stateString;
},
// rejected_callbacks.disable
// fulfilled_callbacks.disable
tuples[3 - i][2].disable,
// rejected_handlers.disable
// fulfilled_handlers.disable
tuples[3 - i][3].disable,
// progress_callbacks.lock
tuples[0][2].lock,
// progress_handlers.lock
tuples[0][3].lock
);
}
list.add(tuple[3].fire);
deferred[tuple[0]] = function() {
deferred[tuple[0] + "With"](this === deferred ? void 0 : this, arguments);
return this;
};
deferred[tuple[0] + "With"] = list.fireWith;
});
promise.promise(deferred);
if (func) {
func.call(deferred, deferred);
}
return deferred;
},
// Deferred helper
when: function(singleValue) {
var remaining = arguments.length, i = remaining, resolveContexts = Array(i), resolveValues = slice.call(arguments), primary = jQuery2.Deferred(), updateFunc = function(i2) {
return function(value) {
resolveContexts[i2] = this;
resolveValues[i2] = arguments.length > 1 ? slice.call(arguments) : value;
if (!--remaining) {
primary.resolveWith(resolveContexts, resolveValues);
}
};
};
if (remaining <= 1) {
adoptValue(
singleValue,
primary.done(updateFunc(i)).resolve,
primary.reject,
!remaining
);
if (primary.state() === "pending" || isFunction2(resolveValues[i] && resolveValues[i].then)) {
return primary.then();
}
}
while (i--) {
adoptValue(resolveValues[i], updateFunc(i), primary.reject);
}
return primary.promise();
}
});
var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
jQuery2.Deferred.exceptionHook = function(error, stack) {
if (window2.console && window2.console.warn && error && rerrorNames.test(error.name)) {
window2.console.warn("jQuery.Deferred exception: " + error.message, error.stack, stack);
}
};
jQuery2.readyException = function(error) {
window2.setTimeout(function() {
throw error;
});
};
var readyList = jQuery2.Deferred();
jQuery2.fn.ready = function(fn2) {
readyList.then(fn2).catch(function(error) {
jQuery2.readyException(error);
});
return this;
};
jQuery2.extend({
// Is the DOM ready to be used? Set to true once it occurs.
isReady: false,
// A counter to track how many items to wait for before
// the ready event fires. See trac-6781
readyWait: 1,
// Handle when the DOM is ready
ready: function(wait) {
if (wait === true ? --jQuery2.readyWait : jQuery2.isReady) {
return;
}
jQuery2.isReady = true;
if (wait !== true && --jQuery2.readyWait > 0) {
return;
}
readyList.resolveWith(document2, [jQuery2]);
}
});
jQuery2.ready.then = readyList.then;
function completed() {
document2.removeEventListener("DOMContentLoaded", completed);
window2.removeEventListener("load", completed);
jQuery2.ready();
}
if (document2.readyState === "complete" || document2.readyState !== "loading" && !document2.documentElement.doScroll) {
window2.setTimeout(jQuery2.ready);
} else {
document2.addEventListener("DOMContentLoaded", completed);
window2.addEventListener("load", completed);
}
var access = function(elems, fn2, key, value, chainable, emptyGet, raw) {
var i = 0, len = elems.length, bulk = key == null;
if (toType(key) === "object") {
chainable = true;
for (i in key) {
access(elems, fn2, i, key[i], true, emptyGet, raw);
}
} else if (value !== void 0) {
chainable = true;
if (!isFunction2(value)) {
raw = true;
}
if (bulk) {
if (raw) {
fn2.call(elems, value);
fn2 = null;
} else {
bulk = fn2;
fn2 = function(elem, _key, value2) {
return bulk.call(jQuery2(elem), value2);
};
}
}
if (fn2) {
for (; i < len; i++) {
fn2(
elems[i],
key,
raw ? value : value.call(elems[i], i, fn2(elems[i], key))
);
}
}
}
if (chainable) {
return elems;
}
if (bulk) {
return fn2.call(elems);
}
return len ? fn2(elems[0], key) : emptyGet;
};
var rmsPrefix = /^-ms-/, rdashAlpha = /-([a-z])/g;
function fcamelCase(_all, letter) {
return letter.toUpperCase();
}
function camelCase2(string2) {
return string2.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
}
var acceptData = function(owner) {
return owner.nodeType === 1 || owner.nodeType === 9 || !+owner.nodeType;
};
function Data() {
this.expando = jQuery2.expando + Data.uid++;
}
Data.uid = 1;
Data.prototype = {
cache: function(owner) {
var value = owner[this.expando];
if (!value) {
value = {};
if (acceptData(owner)) {
if (owner.nodeType) {
owner[this.expando] = value;
} else {
Object.defineProperty(owner, this.expando, {
value,
configurable: true
});
}
}
}
return value;
},
set: function(owner, data, value) {
var prop, cache2 = this.cache(owner);
if (typeof data === "string") {
cache2[camelCase2(data)] = value;
} else {
for (prop in data) {
cache2[camelCase2(prop)] = data[prop];
}
}
return cache2;
},
get: function(owner, key) {
return key === void 0 ? this.cache(owner) : (
// Always use camelCase key (gh-2257)
owner[this.expando] && owner[this.expando][camelCase2(key)]
);
},
access: function(owner, key, value) {
if (key === void 0 || key && typeof key === "string" && value === void 0) {
return this.get(owner, key);
}
this.set(owner, key, value);
return value !== void 0 ? value : key;
},
remove: function(owner, key) {
var i, cache2 = owner[this.expando];
if (cache2 === void 0) {
return;
}
if (key !== void 0) {
if (Array.isArray(key)) {
key = key.map(camelCase2);
} else {
key = camelCase2(key);
key = key in cache2 ? [key] : key.match(rnothtmlwhite) || [];
}
i = key.length;
while (i--) {
delete cache2[key[i]];
}
}
if (key === void 0 || jQuery2.isEmptyObject(cache2)) {
if (owner.nodeType) {
owner[this.expando] = void 0;
} else {
delete owner[this.expando];
}
}
},
hasData: function(owner) {
var cache2 = owner[this.expando];
return cache2 !== void 0 && !jQuery2.isEmptyObject(cache2);
}
};
var dataPriv = new Data();
var dataUser = new Data();
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, rmultiDash = /[A-Z]/g;
function getData(data) {
if (data === "true") {
return true;
}
if (data === "false") {
return false;
}
if (data === "null") {
return null;
}
if (data === +data + "") {
return +data;
}
if (rbrace.test(data)) {
return JSON.parse(data);
}
return data;
}
function dataAttr(elem, key, data) {
var name;
if (data === void 0 && elem.nodeType === 1) {
name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase();
data = elem.getAttribute(name);
if (typeof data === "string") {
try {
data = getData(data);
} catch (e) {
}
dataUser.set(elem, key, data);
} else {
data = void 0;
}
}
return data;
}
jQuery2.extend({
hasData: function(elem) {
return dataUser.hasData(elem) || dataPriv.hasData(elem);
},
data: function(elem, name, data) {
return dataUser.access(elem, name, data);
},
removeData: function(elem, name) {
dataUser.remove(elem, name);
},
// TODO: Now that all calls to _data and _removeData have been replaced
// with direct calls to dataPriv methods, these can be deprecated.
_data: function(elem, name, data) {
return dataPriv.access(elem, name, data);
},
_removeData: function(elem, name) {
dataPriv.remove(elem, name);
}
});
jQuery2.fn.extend({
data: function(key, value) {
var i, name, data, elem = this[0], attrs = elem && elem.attributes;
if (key === void 0) {
if (this.length) {
data = dataUser.get(elem);
if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) {
i = attrs.length;
while (i--) {
if (attrs[i]) {
name = attrs[i].name;
if (name.indexOf("data-") === 0) {
name = camelCase2(name.slice(5));
dataAttr(elem, name, data[name]);
}
}
}
dataPriv.set(elem, "hasDataAttrs", true);
}
}
return data;
}
if (typeof key === "object") {
return this.each(function() {
dataUser.set(this, key);
});
}
return access(this, function(value2) {
var data2;
if (elem && value2 === void 0) {
data2 = dataUser.get(elem, key);
if (data2 !== void 0) {
return data2;
}
data2 = dataAttr(elem, key);
if (data2 !== void 0) {
return data2;
}
return;
}
this.each(function() {
dataUser.set(this, key, value2);
});
}, null, value, arguments.length > 1, null, true);
},
removeData: function(key) {
return this.each(function() {
dataUser.remove(this, key);
});
}
});
jQuery2.extend({
queue: function(elem, type2, data) {
var queue2;
if (elem) {
type2 = (type2 || "fx") + "queue";
queue2 = dataPriv.get(elem, type2);
if (data) {
if (!queue2 || Array.isArray(data)) {
queue2 = dataPriv.access(elem, type2, jQuery2.makeArray(data));
} else {
queue2.push(data);
}
}
return queue2 || [];
}
},
dequeue: function(elem, type2) {
type2 = type2 || "fx";
var queue2 = jQuery2.queue(elem, type2), startLength = queue2.length, fn2 = queue2.shift(), hooks = jQuery2._queueHooks(elem, type2), next = function() {
jQuery2.dequeue(elem, type2);
};
if (fn2 === "inprogress") {
fn2 = queue2.shift();
startLength--;
}
if (fn2) {
if (type2 === "fx") {
queue2.unshift("inprogress");
}
delete hooks.stop;
fn2.call(elem, next, hooks);
}
if (!startLength && hooks) {
hooks.empty.fire();
}
},
// Not public - generate a queueHooks object, or return the current one
_queueHooks: function(elem, type2) {
var key = type2 + "queueHooks";
return dataPriv.get(elem, key) || dataPriv.access(elem, key, {
empty: jQuery2.Callbacks("once memory").add(function() {
dataPriv.remove(elem, [type2 + "queue", key]);
})
});
}
});
jQuery2.fn.extend({
queue: function(type2, data) {
var setter = 2;
if (typeof type2 !== "string") {
data = type2;
type2 = "fx";
setter--;
}
if (arguments.length < setter) {
return jQuery2.queue(this[0], type2);
}
return data === void 0 ? this : this.each(function() {
var queue2 = jQuery2.queue(this, type2, data);
jQuery2._queueHooks(this, type2);
if (type2 === "fx" && queue2[0] !== "inprogress") {
jQuery2.dequeue(this, type2);
}
});
},
dequeue: function(type2) {
return this.each(function() {
jQuery2.dequeue(this, type2);
});
},
clearQueue: function(type2) {
return this.queue(type2 || "fx", []);
},
// Get a promise resolved when queues of a certain type
// are emptied (fx is the type by default)
promise: function(type2, obj) {
var tmp, count = 1, defer = jQuery2.Deferred(), elements = this, i = this.length, resolve2 = function() {
if (!--count) {
defer.resolveWith(elements, [elements]);
}
};
if (typeof type2 !== "string") {
obj = type2;
type2 = void 0;
}
type2 = type2 || "fx";
while (i--) {
tmp = dataPriv.get(elements[i], type2 + "queueHooks");
if (tmp && tmp.empty) {
count++;
tmp.empty.add(resolve2);
}
}
resolve2();
return defer.promise(obj);
}
});
var pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source;
var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i");
var cssExpand = ["Top", "Right", "Bottom", "Left"];
var documentElement = document2.documentElement;
var isAttached = function(elem) {
return jQuery2.contains(elem.ownerDocument, elem);
}, composed = { composed: true };
if (documentElement.getRootNode) {
isAttached = function(elem) {
return jQuery2.contains(elem.ownerDocument, elem) || elem.getRootNode(composed) === elem.ownerDocument;
};
}
var isHiddenWithinTree = function(elem, el) {
elem = el || elem;
return elem.style.display === "none" || elem.style.display === "" && // Otherwise, check computed style
// Support: Firefox <=43 - 45
// Disconnected elements can have computed display: none, so first confirm that elem is
// in the document.
isAttached(elem) && jQuery2.css(elem, "display") === "none";
};
function adjustCSS(elem, prop, valueParts, tween) {
var adjusted, scale, maxIterations = 20, currentValue = tween ? function() {
return tween.cur();
} : function() {
return jQuery2.css(elem, prop, "");
}, initial = currentValue(), unit = valueParts && valueParts[3] || (jQuery2.cssNumber[prop] ? "" : "px"), initialInUnit = elem.nodeType && (jQuery2.cssNumber[prop] || unit !== "px" && +initial) && rcssNum.exec(jQuery2.css(elem, prop));
if (initialInUnit && initialInUnit[3] !== unit) {
initial = initial / 2;
unit = unit || initialInUnit[3];
initialInUnit = +initial || 1;
while (maxIterations--) {
jQuery2.style(elem, prop, initialInUnit + unit);
if ((1 - scale) * (1 - (scale = currentValue() / initial || 0.5)) <= 0) {
maxIterations = 0;
}
initialInUnit = initialInUnit / scale;
}
initialInUnit = initialInUnit * 2;
jQuery2.style(elem, prop, initialInUnit + unit);
valueParts = valueParts || [];
}
if (valueParts) {
initialInUnit = +initialInUnit || +initial || 0;
adjusted = valueParts[1] ? initialInUnit + (valueParts[1] + 1) * valueParts[2] : +valueParts[2];
if (tween) {
tween.unit = unit;
tween.start = initialInUnit;
tween.end = adjusted;
}
}
return adjusted;
}
var defaultDisplayMap = {};
function getDefaultDisplay(elem) {
var temp, doc2 = elem.ownerDocument, nodeName2 = elem.nodeName, display = defaultDisplayMap[nodeName2];
if (display) {
return display;
}
temp = doc2.body.appendChild(doc2.createElement(nodeName2));
display = jQuery2.css(temp, "display");
temp.parentNode.removeChild(temp);
if (display === "none") {
display = "block";
}
defaultDisplayMap[nodeName2] = display;
return display;
}
function showHide(elements, show) {
var display, elem, values2 = [], index2 = 0, length = elements.length;
for (; index2 < length; index2++) {
elem = elements[index2];
if (!elem.style) {
continue;
}
display = elem.style.display;
if (show) {
if (display === "none") {
values2[index2] = dataPriv.get(elem, "display") || null;
if (!values2[index2]) {
elem.style.display = "";
}
}
if (elem.style.display === "" && isHiddenWithinTree(elem)) {
values2[index2] = getDefaultDisplay(elem);
}
} else {
if (display !== "none") {
values2[index2] = "none";
dataPriv.set(elem, "display", display);
}
}
}
for (index2 = 0; index2 < length; index2++) {
if (values2[index2] != null) {
elements[index2].style.display = values2[index2];
}
}
return elements;
}
jQuery2.fn.extend({
show: function() {
return showHide(this, true);
},
hide: function() {
return showHide(this);
},
toggle: function(state) {
if (typeof state === "boolean") {
return state ? this.show() : this.hide();
}
return this.each(function() {
if (isHiddenWithinTree(this)) {
jQuery2(this).show();
} else {
jQuery2(this).hide();
}
});
}
});
var rcheckableType = /^(?:checkbox|radio)$/i;
var rtagName = /<([a-z][^\/\0>\x20\t\r\n\f]*)/i;
var rscriptType = /^$|^module$|\/(?:java|ecma)script/i;
(function() {
var fragment = document2.createDocumentFragment(), div = fragment.appendChild(document2.createElement("div")), input = document2.createElement("input");
input.setAttribute("type", "radio");
input.setAttribute("checked", "checked");
input.setAttribute("name", "t");
div.appendChild(input);
support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
div.innerHTML = "<textarea>x</textarea>";
support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue;
div.innerHTML = "<option></option>";
support.option = !!div.lastChild;
})();
var wrapMap = {
// XHTML parsers do not magically insert elements in the
// same way that tag soup parsers do. So we cannot shorten
// this by omitting <tbody> or other required elements.
thead: [1, "<table>", "</table>"],
col: [2, "<table><colgroup>", "</colgroup></table>"],
tr: [2, "<table><tbody>", "</tbody></table>"],
td: [3, "<table><tbody><tr>", "</tr></tbody></table>"],
_default: [0, "", ""]
};
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
wrapMap.th = wrapMap.td;
if (!support.option) {
wrapMap.optgroup = wrapMap.option = [1, "<select multiple='multiple'>", "</select>"];
}
function getAll(context, tag) {
var ret;
if (typeof context.getElementsByTagName !== "undefined") {
ret = context.getElementsByTagName(tag || "*");
} else if (typeof context.querySelectorAll !== "undefined") {
ret = context.querySelectorAll(tag || "*");
} else {
ret = [];
}
if (tag === void 0 || tag && nodeName(context, tag)) {
return jQuery2.merge([context], ret);
}
return ret;
}
function setGlobalEval(elems, refElements) {
var i = 0, l = elems.length;
for (; i < l; i++) {
dataPriv.set(
elems[i],
"globalEval",
!refElements || dataPriv.get(refElements[i], "globalEval")
);
}
}
var rhtml = /<|&#?\w+;/;
function buildFragment(elems, context, scripts, selection, ignored) {
var elem, tmp, tag, wrap2, attached, j, fragment = context.createDocumentFragment(), nodes = [], i = 0, l = elems.length;
for (; i < l; i++) {
elem = elems[i];
if (elem || elem === 0) {
if (toType(elem) === "object") {
jQuery2.merge(nodes, elem.nodeType ? [elem] : elem);
} else if (!rhtml.test(elem)) {
nodes.push(context.createTextNode(elem));
} else {
tmp = tmp || fragment.appendChild(context.createElement("div"));
tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
wrap2 = wrapMap[tag] || wrapMap._default;
tmp.innerHTML = wrap2[1] + jQuery2.htmlPrefilter(elem) + wrap2[2];
j = wrap2[0];
while (j--) {
tmp = tmp.lastChild;
}
jQuery2.merge(nodes, tmp.childNodes);
tmp = fragment.firstChild;
tmp.textContent = "";
}
}
}
fragment.textContent = "";
i = 0;
while (elem = nodes[i++]) {
if (selection && jQuery2.inArray(elem, selection) > -1) {
if (ignored) {
ignored.push(elem);
}
continue;
}
attached = isAttached(elem);
tmp = getAll(fragment.appendChild(elem), "script");
if (attached) {
setGlobalEval(tmp);
}
if (scripts) {
j = 0;
while (elem = tmp[j++]) {
if (rscriptType.test(elem.type || "")) {
scripts.push(elem);
}
}
}
}
return fragment;
}
var rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
function returnTrue() {
return true;
}
function returnFalse() {
return false;
}
function expectSync(elem, type2) {
return elem === safeActiveElement() === (type2 === "focus");
}
function safeActiveElement() {
try {
return document2.activeElement;
} catch (err) {
}
}
function on2(elem, types2, selector, data, fn2, one) {
var origFn, type2;
if (typeof types2 === "object") {
if (typeof selector !== "string") {
data = data || selector;
selector = void 0;
}
for (type2 in types2) {
on2(elem, type2, selector, data, types2[type2], one);
}
return elem;
}
if (data == null && fn2 == null) {
fn2 = selector;
data = selector = void 0;
} else if (fn2 == null) {
if (typeof selector === "string") {
fn2 = data;
data = void 0;
} else {
fn2 = data;
data = selector;
selector = void 0;
}
}
if (fn2 === false) {
fn2 = returnFalse;
} else if (!fn2) {
return elem;
}
if (one === 1) {
origFn = fn2;
fn2 = function(event) {
jQuery2().off(event);
return origFn.apply(this, arguments);
};
fn2.guid = origFn.guid || (origFn.guid = jQuery2.guid++);
}
return elem.each(function() {
jQuery2.event.add(this, types2, fn2, data, selector);
});
}
jQuery2.event = {
global: {},
add: function(elem, types2, handler, data, selector) {
var handleObjIn, eventHandle, tmp, events, t2, handleObj, special, handlers2, type2, namespaces, origType, elemData = dataPriv.get(elem);
if (!acceptData(elem)) {
return;
}
if (handler.handler) {
handleObjIn = handler;
handler = handleObjIn.handler;
selector = handleObjIn.selector;
}
if (selector) {
jQuery2.find.matchesSelector(documentElement, selector);
}
if (!handler.guid) {
handler.guid = jQuery2.guid++;
}
if (!(events = elemData.events)) {
events = elemData.events = /* @__PURE__ */ Object.create(null);
}
if (!(eventHandle = elemData.handle)) {
eventHandle = elemData.handle = function(e) {
return typeof jQuery2 !== "undefined" && jQuery2.event.triggered !== e.type ? jQuery2.event.dispatch.apply(elem, arguments) : void 0;
};
}
types2 = (types2 || "").match(rnothtmlwhite) || [""];
t2 = types2.length;
while (t2--) {
tmp = rtypenamespace.exec(types2[t2]) || [];
type2 = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
if (!type2) {
continue;
}
special = jQuery2.event.special[type2] || {};
type2 = (selector ? special.delegateType : special.bindType) || type2;
special = jQuery2.event.special[type2] || {};
handleObj = jQuery2.extend({
type: type2,
origType,
data,
handler,
guid: handler.guid,
selector,
needsContext: selector && jQuery2.expr.match.needsContext.test(selector),
namespace: namespaces.join(".")
}, handleObjIn);
if (!(handlers2 = events[type2])) {
handlers2 = events[type2] = [];
handlers2.delegateCount = 0;
if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
if (elem.addEventListener) {
elem.addEventListener(type2, eventHandle);
}
}
}
if (special.add) {
special.add.call(elem, handleObj);
if (!handleObj.handler.guid) {
handleObj.handler.guid = handler.guid;
}
}
if (selector) {
handlers2.splice(handlers2.delegateCount++, 0, handleObj);
} else {
handlers2.push(handleObj);
}
jQuery2.event.global[type2] = true;
}
},
// Detach an event or set of events from an element
remove: function(elem, types2, handler, selector, mappedTypes) {
var j, origCount, tmp, events, t2, handleObj, special, handlers2, type2, namespaces, origType, elemData = dataPriv.hasData(elem) && dataPriv.get(elem);
if (!elemData || !(events = elemData.events)) {
return;
}
types2 = (types2 || "").match(rnothtmlwhite) || [""];
t2 = types2.length;
while (t2--) {
tmp = rtypenamespace.exec(types2[t2]) || [];
type2 = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
if (!type2) {
for (type2 in events) {
jQuery2.event.remove(elem, type2 + types2[t2], handler, selector, true);
}
continue;
}
special = jQuery2.event.special[type2] || {};
type2 = (selector ? special.delegateType : special.bindType) || type2;
handlers2 = events[type2] || [];
tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
origCount = j = handlers2.length;
while (j--) {
handleObj = handlers2[j];
if ((mappedTypes || origType === handleObj.origType) && (!handler || handler.guid === handleObj.guid) && (!tmp || tmp.test(handleObj.namespace)) && (!selector || selector === handleObj.selector || selector === "**" && handleObj.selector)) {
handlers2.splice(j, 1);
if (handleObj.selector) {
handlers2.delegateCount--;
}
if (special.remove) {
special.remove.call(elem, handleObj);
}
}
}
if (origCount && !handlers2.length) {
if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
jQuery2.removeEvent(elem, type2, elemData.handle);
}
delete events[type2];
}
}
if (jQuery2.isEmptyObject(events)) {
dataPriv.remove(elem, "handle events");
}
},
dispatch: function(nativeEvent) {
var i, j, ret, matched, handleObj, handlerQueue, args = new Array(arguments.length), event = jQuery2.event.fix(nativeEvent), handlers2 = (dataPriv.get(this, "events") || /* @__PURE__ */ Object.create(null))[event.type] || [], special = jQuery2.event.special[event.type] || {};
args[0] = event;
for (i = 1; i < arguments.length; i++) {
args[i] = arguments[i];
}
event.delegateTarget = this;
if (special.preDispatch && special.preDispatch.call(this, event) === false) {
return;
}
handlerQueue = jQuery2.event.handlers.call(this, event, handlers2);
i = 0;
while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
event.currentTarget = matched.elem;
j = 0;
while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {
if (!event.rnamespace || handleObj.namespace === false || event.rnamespace.test(handleObj.namespace)) {
event.handleObj = handleObj;
event.data = handleObj.data;
ret = ((jQuery2.event.special[handleObj.origType] || {}).handle || handleObj.handler).apply(matched.elem, args);
if (ret !== void 0) {
if ((event.result = ret) === false) {
event.preventDefault();
event.stopPropagation();
}
}
}
}
}
if (special.postDispatch) {
special.postDispatch.call(this, event);
}
return event.result;
},
handlers: function(event, handlers2) {
var i, handleObj, sel, matchedHandlers, matchedSelectors, handlerQueue = [], delegateCount = handlers2.delegateCount, cur = event.target;
if (delegateCount && // Support: IE <=9
// Black-hole SVG <use> instance trees (trac-13180)
cur.nodeType && // Support: Firefox <=42
// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
// Support: IE 11 only
// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
!(event.type === "click" && event.button >= 1)) {
for (; cur !== this; cur = cur.parentNode || this) {
if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) {
matchedHandlers = [];
matchedSelectors = {};
for (i = 0; i < delegateCount; i++) {
handleObj = handlers2[i];
sel = handleObj.selector + " ";
if (matchedSelectors[sel] === void 0) {
matchedSelectors[sel] = handleObj.needsContext ? jQuery2(sel, this).index(cur) > -1 : jQuery2.find(sel, this, null, [cur]).length;
}
if (matchedSelectors[sel]) {
matchedHandlers.push(handleObj);
}
}
if (matchedHandlers.length) {
handlerQueue.push({ elem: cur, handlers: matchedHandlers });
}
}
}
}
cur = this;
if (delegateCount < handlers2.length) {
handlerQueue.push({ elem: cur, handlers: handlers2.slice(delegateCount) });
}
return handlerQueue;
},
addProp: function(name, hook) {
Object.defineProperty(jQuery2.Event.prototype, name, {
enumerable: true,
configurable: true,
get: isFunction2(hook) ? function() {
if (this.originalEvent) {
return hook(this.originalEvent);
}
} : function() {
if (this.originalEvent) {
return this.originalEvent[name];
}
},
set: function(value) {
Object.defineProperty(this, name, {
enumerable: true,
configurable: true,
writable: true,
value
});
}
});
},
fix: function(originalEvent) {
return originalEvent[jQuery2.expando] ? originalEvent : new jQuery2.Event(originalEvent);
},
special: {
load: {
// Prevent triggered image.load events from bubbling to window.load
noBubble: true
},
click: {
// Utilize native event to ensure correct state for checkable inputs
setup: function(data) {
var el = this || data;
if (rcheckableType.test(el.type) && el.click && nodeName(el, "input")) {
leverageNative(el, "click", returnTrue);
}
return false;
},
trigger: function(data) {
var el = this || data;
if (rcheckableType.test(el.type) && el.click && nodeName(el, "input")) {
leverageNative(el, "click");
}
return true;
},
// For cross-browser consistency, suppress native .click() on links
// Also prevent it if we're currently inside a leveraged native-event stack
_default: function(event) {
var target = event.target;
return rcheckableType.test(target.type) && target.click && nodeName(target, "input") && dataPriv.get(target, "click") || nodeName(target, "a");
}
},
beforeunload: {
postDispatch: function(event) {
if (event.result !== void 0 && event.originalEvent) {
event.originalEvent.returnValue = event.result;
}
}
}
}
};
function leverageNative(el, type2, expectSync2) {
if (!expectSync2) {
if (dataPriv.get(el, type2) === void 0) {
jQuery2.event.add(el, type2, returnTrue);
}
return;
}
dataPriv.set(el, type2, false);
jQuery2.event.add(el, type2, {
namespace: false,
handler: function(event) {
var notAsync, result, saved = dataPriv.get(this, type2);
if (event.isTrigger & 1 && this[type2]) {
if (!saved.length) {
saved = slice.call(arguments);
dataPriv.set(this, type2, saved);
notAsync = expectSync2(this, type2);
this[type2]();
result = dataPriv.get(this, type2);
if (saved !== result || notAsync) {
dataPriv.set(this, type2, false);
} else {
result = {};
}
if (saved !== result) {
event.stopImmediatePropagation();
event.preventDefault();
return result && result.value;
}
} else if ((jQuery2.event.special[type2] || {}).delegateType) {
event.stopPropagation();
}
} else if (saved.length) {
dataPriv.set(this, type2, {
value: jQuery2.event.trigger(
// Support: IE <=9 - 11+
// Extend with the prototype to reset the above stopImmediatePropagation()
jQuery2.extend(saved[0], jQuery2.Event.prototype),
saved.slice(1),
this
)
});
event.stopImmediatePropagation();
}
}
});
}
jQuery2.removeEvent = function(elem, type2, handle) {
if (elem.removeEventListener) {
elem.removeEventListener(type2, handle);
}
};
jQuery2.Event = function(src, props) {
if (!(this instanceof jQuery2.Event)) {
return new jQuery2.Event(src, props);
}
if (src && src.type) {
this.originalEvent = src;
this.type = src.type;
this.isDefaultPrevented = src.defaultPrevented || src.defaultPrevented === void 0 && // Support: Android <=2.3 only
src.returnValue === false ? returnTrue : returnFalse;
this.target = src.target && src.target.nodeType === 3 ? src.target.parentNode : src.target;
this.currentTarget = src.currentTarget;
this.relatedTarget = src.relatedTarget;
} else {
this.type = src;
}
if (props) {
jQuery2.extend(this, props);
}
this.timeStamp = src && src.timeStamp || Date.now();
this[jQuery2.expando] = true;
};
jQuery2.Event.prototype = {
constructor: jQuery2.Event,
isDefaultPrevented: returnFalse,
isPropagationStopped: returnFalse,
isImmediatePropagationStopped: returnFalse,
isSimulated: false,
preventDefault: function() {
var e = this.originalEvent;
this.isDefaultPrevented = returnTrue;
if (e && !this.isSimulated) {
e.preventDefault();
}
},
stopPropagation: function() {
var e = this.originalEvent;
this.isPropagationStopped = returnTrue;
if (e && !this.isSimulated) {
e.stopPropagation();
}
},
stopImmediatePropagation: function() {
var e = this.originalEvent;
this.isImmediatePropagationStopped = returnTrue;
if (e && !this.isSimulated) {
e.stopImmediatePropagation();
}
this.stopPropagation();
}
};
jQuery2.each({
altKey: true,
bubbles: true,
cancelable: true,
changedTouches: true,
ctrlKey: true,
detail: true,
eventPhase: true,
metaKey: true,
pageX: true,
pageY: true,
shiftKey: true,
view: true,
"char": true,
code: true,
charCode: true,
key: true,
keyCode: true,
button: true,
buttons: true,
clientX: true,
clientY: true,
offsetX: true,
offsetY: true,
pointerId: true,
pointerType: true,
screenX: true,
screenY: true,
targetTouches: true,
toElement: true,
touches: true,
which: true
}, jQuery2.event.addProp);
jQuery2.each({ focus: "focusin", blur: "focusout" }, function(type2, delegateType) {
jQuery2.event.special[type2] = {
// Utilize native event if possible so blur/focus sequence is correct
setup: function() {
leverageNative(this, type2, expectSync);
return false;
},
trigger: function() {
leverageNative(this, type2);
return true;
},
// Suppress native focus or blur if we're currently inside
// a leveraged native-event stack
_default: function(event) {
return dataPriv.get(event.target, type2);
},
delegateType
};
});
jQuery2.each({
mouseenter: "mouseover",
mouseleave: "mouseout",
pointerenter: "pointerover",
pointerleave: "pointerout"
}, function(orig, fix) {
jQuery2.event.special[orig] = {
delegateType: fix,
bindType: fix,
handle: function(event) {
var ret, target = this, related = event.relatedTarget, handleObj = event.handleObj;
if (!related || related !== target && !jQuery2.contains(target, related)) {
event.type = handleObj.origType;
ret = handleObj.handler.apply(this, arguments);
event.type = fix;
}
return ret;
}
};
});
jQuery2.fn.extend({
on: function(types2, selector, data, fn2) {
return on2(this, types2, selector, data, fn2);
},
one: function(types2, selector, data, fn2) {
return on2(this, types2, selector, data, fn2, 1);
},
off: function(types2, selector, fn2) {
var handleObj, type2;
if (types2 && types2.preventDefault && types2.handleObj) {
handleObj = types2.handleObj;
jQuery2(types2.delegateTarget).off(
handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
handleObj.selector,
handleObj.handler
);
return this;
}
if (typeof types2 === "object") {
for (type2 in types2) {
this.off(type2, selector, types2[type2]);
}
return this;
}
if (selector === false || typeof selector === "function") {
fn2 = selector;
selector = void 0;
}
if (fn2 === false) {
fn2 = returnFalse;
}
return this.each(function() {
jQuery2.event.remove(this, types2, fn2, selector);
});
}
});
var rnoInnerhtml = /<script|<style|<link/i, rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, rcleanScript = /^\s*<!\[CDATA\[|\]\]>\s*$/g;
function manipulationTarget(elem, content) {
if (nodeName(elem, "table") && nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) {
return jQuery2(elem).children("tbody")[0] || elem;
}
return elem;
}
function disableScript(elem) {
elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type;
return elem;
}
function restoreScript(elem) {
if ((elem.type || "").slice(0, 5) === "true/") {
elem.type = elem.type.slice(5);
} else {
elem.removeAttribute("type");
}
return elem;
}
function cloneCopyEvent(src, dest) {
var i, l, type2, pdataOld, udataOld, udataCur, events;
if (dest.nodeType !== 1) {
return;
}
if (dataPriv.hasData(src)) {
pdataOld = dataPriv.get(src);
events = pdataOld.events;
if (events) {
dataPriv.remove(dest, "handle events");
for (type2 in events) {
for (i = 0, l = events[type2].length; i < l; i++) {
jQuery2.event.add(dest, type2, events[type2][i]);
}
}
}
}
if (dataUser.hasData(src)) {
udataOld = dataUser.access(src);
udataCur = jQuery2.extend({}, udataOld);
dataUser.set(dest, udataCur);
}
}
function fixInput(src, dest) {
var nodeName2 = dest.nodeName.toLowerCase();
if (nodeName2 === "input" && rcheckableType.test(src.type)) {
dest.checked = src.checked;
} else if (nodeName2 === "input" || nodeName2 === "textarea") {
dest.defaultValue = src.defaultValue;
}
}
function domManip(collection, args, callback, ignored) {
args = flat(args);
var fragment, first, scripts, hasScripts, node, doc2, i = 0, l = collection.length, iNoClone = l - 1, value = args[0], valueIsFunction = isFunction2(value);
if (valueIsFunction || l > 1 && typeof value === "string" && !support.checkClone && rchecked.test(value)) {
return collection.each(function(index2) {
var self2 = collection.eq(index2);
if (valueIsFunction) {
args[0] = value.call(this, index2, self2.html());
}
domManip(self2, args, callback, ignored);
});
}
if (l) {
fragment = buildFragment(args, collection[0].ownerDocument, false, collection, ignored);
first = fragment.firstChild;
if (fragment.childNodes.length === 1) {
fragment = first;
}
if (first || ignored) {
scripts = jQuery2.map(getAll(fragment, "script"), disableScript);
hasScripts = scripts.length;
for (; i < l; i++) {
node = fragment;
if (i !== iNoClone) {
node = jQuery2.clone(node, true, true);
if (hasScripts) {
jQuery2.merge(scripts, getAll(node, "script"));
}
}
callback.call(collection[i], node, i);
}
if (hasScripts) {
doc2 = scripts[scripts.length - 1].ownerDocument;
jQuery2.map(scripts, restoreScript);
for (i = 0; i < hasScripts; i++) {
node = scripts[i];
if (rscriptType.test(node.type || "") && !dataPriv.access(node, "globalEval") && jQuery2.contains(doc2, node)) {
if (node.src && (node.type || "").toLowerCase() !== "module") {
if (jQuery2._evalUrl && !node.noModule) {
jQuery2._evalUrl(node.src, {
nonce: node.nonce || node.getAttribute("nonce")
}, doc2);
}
} else {
DOMEval(node.textContent.replace(rcleanScript, ""), node, doc2);
}
}
}
}
}
}
return collection;
}
function remove2(elem, selector, keepData) {
var node, nodes = selector ? jQuery2.filter(selector, elem) : elem, i = 0;
for (; (node = nodes[i]) != null; i++) {
if (!keepData && node.nodeType === 1) {
jQuery2.cleanData(getAll(node));
}
if (node.parentNode) {
if (keepData && isAttached(node)) {
setGlobalEval(getAll(node, "script"));
}
node.parentNode.removeChild(node);
}
}
return elem;
}
jQuery2.extend({
htmlPrefilter: function(html2) {
return html2;
},
clone: function(elem, dataAndEvents, deepDataAndEvents) {
var i, l, srcElements, destElements, clone2 = elem.cloneNode(true), inPage = isAttached(elem);
if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery2.isXMLDoc(elem)) {
destElements = getAll(clone2);
srcElements = getAll(elem);
for (i = 0, l = srcElements.length; i < l; i++) {
fixInput(srcElements[i], destElements[i]);
}
}
if (dataAndEvents) {
if (deepDataAndEvents) {
srcElements = srcElements || getAll(elem);
destElements = destElements || getAll(clone2);
for (i = 0, l = srcElements.length; i < l; i++) {
cloneCopyEvent(srcElements[i], destElements[i]);
}
} else {
cloneCopyEvent(elem, clone2);
}
}
destElements = getAll(clone2, "script");
if (destElements.length > 0) {
setGlobalEval(destElements, !inPage && getAll(elem, "script"));
}
return clone2;
},
cleanData: function(elems) {
var data, elem, type2, special = jQuery2.event.special, i = 0;
for (; (elem = elems[i]) !== void 0; i++) {
if (acceptData(elem)) {
if (data = elem[dataPriv.expando]) {
if (data.events) {
for (type2 in data.events) {
if (special[type2]) {
jQuery2.event.remove(elem, type2);
} else {
jQuery2.removeEvent(elem, type2, data.handle);
}
}
}
elem[dataPriv.expando] = void 0;
}
if (elem[dataUser.expando]) {
elem[dataUser.expando] = void 0;
}
}
}
}
});
jQuery2.fn.extend({
detach: function(selector) {
return remove2(this, selector, true);
},
remove: function(selector) {
return remove2(this, selector);
},
text: function(value) {
return access(this, function(value2) {
return value2 === void 0 ? jQuery2.text(this) : this.empty().each(function() {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
this.textContent = value2;
}
});
}, null, value, arguments.length);
},
append: function() {
return domManip(this, arguments, function(elem) {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
var target = manipulationTarget(this, elem);
target.appendChild(elem);
}
});
},
prepend: function() {
return domManip(this, arguments, function(elem) {
if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
var target = manipulationTarget(this, elem);
target.insertBefore(elem, target.firstChild);
}
});
},
before: function() {
return domManip(this, arguments, function(elem) {
if (this.parentNode) {
this.parentNode.insertBefore(elem, this);
}
});
},
after: function() {
return domManip(this, arguments, function(elem) {
if (this.parentNode) {
this.parentNode.insertBefore(elem, this.nextSibling);
}
});
},
empty: function() {
var elem, i = 0;
for (; (elem = this[i]) != null; i++) {
if (elem.nodeType === 1) {
jQuery2.cleanData(getAll(elem, false));
elem.textContent = "";
}
}
return this;
},
clone: function(dataAndEvents, deepDataAndEvents) {
dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
return this.map(function() {
return jQuery2.clone(this, dataAndEvents, deepDataAndEvents);
});
},
html: function(value) {
return access(this, function(value2) {
var elem = this[0] || {}, i = 0, l = this.length;
if (value2 === void 0 && elem.nodeType === 1) {
return elem.innerHTML;
}
if (typeof value2 === "string" && !rnoInnerhtml.test(value2) && !wrapMap[(rtagName.exec(value2) || ["", ""])[1].toLowerCase()]) {
value2 = jQuery2.htmlPrefilter(value2);
try {
for (; i < l; i++) {
elem = this[i] || {};
if (elem.nodeType === 1) {
jQuery2.cleanData(getAll(elem, false));
elem.innerHTML = value2;
}
}
elem = 0;
} catch (e) {
}
}
if (elem) {
this.empty().append(value2);
}
}, null, value, arguments.length);
},
replaceWith: function() {
var ignored = [];
return domManip(this, arguments, function(elem) {
var parent = this.parentNode;
if (jQuery2.inArray(this, ignored) < 0) {
jQuery2.cleanData(getAll(this));
if (parent) {
parent.replaceChild(elem, this);
}
}
}, ignored);
}
});
jQuery2.each({
appendTo: "append",
prependTo: "prepend",
insertBefore: "before",
insertAfter: "after",
replaceAll: "replaceWith"
}, function(name, original) {
jQuery2.fn[name] = function(selector) {
var elems, ret = [], insert = jQuery2(selector), last2 = insert.length - 1, i = 0;
for (; i <= last2; i++) {
elems = i === last2 ? this : this.clone(true);
jQuery2(insert[i])[original](elems);
push.apply(ret, elems.get());
}
return this.pushStack(ret);
};
});
var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i");
var rcustomProp = /^--/;
var getStyles = function(elem) {
var view = elem.ownerDocument.defaultView;
if (!view || !view.opener) {
view = window2;
}
return view.getComputedStyle(elem);
};
var swap = function(elem, options, callback) {
var ret, name, old = {};
for (name in options) {
old[name] = elem.style[name];
elem.style[name] = options[name];
}
ret = callback.call(elem);
for (name in options) {
elem.style[name] = old[name];
}
return ret;
};
var rboxStyle = new RegExp(cssExpand.join("|"), "i");
var whitespace2 = "[\\x20\\t\\r\\n\\f]";
var rtrimCSS = new RegExp(
"^" + whitespace2 + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace2 + "+$",
"g"
);
(function() {
function computeStyleTests() {
if (!div) {
return;
}
container.style.cssText = "position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0";
div.style.cssText = "position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%";
documentElement.appendChild(container).appendChild(div);
var divStyle = window2.getComputedStyle(div);
pixelPositionVal = divStyle.top !== "1%";
reliableMarginLeftVal = roundPixelMeasures(divStyle.marginLeft) === 12;
div.style.right = "60%";
pixelBoxStylesVal = roundPixelMeasures(divStyle.right) === 36;
boxSizingReliableVal = roundPixelMeasures(divStyle.width) === 36;
div.style.position = "absolute";
scrollboxSizeVal = roundPixelMeasures(div.offsetWidth / 3) === 12;
documentElement.removeChild(container);
div = null;
}
function roundPixelMeasures(measure) {
return Math.round(parseFloat(measure));
}
var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, reliableTrDimensionsVal, reliableMarginLeftVal, container = document2.createElement("div"), div = document2.createElement("div");
if (!div.style) {
return;
}
div.style.backgroundClip = "content-box";
div.cloneNode(true).style.backgroundClip = "";
support.clearCloneStyle = div.style.backgroundClip === "content-box";
jQuery2.extend(support, {
boxSizingReliable: function() {
computeStyleTests();
return boxSizingReliableVal;
},
pixelBoxStyles: function() {
computeStyleTests();
return pixelBoxStylesVal;
},
pixelPosition: function() {
computeStyleTests();
return pixelPositionVal;
},
reliableMarginLeft: function() {
computeStyleTests();
return reliableMarginLeftVal;
},
scrollboxSize: function() {
computeStyleTests();
return scrollboxSizeVal;
},
// Support: IE 9 - 11+, Edge 15 - 18+
// IE/Edge misreport `getComputedStyle` of table rows with width/height
// set in CSS while `offset*` properties report correct values.
// Behavior in IE 9 is more subtle than in newer versions & it passes
// some versions of this test; make sure not to make it pass there!
//
// Support: Firefox 70+
// Only Firefox includes border widths
// in computed dimensions. (gh-4529)
reliableTrDimensions: function() {
var table, tr, trChild, trStyle;
if (reliableTrDimensionsVal == null) {
table = document2.createElement("table");
tr = document2.createElement("tr");
trChild = document2.createElement("div");
table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate";
tr.style.cssText = "border:1px solid";
tr.style.height = "1px";
trChild.style.height = "9px";
trChild.style.display = "block";
documentElement.appendChild(table).appendChild(tr).appendChild(trChild);
trStyle = window2.getComputedStyle(tr);
reliableTrDimensionsVal = parseInt(trStyle.height, 10) + parseInt(trStyle.borderTopWidth, 10) + parseInt(trStyle.borderBottomWidth, 10) === tr.offsetHeight;
documentElement.removeChild(table);
}
return reliableTrDimensionsVal;
}
});
})();
function curCSS(elem, name, computed2) {
var width, minWidth, maxWidth, ret, isCustomProp = rcustomProp.test(name), style = elem.style;
computed2 = computed2 || getStyles(elem);
if (computed2) {
ret = computed2.getPropertyValue(name) || computed2[name];
if (isCustomProp && ret) {
ret = ret.replace(rtrimCSS, "$1") || void 0;
}
if (ret === "" && !isAttached(elem)) {
ret = jQuery2.style(elem, name);
}
if (!support.pixelBoxStyles() && rnumnonpx.test(ret) && rboxStyle.test(name)) {
width = style.width;
minWidth = style.minWidth;
maxWidth = style.maxWidth;
style.minWidth = style.maxWidth = style.width = ret;
ret = computed2.width;
style.width = width;
style.minWidth = minWidth;
style.maxWidth = maxWidth;
}
}
return ret !== void 0 ? (
// Support: IE <=9 - 11 only
// IE returns zIndex value as an integer.
ret + ""
) : ret;
}
function addGetHookIf(conditionFn, hookFn) {
return {
get: function() {
if (conditionFn()) {
delete this.get;
return;
}
return (this.get = hookFn).apply(this, arguments);
}
};
}
var cssPrefixes = ["Webkit", "Moz", "ms"], emptyStyle = document2.createElement("div").style, vendorProps = {};
function vendorPropName(name) {
var capName = name[0].toUpperCase() + name.slice(1), i = cssPrefixes.length;
while (i--) {
name = cssPrefixes[i] + capName;
if (name in emptyStyle) {
return name;
}
}
}
function finalPropName(name) {
var final = jQuery2.cssProps[name] || vendorProps[name];
if (final) {
return final;
}
if (name in emptyStyle) {
return name;
}
return vendorProps[name] = vendorPropName(name) || name;
}
var rdisplayswap = /^(none|table(?!-c[ea]).+)/, cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssNormalTransform = {
letterSpacing: "0",
fontWeight: "400"
};
function setPositiveNumber(_elem, value, subtract) {
var matches = rcssNum.exec(value);
return matches ? (
// Guard against undefined "subtract", e.g., when used as in cssHooks
Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px")
) : value;
}
function boxModelAdjustment(elem, dimension, box, isBorderBox, styles, computedVal) {
var i = dimension === "width" ? 1 : 0, extra = 0, delta = 0;
if (box === (isBorderBox ? "border" : "content")) {
return 0;
}
for (; i < 4; i += 2) {
if (box === "margin") {
delta += jQuery2.css(elem, box + cssExpand[i], true, styles);
}
if (!isBorderBox) {
delta += jQuery2.css(elem, "padding" + cssExpand[i], true, styles);
if (box !== "padding") {
delta += jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
} else {
extra += jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
} else {
if (box === "content") {
delta -= jQuery2.css(elem, "padding" + cssExpand[i], true, styles);
}
if (box !== "margin") {
delta -= jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
}
}
if (!isBorderBox && computedVal >= 0) {
delta += Math.max(0, Math.ceil(
elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - computedVal - delta - extra - 0.5
// If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter
// Use an explicit zero to avoid NaN (gh-3964)
)) || 0;
}
return delta;
}
function getWidthOrHeight(elem, dimension, extra) {
var styles = getStyles(elem), boxSizingNeeded = !support.boxSizingReliable() || extra, isBorderBox = boxSizingNeeded && jQuery2.css(elem, "boxSizing", false, styles) === "border-box", valueIsBorderBox = isBorderBox, val = curCSS(elem, dimension, styles), offsetProp = "offset" + dimension[0].toUpperCase() + dimension.slice(1);
if (rnumnonpx.test(val)) {
if (!extra) {
return val;
}
val = "auto";
}
if ((!support.boxSizingReliable() && isBorderBox || // Support: IE 10 - 11+, Edge 15 - 18+
// IE/Edge misreport `getComputedStyle` of table rows with width/height
// set in CSS while `offset*` properties report correct values.
// Interestingly, in some cases IE 9 doesn't suffer from this issue.
!support.reliableTrDimensions() && nodeName(elem, "tr") || // Fall back to offsetWidth/offsetHeight when value is "auto"
// This happens for inline elements with no explicit setting (gh-3571)
val === "auto" || // Support: Android <=4.1 - 4.3 only
// Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
!parseFloat(val) && jQuery2.css(elem, "display", false, styles) === "inline") && // Make sure the element is visible & connected
elem.getClientRects().length) {
isBorderBox = jQuery2.css(elem, "boxSizing", false, styles) === "border-box";
valueIsBorderBox = offsetProp in elem;
if (valueIsBorderBox) {
val = elem[offsetProp];
}
}
val = parseFloat(val) || 0;
return val + boxModelAdjustment(
elem,
dimension,
extra || (isBorderBox ? "border" : "content"),
valueIsBorderBox,
styles,
// Provide the current computed size to request scroll gutter calculation (gh-3589)
val
) + "px";
}
jQuery2.extend({
// Add in style property hooks for overriding the default
// behavior of getting and setting a style property
cssHooks: {
opacity: {
get: function(elem, computed2) {
if (computed2) {
var ret = curCSS(elem, "opacity");
return ret === "" ? "1" : ret;
}
}
}
},
// Don't automatically add "px" to these possibly-unitless properties
cssNumber: {
"animationIterationCount": true,
"columnCount": true,
"fillOpacity": true,
"flexGrow": true,
"flexShrink": true,
"fontWeight": true,
"gridArea": true,
"gridColumn": true,
"gridColumnEnd": true,
"gridColumnStart": true,
"gridRow": true,
"gridRowEnd": true,
"gridRowStart": true,
"lineHeight": true,
"opacity": true,
"order": true,
"orphans": true,
"widows": true,
"zIndex": true,
"zoom": true
},
// Add in properties whose names you wish to fix before
// setting or getting the value
cssProps: {},
// Get and set the style property on a DOM Node
style: function(elem, name, value, extra) {
if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
return;
}
var ret, type2, hooks, origName = camelCase2(name), isCustomProp = rcustomProp.test(name), style = elem.style;
if (!isCustomProp) {
name = finalPropName(origName);
}
hooks = jQuery2.cssHooks[name] || jQuery2.cssHooks[origName];
if (value !== void 0) {
type2 = typeof value;
if (type2 === "string" && (ret = rcssNum.exec(value)) && ret[1]) {
value = adjustCSS(elem, name, ret);
type2 = "number";
}
if (value == null || value !== value) {
return;
}
if (type2 === "number" && !isCustomProp) {
value += ret && ret[3] || (jQuery2.cssNumber[origName] ? "" : "px");
}
if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
style[name] = "inherit";
}
if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== void 0) {
if (isCustomProp) {
style.setProperty(name, value);
} else {
style[name] = value;
}
}
} else {
if (hooks && "get" in hooks && (ret = hooks.get(elem, false, extra)) !== void 0) {
return ret;
}
return style[name];
}
},
css: function(elem, name, extra, styles) {
var val, num, hooks, origName = camelCase2(name), isCustomProp = rcustomProp.test(name);
if (!isCustomProp) {
name = finalPropName(origName);
}
hooks = jQuery2.cssHooks[name] || jQuery2.cssHooks[origName];
if (hooks && "get" in hooks) {
val = hooks.get(elem, true, extra);
}
if (val === void 0) {
val = curCSS(elem, name, styles);
}
if (val === "normal" && name in cssNormalTransform) {
val = cssNormalTransform[name];
}
if (extra === "" || extra) {
num = parseFloat(val);
return extra === true || isFinite(num) ? num || 0 : val;
}
return val;
}
});
jQuery2.each(["height", "width"], function(_i, dimension) {
jQuery2.cssHooks[dimension] = {
get: function(elem, computed2, extra) {
if (computed2) {
return rdisplayswap.test(jQuery2.css(elem, "display")) && // Support: Safari 8+
// Table columns in Safari have non-zero offsetWidth & zero
// getBoundingClientRect().width unless display is changed.
// Support: IE <=11 only
// Running getBoundingClientRect on a disconnected node
// in IE throws an error.
(!elem.getClientRects().length || !elem.getBoundingClientRect().width) ? swap(elem, cssShow, function() {
return getWidthOrHeight(elem, dimension, extra);
}) : getWidthOrHeight(elem, dimension, extra);
}
},
set: function(elem, value, extra) {
var matches, styles = getStyles(elem), scrollboxSizeBuggy = !support.scrollboxSize() && styles.position === "absolute", boxSizingNeeded = scrollboxSizeBuggy || extra, isBorderBox = boxSizingNeeded && jQuery2.css(elem, "boxSizing", false, styles) === "border-box", subtract = extra ? boxModelAdjustment(
elem,
dimension,
extra,
isBorderBox,
styles
) : 0;
if (isBorderBox && scrollboxSizeBuggy) {
subtract -= Math.ceil(
elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - parseFloat(styles[dimension]) - boxModelAdjustment(elem, dimension, "border", false, styles) - 0.5
);
}
if (subtract && (matches = rcssNum.exec(value)) && (matches[3] || "px") !== "px") {
elem.style[dimension] = value;
value = jQuery2.css(elem, dimension);
}
return setPositiveNumber(elem, value, subtract);
}
};
});
jQuery2.cssHooks.marginLeft = addGetHookIf(
support.reliableMarginLeft,
function(elem, computed2) {
if (computed2) {
return (parseFloat(curCSS(elem, "marginLeft")) || elem.getBoundingClientRect().left - swap(elem, { marginLeft: 0 }, function() {
return elem.getBoundingClientRect().left;
})) + "px";
}
}
);
jQuery2.each({
margin: "",
padding: "",
border: "Width"
}, function(prefix, suffix) {
jQuery2.cssHooks[prefix + suffix] = {
expand: function(value) {
var i = 0, expanded = {}, parts = typeof value === "string" ? value.split(" ") : [value];
for (; i < 4; i++) {
expanded[prefix + cssExpand[i] + suffix] = parts[i] || parts[i - 2] || parts[0];
}
return expanded;
}
};
if (prefix !== "margin") {
jQuery2.cssHooks[prefix + suffix].set = setPositiveNumber;
}
});
jQuery2.fn.extend({
css: function(name, value) {
return access(this, function(elem, name2, value2) {
var styles, len, map2 = {}, i = 0;
if (Array.isArray(name2)) {
styles = getStyles(elem);
len = name2.length;
for (; i < len; i++) {
map2[name2[i]] = jQuery2.css(elem, name2[i], false, styles);
}
return map2;
}
return value2 !== void 0 ? jQuery2.style(elem, name2, value2) : jQuery2.css(elem, name2);
}, name, value, arguments.length > 1);
}
});
function Tween(elem, options, prop, end2, easing) {
return new Tween.prototype.init(elem, options, prop, end2, easing);
}
jQuery2.Tween = Tween;
Tween.prototype = {
constructor: Tween,
init: function(elem, options, prop, end2, easing, unit) {
this.elem = elem;
this.prop = prop;
this.easing = easing || jQuery2.easing._default;
this.options = options;
this.start = this.now = this.cur();
this.end = end2;
this.unit = unit || (jQuery2.cssNumber[prop] ? "" : "px");
},
cur: function() {
var hooks = Tween.propHooks[this.prop];
return hooks && hooks.get ? hooks.get(this) : Tween.propHooks._default.get(this);
},
run: function(percent) {
var eased, hooks = Tween.propHooks[this.prop];
if (this.options.duration) {
this.pos = eased = jQuery2.easing[this.easing](
percent,
this.options.duration * percent,
0,
1,
this.options.duration
);
} else {
this.pos = eased = percent;
}
this.now = (this.end - this.start) * eased + this.start;
if (this.options.step) {
this.options.step.call(this.elem, this.now, this);
}
if (hooks && hooks.set) {
hooks.set(this);
} else {
Tween.propHooks._default.set(this);
}
return this;
}
};
Tween.prototype.init.prototype = Tween.prototype;
Tween.propHooks = {
_default: {
get: function(tween) {
var result;
if (tween.elem.nodeType !== 1 || tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) {
return tween.elem[tween.prop];
}
result = jQuery2.css(tween.elem, tween.prop, "");
return !result || result === "auto" ? 0 : result;
},
set: function(tween) {
if (jQuery2.fx.step[tween.prop]) {
jQuery2.fx.step[tween.prop](tween);
} else if (tween.elem.nodeType === 1 && (jQuery2.cssHooks[tween.prop] || tween.elem.style[finalPropName(tween.prop)] != null)) {
jQuery2.style(tween.elem, tween.prop, tween.now + tween.unit);
} else {
tween.elem[tween.prop] = tween.now;
}
}
}
};
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
set: function(tween) {
if (tween.elem.nodeType && tween.elem.parentNode) {
tween.elem[tween.prop] = tween.now;
}
}
};
jQuery2.easing = {
linear: function(p2) {
return p2;
},
swing: function(p2) {
return 0.5 - Math.cos(p2 * Math.PI) / 2;
},
_default: "swing"
};
jQuery2.fx = Tween.prototype.init;
jQuery2.fx.step = {};
var fxNow, inProgress, rfxtypes = /^(?:toggle|show|hide)$/, rrun = /queueHooks$/;
function schedule() {
if (inProgress) {
if (document2.hidden === false && window2.requestAnimationFrame) {
window2.requestAnimationFrame(schedule);
} else {
window2.setTimeout(schedule, jQuery2.fx.interval);
}
jQuery2.fx.tick();
}
}
function createFxNow() {
window2.setTimeout(function() {
fxNow = void 0;
});
return fxNow = Date.now();
}
function genFx(type2, includeWidth) {
var which, i = 0, attrs = { height: type2 };
includeWidth = includeWidth ? 1 : 0;
for (; i < 4; i += 2 - includeWidth) {
which = cssExpand[i];
attrs["margin" + which] = attrs["padding" + which] = type2;
}
if (includeWidth) {
attrs.opacity = attrs.width = type2;
}
return attrs;
}
function createTween(value, prop, animation) {
var tween, collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]), index2 = 0, length = collection.length;
for (; index2 < length; index2++) {
if (tween = collection[index2].call(animation, prop, value)) {
return tween;
}
}
}
function defaultPrefilter(elem, props, opts) {
var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, isBox = "width" in props || "height" in props, anim = this, orig = {}, style = elem.style, hidden = elem.nodeType && isHiddenWithinTree(elem), dataShow = dataPriv.get(elem, "fxshow");
if (!opts.queue) {
hooks = jQuery2._queueHooks(elem, "fx");
if (hooks.unqueued == null) {
hooks.unqueued = 0;
oldfire = hooks.empty.fire;
hooks.empty.fire = function() {
if (!hooks.unqueued) {
oldfire();
}
};
}
hooks.unqueued++;
anim.always(function() {
anim.always(function() {
hooks.unqueued--;
if (!jQuery2.queue(elem, "fx").length) {
hooks.empty.fire();
}
});
});
}
for (prop in props) {
value = props[prop];
if (rfxtypes.test(value)) {
delete props[prop];
toggle = toggle || value === "toggle";
if (value === (hidden ? "hide" : "show")) {
if (value === "show" && dataShow && dataShow[prop] !== void 0) {
hidden = true;
} else {
continue;
}
}
orig[prop] = dataShow && dataShow[prop] || jQuery2.style(elem, prop);
}
}
propTween = !jQuery2.isEmptyObject(props);
if (!propTween && jQuery2.isEmptyObject(orig)) {
return;
}
if (isBox && elem.nodeType === 1) {
opts.overflow = [style.overflow, style.overflowX, style.overflowY];
restoreDisplay = dataShow && dataShow.display;
if (restoreDisplay == null) {
restoreDisplay = dataPriv.get(elem, "display");
}
display = jQuery2.css(elem, "display");
if (display === "none") {
if (restoreDisplay) {
display = restoreDisplay;
} else {
showHide([elem], true);
restoreDisplay = elem.style.display || restoreDisplay;
display = jQuery2.css(elem, "display");
showHide([elem]);
}
}
if (display === "inline" || display === "inline-block" && restoreDisplay != null) {
if (jQuery2.css(elem, "float") === "none") {
if (!propTween) {
anim.done(function() {
style.display = restoreDisplay;
});
if (restoreDisplay == null) {
display = style.display;
restoreDisplay = display === "none" ? "" : display;
}
}
style.display = "inline-block";
}
}
}
if (opts.overflow) {
style.overflow = "hidden";
anim.always(function() {
style.overflow = opts.overflow[0];
style.overflowX = opts.overflow[1];
style.overflowY = opts.overflow[2];
});
}
propTween = false;
for (prop in orig) {
if (!propTween) {
if (dataShow) {
if ("hidden" in dataShow) {
hidden = dataShow.hidden;
}
} else {
dataShow = dataPriv.access(elem, "fxshow", { display: restoreDisplay });
}
if (toggle) {
dataShow.hidden = !hidden;
}
if (hidden) {
showHide([elem], true);
}
anim.done(function() {
if (!hidden) {
showHide([elem]);
}
dataPriv.remove(elem, "fxshow");
for (prop in orig) {
jQuery2.style(elem, prop, orig[prop]);
}
});
}
propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
if (!(prop in dataShow)) {
dataShow[prop] = propTween.start;
if (hidden) {
propTween.end = propTween.start;
propTween.start = 0;
}
}
}
}
function propFilter(props, specialEasing) {
var index2, name, easing, value, hooks;
for (index2 in props) {
name = camelCase2(index2);
easing = specialEasing[name];
value = props[index2];
if (Array.isArray(value)) {
easing = value[1];
value = props[index2] = value[0];
}
if (index2 !== name) {
props[name] = value;
delete props[index2];
}
hooks = jQuery2.cssHooks[name];
if (hooks && "expand" in hooks) {
value = hooks.expand(value);
delete props[name];
for (index2 in value) {
if (!(index2 in props)) {
props[index2] = value[index2];
specialEasing[index2] = easing;
}
}
} else {
specialEasing[name] = easing;
}
}
}
function Animation(elem, properties, options) {
var result, stopped, index2 = 0, length = Animation.prefilters.length, deferred = jQuery2.Deferred().always(function() {
delete tick.elem;
}), tick = function() {
if (stopped) {
return false;
}
var currentTime = fxNow || createFxNow(), remaining = Math.max(0, animation.startTime + animation.duration - currentTime), temp = remaining / animation.duration || 0, percent = 1 - temp, index3 = 0, length2 = animation.tweens.length;
for (; index3 < length2; index3++) {
animation.tweens[index3].run(percent);
}
deferred.notifyWith(elem, [animation, percent, remaining]);
if (percent < 1 && length2) {
return remaining;
}
if (!length2) {
deferred.notifyWith(elem, [animation, 1, 0]);
}
deferred.resolveWith(elem, [animation]);
return false;
}, animation = deferred.promise({
elem,
props: jQuery2.extend({}, properties),
opts: jQuery2.extend(true, {
specialEasing: {},
easing: jQuery2.easing._default
}, options),
originalProperties: properties,
originalOptions: options,
startTime: fxNow || createFxNow(),
duration: options.duration,
tweens: [],
createTween: function(prop, end2) {
var tween = jQuery2.Tween(
elem,
animation.opts,
prop,
end2,
animation.opts.specialEasing[prop] || animation.opts.easing
);
animation.tweens.push(tween);
return tween;
},
stop: function(gotoEnd) {
var index3 = 0, length2 = gotoEnd ? animation.tweens.length : 0;
if (stopped) {
return this;
}
stopped = true;
for (; index3 < length2; index3++) {
animation.tweens[index3].run(1);
}
if (gotoEnd) {
deferred.notifyWith(elem, [animation, 1, 0]);
deferred.resolveWith(elem, [animation, gotoEnd]);
} else {
deferred.rejectWith(elem, [animation, gotoEnd]);
}
return this;
}
}), props = animation.props;
propFilter(props, animation.opts.specialEasing);
for (; index2 < length; index2++) {
result = Animation.prefilters[index2].call(animation, elem, props, animation.opts);
if (result) {
if (isFunction2(result.stop)) {
jQuery2._queueHooks(animation.elem, animation.opts.queue).stop = result.stop.bind(result);
}
return result;
}
}
jQuery2.map(props, createTween, animation);
if (isFunction2(animation.opts.start)) {
animation.opts.start.call(elem, animation);
}
animation.progress(animation.opts.progress).done(animation.opts.done, animation.opts.complete).fail(animation.opts.fail).always(animation.opts.always);
jQuery2.fx.timer(
jQuery2.extend(tick, {
elem,
anim: animation,
queue: animation.opts.queue
})
);
return animation;
}
jQuery2.Animation = jQuery2.extend(Animation, {
tweeners: {
"*": [function(prop, value) {
var tween = this.createTween(prop, value);
adjustCSS(tween.elem, prop, rcssNum.exec(value), tween);
return tween;
}]
},
tweener: function(props, callback) {
if (isFunction2(props)) {
callback = props;
props = ["*"];
} else {
props = props.match(rnothtmlwhite);
}
var prop, index2 = 0, length = props.length;
for (; index2 < length; index2++) {
prop = props[index2];
Animation.tweeners[prop] = Animation.tweeners[prop] || [];
Animation.tweeners[prop].unshift(callback);
}
},
prefilters: [defaultPrefilter],
prefilter: function(callback, prepend) {
if (prepend) {
Animation.prefilters.unshift(callback);
} else {
Animation.prefilters.push(callback);
}
}
});
jQuery2.speed = function(speed, easing, fn2) {
var opt = speed && typeof speed === "object" ? jQuery2.extend({}, speed) : {
complete: fn2 || !fn2 && easing || isFunction2(speed) && speed,
duration: speed,
easing: fn2 && easing || easing && !isFunction2(easing) && easing
};
if (jQuery2.fx.off) {
opt.duration = 0;
} else {
if (typeof opt.duration !== "number") {
if (opt.duration in jQuery2.fx.speeds) {
opt.duration = jQuery2.fx.speeds[opt.duration];
} else {
opt.duration = jQuery2.fx.speeds._default;
}
}
}
if (opt.queue == null || opt.queue === true) {
opt.queue = "fx";
}
opt.old = opt.complete;
opt.complete = function() {
if (isFunction2(opt.old)) {
opt.old.call(this);
}
if (opt.queue) {
jQuery2.dequeue(this, opt.queue);
}
};
return opt;
};
jQuery2.fn.extend({
fadeTo: function(speed, to, easing, callback) {
return this.filter(isHiddenWithinTree).css("opacity", 0).show().end().animate({ opacity: to }, speed, easing, callback);
},
animate: function(prop, speed, easing, callback) {
var empty = jQuery2.isEmptyObject(prop), optall = jQuery2.speed(speed, easing, callback), doAnimation = function() {
var anim = Animation(this, jQuery2.extend({}, prop), optall);
if (empty || dataPriv.get(this, "finish")) {
anim.stop(true);
}
};
doAnimation.finish = doAnimation;
return empty || optall.queue === false ? this.each(doAnimation) : this.queue(optall.queue, doAnimation);
},
stop: function(type2, clearQueue, gotoEnd) {
var stopQueue = function(hooks) {
var stop = hooks.stop;
delete hooks.stop;
stop(gotoEnd);
};
if (typeof type2 !== "string") {
gotoEnd = clearQueue;
clearQueue = type2;
type2 = void 0;
}
if (clearQueue) {
this.queue(type2 || "fx", []);
}
return this.each(function() {
var dequeue = true, index2 = type2 != null && type2 + "queueHooks", timers = jQuery2.timers, data = dataPriv.get(this);
if (index2) {
if (data[index2] && data[index2].stop) {
stopQueue(data[index2]);
}
} else {
for (index2 in data) {
if (data[index2] && data[index2].stop && rrun.test(index2)) {
stopQueue(data[index2]);
}
}
}
for (index2 = timers.length; index2--; ) {
if (timers[index2].elem === this && (type2 == null || timers[index2].queue === type2)) {
timers[index2].anim.stop(gotoEnd);
dequeue = false;
timers.splice(index2, 1);
}
}
if (dequeue || !gotoEnd) {
jQuery2.dequeue(this, type2);
}
});
},
finish: function(type2) {
if (type2 !== false) {
type2 = type2 || "fx";
}
return this.each(function() {
var index2, data = dataPriv.get(this), queue2 = data[type2 + "queue"], hooks = data[type2 + "queueHooks"], timers = jQuery2.timers, length = queue2 ? queue2.length : 0;
data.finish = true;
jQuery2.queue(this, type2, []);
if (hooks && hooks.stop) {
hooks.stop.call(this, true);
}
for (index2 = timers.length; index2--; ) {
if (timers[index2].elem === this && timers[index2].queue === type2) {
timers[index2].anim.stop(true);
timers.splice(index2, 1);
}
}
for (index2 = 0; index2 < length; index2++) {
if (queue2[index2] && queue2[index2].finish) {
queue2[index2].finish.call(this);
}
}
delete data.finish;
});
}
});
jQuery2.each(["toggle", "show", "hide"], function(_i, name) {
var cssFn = jQuery2.fn[name];
jQuery2.fn[name] = function(speed, easing, callback) {
return speed == null || typeof speed === "boolean" ? cssFn.apply(this, arguments) : this.animate(genFx(name, true), speed, easing, callback);
};
});
jQuery2.each({
slideDown: genFx("show"),
slideUp: genFx("hide"),
slideToggle: genFx("toggle"),
fadeIn: { opacity: "show" },
fadeOut: { opacity: "hide" },
fadeToggle: { opacity: "toggle" }
}, function(name, props) {
jQuery2.fn[name] = function(speed, easing, callback) {
return this.animate(props, speed, easing, callback);
};
});
jQuery2.timers = [];
jQuery2.fx.tick = function() {
var timer, i = 0, timers = jQuery2.timers;
fxNow = Date.now();
for (; i < timers.length; i++) {
timer = timers[i];
if (!timer() && timers[i] === timer) {
timers.splice(i--, 1);
}
}
if (!timers.length) {
jQuery2.fx.stop();
}
fxNow = void 0;
};
jQuery2.fx.timer = function(timer) {
jQuery2.timers.push(timer);
jQuery2.fx.start();
};
jQuery2.fx.interval = 13;
jQuery2.fx.start = function() {
if (inProgress) {
return;
}
inProgress = true;
schedule();
};
jQuery2.fx.stop = function() {
inProgress = null;
};
jQuery2.fx.speeds = {
slow: 600,
fast: 200,
// Default speed
_default: 400
};
jQuery2.fn.delay = function(time, type2) {
time = jQuery2.fx ? jQuery2.fx.speeds[time] || time : time;
type2 = type2 || "fx";
return this.queue(type2, function(next, hooks) {
var timeout = window2.setTimeout(next, time);
hooks.stop = function() {
window2.clearTimeout(timeout);
};
});
};
(function() {
var input = document2.createElement("input"), select = document2.createElement("select"), opt = select.appendChild(document2.createElement("option"));
input.type = "checkbox";
support.checkOn = input.value !== "";
support.optSelected = opt.selected;
input = document2.createElement("input");
input.value = "t";
input.type = "radio";
support.radioValue = input.value === "t";
})();
var boolHook, attrHandle = jQuery2.expr.attrHandle;
jQuery2.fn.extend({
attr: function(name, value) {
return access(this, jQuery2.attr, name, value, arguments.length > 1);
},
removeAttr: function(name) {
return this.each(function() {
jQuery2.removeAttr(this, name);
});
}
});
jQuery2.extend({
attr: function(elem, name, value) {
var ret, hooks, nType = elem.nodeType;
if (nType === 3 || nType === 8 || nType === 2) {
return;
}
if (typeof elem.getAttribute === "undefined") {
return jQuery2.prop(elem, name, value);
}
if (nType !== 1 || !jQuery2.isXMLDoc(elem)) {
hooks = jQuery2.attrHooks[name.toLowerCase()] || (jQuery2.expr.match.bool.test(name) ? boolHook : void 0);
}
if (value !== void 0) {
if (value === null) {
jQuery2.removeAttr(elem, name);
return;
}
if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== void 0) {
return ret;
}
elem.setAttribute(name, value + "");
return value;
}
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
return ret;
}
ret = jQuery2.find.attr(elem, name);
return ret == null ? void 0 : ret;
},
attrHooks: {
type: {
set: function(elem, value) {
if (!support.radioValue && value === "radio" && nodeName(elem, "input")) {
var val = elem.value;
elem.setAttribute("type", value);
if (val) {
elem.value = val;
}
return value;
}
}
}
},
removeAttr: function(elem, value) {
var name, i = 0, attrNames = value && value.match(rnothtmlwhite);
if (attrNames && elem.nodeType === 1) {
while (name = attrNames[i++]) {
elem.removeAttribute(name);
}
}
}
});
boolHook = {
set: function(elem, value, name) {
if (value === false) {
jQuery2.removeAttr(elem, name);
} else {
elem.setAttribute(name, name);
}
return name;
}
};
jQuery2.each(jQuery2.expr.match.bool.source.match(/\w+/g), function(_i, name) {
var getter = attrHandle[name] || jQuery2.find.attr;
attrHandle[name] = function(elem, name2, isXML) {
var ret, handle, lowercaseName = name2.toLowerCase();
if (!isXML) {
handle = attrHandle[lowercaseName];
attrHandle[lowercaseName] = ret;
ret = getter(elem, name2, isXML) != null ? lowercaseName : null;
attrHandle[lowercaseName] = handle;
}
return ret;
};
});
var rfocusable = /^(?:input|select|textarea|button)$/i, rclickable = /^(?:a|area)$/i;
jQuery2.fn.extend({
prop: function(name, value) {
return access(this, jQuery2.prop, name, value, arguments.length > 1);
},
removeProp: function(name) {
return this.each(function() {
delete this[jQuery2.propFix[name] || name];
});
}
});
jQuery2.extend({
prop: function(elem, name, value) {
var ret, hooks, nType = elem.nodeType;
if (nType === 3 || nType === 8 || nType === 2) {
return;
}
if (nType !== 1 || !jQuery2.isXMLDoc(elem)) {
name = jQuery2.propFix[name] || name;
hooks = jQuery2.propHooks[name];
}
if (value !== void 0) {
if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== void 0) {
return ret;
}
return elem[name] = value;
}
if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
return ret;
}
return elem[name];
},
propHooks: {
tabIndex: {
get: function(elem) {
var tabindex = jQuery2.find.attr(elem, "tabindex");
if (tabindex) {
return parseInt(tabindex, 10);
}
if (rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href) {
return 0;
}
return -1;
}
}
},
propFix: {
"for": "htmlFor",
"class": "className"
}
});
if (!support.optSelected) {
jQuery2.propHooks.selected = {
get: function(elem) {
var parent = elem.parentNode;
if (parent && parent.parentNode) {
parent.parentNode.selectedIndex;
}
return null;
},
set: function(elem) {
var parent = elem.parentNode;
if (parent) {
parent.selectedIndex;
if (parent.parentNode) {
parent.parentNode.selectedIndex;
}
}
}
};
}
jQuery2.each([
"tabIndex",
"readOnly",
"maxLength",
"cellSpacing",
"cellPadding",
"rowSpan",
"colSpan",
"useMap",
"frameBorder",
"contentEditable"
], function() {
jQuery2.propFix[this.toLowerCase()] = this;
});
function stripAndCollapse(value) {
var tokens = value.match(rnothtmlwhite) || [];
return tokens.join(" ");
}
function getClass(elem) {
return elem.getAttribute && elem.getAttribute("class") || "";
}
function classesToArray(value) {
if (Array.isArray(value)) {
return value;
}
if (typeof value === "string") {
return value.match(rnothtmlwhite) || [];
}
return [];
}
jQuery2.fn.extend({
addClass: function(value) {
var classNames, cur, curValue, className, i, finalValue;
if (isFunction2(value)) {
return this.each(function(j) {
jQuery2(this).addClass(value.call(this, j, getClass(this)));
});
}
classNames = classesToArray(value);
if (classNames.length) {
return this.each(function() {
curValue = getClass(this);
cur = this.nodeType === 1 && " " + stripAndCollapse(curValue) + " ";
if (cur) {
for (i = 0; i < classNames.length; i++) {
className = classNames[i];
if (cur.indexOf(" " + className + " ") < 0) {
cur += className + " ";
}
}
finalValue = stripAndCollapse(cur);
if (curValue !== finalValue) {
this.setAttribute("class", finalValue);
}
}
});
}
return this;
},
removeClass: function(value) {
var classNames, cur, curValue, className, i, finalValue;
if (isFunction2(value)) {
return this.each(function(j) {
jQuery2(this).removeClass(value.call(this, j, getClass(this)));
});
}
if (!arguments.length) {
return this.attr("class", "");
}
classNames = classesToArray(value);
if (classNames.length) {
return this.each(function() {
curValue = getClass(this);
cur = this.nodeType === 1 && " " + stripAndCollapse(curValue) + " ";
if (cur) {
for (i = 0; i < classNames.length; i++) {
className = classNames[i];
while (cur.indexOf(" " + className + " ") > -1) {
cur = cur.replace(" " + className + " ", " ");
}
}
finalValue = stripAndCollapse(cur);
if (curValue !== finalValue) {
this.setAttribute("class", finalValue);
}
}
});
}
return this;
},
toggleClass: function(value, stateVal) {
var classNames, className, i, self2, type2 = typeof value, isValidValue2 = type2 === "string" || Array.isArray(value);
if (isFunction2(value)) {
return this.each(function(i2) {
jQuery2(this).toggleClass(
value.call(this, i2, getClass(this), stateVal),
stateVal
);
});
}
if (typeof stateVal === "boolean" && isValidValue2) {
return stateVal ? this.addClass(value) : this.removeClass(value);
}
classNames = classesToArray(value);
return this.each(function() {
if (isValidValue2) {
self2 = jQuery2(this);
for (i = 0; i < classNames.length; i++) {
className = classNames[i];
if (self2.hasClass(className)) {
self2.removeClass(className);
} else {
self2.addClass(className);
}
}
} else if (value === void 0 || type2 === "boolean") {
className = getClass(this);
if (className) {
dataPriv.set(this, "__className__", className);
}
if (this.setAttribute) {
this.setAttribute(
"class",
className || value === false ? "" : dataPriv.get(this, "__className__") || ""
);
}
}
});
},
hasClass: function(selector) {
var className, elem, i = 0;
className = " " + selector + " ";
while (elem = this[i++]) {
if (elem.nodeType === 1 && (" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) {
return true;
}
}
return false;
}
});
var rreturn = /\r/g;
jQuery2.fn.extend({
val: function(value) {
var hooks, ret, valueIsFunction, elem = this[0];
if (!arguments.length) {
if (elem) {
hooks = jQuery2.valHooks[elem.type] || jQuery2.valHooks[elem.nodeName.toLowerCase()];
if (hooks && "get" in hooks && (ret = hooks.get(elem, "value")) !== void 0) {
return ret;
}
ret = elem.value;
if (typeof ret === "string") {
return ret.replace(rreturn, "");
}
return ret == null ? "" : ret;
}
return;
}
valueIsFunction = isFunction2(value);
return this.each(function(i) {
var val;
if (this.nodeType !== 1) {
return;
}
if (valueIsFunction) {
val = value.call(this, i, jQuery2(this).val());
} else {
val = value;
}
if (val == null) {
val = "";
} else if (typeof val === "number") {
val += "";
} else if (Array.isArray(val)) {
val = jQuery2.map(val, function(value2) {
return value2 == null ? "" : value2 + "";
});
}
hooks = jQuery2.valHooks[this.type] || jQuery2.valHooks[this.nodeName.toLowerCase()];
if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === void 0) {
this.value = val;
}
});
}
});
jQuery2.extend({
valHooks: {
option: {
get: function(elem) {
var val = jQuery2.find.attr(elem, "value");
return val != null ? val : (
// Support: IE <=10 - 11 only
// option.text throws exceptions (trac-14686, trac-14858)
// Strip and collapse whitespace
// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
stripAndCollapse(jQuery2.text(elem))
);
}
},
select: {
get: function(elem) {
var value, option, i, options = elem.options, index2 = elem.selectedIndex, one = elem.type === "select-one", values2 = one ? null : [], max = one ? index2 + 1 : options.length;
if (index2 < 0) {
i = max;
} else {
i = one ? index2 : 0;
}
for (; i < max; i++) {
option = options[i];
if ((option.selected || i === index2) && // Don't return options that are disabled or in a disabled optgroup
!option.disabled && (!option.parentNode.disabled || !nodeName(option.parentNode, "optgroup"))) {
value = jQuery2(option).val();
if (one) {
return value;
}
values2.push(value);
}
}
return values2;
},
set: function(elem, value) {
var optionSet, option, options = elem.options, values2 = jQuery2.makeArray(value), i = options.length;
while (i--) {
option = options[i];
if (option.selected = jQuery2.inArray(jQuery2.valHooks.option.get(option), values2) > -1) {
optionSet = true;
}
}
if (!optionSet) {
elem.selectedIndex = -1;
}
return values2;
}
}
}
});
jQuery2.each(["radio", "checkbox"], function() {
jQuery2.valHooks[this] = {
set: function(elem, value) {
if (Array.isArray(value)) {
return elem.checked = jQuery2.inArray(jQuery2(elem).val(), value) > -1;
}
}
};
if (!support.checkOn) {
jQuery2.valHooks[this].get = function(elem) {
return elem.getAttribute("value") === null ? "on" : elem.value;
};
}
});
support.focusin = "onfocusin" in window2;
var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, stopPropagationCallback = function(e) {
e.stopPropagation();
};
jQuery2.extend(jQuery2.event, {
trigger: function(event, data, elem, onlyHandlers) {
var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, eventPath = [elem || document2], type2 = hasOwn2.call(event, "type") ? event.type : event, namespaces = hasOwn2.call(event, "namespace") ? event.namespace.split(".") : [];
cur = lastElement = tmp = elem = elem || document2;
if (elem.nodeType === 3 || elem.nodeType === 8) {
return;
}
if (rfocusMorph.test(type2 + jQuery2.event.triggered)) {
return;
}
if (type2.indexOf(".") > -1) {
namespaces = type2.split(".");
type2 = namespaces.shift();
namespaces.sort();
}
ontype = type2.indexOf(":") < 0 && "on" + type2;
event = event[jQuery2.expando] ? event : new jQuery2.Event(type2, typeof event === "object" && event);
event.isTrigger = onlyHandlers ? 2 : 3;
event.namespace = namespaces.join(".");
event.rnamespace = event.namespace ? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
event.result = void 0;
if (!event.target) {
event.target = elem;
}
data = data == null ? [event] : jQuery2.makeArray(data, [event]);
special = jQuery2.event.special[type2] || {};
if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
return;
}
if (!onlyHandlers && !special.noBubble && !isWindow(elem)) {
bubbleType = special.delegateType || type2;
if (!rfocusMorph.test(bubbleType + type2)) {
cur = cur.parentNode;
}
for (; cur; cur = cur.parentNode) {
eventPath.push(cur);
tmp = cur;
}
if (tmp === (elem.ownerDocument || document2)) {
eventPath.push(tmp.defaultView || tmp.parentWindow || window2);
}
}
i = 0;
while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
lastElement = cur;
event.type = i > 1 ? bubbleType : special.bindType || type2;
handle = (dataPriv.get(cur, "events") || /* @__PURE__ */ Object.create(null))[event.type] && dataPriv.get(cur, "handle");
if (handle) {
handle.apply(cur, data);
}
handle = ontype && cur[ontype];
if (handle && handle.apply && acceptData(cur)) {
event.result = handle.apply(cur, data);
if (event.result === false) {
event.preventDefault();
}
}
}
event.type = type2;
if (!onlyHandlers && !event.isDefaultPrevented()) {
if ((!special._default || special._default.apply(eventPath.pop(), data) === false) && acceptData(elem)) {
if (ontype && isFunction2(elem[type2]) && !isWindow(elem)) {
tmp = elem[ontype];
if (tmp) {
elem[ontype] = null;
}
jQuery2.event.triggered = type2;
if (event.isPropagationStopped()) {
lastElement.addEventListener(type2, stopPropagationCallback);
}
elem[type2]();
if (event.isPropagationStopped()) {
lastElement.removeEventListener(type2, stopPropagationCallback);
}
jQuery2.event.triggered = void 0;
if (tmp) {
elem[ontype] = tmp;
}
}
}
}
return event.result;
},
// Piggyback on a donor event to simulate a different one
// Used only for `focus(in | out)` events
simulate: function(type2, elem, event) {
var e = jQuery2.extend(
new jQuery2.Event(),
event,
{
type: type2,
isSimulated: true
}
);
jQuery2.event.trigger(e, null, elem);
}
});
jQuery2.fn.extend({
trigger: function(type2, data) {
return this.each(function() {
jQuery2.event.trigger(type2, data, this);
});
},
triggerHandler: function(type2, data) {
var elem = this[0];
if (elem) {
return jQuery2.event.trigger(type2, data, elem, true);
}
}
});
if (!support.focusin) {
jQuery2.each({ focus: "focusin", blur: "focusout" }, function(orig, fix) {
var handler = function(event) {
jQuery2.event.simulate(fix, event.target, jQuery2.event.fix(event));
};
jQuery2.event.special[fix] = {
setup: function() {
var doc2 = this.ownerDocument || this.document || this, attaches = dataPriv.access(doc2, fix);
if (!attaches) {
doc2.addEventListener(orig, handler, true);
}
dataPriv.access(doc2, fix, (attaches || 0) + 1);
},
teardown: function() {
var doc2 = this.ownerDocument || this.document || this, attaches = dataPriv.access(doc2, fix) - 1;
if (!attaches) {
doc2.removeEventListener(orig, handler, true);
dataPriv.remove(doc2, fix);
} else {
dataPriv.access(doc2, fix, attaches);
}
}
};
});
}
var location2 = window2.location;
var nonce = { guid: Date.now() };
var rquery = /\?/;
jQuery2.parseXML = function(data) {
var xml, parserErrorElem;
if (!data || typeof data !== "string") {
return null;
}
try {
xml = new window2.DOMParser().parseFromString(data, "text/xml");
} catch (e) {
}
parserErrorElem = xml && xml.getElementsByTagName("parsererror")[0];
if (!xml || parserErrorElem) {
jQuery2.error("Invalid XML: " + (parserErrorElem ? jQuery2.map(parserErrorElem.childNodes, function(el) {
return el.textContent;
}).join("\n") : data));
}
return xml;
};
var rbracket = /\[\]$/, rCRLF = /\r?\n/g, rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, rsubmittable = /^(?:input|select|textarea|keygen)/i;
function buildParams(prefix, obj, traditional, add2) {
var name;
if (Array.isArray(obj)) {
jQuery2.each(obj, function(i, v) {
if (traditional || rbracket.test(prefix)) {
add2(prefix, v);
} else {
buildParams(
prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]",
v,
traditional,
add2
);
}
});
} else if (!traditional && toType(obj) === "object") {
for (name in obj) {
buildParams(prefix + "[" + name + "]", obj[name], traditional, add2);
}
} else {
add2(prefix, obj);
}
}
jQuery2.param = function(a, traditional) {
var prefix, s = [], add2 = function(key, valueOrFunction) {
var value = isFunction2(valueOrFunction) ? valueOrFunction() : valueOrFunction;
s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value == null ? "" : value);
};
if (a == null) {
return "";
}
if (Array.isArray(a) || a.jquery && !jQuery2.isPlainObject(a)) {
jQuery2.each(a, function() {
add2(this.name, this.value);
});
} else {
for (prefix in a) {
buildParams(prefix, a[prefix], traditional, add2);
}
}
return s.join("&");
};
jQuery2.fn.extend({
serialize: function() {
return jQuery2.param(this.serializeArray());
},
serializeArray: function() {
return this.map(function() {
var elements = jQuery2.prop(this, "elements");
return elements ? jQuery2.makeArray(elements) : this;
}).filter(function() {
var type2 = this.type;
return this.name && !jQuery2(this).is(":disabled") && rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type2) && (this.checked || !rcheckableType.test(type2));
}).map(function(_i, elem) {
var val = jQuery2(this).val();
if (val == null) {
return null;
}
if (Array.isArray(val)) {
return jQuery2.map(val, function(val2) {
return { name: elem.name, value: val2.replace(rCRLF, "\r\n") };
});
}
return { name: elem.name, value: val.replace(rCRLF, "\r\n") };
}).get();
}
});
var r20 = /%20/g, rhash = /#.*$/, rantiCache = /([?&])_=[^&]*/, rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//, prefilters = {}, transports = {}, allTypes = "*/".concat("*"), originAnchor = document2.createElement("a");
originAnchor.href = location2.href;
function addToPrefiltersOrTransports(structure) {
return function(dataTypeExpression, func) {
if (typeof dataTypeExpression !== "string") {
func = dataTypeExpression;
dataTypeExpression = "*";
}
var dataType, i = 0, dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || [];
if (isFunction2(func)) {
while (dataType = dataTypes[i++]) {
if (dataType[0] === "+") {
dataType = dataType.slice(1) || "*";
(structure[dataType] = structure[dataType] || []).unshift(func);
} else {
(structure[dataType] = structure[dataType] || []).push(func);
}
}
}
};
}
function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
var inspected = {}, seekingTransport = structure === transports;
function inspect(dataType) {
var selected;
inspected[dataType] = true;
jQuery2.each(structure[dataType] || [], function(_, prefilterOrFactory) {
var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
options.dataTypes.unshift(dataTypeOrTransport);
inspect(dataTypeOrTransport);
return false;
} else if (seekingTransport) {
return !(selected = dataTypeOrTransport);
}
});
return selected;
}
return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
}
function ajaxExtend(target, src) {
var key, deep, flatOptions = jQuery2.ajaxSettings.flatOptions || {};
for (key in src) {
if (src[key] !== void 0) {
(flatOptions[key] ? target : deep || (deep = {}))[key] = src[key];
}
}
if (deep) {
jQuery2.extend(true, target, deep);
}
return target;
}
function ajaxHandleResponses(s, jqXHR, responses) {
var ct2, type2, finalDataType, firstDataType, contents = s.contents, dataTypes = s.dataTypes;
while (dataTypes[0] === "*") {
dataTypes.shift();
if (ct2 === void 0) {
ct2 = s.mimeType || jqXHR.getResponseHeader("Content-Type");
}
}
if (ct2) {
for (type2 in contents) {
if (contents[type2] && contents[type2].test(ct2)) {
dataTypes.unshift(type2);
break;
}
}
}
if (dataTypes[0] in responses) {
finalDataType = dataTypes[0];
} else {
for (type2 in responses) {
if (!dataTypes[0] || s.converters[type2 + " " + dataTypes[0]]) {
finalDataType = type2;
break;
}
if (!firstDataType) {
firstDataType = type2;
}
}
finalDataType = finalDataType || firstDataType;
}
if (finalDataType) {
if (finalDataType !== dataTypes[0]) {
dataTypes.unshift(finalDataType);
}
return responses[finalDataType];
}
}
function ajaxConvert(s, response, jqXHR, isSuccess) {
var conv2, current, conv, tmp, prev, converters = {}, dataTypes = s.dataTypes.slice();
if (dataTypes[1]) {
for (conv in s.converters) {
converters[conv.toLowerCase()] = s.converters[conv];
}
}
current = dataTypes.shift();
while (current) {
if (s.responseFields[current]) {
jqXHR[s.responseFields[current]] = response;
}
if (!prev && isSuccess && s.dataFilter) {
response = s.dataFilter(response, s.dataType);
}
prev = current;
current = dataTypes.shift();
if (current) {
if (current === "*") {
current = prev;
} else if (prev !== "*" && prev !== current) {
conv = converters[prev + " " + current] || converters["* " + current];
if (!conv) {
for (conv2 in converters) {
tmp = conv2.split(" ");
if (tmp[1] === current) {
conv = converters[prev + " " + tmp[0]] || converters["* " + tmp[0]];
if (conv) {
if (conv === true) {
conv = converters[conv2];
} else if (converters[conv2] !== true) {
current = tmp[0];
dataTypes.unshift(tmp[1]);
}
break;
}
}
}
}
if (conv !== true) {
if (conv && s.throws) {
response = conv(response);
} else {
try {
response = conv(response);
} catch (e) {
return {
state: "parsererror",
error: conv ? e : "No conversion from " + prev + " to " + current
};
}
}
}
}
}
}
return { state: "success", data: response };
}
jQuery2.extend({
// Counter for holding the number of active queries
active: 0,
// Last-Modified header cache for next request
lastModified: {},
etag: {},
ajaxSettings: {
url: location2.href,
type: "GET",
isLocal: rlocalProtocol.test(location2.protocol),
global: true,
processData: true,
async: true,
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
/*
timeout: 0,
data: null,
dataType: null,
username: null,
password: null,
cache: null,
throws: false,
traditional: false,
headers: {},
*/
accepts: {
"*": allTypes,
text: "text/plain",
html: "text/html",
xml: "application/xml, text/xml",
json: "application/json, text/javascript"
},
contents: {
xml: /\bxml\b/,
html: /\bhtml/,
json: /\bjson\b/
},
responseFields: {
xml: "responseXML",
text: "responseText",
json: "responseJSON"
},
// Data converters
// Keys separate source (or catchall "*") and destination types with a single space
converters: {
// Convert anything to text
"* text": String,
// Text to html (true = no transformation)
"text html": true,
// Evaluate text as a json expression
"text json": JSON.parse,
// Parse text as xml
"text xml": jQuery2.parseXML
},
// For options that shouldn't be deep extended:
// you can add your own custom options here if
// and when you create one that shouldn't be
// deep extended (see ajaxExtend)
flatOptions: {
url: true,
context: true
}
},
// Creates a full fledged settings object into target
// with both ajaxSettings and settings fields.
// If target is omitted, writes into ajaxSettings.
ajaxSetup: function(target, settings2) {
return settings2 ? (
// Building a settings object
ajaxExtend(ajaxExtend(target, jQuery2.ajaxSettings), settings2)
) : (
// Extending ajaxSettings
ajaxExtend(jQuery2.ajaxSettings, target)
);
},
ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
ajaxTransport: addToPrefiltersOrTransports(transports),
// Main method
ajax: function(url, options) {
if (typeof url === "object") {
options = url;
url = void 0;
}
options = options || {};
var transport, cacheURL, responseHeadersString, responseHeaders, timeoutTimer, urlAnchor, completed2, fireGlobals, i, uncached, s = jQuery2.ajaxSetup({}, options), callbackContext = s.context || s, globalEventContext = s.context && (callbackContext.nodeType || callbackContext.jquery) ? jQuery2(callbackContext) : jQuery2.event, deferred = jQuery2.Deferred(), completeDeferred = jQuery2.Callbacks("once memory"), statusCode = s.statusCode || {}, requestHeaders = {}, requestHeadersNames = {}, strAbort = "canceled", jqXHR = {
readyState: 0,
// Builds headers hashtable if needed
getResponseHeader: function(key) {
var match2;
if (completed2) {
if (!responseHeaders) {
responseHeaders = {};
while (match2 = rheaders.exec(responseHeadersString)) {
responseHeaders[match2[1].toLowerCase() + " "] = (responseHeaders[match2[1].toLowerCase() + " "] || []).concat(match2[2]);
}
}
match2 = responseHeaders[key.toLowerCase() + " "];
}
return match2 == null ? null : match2.join(", ");
},
// Raw string
getAllResponseHeaders: function() {
return completed2 ? responseHeadersString : null;
},
// Caches the header
setRequestHeader: function(name, value) {
if (completed2 == null) {
name = requestHeadersNames[name.toLowerCase()] = requestHeadersNames[name.toLowerCase()] || name;
requestHeaders[name] = value;
}
return this;
},
// Overrides response content-type header
overrideMimeType: function(type2) {
if (completed2 == null) {
s.mimeType = type2;
}
return this;
},
// Status-dependent callbacks
statusCode: function(map2) {
var code2;
if (map2) {
if (completed2) {
jqXHR.always(map2[jqXHR.status]);
} else {
for (code2 in map2) {
statusCode[code2] = [statusCode[code2], map2[code2]];
}
}
}
return this;
},
// Cancel the request
abort: function(statusText) {
var finalText = statusText || strAbort;
if (transport) {
transport.abort(finalText);
}
done(0, finalText);
return this;
}
};
deferred.promise(jqXHR);
s.url = ((url || s.url || location2.href) + "").replace(rprotocol, location2.protocol + "//");
s.type = options.method || options.type || s.method || s.type;
s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""];
if (s.crossDomain == null) {
urlAnchor = document2.createElement("a");
try {
urlAnchor.href = s.url;
urlAnchor.href = urlAnchor.href;
s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== urlAnchor.protocol + "//" + urlAnchor.host;
} catch (e) {
s.crossDomain = true;
}
}
if (s.data && s.processData && typeof s.data !== "string") {
s.data = jQuery2.param(s.data, s.traditional);
}
inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
if (completed2) {
return jqXHR;
}
fireGlobals = jQuery2.event && s.global;
if (fireGlobals && jQuery2.active++ === 0) {
jQuery2.event.trigger("ajaxStart");
}
s.type = s.type.toUpperCase();
s.hasContent = !rnoContent.test(s.type);
cacheURL = s.url.replace(rhash, "");
if (!s.hasContent) {
uncached = s.url.slice(cacheURL.length);
if (s.data && (s.processData || typeof s.data === "string")) {
cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data;
delete s.data;
}
if (s.cache === false) {
cacheURL = cacheURL.replace(rantiCache, "$1");
uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + nonce.guid++ + uncached;
}
s.url = cacheURL + uncached;
} else if (s.data && s.processData && (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) {
s.data = s.data.replace(r20, "+");
}
if (s.ifModified) {
if (jQuery2.lastModified[cacheURL]) {
jqXHR.setRequestHeader("If-Modified-Since", jQuery2.lastModified[cacheURL]);
}
if (jQuery2.etag[cacheURL]) {
jqXHR.setRequestHeader("If-None-Match", jQuery2.etag[cacheURL]);
}
}
if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
jqXHR.setRequestHeader("Content-Type", s.contentType);
}
jqXHR.setRequestHeader(
"Accept",
s.dataTypes[0] && s.accepts[s.dataTypes[0]] ? s.accepts[s.dataTypes[0]] + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") : s.accepts["*"]
);
for (i in s.headers) {
jqXHR.setRequestHeader(i, s.headers[i]);
}
if (s.beforeSend && (s.beforeSend.call(callbackContext, jqXHR, s) === false || completed2)) {
return jqXHR.abort();
}
strAbort = "abort";
completeDeferred.add(s.complete);
jqXHR.done(s.success);
jqXHR.fail(s.error);
transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
if (!transport) {
done(-1, "No Transport");
} else {
jqXHR.readyState = 1;
if (fireGlobals) {
globalEventContext.trigger("ajaxSend", [jqXHR, s]);
}
if (completed2) {
return jqXHR;
}
if (s.async && s.timeout > 0) {
timeoutTimer = window2.setTimeout(function() {
jqXHR.abort("timeout");
}, s.timeout);
}
try {
completed2 = false;
transport.send(requestHeaders, done);
} catch (e) {
if (completed2) {
throw e;
}
done(-1, e);
}
}
function done(status, nativeStatusText, responses, headers) {
var isSuccess, success, error, response, modified, statusText = nativeStatusText;
if (completed2) {
return;
}
completed2 = true;
if (timeoutTimer) {
window2.clearTimeout(timeoutTimer);
}
transport = void 0;
responseHeadersString = headers || "";
jqXHR.readyState = status > 0 ? 4 : 0;
isSuccess = status >= 200 && status < 300 || status === 304;
if (responses) {
response = ajaxHandleResponses(s, jqXHR, responses);
}
if (!isSuccess && jQuery2.inArray("script", s.dataTypes) > -1 && jQuery2.inArray("json", s.dataTypes) < 0) {
s.converters["text script"] = function() {
};
}
response = ajaxConvert(s, response, jqXHR, isSuccess);
if (isSuccess) {
if (s.ifModified) {
modified = jqXHR.getResponseHeader("Last-Modified");
if (modified) {
jQuery2.lastModified[cacheURL] = modified;
}
modified = jqXHR.getResponseHeader("etag");
if (modified) {
jQuery2.etag[cacheURL] = modified;
}
}
if (status === 204 || s.type === "HEAD") {
statusText = "nocontent";
} else if (status === 304) {
statusText = "notmodified";
} else {
statusText = response.state;
success = response.data;
error = response.error;
isSuccess = !error;
}
} else {
error = statusText;
if (status || !statusText) {
statusText = "error";
if (status < 0) {
status = 0;
}
}
}
jqXHR.status = status;
jqXHR.statusText = (nativeStatusText || statusText) + "";
if (isSuccess) {
deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
} else {
deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
}
jqXHR.statusCode(statusCode);
statusCode = void 0;
if (fireGlobals) {
globalEventContext.trigger(
isSuccess ? "ajaxSuccess" : "ajaxError",
[jqXHR, s, isSuccess ? success : error]
);
}
completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
if (fireGlobals) {
globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
if (!--jQuery2.active) {
jQuery2.event.trigger("ajaxStop");
}
}
}
return jqXHR;
},
getJSON: function(url, data, callback) {
return jQuery2.get(url, data, callback, "json");
},
getScript: function(url, callback) {
return jQuery2.get(url, void 0, callback, "script");
}
});
jQuery2.each(["get", "post"], function(_i, method2) {
jQuery2[method2] = function(url, data, callback, type2) {
if (isFunction2(data)) {
type2 = type2 || callback;
callback = data;
data = void 0;
}
return jQuery2.ajax(jQuery2.extend({
url,
type: method2,
dataType: type2,
data,
success: callback
}, jQuery2.isPlainObject(url) && url));
};
});
jQuery2.ajaxPrefilter(function(s) {
var i;
for (i in s.headers) {
if (i.toLowerCase() === "content-type") {
s.contentType = s.headers[i] || "";
}
}
});
jQuery2._evalUrl = function(url, options, doc2) {
return jQuery2.ajax({
url,
// Make this explicit, since user can override this through ajaxSetup (trac-11264)
type: "GET",
dataType: "script",
cache: true,
async: false,
global: false,
// Only evaluate the response if it is successful (gh-4126)
// dataFilter is not invoked for failure responses, so using it instead
// of the default converter is kludgy but it works.
converters: {
"text script": function() {
}
},
dataFilter: function(response) {
jQuery2.globalEval(response, options, doc2);
}
});
};
jQuery2.fn.extend({
wrapAll: function(html2) {
var wrap2;
if (this[0]) {
if (isFunction2(html2)) {
html2 = html2.call(this[0]);
}
wrap2 = jQuery2(html2, this[0].ownerDocument).eq(0).clone(true);
if (this[0].parentNode) {
wrap2.insertBefore(this[0]);
}
wrap2.map(function() {
var elem = this;
while (elem.firstElementChild) {
elem = elem.firstElementChild;
}
return elem;
}).append(this);
}
return this;
},
wrapInner: function(html2) {
if (isFunction2(html2)) {
return this.each(function(i) {
jQuery2(this).wrapInner(html2.call(this, i));
});
}
return this.each(function() {
var self2 = jQuery2(this), contents = self2.contents();
if (contents.length) {
contents.wrapAll(html2);
} else {
self2.append(html2);
}
});
},
wrap: function(html2) {
var htmlIsFunction = isFunction2(html2);
return this.each(function(i) {
jQuery2(this).wrapAll(htmlIsFunction ? html2.call(this, i) : html2);
});
},
unwrap: function(selector) {
this.parent(selector).not("body").each(function() {
jQuery2(this).replaceWith(this.childNodes);
});
return this;
}
});
jQuery2.expr.pseudos.hidden = function(elem) {
return !jQuery2.expr.pseudos.visible(elem);
};
jQuery2.expr.pseudos.visible = function(elem) {
return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length);
};
jQuery2.ajaxSettings.xhr = function() {
try {
return new window2.XMLHttpRequest();
} catch (e) {
}
};
var xhrSuccessStatus = {
// File protocol always yields status code 0, assume 200
0: 200,
// Support: IE <=9 only
// trac-1450: sometimes IE returns 1223 when it should be 204
1223: 204
}, xhrSupported = jQuery2.ajaxSettings.xhr();
support.cors = !!xhrSupported && "withCredentials" in xhrSupported;
support.ajax = xhrSupported = !!xhrSupported;
jQuery2.ajaxTransport(function(options) {
var callback, errorCallback;
if (support.cors || xhrSupported && !options.crossDomain) {
return {
send: function(headers, complete) {
var i, xhr = options.xhr();
xhr.open(
options.type,
options.url,
options.async,
options.username,
options.password
);
if (options.xhrFields) {
for (i in options.xhrFields) {
xhr[i] = options.xhrFields[i];
}
}
if (options.mimeType && xhr.overrideMimeType) {
xhr.overrideMimeType(options.mimeType);
}
if (!options.crossDomain && !headers["X-Requested-With"]) {
headers["X-Requested-With"] = "XMLHttpRequest";
}
for (i in headers) {
xhr.setRequestHeader(i, headers[i]);
}
callback = function(type2) {
return function() {
if (callback) {
callback = errorCallback = xhr.onload = xhr.onerror = xhr.onabort = xhr.ontimeout = xhr.onreadystatechange = null;
if (type2 === "abort") {
xhr.abort();
} else if (type2 === "error") {
if (typeof xhr.status !== "number") {
complete(0, "error");
} else {
complete(
// File: protocol always yields status 0; see trac-8605, trac-14207
xhr.status,
xhr.statusText
);
}
} else {
complete(
xhrSuccessStatus[xhr.status] || xhr.status,
xhr.statusText,
// Support: IE <=9 only
// IE9 has no XHR2 but throws on binary (trac-11426)
// For XHR2 non-text, let the caller handle it (gh-2498)
(xhr.responseType || "text") !== "text" || typeof xhr.responseText !== "string" ? { binary: xhr.response } : { text: xhr.responseText },
xhr.getAllResponseHeaders()
);
}
}
};
};
xhr.onload = callback();
errorCallback = xhr.onerror = xhr.ontimeout = callback("error");
if (xhr.onabort !== void 0) {
xhr.onabort = errorCallback;
} else {
xhr.onreadystatechange = function() {
if (xhr.readyState === 4) {
window2.setTimeout(function() {
if (callback) {
errorCallback();
}
});
}
};
}
callback = callback("abort");
try {
xhr.send(options.hasContent && options.data || null);
} catch (e) {
if (callback) {
throw e;
}
}
},
abort: function() {
if (callback) {
callback();
}
}
};
}
});
jQuery2.ajaxPrefilter(function(s) {
if (s.crossDomain) {
s.contents.script = false;
}
});
jQuery2.ajaxSetup({
accepts: {
script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
},
contents: {
script: /\b(?:java|ecma)script\b/
},
converters: {
"text script": function(text) {
jQuery2.globalEval(text);
return text;
}
}
});
jQuery2.ajaxPrefilter("script", function(s) {
if (s.cache === void 0) {
s.cache = false;
}
if (s.crossDomain) {
s.type = "GET";
}
});
jQuery2.ajaxTransport("script", function(s) {
if (s.crossDomain || s.scriptAttrs) {
var script, callback;
return {
send: function(_, complete) {
script = jQuery2("<script>").attr(s.scriptAttrs || {}).prop({ charset: s.scriptCharset, src: s.url }).on("load error", callback = function(evt) {
script.remove();
callback = null;
if (evt) {
complete(evt.type === "error" ? 404 : 200, evt.type);
}
});
document2.head.appendChild(script[0]);
},
abort: function() {
if (callback) {
callback();
}
}
};
}
});
var oldCallbacks = [], rjsonp = /(=)\?(?=&|$)|\?\?/;
jQuery2.ajaxSetup({
jsonp: "callback",
jsonpCallback: function() {
var callback = oldCallbacks.pop() || jQuery2.expando + "_" + nonce.guid++;
this[callback] = true;
return callback;
}
});
jQuery2.ajaxPrefilter("json jsonp", function(s, originalSettings, jqXHR) {
var callbackName, overwritten, responseContainer, jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ? "url" : typeof s.data === "string" && (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0 && rjsonp.test(s.data) && "data");
if (jsonProp || s.dataTypes[0] === "jsonp") {
callbackName = s.jsonpCallback = isFunction2(s.jsonpCallback) ? s.jsonpCallback() : s.jsonpCallback;
if (jsonProp) {
s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
} else if (s.jsonp !== false) {
s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
}
s.converters["script json"] = function() {
if (!responseContainer) {
jQuery2.error(callbackName + " was not called");
}
return responseContainer[0];
};
s.dataTypes[0] = "json";
overwritten = window2[callbackName];
window2[callbackName] = function() {
responseContainer = arguments;
};
jqXHR.always(function() {
if (overwritten === void 0) {
jQuery2(window2).removeProp(callbackName);
} else {
window2[callbackName] = overwritten;
}
if (s[callbackName]) {
s.jsonpCallback = originalSettings.jsonpCallback;
oldCallbacks.push(callbackName);
}
if (responseContainer && isFunction2(overwritten)) {
overwritten(responseContainer[0]);
}
responseContainer = overwritten = void 0;
});
return "script";
}
});
support.createHTMLDocument = function() {
var body = document2.implementation.createHTMLDocument("").body;
body.innerHTML = "<form></form><form></form>";
return body.childNodes.length === 2;
}();
jQuery2.parseHTML = function(data, context, keepScripts) {
if (typeof data !== "string") {
return [];
}
if (typeof context === "boolean") {
keepScripts = context;
context = false;
}
var base2, parsed, scripts;
if (!context) {
if (support.createHTMLDocument) {
context = document2.implementation.createHTMLDocument("");
base2 = context.createElement("base");
base2.href = document2.location.href;
context.head.appendChild(base2);
} else {
context = document2;
}
}
parsed = rsingleTag.exec(data);
scripts = !keepScripts && [];
if (parsed) {
return [context.createElement(parsed[1])];
}
parsed = buildFragment([data], context, scripts);
if (scripts && scripts.length) {
jQuery2(scripts).remove();
}
return jQuery2.merge([], parsed.childNodes);
};
jQuery2.fn.load = function(url, params, callback) {
var selector, type2, response, self2 = this, off = url.indexOf(" ");
if (off > -1) {
selector = stripAndCollapse(url.slice(off));
url = url.slice(0, off);
}
if (isFunction2(params)) {
callback = params;
params = void 0;
} else if (params && typeof params === "object") {
type2 = "POST";
}
if (self2.length > 0) {
jQuery2.ajax({
url,
// If "type" variable is undefined, then "GET" method will be used.
// Make value of this field explicit since
// user can override it through ajaxSetup method
type: type2 || "GET",
dataType: "html",
data: params
}).done(function(responseText) {
response = arguments;
self2.html(selector ? (
// If a selector was specified, locate the right elements in a dummy div
// Exclude scripts to avoid IE 'Permission Denied' errors
jQuery2("<div>").append(jQuery2.parseHTML(responseText)).find(selector)
) : (
// Otherwise use the full result
responseText
));
}).always(callback && function(jqXHR, status) {
self2.each(function() {
callback.apply(this, response || [jqXHR.responseText, status, jqXHR]);
});
});
}
return this;
};
jQuery2.expr.pseudos.animated = function(elem) {
return jQuery2.grep(jQuery2.timers, function(fn2) {
return elem === fn2.elem;
}).length;
};
jQuery2.offset = {
setOffset: function(elem, options, i) {
var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, position = jQuery2.css(elem, "position"), curElem = jQuery2(elem), props = {};
if (position === "static") {
elem.style.position = "relative";
}
curOffset = curElem.offset();
curCSSTop = jQuery2.css(elem, "top");
curCSSLeft = jQuery2.css(elem, "left");
calculatePosition = (position === "absolute" || position === "fixed") && (curCSSTop + curCSSLeft).indexOf("auto") > -1;
if (calculatePosition) {
curPosition = curElem.position();
curTop = curPosition.top;
curLeft = curPosition.left;
} else {
curTop = parseFloat(curCSSTop) || 0;
curLeft = parseFloat(curCSSLeft) || 0;
}
if (isFunction2(options)) {
options = options.call(elem, i, jQuery2.extend({}, curOffset));
}
if (options.top != null) {
props.top = options.top - curOffset.top + curTop;
}
if (options.left != null) {
props.left = options.left - curOffset.left + curLeft;
}
if ("using" in options) {
options.using.call(elem, props);
} else {
curElem.css(props);
}
}
};
jQuery2.fn.extend({
// offset() relates an element's border box to the document origin
offset: function(options) {
if (arguments.length) {
return options === void 0 ? this : this.each(function(i) {
jQuery2.offset.setOffset(this, options, i);
});
}
var rect, win, elem = this[0];
if (!elem) {
return;
}
if (!elem.getClientRects().length) {
return { top: 0, left: 0 };
}
rect = elem.getBoundingClientRect();
win = elem.ownerDocument.defaultView;
return {
top: rect.top + win.pageYOffset,
left: rect.left + win.pageXOffset
};
},
// position() relates an element's margin box to its offset parent's padding box
// This corresponds to the behavior of CSS absolute positioning
position: function() {
if (!this[0]) {
return;
}
var offsetParent, offset, doc2, elem = this[0], parentOffset = { top: 0, left: 0 };
if (jQuery2.css(elem, "position") === "fixed") {
offset = elem.getBoundingClientRect();
} else {
offset = this.offset();
doc2 = elem.ownerDocument;
offsetParent = elem.offsetParent || doc2.documentElement;
while (offsetParent && (offsetParent === doc2.body || offsetParent === doc2.documentElement) && jQuery2.css(offsetParent, "position") === "static") {
offsetParent = offsetParent.parentNode;
}
if (offsetParent && offsetParent !== elem && offsetParent.nodeType === 1) {
parentOffset = jQuery2(offsetParent).offset();
parentOffset.top += jQuery2.css(offsetParent, "borderTopWidth", true);
parentOffset.left += jQuery2.css(offsetParent, "borderLeftWidth", true);
}
}
return {
top: offset.top - parentOffset.top - jQuery2.css(elem, "marginTop", true),
left: offset.left - parentOffset.left - jQuery2.css(elem, "marginLeft", true)
};
},
// This method will return documentElement in the following cases:
// 1) For the element inside the iframe without offsetParent, this method will return
// documentElement of the parent window
// 2) For the hidden or detached element
// 3) For body or html element, i.e. in case of the html node - it will return itself
//
// but those exceptions were never presented as a real life use-cases
// and might be considered as more preferable results.
//
// This logic, however, is not guaranteed and can change at any point in the future
offsetParent: function() {
return this.map(function() {
var offsetParent = this.offsetParent;
while (offsetParent && jQuery2.css(offsetParent, "position") === "static") {
offsetParent = offsetParent.offsetParent;
}
return offsetParent || documentElement;
});
}
});
jQuery2.each({ scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function(method2, prop) {
var top = "pageYOffset" === prop;
jQuery2.fn[method2] = function(val) {
return access(this, function(elem, method3, val2) {
var win;
if (isWindow(elem)) {
win = elem;
} else if (elem.nodeType === 9) {
win = elem.defaultView;
}
if (val2 === void 0) {
return win ? win[prop] : elem[method3];
}
if (win) {
win.scrollTo(
!top ? val2 : win.pageXOffset,
top ? val2 : win.pageYOffset
);
} else {
elem[method3] = val2;
}
}, method2, val, arguments.length);
};
});
jQuery2.each(["top", "left"], function(_i, prop) {
jQuery2.cssHooks[prop] = addGetHookIf(
support.pixelPosition,
function(elem, computed2) {
if (computed2) {
computed2 = curCSS(elem, prop);
return rnumnonpx.test(computed2) ? jQuery2(elem).position()[prop] + "px" : computed2;
}
}
);
});
jQuery2.each({ Height: "height", Width: "width" }, function(name, type2) {
jQuery2.each({
padding: "inner" + name,
content: type2,
"": "outer" + name
}, function(defaultExtra, funcName) {
jQuery2.fn[funcName] = function(margin, value) {
var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"), extra = defaultExtra || (margin === true || value === true ? "margin" : "border");
return access(this, function(elem, type3, value2) {
var doc2;
if (isWindow(elem)) {
return funcName.indexOf("outer") === 0 ? elem["inner" + name] : elem.document.documentElement["client" + name];
}
if (elem.nodeType === 9) {
doc2 = elem.documentElement;
return Math.max(
elem.body["scroll" + name],
doc2["scroll" + name],
elem.body["offset" + name],
doc2["offset" + name],
doc2["client" + name]
);
}
return value2 === void 0 ? (
// Get width or height on the element, requesting but not forcing parseFloat
jQuery2.css(elem, type3, extra)
) : (
// Set width or height on the element
jQuery2.style(elem, type3, value2, extra)
);
}, type2, chainable ? margin : void 0, chainable);
};
});
});
jQuery2.each([
"ajaxStart",
"ajaxStop",
"ajaxComplete",
"ajaxError",
"ajaxSuccess",
"ajaxSend"
], function(_i, type2) {
jQuery2.fn[type2] = function(fn2) {
return this.on(type2, fn2);
};
});
jQuery2.fn.extend({
bind: function(types2, data, fn2) {
return this.on(types2, null, data, fn2);
},
unbind: function(types2, fn2) {
return this.off(types2, null, fn2);
},
delegate: function(selector, types2, data, fn2) {
return this.on(types2, selector, data, fn2);
},
undelegate: function(selector, types2, fn2) {
return arguments.length === 1 ? this.off(selector, "**") : this.off(types2, selector || "**", fn2);
},
hover: function(fnOver, fnOut) {
return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
}
});
jQuery2.each(
"blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),
function(_i, name) {
jQuery2.fn[name] = function(data, fn2) {
return arguments.length > 0 ? this.on(name, null, data, fn2) : this.trigger(name);
};
}
);
var rtrim = /^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;
jQuery2.proxy = function(fn2, context) {
var tmp, args, proxy2;
if (typeof context === "string") {
tmp = fn2[context];
context = fn2;
fn2 = tmp;
}
if (!isFunction2(fn2)) {
return void 0;
}
args = slice.call(arguments, 2);
proxy2 = function() {
return fn2.apply(context || this, args.concat(slice.call(arguments)));
};
proxy2.guid = fn2.guid = fn2.guid || jQuery2.guid++;
return proxy2;
};
jQuery2.holdReady = function(hold) {
if (hold) {
jQuery2.readyWait++;
} else {
jQuery2.ready(true);
}
};
jQuery2.isArray = Array.isArray;
jQuery2.parseJSON = JSON.parse;
jQuery2.nodeName = nodeName;
jQuery2.isFunction = isFunction2;
jQuery2.isWindow = isWindow;
jQuery2.camelCase = camelCase2;
jQuery2.type = toType;
jQuery2.now = Date.now;
jQuery2.isNumeric = function(obj) {
var type2 = jQuery2.type(obj);
return (type2 === "number" || type2 === "string") && // parseFloat NaNs numeric-cast false positives ("")
// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
// subtraction forces infinities to NaN
!isNaN(obj - parseFloat(obj));
};
jQuery2.trim = function(text) {
return text == null ? "" : (text + "").replace(rtrim, "$1");
};
var _jQuery = window2.jQuery, _$ = window2.$;
jQuery2.noConflict = function(deep) {
if (window2.$ === jQuery2) {
window2.$ = _$;
}
if (deep && window2.jQuery === jQuery2) {
window2.jQuery = _jQuery;
}
return jQuery2;
};
if (typeof noGlobal === "undefined") {
window2.jQuery = window2.$ = jQuery2;
}
return jQuery2;
});
})(jquery);
var jqueryExports = jquery.exports;
const $ = /* @__PURE__ */ getDefaultExportFromCjs(jqueryExports);
{
_monkeyWindow.jQuery = $;
}
/*!
* Copyright 2012, Chris Wanstrath
* Released under the MIT License
* https://github.com/defunkt/jquery-pjax
*/
(function($2) {
function fnPjax(selector, container, options) {
options = optionsFor(container, options);
return this.on("click.pjax", selector, function(event) {
var opts = options;
if (!opts.container) {
opts = $2.extend({}, options);
opts.container = $2(this).attr("data-pjax");
}
handleClick(event, opts);
});
}
function handleClick(event, container, options) {
options = optionsFor(container, options);
var link = event.currentTarget;
var $link = $2(link);
if (link.tagName.toUpperCase() !== "A")
throw "$.fn.pjax or $.pjax.click requires an anchor element";
if (event.which > 1 || event.metaKey || event.ctrlKey || event.shiftKey || event.altKey)
return;
if (location.protocol !== link.protocol || location.hostname !== link.hostname)
return;
if (link.href.indexOf("#") > -1 && stripHash(link) == stripHash(location))
return;
if (event.isDefaultPrevented())
return;
var defaults = {
url: link.href,
container: $link.attr("data-pjax"),
target: link
};
var opts = $2.extend({}, defaults, options);
var clickEvent = $2.Event("pjax:click");
$link.trigger(clickEvent, [opts]);
if (!clickEvent.isDefaultPrevented()) {
pjax(opts);
event.preventDefault();
$link.trigger("pjax:clicked", [opts]);
}
}
function handleSubmit(event, container, options) {
options = optionsFor(container, options);
var form = event.currentTarget;
var $form = $2(form);
if (form.tagName.toUpperCase() !== "FORM")
throw "$.pjax.submit requires a form element";
var defaults = {
type: ($form.attr("method") || "GET").toUpperCase(),
url: $form.attr("action"),
container: $form.attr("data-pjax"),
target: form
};
if (defaults.type !== "GET" && window.FormData !== void 0) {
defaults.data = new FormData(form);
defaults.processData = false;
defaults.contentType = false;
} else {
if ($form.find(":file").length) {
return;
}
defaults.data = $form.serializeArray();
}
pjax($2.extend({}, defaults, options));
event.preventDefault();
}
function pjax(options) {
options = $2.extend(true, {}, $2.ajaxSettings, pjax.defaults, options);
if ($2.isFunction(options.url)) {
options.url = options.url();
}
var hash = parseURL(options.url).hash;
var containerType = $2.type(options.container);
if (containerType !== "string") {
throw "expected string value for 'container' option; got " + containerType;
}
var context = options.context = $2(options.container);
if (!context.length) {
throw "the container selector '" + options.container + "' did not match anything";
}
if (!options.data)
options.data = {};
if ($2.isArray(options.data)) {
options.data.push({ name: "_pjax", value: options.container });
} else {
options.data._pjax = options.container;
}
function fire(type2, args, props) {
if (!props)
props = {};
props.relatedTarget = options.target;
var event = $2.Event(type2, props);
context.trigger(event, args);
return !event.isDefaultPrevented();
}
var timeoutTimer;
options.beforeSend = function(xhr2, settings2) {
if (settings2.type !== "GET") {
settings2.timeout = 0;
}
xhr2.setRequestHeader("X-PJAX", "true");
xhr2.setRequestHeader("X-PJAX-Container", options.container);
if (!fire("pjax:beforeSend", [xhr2, settings2]))
return false;
if (settings2.timeout > 0) {
timeoutTimer = setTimeout(function() {
if (fire("pjax:timeout", [xhr2, options]))
xhr2.abort("timeout");
}, settings2.timeout);
settings2.timeout = 0;
}
var url = parseURL(settings2.url);
if (hash)
url.hash = hash;
options.requestUrl = stripInternalParams(url);
};
options.complete = function(xhr2, textStatus) {
if (timeoutTimer)
clearTimeout(timeoutTimer);
fire("pjax:complete", [xhr2, textStatus, options]);
fire("pjax:end", [xhr2, options]);
};
options.error = function(xhr2, textStatus, errorThrown) {
var container = extractContainer("", xhr2, options);
var allowed = fire("pjax:error", [xhr2, textStatus, errorThrown, options]);
if (options.type == "GET" && textStatus !== "abort" && allowed) {
locationReplace(container.url);
}
};
options.success = function(data, status, xhr2) {
var previousState = pjax.state;
var currentVersion = typeof $2.pjax.defaults.version === "function" ? $2.pjax.defaults.version() : $2.pjax.defaults.version;
var latestVersion = xhr2.getResponseHeader("X-PJAX-Version");
var container = extractContainer(data, xhr2, options);
var url = parseURL(container.url);
if (hash) {
url.hash = hash;
container.url = url.href;
}
if (currentVersion && latestVersion && currentVersion !== latestVersion) {
locationReplace(container.url);
return;
}
if (!container.contents) {
locationReplace(container.url);
return;
}
pjax.state = {
id: options.id || uniqueId(),
url: container.url,
title: container.title,
container: options.container,
fragment: options.fragment,
timeout: options.timeout
};
if (options.push || options.replace) {
window.history.replaceState(pjax.state, container.title, container.url);
}
var blurFocus = $2.contains(context, document.activeElement);
if (blurFocus) {
try {
document.activeElement.blur();
} catch (e) {
}
}
if (container.title)
document.title = container.title;
fire("pjax:beforeReplace", [container.contents, options], {
state: pjax.state,
previousState
});
context.html(container.contents);
var autofocusEl = context.find("input[autofocus], textarea[autofocus]").last()[0];
if (autofocusEl && document.activeElement !== autofocusEl) {
autofocusEl.focus();
}
executeScriptTags(container.scripts);
var scrollTo = options.scrollTo;
if (hash) {
var name = decodeURIComponent(hash.slice(1));
var target = document.getElementById(name) || document.getElementsByName(name)[0];
if (target)
scrollTo = $2(target).offset().top;
}
if (typeof scrollTo == "number")
$2(window).scrollTop(scrollTo);
fire("pjax:success", [data, status, xhr2, options]);
};
if (!pjax.state) {
pjax.state = {
id: uniqueId(),
url: window.location.href,
title: document.title,
container: options.container,
fragment: options.fragment,
timeout: options.timeout
};
window.history.replaceState(pjax.state, document.title);
}
abortXHR(pjax.xhr);
pjax.options = options;
var xhr = pjax.xhr = $2.ajax(options);
if (xhr.readyState > 0) {
if (options.push && !options.replace) {
cachePush(pjax.state.id, [options.container, cloneContents(context)]);
window.history.pushState(null, "", options.requestUrl);
}
fire("pjax:start", [xhr, options]);
fire("pjax:send", [xhr, options]);
}
return pjax.xhr;
}
function pjaxReload(container, options) {
var defaults = {
url: window.location.href,
push: false,
replace: true,
scrollTo: false
};
return pjax($2.extend(defaults, optionsFor(container, options)));
}
function locationReplace(url) {
window.history.replaceState(null, "", pjax.state.url);
window.location.replace(url);
}
var initialPop = true;
var initialURL = window.location.href;
var initialState = window.history.state;
if (initialState && initialState.container) {
pjax.state = initialState;
}
if ("state" in window.history) {
initialPop = false;
}
function onPjaxPopstate(event) {
if (!initialPop) {
abortXHR(pjax.xhr);
}
var previousState = pjax.state;
var state = event.state;
var direction;
if (state && state.container) {
if (initialPop && initialURL == state.url)
return;
if (previousState) {
if (previousState.id === state.id)
return;
direction = previousState.id < state.id ? "forward" : "back";
}
var cache2 = cacheMapping[state.id] || [];
var containerSelector = cache2[0] || state.container;
var container = $2(containerSelector), contents = cache2[1];
if (container.length) {
if (previousState) {
cachePop(direction, previousState.id, [containerSelector, cloneContents(container)]);
}
var popstateEvent = $2.Event("pjax:popstate", {
state,
direction
});
container.trigger(popstateEvent);
var options = {
id: state.id,
url: state.url,
container: containerSelector,
push: false,
fragment: state.fragment,
timeout: state.timeout,
scrollTo: false
};
if (contents) {
container.trigger("pjax:start", [null, options]);
pjax.state = state;
if (state.title)
document.title = state.title;
var beforeReplaceEvent = $2.Event("pjax:beforeReplace", {
state,
previousState
});
container.trigger(beforeReplaceEvent, [contents, options]);
container.html(contents);
container.trigger("pjax:end", [null, options]);
} else {
pjax(options);
}
container[0].offsetHeight;
} else {
locationReplace(location.href);
}
}
initialPop = false;
}
function fallbackPjax(options) {
var url = $2.isFunction(options.url) ? options.url() : options.url, method2 = options.type ? options.type.toUpperCase() : "GET";
var form = $2("<form>", {
method: method2 === "GET" ? "GET" : "POST",
action: url,
style: "display:none"
});
if (method2 !== "GET" && method2 !== "POST") {
form.append($2("<input>", {
type: "hidden",
name: "_method",
value: method2.toLowerCase()
}));
}
var data = options.data;
if (typeof data === "string") {
$2.each(data.split("&"), function(index2, value) {
var pair = value.split("=");
form.append($2("<input>", { type: "hidden", name: pair[0], value: pair[1] }));
});
} else if ($2.isArray(data)) {
$2.each(data, function(index2, value) {
form.append($2("<input>", { type: "hidden", name: value.name, value: value.value }));
});
} else if (typeof data === "object") {
var key;
for (key in data)
form.append($2("<input>", { type: "hidden", name: key, value: data[key] }));
}
$2(document.body).append(form);
form.submit();
}
function abortXHR(xhr) {
if (xhr && xhr.readyState < 4) {
xhr.onreadystatechange = $2.noop;
xhr.abort();
}
}
function uniqueId() {
return (/* @__PURE__ */ new Date()).getTime();
}
function cloneContents(container) {
var cloned = container.clone();
cloned.find("script").each(function() {
if (!this.src)
$2._data(this, "globalEval", false);
});
return cloned.contents();
}
function stripInternalParams(url) {
url.search = url.search.replace(/([?&])(_pjax|_)=[^&]*/g, "").replace(/^&/, "");
return url.href.replace(/\?($|#)/, "$1");
}
function parseURL(url) {
var a = document.createElement("a");
a.href = url;
return a;
}
function stripHash(location2) {
return location2.href.replace(/#.*/, "");
}
function optionsFor(container, options) {
if (container && options) {
options = $2.extend({}, options);
options.container = container;
return options;
} else if ($2.isPlainObject(container)) {
return container;
} else {
return { container };
}
}
function findAll(elems, selector) {
return elems.filter(selector).add(elems.find(selector));
}
function parseHTML(html2) {
return $2.parseHTML(html2, document, true);
}
function extractContainer(data, xhr, options) {
var obj = {}, fullDocument = /<html/i.test(data);
var serverUrl = xhr.getResponseHeader("X-PJAX-URL");
obj.url = serverUrl ? stripInternalParams(parseURL(serverUrl)) : options.requestUrl;
var $head, $body;
if (fullDocument) {
$body = $2(parseHTML(data.match(/<body[^>]*>([\s\S.]*)<\/body>/i)[0]));
var head = data.match(/<head[^>]*>([\s\S.]*)<\/head>/i);
$head = head != null ? $2(parseHTML(head[0])) : $body;
} else {
$head = $body = $2(parseHTML(data));
}
if ($body.length === 0)
return obj;
obj.title = findAll($head, "title").last().text();
if (options.fragment) {
var $fragment = $body;
if (options.fragment !== "body") {
$fragment = findAll($fragment, options.fragment).first();
}
if ($fragment.length) {
obj.contents = options.fragment === "body" ? $fragment : $fragment.contents();
if (!obj.title)
obj.title = $fragment.attr("title") || $fragment.data("title");
}
} else if (!fullDocument) {
obj.contents = $body;
}
if (obj.contents) {
obj.contents = obj.contents.not(function() {
return $2(this).is("title");
});
obj.contents.find("title").remove();
obj.scripts = findAll(obj.contents, "script[src]").remove();
obj.contents = obj.contents.not(obj.scripts);
}
if (obj.title)
obj.title = $2.trim(obj.title);
return obj;
}
function executeScriptTags(scripts) {
if (!scripts)
return;
var existingScripts = $2("script[src]");
scripts.each(function() {
var src = this.src;
var matchedScripts = existingScripts.filter(function() {
return this.src === src;
});
if (matchedScripts.length)
return;
var script = document.createElement("script");
var type2 = $2(this).attr("type");
if (type2)
script.type = type2;
script.src = $2(this).attr("src");
document.head.appendChild(script);
});
}
var cacheMapping = {};
var cacheForwardStack = [];
var cacheBackStack = [];
function cachePush(id, value) {
cacheMapping[id] = value;
cacheBackStack.push(id);
trimCacheStack(cacheForwardStack, 0);
trimCacheStack(cacheBackStack, pjax.defaults.maxCacheLength);
}
function cachePop(direction, id, value) {
var pushStack, popStack;
cacheMapping[id] = value;
if (direction === "forward") {
pushStack = cacheBackStack;
popStack = cacheForwardStack;
} else {
pushStack = cacheForwardStack;
popStack = cacheBackStack;
}
pushStack.push(id);
id = popStack.pop();
if (id)
delete cacheMapping[id];
trimCacheStack(pushStack, pjax.defaults.maxCacheLength);
}
function trimCacheStack(stack, length) {
while (stack.length > length)
delete cacheMapping[stack.shift()];
}
function findVersion() {
return $2("meta").filter(function() {
var name = $2(this).attr("http-equiv");
return name && name.toUpperCase() === "X-PJAX-VERSION";
}).attr("content");
}
function enable() {
$2.fn.pjax = fnPjax;
$2.pjax = pjax;
$2.pjax.enable = $2.noop;
$2.pjax.disable = disable;
$2.pjax.click = handleClick;
$2.pjax.submit = handleSubmit;
$2.pjax.reload = pjaxReload;
$2.pjax.defaults = {
timeout: 650,
push: true,
replace: false,
type: "GET",
dataType: "html",
scrollTo: 0,
maxCacheLength: 20,
version: findVersion
};
$2(window).on("popstate.pjax", onPjaxPopstate);
}
function disable() {
$2.fn.pjax = function() {
return this;
};
$2.pjax = fallbackPjax;
$2.pjax.enable = enable;
$2.pjax.disable = $2.noop;
$2.pjax.click = $2.noop;
$2.pjax.submit = $2.noop;
$2.pjax.reload = function() {
window.location.reload();
};
$2(window).off("popstate.pjax", onPjaxPopstate);
}
if ($2.event.props && $2.inArray("state", $2.event.props) < 0) {
$2.event.props.push("state");
} else if (!("state" in $2.Event.prototype)) {
$2.event.addProp("state");
}
$2.support.pjax = window.history && window.history.pushState && window.history.replaceState && // pushState isn't reliable on iOS until 5.
!navigator.userAgent.match(/((iPod|iPhone|iPad).+\bOS\s+[1-4]\D|WebApps\/.+CFNetwork)/);
if ($2.support.pjax) {
enable();
} else {
disable();
}
})(jQuery);
function makeMap(str, expectsLowerCase) {
const map2 = /* @__PURE__ */ Object.create(null);
const list = str.split(",");
for (let i = 0; i < list.length; i++) {
map2[list[i]] = true;
}
return expectsLowerCase ? (val) => !!map2[val.toLowerCase()] : (val) => !!map2[val];
}
function normalizeStyle(value) {
if (isArray$3(value)) {
const res = {};
for (let i = 0; i < value.length; i++) {
const item = value[i];
const normalized = isString$2(item) ? parseStringStyle(item) : normalizeStyle(item);
if (normalized) {
for (const key in normalized) {
res[key] = normalized[key];
}
}
}
return res;
} else if (isString$2(value)) {
return value;
} else if (isObject$3(value)) {
return value;
}
}
const listDelimiterRE = /;(?![^(]*\))/g;
const propertyDelimiterRE = /:([^]+)/;
const styleCommentRE = /\/\*.*?\*\//gs;
function parseStringStyle(cssText) {
const ret = {};
cssText.replace(styleCommentRE, "").split(listDelimiterRE).forEach((item) => {
if (item) {
const tmp = item.split(propertyDelimiterRE);
tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim());
}
});
return ret;
}
function normalizeClass(value) {
let res = "";
if (isString$2(value)) {
res = value;
} else if (isArray$3(value)) {
for (let i = 0; i < value.length; i++) {
const normalized = normalizeClass(value[i]);
if (normalized) {
res += normalized + " ";
}
}
} else if (isObject$3(value)) {
for (const name in value) {
if (value[name]) {
res += name + " ";
}
}
}
return res.trim();
}
const specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`;
const isSpecialBooleanAttr = /* @__PURE__ */ makeMap(specialBooleanAttrs);
function includeBooleanAttr(value) {
return !!value || value === "";
}
function looseCompareArrays(a, b) {
if (a.length !== b.length)
return false;
let equal = true;
for (let i = 0; equal && i < a.length; i++) {
equal = looseEqual(a[i], b[i]);
}
return equal;
}
function looseEqual(a, b) {
if (a === b)
return true;
let aValidType = isDate$1(a);
let bValidType = isDate$1(b);
if (aValidType || bValidType) {
return aValidType && bValidType ? a.getTime() === b.getTime() : false;
}
aValidType = isSymbol$1(a);
bValidType = isSymbol$1(b);
if (aValidType || bValidType) {
return a === b;
}
aValidType = isArray$3(a);
bValidType = isArray$3(b);
if (aValidType || bValidType) {
return aValidType && bValidType ? looseCompareArrays(a, b) : false;
}
aValidType = isObject$3(a);
bValidType = isObject$3(b);
if (aValidType || bValidType) {
if (!aValidType || !bValidType) {
return false;
}
const aKeysCount = Object.keys(a).length;
const bKeysCount = Object.keys(b).length;
if (aKeysCount !== bKeysCount) {
return false;
}
for (const key in a) {
const aHasKey = a.hasOwnProperty(key);
const bHasKey = b.hasOwnProperty(key);
if (aHasKey && !bHasKey || !aHasKey && bHasKey || !looseEqual(a[key], b[key])) {
return false;
}
}
}
return String(a) === String(b);
}
function looseIndexOf(arr, val) {
return arr.findIndex((item) => looseEqual(item, val));
}
const toDisplayString$1 = (val) => {
return isString$2(val) ? val : val == null ? "" : isArray$3(val) || isObject$3(val) && (val.toString === objectToString$2 || !isFunction$2(val.toString)) ? JSON.stringify(val, replacer, 2) : String(val);
};
const replacer = (_key, val) => {
if (val && val.__v_isRef) {
return replacer(_key, val.value);
} else if (isMap$2(val)) {
return {
[`Map(${val.size})`]: [...val.entries()].reduce((entries, [key, val2]) => {
entries[`${key} =>`] = val2;
return entries;
}, {})
};
} else if (isSet$2(val)) {
return {
[`Set(${val.size})`]: [...val.values()]
};
} else if (isObject$3(val) && !isArray$3(val) && !isPlainObject$2(val)) {
return String(val);
}
return val;
};
const EMPTY_OBJ = {};
const EMPTY_ARR = [];
const NOOP = () => {
};
const NO = () => false;
const onRE = /^on[^a-z]/;
const isOn = (key) => onRE.test(key);
const isModelListener = (key) => key.startsWith("onUpdate:");
const extend = Object.assign;
const remove = (arr, el) => {
const i = arr.indexOf(el);
if (i > -1) {
arr.splice(i, 1);
}
};
const hasOwnProperty$h = Object.prototype.hasOwnProperty;
const hasOwn$1 = (val, key) => hasOwnProperty$h.call(val, key);
const isArray$3 = Array.isArray;
const isMap$2 = (val) => toTypeString$1(val) === "[object Map]";
const isSet$2 = (val) => toTypeString$1(val) === "[object Set]";
const isDate$1 = (val) => toTypeString$1(val) === "[object Date]";
const isFunction$2 = (val) => typeof val === "function";
const isString$2 = (val) => typeof val === "string";
const isSymbol$1 = (val) => typeof val === "symbol";
const isObject$3 = (val) => val !== null && typeof val === "object";
const isPromise = (val) => {
return isObject$3(val) && isFunction$2(val.then) && isFunction$2(val.catch);
};
const objectToString$2 = Object.prototype.toString;
const toTypeString$1 = (value) => objectToString$2.call(value);
const toRawType = (value) => {
return toTypeString$1(value).slice(8, -1);
};
const isPlainObject$2 = (val) => toTypeString$1(val) === "[object Object]";
const isIntegerKey = (key) => isString$2(key) && key !== "NaN" && key[0] !== "-" && "" + parseInt(key, 10) === key;
const isReservedProp = /* @__PURE__ */ makeMap(
// the leading comma is intentional so empty string "" is also included
",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted"
);
const cacheStringFunction = (fn2) => {
const cache2 = /* @__PURE__ */ Object.create(null);
return (str) => {
const hit = cache2[str];
return hit || (cache2[str] = fn2(str));
};
};
const camelizeRE = /-(\w)/g;
const camelize = cacheStringFunction((str) => {
return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : "");
});
const hyphenateRE = /\B([A-Z])/g;
const hyphenate = cacheStringFunction((str) => str.replace(hyphenateRE, "-$1").toLowerCase());
const capitalize$2 = cacheStringFunction((str) => str.charAt(0).toUpperCase() + str.slice(1));
const toHandlerKey = cacheStringFunction((str) => str ? `on${capitalize$2(str)}` : ``);
const hasChanged = (value, oldValue) => !Object.is(value, oldValue);
const invokeArrayFns = (fns, arg) => {
for (let i = 0; i < fns.length; i++) {
fns[i](arg);
}
};
const def = (obj, key, value) => {
Object.defineProperty(obj, key, {
configurable: true,
enumerable: false,
value
});
};
const looseToNumber = (val) => {
const n = parseFloat(val);
return isNaN(n) ? val : n;
};
const toNumber$1 = (val) => {
const n = isString$2(val) ? Number(val) : NaN;
return isNaN(n) ? val : n;
};
let _globalThis$1;
const getGlobalThis$1 = () => {
return _globalThis$1 || (_globalThis$1 = typeof globalThis !== "undefined" ? globalThis : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : {});
};
let activeEffectScope;
class EffectScope {
constructor(detached = false) {
this.detached = detached;
this._active = true;
this.effects = [];
this.cleanups = [];
this.parent = activeEffectScope;
if (!detached && activeEffectScope) {
this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(this) - 1;
}
}
get active() {
return this._active;
}
run(fn2) {
if (this._active) {
const currentEffectScope = activeEffectScope;
try {
activeEffectScope = this;
return fn2();
} finally {
activeEffectScope = currentEffectScope;
}
}
}
/**
* This should only be called on non-detached scopes
* @internal
*/
on() {
activeEffectScope = this;
}
/**
* This should only be called on non-detached scopes
* @internal
*/
off() {
activeEffectScope = this.parent;
}
stop(fromParent) {
if (this._active) {
let i, l;
for (i = 0, l = this.effects.length; i < l; i++) {
this.effects[i].stop();
}
for (i = 0, l = this.cleanups.length; i < l; i++) {
this.cleanups[i]();
}
if (this.scopes) {
for (i = 0, l = this.scopes.length; i < l; i++) {
this.scopes[i].stop(true);
}
}
if (!this.detached && this.parent && !fromParent) {
const last2 = this.parent.scopes.pop();
if (last2 && last2 !== this) {
this.parent.scopes[this.index] = last2;
last2.index = this.index;
}
}
this.parent = void 0;
this._active = false;
}
}
}
function effectScope(detached) {
return new EffectScope(detached);
}
function recordEffectScope(effect, scope = activeEffectScope) {
if (scope && scope.active) {
scope.effects.push(effect);
}
}
function getCurrentScope() {
return activeEffectScope;
}
function onScopeDispose(fn2) {
if (activeEffectScope) {
activeEffectScope.cleanups.push(fn2);
}
}
const createDep = (effects) => {
const dep = new Set(effects);
dep.w = 0;
dep.n = 0;
return dep;
};
const wasTracked = (dep) => (dep.w & trackOpBit) > 0;
const newTracked = (dep) => (dep.n & trackOpBit) > 0;
const initDepMarkers = ({ deps }) => {
if (deps.length) {
for (let i = 0; i < deps.length; i++) {
deps[i].w |= trackOpBit;
}
}
};
const finalizeDepMarkers = (effect) => {
const { deps } = effect;
if (deps.length) {
let ptr = 0;
for (let i = 0; i < deps.length; i++) {
const dep = deps[i];
if (wasTracked(dep) && !newTracked(dep)) {
dep.delete(effect);
} else {
deps[ptr++] = dep;
}
dep.w &= ~trackOpBit;
dep.n &= ~trackOpBit;
}
deps.length = ptr;
}
};
const targetMap = /* @__PURE__ */ new WeakMap();
let effectTrackDepth = 0;
let trackOpBit = 1;
const maxMarkerBits = 30;
let activeEffect;
const ITERATE_KEY = Symbol("");
const MAP_KEY_ITERATE_KEY = Symbol("");
class ReactiveEffect {
constructor(fn2, scheduler = null, scope) {
this.fn = fn2;
this.scheduler = scheduler;
this.active = true;
this.deps = [];
this.parent = void 0;
recordEffectScope(this, scope);
}
run() {
if (!this.active) {
return this.fn();
}
let parent = activeEffect;
let lastShouldTrack = shouldTrack;
while (parent) {
if (parent === this) {
return;
}
parent = parent.parent;
}
try {
this.parent = activeEffect;
activeEffect = this;
shouldTrack = true;
trackOpBit = 1 << ++effectTrackDepth;
if (effectTrackDepth <= maxMarkerBits) {
initDepMarkers(this);
} else {
cleanupEffect(this);
}
return this.fn();
} finally {
if (effectTrackDepth <= maxMarkerBits) {
finalizeDepMarkers(this);
}
trackOpBit = 1 << --effectTrackDepth;
activeEffect = this.parent;
shouldTrack = lastShouldTrack;
this.parent = void 0;
if (this.deferStop) {
this.stop();
}
}
}
stop() {
if (activeEffect === this) {
this.deferStop = true;
} else if (this.active) {
cleanupEffect(this);
if (this.onStop) {
this.onStop();
}
this.active = false;
}
}
}
function cleanupEffect(effect) {
const { deps } = effect;
if (deps.length) {
for (let i = 0; i < deps.length; i++) {
deps[i].delete(effect);
}
deps.length = 0;
}
}
let shouldTrack = true;
const trackStack = [];
function pauseTracking() {
trackStack.push(shouldTrack);
shouldTrack = false;
}
function resetTracking() {
const last2 = trackStack.pop();
shouldTrack = last2 === void 0 ? true : last2;
}
function track(target, type2, key) {
if (shouldTrack && activeEffect) {
let depsMap = targetMap.get(target);
if (!depsMap) {
targetMap.set(target, depsMap = /* @__PURE__ */ new Map());
}
let dep = depsMap.get(key);
if (!dep) {
depsMap.set(key, dep = createDep());
}
trackEffects(dep);
}
}
function trackEffects(dep, debuggerEventExtraInfo) {
let shouldTrack2 = false;
if (effectTrackDepth <= maxMarkerBits) {
if (!newTracked(dep)) {
dep.n |= trackOpBit;
shouldTrack2 = !wasTracked(dep);
}
} else {
shouldTrack2 = !dep.has(activeEffect);
}
if (shouldTrack2) {
dep.add(activeEffect);
activeEffect.deps.push(dep);
}
}
function trigger(target, type2, key, newValue, oldValue, oldTarget) {
const depsMap = targetMap.get(target);
if (!depsMap) {
return;
}
let deps = [];
if (type2 === "clear") {
deps = [...depsMap.values()];
} else if (key === "length" && isArray$3(target)) {
const newLength = Number(newValue);
depsMap.forEach((dep, key2) => {
if (key2 === "length" || key2 >= newLength) {
deps.push(dep);
}
});
} else {
if (key !== void 0) {
deps.push(depsMap.get(key));
}
switch (type2) {
case "add":
if (!isArray$3(target)) {
deps.push(depsMap.get(ITERATE_KEY));
if (isMap$2(target)) {
deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
}
} else if (isIntegerKey(key)) {
deps.push(depsMap.get("length"));
}
break;
case "delete":
if (!isArray$3(target)) {
deps.push(depsMap.get(ITERATE_KEY));
if (isMap$2(target)) {
deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
}
}
break;
case "set":
if (isMap$2(target)) {
deps.push(depsMap.get(ITERATE_KEY));
}
break;
}
}
if (deps.length === 1) {
if (deps[0]) {
{
triggerEffects(deps[0]);
}
}
} else {
const effects = [];
for (const dep of deps) {
if (dep) {
effects.push(...dep);
}
}
{
triggerEffects(createDep(effects));
}
}
}
function triggerEffects(dep, debuggerEventExtraInfo) {
const effects = isArray$3(dep) ? dep : [...dep];
for (const effect of effects) {
if (effect.computed) {
triggerEffect(effect);
}
}
for (const effect of effects) {
if (!effect.computed) {
triggerEffect(effect);
}
}
}
function triggerEffect(effect, debuggerEventExtraInfo) {
if (effect !== activeEffect || effect.allowRecurse) {
if (effect.scheduler) {
effect.scheduler();
} else {
effect.run();
}
}
}
function getDepFromReactive(object2, key) {
var _a2;
return (_a2 = targetMap.get(object2)) === null || _a2 === void 0 ? void 0 : _a2.get(key);
}
const isNonTrackableKeys = /* @__PURE__ */ makeMap(`__proto__,__v_isRef,__isVue`);
const builtInSymbols = new Set(
/* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((key) => key !== "arguments" && key !== "caller").map((key) => Symbol[key]).filter(isSymbol$1)
);
const get$1 = /* @__PURE__ */ createGetter();
const shallowGet = /* @__PURE__ */ createGetter(false, true);
const readonlyGet = /* @__PURE__ */ createGetter(true);
const arrayInstrumentations = /* @__PURE__ */ createArrayInstrumentations();
function createArrayInstrumentations() {
const instrumentations = {};
["includes", "indexOf", "lastIndexOf"].forEach((key) => {
instrumentations[key] = function(...args) {
const arr = toRaw(this);
for (let i = 0, l = this.length; i < l; i++) {
track(arr, "get", i + "");
}
const res = arr[key](...args);
if (res === -1 || res === false) {
return arr[key](...args.map(toRaw));
} else {
return res;
}
};
});
["push", "pop", "shift", "unshift", "splice"].forEach((key) => {
instrumentations[key] = function(...args) {
pauseTracking();
const res = toRaw(this)[key].apply(this, args);
resetTracking();
return res;
};
});
return instrumentations;
}
function hasOwnProperty$g(key) {
const obj = toRaw(this);
track(obj, "has", key);
return obj.hasOwnProperty(key);
}
function createGetter(isReadonly2 = false, shallow = false) {
return function get2(target, key, receiver) {
if (key === "__v_isReactive") {
return !isReadonly2;
} else if (key === "__v_isReadonly") {
return isReadonly2;
} else if (key === "__v_isShallow") {
return shallow;
} else if (key === "__v_raw" && receiver === (isReadonly2 ? shallow ? shallowReadonlyMap : readonlyMap : shallow ? shallowReactiveMap : reactiveMap).get(target)) {
return target;
}
const targetIsArray = isArray$3(target);
if (!isReadonly2) {
if (targetIsArray && hasOwn$1(arrayInstrumentations, key)) {
return Reflect.get(arrayInstrumentations, key, receiver);
}
if (key === "hasOwnProperty") {
return hasOwnProperty$g;
}
}
const res = Reflect.get(target, key, receiver);
if (isSymbol$1(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) {
return res;
}
if (!isReadonly2) {
track(target, "get", key);
}
if (shallow) {
return res;
}
if (isRef(res)) {
return targetIsArray && isIntegerKey(key) ? res : res.value;
}
if (isObject$3(res)) {
return isReadonly2 ? readonly(res) : reactive(res);
}
return res;
};
}
const set$1 = /* @__PURE__ */ createSetter();
const shallowSet = /* @__PURE__ */ createSetter(true);
function createSetter(shallow = false) {
return function set2(target, key, value, receiver) {
let oldValue = target[key];
if (isReadonly(oldValue) && isRef(oldValue) && !isRef(value)) {
return false;
}
if (!shallow) {
if (!isShallow(value) && !isReadonly(value)) {
oldValue = toRaw(oldValue);
value = toRaw(value);
}
if (!isArray$3(target) && isRef(oldValue) && !isRef(value)) {
oldValue.value = value;
return true;
}
}
const hadKey = isArray$3(target) && isIntegerKey(key) ? Number(key) < target.length : hasOwn$1(target, key);
const result = Reflect.set(target, key, value, receiver);
if (target === toRaw(receiver)) {
if (!hadKey) {
trigger(target, "add", key, value);
} else if (hasChanged(value, oldValue)) {
trigger(target, "set", key, value);
}
}
return result;
};
}
function deleteProperty(target, key) {
const hadKey = hasOwn$1(target, key);
target[key];
const result = Reflect.deleteProperty(target, key);
if (result && hadKey) {
trigger(target, "delete", key, void 0);
}
return result;
}
function has$1(target, key) {
const result = Reflect.has(target, key);
if (!isSymbol$1(key) || !builtInSymbols.has(key)) {
track(target, "has", key);
}
return result;
}
function ownKeys(target) {
track(target, "iterate", isArray$3(target) ? "length" : ITERATE_KEY);
return Reflect.ownKeys(target);
}
const mutableHandlers = {
get: get$1,
set: set$1,
deleteProperty,
has: has$1,
ownKeys
};
const readonlyHandlers = {
get: readonlyGet,
set(target, key) {
return true;
},
deleteProperty(target, key) {
return true;
}
};
const shallowReactiveHandlers = /* @__PURE__ */ extend({}, mutableHandlers, {
get: shallowGet,
set: shallowSet
});
const toShallow = (value) => value;
const getProto = (v) => Reflect.getPrototypeOf(v);
function get$2(target, key, isReadonly2 = false, isShallow2 = false) {
target = target[
"__v_raw"
/* ReactiveFlags.RAW */
];
const rawTarget = toRaw(target);
const rawKey = toRaw(key);
if (!isReadonly2) {
if (key !== rawKey) {
track(rawTarget, "get", key);
}
track(rawTarget, "get", rawKey);
}
const { has: has2 } = getProto(rawTarget);
const wrap2 = isShallow2 ? toShallow : isReadonly2 ? toReadonly : toReactive;
if (has2.call(rawTarget, key)) {
return wrap2(target.get(key));
} else if (has2.call(rawTarget, rawKey)) {
return wrap2(target.get(rawKey));
} else if (target !== rawTarget) {
target.get(key);
}
}
function has(key, isReadonly2 = false) {
const target = this[
"__v_raw"
/* ReactiveFlags.RAW */
];
const rawTarget = toRaw(target);
const rawKey = toRaw(key);
if (!isReadonly2) {
if (key !== rawKey) {
track(rawTarget, "has", key);
}
track(rawTarget, "has", rawKey);
}
return key === rawKey ? target.has(key) : target.has(key) || target.has(rawKey);
}
function size(target, isReadonly2 = false) {
target = target[
"__v_raw"
/* ReactiveFlags.RAW */
];
!isReadonly2 && track(toRaw(target), "iterate", ITERATE_KEY);
return Reflect.get(target, "size", target);
}
function add(value) {
value = toRaw(value);
const target = toRaw(this);
const proto = getProto(target);
const hadKey = proto.has.call(target, value);
if (!hadKey) {
target.add(value);
trigger(target, "add", value, value);
}
return this;
}
function set$2(key, value) {
value = toRaw(value);
const target = toRaw(this);
const { has: has2, get: get2 } = getProto(target);
let hadKey = has2.call(target, key);
if (!hadKey) {
key = toRaw(key);
hadKey = has2.call(target, key);
}
const oldValue = get2.call(target, key);
target.set(key, value);
if (!hadKey) {
trigger(target, "add", key, value);
} else if (hasChanged(value, oldValue)) {
trigger(target, "set", key, value);
}
return this;
}
function deleteEntry(key) {
const target = toRaw(this);
const { has: has2, get: get2 } = getProto(target);
let hadKey = has2.call(target, key);
if (!hadKey) {
key = toRaw(key);
hadKey = has2.call(target, key);
}
get2 ? get2.call(target, key) : void 0;
const result = target.delete(key);
if (hadKey) {
trigger(target, "delete", key, void 0);
}
return result;
}
function clear() {
const target = toRaw(this);
const hadItems = target.size !== 0;
const result = target.clear();
if (hadItems) {
trigger(target, "clear", void 0, void 0);
}
return result;
}
function createForEach(isReadonly2, isShallow2) {
return function forEach2(callback, thisArg) {
const observed = this;
const target = observed[
"__v_raw"
/* ReactiveFlags.RAW */
];
const rawTarget = toRaw(target);
const wrap2 = isShallow2 ? toShallow : isReadonly2 ? toReadonly : toReactive;
!isReadonly2 && track(rawTarget, "iterate", ITERATE_KEY);
return target.forEach((value, key) => {
return callback.call(thisArg, wrap2(value), wrap2(key), observed);
});
};
}
function createIterableMethod(method2, isReadonly2, isShallow2) {
return function(...args) {
const target = this[
"__v_raw"
/* ReactiveFlags.RAW */
];
const rawTarget = toRaw(target);
const targetIsMap = isMap$2(rawTarget);
const isPair = method2 === "entries" || method2 === Symbol.iterator && targetIsMap;
const isKeyOnly = method2 === "keys" && targetIsMap;
const innerIterator = target[method2](...args);
const wrap2 = isShallow2 ? toShallow : isReadonly2 ? toReadonly : toReactive;
!isReadonly2 && track(rawTarget, "iterate", isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY);
return {
// iterator protocol
next() {
const { value, done } = innerIterator.next();
return done ? { value, done } : {
value: isPair ? [wrap2(value[0]), wrap2(value[1])] : wrap2(value),
done
};
},
// iterable protocol
[Symbol.iterator]() {
return this;
}
};
};
}
function createReadonlyMethod(type2) {
return function(...args) {
return type2 === "delete" ? false : this;
};
}
function createInstrumentations() {
const mutableInstrumentations2 = {
get(key) {
return get$2(this, key);
},
get size() {
return size(this);
},
has,
add,
set: set$2,
delete: deleteEntry,
clear,
forEach: createForEach(false, false)
};
const shallowInstrumentations2 = {
get(key) {
return get$2(this, key, false, true);
},
get size() {
return size(this);
},
has,
add,
set: set$2,
delete: deleteEntry,
clear,
forEach: createForEach(false, true)
};
const readonlyInstrumentations2 = {
get(key) {
return get$2(this, key, true);
},
get size() {
return size(this, true);
},
has(key) {
return has.call(this, key, true);
},
add: createReadonlyMethod(
"add"
/* TriggerOpTypes.ADD */
),
set: createReadonlyMethod(
"set"
/* TriggerOpTypes.SET */
),
delete: createReadonlyMethod(
"delete"
/* TriggerOpTypes.DELETE */
),
clear: createReadonlyMethod(
"clear"
/* TriggerOpTypes.CLEAR */
),
forEach: createForEach(true, false)
};
const shallowReadonlyInstrumentations2 = {
get(key) {
return get$2(this, key, true, true);
},
get size() {
return size(this, true);
},
has(key) {
return has.call(this, key, true);
},
add: createReadonlyMethod(
"add"
/* TriggerOpTypes.ADD */
),
set: createReadonlyMethod(
"set"
/* TriggerOpTypes.SET */
),
delete: createReadonlyMethod(
"delete"
/* TriggerOpTypes.DELETE */
),
clear: createReadonlyMethod(
"clear"
/* TriggerOpTypes.CLEAR */
),
forEach: createForEach(true, true)
};
const iteratorMethods = ["keys", "values", "entries", Symbol.iterator];
iteratorMethods.forEach((method2) => {
mutableInstrumentations2[method2] = createIterableMethod(method2, false, false);
readonlyInstrumentations2[method2] = createIterableMethod(method2, true, false);
shallowInstrumentations2[method2] = createIterableMethod(method2, false, true);
shallowReadonlyInstrumentations2[method2] = createIterableMethod(method2, true, true);
});
return [
mutableInstrumentations2,
readonlyInstrumentations2,
shallowInstrumentations2,
shallowReadonlyInstrumentations2
];
}
const [mutableInstrumentations, readonlyInstrumentations, shallowInstrumentations, shallowReadonlyInstrumentations] = /* @__PURE__ */ createInstrumentations();
function createInstrumentationGetter(isReadonly2, shallow) {
const instrumentations = shallow ? isReadonly2 ? shallowReadonlyInstrumentations : shallowInstrumentations : isReadonly2 ? readonlyInstrumentations : mutableInstrumentations;
return (target, key, receiver) => {
if (key === "__v_isReactive") {
return !isReadonly2;
} else if (key === "__v_isReadonly") {
return isReadonly2;
} else if (key === "__v_raw") {
return target;
}
return Reflect.get(hasOwn$1(instrumentations, key) && key in target ? instrumentations : target, key, receiver);
};
}
const mutableCollectionHandlers = {
get: /* @__PURE__ */ createInstrumentationGetter(false, false)
};
const shallowCollectionHandlers = {
get: /* @__PURE__ */ createInstrumentationGetter(false, true)
};
const readonlyCollectionHandlers = {
get: /* @__PURE__ */ createInstrumentationGetter(true, false)
};
const reactiveMap = /* @__PURE__ */ new WeakMap();
const shallowReactiveMap = /* @__PURE__ */ new WeakMap();
const readonlyMap = /* @__PURE__ */ new WeakMap();
const shallowReadonlyMap = /* @__PURE__ */ new WeakMap();
function targetTypeMap(rawType) {
switch (rawType) {
case "Object":
case "Array":
return 1;
case "Map":
case "Set":
case "WeakMap":
case "WeakSet":
return 2;
default:
return 0;
}
}
function getTargetType(value) {
return value[
"__v_skip"
/* ReactiveFlags.SKIP */
] || !Object.isExtensible(value) ? 0 : targetTypeMap(toRawType(value));
}
function reactive(target) {
if (isReadonly(target)) {
return target;
}
return createReactiveObject(target, false, mutableHandlers, mutableCollectionHandlers, reactiveMap);
}
function shallowReactive(target) {
return createReactiveObject(target, false, shallowReactiveHandlers, shallowCollectionHandlers, shallowReactiveMap);
}
function readonly(target) {
return createReactiveObject(target, true, readonlyHandlers, readonlyCollectionHandlers, readonlyMap);
}
function createReactiveObject(target, isReadonly2, baseHandlers, collectionHandlers, proxyMap) {
if (!isObject$3(target)) {
return target;
}
if (target[
"__v_raw"
/* ReactiveFlags.RAW */
] && !(isReadonly2 && target[
"__v_isReactive"
/* ReactiveFlags.IS_REACTIVE */
])) {
return target;
}
const existingProxy = proxyMap.get(target);
if (existingProxy) {
return existingProxy;
}
const targetType = getTargetType(target);
if (targetType === 0) {
return target;
}
const proxy2 = new Proxy(target, targetType === 2 ? collectionHandlers : baseHandlers);
proxyMap.set(target, proxy2);
return proxy2;
}
function isReactive(value) {
if (isReadonly(value)) {
return isReactive(value[
"__v_raw"
/* ReactiveFlags.RAW */
]);
}
return !!(value && value[
"__v_isReactive"
/* ReactiveFlags.IS_REACTIVE */
]);
}
function isReadonly(value) {
return !!(value && value[
"__v_isReadonly"
/* ReactiveFlags.IS_READONLY */
]);
}
function isShallow(value) {
return !!(value && value[
"__v_isShallow"
/* ReactiveFlags.IS_SHALLOW */
]);
}
function isProxy(value) {
return isReactive(value) || isReadonly(value);
}
function toRaw(observed) {
const raw = observed && observed[
"__v_raw"
/* ReactiveFlags.RAW */
];
return raw ? toRaw(raw) : observed;
}
function markRaw(value) {
def(value, "__v_skip", true);
return value;
}
const toReactive = (value) => isObject$3(value) ? reactive(value) : value;
const toReadonly = (value) => isObject$3(value) ? readonly(value) : value;
function trackRefValue(ref2) {
if (shouldTrack && activeEffect) {
ref2 = toRaw(ref2);
{
trackEffects(ref2.dep || (ref2.dep = createDep()));
}
}
}
function triggerRefValue(ref2, newVal) {
ref2 = toRaw(ref2);
const dep = ref2.dep;
if (dep) {
{
triggerEffects(dep);
}
}
}
function isRef(r) {
return !!(r && r.__v_isRef === true);
}
function ref(value) {
return createRef(value, false);
}
function shallowRef(value) {
return createRef(value, true);
}
function createRef(rawValue, shallow) {
if (isRef(rawValue)) {
return rawValue;
}
return new RefImpl(rawValue, shallow);
}
class RefImpl {
constructor(value, __v_isShallow) {
this.__v_isShallow = __v_isShallow;
this.dep = void 0;
this.__v_isRef = true;
this._rawValue = __v_isShallow ? value : toRaw(value);
this._value = __v_isShallow ? value : toReactive(value);
}
get value() {
trackRefValue(this);
return this._value;
}
set value(newVal) {
const useDirectValue = this.__v_isShallow || isShallow(newVal) || isReadonly(newVal);
newVal = useDirectValue ? newVal : toRaw(newVal);
if (hasChanged(newVal, this._rawValue)) {
this._rawValue = newVal;
this._value = useDirectValue ? newVal : toReactive(newVal);
triggerRefValue(this);
}
}
}
function triggerRef(ref2) {
triggerRefValue(ref2);
}
function unref(ref2) {
return isRef(ref2) ? ref2.value : ref2;
}
const shallowUnwrapHandlers = {
get: (target, key, receiver) => unref(Reflect.get(target, key, receiver)),
set: (target, key, value, receiver) => {
const oldValue = target[key];
if (isRef(oldValue) && !isRef(value)) {
oldValue.value = value;
return true;
} else {
return Reflect.set(target, key, value, receiver);
}
}
};
function proxyRefs(objectWithRefs) {
return isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers);
}
function toRefs(object2) {
const ret = isArray$3(object2) ? new Array(object2.length) : {};
for (const key in object2) {
ret[key] = toRef(object2, key);
}
return ret;
}
class ObjectRefImpl {
constructor(_object, _key, _defaultValue) {
this._object = _object;
this._key = _key;
this._defaultValue = _defaultValue;
this.__v_isRef = true;
}
get value() {
const val = this._object[this._key];
return val === void 0 ? this._defaultValue : val;
}
set value(newVal) {
this._object[this._key] = newVal;
}
get dep() {
return getDepFromReactive(toRaw(this._object), this._key);
}
}
function toRef(object2, key, defaultValue) {
const val = object2[key];
return isRef(val) ? val : new ObjectRefImpl(object2, key, defaultValue);
}
var _a$1;
class ComputedRefImpl {
constructor(getter, _setter, isReadonly2, isSSR) {
this._setter = _setter;
this.dep = void 0;
this.__v_isRef = true;
this[_a$1] = false;
this._dirty = true;
this.effect = new ReactiveEffect(getter, () => {
if (!this._dirty) {
this._dirty = true;
triggerRefValue(this);
}
});
this.effect.computed = this;
this.effect.active = this._cacheable = !isSSR;
this[
"__v_isReadonly"
/* ReactiveFlags.IS_READONLY */
] = isReadonly2;
}
get value() {
const self2 = toRaw(this);
trackRefValue(self2);
if (self2._dirty || !self2._cacheable) {
self2._dirty = false;
self2._value = self2.effect.run();
}
return self2._value;
}
set value(newValue) {
this._setter(newValue);
}
}
_a$1 = "__v_isReadonly";
function computed$1(getterOrOptions, debugOptions, isSSR = false) {
let getter;
let setter;
const onlyGetter = isFunction$2(getterOrOptions);
if (onlyGetter) {
getter = getterOrOptions;
setter = NOOP;
} else {
getter = getterOrOptions.get;
setter = getterOrOptions.set;
}
const cRef = new ComputedRefImpl(getter, setter, onlyGetter || !setter, isSSR);
return cRef;
}
function warn$1(msg, ...args) {
return;
}
function callWithErrorHandling(fn2, instance, type2, args) {
let res;
try {
res = args ? fn2(...args) : fn2();
} catch (err) {
handleError(err, instance, type2);
}
return res;
}
function callWithAsyncErrorHandling(fn2, instance, type2, args) {
if (isFunction$2(fn2)) {
const res = callWithErrorHandling(fn2, instance, type2, args);
if (res && isPromise(res)) {
res.catch((err) => {
handleError(err, instance, type2);
});
}
return res;
}
const values2 = [];
for (let i = 0; i < fn2.length; i++) {
values2.push(callWithAsyncErrorHandling(fn2[i], instance, type2, args));
}
return values2;
}
function handleError(err, instance, type2, throwInDev = true) {
const contextVNode = instance ? instance.vnode : null;
if (instance) {
let cur = instance.parent;
const exposedInstance = instance.proxy;
const errorInfo = type2;
while (cur) {
const errorCapturedHooks = cur.ec;
if (errorCapturedHooks) {
for (let i = 0; i < errorCapturedHooks.length; i++) {
if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) {
return;
}
}
}
cur = cur.parent;
}
const appErrorHandler = instance.appContext.config.errorHandler;
if (appErrorHandler) {
callWithErrorHandling(appErrorHandler, null, 10, [err, exposedInstance, errorInfo]);
return;
}
}
logError(err, type2, contextVNode, throwInDev);
}
function logError(err, type2, contextVNode, throwInDev = true) {
{
console.error(err);
}
}
let isFlushing = false;
let isFlushPending = false;
const queue = [];
let flushIndex = 0;
const pendingPostFlushCbs = [];
let activePostFlushCbs = null;
let postFlushIndex = 0;
const resolvedPromise = /* @__PURE__ */ Promise.resolve();
let currentFlushPromise = null;
function nextTick(fn2) {
const p2 = currentFlushPromise || resolvedPromise;
return fn2 ? p2.then(this ? fn2.bind(this) : fn2) : p2;
}
function findInsertionIndex(id) {
let start = flushIndex + 1;
let end2 = queue.length;
while (start < end2) {
const middle = start + end2 >>> 1;
const middleJobId = getId(queue[middle]);
middleJobId < id ? start = middle + 1 : end2 = middle;
}
return start;
}
function queueJob(job) {
if (!queue.length || !queue.includes(job, isFlushing && job.allowRecurse ? flushIndex + 1 : flushIndex)) {
if (job.id == null) {
queue.push(job);
} else {
queue.splice(findInsertionIndex(job.id), 0, job);
}
queueFlush();
}
}
function queueFlush() {
if (!isFlushing && !isFlushPending) {
isFlushPending = true;
currentFlushPromise = resolvedPromise.then(flushJobs);
}
}
function invalidateJob(job) {
const i = queue.indexOf(job);
if (i > flushIndex) {
queue.splice(i, 1);
}
}
function queuePostFlushCb(cb) {
if (!isArray$3(cb)) {
if (!activePostFlushCbs || !activePostFlushCbs.includes(cb, cb.allowRecurse ? postFlushIndex + 1 : postFlushIndex)) {
pendingPostFlushCbs.push(cb);
}
} else {
pendingPostFlushCbs.push(...cb);
}
queueFlush();
}
function flushPreFlushCbs(seen, i = isFlushing ? flushIndex + 1 : 0) {
for (; i < queue.length; i++) {
const cb = queue[i];
if (cb && cb.pre) {
queue.splice(i, 1);
i--;
cb();
}
}
}
function flushPostFlushCbs(seen) {
if (pendingPostFlushCbs.length) {
const deduped = [...new Set(pendingPostFlushCbs)];
pendingPostFlushCbs.length = 0;
if (activePostFlushCbs) {
activePostFlushCbs.push(...deduped);
return;
}
activePostFlushCbs = deduped;
activePostFlushCbs.sort((a, b) => getId(a) - getId(b));
for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {
activePostFlushCbs[postFlushIndex]();
}
activePostFlushCbs = null;
postFlushIndex = 0;
}
}
const getId = (job) => job.id == null ? Infinity : job.id;
const comparator = (a, b) => {
const diff = getId(a) - getId(b);
if (diff === 0) {
if (a.pre && !b.pre)
return -1;
if (b.pre && !a.pre)
return 1;
}
return diff;
};
function flushJobs(seen) {
isFlushPending = false;
isFlushing = true;
queue.sort(comparator);
try {
for (flushIndex = 0; flushIndex < queue.length; flushIndex++) {
const job = queue[flushIndex];
if (job && job.active !== false) {
if (false)
;
callWithErrorHandling(
job,
null,
14
/* ErrorCodes.SCHEDULER */
);
}
}
} finally {
flushIndex = 0;
queue.length = 0;
flushPostFlushCbs();
isFlushing = false;
currentFlushPromise = null;
if (queue.length || pendingPostFlushCbs.length) {
flushJobs();
}
}
}
function emit(instance, event, ...rawArgs) {
if (instance.isUnmounted)
return;
const props = instance.vnode.props || EMPTY_OBJ;
let args = rawArgs;
const isModelListener2 = event.startsWith("update:");
const modelArg = isModelListener2 && event.slice(7);
if (modelArg && modelArg in props) {
const modifiersKey = `${modelArg === "modelValue" ? "model" : modelArg}Modifiers`;
const { number: number2, trim } = props[modifiersKey] || EMPTY_OBJ;
if (trim) {
args = rawArgs.map((a) => isString$2(a) ? a.trim() : a);
}
if (number2) {
args = rawArgs.map(looseToNumber);
}
}
let handlerName;
let handler = props[handlerName = toHandlerKey(event)] || // also try camelCase event handler (#2249)
props[handlerName = toHandlerKey(camelize(event))];
if (!handler && isModelListener2) {
handler = props[handlerName = toHandlerKey(hyphenate(event))];
}
if (handler) {
callWithAsyncErrorHandling(handler, instance, 6, args);
}
const onceHandler = props[handlerName + `Once`];
if (onceHandler) {
if (!instance.emitted) {
instance.emitted = {};
} else if (instance.emitted[handlerName]) {
return;
}
instance.emitted[handlerName] = true;
callWithAsyncErrorHandling(onceHandler, instance, 6, args);
}
}
function normalizeEmitsOptions(comp, appContext, asMixin = false) {
const cache2 = appContext.emitsCache;
const cached = cache2.get(comp);
if (cached !== void 0) {
return cached;
}
const raw = comp.emits;
let normalized = {};
let hasExtends = false;
if (!isFunction$2(comp)) {
const extendEmits = (raw2) => {
const normalizedFromExtend = normalizeEmitsOptions(raw2, appContext, true);
if (normalizedFromExtend) {
hasExtends = true;
extend(normalized, normalizedFromExtend);
}
};
if (!asMixin && appContext.mixins.length) {
appContext.mixins.forEach(extendEmits);
}
if (comp.extends) {
extendEmits(comp.extends);
}
if (comp.mixins) {
comp.mixins.forEach(extendEmits);
}
}
if (!raw && !hasExtends) {
if (isObject$3(comp)) {
cache2.set(comp, null);
}
return null;
}
if (isArray$3(raw)) {
raw.forEach((key) => normalized[key] = null);
} else {
extend(normalized, raw);
}
if (isObject$3(comp)) {
cache2.set(comp, normalized);
}
return normalized;
}
function isEmitListener(options, key) {
if (!options || !isOn(key)) {
return false;
}
key = key.slice(2).replace(/Once$/, "");
return hasOwn$1(options, key[0].toLowerCase() + key.slice(1)) || hasOwn$1(options, hyphenate(key)) || hasOwn$1(options, key);
}
let currentRenderingInstance = null;
let currentScopeId = null;
function setCurrentRenderingInstance(instance) {
const prev = currentRenderingInstance;
currentRenderingInstance = instance;
currentScopeId = instance && instance.type.__scopeId || null;
return prev;
}
function pushScopeId(id) {
currentScopeId = id;
}
function popScopeId() {
currentScopeId = null;
}
function withCtx(fn2, ctx = currentRenderingInstance, isNonScopedSlot) {
if (!ctx)
return fn2;
if (fn2._n) {
return fn2;
}
const renderFnWithContext = (...args) => {
if (renderFnWithContext._d) {
setBlockTracking(-1);
}
const prevInstance = setCurrentRenderingInstance(ctx);
let res;
try {
res = fn2(...args);
} finally {
setCurrentRenderingInstance(prevInstance);
if (renderFnWithContext._d) {
setBlockTracking(1);
}
}
return res;
};
renderFnWithContext._n = true;
renderFnWithContext._c = true;
renderFnWithContext._d = true;
return renderFnWithContext;
}
function markAttrsAccessed() {
}
function renderComponentRoot(instance) {
const { type: Component, vnode, proxy: proxy2, withProxy, props, propsOptions: [propsOptions], slots, attrs, emit: emit2, render: render2, renderCache, data, setupState, ctx, inheritAttrs } = instance;
let result;
let fallthroughAttrs;
const prev = setCurrentRenderingInstance(instance);
try {
if (vnode.shapeFlag & 4) {
const proxyToUse = withProxy || proxy2;
result = normalizeVNode(render2.call(proxyToUse, proxyToUse, renderCache, props, setupState, data, ctx));
fallthroughAttrs = attrs;
} else {
const render3 = Component;
if (false)
;
result = normalizeVNode(render3.length > 1 ? render3(props, false ? {
get attrs() {
markAttrsAccessed();
return attrs;
},
slots,
emit: emit2
} : { attrs, slots, emit: emit2 }) : render3(
props,
null
/* we know it doesn't need it */
));
fallthroughAttrs = Component.props ? attrs : getFunctionalFallthrough(attrs);
}
} catch (err) {
blockStack.length = 0;
handleError(
err,
instance,
1
/* ErrorCodes.RENDER_FUNCTION */
);
result = createVNode(Comment);
}
let root2 = result;
if (fallthroughAttrs && inheritAttrs !== false) {
const keys2 = Object.keys(fallthroughAttrs);
const { shapeFlag } = root2;
if (keys2.length) {
if (shapeFlag & (1 | 6)) {
if (propsOptions && keys2.some(isModelListener)) {
fallthroughAttrs = filterModelListeners(fallthroughAttrs, propsOptions);
}
root2 = cloneVNode(root2, fallthroughAttrs);
}
}
}
if (vnode.dirs) {
root2 = cloneVNode(root2);
root2.dirs = root2.dirs ? root2.dirs.concat(vnode.dirs) : vnode.dirs;
}
if (vnode.transition) {
root2.transition = vnode.transition;
}
{
result = root2;
}
setCurrentRenderingInstance(prev);
return result;
}
const getFunctionalFallthrough = (attrs) => {
let res;
for (const key in attrs) {
if (key === "class" || key === "style" || isOn(key)) {
(res || (res = {}))[key] = attrs[key];
}
}
return res;
};
const filterModelListeners = (attrs, props) => {
const res = {};
for (const key in attrs) {
if (!isModelListener(key) || !(key.slice(9) in props)) {
res[key] = attrs[key];
}
}
return res;
};
function shouldUpdateComponent(prevVNode, nextVNode, optimized) {
const { props: prevProps, children: prevChildren, component } = prevVNode;
const { props: nextProps, children: nextChildren, patchFlag } = nextVNode;
const emits = component.emitsOptions;
if (nextVNode.dirs || nextVNode.transition) {
return true;
}
if (optimized && patchFlag >= 0) {
if (patchFlag & 1024) {
return true;
}
if (patchFlag & 16) {
if (!prevProps) {
return !!nextProps;
}
return hasPropsChanged(prevProps, nextProps, emits);
} else if (patchFlag & 8) {
const dynamicProps = nextVNode.dynamicProps;
for (let i = 0; i < dynamicProps.length; i++) {
const key = dynamicProps[i];
if (nextProps[key] !== prevProps[key] && !isEmitListener(emits, key)) {
return true;
}
}
}
} else {
if (prevChildren || nextChildren) {
if (!nextChildren || !nextChildren.$stable) {
return true;
}
}
if (prevProps === nextProps) {
return false;
}
if (!prevProps) {
return !!nextProps;
}
if (!nextProps) {
return true;
}
return hasPropsChanged(prevProps, nextProps, emits);
}
return false;
}
function hasPropsChanged(prevProps, nextProps, emitsOptions) {
const nextKeys = Object.keys(nextProps);
if (nextKeys.length !== Object.keys(prevProps).length) {
return true;
}
for (let i = 0; i < nextKeys.length; i++) {
const key = nextKeys[i];
if (nextProps[key] !== prevProps[key] && !isEmitListener(emitsOptions, key)) {
return true;
}
}
return false;
}
function updateHOCHostEl({ vnode, parent }, el) {
while (parent && parent.subTree === vnode) {
(vnode = parent.vnode).el = el;
parent = parent.parent;
}
}
const isSuspense = (type2) => type2.__isSuspense;
function queueEffectWithSuspense(fn2, suspense) {
if (suspense && suspense.pendingBranch) {
if (isArray$3(fn2)) {
suspense.effects.push(...fn2);
} else {
suspense.effects.push(fn2);
}
} else {
queuePostFlushCb(fn2);
}
}
function provide(key, value) {
if (!currentInstance)
;
else {
let provides = currentInstance.provides;
const parentProvides = currentInstance.parent && currentInstance.parent.provides;
if (parentProvides === provides) {
provides = currentInstance.provides = Object.create(parentProvides);
}
provides[key] = value;
}
}
function inject(key, defaultValue, treatDefaultAsFactory = false) {
const instance = currentInstance || currentRenderingInstance;
if (instance) {
const provides = instance.parent == null ? instance.vnode.appContext && instance.vnode.appContext.provides : instance.parent.provides;
if (provides && key in provides) {
return provides[key];
} else if (arguments.length > 1) {
return treatDefaultAsFactory && isFunction$2(defaultValue) ? defaultValue.call(instance.proxy) : defaultValue;
} else
;
}
}
function watchEffect(effect, options) {
return doWatch(effect, null, options);
}
const INITIAL_WATCHER_VALUE = {};
function watch(source, cb, options) {
return doWatch(source, cb, options);
}
function doWatch(source, cb, { immediate, deep, flush, onTrack, onTrigger } = EMPTY_OBJ) {
const instance = getCurrentScope() === (currentInstance === null || currentInstance === void 0 ? void 0 : currentInstance.scope) ? currentInstance : null;
let getter;
let forceTrigger = false;
let isMultiSource = false;
if (isRef(source)) {
getter = () => source.value;
forceTrigger = isShallow(source);
} else if (isReactive(source)) {
getter = () => source;
deep = true;
} else if (isArray$3(source)) {
isMultiSource = true;
forceTrigger = source.some((s) => isReactive(s) || isShallow(s));
getter = () => source.map((s) => {
if (isRef(s)) {
return s.value;
} else if (isReactive(s)) {
return traverse(s);
} else if (isFunction$2(s)) {
return callWithErrorHandling(
s,
instance,
2
/* ErrorCodes.WATCH_GETTER */
);
} else
;
});
} else if (isFunction$2(source)) {
if (cb) {
getter = () => callWithErrorHandling(
source,
instance,
2
/* ErrorCodes.WATCH_GETTER */
);
} else {
getter = () => {
if (instance && instance.isUnmounted) {
return;
}
if (cleanup) {
cleanup();
}
return callWithAsyncErrorHandling(source, instance, 3, [onCleanup]);
};
}
} else {
getter = NOOP;
}
if (cb && deep) {
const baseGetter = getter;
getter = () => traverse(baseGetter());
}
let cleanup;
let onCleanup = (fn2) => {
cleanup = effect.onStop = () => {
callWithErrorHandling(
fn2,
instance,
4
/* ErrorCodes.WATCH_CLEANUP */
);
};
};
let ssrCleanup;
if (isInSSRComponentSetup) {
onCleanup = NOOP;
if (!cb) {
getter();
} else if (immediate) {
callWithAsyncErrorHandling(cb, instance, 3, [
getter(),
isMultiSource ? [] : void 0,
onCleanup
]);
}
if (flush === "sync") {
const ctx = useSSRContext();
ssrCleanup = ctx.__watcherHandles || (ctx.__watcherHandles = []);
} else {
return NOOP;
}
}
let oldValue = isMultiSource ? new Array(source.length).fill(INITIAL_WATCHER_VALUE) : INITIAL_WATCHER_VALUE;
const job = () => {
if (!effect.active) {
return;
}
if (cb) {
const newValue = effect.run();
if (deep || forceTrigger || (isMultiSource ? newValue.some((v, i) => hasChanged(v, oldValue[i])) : hasChanged(newValue, oldValue)) || false) {
if (cleanup) {
cleanup();
}
callWithAsyncErrorHandling(cb, instance, 3, [
newValue,
// pass undefined as the old value when it's changed for the first time
oldValue === INITIAL_WATCHER_VALUE ? void 0 : isMultiSource && oldValue[0] === INITIAL_WATCHER_VALUE ? [] : oldValue,
onCleanup
]);
oldValue = newValue;
}
} else {
effect.run();
}
};
job.allowRecurse = !!cb;
let scheduler;
if (flush === "sync") {
scheduler = job;
} else if (flush === "post") {
scheduler = () => queuePostRenderEffect(job, instance && instance.suspense);
} else {
job.pre = true;
if (instance)
job.id = instance.uid;
scheduler = () => queueJob(job);
}
const effect = new ReactiveEffect(getter, scheduler);
if (cb) {
if (immediate) {
job();
} else {
oldValue = effect.run();
}
} else if (flush === "post") {
queuePostRenderEffect(effect.run.bind(effect), instance && instance.suspense);
} else {
effect.run();
}
const unwatch = () => {
effect.stop();
if (instance && instance.scope) {
remove(instance.scope.effects, effect);
}
};
if (ssrCleanup)
ssrCleanup.push(unwatch);
return unwatch;
}
function instanceWatch(source, value, options) {
const publicThis = this.proxy;
const getter = isString$2(source) ? source.includes(".") ? createPathGetter(publicThis, source) : () => publicThis[source] : source.bind(publicThis, publicThis);
let cb;
if (isFunction$2(value)) {
cb = value;
} else {
cb = value.handler;
options = value;
}
const cur = currentInstance;
setCurrentInstance(this);
const res = doWatch(getter, cb.bind(publicThis), options);
if (cur) {
setCurrentInstance(cur);
} else {
unsetCurrentInstance();
}
return res;
}
function createPathGetter(ctx, path) {
const segments = path.split(".");
return () => {
let cur = ctx;
for (let i = 0; i < segments.length && cur; i++) {
cur = cur[segments[i]];
}
return cur;
};
}
function traverse(value, seen) {
if (!isObject$3(value) || value[
"__v_skip"
/* ReactiveFlags.SKIP */
]) {
return value;
}
seen = seen || /* @__PURE__ */ new Set();
if (seen.has(value)) {
return value;
}
seen.add(value);
if (isRef(value)) {
traverse(value.value, seen);
} else if (isArray$3(value)) {
for (let i = 0; i < value.length; i++) {
traverse(value[i], seen);
}
} else if (isSet$2(value) || isMap$2(value)) {
value.forEach((v) => {
traverse(v, seen);
});
} else if (isPlainObject$2(value)) {
for (const key in value) {
traverse(value[key], seen);
}
}
return value;
}
function useTransitionState() {
const state = {
isMounted: false,
isLeaving: false,
isUnmounting: false,
leavingVNodes: /* @__PURE__ */ new Map()
};
onMounted(() => {
state.isMounted = true;
});
onBeforeUnmount(() => {
state.isUnmounting = true;
});
return state;
}
const TransitionHookValidator = [Function, Array];
const BaseTransitionImpl = {
name: `BaseTransition`,
props: {
mode: String,
appear: Boolean,
persisted: Boolean,
// enter
onBeforeEnter: TransitionHookValidator,
onEnter: TransitionHookValidator,
onAfterEnter: TransitionHookValidator,
onEnterCancelled: TransitionHookValidator,
// leave
onBeforeLeave: TransitionHookValidator,
onLeave: TransitionHookValidator,
onAfterLeave: TransitionHookValidator,
onLeaveCancelled: TransitionHookValidator,
// appear
onBeforeAppear: TransitionHookValidator,
onAppear: TransitionHookValidator,
onAfterAppear: TransitionHookValidator,
onAppearCancelled: TransitionHookValidator
},
setup(props, { slots }) {
const instance = getCurrentInstance();
const state = useTransitionState();
let prevTransitionKey;
return () => {
const children = slots.default && getTransitionRawChildren(slots.default(), true);
if (!children || !children.length) {
return;
}
let child = children[0];
if (children.length > 1) {
for (const c of children) {
if (c.type !== Comment) {
child = c;
break;
}
}
}
const rawProps = toRaw(props);
const { mode } = rawProps;
if (state.isLeaving) {
return emptyPlaceholder(child);
}
const innerChild = getKeepAliveChild(child);
if (!innerChild) {
return emptyPlaceholder(child);
}
const enterHooks = resolveTransitionHooks(innerChild, rawProps, state, instance);
setTransitionHooks(innerChild, enterHooks);
const oldChild = instance.subTree;
const oldInnerChild = oldChild && getKeepAliveChild(oldChild);
let transitionKeyChanged = false;
const { getTransitionKey } = innerChild.type;
if (getTransitionKey) {
const key = getTransitionKey();
if (prevTransitionKey === void 0) {
prevTransitionKey = key;
} else if (key !== prevTransitionKey) {
prevTransitionKey = key;
transitionKeyChanged = true;
}
}
if (oldInnerChild && oldInnerChild.type !== Comment && (!isSameVNodeType(innerChild, oldInnerChild) || transitionKeyChanged)) {
const leavingHooks = resolveTransitionHooks(oldInnerChild, rawProps, state, instance);
setTransitionHooks(oldInnerChild, leavingHooks);
if (mode === "out-in") {
state.isLeaving = true;
leavingHooks.afterLeave = () => {
state.isLeaving = false;
if (instance.update.active !== false) {
instance.update();
}
};
return emptyPlaceholder(child);
} else if (mode === "in-out" && innerChild.type !== Comment) {
leavingHooks.delayLeave = (el, earlyRemove, delayedLeave) => {
const leavingVNodesCache = getLeavingNodesForType(state, oldInnerChild);
leavingVNodesCache[String(oldInnerChild.key)] = oldInnerChild;
el._leaveCb = () => {
earlyRemove();
el._leaveCb = void 0;
delete enterHooks.delayedLeave;
};
enterHooks.delayedLeave = delayedLeave;
};
}
}
return child;
};
}
};
const BaseTransition = BaseTransitionImpl;
function getLeavingNodesForType(state, vnode) {
const { leavingVNodes } = state;
let leavingVNodesCache = leavingVNodes.get(vnode.type);
if (!leavingVNodesCache) {
leavingVNodesCache = /* @__PURE__ */ Object.create(null);
leavingVNodes.set(vnode.type, leavingVNodesCache);
}
return leavingVNodesCache;
}
function resolveTransitionHooks(vnode, props, state, instance) {
const { appear, mode, persisted = false, onBeforeEnter, onEnter, onAfterEnter, onEnterCancelled, onBeforeLeave, onLeave, onAfterLeave, onLeaveCancelled, onBeforeAppear, onAppear, onAfterAppear, onAppearCancelled } = props;
const key = String(vnode.key);
const leavingVNodesCache = getLeavingNodesForType(state, vnode);
const callHook2 = (hook, args) => {
hook && callWithAsyncErrorHandling(hook, instance, 9, args);
};
const callAsyncHook = (hook, args) => {
const done = args[1];
callHook2(hook, args);
if (isArray$3(hook)) {
if (hook.every((hook2) => hook2.length <= 1))
done();
} else if (hook.length <= 1) {
done();
}
};
const hooks = {
mode,
persisted,
beforeEnter(el) {
let hook = onBeforeEnter;
if (!state.isMounted) {
if (appear) {
hook = onBeforeAppear || onBeforeEnter;
} else {
return;
}
}
if (el._leaveCb) {
el._leaveCb(
true
/* cancelled */
);
}
const leavingVNode = leavingVNodesCache[key];
if (leavingVNode && isSameVNodeType(vnode, leavingVNode) && leavingVNode.el._leaveCb) {
leavingVNode.el._leaveCb();
}
callHook2(hook, [el]);
},
enter(el) {
let hook = onEnter;
let afterHook = onAfterEnter;
let cancelHook = onEnterCancelled;
if (!state.isMounted) {
if (appear) {
hook = onAppear || onEnter;
afterHook = onAfterAppear || onAfterEnter;
cancelHook = onAppearCancelled || onEnterCancelled;
} else {
return;
}
}
let called = false;
const done = el._enterCb = (cancelled) => {
if (called)
return;
called = true;
if (cancelled) {
callHook2(cancelHook, [el]);
} else {
callHook2(afterHook, [el]);
}
if (hooks.delayedLeave) {
hooks.delayedLeave();
}
el._enterCb = void 0;
};
if (hook) {
callAsyncHook(hook, [el, done]);
} else {
done();
}
},
leave(el, remove2) {
const key2 = String(vnode.key);
if (el._enterCb) {
el._enterCb(
true
/* cancelled */
);
}
if (state.isUnmounting) {
return remove2();
}
callHook2(onBeforeLeave, [el]);
let called = false;
const done = el._leaveCb = (cancelled) => {
if (called)
return;
called = true;
remove2();
if (cancelled) {
callHook2(onLeaveCancelled, [el]);
} else {
callHook2(onAfterLeave, [el]);
}
el._leaveCb = void 0;
if (leavingVNodesCache[key2] === vnode) {
delete leavingVNodesCache[key2];
}
};
leavingVNodesCache[key2] = vnode;
if (onLeave) {
callAsyncHook(onLeave, [el, done]);
} else {
done();
}
},
clone(vnode2) {
return resolveTransitionHooks(vnode2, props, state, instance);
}
};
return hooks;
}
function emptyPlaceholder(vnode) {
if (isKeepAlive(vnode)) {
vnode = cloneVNode(vnode);
vnode.children = null;
return vnode;
}
}
function getKeepAliveChild(vnode) {
return isKeepAlive(vnode) ? vnode.children ? vnode.children[0] : void 0 : vnode;
}
function setTransitionHooks(vnode, hooks) {
if (vnode.shapeFlag & 6 && vnode.component) {
setTransitionHooks(vnode.component.subTree, hooks);
} else if (vnode.shapeFlag & 128) {
vnode.ssContent.transition = hooks.clone(vnode.ssContent);
vnode.ssFallback.transition = hooks.clone(vnode.ssFallback);
} else {
vnode.transition = hooks;
}
}
function getTransitionRawChildren(children, keepComment = false, parentKey) {
let ret = [];
let keyedFragmentCount = 0;
for (let i = 0; i < children.length; i++) {
let child = children[i];
const key = parentKey == null ? child.key : String(parentKey) + String(child.key != null ? child.key : i);
if (child.type === Fragment$1) {
if (child.patchFlag & 128)
keyedFragmentCount++;
ret = ret.concat(getTransitionRawChildren(child.children, keepComment, key));
} else if (keepComment || child.type !== Comment) {
ret.push(key != null ? cloneVNode(child, { key }) : child);
}
}
if (keyedFragmentCount > 1) {
for (let i = 0; i < ret.length; i++) {
ret[i].patchFlag = -2;
}
}
return ret;
}
function defineComponent(options) {
return isFunction$2(options) ? { setup: options, name: options.name } : options;
}
const isAsyncWrapper = (i) => !!i.type.__asyncLoader;
const isKeepAlive = (vnode) => vnode.type.__isKeepAlive;
function onActivated(hook, target) {
registerKeepAliveHook(hook, "a", target);
}
function onDeactivated(hook, target) {
registerKeepAliveHook(hook, "da", target);
}
function registerKeepAliveHook(hook, type2, target = currentInstance) {
const wrappedHook = hook.__wdc || (hook.__wdc = () => {
let current = target;
while (current) {
if (current.isDeactivated) {
return;
}
current = current.parent;
}
return hook();
});
injectHook(type2, wrappedHook, target);
if (target) {
let current = target.parent;
while (current && current.parent) {
if (isKeepAlive(current.parent.vnode)) {
injectToKeepAliveRoot(wrappedHook, type2, target, current);
}
current = current.parent;
}
}
}
function injectToKeepAliveRoot(hook, type2, target, keepAliveRoot) {
const injected = injectHook(
type2,
hook,
keepAliveRoot,
true
/* prepend */
);
onUnmounted(() => {
remove(keepAliveRoot[type2], injected);
}, target);
}
function injectHook(type2, hook, target = currentInstance, prepend = false) {
if (target) {
const hooks = target[type2] || (target[type2] = []);
const wrappedHook = hook.__weh || (hook.__weh = (...args) => {
if (target.isUnmounted) {
return;
}
pauseTracking();
setCurrentInstance(target);
const res = callWithAsyncErrorHandling(hook, target, type2, args);
unsetCurrentInstance();
resetTracking();
return res;
});
if (prepend) {
hooks.unshift(wrappedHook);
} else {
hooks.push(wrappedHook);
}
return wrappedHook;
}
}
const createHook = (lifecycle) => (hook, target = currentInstance) => (
// post-create lifecycle registrations are noops during SSR (except for serverPrefetch)
(!isInSSRComponentSetup || lifecycle === "sp") && injectHook(lifecycle, (...args) => hook(...args), target)
);
const onBeforeMount = createHook(
"bm"
/* LifecycleHooks.BEFORE_MOUNT */
);
const onMounted = createHook(
"m"
/* LifecycleHooks.MOUNTED */
);
const onBeforeUpdate = createHook(
"bu"
/* LifecycleHooks.BEFORE_UPDATE */
);
const onUpdated = createHook(
"u"
/* LifecycleHooks.UPDATED */
);
const onBeforeUnmount = createHook(
"bum"
/* LifecycleHooks.BEFORE_UNMOUNT */
);
const onUnmounted = createHook(
"um"
/* LifecycleHooks.UNMOUNTED */
);
const onServerPrefetch = createHook(
"sp"
/* LifecycleHooks.SERVER_PREFETCH */
);
const onRenderTriggered = createHook(
"rtg"
/* LifecycleHooks.RENDER_TRIGGERED */
);
const onRenderTracked = createHook(
"rtc"
/* LifecycleHooks.RENDER_TRACKED */
);
function onErrorCaptured(hook, target = currentInstance) {
injectHook("ec", hook, target);
}
function withDirectives(vnode, directives) {
const internalInstance = currentRenderingInstance;
if (internalInstance === null) {
return vnode;
}
const instance = getExposeProxy(internalInstance) || internalInstance.proxy;
const bindings = vnode.dirs || (vnode.dirs = []);
for (let i = 0; i < directives.length; i++) {
let [dir, value, arg, modifiers = EMPTY_OBJ] = directives[i];
if (dir) {
if (isFunction$2(dir)) {
dir = {
mounted: dir,
updated: dir
};
}
if (dir.deep) {
traverse(value);
}
bindings.push({
dir,
instance,
value,
oldValue: void 0,
arg,
modifiers
});
}
}
return vnode;
}
function invokeDirectiveHook(vnode, prevVNode, instance, name) {
const bindings = vnode.dirs;
const oldBindings = prevVNode && prevVNode.dirs;
for (let i = 0; i < bindings.length; i++) {
const binding = bindings[i];
if (oldBindings) {
binding.oldValue = oldBindings[i].value;
}
let hook = binding.dir[name];
if (hook) {
pauseTracking();
callWithAsyncErrorHandling(hook, instance, 8, [
vnode.el,
binding,
vnode,
prevVNode
]);
resetTracking();
}
}
}
const COMPONENTS = "components";
const DIRECTIVES = "directives";
function resolveComponent(name, maybeSelfReference) {
return resolveAsset(COMPONENTS, name, true, maybeSelfReference) || name;
}
const NULL_DYNAMIC_COMPONENT = Symbol();
function resolveDynamicComponent(component) {
if (isString$2(component)) {
return resolveAsset(COMPONENTS, component, false) || component;
} else {
return component || NULL_DYNAMIC_COMPONENT;
}
}
function resolveDirective(name) {
return resolveAsset(DIRECTIVES, name);
}
function resolveAsset(type2, name, warnMissing = true, maybeSelfReference = false) {
const instance = currentRenderingInstance || currentInstance;
if (instance) {
const Component = instance.type;
if (type2 === COMPONENTS) {
const selfName = getComponentName(
Component,
false
/* do not include inferred name to avoid breaking existing code */
);
if (selfName && (selfName === name || selfName === camelize(name) || selfName === capitalize$2(camelize(name)))) {
return Component;
}
}
const res = (
// local registration
// check instance[type] first which is resolved for options API
resolve(instance[type2] || Component[type2], name) || // global registration
resolve(instance.appContext[type2], name)
);
if (!res && maybeSelfReference) {
return Component;
}
return res;
}
}
function resolve(registry, name) {
return registry && (registry[name] || registry[camelize(name)] || registry[capitalize$2(camelize(name))]);
}
function renderList(source, renderItem, cache2, index2) {
let ret;
const cached = cache2 && cache2[index2];
if (isArray$3(source) || isString$2(source)) {
ret = new Array(source.length);
for (let i = 0, l = source.length; i < l; i++) {
ret[i] = renderItem(source[i], i, void 0, cached && cached[i]);
}
} else if (typeof source === "number") {
ret = new Array(source);
for (let i = 0; i < source; i++) {
ret[i] = renderItem(i + 1, i, void 0, cached && cached[i]);
}
} else if (isObject$3(source)) {
if (source[Symbol.iterator]) {
ret = Array.from(source, (item, i) => renderItem(item, i, void 0, cached && cached[i]));
} else {
const keys2 = Object.keys(source);
ret = new Array(keys2.length);
for (let i = 0, l = keys2.length; i < l; i++) {
const key = keys2[i];
ret[i] = renderItem(source[key], key, i, cached && cached[i]);
}
}
} else {
ret = [];
}
if (cache2) {
cache2[index2] = ret;
}
return ret;
}
function createSlots(slots, dynamicSlots) {
for (let i = 0; i < dynamicSlots.length; i++) {
const slot = dynamicSlots[i];
if (isArray$3(slot)) {
for (let j = 0; j < slot.length; j++) {
slots[slot[j].name] = slot[j].fn;
}
} else if (slot) {
slots[slot.name] = slot.key ? (...args) => {
const res = slot.fn(...args);
if (res)
res.key = slot.key;
return res;
} : slot.fn;
}
}
return slots;
}
function renderSlot(slots, name, props = {}, fallback, noSlotted) {
if (currentRenderingInstance.isCE || currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.isCE) {
if (name !== "default")
props.name = name;
return createVNode("slot", props, fallback && fallback());
}
let slot = slots[name];
if (slot && slot._c) {
slot._d = false;
}
openBlock();
const validSlotContent = slot && ensureValidVNode(slot(props));
const rendered = createBlock(
Fragment$1,
{
key: props.key || // slot content array of a dynamic conditional slot may have a branch
// key attached in the `createSlots` helper, respect that
validSlotContent && validSlotContent.key || `_${name}`
},
validSlotContent || (fallback ? fallback() : []),
validSlotContent && slots._ === 1 ? 64 : -2
/* PatchFlags.BAIL */
);
if (!noSlotted && rendered.scopeId) {
rendered.slotScopeIds = [rendered.scopeId + "-s"];
}
if (slot && slot._c) {
slot._d = true;
}
return rendered;
}
function ensureValidVNode(vnodes) {
return vnodes.some((child) => {
if (!isVNode$1(child))
return true;
if (child.type === Comment)
return false;
if (child.type === Fragment$1 && !ensureValidVNode(child.children))
return false;
return true;
}) ? vnodes : null;
}
const getPublicInstance = (i) => {
if (!i)
return null;
if (isStatefulComponent(i))
return getExposeProxy(i) || i.proxy;
return getPublicInstance(i.parent);
};
const publicPropertiesMap = (
// Move PURE marker to new line to workaround compiler discarding it
// due to type annotation
/* @__PURE__ */ extend(/* @__PURE__ */ Object.create(null), {
$: (i) => i,
$el: (i) => i.vnode.el,
$data: (i) => i.data,
$props: (i) => i.props,
$attrs: (i) => i.attrs,
$slots: (i) => i.slots,
$refs: (i) => i.refs,
$parent: (i) => getPublicInstance(i.parent),
$root: (i) => getPublicInstance(i.root),
$emit: (i) => i.emit,
$options: (i) => resolveMergedOptions(i),
$forceUpdate: (i) => i.f || (i.f = () => queueJob(i.update)),
$nextTick: (i) => i.n || (i.n = nextTick.bind(i.proxy)),
$watch: (i) => instanceWatch.bind(i)
})
);
const hasSetupBinding = (state, key) => state !== EMPTY_OBJ && !state.__isScriptSetup && hasOwn$1(state, key);
const PublicInstanceProxyHandlers = {
get({ _: instance }, key) {
const { ctx, setupState, data, props, accessCache, type: type2, appContext } = instance;
let normalizedProps;
if (key[0] !== "$") {
const n = accessCache[key];
if (n !== void 0) {
switch (n) {
case 1:
return setupState[key];
case 2:
return data[key];
case 4:
return ctx[key];
case 3:
return props[key];
}
} else if (hasSetupBinding(setupState, key)) {
accessCache[key] = 1;
return setupState[key];
} else if (data !== EMPTY_OBJ && hasOwn$1(data, key)) {
accessCache[key] = 2;
return data[key];
} else if (
// only cache other properties when instance has declared (thus stable)
// props
(normalizedProps = instance.propsOptions[0]) && hasOwn$1(normalizedProps, key)
) {
accessCache[key] = 3;
return props[key];
} else if (ctx !== EMPTY_OBJ && hasOwn$1(ctx, key)) {
accessCache[key] = 4;
return ctx[key];
} else if (shouldCacheAccess) {
accessCache[key] = 0;
}
}
const publicGetter = publicPropertiesMap[key];
let cssModule, globalProperties;
if (publicGetter) {
if (key === "$attrs") {
track(instance, "get", key);
}
return publicGetter(instance);
} else if (
// css module (injected by vue-loader)
(cssModule = type2.__cssModules) && (cssModule = cssModule[key])
) {
return cssModule;
} else if (ctx !== EMPTY_OBJ && hasOwn$1(ctx, key)) {
accessCache[key] = 4;
return ctx[key];
} else if (
// global properties
globalProperties = appContext.config.globalProperties, hasOwn$1(globalProperties, key)
) {
{
return globalProperties[key];
}
} else
;
},
set({ _: instance }, key, value) {
const { data, setupState, ctx } = instance;
if (hasSetupBinding(setupState, key)) {
setupState[key] = value;
return true;
} else if (data !== EMPTY_OBJ && hasOwn$1(data, key)) {
data[key] = value;
return true;
} else if (hasOwn$1(instance.props, key)) {
return false;
}
if (key[0] === "$" && key.slice(1) in instance) {
return false;
} else {
{
ctx[key] = value;
}
}
return true;
},
has({ _: { data, setupState, accessCache, ctx, appContext, propsOptions } }, key) {
let normalizedProps;
return !!accessCache[key] || data !== EMPTY_OBJ && hasOwn$1(data, key) || hasSetupBinding(setupState, key) || (normalizedProps = propsOptions[0]) && hasOwn$1(normalizedProps, key) || hasOwn$1(ctx, key) || hasOwn$1(publicPropertiesMap, key) || hasOwn$1(appContext.config.globalProperties, key);
},
defineProperty(target, key, descriptor) {
if (descriptor.get != null) {
target._.accessCache[key] = 0;
} else if (hasOwn$1(descriptor, "value")) {
this.set(target, key, descriptor.value, null);
}
return Reflect.defineProperty(target, key, descriptor);
}
};
let shouldCacheAccess = true;
function applyOptions(instance) {
const options = resolveMergedOptions(instance);
const publicThis = instance.proxy;
const ctx = instance.ctx;
shouldCacheAccess = false;
if (options.beforeCreate) {
callHook$1(
options.beforeCreate,
instance,
"bc"
/* LifecycleHooks.BEFORE_CREATE */
);
}
const {
// state
data: dataOptions,
computed: computedOptions,
methods,
watch: watchOptions,
provide: provideOptions,
inject: injectOptions,
// lifecycle
created,
beforeMount,
mounted,
beforeUpdate,
updated,
activated,
deactivated,
beforeDestroy,
beforeUnmount,
destroyed,
unmounted,
render: render2,
renderTracked,
renderTriggered,
errorCaptured,
serverPrefetch,
// public API
expose: expose2,
inheritAttrs,
// assets
components,
directives,
filters
} = options;
const checkDuplicateProperties = null;
if (injectOptions) {
resolveInjections(injectOptions, ctx, checkDuplicateProperties, instance.appContext.config.unwrapInjectedRef);
}
if (methods) {
for (const key in methods) {
const methodHandler = methods[key];
if (isFunction$2(methodHandler)) {
{
ctx[key] = methodHandler.bind(publicThis);
}
}
}
}
if (dataOptions) {
const data = dataOptions.call(publicThis, publicThis);
if (!isObject$3(data))
;
else {
instance.data = reactive(data);
}
}
shouldCacheAccess = true;
if (computedOptions) {
for (const key in computedOptions) {
const opt = computedOptions[key];
const get2 = isFunction$2(opt) ? opt.bind(publicThis, publicThis) : isFunction$2(opt.get) ? opt.get.bind(publicThis, publicThis) : NOOP;
const set2 = !isFunction$2(opt) && isFunction$2(opt.set) ? opt.set.bind(publicThis) : NOOP;
const c = computed({
get: get2,
set: set2
});
Object.defineProperty(ctx, key, {
enumerable: true,
configurable: true,
get: () => c.value,
set: (v) => c.value = v
});
}
}
if (watchOptions) {
for (const key in watchOptions) {
createWatcher(watchOptions[key], ctx, publicThis, key);
}
}
if (provideOptions) {
const provides = isFunction$2(provideOptions) ? provideOptions.call(publicThis) : provideOptions;
Reflect.ownKeys(provides).forEach((key) => {
provide(key, provides[key]);
});
}
if (created) {
callHook$1(
created,
instance,
"c"
/* LifecycleHooks.CREATED */
);
}
function registerLifecycleHook(register, hook) {
if (isArray$3(hook)) {
hook.forEach((_hook) => register(_hook.bind(publicThis)));
} else if (hook) {
register(hook.bind(publicThis));
}
}
registerLifecycleHook(onBeforeMount, beforeMount);
registerLifecycleHook(onMounted, mounted);
registerLifecycleHook(onBeforeUpdate, beforeUpdate);
registerLifecycleHook(onUpdated, updated);
registerLifecycleHook(onActivated, activated);
registerLifecycleHook(onDeactivated, deactivated);
registerLifecycleHook(onErrorCaptured, errorCaptured);
registerLifecycleHook(onRenderTracked, renderTracked);
registerLifecycleHook(onRenderTriggered, renderTriggered);
registerLifecycleHook(onBeforeUnmount, beforeUnmount);
registerLifecycleHook(onUnmounted, unmounted);
registerLifecycleHook(onServerPrefetch, serverPrefetch);
if (isArray$3(expose2)) {
if (expose2.length) {
const exposed = instance.exposed || (instance.exposed = {});
expose2.forEach((key) => {
Object.defineProperty(exposed, key, {
get: () => publicThis[key],
set: (val) => publicThis[key] = val
});
});
} else if (!instance.exposed) {
instance.exposed = {};
}
}
if (render2 && instance.render === NOOP) {
instance.render = render2;
}
if (inheritAttrs != null) {
instance.inheritAttrs = inheritAttrs;
}
if (components)
instance.components = components;
if (directives)
instance.directives = directives;
}
function resolveInjections(injectOptions, ctx, checkDuplicateProperties = NOOP, unwrapRef = false) {
if (isArray$3(injectOptions)) {
injectOptions = normalizeInject(injectOptions);
}
for (const key in injectOptions) {
const opt = injectOptions[key];
let injected;
if (isObject$3(opt)) {
if ("default" in opt) {
injected = inject(
opt.from || key,
opt.default,
true
/* treat default function as factory */
);
} else {
injected = inject(opt.from || key);
}
} else {
injected = inject(opt);
}
if (isRef(injected)) {
if (unwrapRef) {
Object.defineProperty(ctx, key, {
enumerable: true,
configurable: true,
get: () => injected.value,
set: (v) => injected.value = v
});
} else {
ctx[key] = injected;
}
} else {
ctx[key] = injected;
}
}
}
function callHook$1(hook, instance, type2) {
callWithAsyncErrorHandling(isArray$3(hook) ? hook.map((h2) => h2.bind(instance.proxy)) : hook.bind(instance.proxy), instance, type2);
}
function createWatcher(raw, ctx, publicThis, key) {
const getter = key.includes(".") ? createPathGetter(publicThis, key) : () => publicThis[key];
if (isString$2(raw)) {
const handler = ctx[raw];
if (isFunction$2(handler)) {
watch(getter, handler);
}
} else if (isFunction$2(raw)) {
watch(getter, raw.bind(publicThis));
} else if (isObject$3(raw)) {
if (isArray$3(raw)) {
raw.forEach((r) => createWatcher(r, ctx, publicThis, key));
} else {
const handler = isFunction$2(raw.handler) ? raw.handler.bind(publicThis) : ctx[raw.handler];
if (isFunction$2(handler)) {
watch(getter, handler, raw);
}
}
} else
;
}
function resolveMergedOptions(instance) {
const base2 = instance.type;
const { mixins, extends: extendsOptions } = base2;
const { mixins: globalMixins, optionsCache: cache2, config: { optionMergeStrategies } } = instance.appContext;
const cached = cache2.get(base2);
let resolved;
if (cached) {
resolved = cached;
} else if (!globalMixins.length && !mixins && !extendsOptions) {
{
resolved = base2;
}
} else {
resolved = {};
if (globalMixins.length) {
globalMixins.forEach((m) => mergeOptions(resolved, m, optionMergeStrategies, true));
}
mergeOptions(resolved, base2, optionMergeStrategies);
}
if (isObject$3(base2)) {
cache2.set(base2, resolved);
}
return resolved;
}
function mergeOptions(to, from, strats, asMixin = false) {
const { mixins, extends: extendsOptions } = from;
if (extendsOptions) {
mergeOptions(to, extendsOptions, strats, true);
}
if (mixins) {
mixins.forEach((m) => mergeOptions(to, m, strats, true));
}
for (const key in from) {
if (asMixin && key === "expose")
;
else {
const strat = internalOptionMergeStrats[key] || strats && strats[key];
to[key] = strat ? strat(to[key], from[key]) : from[key];
}
}
return to;
}
const internalOptionMergeStrats = {
data: mergeDataFn,
props: mergeObjectOptions,
emits: mergeObjectOptions,
// objects
methods: mergeObjectOptions,
computed: mergeObjectOptions,
// lifecycle
beforeCreate: mergeAsArray,
created: mergeAsArray,
beforeMount: mergeAsArray,
mounted: mergeAsArray,
beforeUpdate: mergeAsArray,
updated: mergeAsArray,
beforeDestroy: mergeAsArray,
beforeUnmount: mergeAsArray,
destroyed: mergeAsArray,
unmounted: mergeAsArray,
activated: mergeAsArray,
deactivated: mergeAsArray,
errorCaptured: mergeAsArray,
serverPrefetch: mergeAsArray,
// assets
components: mergeObjectOptions,
directives: mergeObjectOptions,
// watch
watch: mergeWatchOptions,
// provide / inject
provide: mergeDataFn,
inject: mergeInject
};
function mergeDataFn(to, from) {
if (!from) {
return to;
}
if (!to) {
return from;
}
return function mergedDataFn() {
return extend(isFunction$2(to) ? to.call(this, this) : to, isFunction$2(from) ? from.call(this, this) : from);
};
}
function mergeInject(to, from) {
return mergeObjectOptions(normalizeInject(to), normalizeInject(from));
}
function normalizeInject(raw) {
if (isArray$3(raw)) {
const res = {};
for (let i = 0; i < raw.length; i++) {
res[raw[i]] = raw[i];
}
return res;
}
return raw;
}
function mergeAsArray(to, from) {
return to ? [...new Set([].concat(to, from))] : from;
}
function mergeObjectOptions(to, from) {
return to ? extend(extend(/* @__PURE__ */ Object.create(null), to), from) : from;
}
function mergeWatchOptions(to, from) {
if (!to)
return from;
if (!from)
return to;
const merged = extend(/* @__PURE__ */ Object.create(null), to);
for (const key in from) {
merged[key] = mergeAsArray(to[key], from[key]);
}
return merged;
}
function initProps(instance, rawProps, isStateful, isSSR = false) {
const props = {};
const attrs = {};
def(attrs, InternalObjectKey, 1);
instance.propsDefaults = /* @__PURE__ */ Object.create(null);
setFullProps(instance, rawProps, props, attrs);
for (const key in instance.propsOptions[0]) {
if (!(key in props)) {
props[key] = void 0;
}
}
if (isStateful) {
instance.props = isSSR ? props : shallowReactive(props);
} else {
if (!instance.type.props) {
instance.props = attrs;
} else {
instance.props = props;
}
}
instance.attrs = attrs;
}
function updateProps(instance, rawProps, rawPrevProps, optimized) {
const { props, attrs, vnode: { patchFlag } } = instance;
const rawCurrentProps = toRaw(props);
const [options] = instance.propsOptions;
let hasAttrsChanged = false;
if (
// always force full diff in dev
// - #1942 if hmr is enabled with sfc component
// - vite#872 non-sfc component used by sfc component
(optimized || patchFlag > 0) && !(patchFlag & 16)
) {
if (patchFlag & 8) {
const propsToUpdate = instance.vnode.dynamicProps;
for (let i = 0; i < propsToUpdate.length; i++) {
let key = propsToUpdate[i];
if (isEmitListener(instance.emitsOptions, key)) {
continue;
}
const value = rawProps[key];
if (options) {
if (hasOwn$1(attrs, key)) {
if (value !== attrs[key]) {
attrs[key] = value;
hasAttrsChanged = true;
}
} else {
const camelizedKey = camelize(key);
props[camelizedKey] = resolvePropValue(
options,
rawCurrentProps,
camelizedKey,
value,
instance,
false
/* isAbsent */
);
}
} else {
if (value !== attrs[key]) {
attrs[key] = value;
hasAttrsChanged = true;
}
}
}
}
} else {
if (setFullProps(instance, rawProps, props, attrs)) {
hasAttrsChanged = true;
}
let kebabKey;
for (const key in rawCurrentProps) {
if (!rawProps || // for camelCase
!hasOwn$1(rawProps, key) && // it's possible the original props was passed in as kebab-case
// and converted to camelCase (#955)
((kebabKey = hyphenate(key)) === key || !hasOwn$1(rawProps, kebabKey))) {
if (options) {
if (rawPrevProps && // for camelCase
(rawPrevProps[key] !== void 0 || // for kebab-case
rawPrevProps[kebabKey] !== void 0)) {
props[key] = resolvePropValue(
options,
rawCurrentProps,
key,
void 0,
instance,
true
/* isAbsent */
);
}
} else {
delete props[key];
}
}
}
if (attrs !== rawCurrentProps) {
for (const key in attrs) {
if (!rawProps || !hasOwn$1(rawProps, key) && true) {
delete attrs[key];
hasAttrsChanged = true;
}
}
}
}
if (hasAttrsChanged) {
trigger(instance, "set", "$attrs");
}
}
function setFullProps(instance, rawProps, props, attrs) {
const [options, needCastKeys] = instance.propsOptions;
let hasAttrsChanged = false;
let rawCastValues;
if (rawProps) {
for (let key in rawProps) {
if (isReservedProp(key)) {
continue;
}
const value = rawProps[key];
let camelKey;
if (options && hasOwn$1(options, camelKey = camelize(key))) {
if (!needCastKeys || !needCastKeys.includes(camelKey)) {
props[camelKey] = value;
} else {
(rawCastValues || (rawCastValues = {}))[camelKey] = value;
}
} else if (!isEmitListener(instance.emitsOptions, key)) {
if (!(key in attrs) || value !== attrs[key]) {
attrs[key] = value;
hasAttrsChanged = true;
}
}
}
}
if (needCastKeys) {
const rawCurrentProps = toRaw(props);
const castValues = rawCastValues || EMPTY_OBJ;
for (let i = 0; i < needCastKeys.length; i++) {
const key = needCastKeys[i];
props[key] = resolvePropValue(options, rawCurrentProps, key, castValues[key], instance, !hasOwn$1(castValues, key));
}
}
return hasAttrsChanged;
}
function resolvePropValue(options, props, key, value, instance, isAbsent) {
const opt = options[key];
if (opt != null) {
const hasDefault = hasOwn$1(opt, "default");
if (hasDefault && value === void 0) {
const defaultValue = opt.default;
if (opt.type !== Function && isFunction$2(defaultValue)) {
const { propsDefaults } = instance;
if (key in propsDefaults) {
value = propsDefaults[key];
} else {
setCurrentInstance(instance);
value = propsDefaults[key] = defaultValue.call(null, props);
unsetCurrentInstance();
}
} else {
value = defaultValue;
}
}
if (opt[
0
/* BooleanFlags.shouldCast */
]) {
if (isAbsent && !hasDefault) {
value = false;
} else if (opt[
1
/* BooleanFlags.shouldCastTrue */
] && (value === "" || value === hyphenate(key))) {
value = true;
}
}
}
return value;
}
function normalizePropsOptions(comp, appContext, asMixin = false) {
const cache2 = appContext.propsCache;
const cached = cache2.get(comp);
if (cached) {
return cached;
}
const raw = comp.props;
const normalized = {};
const needCastKeys = [];
let hasExtends = false;
if (!isFunction$2(comp)) {
const extendProps = (raw2) => {
hasExtends = true;
const [props, keys2] = normalizePropsOptions(raw2, appContext, true);
extend(normalized, props);
if (keys2)
needCastKeys.push(...keys2);
};
if (!asMixin && appContext.mixins.length) {
appContext.mixins.forEach(extendProps);
}
if (comp.extends) {
extendProps(comp.extends);
}
if (comp.mixins) {
comp.mixins.forEach(extendProps);
}
}
if (!raw && !hasExtends) {
if (isObject$3(comp)) {
cache2.set(comp, EMPTY_ARR);
}
return EMPTY_ARR;
}
if (isArray$3(raw)) {
for (let i = 0; i < raw.length; i++) {
const normalizedKey = camelize(raw[i]);
if (validatePropName(normalizedKey)) {
normalized[normalizedKey] = EMPTY_OBJ;
}
}
} else if (raw) {
for (const key in raw) {
const normalizedKey = camelize(key);
if (validatePropName(normalizedKey)) {
const opt = raw[key];
const prop = normalized[normalizedKey] = isArray$3(opt) || isFunction$2(opt) ? { type: opt } : Object.assign({}, opt);
if (prop) {
const booleanIndex = getTypeIndex(Boolean, prop.type);
const stringIndex = getTypeIndex(String, prop.type);
prop[
0
/* BooleanFlags.shouldCast */
] = booleanIndex > -1;
prop[
1
/* BooleanFlags.shouldCastTrue */
] = stringIndex < 0 || booleanIndex < stringIndex;
if (booleanIndex > -1 || hasOwn$1(prop, "default")) {
needCastKeys.push(normalizedKey);
}
}
}
}
}
const res = [normalized, needCastKeys];
if (isObject$3(comp)) {
cache2.set(comp, res);
}
return res;
}
function validatePropName(key) {
if (key[0] !== "$") {
return true;
}
return false;
}
function getType(ctor) {
const match2 = ctor && ctor.toString().match(/^\s*(function|class) (\w+)/);
return match2 ? match2[2] : ctor === null ? "null" : "";
}
function isSameType(a, b) {
return getType(a) === getType(b);
}
function getTypeIndex(type2, expectedTypes) {
if (isArray$3(expectedTypes)) {
return expectedTypes.findIndex((t2) => isSameType(t2, type2));
} else if (isFunction$2(expectedTypes)) {
return isSameType(expectedTypes, type2) ? 0 : -1;
}
return -1;
}
const isInternalKey = (key) => key[0] === "_" || key === "$stable";
const normalizeSlotValue = (value) => isArray$3(value) ? value.map(normalizeVNode) : [normalizeVNode(value)];
const normalizeSlot = (key, rawSlot, ctx) => {
if (rawSlot._n) {
return rawSlot;
}
const normalized = withCtx((...args) => {
if (false)
;
return normalizeSlotValue(rawSlot(...args));
}, ctx);
normalized._c = false;
return normalized;
};
const normalizeObjectSlots = (rawSlots, slots, instance) => {
const ctx = rawSlots._ctx;
for (const key in rawSlots) {
if (isInternalKey(key))
continue;
const value = rawSlots[key];
if (isFunction$2(value)) {
slots[key] = normalizeSlot(key, value, ctx);
} else if (value != null) {
const normalized = normalizeSlotValue(value);
slots[key] = () => normalized;
}
}
};
const normalizeVNodeSlots = (instance, children) => {
const normalized = normalizeSlotValue(children);
instance.slots.default = () => normalized;
};
const initSlots = (instance, children) => {
if (instance.vnode.shapeFlag & 32) {
const type2 = children._;
if (type2) {
instance.slots = toRaw(children);
def(children, "_", type2);
} else {
normalizeObjectSlots(children, instance.slots = {});
}
} else {
instance.slots = {};
if (children) {
normalizeVNodeSlots(instance, children);
}
}
def(instance.slots, InternalObjectKey, 1);
};
const updateSlots = (instance, children, optimized) => {
const { vnode, slots } = instance;
let needDeletionCheck = true;
let deletionComparisonTarget = EMPTY_OBJ;
if (vnode.shapeFlag & 32) {
const type2 = children._;
if (type2) {
if (optimized && type2 === 1) {
needDeletionCheck = false;
} else {
extend(slots, children);
if (!optimized && type2 === 1) {
delete slots._;
}
}
} else {
needDeletionCheck = !children.$stable;
normalizeObjectSlots(children, slots);
}
deletionComparisonTarget = children;
} else if (children) {
normalizeVNodeSlots(instance, children);
deletionComparisonTarget = { default: 1 };
}
if (needDeletionCheck) {
for (const key in slots) {
if (!isInternalKey(key) && !(key in deletionComparisonTarget)) {
delete slots[key];
}
}
}
};
function createAppContext() {
return {
app: null,
config: {
isNativeTag: NO,
performance: false,
globalProperties: {},
optionMergeStrategies: {},
errorHandler: void 0,
warnHandler: void 0,
compilerOptions: {}
},
mixins: [],
components: {},
directives: {},
provides: /* @__PURE__ */ Object.create(null),
optionsCache: /* @__PURE__ */ new WeakMap(),
propsCache: /* @__PURE__ */ new WeakMap(),
emitsCache: /* @__PURE__ */ new WeakMap()
};
}
let uid$1 = 0;
function createAppAPI(render2, hydrate) {
return function createApp2(rootComponent, rootProps = null) {
if (!isFunction$2(rootComponent)) {
rootComponent = Object.assign({}, rootComponent);
}
if (rootProps != null && !isObject$3(rootProps)) {
rootProps = null;
}
const context = createAppContext();
const installedPlugins = /* @__PURE__ */ new Set();
let isMounted = false;
const app = context.app = {
_uid: uid$1++,
_component: rootComponent,
_props: rootProps,
_container: null,
_context: context,
_instance: null,
version,
get config() {
return context.config;
},
set config(v) {
},
use(plugin, ...options) {
if (installedPlugins.has(plugin))
;
else if (plugin && isFunction$2(plugin.install)) {
installedPlugins.add(plugin);
plugin.install(app, ...options);
} else if (isFunction$2(plugin)) {
installedPlugins.add(plugin);
plugin(app, ...options);
} else
;
return app;
},
mixin(mixin) {
{
if (!context.mixins.includes(mixin)) {
context.mixins.push(mixin);
}
}
return app;
},
component(name, component) {
if (!component) {
return context.components[name];
}
context.components[name] = component;
return app;
},
directive(name, directive) {
if (!directive) {
return context.directives[name];
}
context.directives[name] = directive;
return app;
},
mount(rootContainer, isHydrate, isSVG) {
if (!isMounted) {
const vnode = createVNode(rootComponent, rootProps);
vnode.appContext = context;
if (isHydrate && hydrate) {
hydrate(vnode, rootContainer);
} else {
render2(vnode, rootContainer, isSVG);
}
isMounted = true;
app._container = rootContainer;
rootContainer.__vue_app__ = app;
return getExposeProxy(vnode.component) || vnode.component.proxy;
}
},
unmount() {
if (isMounted) {
render2(null, app._container);
delete app._container.__vue_app__;
}
},
provide(key, value) {
context.provides[key] = value;
return app;
}
};
return app;
};
}
function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) {
if (isArray$3(rawRef)) {
rawRef.forEach((r, i) => setRef(r, oldRawRef && (isArray$3(oldRawRef) ? oldRawRef[i] : oldRawRef), parentSuspense, vnode, isUnmount));
return;
}
if (isAsyncWrapper(vnode) && !isUnmount) {
return;
}
const refValue = vnode.shapeFlag & 4 ? getExposeProxy(vnode.component) || vnode.component.proxy : vnode.el;
const value = isUnmount ? null : refValue;
const { i: owner, r: ref2 } = rawRef;
const oldRef = oldRawRef && oldRawRef.r;
const refs = owner.refs === EMPTY_OBJ ? owner.refs = {} : owner.refs;
const setupState = owner.setupState;
if (oldRef != null && oldRef !== ref2) {
if (isString$2(oldRef)) {
refs[oldRef] = null;
if (hasOwn$1(setupState, oldRef)) {
setupState[oldRef] = null;
}
} else if (isRef(oldRef)) {
oldRef.value = null;
}
}
if (isFunction$2(ref2)) {
callWithErrorHandling(ref2, owner, 12, [value, refs]);
} else {
const _isString = isString$2(ref2);
const _isRef = isRef(ref2);
if (_isString || _isRef) {
const doSet = () => {
if (rawRef.f) {
const existing = _isString ? hasOwn$1(setupState, ref2) ? setupState[ref2] : refs[ref2] : ref2.value;
if (isUnmount) {
isArray$3(existing) && remove(existing, refValue);
} else {
if (!isArray$3(existing)) {
if (_isString) {
refs[ref2] = [refValue];
if (hasOwn$1(setupState, ref2)) {
setupState[ref2] = refs[ref2];
}
} else {
ref2.value = [refValue];
if (rawRef.k)
refs[rawRef.k] = ref2.value;
}
} else if (!existing.includes(refValue)) {
existing.push(refValue);
}
}
} else if (_isString) {
refs[ref2] = value;
if (hasOwn$1(setupState, ref2)) {
setupState[ref2] = value;
}
} else if (_isRef) {
ref2.value = value;
if (rawRef.k)
refs[rawRef.k] = value;
} else
;
};
if (value) {
doSet.id = -1;
queuePostRenderEffect(doSet, parentSuspense);
} else {
doSet();
}
}
}
}
const queuePostRenderEffect = queueEffectWithSuspense;
function createRenderer(options) {
return baseCreateRenderer(options);
}
function baseCreateRenderer(options, createHydrationFns) {
const target = getGlobalThis$1();
target.__VUE__ = true;
const { insert: hostInsert, remove: hostRemove, patchProp: hostPatchProp, createElement: hostCreateElement, createText: hostCreateText, createComment: hostCreateComment, setText: hostSetText, setElementText: hostSetElementText, parentNode: hostParentNode, nextSibling: hostNextSibling, setScopeId: hostSetScopeId = NOOP, insertStaticContent: hostInsertStaticContent } = options;
const patch = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, isSVG = false, slotScopeIds = null, optimized = !!n2.dynamicChildren) => {
if (n1 === n2) {
return;
}
if (n1 && !isSameVNodeType(n1, n2)) {
anchor = getNextHostNode(n1);
unmount(n1, parentComponent, parentSuspense, true);
n1 = null;
}
if (n2.patchFlag === -2) {
optimized = false;
n2.dynamicChildren = null;
}
const { type: type2, ref: ref2, shapeFlag } = n2;
switch (type2) {
case Text:
processText(n1, n2, container, anchor);
break;
case Comment:
processCommentNode(n1, n2, container, anchor);
break;
case Static:
if (n1 == null) {
mountStaticNode(n2, container, anchor, isSVG);
}
break;
case Fragment$1:
processFragment(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
break;
default:
if (shapeFlag & 1) {
processElement(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else if (shapeFlag & 6) {
processComponent(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else if (shapeFlag & 64) {
type2.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
} else if (shapeFlag & 128) {
type2.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
} else
;
}
if (ref2 != null && parentComponent) {
setRef(ref2, n1 && n1.ref, parentSuspense, n2 || n1, !n2);
}
};
const processText = (n1, n2, container, anchor) => {
if (n1 == null) {
hostInsert(n2.el = hostCreateText(n2.children), container, anchor);
} else {
const el = n2.el = n1.el;
if (n2.children !== n1.children) {
hostSetText(el, n2.children);
}
}
};
const processCommentNode = (n1, n2, container, anchor) => {
if (n1 == null) {
hostInsert(n2.el = hostCreateComment(n2.children || ""), container, anchor);
} else {
n2.el = n1.el;
}
};
const mountStaticNode = (n2, container, anchor, isSVG) => {
[n2.el, n2.anchor] = hostInsertStaticContent(n2.children, container, anchor, isSVG, n2.el, n2.anchor);
};
const moveStaticNode = ({ el, anchor }, container, nextSibling) => {
let next;
while (el && el !== anchor) {
next = hostNextSibling(el);
hostInsert(el, container, nextSibling);
el = next;
}
hostInsert(anchor, container, nextSibling);
};
const removeStaticNode = ({ el, anchor }) => {
let next;
while (el && el !== anchor) {
next = hostNextSibling(el);
hostRemove(el);
el = next;
}
hostRemove(anchor);
};
const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
isSVG = isSVG || n2.type === "svg";
if (n1 == null) {
mountElement(n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else {
patchElement(n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
};
const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
let el;
let vnodeHook;
const { type: type2, props, shapeFlag, transition, dirs } = vnode;
el = vnode.el = hostCreateElement(vnode.type, isSVG, props && props.is, props);
if (shapeFlag & 8) {
hostSetElementText(el, vnode.children);
} else if (shapeFlag & 16) {
mountChildren(vnode.children, el, null, parentComponent, parentSuspense, isSVG && type2 !== "foreignObject", slotScopeIds, optimized);
}
if (dirs) {
invokeDirectiveHook(vnode, null, parentComponent, "created");
}
setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent);
if (props) {
for (const key in props) {
if (key !== "value" && !isReservedProp(key)) {
hostPatchProp(el, key, null, props[key], isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
}
}
if ("value" in props) {
hostPatchProp(el, "value", null, props.value);
}
if (vnodeHook = props.onVnodeBeforeMount) {
invokeVNodeHook(vnodeHook, parentComponent, vnode);
}
}
if (dirs) {
invokeDirectiveHook(vnode, null, parentComponent, "beforeMount");
}
const needCallTransitionHooks = (!parentSuspense || parentSuspense && !parentSuspense.pendingBranch) && transition && !transition.persisted;
if (needCallTransitionHooks) {
transition.beforeEnter(el);
}
hostInsert(el, container, anchor);
if ((vnodeHook = props && props.onVnodeMounted) || needCallTransitionHooks || dirs) {
queuePostRenderEffect(() => {
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
needCallTransitionHooks && transition.enter(el);
dirs && invokeDirectiveHook(vnode, null, parentComponent, "mounted");
}, parentSuspense);
}
};
const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => {
if (scopeId) {
hostSetScopeId(el, scopeId);
}
if (slotScopeIds) {
for (let i = 0; i < slotScopeIds.length; i++) {
hostSetScopeId(el, slotScopeIds[i]);
}
}
if (parentComponent) {
let subTree = parentComponent.subTree;
if (vnode === subTree) {
const parentVNode = parentComponent.vnode;
setScopeId(el, parentVNode, parentVNode.scopeId, parentVNode.slotScopeIds, parentComponent.parent);
}
}
};
const mountChildren = (children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, start = 0) => {
for (let i = start; i < children.length; i++) {
const child = children[i] = optimized ? cloneIfMounted(children[i]) : normalizeVNode(children[i]);
patch(null, child, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
};
const patchElement = (n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
const el = n2.el = n1.el;
let { patchFlag, dynamicChildren, dirs } = n2;
patchFlag |= n1.patchFlag & 16;
const oldProps = n1.props || EMPTY_OBJ;
const newProps = n2.props || EMPTY_OBJ;
let vnodeHook;
parentComponent && toggleRecurse(parentComponent, false);
if (vnodeHook = newProps.onVnodeBeforeUpdate) {
invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
}
if (dirs) {
invokeDirectiveHook(n2, n1, parentComponent, "beforeUpdate");
}
parentComponent && toggleRecurse(parentComponent, true);
const areChildrenSVG = isSVG && n2.type !== "foreignObject";
if (dynamicChildren) {
patchBlockChildren(n1.dynamicChildren, dynamicChildren, el, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds);
} else if (!optimized) {
patchChildren(n1, n2, el, null, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds, false);
}
if (patchFlag > 0) {
if (patchFlag & 16) {
patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
} else {
if (patchFlag & 2) {
if (oldProps.class !== newProps.class) {
hostPatchProp(el, "class", null, newProps.class, isSVG);
}
}
if (patchFlag & 4) {
hostPatchProp(el, "style", oldProps.style, newProps.style, isSVG);
}
if (patchFlag & 8) {
const propsToUpdate = n2.dynamicProps;
for (let i = 0; i < propsToUpdate.length; i++) {
const key = propsToUpdate[i];
const prev = oldProps[key];
const next = newProps[key];
if (next !== prev || key === "value") {
hostPatchProp(el, key, prev, next, isSVG, n1.children, parentComponent, parentSuspense, unmountChildren);
}
}
}
}
if (patchFlag & 1) {
if (n1.children !== n2.children) {
hostSetElementText(el, n2.children);
}
}
} else if (!optimized && dynamicChildren == null) {
patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
}
if ((vnodeHook = newProps.onVnodeUpdated) || dirs) {
queuePostRenderEffect(() => {
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
dirs && invokeDirectiveHook(n2, n1, parentComponent, "updated");
}, parentSuspense);
}
};
const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, isSVG, slotScopeIds) => {
for (let i = 0; i < newChildren.length; i++) {
const oldVNode = oldChildren[i];
const newVNode = newChildren[i];
const container = (
// oldVNode may be an errored async setup() component inside Suspense
// which will not have a mounted element
oldVNode.el && // - In the case of a Fragment, we need to provide the actual parent
// of the Fragment itself so it can move its children.
(oldVNode.type === Fragment$1 || // - In the case of different nodes, there is going to be a replacement
// which also requires the correct parent container
!isSameVNodeType(oldVNode, newVNode) || // - In the case of a component, it could contain anything.
oldVNode.shapeFlag & (6 | 64)) ? hostParentNode(oldVNode.el) : (
// In other cases, the parent container is not actually used so we
// just pass the block element here to avoid a DOM parentNode call.
fallbackContainer
)
);
patch(oldVNode, newVNode, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, true);
}
};
const patchProps = (el, vnode, oldProps, newProps, parentComponent, parentSuspense, isSVG) => {
if (oldProps !== newProps) {
if (oldProps !== EMPTY_OBJ) {
for (const key in oldProps) {
if (!isReservedProp(key) && !(key in newProps)) {
hostPatchProp(el, key, oldProps[key], null, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
}
}
}
for (const key in newProps) {
if (isReservedProp(key))
continue;
const next = newProps[key];
const prev = oldProps[key];
if (next !== prev && key !== "value") {
hostPatchProp(el, key, prev, next, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
}
}
if ("value" in newProps) {
hostPatchProp(el, "value", oldProps.value, newProps.value);
}
}
};
const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
const fragmentStartAnchor = n2.el = n1 ? n1.el : hostCreateText("");
const fragmentEndAnchor = n2.anchor = n1 ? n1.anchor : hostCreateText("");
let { patchFlag, dynamicChildren, slotScopeIds: fragmentSlotScopeIds } = n2;
if (fragmentSlotScopeIds) {
slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
}
if (n1 == null) {
hostInsert(fragmentStartAnchor, container, anchor);
hostInsert(fragmentEndAnchor, container, anchor);
mountChildren(n2.children, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else {
if (patchFlag > 0 && patchFlag & 64 && dynamicChildren && // #2715 the previous fragment could've been a BAILed one as a result
// of renderSlot() with no valid children
n1.dynamicChildren) {
patchBlockChildren(n1.dynamicChildren, dynamicChildren, container, parentComponent, parentSuspense, isSVG, slotScopeIds);
if (
// #2080 if the stable fragment has a key, it's a <template v-for> that may
// get moved around. Make sure all root level vnodes inherit el.
// #2134 or if it's a component root, it may also get moved around
// as the component is being moved.
n2.key != null || parentComponent && n2 === parentComponent.subTree
) {
traverseStaticChildren(
n1,
n2,
true
/* shallow */
);
}
} else {
patchChildren(n1, n2, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
}
};
const processComponent = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
n2.slotScopeIds = slotScopeIds;
if (n1 == null) {
if (n2.shapeFlag & 512) {
parentComponent.ctx.activate(n2, container, anchor, isSVG, optimized);
} else {
mountComponent(n2, container, anchor, parentComponent, parentSuspense, isSVG, optimized);
}
} else {
updateComponent(n1, n2, optimized);
}
};
const mountComponent = (initialVNode, container, anchor, parentComponent, parentSuspense, isSVG, optimized) => {
const instance = initialVNode.component = createComponentInstance(initialVNode, parentComponent, parentSuspense);
if (isKeepAlive(initialVNode)) {
instance.ctx.renderer = internals;
}
{
setupComponent(instance);
}
if (instance.asyncDep) {
parentSuspense && parentSuspense.registerDep(instance, setupRenderEffect);
if (!initialVNode.el) {
const placeholder = instance.subTree = createVNode(Comment);
processCommentNode(null, placeholder, container, anchor);
}
return;
}
setupRenderEffect(instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized);
};
const updateComponent = (n1, n2, optimized) => {
const instance = n2.component = n1.component;
if (shouldUpdateComponent(n1, n2, optimized)) {
if (instance.asyncDep && !instance.asyncResolved) {
updateComponentPreRender(instance, n2, optimized);
return;
} else {
instance.next = n2;
invalidateJob(instance.update);
instance.update();
}
} else {
n2.el = n1.el;
instance.vnode = n2;
}
};
const setupRenderEffect = (instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized) => {
const componentUpdateFn = () => {
if (!instance.isMounted) {
let vnodeHook;
const { el, props } = initialVNode;
const { bm, m, parent } = instance;
const isAsyncWrapperVNode = isAsyncWrapper(initialVNode);
toggleRecurse(instance, false);
if (bm) {
invokeArrayFns(bm);
}
if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeBeforeMount)) {
invokeVNodeHook(vnodeHook, parent, initialVNode);
}
toggleRecurse(instance, true);
if (el && hydrateNode) {
const hydrateSubTree = () => {
instance.subTree = renderComponentRoot(instance);
hydrateNode(el, instance.subTree, instance, parentSuspense, null);
};
if (isAsyncWrapperVNode) {
initialVNode.type.__asyncLoader().then(
// note: we are moving the render call into an async callback,
// which means it won't track dependencies - but it's ok because
// a server-rendered async wrapper is already in resolved state
// and it will never need to change.
() => !instance.isUnmounted && hydrateSubTree()
);
} else {
hydrateSubTree();
}
} else {
const subTree = instance.subTree = renderComponentRoot(instance);
patch(null, subTree, container, anchor, instance, parentSuspense, isSVG);
initialVNode.el = subTree.el;
}
if (m) {
queuePostRenderEffect(m, parentSuspense);
}
if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeMounted)) {
const scopedInitialVNode = initialVNode;
queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, scopedInitialVNode), parentSuspense);
}
if (initialVNode.shapeFlag & 256 || parent && isAsyncWrapper(parent.vnode) && parent.vnode.shapeFlag & 256) {
instance.a && queuePostRenderEffect(instance.a, parentSuspense);
}
instance.isMounted = true;
initialVNode = container = anchor = null;
} else {
let { next, bu, u, parent, vnode } = instance;
let originNext = next;
let vnodeHook;
toggleRecurse(instance, false);
if (next) {
next.el = vnode.el;
updateComponentPreRender(instance, next, optimized);
} else {
next = vnode;
}
if (bu) {
invokeArrayFns(bu);
}
if (vnodeHook = next.props && next.props.onVnodeBeforeUpdate) {
invokeVNodeHook(vnodeHook, parent, next, vnode);
}
toggleRecurse(instance, true);
const nextTree = renderComponentRoot(instance);
const prevTree = instance.subTree;
instance.subTree = nextTree;
patch(
prevTree,
nextTree,
// parent may have changed if it's in a teleport
hostParentNode(prevTree.el),
// anchor may have changed if it's in a fragment
getNextHostNode(prevTree),
instance,
parentSuspense,
isSVG
);
next.el = nextTree.el;
if (originNext === null) {
updateHOCHostEl(instance, nextTree.el);
}
if (u) {
queuePostRenderEffect(u, parentSuspense);
}
if (vnodeHook = next.props && next.props.onVnodeUpdated) {
queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, next, vnode), parentSuspense);
}
}
};
const effect = instance.effect = new ReactiveEffect(
componentUpdateFn,
() => queueJob(update),
instance.scope
// track it in component's effect scope
);
const update = instance.update = () => effect.run();
update.id = instance.uid;
toggleRecurse(instance, true);
update();
};
const updateComponentPreRender = (instance, nextVNode, optimized) => {
nextVNode.component = instance;
const prevProps = instance.vnode.props;
instance.vnode = nextVNode;
instance.next = null;
updateProps(instance, nextVNode.props, prevProps, optimized);
updateSlots(instance, nextVNode.children, optimized);
pauseTracking();
flushPreFlushCbs();
resetTracking();
};
const patchChildren = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized = false) => {
const c1 = n1 && n1.children;
const prevShapeFlag = n1 ? n1.shapeFlag : 0;
const c2 = n2.children;
const { patchFlag, shapeFlag } = n2;
if (patchFlag > 0) {
if (patchFlag & 128) {
patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
return;
} else if (patchFlag & 256) {
patchUnkeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
return;
}
}
if (shapeFlag & 8) {
if (prevShapeFlag & 16) {
unmountChildren(c1, parentComponent, parentSuspense);
}
if (c2 !== c1) {
hostSetElementText(container, c2);
}
} else {
if (prevShapeFlag & 16) {
if (shapeFlag & 16) {
patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else {
unmountChildren(c1, parentComponent, parentSuspense, true);
}
} else {
if (prevShapeFlag & 8) {
hostSetElementText(container, "");
}
if (shapeFlag & 16) {
mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
}
}
};
const patchUnkeyedChildren = (c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
c1 = c1 || EMPTY_ARR;
c2 = c2 || EMPTY_ARR;
const oldLength = c1.length;
const newLength = c2.length;
const commonLength = Math.min(oldLength, newLength);
let i;
for (i = 0; i < commonLength; i++) {
const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
patch(c1[i], nextChild, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
if (oldLength > newLength) {
unmountChildren(c1, parentComponent, parentSuspense, true, false, commonLength);
} else {
mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, commonLength);
}
};
const patchKeyedChildren = (c1, c2, container, parentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
let i = 0;
const l2 = c2.length;
let e1 = c1.length - 1;
let e2 = l2 - 1;
while (i <= e1 && i <= e2) {
const n1 = c1[i];
const n2 = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
if (isSameVNodeType(n1, n2)) {
patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else {
break;
}
i++;
}
while (i <= e1 && i <= e2) {
const n1 = c1[e1];
const n2 = c2[e2] = optimized ? cloneIfMounted(c2[e2]) : normalizeVNode(c2[e2]);
if (isSameVNodeType(n1, n2)) {
patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else {
break;
}
e1--;
e2--;
}
if (i > e1) {
if (i <= e2) {
const nextPos = e2 + 1;
const anchor = nextPos < l2 ? c2[nextPos].el : parentAnchor;
while (i <= e2) {
patch(null, c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]), container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
i++;
}
}
} else if (i > e2) {
while (i <= e1) {
unmount(c1[i], parentComponent, parentSuspense, true);
i++;
}
} else {
const s1 = i;
const s2 = i;
const keyToNewIndexMap = /* @__PURE__ */ new Map();
for (i = s2; i <= e2; i++) {
const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
if (nextChild.key != null) {
keyToNewIndexMap.set(nextChild.key, i);
}
}
let j;
let patched = 0;
const toBePatched = e2 - s2 + 1;
let moved = false;
let maxNewIndexSoFar = 0;
const newIndexToOldIndexMap = new Array(toBePatched);
for (i = 0; i < toBePatched; i++)
newIndexToOldIndexMap[i] = 0;
for (i = s1; i <= e1; i++) {
const prevChild = c1[i];
if (patched >= toBePatched) {
unmount(prevChild, parentComponent, parentSuspense, true);
continue;
}
let newIndex;
if (prevChild.key != null) {
newIndex = keyToNewIndexMap.get(prevChild.key);
} else {
for (j = s2; j <= e2; j++) {
if (newIndexToOldIndexMap[j - s2] === 0 && isSameVNodeType(prevChild, c2[j])) {
newIndex = j;
break;
}
}
}
if (newIndex === void 0) {
unmount(prevChild, parentComponent, parentSuspense, true);
} else {
newIndexToOldIndexMap[newIndex - s2] = i + 1;
if (newIndex >= maxNewIndexSoFar) {
maxNewIndexSoFar = newIndex;
} else {
moved = true;
}
patch(prevChild, c2[newIndex], container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
patched++;
}
}
const increasingNewIndexSequence = moved ? getSequence(newIndexToOldIndexMap) : EMPTY_ARR;
j = increasingNewIndexSequence.length - 1;
for (i = toBePatched - 1; i >= 0; i--) {
const nextIndex = s2 + i;
const nextChild = c2[nextIndex];
const anchor = nextIndex + 1 < l2 ? c2[nextIndex + 1].el : parentAnchor;
if (newIndexToOldIndexMap[i] === 0) {
patch(null, nextChild, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
} else if (moved) {
if (j < 0 || i !== increasingNewIndexSequence[j]) {
move(
nextChild,
container,
anchor,
2
/* MoveType.REORDER */
);
} else {
j--;
}
}
}
}
};
const move = (vnode, container, anchor, moveType, parentSuspense = null) => {
const { el, type: type2, transition, children, shapeFlag } = vnode;
if (shapeFlag & 6) {
move(vnode.component.subTree, container, anchor, moveType);
return;
}
if (shapeFlag & 128) {
vnode.suspense.move(container, anchor, moveType);
return;
}
if (shapeFlag & 64) {
type2.move(vnode, container, anchor, internals);
return;
}
if (type2 === Fragment$1) {
hostInsert(el, container, anchor);
for (let i = 0; i < children.length; i++) {
move(children[i], container, anchor, moveType);
}
hostInsert(vnode.anchor, container, anchor);
return;
}
if (type2 === Static) {
moveStaticNode(vnode, container, anchor);
return;
}
const needTransition = moveType !== 2 && shapeFlag & 1 && transition;
if (needTransition) {
if (moveType === 0) {
transition.beforeEnter(el);
hostInsert(el, container, anchor);
queuePostRenderEffect(() => transition.enter(el), parentSuspense);
} else {
const { leave, delayLeave, afterLeave } = transition;
const remove3 = () => hostInsert(el, container, anchor);
const performLeave = () => {
leave(el, () => {
remove3();
afterLeave && afterLeave();
});
};
if (delayLeave) {
delayLeave(el, remove3, performLeave);
} else {
performLeave();
}
}
} else {
hostInsert(el, container, anchor);
}
};
const unmount = (vnode, parentComponent, parentSuspense, doRemove = false, optimized = false) => {
const { type: type2, props, ref: ref2, children, dynamicChildren, shapeFlag, patchFlag, dirs } = vnode;
if (ref2 != null) {
setRef(ref2, null, parentSuspense, vnode, true);
}
if (shapeFlag & 256) {
parentComponent.ctx.deactivate(vnode);
return;
}
const shouldInvokeDirs = shapeFlag & 1 && dirs;
const shouldInvokeVnodeHook = !isAsyncWrapper(vnode);
let vnodeHook;
if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeBeforeUnmount)) {
invokeVNodeHook(vnodeHook, parentComponent, vnode);
}
if (shapeFlag & 6) {
unmountComponent(vnode.component, parentSuspense, doRemove);
} else {
if (shapeFlag & 128) {
vnode.suspense.unmount(parentSuspense, doRemove);
return;
}
if (shouldInvokeDirs) {
invokeDirectiveHook(vnode, null, parentComponent, "beforeUnmount");
}
if (shapeFlag & 64) {
vnode.type.remove(vnode, parentComponent, parentSuspense, optimized, internals, doRemove);
} else if (dynamicChildren && // #1153: fast path should not be taken for non-stable (v-for) fragments
(type2 !== Fragment$1 || patchFlag > 0 && patchFlag & 64)) {
unmountChildren(dynamicChildren, parentComponent, parentSuspense, false, true);
} else if (type2 === Fragment$1 && patchFlag & (128 | 256) || !optimized && shapeFlag & 16) {
unmountChildren(children, parentComponent, parentSuspense);
}
if (doRemove) {
remove2(vnode);
}
}
if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeUnmounted) || shouldInvokeDirs) {
queuePostRenderEffect(() => {
vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
shouldInvokeDirs && invokeDirectiveHook(vnode, null, parentComponent, "unmounted");
}, parentSuspense);
}
};
const remove2 = (vnode) => {
const { type: type2, el, anchor, transition } = vnode;
if (type2 === Fragment$1) {
{
removeFragment(el, anchor);
}
return;
}
if (type2 === Static) {
removeStaticNode(vnode);
return;
}
const performRemove = () => {
hostRemove(el);
if (transition && !transition.persisted && transition.afterLeave) {
transition.afterLeave();
}
};
if (vnode.shapeFlag & 1 && transition && !transition.persisted) {
const { leave, delayLeave } = transition;
const performLeave = () => leave(el, performRemove);
if (delayLeave) {
delayLeave(vnode.el, performRemove, performLeave);
} else {
performLeave();
}
} else {
performRemove();
}
};
const removeFragment = (cur, end2) => {
let next;
while (cur !== end2) {
next = hostNextSibling(cur);
hostRemove(cur);
cur = next;
}
hostRemove(end2);
};
const unmountComponent = (instance, parentSuspense, doRemove) => {
const { bum, scope, update, subTree, um } = instance;
if (bum) {
invokeArrayFns(bum);
}
scope.stop();
if (update) {
update.active = false;
unmount(subTree, instance, parentSuspense, doRemove);
}
if (um) {
queuePostRenderEffect(um, parentSuspense);
}
queuePostRenderEffect(() => {
instance.isUnmounted = true;
}, parentSuspense);
if (parentSuspense && parentSuspense.pendingBranch && !parentSuspense.isUnmounted && instance.asyncDep && !instance.asyncResolved && instance.suspenseId === parentSuspense.pendingId) {
parentSuspense.deps--;
if (parentSuspense.deps === 0) {
parentSuspense.resolve();
}
}
};
const unmountChildren = (children, parentComponent, parentSuspense, doRemove = false, optimized = false, start = 0) => {
for (let i = start; i < children.length; i++) {
unmount(children[i], parentComponent, parentSuspense, doRemove, optimized);
}
};
const getNextHostNode = (vnode) => {
if (vnode.shapeFlag & 6) {
return getNextHostNode(vnode.component.subTree);
}
if (vnode.shapeFlag & 128) {
return vnode.suspense.next();
}
return hostNextSibling(vnode.anchor || vnode.el);
};
const render2 = (vnode, container, isSVG) => {
if (vnode == null) {
if (container._vnode) {
unmount(container._vnode, null, null, true);
}
} else {
patch(container._vnode || null, vnode, container, null, null, null, isSVG);
}
flushPreFlushCbs();
flushPostFlushCbs();
container._vnode = vnode;
};
const internals = {
p: patch,
um: unmount,
m: move,
r: remove2,
mt: mountComponent,
mc: mountChildren,
pc: patchChildren,
pbc: patchBlockChildren,
n: getNextHostNode,
o: options
};
let hydrate;
let hydrateNode;
if (createHydrationFns) {
[hydrate, hydrateNode] = createHydrationFns(internals);
}
return {
render: render2,
hydrate,
createApp: createAppAPI(render2, hydrate)
};
}
function toggleRecurse({ effect, update }, allowed) {
effect.allowRecurse = update.allowRecurse = allowed;
}
function traverseStaticChildren(n1, n2, shallow = false) {
const ch1 = n1.children;
const ch2 = n2.children;
if (isArray$3(ch1) && isArray$3(ch2)) {
for (let i = 0; i < ch1.length; i++) {
const c1 = ch1[i];
let c2 = ch2[i];
if (c2.shapeFlag & 1 && !c2.dynamicChildren) {
if (c2.patchFlag <= 0 || c2.patchFlag === 32) {
c2 = ch2[i] = cloneIfMounted(ch2[i]);
c2.el = c1.el;
}
if (!shallow)
traverseStaticChildren(c1, c2);
}
if (c2.type === Text) {
c2.el = c1.el;
}
}
}
}
function getSequence(arr) {
const p2 = arr.slice();
const result = [0];
let i, j, u, v, c;
const len = arr.length;
for (i = 0; i < len; i++) {
const arrI = arr[i];
if (arrI !== 0) {
j = result[result.length - 1];
if (arr[j] < arrI) {
p2[i] = j;
result.push(i);
continue;
}
u = 0;
v = result.length - 1;
while (u < v) {
c = u + v >> 1;
if (arr[result[c]] < arrI) {
u = c + 1;
} else {
v = c;
}
}
if (arrI < arr[result[u]]) {
if (u > 0) {
p2[i] = result[u - 1];
}
result[u] = i;
}
}
}
u = result.length;
v = result[u - 1];
while (u-- > 0) {
result[u] = v;
v = p2[v];
}
return result;
}
const isTeleport = (type2) => type2.__isTeleport;
const isTeleportDisabled = (props) => props && (props.disabled || props.disabled === "");
const isTargetSVG = (target) => typeof SVGElement !== "undefined" && target instanceof SVGElement;
const resolveTarget = (props, select) => {
const targetSelector = props && props.to;
if (isString$2(targetSelector)) {
if (!select) {
return null;
} else {
const target = select(targetSelector);
return target;
}
} else {
return targetSelector;
}
};
const TeleportImpl = {
__isTeleport: true,
process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals) {
const { mc: mountChildren, pc: patchChildren, pbc: patchBlockChildren, o: { insert, querySelector, createText, createComment } } = internals;
const disabled = isTeleportDisabled(n2.props);
let { shapeFlag, children, dynamicChildren } = n2;
if (n1 == null) {
const placeholder = n2.el = createText("");
const mainAnchor = n2.anchor = createText("");
insert(placeholder, container, anchor);
insert(mainAnchor, container, anchor);
const target = n2.target = resolveTarget(n2.props, querySelector);
const targetAnchor = n2.targetAnchor = createText("");
if (target) {
insert(targetAnchor, target);
isSVG = isSVG || isTargetSVG(target);
}
const mount = (container2, anchor2) => {
if (shapeFlag & 16) {
mountChildren(children, container2, anchor2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
}
};
if (disabled) {
mount(container, mainAnchor);
} else if (target) {
mount(target, targetAnchor);
}
} else {
n2.el = n1.el;
const mainAnchor = n2.anchor = n1.anchor;
const target = n2.target = n1.target;
const targetAnchor = n2.targetAnchor = n1.targetAnchor;
const wasDisabled = isTeleportDisabled(n1.props);
const currentContainer = wasDisabled ? container : target;
const currentAnchor = wasDisabled ? mainAnchor : targetAnchor;
isSVG = isSVG || isTargetSVG(target);
if (dynamicChildren) {
patchBlockChildren(n1.dynamicChildren, dynamicChildren, currentContainer, parentComponent, parentSuspense, isSVG, slotScopeIds);
traverseStaticChildren(n1, n2, true);
} else if (!optimized) {
patchChildren(n1, n2, currentContainer, currentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, false);
}
if (disabled) {
if (!wasDisabled) {
moveTeleport(
n2,
container,
mainAnchor,
internals,
1
/* TeleportMoveTypes.TOGGLE */
);
}
} else {
if ((n2.props && n2.props.to) !== (n1.props && n1.props.to)) {
const nextTarget = n2.target = resolveTarget(n2.props, querySelector);
if (nextTarget) {
moveTeleport(
n2,
nextTarget,
null,
internals,
0
/* TeleportMoveTypes.TARGET_CHANGE */
);
}
} else if (wasDisabled) {
moveTeleport(
n2,
target,
targetAnchor,
internals,
1
/* TeleportMoveTypes.TOGGLE */
);
}
}
}
updateCssVars(n2);
},
remove(vnode, parentComponent, parentSuspense, optimized, { um: unmount, o: { remove: hostRemove } }, doRemove) {
const { shapeFlag, children, anchor, targetAnchor, target, props } = vnode;
if (target) {
hostRemove(targetAnchor);
}
if (doRemove || !isTeleportDisabled(props)) {
hostRemove(anchor);
if (shapeFlag & 16) {
for (let i = 0; i < children.length; i++) {
const child = children[i];
unmount(child, parentComponent, parentSuspense, true, !!child.dynamicChildren);
}
}
}
},
move: moveTeleport,
hydrate: hydrateTeleport
};
function moveTeleport(vnode, container, parentAnchor, { o: { insert }, m: move }, moveType = 2) {
if (moveType === 0) {
insert(vnode.targetAnchor, container, parentAnchor);
}
const { el, anchor, shapeFlag, children, props } = vnode;
const isReorder = moveType === 2;
if (isReorder) {
insert(el, container, parentAnchor);
}
if (!isReorder || isTeleportDisabled(props)) {
if (shapeFlag & 16) {
for (let i = 0; i < children.length; i++) {
move(
children[i],
container,
parentAnchor,
2
/* MoveType.REORDER */
);
}
}
}
if (isReorder) {
insert(anchor, container, parentAnchor);
}
}
function hydrateTeleport(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, { o: { nextSibling, parentNode, querySelector } }, hydrateChildren) {
const target = vnode.target = resolveTarget(vnode.props, querySelector);
if (target) {
const targetNode = target._lpa || target.firstChild;
if (vnode.shapeFlag & 16) {
if (isTeleportDisabled(vnode.props)) {
vnode.anchor = hydrateChildren(nextSibling(node), vnode, parentNode(node), parentComponent, parentSuspense, slotScopeIds, optimized);
vnode.targetAnchor = targetNode;
} else {
vnode.anchor = nextSibling(node);
let targetAnchor = targetNode;
while (targetAnchor) {
targetAnchor = nextSibling(targetAnchor);
if (targetAnchor && targetAnchor.nodeType === 8 && targetAnchor.data === "teleport anchor") {
vnode.targetAnchor = targetAnchor;
target._lpa = vnode.targetAnchor && nextSibling(vnode.targetAnchor);
break;
}
}
hydrateChildren(targetNode, vnode, target, parentComponent, parentSuspense, slotScopeIds, optimized);
}
}
updateCssVars(vnode);
}
return vnode.anchor && nextSibling(vnode.anchor);
}
const Teleport = TeleportImpl;
function updateCssVars(vnode) {
const ctx = vnode.ctx;
if (ctx && ctx.ut) {
let node = vnode.children[0].el;
while (node !== vnode.targetAnchor) {
if (node.nodeType === 1)
node.setAttribute("data-v-owner", ctx.uid);
node = node.nextSibling;
}
ctx.ut();
}
}
const Fragment$1 = Symbol(void 0);
const Text = Symbol(void 0);
const Comment = Symbol(void 0);
const Static = Symbol(void 0);
const blockStack = [];
let currentBlock = null;
function openBlock(disableTracking = false) {
blockStack.push(currentBlock = disableTracking ? null : []);
}
function closeBlock() {
blockStack.pop();
currentBlock = blockStack[blockStack.length - 1] || null;
}
let isBlockTreeEnabled = 1;
function setBlockTracking(value) {
isBlockTreeEnabled += value;
}
function setupBlock(vnode) {
vnode.dynamicChildren = isBlockTreeEnabled > 0 ? currentBlock || EMPTY_ARR : null;
closeBlock();
if (isBlockTreeEnabled > 0 && currentBlock) {
currentBlock.push(vnode);
}
return vnode;
}
function createElementBlock(type2, props, children, patchFlag, dynamicProps, shapeFlag) {
return setupBlock(createBaseVNode(
type2,
props,
children,
patchFlag,
dynamicProps,
shapeFlag,
true
/* isBlock */
));
}
function createBlock(type2, props, children, patchFlag, dynamicProps) {
return setupBlock(createVNode(
type2,
props,
children,
patchFlag,
dynamicProps,
true
/* isBlock: prevent a block from tracking itself */
));
}
function isVNode$1(value) {
return value ? value.__v_isVNode === true : false;
}
function isSameVNodeType(n1, n2) {
return n1.type === n2.type && n1.key === n2.key;
}
const InternalObjectKey = `__vInternal`;
const normalizeKey = ({ key }) => key != null ? key : null;
const normalizeRef = ({ ref: ref2, ref_key, ref_for }) => {
return ref2 != null ? isString$2(ref2) || isRef(ref2) || isFunction$2(ref2) ? { i: currentRenderingInstance, r: ref2, k: ref_key, f: !!ref_for } : ref2 : null;
};
function createBaseVNode(type2, props = null, children = null, patchFlag = 0, dynamicProps = null, shapeFlag = type2 === Fragment$1 ? 0 : 1, isBlockNode = false, needFullChildrenNormalization = false) {
const vnode = {
__v_isVNode: true,
__v_skip: true,
type: type2,
props,
key: props && normalizeKey(props),
ref: props && normalizeRef(props),
scopeId: currentScopeId,
slotScopeIds: null,
children,
component: null,
suspense: null,
ssContent: null,
ssFallback: null,
dirs: null,
transition: null,
el: null,
anchor: null,
target: null,
targetAnchor: null,
staticCount: 0,
shapeFlag,
patchFlag,
dynamicProps,
dynamicChildren: null,
appContext: null,
ctx: currentRenderingInstance
};
if (needFullChildrenNormalization) {
normalizeChildren(vnode, children);
if (shapeFlag & 128) {
type2.normalize(vnode);
}
} else if (children) {
vnode.shapeFlag |= isString$2(children) ? 8 : 16;
}
if (isBlockTreeEnabled > 0 && // avoid a block node from tracking itself
!isBlockNode && // has current parent block
currentBlock && // presence of a patch flag indicates this node needs patching on updates.
// component nodes also should always be patched, because even if the
// component doesn't need to update, it needs to persist the instance on to
// the next vnode so that it can be properly unmounted later.
(vnode.patchFlag > 0 || shapeFlag & 6) && // the EVENTS flag is only for hydration and if it is the only flag, the
// vnode should not be considered dynamic due to handler caching.
vnode.patchFlag !== 32) {
currentBlock.push(vnode);
}
return vnode;
}
const createVNode = _createVNode;
function _createVNode(type2, props = null, children = null, patchFlag = 0, dynamicProps = null, isBlockNode = false) {
if (!type2 || type2 === NULL_DYNAMIC_COMPONENT) {
type2 = Comment;
}
if (isVNode$1(type2)) {
const cloned = cloneVNode(
type2,
props,
true
/* mergeRef: true */
);
if (children) {
normalizeChildren(cloned, children);
}
if (isBlockTreeEnabled > 0 && !isBlockNode && currentBlock) {
if (cloned.shapeFlag & 6) {
currentBlock[currentBlock.indexOf(type2)] = cloned;
} else {
currentBlock.push(cloned);
}
}
cloned.patchFlag |= -2;
return cloned;
}
if (isClassComponent(type2)) {
type2 = type2.__vccOpts;
}
if (props) {
props = guardReactiveProps(props);
let { class: klass, style } = props;
if (klass && !isString$2(klass)) {
props.class = normalizeClass(klass);
}
if (isObject$3(style)) {
if (isProxy(style) && !isArray$3(style)) {
style = extend({}, style);
}
props.style = normalizeStyle(style);
}
}
const shapeFlag = isString$2(type2) ? 1 : isSuspense(type2) ? 128 : isTeleport(type2) ? 64 : isObject$3(type2) ? 4 : isFunction$2(type2) ? 2 : 0;
return createBaseVNode(type2, props, children, patchFlag, dynamicProps, shapeFlag, isBlockNode, true);
}
function guardReactiveProps(props) {
if (!props)
return null;
return isProxy(props) || InternalObjectKey in props ? extend({}, props) : props;
}
function cloneVNode(vnode, extraProps, mergeRef = false) {
const { props, ref: ref2, patchFlag, children } = vnode;
const mergedProps = extraProps ? mergeProps(props || {}, extraProps) : props;
const cloned = {
__v_isVNode: true,
__v_skip: true,
type: vnode.type,
props: mergedProps,
key: mergedProps && normalizeKey(mergedProps),
ref: extraProps && extraProps.ref ? (
// #2078 in the case of <component :is="vnode" ref="extra"/>
// if the vnode itself already has a ref, cloneVNode will need to merge
// the refs so the single vnode can be set on multiple refs
mergeRef && ref2 ? isArray$3(ref2) ? ref2.concat(normalizeRef(extraProps)) : [ref2, normalizeRef(extraProps)] : normalizeRef(extraProps)
) : ref2,
scopeId: vnode.scopeId,
slotScopeIds: vnode.slotScopeIds,
children,
target: vnode.target,
targetAnchor: vnode.targetAnchor,
staticCount: vnode.staticCount,
shapeFlag: vnode.shapeFlag,
// if the vnode is cloned with extra props, we can no longer assume its
// existing patch flag to be reliable and need to add the FULL_PROPS flag.
// note: preserve flag for fragments since they use the flag for children
// fast paths only.
patchFlag: extraProps && vnode.type !== Fragment$1 ? patchFlag === -1 ? 16 : patchFlag | 16 : patchFlag,
dynamicProps: vnode.dynamicProps,
dynamicChildren: vnode.dynamicChildren,
appContext: vnode.appContext,
dirs: vnode.dirs,
transition: vnode.transition,
// These should technically only be non-null on mounted VNodes. However,
// they *should* be copied for kept-alive vnodes. So we just always copy
// them since them being non-null during a mount doesn't affect the logic as
// they will simply be overwritten.
component: vnode.component,
suspense: vnode.suspense,
ssContent: vnode.ssContent && cloneVNode(vnode.ssContent),
ssFallback: vnode.ssFallback && cloneVNode(vnode.ssFallback),
el: vnode.el,
anchor: vnode.anchor,
ctx: vnode.ctx,
ce: vnode.ce
};
return cloned;
}
function createTextVNode(text = " ", flag = 0) {
return createVNode(Text, null, text, flag);
}
function createCommentVNode(text = "", asBlock = false) {
return asBlock ? (openBlock(), createBlock(Comment, null, text)) : createVNode(Comment, null, text);
}
function normalizeVNode(child) {
if (child == null || typeof child === "boolean") {
return createVNode(Comment);
} else if (isArray$3(child)) {
return createVNode(
Fragment$1,
null,
// #3666, avoid reference pollution when reusing vnode
child.slice()
);
} else if (typeof child === "object") {
return cloneIfMounted(child);
} else {
return createVNode(Text, null, String(child));
}
}
function cloneIfMounted(child) {
return child.el === null && child.patchFlag !== -1 || child.memo ? child : cloneVNode(child);
}
function normalizeChildren(vnode, children) {
let type2 = 0;
const { shapeFlag } = vnode;
if (children == null) {
children = null;
} else if (isArray$3(children)) {
type2 = 16;
} else if (typeof children === "object") {
if (shapeFlag & (1 | 64)) {
const slot = children.default;
if (slot) {
slot._c && (slot._d = false);
normalizeChildren(vnode, slot());
slot._c && (slot._d = true);
}
return;
} else {
type2 = 32;
const slotFlag = children._;
if (!slotFlag && !(InternalObjectKey in children)) {
children._ctx = currentRenderingInstance;
} else if (slotFlag === 3 && currentRenderingInstance) {
if (currentRenderingInstance.slots._ === 1) {
children._ = 1;
} else {
children._ = 2;
vnode.patchFlag |= 1024;
}
}
}
} else if (isFunction$2(children)) {
children = { default: children, _ctx: currentRenderingInstance };
type2 = 32;
} else {
children = String(children);
if (shapeFlag & 64) {
type2 = 16;
children = [createTextVNode(children)];
} else {
type2 = 8;
}
}
vnode.children = children;
vnode.shapeFlag |= type2;
}
function mergeProps(...args) {
const ret = {};
for (let i = 0; i < args.length; i++) {
const toMerge = args[i];
for (const key in toMerge) {
if (key === "class") {
if (ret.class !== toMerge.class) {
ret.class = normalizeClass([ret.class, toMerge.class]);
}
} else if (key === "style") {
ret.style = normalizeStyle([ret.style, toMerge.style]);
} else if (isOn(key)) {
const existing = ret[key];
const incoming = toMerge[key];
if (incoming && existing !== incoming && !(isArray$3(existing) && existing.includes(incoming))) {
ret[key] = existing ? [].concat(existing, incoming) : incoming;
}
} else if (key !== "") {
ret[key] = toMerge[key];
}
}
}
return ret;
}
function invokeVNodeHook(hook, instance, vnode, prevVNode = null) {
callWithAsyncErrorHandling(hook, instance, 7, [
vnode,
prevVNode
]);
}
const emptyAppContext = createAppContext();
let uid = 0;
function createComponentInstance(vnode, parent, suspense) {
const type2 = vnode.type;
const appContext = (parent ? parent.appContext : vnode.appContext) || emptyAppContext;
const instance = {
uid: uid++,
vnode,
type: type2,
parent,
appContext,
root: null,
next: null,
subTree: null,
effect: null,
update: null,
scope: new EffectScope(
true
/* detached */
),
render: null,
proxy: null,
exposed: null,
exposeProxy: null,
withProxy: null,
provides: parent ? parent.provides : Object.create(appContext.provides),
accessCache: null,
renderCache: [],
// local resolved assets
components: null,
directives: null,
// resolved props and emits options
propsOptions: normalizePropsOptions(type2, appContext),
emitsOptions: normalizeEmitsOptions(type2, appContext),
// emit
emit: null,
emitted: null,
// props default value
propsDefaults: EMPTY_OBJ,
// inheritAttrs
inheritAttrs: type2.inheritAttrs,
// state
ctx: EMPTY_OBJ,
data: EMPTY_OBJ,
props: EMPTY_OBJ,
attrs: EMPTY_OBJ,
slots: EMPTY_OBJ,
refs: EMPTY_OBJ,
setupState: EMPTY_OBJ,
setupContext: null,
// suspense related
suspense,
suspenseId: suspense ? suspense.pendingId : 0,
asyncDep: null,
asyncResolved: false,
// lifecycle hooks
// not using enums here because it results in computed properties
isMounted: false,
isUnmounted: false,
isDeactivated: false,
bc: null,
c: null,
bm: null,
m: null,
bu: null,
u: null,
um: null,
bum: null,
da: null,
a: null,
rtg: null,
rtc: null,
ec: null,
sp: null
};
{
instance.ctx = { _: instance };
}
instance.root = parent ? parent.root : instance;
instance.emit = emit.bind(null, instance);
if (vnode.ce) {
vnode.ce(instance);
}
return instance;
}
let currentInstance = null;
const getCurrentInstance = () => currentInstance || currentRenderingInstance;
const setCurrentInstance = (instance) => {
currentInstance = instance;
instance.scope.on();
};
const unsetCurrentInstance = () => {
currentInstance && currentInstance.scope.off();
currentInstance = null;
};
function isStatefulComponent(instance) {
return instance.vnode.shapeFlag & 4;
}
let isInSSRComponentSetup = false;
function setupComponent(instance, isSSR = false) {
isInSSRComponentSetup = isSSR;
const { props, children } = instance.vnode;
const isStateful = isStatefulComponent(instance);
initProps(instance, props, isStateful, isSSR);
initSlots(instance, children);
const setupResult = isStateful ? setupStatefulComponent(instance, isSSR) : void 0;
isInSSRComponentSetup = false;
return setupResult;
}
function setupStatefulComponent(instance, isSSR) {
const Component = instance.type;
instance.accessCache = /* @__PURE__ */ Object.create(null);
instance.proxy = markRaw(new Proxy(instance.ctx, PublicInstanceProxyHandlers));
const { setup } = Component;
if (setup) {
const setupContext = instance.setupContext = setup.length > 1 ? createSetupContext(instance) : null;
setCurrentInstance(instance);
pauseTracking();
const setupResult = callWithErrorHandling(setup, instance, 0, [instance.props, setupContext]);
resetTracking();
unsetCurrentInstance();
if (isPromise(setupResult)) {
setupResult.then(unsetCurrentInstance, unsetCurrentInstance);
if (isSSR) {
return setupResult.then((resolvedResult) => {
handleSetupResult(instance, resolvedResult, isSSR);
}).catch((e) => {
handleError(
e,
instance,
0
/* ErrorCodes.SETUP_FUNCTION */
);
});
} else {
instance.asyncDep = setupResult;
}
} else {
handleSetupResult(instance, setupResult, isSSR);
}
} else {
finishComponentSetup(instance, isSSR);
}
}
function handleSetupResult(instance, setupResult, isSSR) {
if (isFunction$2(setupResult)) {
if (instance.type.__ssrInlineRender) {
instance.ssrRender = setupResult;
} else {
instance.render = setupResult;
}
} else if (isObject$3(setupResult)) {
instance.setupState = proxyRefs(setupResult);
} else
;
finishComponentSetup(instance, isSSR);
}
let compile;
function finishComponentSetup(instance, isSSR, skipOptions) {
const Component = instance.type;
if (!instance.render) {
if (!isSSR && compile && !Component.render) {
const template2 = Component.template || resolveMergedOptions(instance).template;
if (template2) {
const { isCustomElement, compilerOptions } = instance.appContext.config;
const { delimiters, compilerOptions: componentCompilerOptions } = Component;
const finalCompilerOptions = extend(extend({
isCustomElement,
delimiters
}, compilerOptions), componentCompilerOptions);
Component.render = compile(template2, finalCompilerOptions);
}
}
instance.render = Component.render || NOOP;
}
{
setCurrentInstance(instance);
pauseTracking();
applyOptions(instance);
resetTracking();
unsetCurrentInstance();
}
}
function createAttrsProxy(instance) {
return new Proxy(instance.attrs, {
get(target, key) {
track(instance, "get", "$attrs");
return target[key];
}
});
}
function createSetupContext(instance) {
const expose2 = (exposed) => {
instance.exposed = exposed || {};
};
let attrs;
{
return {
get attrs() {
return attrs || (attrs = createAttrsProxy(instance));
},
slots: instance.slots,
emit: instance.emit,
expose: expose2
};
}
}
function getExposeProxy(instance) {
if (instance.exposed) {
return instance.exposeProxy || (instance.exposeProxy = new Proxy(proxyRefs(markRaw(instance.exposed)), {
get(target, key) {
if (key in target) {
return target[key];
} else if (key in publicPropertiesMap) {
return publicPropertiesMap[key](instance);
}
},
has(target, key) {
return key in target || key in publicPropertiesMap;
}
}));
}
}
function getComponentName(Component, includeInferred = true) {
return isFunction$2(Component) ? Component.displayName || Component.name : Component.name || includeInferred && Component.__name;
}
function isClassComponent(value) {
return isFunction$2(value) && "__vccOpts" in value;
}
const computed = (getterOrOptions, debugOptions) => {
return computed$1(getterOrOptions, debugOptions, isInSSRComponentSetup);
};
function useSlots() {
return getContext().slots;
}
function useAttrs$1() {
return getContext().attrs;
}
function getContext() {
const i = getCurrentInstance();
return i.setupContext || (i.setupContext = createSetupContext(i));
}
function h(type2, propsOrChildren, children) {
const l = arguments.length;
if (l === 2) {
if (isObject$3(propsOrChildren) && !isArray$3(propsOrChildren)) {
if (isVNode$1(propsOrChildren)) {
return createVNode(type2, null, [propsOrChildren]);
}
return createVNode(type2, propsOrChildren);
} else {
return createVNode(type2, null, propsOrChildren);
}
} else {
if (l > 3) {
children = Array.prototype.slice.call(arguments, 2);
} else if (l === 3 && isVNode$1(children)) {
children = [children];
}
return createVNode(type2, propsOrChildren, children);
}
}
const ssrContextKey = Symbol(``);
const useSSRContext = () => {
{
const ctx = inject(ssrContextKey);
return ctx;
}
};
const version = "3.2.47";
const svgNS = "http://www.w3.org/2000/svg";
const doc = typeof document !== "undefined" ? document : null;
const templateContainer = doc && /* @__PURE__ */ doc.createElement("template");
const nodeOps = {
insert: (child, parent, anchor) => {
parent.insertBefore(child, anchor || null);
},
remove: (child) => {
const parent = child.parentNode;
if (parent) {
parent.removeChild(child);
}
},
createElement: (tag, isSVG, is, props) => {
const el = isSVG ? doc.createElementNS(svgNS, tag) : doc.createElement(tag, is ? { is } : void 0);
if (tag === "select" && props && props.multiple != null) {
el.setAttribute("multiple", props.multiple);
}
return el;
},
createText: (text) => doc.createTextNode(text),
createComment: (text) => doc.createComment(text),
setText: (node, text) => {
node.nodeValue = text;
},
setElementText: (el, text) => {
el.textContent = text;
},
parentNode: (node) => node.parentNode,
nextSibling: (node) => node.nextSibling,
querySelector: (selector) => doc.querySelector(selector),
setScopeId(el, id) {
el.setAttribute(id, "");
},
// __UNSAFE__
// Reason: innerHTML.
// Static content here can only come from compiled templates.
// As long as the user only uses trusted templates, this is safe.
insertStaticContent(content, parent, anchor, isSVG, start, end2) {
const before = anchor ? anchor.previousSibling : parent.lastChild;
if (start && (start === end2 || start.nextSibling)) {
while (true) {
parent.insertBefore(start.cloneNode(true), anchor);
if (start === end2 || !(start = start.nextSibling))
break;
}
} else {
templateContainer.innerHTML = isSVG ? `<svg>${content}</svg>` : content;
const template2 = templateContainer.content;
if (isSVG) {
const wrapper = template2.firstChild;
while (wrapper.firstChild) {
template2.appendChild(wrapper.firstChild);
}
template2.removeChild(wrapper);
}
parent.insertBefore(template2, anchor);
}
return [
// first
before ? before.nextSibling : parent.firstChild,
// last
anchor ? anchor.previousSibling : parent.lastChild
];
}
};
function patchClass(el, value, isSVG) {
const transitionClasses = el._vtc;
if (transitionClasses) {
value = (value ? [value, ...transitionClasses] : [...transitionClasses]).join(" ");
}
if (value == null) {
el.removeAttribute("class");
} else if (isSVG) {
el.setAttribute("class", value);
} else {
el.className = value;
}
}
function patchStyle(el, prev, next) {
const style = el.style;
const isCssString = isString$2(next);
if (next && !isCssString) {
if (prev && !isString$2(prev)) {
for (const key in prev) {
if (next[key] == null) {
setStyle(style, key, "");
}
}
}
for (const key in next) {
setStyle(style, key, next[key]);
}
} else {
const currentDisplay = style.display;
if (isCssString) {
if (prev !== next) {
style.cssText = next;
}
} else if (prev) {
el.removeAttribute("style");
}
if ("_vod" in el) {
style.display = currentDisplay;
}
}
}
const importantRE = /\s*!important$/;
function setStyle(style, name, val) {
if (isArray$3(val)) {
val.forEach((v) => setStyle(style, name, v));
} else {
if (val == null)
val = "";
if (name.startsWith("--")) {
style.setProperty(name, val);
} else {
const prefixed = autoPrefix(style, name);
if (importantRE.test(val)) {
style.setProperty(hyphenate(prefixed), val.replace(importantRE, ""), "important");
} else {
style[prefixed] = val;
}
}
}
}
const prefixes = ["Webkit", "Moz", "ms"];
const prefixCache = {};
function autoPrefix(style, rawName) {
const cached = prefixCache[rawName];
if (cached) {
return cached;
}
let name = camelize(rawName);
if (name !== "filter" && name in style) {
return prefixCache[rawName] = name;
}
name = capitalize$2(name);
for (let i = 0; i < prefixes.length; i++) {
const prefixed = prefixes[i] + name;
if (prefixed in style) {
return prefixCache[rawName] = prefixed;
}
}
return rawName;
}
const xlinkNS = "http://www.w3.org/1999/xlink";
function patchAttr(el, key, value, isSVG, instance) {
if (isSVG && key.startsWith("xlink:")) {
if (value == null) {
el.removeAttributeNS(xlinkNS, key.slice(6, key.length));
} else {
el.setAttributeNS(xlinkNS, key, value);
}
} else {
const isBoolean2 = isSpecialBooleanAttr(key);
if (value == null || isBoolean2 && !includeBooleanAttr(value)) {
el.removeAttribute(key);
} else {
el.setAttribute(key, isBoolean2 ? "" : value);
}
}
}
function patchDOMProp(el, key, value, prevChildren, parentComponent, parentSuspense, unmountChildren) {
if (key === "innerHTML" || key === "textContent") {
if (prevChildren) {
unmountChildren(prevChildren, parentComponent, parentSuspense);
}
el[key] = value == null ? "" : value;
return;
}
if (key === "value" && el.tagName !== "PROGRESS" && // custom elements may use _value internally
!el.tagName.includes("-")) {
el._value = value;
const newValue = value == null ? "" : value;
if (el.value !== newValue || // #4956: always set for OPTION elements because its value falls back to
// textContent if no value attribute is present. And setting .value for
// OPTION has no side effect
el.tagName === "OPTION") {
el.value = newValue;
}
if (value == null) {
el.removeAttribute(key);
}
return;
}
let needRemove = false;
if (value === "" || value == null) {
const type2 = typeof el[key];
if (type2 === "boolean") {
value = includeBooleanAttr(value);
} else if (value == null && type2 === "string") {
value = "";
needRemove = true;
} else if (type2 === "number") {
value = 0;
needRemove = true;
}
}
try {
el[key] = value;
} catch (e) {
}
needRemove && el.removeAttribute(key);
}
function addEventListener(el, event, handler, options) {
el.addEventListener(event, handler, options);
}
function removeEventListener(el, event, handler, options) {
el.removeEventListener(event, handler, options);
}
function patchEvent(el, rawName, prevValue, nextValue, instance = null) {
const invokers = el._vei || (el._vei = {});
const existingInvoker = invokers[rawName];
if (nextValue && existingInvoker) {
existingInvoker.value = nextValue;
} else {
const [name, options] = parseName(rawName);
if (nextValue) {
const invoker = invokers[rawName] = createInvoker(nextValue, instance);
addEventListener(el, name, invoker, options);
} else if (existingInvoker) {
removeEventListener(el, name, existingInvoker, options);
invokers[rawName] = void 0;
}
}
}
const optionsModifierRE = /(?:Once|Passive|Capture)$/;
function parseName(name) {
let options;
if (optionsModifierRE.test(name)) {
options = {};
let m;
while (m = name.match(optionsModifierRE)) {
name = name.slice(0, name.length - m[0].length);
options[m[0].toLowerCase()] = true;
}
}
const event = name[2] === ":" ? name.slice(3) : hyphenate(name.slice(2));
return [event, options];
}
let cachedNow = 0;
const p = /* @__PURE__ */ Promise.resolve();
const getNow = () => cachedNow || (p.then(() => cachedNow = 0), cachedNow = Date.now());
function createInvoker(initialValue, instance) {
const invoker = (e) => {
if (!e._vts) {
e._vts = Date.now();
} else if (e._vts <= invoker.attached) {
return;
}
callWithAsyncErrorHandling(patchStopImmediatePropagation(e, invoker.value), instance, 5, [e]);
};
invoker.value = initialValue;
invoker.attached = getNow();
return invoker;
}
function patchStopImmediatePropagation(e, value) {
if (isArray$3(value)) {
const originalStop = e.stopImmediatePropagation;
e.stopImmediatePropagation = () => {
originalStop.call(e);
e._stopped = true;
};
return value.map((fn2) => (e2) => !e2._stopped && fn2 && fn2(e2));
} else {
return value;
}
}
const nativeOnRE = /^on[a-z]/;
const patchProp = (el, key, prevValue, nextValue, isSVG = false, prevChildren, parentComponent, parentSuspense, unmountChildren) => {
if (key === "class") {
patchClass(el, nextValue, isSVG);
} else if (key === "style") {
patchStyle(el, prevValue, nextValue);
} else if (isOn(key)) {
if (!isModelListener(key)) {
patchEvent(el, key, prevValue, nextValue, parentComponent);
}
} else if (key[0] === "." ? (key = key.slice(1), true) : key[0] === "^" ? (key = key.slice(1), false) : shouldSetAsProp(el, key, nextValue, isSVG)) {
patchDOMProp(el, key, nextValue, prevChildren, parentComponent, parentSuspense, unmountChildren);
} else {
if (key === "true-value") {
el._trueValue = nextValue;
} else if (key === "false-value") {
el._falseValue = nextValue;
}
patchAttr(el, key, nextValue, isSVG);
}
};
function shouldSetAsProp(el, key, value, isSVG) {
if (isSVG) {
if (key === "innerHTML" || key === "textContent") {
return true;
}
if (key in el && nativeOnRE.test(key) && isFunction$2(value)) {
return true;
}
return false;
}
if (key === "spellcheck" || key === "draggable" || key === "translate") {
return false;
}
if (key === "form") {
return false;
}
if (key === "list" && el.tagName === "INPUT") {
return false;
}
if (key === "type" && el.tagName === "TEXTAREA") {
return false;
}
if (nativeOnRE.test(key) && isString$2(value)) {
return false;
}
return key in el;
}
const TRANSITION = "transition";
const ANIMATION = "animation";
const Transition = (props, { slots }) => h(BaseTransition, resolveTransitionProps(props), slots);
Transition.displayName = "Transition";
const DOMTransitionPropsValidators = {
name: String,
type: String,
css: {
type: Boolean,
default: true
},
duration: [String, Number, Object],
enterFromClass: String,
enterActiveClass: String,
enterToClass: String,
appearFromClass: String,
appearActiveClass: String,
appearToClass: String,
leaveFromClass: String,
leaveActiveClass: String,
leaveToClass: String
};
const TransitionPropsValidators = Transition.props = /* @__PURE__ */ extend({}, BaseTransition.props, DOMTransitionPropsValidators);
const callHook = (hook, args = []) => {
if (isArray$3(hook)) {
hook.forEach((h2) => h2(...args));
} else if (hook) {
hook(...args);
}
};
const hasExplicitCallback = (hook) => {
return hook ? isArray$3(hook) ? hook.some((h2) => h2.length > 1) : hook.length > 1 : false;
};
function resolveTransitionProps(rawProps) {
const baseProps = {};
for (const key in rawProps) {
if (!(key in DOMTransitionPropsValidators)) {
baseProps[key] = rawProps[key];
}
}
if (rawProps.css === false) {
return baseProps;
}
const { name = "v", type: type2, duration, enterFromClass = `${name}-enter-from`, enterActiveClass = `${name}-enter-active`, enterToClass = `${name}-enter-to`, appearFromClass = enterFromClass, appearActiveClass = enterActiveClass, appearToClass = enterToClass, leaveFromClass = `${name}-leave-from`, leaveActiveClass = `${name}-leave-active`, leaveToClass = `${name}-leave-to` } = rawProps;
const durations = normalizeDuration(duration);
const enterDuration = durations && durations[0];
const leaveDuration = durations && durations[1];
const { onBeforeEnter, onEnter, onEnterCancelled, onLeave, onLeaveCancelled, onBeforeAppear = onBeforeEnter, onAppear = onEnter, onAppearCancelled = onEnterCancelled } = baseProps;
const finishEnter = (el, isAppear, done) => {
removeTransitionClass(el, isAppear ? appearToClass : enterToClass);
removeTransitionClass(el, isAppear ? appearActiveClass : enterActiveClass);
done && done();
};
const finishLeave = (el, done) => {
el._isLeaving = false;
removeTransitionClass(el, leaveFromClass);
removeTransitionClass(el, leaveToClass);
removeTransitionClass(el, leaveActiveClass);
done && done();
};
const makeEnterHook = (isAppear) => {
return (el, done) => {
const hook = isAppear ? onAppear : onEnter;
const resolve2 = () => finishEnter(el, isAppear, done);
callHook(hook, [el, resolve2]);
nextFrame(() => {
removeTransitionClass(el, isAppear ? appearFromClass : enterFromClass);
addTransitionClass(el, isAppear ? appearToClass : enterToClass);
if (!hasExplicitCallback(hook)) {
whenTransitionEnds(el, type2, enterDuration, resolve2);
}
});
};
};
return extend(baseProps, {
onBeforeEnter(el) {
callHook(onBeforeEnter, [el]);
addTransitionClass(el, enterFromClass);
addTransitionClass(el, enterActiveClass);
},
onBeforeAppear(el) {
callHook(onBeforeAppear, [el]);
addTransitionClass(el, appearFromClass);
addTransitionClass(el, appearActiveClass);
},
onEnter: makeEnterHook(false),
onAppear: makeEnterHook(true),
onLeave(el, done) {
el._isLeaving = true;
const resolve2 = () => finishLeave(el, done);
addTransitionClass(el, leaveFromClass);
forceReflow();
addTransitionClass(el, leaveActiveClass);
nextFrame(() => {
if (!el._isLeaving) {
return;
}
removeTransitionClass(el, leaveFromClass);
addTransitionClass(el, leaveToClass);
if (!hasExplicitCallback(onLeave)) {
whenTransitionEnds(el, type2, leaveDuration, resolve2);
}
});
callHook(onLeave, [el, resolve2]);
},
onEnterCancelled(el) {
finishEnter(el, false);
callHook(onEnterCancelled, [el]);
},
onAppearCancelled(el) {
finishEnter(el, true);
callHook(onAppearCancelled, [el]);
},
onLeaveCancelled(el) {
finishLeave(el);
callHook(onLeaveCancelled, [el]);
}
});
}
function normalizeDuration(duration) {
if (duration == null) {
return null;
} else if (isObject$3(duration)) {
return [NumberOf(duration.enter), NumberOf(duration.leave)];
} else {
const n = NumberOf(duration);
return [n, n];
}
}
function NumberOf(val) {
const res = toNumber$1(val);
return res;
}
function addTransitionClass(el, cls) {
cls.split(/\s+/).forEach((c) => c && el.classList.add(c));
(el._vtc || (el._vtc = /* @__PURE__ */ new Set())).add(cls);
}
function removeTransitionClass(el, cls) {
cls.split(/\s+/).forEach((c) => c && el.classList.remove(c));
const { _vtc } = el;
if (_vtc) {
_vtc.delete(cls);
if (!_vtc.size) {
el._vtc = void 0;
}
}
}
function nextFrame(cb) {
requestAnimationFrame(() => {
requestAnimationFrame(cb);
});
}
let endId = 0;
function whenTransitionEnds(el, expectedType, explicitTimeout, resolve2) {
const id = el._endId = ++endId;
const resolveIfNotStale = () => {
if (id === el._endId) {
resolve2();
}
};
if (explicitTimeout) {
return setTimeout(resolveIfNotStale, explicitTimeout);
}
const { type: type2, timeout, propCount } = getTransitionInfo(el, expectedType);
if (!type2) {
return resolve2();
}
const endEvent = type2 + "end";
let ended = 0;
const end2 = () => {
el.removeEventListener(endEvent, onEnd);
resolveIfNotStale();
};
const onEnd = (e) => {
if (e.target === el && ++ended >= propCount) {
end2();
}
};
setTimeout(() => {
if (ended < propCount) {
end2();
}
}, timeout + 1);
el.addEventListener(endEvent, onEnd);
}
function getTransitionInfo(el, expectedType) {
const styles = window.getComputedStyle(el);
const getStyleProperties = (key) => (styles[key] || "").split(", ");
const transitionDelays = getStyleProperties(`${TRANSITION}Delay`);
const transitionDurations = getStyleProperties(`${TRANSITION}Duration`);
const transitionTimeout = getTimeout(transitionDelays, transitionDurations);
const animationDelays = getStyleProperties(`${ANIMATION}Delay`);
const animationDurations = getStyleProperties(`${ANIMATION}Duration`);
const animationTimeout = getTimeout(animationDelays, animationDurations);
let type2 = null;
let timeout = 0;
let propCount = 0;
if (expectedType === TRANSITION) {
if (transitionTimeout > 0) {
type2 = TRANSITION;
timeout = transitionTimeout;
propCount = transitionDurations.length;
}
} else if (expectedType === ANIMATION) {
if (animationTimeout > 0) {
type2 = ANIMATION;
timeout = animationTimeout;
propCount = animationDurations.length;
}
} else {
timeout = Math.max(transitionTimeout, animationTimeout);
type2 = timeout > 0 ? transitionTimeout > animationTimeout ? TRANSITION : ANIMATION : null;
propCount = type2 ? type2 === TRANSITION ? transitionDurations.length : animationDurations.length : 0;
}
const hasTransform = type2 === TRANSITION && /\b(transform|all)(,|$)/.test(getStyleProperties(`${TRANSITION}Property`).toString());
return {
type: type2,
timeout,
propCount,
hasTransform
};
}
function getTimeout(delays, durations) {
while (delays.length < durations.length) {
delays = delays.concat(delays);
}
return Math.max(...durations.map((d, i) => toMs(d) + toMs(delays[i])));
}
function toMs(s) {
return Number(s.slice(0, -1).replace(",", ".")) * 1e3;
}
function forceReflow() {
return document.body.offsetHeight;
}
const positionMap = /* @__PURE__ */ new WeakMap();
const newPositionMap = /* @__PURE__ */ new WeakMap();
const TransitionGroupImpl = {
name: "TransitionGroup",
props: /* @__PURE__ */ extend({}, TransitionPropsValidators, {
tag: String,
moveClass: String
}),
setup(props, { slots }) {
const instance = getCurrentInstance();
const state = useTransitionState();
let prevChildren;
let children;
onUpdated(() => {
if (!prevChildren.length) {
return;
}
const moveClass = props.moveClass || `${props.name || "v"}-move`;
if (!hasCSSTransform(prevChildren[0].el, instance.vnode.el, moveClass)) {
return;
}
prevChildren.forEach(callPendingCbs);
prevChildren.forEach(recordPosition);
const movedChildren = prevChildren.filter(applyTranslation);
forceReflow();
movedChildren.forEach((c) => {
const el = c.el;
const style = el.style;
addTransitionClass(el, moveClass);
style.transform = style.webkitTransform = style.transitionDuration = "";
const cb = el._moveCb = (e) => {
if (e && e.target !== el) {
return;
}
if (!e || /transform$/.test(e.propertyName)) {
el.removeEventListener("transitionend", cb);
el._moveCb = null;
removeTransitionClass(el, moveClass);
}
};
el.addEventListener("transitionend", cb);
});
});
return () => {
const rawProps = toRaw(props);
const cssTransitionProps = resolveTransitionProps(rawProps);
let tag = rawProps.tag || Fragment$1;
prevChildren = children;
children = slots.default ? getTransitionRawChildren(slots.default()) : [];
for (let i = 0; i < children.length; i++) {
const child = children[i];
if (child.key != null) {
setTransitionHooks(child, resolveTransitionHooks(child, cssTransitionProps, state, instance));
}
}
if (prevChildren) {
for (let i = 0; i < prevChildren.length; i++) {
const child = prevChildren[i];
setTransitionHooks(child, resolveTransitionHooks(child, cssTransitionProps, state, instance));
positionMap.set(child, child.el.getBoundingClientRect());
}
}
return createVNode(tag, null, children);
};
}
};
const removeMode = (props) => delete props.mode;
/* @__PURE__ */ removeMode(TransitionGroupImpl.props);
const TransitionGroup = TransitionGroupImpl;
function callPendingCbs(c) {
const el = c.el;
if (el._moveCb) {
el._moveCb();
}
if (el._enterCb) {
el._enterCb();
}
}
function recordPosition(c) {
newPositionMap.set(c, c.el.getBoundingClientRect());
}
function applyTranslation(c) {
const oldPos = positionMap.get(c);
const newPos = newPositionMap.get(c);
const dx = oldPos.left - newPos.left;
const dy = oldPos.top - newPos.top;
if (dx || dy) {
const s = c.el.style;
s.transform = s.webkitTransform = `translate(${dx}px,${dy}px)`;
s.transitionDuration = "0s";
return c;
}
}
function hasCSSTransform(el, root2, moveClass) {
const clone2 = el.cloneNode();
if (el._vtc) {
el._vtc.forEach((cls) => {
cls.split(/\s+/).forEach((c) => c && clone2.classList.remove(c));
});
}
moveClass.split(/\s+/).forEach((c) => c && clone2.classList.add(c));
clone2.style.display = "none";
const container = root2.nodeType === 1 ? root2 : root2.parentNode;
container.appendChild(clone2);
const { hasTransform } = getTransitionInfo(clone2);
container.removeChild(clone2);
return hasTransform;
}
const getModelAssigner = (vnode) => {
const fn2 = vnode.props["onUpdate:modelValue"] || false;
return isArray$3(fn2) ? (value) => invokeArrayFns(fn2, value) : fn2;
};
function onCompositionStart(e) {
e.target.composing = true;
}
function onCompositionEnd(e) {
const target = e.target;
if (target.composing) {
target.composing = false;
target.dispatchEvent(new Event("input"));
}
}
const vModelText = {
created(el, { modifiers: { lazy, trim, number: number2 } }, vnode) {
el._assign = getModelAssigner(vnode);
const castToNumber = number2 || vnode.props && vnode.props.type === "number";
addEventListener(el, lazy ? "change" : "input", (e) => {
if (e.target.composing)
return;
let domValue = el.value;
if (trim) {
domValue = domValue.trim();
}
if (castToNumber) {
domValue = looseToNumber(domValue);
}
el._assign(domValue);
});
if (trim) {
addEventListener(el, "change", () => {
el.value = el.value.trim();
});
}
if (!lazy) {
addEventListener(el, "compositionstart", onCompositionStart);
addEventListener(el, "compositionend", onCompositionEnd);
addEventListener(el, "change", onCompositionEnd);
}
},
// set value on mounted so it's after min/max for type="range"
mounted(el, { value }) {
el.value = value == null ? "" : value;
},
beforeUpdate(el, { value, modifiers: { lazy, trim, number: number2 } }, vnode) {
el._assign = getModelAssigner(vnode);
if (el.composing)
return;
if (document.activeElement === el && el.type !== "range") {
if (lazy) {
return;
}
if (trim && el.value.trim() === value) {
return;
}
if ((number2 || el.type === "number") && looseToNumber(el.value) === value) {
return;
}
}
const newValue = value == null ? "" : value;
if (el.value !== newValue) {
el.value = newValue;
}
}
};
const vModelCheckbox = {
// #4096 array checkboxes need to be deep traversed
deep: true,
created(el, _, vnode) {
el._assign = getModelAssigner(vnode);
addEventListener(el, "change", () => {
const modelValue = el._modelValue;
const elementValue = getValue$2(el);
const checked = el.checked;
const assign2 = el._assign;
if (isArray$3(modelValue)) {
const index2 = looseIndexOf(modelValue, elementValue);
const found = index2 !== -1;
if (checked && !found) {
assign2(modelValue.concat(elementValue));
} else if (!checked && found) {
const filtered = [...modelValue];
filtered.splice(index2, 1);
assign2(filtered);
}
} else if (isSet$2(modelValue)) {
const cloned = new Set(modelValue);
if (checked) {
cloned.add(elementValue);
} else {
cloned.delete(elementValue);
}
assign2(cloned);
} else {
assign2(getCheckboxValue(el, checked));
}
});
},
// set initial checked on mount to wait for true-value/false-value
mounted: setChecked,
beforeUpdate(el, binding, vnode) {
el._assign = getModelAssigner(vnode);
setChecked(el, binding, vnode);
}
};
function setChecked(el, { value, oldValue }, vnode) {
el._modelValue = value;
if (isArray$3(value)) {
el.checked = looseIndexOf(value, vnode.props.value) > -1;
} else if (isSet$2(value)) {
el.checked = value.has(vnode.props.value);
} else if (value !== oldValue) {
el.checked = looseEqual(value, getCheckboxValue(el, true));
}
}
const vModelSelect = {
// <select multiple> value need to be deep traversed
deep: true,
created(el, { value, modifiers: { number: number2 } }, vnode) {
const isSetModel = isSet$2(value);
addEventListener(el, "change", () => {
const selectedVal = Array.prototype.filter.call(el.options, (o) => o.selected).map((o) => number2 ? looseToNumber(getValue$2(o)) : getValue$2(o));
el._assign(el.multiple ? isSetModel ? new Set(selectedVal) : selectedVal : selectedVal[0]);
});
el._assign = getModelAssigner(vnode);
},
// set value in mounted & updated because <select> relies on its children
// <option>s.
mounted(el, { value }) {
setSelected(el, value);
},
beforeUpdate(el, _binding, vnode) {
el._assign = getModelAssigner(vnode);
},
updated(el, { value }) {
setSelected(el, value);
}
};
function setSelected(el, value) {
const isMultiple = el.multiple;
if (isMultiple && !isArray$3(value) && !isSet$2(value)) {
return;
}
for (let i = 0, l = el.options.length; i < l; i++) {
const option = el.options[i];
const optionValue = getValue$2(option);
if (isMultiple) {
if (isArray$3(value)) {
option.selected = looseIndexOf(value, optionValue) > -1;
} else {
option.selected = value.has(optionValue);
}
} else {
if (looseEqual(getValue$2(option), value)) {
if (el.selectedIndex !== i)
el.selectedIndex = i;
return;
}
}
}
if (!isMultiple && el.selectedIndex !== -1) {
el.selectedIndex = -1;
}
}
function getValue$2(el) {
return "_value" in el ? el._value : el.value;
}
function getCheckboxValue(el, checked) {
const key = checked ? "_trueValue" : "_falseValue";
return key in el ? el[key] : checked;
}
const systemModifiers = ["ctrl", "shift", "alt", "meta"];
const modifierGuards = {
stop: (e) => e.stopPropagation(),
prevent: (e) => e.preventDefault(),
self: (e) => e.target !== e.currentTarget,
ctrl: (e) => !e.ctrlKey,
shift: (e) => !e.shiftKey,
alt: (e) => !e.altKey,
meta: (e) => !e.metaKey,
left: (e) => "button" in e && e.button !== 0,
middle: (e) => "button" in e && e.button !== 1,
right: (e) => "button" in e && e.button !== 2,
exact: (e, modifiers) => systemModifiers.some((m) => e[`${m}Key`] && !modifiers.includes(m))
};
const withModifiers = (fn2, modifiers) => {
return (event, ...args) => {
for (let i = 0; i < modifiers.length; i++) {
const guard = modifierGuards[modifiers[i]];
if (guard && guard(event, modifiers))
return;
}
return fn2(event, ...args);
};
};
const keyNames = {
esc: "escape",
space: " ",
up: "arrow-up",
left: "arrow-left",
right: "arrow-right",
down: "arrow-down",
delete: "backspace"
};
const withKeys = (fn2, modifiers) => {
return (event) => {
if (!("key" in event)) {
return;
}
const eventKey = hyphenate(event.key);
if (modifiers.some((k) => k === eventKey || keyNames[k] === eventKey)) {
return fn2(event);
}
};
};
const vShow = {
beforeMount(el, { value }, { transition }) {
el._vod = el.style.display === "none" ? "" : el.style.display;
if (transition && value) {
transition.beforeEnter(el);
} else {
setDisplay(el, value);
}
},
mounted(el, { value }, { transition }) {
if (transition && value) {
transition.enter(el);
}
},
updated(el, { value, oldValue }, { transition }) {
if (!value === !oldValue)
return;
if (transition) {
if (value) {
transition.beforeEnter(el);
setDisplay(el, true);
transition.enter(el);
} else {
transition.leave(el, () => {
setDisplay(el, false);
});
}
} else {
setDisplay(el, value);
}
},
beforeUnmount(el, { value }) {
setDisplay(el, value);
}
};
function setDisplay(el, value) {
el.style.display = value ? el._vod : "none";
}
const rendererOptions = /* @__PURE__ */ extend({ patchProp }, nodeOps);
let renderer;
function ensureRenderer() {
return renderer || (renderer = createRenderer(rendererOptions));
}
const render = (...args) => {
ensureRenderer().render(...args);
};
const createApp = (...args) => {
const app = ensureRenderer().createApp(...args);
const { mount } = app;
app.mount = (containerOrSelector) => {
const container = normalizeContainer(containerOrSelector);
if (!container)
return;
const component = app._component;
if (!isFunction$2(component) && !component.render && !component.template) {
component.template = container.innerHTML;
}
container.innerHTML = "";
const proxy2 = mount(container, false, container instanceof SVGElement);
if (container instanceof Element) {
container.removeAttribute("v-cloak");
container.setAttribute("data-v-app", "");
}
return proxy2;
};
return app;
};
function normalizeContainer(container) {
if (isString$2(container)) {
const res = document.querySelector(container);
return res;
}
return container;
}
var functionOnce = once;
function once(fn2) {
var called, value;
if (typeof fn2 !== "function") {
throw new Error("expected a function but got " + fn2);
}
return function wrap2() {
if (called) {
return value;
}
called = true;
value = fn2.apply(this, arguments);
fn2 = void 0;
return value;
};
}
var eventemitter3 = { exports: {} };
(function(module2) {
var has2 = Object.prototype.hasOwnProperty, prefix = "~";
function Events() {
}
if (Object.create) {
Events.prototype = /* @__PURE__ */ Object.create(null);
if (!new Events().__proto__)
prefix = false;
}
function EE(fn2, context, once2) {
this.fn = fn2;
this.context = context;
this.once = once2 || false;
}
function addListener(emitter, event, fn2, context, once2) {
if (typeof fn2 !== "function") {
throw new TypeError("The listener must be a function");
}
var listener = new EE(fn2, context || emitter, once2), evt = prefix ? prefix + event : event;
if (!emitter._events[evt])
emitter._events[evt] = listener, emitter._eventsCount++;
else if (!emitter._events[evt].fn)
emitter._events[evt].push(listener);
else
emitter._events[evt] = [emitter._events[evt], listener];
return emitter;
}
function clearEvent(emitter, evt) {
if (--emitter._eventsCount === 0)
emitter._events = new Events();
else
delete emitter._events[evt];
}
function EventEmitter2() {
this._events = new Events();
this._eventsCount = 0;
}
EventEmitter2.prototype.eventNames = function eventNames() {
var names2 = [], events, name;
if (this._eventsCount === 0)
return names2;
for (name in events = this._events) {
if (has2.call(events, name))
names2.push(prefix ? name.slice(1) : name);
}
if (Object.getOwnPropertySymbols) {
return names2.concat(Object.getOwnPropertySymbols(events));
}
return names2;
};
EventEmitter2.prototype.listeners = function listeners(event) {
var evt = prefix ? prefix + event : event, handlers2 = this._events[evt];
if (!handlers2)
return [];
if (handlers2.fn)
return [handlers2.fn];
for (var i = 0, l = handlers2.length, ee2 = new Array(l); i < l; i++) {
ee2[i] = handlers2[i].fn;
}
return ee2;
};
EventEmitter2.prototype.listenerCount = function listenerCount(event) {
var evt = prefix ? prefix + event : event, listeners = this._events[evt];
if (!listeners)
return 0;
if (listeners.fn)
return 1;
return listeners.length;
};
EventEmitter2.prototype.emit = function emit2(event, a1, a2, a3, a4, a5) {
var evt = prefix ? prefix + event : event;
if (!this._events[evt])
return false;
var listeners = this._events[evt], len = arguments.length, args, i;
if (listeners.fn) {
if (listeners.once)
this.removeListener(event, listeners.fn, void 0, true);
switch (len) {
case 1:
return listeners.fn.call(listeners.context), true;
case 2:
return listeners.fn.call(listeners.context, a1), true;
case 3:
return listeners.fn.call(listeners.context, a1, a2), true;
case 4:
return listeners.fn.call(listeners.context, a1, a2, a3), true;
case 5:
return listeners.fn.call(listeners.context, a1, a2, a3, a4), true;
case 6:
return listeners.fn.call(listeners.context, a1, a2, a3, a4, a5), true;
}
for (i = 1, args = new Array(len - 1); i < len; i++) {
args[i - 1] = arguments[i];
}
listeners.fn.apply(listeners.context, args);
} else {
var length = listeners.length, j;
for (i = 0; i < length; i++) {
if (listeners[i].once)
this.removeListener(event, listeners[i].fn, void 0, true);
switch (len) {
case 1:
listeners[i].fn.call(listeners[i].context);
break;
case 2:
listeners[i].fn.call(listeners[i].context, a1);
break;
case 3:
listeners[i].fn.call(listeners[i].context, a1, a2);
break;
case 4:
listeners[i].fn.call(listeners[i].context, a1, a2, a3);
break;
default:
if (!args)
for (j = 1, args = new Array(len - 1); j < len; j++) {
args[j - 1] = arguments[j];
}
listeners[i].fn.apply(listeners[i].context, args);
}
}
}
return true;
};
EventEmitter2.prototype.on = function on2(event, fn2, context) {
return addListener(this, event, fn2, context, false);
};
EventEmitter2.prototype.once = function once2(event, fn2, context) {
return addListener(this, event, fn2, context, true);
};
EventEmitter2.prototype.removeListener = function removeListener(event, fn2, context, once2) {
var evt = prefix ? prefix + event : event;
if (!this._events[evt])
return this;
if (!fn2) {
clearEvent(this, evt);
return this;
}
var listeners = this._events[evt];
if (listeners.fn) {
if (listeners.fn === fn2 && (!once2 || listeners.once) && (!context || listeners.context === context)) {
clearEvent(this, evt);
}
} else {
for (var i = 0, events = [], length = listeners.length; i < length; i++) {
if (listeners[i].fn !== fn2 || once2 && !listeners[i].once || context && listeners[i].context !== context) {
events.push(listeners[i]);
}
}
if (events.length)
this._events[evt] = events.length === 1 ? events[0] : events;
else
clearEvent(this, evt);
}
return this;
};
EventEmitter2.prototype.removeAllListeners = function removeAllListeners(event) {
var evt;
if (event) {
evt = prefix ? prefix + event : event;
if (this._events[evt])
clearEvent(this, evt);
} else {
this._events = new Events();
this._eventsCount = 0;
}
return this;
};
EventEmitter2.prototype.off = EventEmitter2.prototype.removeListener;
EventEmitter2.prototype.addListener = EventEmitter2.prototype.on;
EventEmitter2.prefixed = prefix;
EventEmitter2.EventEmitter = EventEmitter2;
{
module2.exports = EventEmitter2;
}
})(eventemitter3);
var eventemitter3Exports = eventemitter3.exports;
const EventEmitter = /* @__PURE__ */ getDefaultExportFromCjs(eventemitter3Exports);
let getRandomValues;
const rnds8 = new Uint8Array(16);
function rng() {
if (!getRandomValues) {
getRandomValues = typeof crypto !== "undefined" && crypto.getRandomValues && crypto.getRandomValues.bind(crypto);
if (!getRandomValues) {
throw new Error("crypto.getRandomValues() not supported. See https://github.com/uuidjs/uuid#getrandomvalues-not-supported");
}
}
return getRandomValues(rnds8);
}
const byteToHex = [];
for (let i = 0; i < 256; ++i) {
byteToHex.push((i + 256).toString(16).slice(1));
}
function unsafeStringify(arr, offset = 0) {
return (byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + "-" + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + "-" + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + "-" + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + "-" + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]).toLowerCase();
}
const randomUUID = typeof crypto !== "undefined" && crypto.randomUUID && crypto.randomUUID.bind(crypto);
const native = {
randomUUID
};
function v4(options, buf, offset) {
if (native.randomUUID && !buf && !options) {
return native.randomUUID();
}
options = options || {};
const rnds = options.random || (options.rng || rng)();
rnds[6] = rnds[6] & 15 | 64;
rnds[8] = rnds[8] & 63 | 128;
if (buf) {
offset = offset || 0;
for (let i = 0; i < 16; ++i) {
buf[offset + i] = rnds[i];
}
return buf;
}
return unsafeStringify(rnds);
}
const removeAt = (array2, index2) => array2.splice(index2, 1)[0];
class AsyncQueue {
constructor(thread = 1) {
__publicField(this, "queue", reactive([]));
__publicField(this, "emitter", new EventEmitter());
__publicField(this, "canSingleStart", () => true);
__publicField(this, "singleRunning", false);
this.thread = thread;
}
get runningThreadNum() {
return this.queue.filter(({ running }) => running).length;
}
get length() {
return this.queue.length;
}
push(fn2, info) {
this.queue.push({
id: v4(),
running: false,
fn: fn2,
info
});
}
async start() {
if (this.thread <= 1) {
if (this.singleRunning || this.queue.length === 0)
return;
this.singleRunning = true;
do {
if (!this.canSingleStart()) {
this.singleRunning = false;
return;
}
await this.queue[0].fn();
this.queue.shift();
} while (this.queue.length > 0);
this.singleRunning = false;
this.emitter.emit("finish");
} else {
const running = this.runningThreadNum;
if (running >= this.thread || this.queue.length === running)
return;
const idleItems = this.queue.filter(({ running: running2 }) => !running2);
for (let i = 0; i < Math.min(idleItems.length, this.thread - running); i++) {
const item = idleItems[i];
item.running = true;
item.fn().then(async () => {
removeAt(
this.queue,
this.queue.findIndex(({ id }) => id === item.id)
);
if (this.queue.length)
await this.start();
else
this.emitter.emit("finish");
}).catch(logger.error);
}
}
}
async skipFromError() {
this.queue.shift();
await this.restartFromError();
}
async restartFromError() {
this.singleRunning = false;
await this.start();
}
}
var freeGlobal = typeof global == "object" && global && global.Object === Object && global;
const freeGlobal$1 = freeGlobal;
var freeSelf = typeof self == "object" && self && self.Object === Object && self;
var root = freeGlobal$1 || freeSelf || Function("return this")();
const root$1 = root;
var Symbol$1 = root$1.Symbol;
const Symbol$2 = Symbol$1;
var objectProto$i = Object.prototype;
var hasOwnProperty$f = objectProto$i.hasOwnProperty;
var nativeObjectToString$2 = objectProto$i.toString;
var symToStringTag$1 = Symbol$2 ? Symbol$2.toStringTag : void 0;
function getRawTag(value) {
var isOwn = hasOwnProperty$f.call(value, symToStringTag$1), tag = value[symToStringTag$1];
try {
value[symToStringTag$1] = void 0;
var unmasked = true;
} catch (e) {
}
var result = nativeObjectToString$2.call(value);
if (unmasked) {
if (isOwn) {
value[symToStringTag$1] = tag;
} else {
delete value[symToStringTag$1];
}
}
return result;
}
var objectProto$h = Object.prototype;
var nativeObjectToString$1 = objectProto$h.toString;
function objectToString$1(value) {
return nativeObjectToString$1.call(value);
}
var nullTag = "[object Null]", undefinedTag = "[object Undefined]";
var symToStringTag = Symbol$2 ? Symbol$2.toStringTag : void 0;
function baseGetTag(value) {
if (value == null) {
return value === void 0 ? undefinedTag : nullTag;
}
return symToStringTag && symToStringTag in Object(value) ? getRawTag(value) : objectToString$1(value);
}
function isObjectLike(value) {
return value != null && typeof value == "object";
}
var symbolTag$3 = "[object Symbol]";
function isSymbol(value) {
return typeof value == "symbol" || isObjectLike(value) && baseGetTag(value) == symbolTag$3;
}
function arrayMap(array2, iteratee) {
var index2 = -1, length = array2 == null ? 0 : array2.length, result = Array(length);
while (++index2 < length) {
result[index2] = iteratee(array2[index2], index2, array2);
}
return result;
}
var isArray$1 = Array.isArray;
const isArray$2 = isArray$1;
var INFINITY$1 = 1 / 0;
var symbolProto$2 = Symbol$2 ? Symbol$2.prototype : void 0, symbolToString = symbolProto$2 ? symbolProto$2.toString : void 0;
function baseToString(value) {
if (typeof value == "string") {
return value;
}
if (isArray$2(value)) {
return arrayMap(value, baseToString) + "";
}
if (isSymbol(value)) {
return symbolToString ? symbolToString.call(value) : "";
}
var result = value + "";
return result == "0" && 1 / value == -INFINITY$1 ? "-0" : result;
}
var reWhitespace = /\s/;
function trimmedEndIndex(string2) {
var index2 = string2.length;
while (index2-- && reWhitespace.test(string2.charAt(index2))) {
}
return index2;
}
var reTrimStart = /^\s+/;
function baseTrim(string2) {
return string2 ? string2.slice(0, trimmedEndIndex(string2) + 1).replace(reTrimStart, "") : string2;
}
function isObject$2(value) {
var type2 = typeof value;
return value != null && (type2 == "object" || type2 == "function");
}
var NAN = 0 / 0;
var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
var reIsBinary = /^0b[01]+$/i;
var reIsOctal = /^0o[0-7]+$/i;
var freeParseInt = parseInt;
function toNumber(value) {
if (typeof value == "number") {
return value;
}
if (isSymbol(value)) {
return NAN;
}
if (isObject$2(value)) {
var other = typeof value.valueOf == "function" ? value.valueOf() : value;
value = isObject$2(other) ? other + "" : other;
}
if (typeof value != "string") {
return value === 0 ? value : +value;
}
value = baseTrim(value);
var isBinary = reIsBinary.test(value);
return isBinary || reIsOctal.test(value) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : reIsBadHex.test(value) ? NAN : +value;
}
function identity$1(value) {
return value;
}
var asyncTag = "[object AsyncFunction]", funcTag$2 = "[object Function]", genTag$1 = "[object GeneratorFunction]", proxyTag = "[object Proxy]";
function isFunction$1(value) {
if (!isObject$2(value)) {
return false;
}
var tag = baseGetTag(value);
return tag == funcTag$2 || tag == genTag$1 || tag == asyncTag || tag == proxyTag;
}
var coreJsData = root$1["__core-js_shared__"];
const coreJsData$1 = coreJsData;
var maskSrcKey = function() {
var uid2 = /[^.]+$/.exec(coreJsData$1 && coreJsData$1.keys && coreJsData$1.keys.IE_PROTO || "");
return uid2 ? "Symbol(src)_1." + uid2 : "";
}();
function isMasked(func) {
return !!maskSrcKey && maskSrcKey in func;
}
var funcProto$2 = Function.prototype;
var funcToString$2 = funcProto$2.toString;
function toSource(func) {
if (func != null) {
try {
return funcToString$2.call(func);
} catch (e) {
}
try {
return func + "";
} catch (e) {
}
}
return "";
}
var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
var reIsHostCtor = /^\[object .+?Constructor\]$/;
var funcProto$1 = Function.prototype, objectProto$g = Object.prototype;
var funcToString$1 = funcProto$1.toString;
var hasOwnProperty$e = objectProto$g.hasOwnProperty;
var reIsNative = RegExp(
"^" + funcToString$1.call(hasOwnProperty$e).replace(reRegExpChar, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$"
);
function baseIsNative(value) {
if (!isObject$2(value) || isMasked(value)) {
return false;
}
var pattern2 = isFunction$1(value) ? reIsNative : reIsHostCtor;
return pattern2.test(toSource(value));
}
function getValue$1(object2, key) {
return object2 == null ? void 0 : object2[key];
}
function getNative(object2, key) {
var value = getValue$1(object2, key);
return baseIsNative(value) ? value : void 0;
}
var WeakMap$1 = getNative(root$1, "WeakMap");
const WeakMap$2 = WeakMap$1;
var objectCreate = Object.create;
var baseCreate = function() {
function object2() {
}
return function(proto) {
if (!isObject$2(proto)) {
return {};
}
if (objectCreate) {
return objectCreate(proto);
}
object2.prototype = proto;
var result = new object2();
object2.prototype = void 0;
return result;
};
}();
const baseCreate$1 = baseCreate;
function apply$1(func, thisArg, args) {
switch (args.length) {
case 0:
return func.call(thisArg);
case 1:
return func.call(thisArg, args[0]);
case 2:
return func.call(thisArg, args[0], args[1]);
case 3:
return func.call(thisArg, args[0], args[1], args[2]);
}
return func.apply(thisArg, args);
}
function copyArray(source, array2) {
var index2 = -1, length = source.length;
array2 || (array2 = Array(length));
while (++index2 < length) {
array2[index2] = source[index2];
}
return array2;
}
var HOT_COUNT = 800, HOT_SPAN = 16;
var nativeNow = Date.now;
function shortOut(func) {
var count = 0, lastCalled = 0;
return function() {
var stamp = nativeNow(), remaining = HOT_SPAN - (stamp - lastCalled);
lastCalled = stamp;
if (remaining > 0) {
if (++count >= HOT_COUNT) {
return arguments[0];
}
} else {
count = 0;
}
return func.apply(void 0, arguments);
};
}
function constant(value) {
return function() {
return value;
};
}
var defineProperty = function() {
try {
var func = getNative(Object, "defineProperty");
func({}, "", {});
return func;
} catch (e) {
}
}();
const defineProperty$1 = defineProperty;
var baseSetToString = !defineProperty$1 ? identity$1 : function(func, string2) {
return defineProperty$1(func, "toString", {
"configurable": true,
"enumerable": false,
"value": constant(string2),
"writable": true
});
};
const baseSetToString$1 = baseSetToString;
var setToString = shortOut(baseSetToString$1);
const setToString$1 = setToString;
function arrayEach(array2, iteratee) {
var index2 = -1, length = array2 == null ? 0 : array2.length;
while (++index2 < length) {
if (iteratee(array2[index2], index2, array2) === false) {
break;
}
}
return array2;
}
var MAX_SAFE_INTEGER$1 = 9007199254740991;
var reIsUint = /^(?:0|[1-9]\d*)$/;
function isIndex(value, length) {
var type2 = typeof value;
length = length == null ? MAX_SAFE_INTEGER$1 : length;
return !!length && (type2 == "number" || type2 != "symbol" && reIsUint.test(value)) && (value > -1 && value % 1 == 0 && value < length);
}
function baseAssignValue(object2, key, value) {
if (key == "__proto__" && defineProperty$1) {
defineProperty$1(object2, key, {
"configurable": true,
"enumerable": true,
"value": value,
"writable": true
});
} else {
object2[key] = value;
}
}
function eq(value, other) {
return value === other || value !== value && other !== other;
}
var objectProto$f = Object.prototype;
var hasOwnProperty$d = objectProto$f.hasOwnProperty;
function assignValue(object2, key, value) {
var objValue = object2[key];
if (!(hasOwnProperty$d.call(object2, key) && eq(objValue, value)) || value === void 0 && !(key in object2)) {
baseAssignValue(object2, key, value);
}
}
function copyObject(source, props, object2, customizer) {
var isNew = !object2;
object2 || (object2 = {});
var index2 = -1, length = props.length;
while (++index2 < length) {
var key = props[index2];
var newValue = customizer ? customizer(object2[key], source[key], key, object2, source) : void 0;
if (newValue === void 0) {
newValue = source[key];
}
if (isNew) {
baseAssignValue(object2, key, newValue);
} else {
assignValue(object2, key, newValue);
}
}
return object2;
}
var nativeMax$1 = Math.max;
function overRest(func, start, transform2) {
start = nativeMax$1(start === void 0 ? func.length - 1 : start, 0);
return function() {
var args = arguments, index2 = -1, length = nativeMax$1(args.length - start, 0), array2 = Array(length);
while (++index2 < length) {
array2[index2] = args[start + index2];
}
index2 = -1;
var otherArgs = Array(start + 1);
while (++index2 < start) {
otherArgs[index2] = args[index2];
}
otherArgs[start] = transform2(array2);
return apply$1(func, this, otherArgs);
};
}
function baseRest(func, start) {
return setToString$1(overRest(func, start, identity$1), func + "");
}
var MAX_SAFE_INTEGER = 9007199254740991;
function isLength(value) {
return typeof value == "number" && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
}
function isArrayLike(value) {
return value != null && isLength(value.length) && !isFunction$1(value);
}
function isIterateeCall(value, index2, object2) {
if (!isObject$2(object2)) {
return false;
}
var type2 = typeof index2;
if (type2 == "number" ? isArrayLike(object2) && isIndex(index2, object2.length) : type2 == "string" && index2 in object2) {
return eq(object2[index2], value);
}
return false;
}
function createAssigner(assigner) {
return baseRest(function(object2, sources) {
var index2 = -1, length = sources.length, customizer = length > 1 ? sources[length - 1] : void 0, guard = length > 2 ? sources[2] : void 0;
customizer = assigner.length > 3 && typeof customizer == "function" ? (length--, customizer) : void 0;
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
customizer = length < 3 ? void 0 : customizer;
length = 1;
}
object2 = Object(object2);
while (++index2 < length) {
var source = sources[index2];
if (source) {
assigner(object2, source, index2, customizer);
}
}
return object2;
});
}
var objectProto$e = Object.prototype;
function isPrototype(value) {
var Ctor = value && value.constructor, proto = typeof Ctor == "function" && Ctor.prototype || objectProto$e;
return value === proto;
}
function baseTimes(n, iteratee) {
var index2 = -1, result = Array(n);
while (++index2 < n) {
result[index2] = iteratee(index2);
}
return result;
}
var argsTag$3 = "[object Arguments]";
function baseIsArguments(value) {
return isObjectLike(value) && baseGetTag(value) == argsTag$3;
}
var objectProto$d = Object.prototype;
var hasOwnProperty$c = objectProto$d.hasOwnProperty;
var propertyIsEnumerable$1 = objectProto$d.propertyIsEnumerable;
var isArguments = baseIsArguments(function() {
return arguments;
}()) ? baseIsArguments : function(value) {
return isObjectLike(value) && hasOwnProperty$c.call(value, "callee") && !propertyIsEnumerable$1.call(value, "callee");
};
const isArguments$1 = isArguments;
function stubFalse() {
return false;
}
var freeExports$2 = typeof exports == "object" && exports && !exports.nodeType && exports;
var freeModule$2 = freeExports$2 && typeof module == "object" && module && !module.nodeType && module;
var moduleExports$2 = freeModule$2 && freeModule$2.exports === freeExports$2;
var Buffer$1 = moduleExports$2 ? root$1.Buffer : void 0;
var nativeIsBuffer = Buffer$1 ? Buffer$1.isBuffer : void 0;
var isBuffer$1 = nativeIsBuffer || stubFalse;
const isBuffer$2 = isBuffer$1;
var argsTag$2 = "[object Arguments]", arrayTag$2 = "[object Array]", boolTag$3 = "[object Boolean]", dateTag$3 = "[object Date]", errorTag$3 = "[object Error]", funcTag$1 = "[object Function]", mapTag$5 = "[object Map]", numberTag$3 = "[object Number]", objectTag$4 = "[object Object]", regexpTag$3 = "[object RegExp]", setTag$5 = "[object Set]", stringTag$3 = "[object String]", weakMapTag$2 = "[object WeakMap]";
var arrayBufferTag$3 = "[object ArrayBuffer]", dataViewTag$4 = "[object DataView]", float32Tag$2 = "[object Float32Array]", float64Tag$2 = "[object Float64Array]", int8Tag$2 = "[object Int8Array]", int16Tag$2 = "[object Int16Array]", int32Tag$2 = "[object Int32Array]", uint8Tag$2 = "[object Uint8Array]", uint8ClampedTag$2 = "[object Uint8ClampedArray]", uint16Tag$2 = "[object Uint16Array]", uint32Tag$2 = "[object Uint32Array]";
var typedArrayTags = {};
typedArrayTags[float32Tag$2] = typedArrayTags[float64Tag$2] = typedArrayTags[int8Tag$2] = typedArrayTags[int16Tag$2] = typedArrayTags[int32Tag$2] = typedArrayTags[uint8Tag$2] = typedArrayTags[uint8ClampedTag$2] = typedArrayTags[uint16Tag$2] = typedArrayTags[uint32Tag$2] = true;
typedArrayTags[argsTag$2] = typedArrayTags[arrayTag$2] = typedArrayTags[arrayBufferTag$3] = typedArrayTags[boolTag$3] = typedArrayTags[dataViewTag$4] = typedArrayTags[dateTag$3] = typedArrayTags[errorTag$3] = typedArrayTags[funcTag$1] = typedArrayTags[mapTag$5] = typedArrayTags[numberTag$3] = typedArrayTags[objectTag$4] = typedArrayTags[regexpTag$3] = typedArrayTags[setTag$5] = typedArrayTags[stringTag$3] = typedArrayTags[weakMapTag$2] = false;
function baseIsTypedArray(value) {
return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
}
function baseUnary(func) {
return function(value) {
return func(value);
};
}
var freeExports$1 = typeof exports == "object" && exports && !exports.nodeType && exports;
var freeModule$1 = freeExports$1 && typeof module == "object" && module && !module.nodeType && module;
var moduleExports$1 = freeModule$1 && freeModule$1.exports === freeExports$1;
var freeProcess = moduleExports$1 && freeGlobal$1.process;
var nodeUtil = function() {
try {
var types2 = freeModule$1 && freeModule$1.require && freeModule$1.require("util").types;
if (types2) {
return types2;
}
return freeProcess && freeProcess.binding && freeProcess.binding("util");
} catch (e) {
}
}();
const nodeUtil$1 = nodeUtil;
var nodeIsTypedArray = nodeUtil$1 && nodeUtil$1.isTypedArray;
var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
const isTypedArray$1 = isTypedArray;
var objectProto$c = Object.prototype;
var hasOwnProperty$b = objectProto$c.hasOwnProperty;
function arrayLikeKeys(value, inherited) {
var isArr = isArray$2(value), isArg = !isArr && isArguments$1(value), isBuff = !isArr && !isArg && isBuffer$2(value), isType = !isArr && !isArg && !isBuff && isTypedArray$1(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length;
for (var key in value) {
if ((inherited || hasOwnProperty$b.call(value, key)) && !(skipIndexes && // Safari 9 has enumerable `arguments.length` in strict mode.
(key == "length" || // Node.js 0.10 has enumerable non-index properties on buffers.
isBuff && (key == "offset" || key == "parent") || // PhantomJS 2 has enumerable non-index properties on typed arrays.
isType && (key == "buffer" || key == "byteLength" || key == "byteOffset") || // Skip index properties.
isIndex(key, length)))) {
result.push(key);
}
}
return result;
}
function overArg(func, transform2) {
return function(arg) {
return func(transform2(arg));
};
}
var nativeKeys = overArg(Object.keys, Object);
const nativeKeys$1 = nativeKeys;
var objectProto$b = Object.prototype;
var hasOwnProperty$a = objectProto$b.hasOwnProperty;
function baseKeys(object2) {
if (!isPrototype(object2)) {
return nativeKeys$1(object2);
}
var result = [];
for (var key in Object(object2)) {
if (hasOwnProperty$a.call(object2, key) && key != "constructor") {
result.push(key);
}
}
return result;
}
function keys(object2) {
return isArrayLike(object2) ? arrayLikeKeys(object2) : baseKeys(object2);
}
function nativeKeysIn(object2) {
var result = [];
if (object2 != null) {
for (var key in Object(object2)) {
result.push(key);
}
}
return result;
}
var objectProto$a = Object.prototype;
var hasOwnProperty$9 = objectProto$a.hasOwnProperty;
function baseKeysIn(object2) {
if (!isObject$2(object2)) {
return nativeKeysIn(object2);
}
var isProto = isPrototype(object2), result = [];
for (var key in object2) {
if (!(key == "constructor" && (isProto || !hasOwnProperty$9.call(object2, key)))) {
result.push(key);
}
}
return result;
}
function keysIn(object2) {
return isArrayLike(object2) ? arrayLikeKeys(object2, true) : baseKeysIn(object2);
}
var assignInWith = createAssigner(function(object2, source, srcIndex, customizer) {
copyObject(source, keysIn(source), object2, customizer);
});
const extendWith = assignInWith;
var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/;
function isKey(value, object2) {
if (isArray$2(value)) {
return false;
}
var type2 = typeof value;
if (type2 == "number" || type2 == "symbol" || type2 == "boolean" || value == null || isSymbol(value)) {
return true;
}
return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || object2 != null && value in Object(object2);
}
var nativeCreate = getNative(Object, "create");
const nativeCreate$1 = nativeCreate;
function hashClear() {
this.__data__ = nativeCreate$1 ? nativeCreate$1(null) : {};
this.size = 0;
}
function hashDelete(key) {
var result = this.has(key) && delete this.__data__[key];
this.size -= result ? 1 : 0;
return result;
}
var HASH_UNDEFINED$2 = "__lodash_hash_undefined__";
var objectProto$9 = Object.prototype;
var hasOwnProperty$8 = objectProto$9.hasOwnProperty;
function hashGet(key) {
var data = this.__data__;
if (nativeCreate$1) {
var result = data[key];
return result === HASH_UNDEFINED$2 ? void 0 : result;
}
return hasOwnProperty$8.call(data, key) ? data[key] : void 0;
}
var objectProto$8 = Object.prototype;
var hasOwnProperty$7 = objectProto$8.hasOwnProperty;
function hashHas(key) {
var data = this.__data__;
return nativeCreate$1 ? data[key] !== void 0 : hasOwnProperty$7.call(data, key);
}
var HASH_UNDEFINED$1 = "__lodash_hash_undefined__";
function hashSet(key, value) {
var data = this.__data__;
this.size += this.has(key) ? 0 : 1;
data[key] = nativeCreate$1 && value === void 0 ? HASH_UNDEFINED$1 : value;
return this;
}
function Hash(entries) {
var index2 = -1, length = entries == null ? 0 : entries.length;
this.clear();
while (++index2 < length) {
var entry = entries[index2];
this.set(entry[0], entry[1]);
}
}
Hash.prototype.clear = hashClear;
Hash.prototype["delete"] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
function listCacheClear() {
this.__data__ = [];
this.size = 0;
}
function assocIndexOf(array2, key) {
var length = array2.length;
while (length--) {
if (eq(array2[length][0], key)) {
return length;
}
}
return -1;
}
var arrayProto = Array.prototype;
var splice = arrayProto.splice;
function listCacheDelete(key) {
var data = this.__data__, index2 = assocIndexOf(data, key);
if (index2 < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index2 == lastIndex) {
data.pop();
} else {
splice.call(data, index2, 1);
}
--this.size;
return true;
}
function listCacheGet(key) {
var data = this.__data__, index2 = assocIndexOf(data, key);
return index2 < 0 ? void 0 : data[index2][1];
}
function listCacheHas(key) {
return assocIndexOf(this.__data__, key) > -1;
}
function listCacheSet(key, value) {
var data = this.__data__, index2 = assocIndexOf(data, key);
if (index2 < 0) {
++this.size;
data.push([key, value]);
} else {
data[index2][1] = value;
}
return this;
}
function ListCache(entries) {
var index2 = -1, length = entries == null ? 0 : entries.length;
this.clear();
while (++index2 < length) {
var entry = entries[index2];
this.set(entry[0], entry[1]);
}
}
ListCache.prototype.clear = listCacheClear;
ListCache.prototype["delete"] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
var Map$1 = getNative(root$1, "Map");
const Map$2 = Map$1;
function mapCacheClear() {
this.size = 0;
this.__data__ = {
"hash": new Hash(),
"map": new (Map$2 || ListCache)(),
"string": new Hash()
};
}
function isKeyable(value) {
var type2 = typeof value;
return type2 == "string" || type2 == "number" || type2 == "symbol" || type2 == "boolean" ? value !== "__proto__" : value === null;
}
function getMapData(map2, key) {
var data = map2.__data__;
return isKeyable(key) ? data[typeof key == "string" ? "string" : "hash"] : data.map;
}
function mapCacheDelete(key) {
var result = getMapData(this, key)["delete"](key);
this.size -= result ? 1 : 0;
return result;
}
function mapCacheGet(key) {
return getMapData(this, key).get(key);
}
function mapCacheHas(key) {
return getMapData(this, key).has(key);
}
function mapCacheSet(key, value) {
var data = getMapData(this, key), size2 = data.size;
data.set(key, value);
this.size += data.size == size2 ? 0 : 1;
return this;
}
function MapCache(entries) {
var index2 = -1, length = entries == null ? 0 : entries.length;
this.clear();
while (++index2 < length) {
var entry = entries[index2];
this.set(entry[0], entry[1]);
}
}
MapCache.prototype.clear = mapCacheClear;
MapCache.prototype["delete"] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
var FUNC_ERROR_TEXT$1 = "Expected a function";
function memoize(func, resolver) {
if (typeof func != "function" || resolver != null && typeof resolver != "function") {
throw new TypeError(FUNC_ERROR_TEXT$1);
}
var memoized = function() {
var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache2 = memoized.cache;
if (cache2.has(key)) {
return cache2.get(key);
}
var result = func.apply(this, args);
memoized.cache = cache2.set(key, result) || cache2;
return result;
};
memoized.cache = new (memoize.Cache || MapCache)();
return memoized;
}
memoize.Cache = MapCache;
var MAX_MEMOIZE_SIZE = 500;
function memoizeCapped(func) {
var result = memoize(func, function(key) {
if (cache2.size === MAX_MEMOIZE_SIZE) {
cache2.clear();
}
return key;
});
var cache2 = result.cache;
return result;
}
var rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
var reEscapeChar = /\\(\\)?/g;
var stringToPath = memoizeCapped(function(string2) {
var result = [];
if (string2.charCodeAt(0) === 46) {
result.push("");
}
string2.replace(rePropName, function(match2, number2, quote, subString) {
result.push(quote ? subString.replace(reEscapeChar, "$1") : number2 || match2);
});
return result;
});
const stringToPath$1 = stringToPath;
function toString(value) {
return value == null ? "" : baseToString(value);
}
function castPath(value, object2) {
if (isArray$2(value)) {
return value;
}
return isKey(value, object2) ? [value] : stringToPath$1(toString(value));
}
var INFINITY = 1 / 0;
function toKey(value) {
if (typeof value == "string" || isSymbol(value)) {
return value;
}
var result = value + "";
return result == "0" && 1 / value == -INFINITY ? "-0" : result;
}
function baseGet(object2, path) {
path = castPath(path, object2);
var index2 = 0, length = path.length;
while (object2 != null && index2 < length) {
object2 = object2[toKey(path[index2++])];
}
return index2 && index2 == length ? object2 : void 0;
}
function get(object2, path, defaultValue) {
var result = object2 == null ? void 0 : baseGet(object2, path);
return result === void 0 ? defaultValue : result;
}
function arrayPush(array2, values2) {
var index2 = -1, length = values2.length, offset = array2.length;
while (++index2 < length) {
array2[offset + index2] = values2[index2];
}
return array2;
}
var spreadableSymbol = Symbol$2 ? Symbol$2.isConcatSpreadable : void 0;
function isFlattenable(value) {
return isArray$2(value) || isArguments$1(value) || !!(spreadableSymbol && value && value[spreadableSymbol]);
}
function baseFlatten(array2, depth, predicate, isStrict, result) {
var index2 = -1, length = array2.length;
predicate || (predicate = isFlattenable);
result || (result = []);
while (++index2 < length) {
var value = array2[index2];
if (depth > 0 && predicate(value)) {
if (depth > 1) {
baseFlatten(value, depth - 1, predicate, isStrict, result);
} else {
arrayPush(result, value);
}
} else if (!isStrict) {
result[result.length] = value;
}
}
return result;
}
function flatten(array2) {
var length = array2 == null ? 0 : array2.length;
return length ? baseFlatten(array2, 1) : [];
}
function flatRest(func) {
return setToString$1(overRest(func, void 0, flatten), func + "");
}
var getPrototype = overArg(Object.getPrototypeOf, Object);
const getPrototype$1 = getPrototype;
var objectTag$3 = "[object Object]";
var funcProto = Function.prototype, objectProto$7 = Object.prototype;
var funcToString = funcProto.toString;
var hasOwnProperty$6 = objectProto$7.hasOwnProperty;
var objectCtorString = funcToString.call(Object);
function isPlainObject$1(value) {
if (!isObjectLike(value) || baseGetTag(value) != objectTag$3) {
return false;
}
var proto = getPrototype$1(value);
if (proto === null) {
return true;
}
var Ctor = hasOwnProperty$6.call(proto, "constructor") && proto.constructor;
return typeof Ctor == "function" && Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString;
}
var domExcTag = "[object DOMException]", errorTag$2 = "[object Error]";
function isError(value) {
if (!isObjectLike(value)) {
return false;
}
var tag = baseGetTag(value);
return tag == errorTag$2 || tag == domExcTag || typeof value.message == "string" && typeof value.name == "string" && !isPlainObject$1(value);
}
var attempt = baseRest(function(func, args) {
try {
return apply$1(func, void 0, args);
} catch (e) {
return isError(e) ? e : new Error(e);
}
});
const attempt$1 = attempt;
function baseSlice(array2, start, end2) {
var index2 = -1, length = array2.length;
if (start < 0) {
start = -start > length ? 0 : length + start;
}
end2 = end2 > length ? length : end2;
if (end2 < 0) {
end2 += length;
}
length = start > end2 ? 0 : end2 - start >>> 0;
start >>>= 0;
var result = Array(length);
while (++index2 < length) {
result[index2] = array2[index2 + start];
}
return result;
}
function castSlice(array2, start, end2) {
var length = array2.length;
end2 = end2 === void 0 ? length : end2;
return !start && end2 >= length ? array2 : baseSlice(array2, start, end2);
}
var rsAstralRange$2 = "\\ud800-\\udfff", rsComboMarksRange$3 = "\\u0300-\\u036f", reComboHalfMarksRange$3 = "\\ufe20-\\ufe2f", rsComboSymbolsRange$3 = "\\u20d0-\\u20ff", rsComboRange$3 = rsComboMarksRange$3 + reComboHalfMarksRange$3 + rsComboSymbolsRange$3, rsVarRange$2 = "\\ufe0e\\ufe0f";
var rsZWJ$2 = "\\u200d";
var reHasUnicode = RegExp("[" + rsZWJ$2 + rsAstralRange$2 + rsComboRange$3 + rsVarRange$2 + "]");
function hasUnicode(string2) {
return reHasUnicode.test(string2);
}
function asciiToArray(string2) {
return string2.split("");
}
var rsAstralRange$1 = "\\ud800-\\udfff", rsComboMarksRange$2 = "\\u0300-\\u036f", reComboHalfMarksRange$2 = "\\ufe20-\\ufe2f", rsComboSymbolsRange$2 = "\\u20d0-\\u20ff", rsComboRange$2 = rsComboMarksRange$2 + reComboHalfMarksRange$2 + rsComboSymbolsRange$2, rsVarRange$1 = "\\ufe0e\\ufe0f";
var rsAstral = "[" + rsAstralRange$1 + "]", rsCombo$2 = "[" + rsComboRange$2 + "]", rsFitz$1 = "\\ud83c[\\udffb-\\udfff]", rsModifier$1 = "(?:" + rsCombo$2 + "|" + rsFitz$1 + ")", rsNonAstral$1 = "[^" + rsAstralRange$1 + "]", rsRegional$1 = "(?:\\ud83c[\\udde6-\\uddff]){2}", rsSurrPair$1 = "[\\ud800-\\udbff][\\udc00-\\udfff]", rsZWJ$1 = "\\u200d";
var reOptMod$1 = rsModifier$1 + "?", rsOptVar$1 = "[" + rsVarRange$1 + "]?", rsOptJoin$1 = "(?:" + rsZWJ$1 + "(?:" + [rsNonAstral$1, rsRegional$1, rsSurrPair$1].join("|") + ")" + rsOptVar$1 + reOptMod$1 + ")*", rsSeq$1 = rsOptVar$1 + reOptMod$1 + rsOptJoin$1, rsSymbol = "(?:" + [rsNonAstral$1 + rsCombo$2 + "?", rsCombo$2, rsRegional$1, rsSurrPair$1, rsAstral].join("|") + ")";
var reUnicode = RegExp(rsFitz$1 + "(?=" + rsFitz$1 + ")|" + rsSymbol + rsSeq$1, "g");
function unicodeToArray(string2) {
return string2.match(reUnicode) || [];
}
function stringToArray(string2) {
return hasUnicode(string2) ? unicodeToArray(string2) : asciiToArray(string2);
}
function createCaseFirst(methodName) {
return function(string2) {
string2 = toString(string2);
var strSymbols = hasUnicode(string2) ? stringToArray(string2) : void 0;
var chr = strSymbols ? strSymbols[0] : string2.charAt(0);
var trailing = strSymbols ? castSlice(strSymbols, 1).join("") : string2.slice(1);
return chr[methodName]() + trailing;
};
}
var upperFirst = createCaseFirst("toUpperCase");
const upperFirst$1 = upperFirst;
function capitalize$1(string2) {
return upperFirst$1(toString(string2).toLowerCase());
}
function arrayReduce(array2, iteratee, accumulator, initAccum) {
var index2 = -1, length = array2 == null ? 0 : array2.length;
if (initAccum && length) {
accumulator = array2[++index2];
}
while (++index2 < length) {
accumulator = iteratee(accumulator, array2[index2], index2, array2);
}
return accumulator;
}
function basePropertyOf(object2) {
return function(key) {
return object2 == null ? void 0 : object2[key];
};
}
var deburredLetters = {
// Latin-1 Supplement block.
"À": "A",
"Á": "A",
"Â": "A",
"Ã": "A",
"Ä": "A",
"Å": "A",
"à": "a",
"á": "a",
"â": "a",
"ã": "a",
"ä": "a",
"å": "a",
"Ç": "C",
"ç": "c",
"Ð": "D",
"ð": "d",
"È": "E",
"É": "E",
"Ê": "E",
"Ë": "E",
"è": "e",
"é": "e",
"ê": "e",
"ë": "e",
"Ì": "I",
"Í": "I",
"Î": "I",
"Ï": "I",
"ì": "i",
"í": "i",
"î": "i",
"ï": "i",
"Ñ": "N",
"ñ": "n",
"Ò": "O",
"Ó": "O",
"Ô": "O",
"Õ": "O",
"Ö": "O",
"Ø": "O",
"ò": "o",
"ó": "o",
"ô": "o",
"õ": "o",
"ö": "o",
"ø": "o",
"Ù": "U",
"Ú": "U",
"Û": "U",
"Ü": "U",
"ù": "u",
"ú": "u",
"û": "u",
"ü": "u",
"Ý": "Y",
"ý": "y",
"ÿ": "y",
"Æ": "Ae",
"æ": "ae",
"Þ": "Th",
"þ": "th",
"ß": "ss",
// Latin Extended-A block.
"Ā": "A",
"Ă": "A",
"Ą": "A",
"ā": "a",
"ă": "a",
"ą": "a",
"Ć": "C",
"Ĉ": "C",
"Ċ": "C",
"Č": "C",
"ć": "c",
"ĉ": "c",
"ċ": "c",
"č": "c",
"Ď": "D",
"Đ": "D",
"ď": "d",
"đ": "d",
"Ē": "E",
"Ĕ": "E",
"Ė": "E",
"Ę": "E",
"Ě": "E",
"ē": "e",
"ĕ": "e",
"ė": "e",
"ę": "e",
"ě": "e",
"Ĝ": "G",
"Ğ": "G",
"Ġ": "G",
"Ģ": "G",
"ĝ": "g",
"ğ": "g",
"ġ": "g",
"ģ": "g",
"Ĥ": "H",
"Ħ": "H",
"ĥ": "h",
"ħ": "h",
"Ĩ": "I",
"Ī": "I",
"Ĭ": "I",
"Į": "I",
"İ": "I",
"ĩ": "i",
"ī": "i",
"ĭ": "i",
"į": "i",
"ı": "i",
"Ĵ": "J",
"ĵ": "j",
"Ķ": "K",
"ķ": "k",
"ĸ": "k",
"Ĺ": "L",
"Ļ": "L",
"Ľ": "L",
"Ŀ": "L",
"Ł": "L",
"ĺ": "l",
"ļ": "l",
"ľ": "l",
"ŀ": "l",
"ł": "l",
"Ń": "N",
"Ņ": "N",
"Ň": "N",
"Ŋ": "N",
"ń": "n",
"ņ": "n",
"ň": "n",
"ŋ": "n",
"Ō": "O",
"Ŏ": "O",
"Ő": "O",
"ō": "o",
"ŏ": "o",
"ő": "o",
"Ŕ": "R",
"Ŗ": "R",
"Ř": "R",
"ŕ": "r",
"ŗ": "r",
"ř": "r",
"Ś": "S",
"Ŝ": "S",
"Ş": "S",
"Š": "S",
"ś": "s",
"ŝ": "s",
"ş": "s",
"š": "s",
"Ţ": "T",
"Ť": "T",
"Ŧ": "T",
"ţ": "t",
"ť": "t",
"ŧ": "t",
"Ũ": "U",
"Ū": "U",
"Ŭ": "U",
"Ů": "U",
"Ű": "U",
"Ų": "U",
"ũ": "u",
"ū": "u",
"ŭ": "u",
"ů": "u",
"ű": "u",
"ų": "u",
"Ŵ": "W",
"ŵ": "w",
"Ŷ": "Y",
"ŷ": "y",
"Ÿ": "Y",
"Ź": "Z",
"Ż": "Z",
"Ž": "Z",
"ź": "z",
"ż": "z",
"ž": "z",
"IJ": "IJ",
"ij": "ij",
"Œ": "Oe",
"œ": "oe",
"ʼn": "'n",
"ſ": "s"
};
var deburrLetter = basePropertyOf(deburredLetters);
const deburrLetter$1 = deburrLetter;
var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
var rsComboMarksRange$1 = "\\u0300-\\u036f", reComboHalfMarksRange$1 = "\\ufe20-\\ufe2f", rsComboSymbolsRange$1 = "\\u20d0-\\u20ff", rsComboRange$1 = rsComboMarksRange$1 + reComboHalfMarksRange$1 + rsComboSymbolsRange$1;
var rsCombo$1 = "[" + rsComboRange$1 + "]";
var reComboMark = RegExp(rsCombo$1, "g");
function deburr(string2) {
string2 = toString(string2);
return string2 && string2.replace(reLatin, deburrLetter$1).replace(reComboMark, "");
}
var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
function asciiWords(string2) {
return string2.match(reAsciiWord) || [];
}
var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
function hasUnicodeWord(string2) {
return reHasUnicodeWord.test(string2);
}
var rsAstralRange = "\\ud800-\\udfff", rsComboMarksRange = "\\u0300-\\u036f", reComboHalfMarksRange = "\\ufe20-\\ufe2f", rsComboSymbolsRange = "\\u20d0-\\u20ff", rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, rsDingbatRange = "\\u2700-\\u27bf", rsLowerRange = "a-z\\xdf-\\xf6\\xf8-\\xff", rsMathOpRange = "\\xac\\xb1\\xd7\\xf7", rsNonCharRange = "\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf", rsPunctuationRange = "\\u2000-\\u206f", rsSpaceRange = " \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000", rsUpperRange = "A-Z\\xc0-\\xd6\\xd8-\\xde", rsVarRange = "\\ufe0e\\ufe0f", rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
var rsApos$1 = "['’]", rsBreak = "[" + rsBreakRange + "]", rsCombo = "[" + rsComboRange + "]", rsDigits = "\\d+", rsDingbat = "[" + rsDingbatRange + "]", rsLower = "[" + rsLowerRange + "]", rsMisc = "[^" + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + "]", rsFitz = "\\ud83c[\\udffb-\\udfff]", rsModifier = "(?:" + rsCombo + "|" + rsFitz + ")", rsNonAstral = "[^" + rsAstralRange + "]", rsRegional = "(?:\\ud83c[\\udde6-\\uddff]){2}", rsSurrPair = "[\\ud800-\\udbff][\\udc00-\\udfff]", rsUpper = "[" + rsUpperRange + "]", rsZWJ = "\\u200d";
var rsMiscLower = "(?:" + rsLower + "|" + rsMisc + ")", rsMiscUpper = "(?:" + rsUpper + "|" + rsMisc + ")", rsOptContrLower = "(?:" + rsApos$1 + "(?:d|ll|m|re|s|t|ve))?", rsOptContrUpper = "(?:" + rsApos$1 + "(?:D|LL|M|RE|S|T|VE))?", reOptMod = rsModifier + "?", rsOptVar = "[" + rsVarRange + "]?", rsOptJoin = "(?:" + rsZWJ + "(?:" + [rsNonAstral, rsRegional, rsSurrPair].join("|") + ")" + rsOptVar + reOptMod + ")*", rsOrdLower = "\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])", rsOrdUpper = "\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])", rsSeq = rsOptVar + reOptMod + rsOptJoin, rsEmoji = "(?:" + [rsDingbat, rsRegional, rsSurrPair].join("|") + ")" + rsSeq;
var reUnicodeWord = RegExp([
rsUpper + "?" + rsLower + "+" + rsOptContrLower + "(?=" + [rsBreak, rsUpper, "$"].join("|") + ")",
rsMiscUpper + "+" + rsOptContrUpper + "(?=" + [rsBreak, rsUpper + rsMiscLower, "$"].join("|") + ")",
rsUpper + "?" + rsMiscLower + "+" + rsOptContrLower,
rsUpper + "+" + rsOptContrUpper,
rsOrdUpper,
rsOrdLower,
rsDigits,
rsEmoji
].join("|"), "g");
function unicodeWords(string2) {
return string2.match(reUnicodeWord) || [];
}
function words(string2, pattern2, guard) {
string2 = toString(string2);
pattern2 = guard ? void 0 : pattern2;
if (pattern2 === void 0) {
return hasUnicodeWord(string2) ? unicodeWords(string2) : asciiWords(string2);
}
return string2.match(pattern2) || [];
}
var rsApos = "['’]";
var reApos = RegExp(rsApos, "g");
function createCompounder(callback) {
return function(string2) {
return arrayReduce(words(deburr(string2).replace(reApos, "")), callback, "");
};
}
var camelCase = createCompounder(function(result, word, index2) {
word = word.toLowerCase();
return result + (index2 ? capitalize$1(word) : word);
});
const camelCase$1 = camelCase;
function castArray() {
if (!arguments.length) {
return [];
}
var value = arguments[0];
return isArray$2(value) ? value : [value];
}
function stackClear() {
this.__data__ = new ListCache();
this.size = 0;
}
function stackDelete(key) {
var data = this.__data__, result = data["delete"](key);
this.size = data.size;
return result;
}
function stackGet(key) {
return this.__data__.get(key);
}
function stackHas(key) {
return this.__data__.has(key);
}
var LARGE_ARRAY_SIZE = 200;
function stackSet(key, value) {
var data = this.__data__;
if (data instanceof ListCache) {
var pairs = data.__data__;
if (!Map$2 || pairs.length < LARGE_ARRAY_SIZE - 1) {
pairs.push([key, value]);
this.size = ++data.size;
return this;
}
data = this.__data__ = new MapCache(pairs);
}
data.set(key, value);
this.size = data.size;
return this;
}
function Stack(entries) {
var data = this.__data__ = new ListCache(entries);
this.size = data.size;
}
Stack.prototype.clear = stackClear;
Stack.prototype["delete"] = stackDelete;
Stack.prototype.get = stackGet;
Stack.prototype.has = stackHas;
Stack.prototype.set = stackSet;
function baseAssign(object2, source) {
return object2 && copyObject(source, keys(source), object2);
}
function baseAssignIn(object2, source) {
return object2 && copyObject(source, keysIn(source), object2);
}
var freeExports = typeof exports == "object" && exports && !exports.nodeType && exports;
var freeModule = freeExports && typeof module == "object" && module && !module.nodeType && module;
var moduleExports = freeModule && freeModule.exports === freeExports;
var Buffer = moduleExports ? root$1.Buffer : void 0, allocUnsafe = Buffer ? Buffer.allocUnsafe : void 0;
function cloneBuffer(buffer, isDeep) {
if (isDeep) {
return buffer.slice();
}
var length = buffer.length, result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
buffer.copy(result);
return result;
}
function arrayFilter(array2, predicate) {
var index2 = -1, length = array2 == null ? 0 : array2.length, resIndex = 0, result = [];
while (++index2 < length) {
var value = array2[index2];
if (predicate(value, index2, array2)) {
result[resIndex++] = value;
}
}
return result;
}
function stubArray() {
return [];
}
var objectProto$6 = Object.prototype;
var propertyIsEnumerable = objectProto$6.propertyIsEnumerable;
var nativeGetSymbols$1 = Object.getOwnPropertySymbols;
var getSymbols = !nativeGetSymbols$1 ? stubArray : function(object2) {
if (object2 == null) {
return [];
}
object2 = Object(object2);
return arrayFilter(nativeGetSymbols$1(object2), function(symbol) {
return propertyIsEnumerable.call(object2, symbol);
});
};
const getSymbols$1 = getSymbols;
function copySymbols(source, object2) {
return copyObject(source, getSymbols$1(source), object2);
}
var nativeGetSymbols = Object.getOwnPropertySymbols;
var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object2) {
var result = [];
while (object2) {
arrayPush(result, getSymbols$1(object2));
object2 = getPrototype$1(object2);
}
return result;
};
const getSymbolsIn$1 = getSymbolsIn;
function copySymbolsIn(source, object2) {
return copyObject(source, getSymbolsIn$1(source), object2);
}
function baseGetAllKeys(object2, keysFunc, symbolsFunc) {
var result = keysFunc(object2);
return isArray$2(object2) ? result : arrayPush(result, symbolsFunc(object2));
}
function getAllKeys(object2) {
return baseGetAllKeys(object2, keys, getSymbols$1);
}
function getAllKeysIn(object2) {
return baseGetAllKeys(object2, keysIn, getSymbolsIn$1);
}
var DataView = getNative(root$1, "DataView");
const DataView$1 = DataView;
var Promise$1 = getNative(root$1, "Promise");
const Promise$2 = Promise$1;
var Set$1 = getNative(root$1, "Set");
const Set$2 = Set$1;
var mapTag$4 = "[object Map]", objectTag$2 = "[object Object]", promiseTag = "[object Promise]", setTag$4 = "[object Set]", weakMapTag$1 = "[object WeakMap]";
var dataViewTag$3 = "[object DataView]";
var dataViewCtorString = toSource(DataView$1), mapCtorString = toSource(Map$2), promiseCtorString = toSource(Promise$2), setCtorString = toSource(Set$2), weakMapCtorString = toSource(WeakMap$2);
var getTag = baseGetTag;
if (DataView$1 && getTag(new DataView$1(new ArrayBuffer(1))) != dataViewTag$3 || Map$2 && getTag(new Map$2()) != mapTag$4 || Promise$2 && getTag(Promise$2.resolve()) != promiseTag || Set$2 && getTag(new Set$2()) != setTag$4 || WeakMap$2 && getTag(new WeakMap$2()) != weakMapTag$1) {
getTag = function(value) {
var result = baseGetTag(value), Ctor = result == objectTag$2 ? value.constructor : void 0, ctorString = Ctor ? toSource(Ctor) : "";
if (ctorString) {
switch (ctorString) {
case dataViewCtorString:
return dataViewTag$3;
case mapCtorString:
return mapTag$4;
case promiseCtorString:
return promiseTag;
case setCtorString:
return setTag$4;
case weakMapCtorString:
return weakMapTag$1;
}
}
return result;
};
}
const getTag$1 = getTag;
var objectProto$5 = Object.prototype;
var hasOwnProperty$5 = objectProto$5.hasOwnProperty;
function initCloneArray(array2) {
var length = array2.length, result = new array2.constructor(length);
if (length && typeof array2[0] == "string" && hasOwnProperty$5.call(array2, "index")) {
result.index = array2.index;
result.input = array2.input;
}
return result;
}
var Uint8Array$1 = root$1.Uint8Array;
const Uint8Array$2 = Uint8Array$1;
function cloneArrayBuffer(arrayBuffer) {
var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
new Uint8Array$2(result).set(new Uint8Array$2(arrayBuffer));
return result;
}
function cloneDataView(dataView, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
}
var reFlags = /\w*$/;
function cloneRegExp(regexp2) {
var result = new regexp2.constructor(regexp2.source, reFlags.exec(regexp2));
result.lastIndex = regexp2.lastIndex;
return result;
}
var symbolProto$1 = Symbol$2 ? Symbol$2.prototype : void 0, symbolValueOf$1 = symbolProto$1 ? symbolProto$1.valueOf : void 0;
function cloneSymbol(symbol) {
return symbolValueOf$1 ? Object(symbolValueOf$1.call(symbol)) : {};
}
function cloneTypedArray(typedArray, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
}
var boolTag$2 = "[object Boolean]", dateTag$2 = "[object Date]", mapTag$3 = "[object Map]", numberTag$2 = "[object Number]", regexpTag$2 = "[object RegExp]", setTag$3 = "[object Set]", stringTag$2 = "[object String]", symbolTag$2 = "[object Symbol]";
var arrayBufferTag$2 = "[object ArrayBuffer]", dataViewTag$2 = "[object DataView]", float32Tag$1 = "[object Float32Array]", float64Tag$1 = "[object Float64Array]", int8Tag$1 = "[object Int8Array]", int16Tag$1 = "[object Int16Array]", int32Tag$1 = "[object Int32Array]", uint8Tag$1 = "[object Uint8Array]", uint8ClampedTag$1 = "[object Uint8ClampedArray]", uint16Tag$1 = "[object Uint16Array]", uint32Tag$1 = "[object Uint32Array]";
function initCloneByTag(object2, tag, isDeep) {
var Ctor = object2.constructor;
switch (tag) {
case arrayBufferTag$2:
return cloneArrayBuffer(object2);
case boolTag$2:
case dateTag$2:
return new Ctor(+object2);
case dataViewTag$2:
return cloneDataView(object2, isDeep);
case float32Tag$1:
case float64Tag$1:
case int8Tag$1:
case int16Tag$1:
case int32Tag$1:
case uint8Tag$1:
case uint8ClampedTag$1:
case uint16Tag$1:
case uint32Tag$1:
return cloneTypedArray(object2, isDeep);
case mapTag$3:
return new Ctor();
case numberTag$2:
case stringTag$2:
return new Ctor(object2);
case regexpTag$2:
return cloneRegExp(object2);
case setTag$3:
return new Ctor();
case symbolTag$2:
return cloneSymbol(object2);
}
}
function initCloneObject(object2) {
return typeof object2.constructor == "function" && !isPrototype(object2) ? baseCreate$1(getPrototype$1(object2)) : {};
}
var mapTag$2 = "[object Map]";
function baseIsMap(value) {
return isObjectLike(value) && getTag$1(value) == mapTag$2;
}
var nodeIsMap = nodeUtil$1 && nodeUtil$1.isMap;
var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
const isMap$1 = isMap;
var setTag$2 = "[object Set]";
function baseIsSet(value) {
return isObjectLike(value) && getTag$1(value) == setTag$2;
}
var nodeIsSet = nodeUtil$1 && nodeUtil$1.isSet;
var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
const isSet$1 = isSet;
var CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG$1 = 4;
var argsTag$1 = "[object Arguments]", arrayTag$1 = "[object Array]", boolTag$1 = "[object Boolean]", dateTag$1 = "[object Date]", errorTag$1 = "[object Error]", funcTag = "[object Function]", genTag = "[object GeneratorFunction]", mapTag$1 = "[object Map]", numberTag$1 = "[object Number]", objectTag$1 = "[object Object]", regexpTag$1 = "[object RegExp]", setTag$1 = "[object Set]", stringTag$1 = "[object String]", symbolTag$1 = "[object Symbol]", weakMapTag = "[object WeakMap]";
var arrayBufferTag$1 = "[object ArrayBuffer]", dataViewTag$1 = "[object DataView]", float32Tag = "[object Float32Array]", float64Tag = "[object Float64Array]", int8Tag = "[object Int8Array]", int16Tag = "[object Int16Array]", int32Tag = "[object Int32Array]", uint8Tag = "[object Uint8Array]", uint8ClampedTag = "[object Uint8ClampedArray]", uint16Tag = "[object Uint16Array]", uint32Tag = "[object Uint32Array]";
var cloneableTags = {};
cloneableTags[argsTag$1] = cloneableTags[arrayTag$1] = cloneableTags[arrayBufferTag$1] = cloneableTags[dataViewTag$1] = cloneableTags[boolTag$1] = cloneableTags[dateTag$1] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag$1] = cloneableTags[numberTag$1] = cloneableTags[objectTag$1] = cloneableTags[regexpTag$1] = cloneableTags[setTag$1] = cloneableTags[stringTag$1] = cloneableTags[symbolTag$1] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
cloneableTags[errorTag$1] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false;
function baseClone(value, bitmask, customizer, key, object2, stack) {
var result, isDeep = bitmask & CLONE_DEEP_FLAG, isFlat = bitmask & CLONE_FLAT_FLAG, isFull = bitmask & CLONE_SYMBOLS_FLAG$1;
if (customizer) {
result = object2 ? customizer(value, key, object2, stack) : customizer(value);
}
if (result !== void 0) {
return result;
}
if (!isObject$2(value)) {
return value;
}
var isArr = isArray$2(value);
if (isArr) {
result = initCloneArray(value);
if (!isDeep) {
return copyArray(value, result);
}
} else {
var tag = getTag$1(value), isFunc = tag == funcTag || tag == genTag;
if (isBuffer$2(value)) {
return cloneBuffer(value, isDeep);
}
if (tag == objectTag$1 || tag == argsTag$1 || isFunc && !object2) {
result = isFlat || isFunc ? {} : initCloneObject(value);
if (!isDeep) {
return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value));
}
} else {
if (!cloneableTags[tag]) {
return object2 ? value : {};
}
result = initCloneByTag(value, tag, isDeep);
}
}
stack || (stack = new Stack());
var stacked = stack.get(value);
if (stacked) {
return stacked;
}
stack.set(value, result);
if (isSet$1(value)) {
value.forEach(function(subValue) {
result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
});
} else if (isMap$1(value)) {
value.forEach(function(subValue, key2) {
result.set(key2, baseClone(subValue, bitmask, customizer, key2, value, stack));
});
}
var keysFunc = isFull ? isFlat ? getAllKeysIn : getAllKeys : isFlat ? keysIn : keys;
var props = isArr ? void 0 : keysFunc(value);
arrayEach(props || value, function(subValue, key2) {
if (props) {
key2 = subValue;
subValue = value[key2];
}
assignValue(result, key2, baseClone(subValue, bitmask, customizer, key2, value, stack));
});
return result;
}
var CLONE_SYMBOLS_FLAG = 4;
function clone(value) {
return baseClone(value, CLONE_SYMBOLS_FLAG);
}
var HASH_UNDEFINED = "__lodash_hash_undefined__";
function setCacheAdd(value) {
this.__data__.set(value, HASH_UNDEFINED);
return this;
}
function setCacheHas(value) {
return this.__data__.has(value);
}
function SetCache(values2) {
var index2 = -1, length = values2 == null ? 0 : values2.length;
this.__data__ = new MapCache();
while (++index2 < length) {
this.add(values2[index2]);
}
}
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
function arraySome(array2, predicate) {
var index2 = -1, length = array2 == null ? 0 : array2.length;
while (++index2 < length) {
if (predicate(array2[index2], index2, array2)) {
return true;
}
}
return false;
}
function cacheHas(cache2, key) {
return cache2.has(key);
}
var COMPARE_PARTIAL_FLAG$5 = 1, COMPARE_UNORDERED_FLAG$3 = 2;
function equalArrays(array2, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG$5, arrLength = array2.length, othLength = other.length;
if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
return false;
}
var arrStacked = stack.get(array2);
var othStacked = stack.get(other);
if (arrStacked && othStacked) {
return arrStacked == other && othStacked == array2;
}
var index2 = -1, result = true, seen = bitmask & COMPARE_UNORDERED_FLAG$3 ? new SetCache() : void 0;
stack.set(array2, other);
stack.set(other, array2);
while (++index2 < arrLength) {
var arrValue = array2[index2], othValue = other[index2];
if (customizer) {
var compared = isPartial ? customizer(othValue, arrValue, index2, other, array2, stack) : customizer(arrValue, othValue, index2, array2, other, stack);
}
if (compared !== void 0) {
if (compared) {
continue;
}
result = false;
break;
}
if (seen) {
if (!arraySome(other, function(othValue2, othIndex) {
if (!cacheHas(seen, othIndex) && (arrValue === othValue2 || equalFunc(arrValue, othValue2, bitmask, customizer, stack))) {
return seen.push(othIndex);
}
})) {
result = false;
break;
}
} else if (!(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
result = false;
break;
}
}
stack["delete"](array2);
stack["delete"](other);
return result;
}
function mapToArray(map2) {
var index2 = -1, result = Array(map2.size);
map2.forEach(function(value, key) {
result[++index2] = [key, value];
});
return result;
}
function setToArray(set2) {
var index2 = -1, result = Array(set2.size);
set2.forEach(function(value) {
result[++index2] = value;
});
return result;
}
var COMPARE_PARTIAL_FLAG$4 = 1, COMPARE_UNORDERED_FLAG$2 = 2;
var boolTag = "[object Boolean]", dateTag = "[object Date]", errorTag = "[object Error]", mapTag = "[object Map]", numberTag = "[object Number]", regexpTag = "[object RegExp]", setTag = "[object Set]", stringTag = "[object String]", symbolTag = "[object Symbol]";
var arrayBufferTag = "[object ArrayBuffer]", dataViewTag = "[object DataView]";
var symbolProto = Symbol$2 ? Symbol$2.prototype : void 0, symbolValueOf = symbolProto ? symbolProto.valueOf : void 0;
function equalByTag(object2, other, tag, bitmask, customizer, equalFunc, stack) {
switch (tag) {
case dataViewTag:
if (object2.byteLength != other.byteLength || object2.byteOffset != other.byteOffset) {
return false;
}
object2 = object2.buffer;
other = other.buffer;
case arrayBufferTag:
if (object2.byteLength != other.byteLength || !equalFunc(new Uint8Array$2(object2), new Uint8Array$2(other))) {
return false;
}
return true;
case boolTag:
case dateTag:
case numberTag:
return eq(+object2, +other);
case errorTag:
return object2.name == other.name && object2.message == other.message;
case regexpTag:
case stringTag:
return object2 == other + "";
case mapTag:
var convert = mapToArray;
case setTag:
var isPartial = bitmask & COMPARE_PARTIAL_FLAG$4;
convert || (convert = setToArray);
if (object2.size != other.size && !isPartial) {
return false;
}
var stacked = stack.get(object2);
if (stacked) {
return stacked == other;
}
bitmask |= COMPARE_UNORDERED_FLAG$2;
stack.set(object2, other);
var result = equalArrays(convert(object2), convert(other), bitmask, customizer, equalFunc, stack);
stack["delete"](object2);
return result;
case symbolTag:
if (symbolValueOf) {
return symbolValueOf.call(object2) == symbolValueOf.call(other);
}
}
return false;
}
var COMPARE_PARTIAL_FLAG$3 = 1;
var objectProto$4 = Object.prototype;
var hasOwnProperty$4 = objectProto$4.hasOwnProperty;
function equalObjects(object2, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG$3, objProps = getAllKeys(object2), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length;
if (objLength != othLength && !isPartial) {
return false;
}
var index2 = objLength;
while (index2--) {
var key = objProps[index2];
if (!(isPartial ? key in other : hasOwnProperty$4.call(other, key))) {
return false;
}
}
var objStacked = stack.get(object2);
var othStacked = stack.get(other);
if (objStacked && othStacked) {
return objStacked == other && othStacked == object2;
}
var result = true;
stack.set(object2, other);
stack.set(other, object2);
var skipCtor = isPartial;
while (++index2 < objLength) {
key = objProps[index2];
var objValue = object2[key], othValue = other[key];
if (customizer) {
var compared = isPartial ? customizer(othValue, objValue, key, other, object2, stack) : customizer(objValue, othValue, key, object2, other, stack);
}
if (!(compared === void 0 ? objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack) : compared)) {
result = false;
break;
}
skipCtor || (skipCtor = key == "constructor");
}
if (result && !skipCtor) {
var objCtor = object2.constructor, othCtor = other.constructor;
if (objCtor != othCtor && ("constructor" in object2 && "constructor" in other) && !(typeof objCtor == "function" && objCtor instanceof objCtor && typeof othCtor == "function" && othCtor instanceof othCtor)) {
result = false;
}
}
stack["delete"](object2);
stack["delete"](other);
return result;
}
var COMPARE_PARTIAL_FLAG$2 = 1;
var argsTag = "[object Arguments]", arrayTag = "[object Array]", objectTag = "[object Object]";
var objectProto$3 = Object.prototype;
var hasOwnProperty$3 = objectProto$3.hasOwnProperty;
function baseIsEqualDeep(object2, other, bitmask, customizer, equalFunc, stack) {
var objIsArr = isArray$2(object2), othIsArr = isArray$2(other), objTag = objIsArr ? arrayTag : getTag$1(object2), othTag = othIsArr ? arrayTag : getTag$1(other);
objTag = objTag == argsTag ? objectTag : objTag;
othTag = othTag == argsTag ? objectTag : othTag;
var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag;
if (isSameTag && isBuffer$2(object2)) {
if (!isBuffer$2(other)) {
return false;
}
objIsArr = true;
objIsObj = false;
}
if (isSameTag && !objIsObj) {
stack || (stack = new Stack());
return objIsArr || isTypedArray$1(object2) ? equalArrays(object2, other, bitmask, customizer, equalFunc, stack) : equalByTag(object2, other, objTag, bitmask, customizer, equalFunc, stack);
}
if (!(bitmask & COMPARE_PARTIAL_FLAG$2)) {
var objIsWrapped = objIsObj && hasOwnProperty$3.call(object2, "__wrapped__"), othIsWrapped = othIsObj && hasOwnProperty$3.call(other, "__wrapped__");
if (objIsWrapped || othIsWrapped) {
var objUnwrapped = objIsWrapped ? object2.value() : object2, othUnwrapped = othIsWrapped ? other.value() : other;
stack || (stack = new Stack());
return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
}
}
if (!isSameTag) {
return false;
}
stack || (stack = new Stack());
return equalObjects(object2, other, bitmask, customizer, equalFunc, stack);
}
function baseIsEqual(value, other, bitmask, customizer, stack) {
if (value === other) {
return true;
}
if (value == null || other == null || !isObjectLike(value) && !isObjectLike(other)) {
return value !== value && other !== other;
}
return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
}
var COMPARE_PARTIAL_FLAG$1 = 1, COMPARE_UNORDERED_FLAG$1 = 2;
function baseIsMatch(object2, source, matchData, customizer) {
var index2 = matchData.length, length = index2, noCustomizer = !customizer;
if (object2 == null) {
return !length;
}
object2 = Object(object2);
while (index2--) {
var data = matchData[index2];
if (noCustomizer && data[2] ? data[1] !== object2[data[0]] : !(data[0] in object2)) {
return false;
}
}
while (++index2 < length) {
data = matchData[index2];
var key = data[0], objValue = object2[key], srcValue = data[1];
if (noCustomizer && data[2]) {
if (objValue === void 0 && !(key in object2)) {
return false;
}
} else {
var stack = new Stack();
if (customizer) {
var result = customizer(objValue, srcValue, key, object2, source, stack);
}
if (!(result === void 0 ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG$1 | COMPARE_UNORDERED_FLAG$1, customizer, stack) : result)) {
return false;
}
}
}
return true;
}
function isStrictComparable(value) {
return value === value && !isObject$2(value);
}
function getMatchData(object2) {
var result = keys(object2), length = result.length;
while (length--) {
var key = result[length], value = object2[key];
result[length] = [key, value, isStrictComparable(value)];
}
return result;
}
function matchesStrictComparable(key, srcValue) {
return function(object2) {
if (object2 == null) {
return false;
}
return object2[key] === srcValue && (srcValue !== void 0 || key in Object(object2));
};
}
function baseMatches(source) {
var matchData = getMatchData(source);
if (matchData.length == 1 && matchData[0][2]) {
return matchesStrictComparable(matchData[0][0], matchData[0][1]);
}
return function(object2) {
return object2 === source || baseIsMatch(object2, source, matchData);
};
}
function baseHasIn(object2, key) {
return object2 != null && key in Object(object2);
}
function hasPath(object2, path, hasFunc) {
path = castPath(path, object2);
var index2 = -1, length = path.length, result = false;
while (++index2 < length) {
var key = toKey(path[index2]);
if (!(result = object2 != null && hasFunc(object2, key))) {
break;
}
object2 = object2[key];
}
if (result || ++index2 != length) {
return result;
}
length = object2 == null ? 0 : object2.length;
return !!length && isLength(length) && isIndex(key, length) && (isArray$2(object2) || isArguments$1(object2));
}
function hasIn(object2, path) {
return object2 != null && hasPath(object2, path, baseHasIn);
}
var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2;
function baseMatchesProperty(path, srcValue) {
if (isKey(path) && isStrictComparable(srcValue)) {
return matchesStrictComparable(toKey(path), srcValue);
}
return function(object2) {
var objValue = get(object2, path);
return objValue === void 0 && objValue === srcValue ? hasIn(object2, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
};
}
function baseProperty(key) {
return function(object2) {
return object2 == null ? void 0 : object2[key];
};
}
function basePropertyDeep(path) {
return function(object2) {
return baseGet(object2, path);
};
}
function property(path) {
return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path);
}
function baseIteratee(value) {
if (typeof value == "function") {
return value;
}
if (value == null) {
return identity$1;
}
if (typeof value == "object") {
return isArray$2(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value);
}
return property(value);
}
function createBaseFor(fromRight) {
return function(object2, iteratee, keysFunc) {
var index2 = -1, iterable = Object(object2), props = keysFunc(object2), length = props.length;
while (length--) {
var key = props[fromRight ? length : ++index2];
if (iteratee(iterable[key], key, iterable) === false) {
break;
}
}
return object2;
};
}
var baseFor = createBaseFor();
const baseFor$1 = baseFor;
function baseForOwn(object2, iteratee) {
return object2 && baseFor$1(object2, iteratee, keys);
}
function createBaseEach(eachFunc, fromRight) {
return function(collection, iteratee) {
if (collection == null) {
return collection;
}
if (!isArrayLike(collection)) {
return eachFunc(collection, iteratee);
}
var length = collection.length, index2 = fromRight ? length : -1, iterable = Object(collection);
while (fromRight ? index2-- : ++index2 < length) {
if (iteratee(iterable[index2], index2, iterable) === false) {
break;
}
}
return collection;
};
}
var baseEach = createBaseEach(baseForOwn);
const baseEach$1 = baseEach;
var now = function() {
return root$1.Date.now();
};
const now$1 = now;
var FUNC_ERROR_TEXT = "Expected a function";
var nativeMax = Math.max, nativeMin = Math.min;
function debounce(func, wait, options) {
var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true;
if (typeof func != "function") {
throw new TypeError(FUNC_ERROR_TEXT);
}
wait = toNumber(wait) || 0;
if (isObject$2(options)) {
leading = !!options.leading;
maxing = "maxWait" in options;
maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
trailing = "trailing" in options ? !!options.trailing : trailing;
}
function invokeFunc(time) {
var args = lastArgs, thisArg = lastThis;
lastArgs = lastThis = void 0;
lastInvokeTime = time;
result = func.apply(thisArg, args);
return result;
}
function leadingEdge(time) {
lastInvokeTime = time;
timerId = setTimeout(timerExpired, wait);
return leading ? invokeFunc(time) : result;
}
function remainingWait(time) {
var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall;
return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting;
}
function shouldInvoke(time) {
var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime;
return lastCallTime === void 0 || timeSinceLastCall >= wait || timeSinceLastCall < 0 || maxing && timeSinceLastInvoke >= maxWait;
}
function timerExpired() {
var time = now$1();
if (shouldInvoke(time)) {
return trailingEdge(time);
}
timerId = setTimeout(timerExpired, remainingWait(time));
}
function trailingEdge(time) {
timerId = void 0;
if (trailing && lastArgs) {
return invokeFunc(time);
}
lastArgs = lastThis = void 0;
return result;
}
function cancel() {
if (timerId !== void 0) {
clearTimeout(timerId);
}
lastInvokeTime = 0;
lastArgs = lastCallTime = lastThis = timerId = void 0;
}
function flush() {
return timerId === void 0 ? result : trailingEdge(now$1());
}
function debounced() {
var time = now$1(), isInvoking = shouldInvoke(time);
lastArgs = arguments;
lastThis = this;
lastCallTime = time;
if (isInvoking) {
if (timerId === void 0) {
return leadingEdge(lastCallTime);
}
if (maxing) {
clearTimeout(timerId);
timerId = setTimeout(timerExpired, wait);
return invokeFunc(lastCallTime);
}
}
if (timerId === void 0) {
timerId = setTimeout(timerExpired, wait);
}
return result;
}
debounced.cancel = cancel;
debounced.flush = flush;
return debounced;
}
function last(array2) {
var length = array2 == null ? 0 : array2.length;
return length ? array2[length - 1] : void 0;
}
function castFunction(value) {
return typeof value == "function" ? value : identity$1;
}
function forEach(collection, iteratee) {
var func = isArray$2(collection) ? arrayEach : baseEach$1;
return func(collection, castFunction(iteratee));
}
var htmlEscapes = {
"&": "&",
"<": "<",
">": ">",
'"': """,
"'": "'"
};
var escapeHtmlChar = basePropertyOf(htmlEscapes);
const escapeHtmlChar$1 = escapeHtmlChar;
var reUnescapedHtml = /[&<>"']/g, reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
function escape$1(string2) {
string2 = toString(string2);
return string2 && reHasUnescapedHtml.test(string2) ? string2.replace(reUnescapedHtml, escapeHtmlChar$1) : string2;
}
function baseFilter(collection, predicate) {
var result = [];
baseEach$1(collection, function(value, index2, collection2) {
if (predicate(value, index2, collection2)) {
result.push(value);
}
});
return result;
}
function filter(collection, predicate) {
var func = isArray$2(collection) ? arrayFilter : baseFilter;
return func(collection, baseIteratee(predicate));
}
function baseMap(collection, iteratee) {
var index2 = -1, result = isArrayLike(collection) ? Array(collection.length) : [];
baseEach$1(collection, function(value, key, collection2) {
result[++index2] = iteratee(value, key, collection2);
});
return result;
}
function map(collection, iteratee) {
var func = isArray$2(collection) ? arrayMap : baseMap;
return func(collection, baseIteratee(iteratee));
}
function fromPairs(pairs) {
var index2 = -1, length = pairs == null ? 0 : pairs.length, result = {};
while (++index2 < length) {
var pair = pairs[index2];
result[pair[0]] = pair[1];
}
return result;
}
function baseValues(object2, props) {
return arrayMap(props, function(key) {
return object2[key];
});
}
function values(object2) {
return object2 == null ? [] : baseValues(object2, keys(object2));
}
function baseInverter(object2, setter, iteratee, accumulator) {
baseForOwn(object2, function(value, key, object3) {
setter(accumulator, iteratee(value), key, object3);
});
return accumulator;
}
function createInverter(setter, toIteratee) {
return function(object2, iteratee) {
return baseInverter(object2, setter, toIteratee(iteratee), {});
};
}
var objectProto$2 = Object.prototype;
var nativeObjectToString = objectProto$2.toString;
var invert = createInverter(function(result, value, key) {
if (value != null && typeof value.toString != "function") {
value = nativeObjectToString.call(value);
}
result[value] = key;
}, constant(identity$1));
const invert$1 = invert;
function isEqual(value, other) {
return baseIsEqual(value, other);
}
function isNil(value) {
return value == null;
}
function isUndefined$1(value) {
return value === void 0;
}
var kebabCase = createCompounder(function(result, word, index2) {
return result + (index2 ? "-" : "") + word.toLowerCase();
});
const kebabCase$1 = kebabCase;
function baseLt(value, other) {
return value < other;
}
function mapValues(object2, iteratee) {
var result = {};
iteratee = baseIteratee(iteratee);
baseForOwn(object2, function(value, key, object3) {
baseAssignValue(result, key, iteratee(value, key, object3));
});
return result;
}
function baseExtremum(array2, iteratee, comparator2) {
var index2 = -1, length = array2.length;
while (++index2 < length) {
var value = array2[index2], current = iteratee(value);
if (current != null && (computed2 === void 0 ? current === current && !isSymbol(current) : comparator2(current, computed2))) {
var computed2 = current, result = value;
}
}
return result;
}
function minBy(array2, iteratee) {
return array2 && array2.length ? baseExtremum(array2, baseIteratee(iteratee), baseLt) : void 0;
}
function baseSet(object2, path, value, customizer) {
if (!isObject$2(object2)) {
return object2;
}
path = castPath(path, object2);
var index2 = -1, length = path.length, lastIndex = length - 1, nested = object2;
while (nested != null && ++index2 < length) {
var key = toKey(path[index2]), newValue = value;
if (key === "__proto__" || key === "constructor" || key === "prototype") {
return object2;
}
if (index2 != lastIndex) {
var objValue = nested[key];
newValue = customizer ? customizer(objValue, key, nested) : void 0;
if (newValue === void 0) {
newValue = isObject$2(objValue) ? objValue : isIndex(path[index2 + 1]) ? [] : {};
}
}
assignValue(nested, key, newValue);
nested = nested[key];
}
return object2;
}
function basePickBy(object2, paths, predicate) {
var index2 = -1, length = paths.length, result = {};
while (++index2 < length) {
var path = paths[index2], value = baseGet(object2, path);
if (predicate(value, path)) {
baseSet(result, castPath(path, object2), value);
}
}
return result;
}
function basePick(object2, paths) {
return basePickBy(object2, paths, function(value, path) {
return hasIn(object2, path);
});
}
var pick = flatRest(function(object2, paths) {
return object2 == null ? {} : basePick(object2, paths);
});
const pick$1 = pick;
var nativeFloor = Math.floor, nativeRandom = Math.random;
function baseRandom(lower, upper) {
return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
}
function arraySample(array2) {
var length = array2.length;
return length ? array2[baseRandom(0, length - 1)] : void 0;
}
function baseSample(collection) {
return arraySample(values(collection));
}
function sample(collection) {
var func = isArray$2(collection) ? arraySample : baseSample;
return func(collection);
}
function set(object2, path, value) {
return object2 == null ? object2 : baseSet(object2, path, value);
}
var objectProto$1 = Object.prototype;
var hasOwnProperty$2 = objectProto$1.hasOwnProperty;
function customDefaultsAssignIn(objValue, srcValue, key, object2) {
if (objValue === void 0 || eq(objValue, objectProto$1[key]) && !hasOwnProperty$2.call(object2, key)) {
return srcValue;
}
return objValue;
}
var stringEscapes = {
"\\": "\\",
"'": "'",
"\n": "n",
"\r": "r",
"\u2028": "u2028",
"\u2029": "u2029"
};
function escapeStringChar(chr) {
return "\\" + stringEscapes[chr];
}
var reInterpolate = /<%=([\s\S]+?)%>/g;
const reInterpolate$1 = reInterpolate;
var reEscape = /<%-([\s\S]+?)%>/g;
const reEscape$1 = reEscape;
var reEvaluate = /<%([\s\S]+?)%>/g;
const reEvaluate$1 = reEvaluate;
var templateSettings = {
/**
* Used to detect `data` property values to be HTML-escaped.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
"escape": reEscape$1,
/**
* Used to detect code to be evaluated.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
"evaluate": reEvaluate$1,
/**
* Used to detect `data` property values to inject.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
"interpolate": reInterpolate$1,
/**
* Used to reference the data object in the template text.
*
* @memberOf _.templateSettings
* @type {string}
*/
"variable": "",
/**
* Used to import variables into the compiled template.
*
* @memberOf _.templateSettings
* @type {Object}
*/
"imports": {
/**
* A reference to the `lodash` function.
*
* @memberOf _.templateSettings.imports
* @type {Function}
*/
"_": { "escape": escape$1 }
}
};
const templateSettings$1 = templateSettings;
var INVALID_TEMPL_VAR_ERROR_TEXT = "Invalid `variable` option passed into `_.template`";
var reEmptyStringLeading = /\b__p \+= '';/g, reEmptyStringMiddle = /\b(__p \+=) '' \+/g, reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
var reForbiddenIdentifierChars = /[()=,{}\[\]\/\s]/;
var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
var reNoMatch = /($^)/;
var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
var objectProto = Object.prototype;
var hasOwnProperty$1 = objectProto.hasOwnProperty;
function template(string2, options, guard) {
var settings2 = templateSettings$1.imports._.templateSettings || templateSettings$1;
if (guard && isIterateeCall(string2, options, guard)) {
options = void 0;
}
string2 = toString(string2);
options = extendWith({}, options, settings2, customDefaultsAssignIn);
var imports = extendWith({}, options.imports, settings2.imports, customDefaultsAssignIn), importsKeys = keys(imports), importsValues = baseValues(imports, importsKeys);
var isEscaping, isEvaluating, index2 = 0, interpolate = options.interpolate || reNoMatch, source = "__p += '";
var reDelimiters = RegExp(
(options.escape || reNoMatch).source + "|" + interpolate.source + "|" + (interpolate === reInterpolate$1 ? reEsTemplate : reNoMatch).source + "|" + (options.evaluate || reNoMatch).source + "|$",
"g"
);
var sourceURL = hasOwnProperty$1.call(options, "sourceURL") ? "//# sourceURL=" + (options.sourceURL + "").replace(/\s/g, " ") + "\n" : "";
string2.replace(reDelimiters, function(match2, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) {
interpolateValue || (interpolateValue = esTemplateValue);
source += string2.slice(index2, offset).replace(reUnescapedString, escapeStringChar);
if (escapeValue) {
isEscaping = true;
source += "' +\n__e(" + escapeValue + ") +\n'";
}
if (evaluateValue) {
isEvaluating = true;
source += "';\n" + evaluateValue + ";\n__p += '";
}
if (interpolateValue) {
source += "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'";
}
index2 = offset + match2.length;
return match2;
});
source += "';\n";
var variable = hasOwnProperty$1.call(options, "variable") && options.variable;
if (!variable) {
source = "with (obj) {\n" + source + "\n}\n";
} else if (reForbiddenIdentifierChars.test(variable)) {
throw new Error(INVALID_TEMPL_VAR_ERROR_TEXT);
}
source = (isEvaluating ? source.replace(reEmptyStringLeading, "") : source).replace(reEmptyStringMiddle, "$1").replace(reEmptyStringTrailing, "$1;");
source = "function(" + (variable || "obj") + ") {\n" + (variable ? "" : "obj || (obj = {});\n") + "var __t, __p = ''" + (isEscaping ? ", __e = _.escape" : "") + (isEvaluating ? ", __j = Array.prototype.join;\nfunction print() { __p += __j.call(arguments, '') }\n" : ";\n") + source + "return __p\n}";
var result = attempt$1(function() {
return Function(importsKeys, sourceURL + "return " + source).apply(void 0, importsValues);
});
result.source = source;
if (isError(result)) {
throw result;
}
return result;
}
var __spreadArray = globalThis && globalThis.__spreadArray || function(to, from, pack) {
if (pack || arguments.length === 2)
for (var i = 0, l = from.length, ar; i < l; i++) {
if (ar || !(i in from)) {
if (!ar)
ar = Array.prototype.slice.call(from, 0, i);
ar[i] = from[i];
}
}
return to.concat(ar || Array.prototype.slice.call(from));
};
var BrowserInfo = (
/** @class */
function() {
function BrowserInfo2(name, version2, os) {
this.name = name;
this.version = version2;
this.os = os;
this.type = "browser";
}
return BrowserInfo2;
}()
);
var NodeInfo = (
/** @class */
function() {
function NodeInfo2(version2) {
this.version = version2;
this.type = "node";
this.name = "node";
this.os = process.platform;
}
return NodeInfo2;
}()
);
var SearchBotDeviceInfo = (
/** @class */
function() {
function SearchBotDeviceInfo2(name, version2, os, bot) {
this.name = name;
this.version = version2;
this.os = os;
this.bot = bot;
this.type = "bot-device";
}
return SearchBotDeviceInfo2;
}()
);
var BotInfo = (
/** @class */
function() {
function BotInfo2() {
this.type = "bot";
this.bot = true;
this.name = "bot";
this.version = null;
this.os = null;
}
return BotInfo2;
}()
);
var ReactNativeInfo = (
/** @class */
function() {
function ReactNativeInfo2() {
this.type = "react-native";
this.name = "react-native";
this.version = null;
this.os = null;
}
return ReactNativeInfo2;
}()
);
var SEARCHBOX_UA_REGEX = /alexa|bot|crawl(er|ing)|facebookexternalhit|feedburner|google web preview|nagios|postrank|pingdom|slurp|spider|yahoo!|yandex/;
var SEARCHBOT_OS_REGEX = /(nuhk|curl|Googlebot|Yammybot|Openbot|Slurp|MSNBot|Ask\ Jeeves\/Teoma|ia_archiver)/;
var REQUIRED_VERSION_PARTS = 3;
var userAgentRules = [
["aol", /AOLShield\/([0-9\._]+)/],
["edge", /Edge\/([0-9\._]+)/],
["edge-ios", /EdgiOS\/([0-9\._]+)/],
["yandexbrowser", /YaBrowser\/([0-9\._]+)/],
["kakaotalk", /KAKAOTALK\s([0-9\.]+)/],
["samsung", /SamsungBrowser\/([0-9\.]+)/],
["silk", /\bSilk\/([0-9._-]+)\b/],
["miui", /MiuiBrowser\/([0-9\.]+)$/],
["beaker", /BeakerBrowser\/([0-9\.]+)/],
["edge-chromium", /EdgA?\/([0-9\.]+)/],
[
"chromium-webview",
/(?!Chrom.*OPR)wv\).*Chrom(?:e|ium)\/([0-9\.]+)(:?\s|$)/
],
["chrome", /(?!Chrom.*OPR)Chrom(?:e|ium)\/([0-9\.]+)(:?\s|$)/],
["phantomjs", /PhantomJS\/([0-9\.]+)(:?\s|$)/],
["crios", /CriOS\/([0-9\.]+)(:?\s|$)/],
["firefox", /Firefox\/([0-9\.]+)(?:\s|$)/],
["fxios", /FxiOS\/([0-9\.]+)/],
["opera-mini", /Opera Mini.*Version\/([0-9\.]+)/],
["opera", /Opera\/([0-9\.]+)(?:\s|$)/],
["opera", /OPR\/([0-9\.]+)(:?\s|$)/],
["pie", /^Microsoft Pocket Internet Explorer\/(\d+\.\d+)$/],
["pie", /^Mozilla\/\d\.\d+\s\(compatible;\s(?:MSP?IE|MSInternet Explorer) (\d+\.\d+);.*Windows CE.*\)$/],
["netfront", /^Mozilla\/\d\.\d+.*NetFront\/(\d.\d)/],
["ie", /Trident\/7\.0.*rv\:([0-9\.]+).*\).*Gecko$/],
["ie", /MSIE\s([0-9\.]+);.*Trident\/[4-7].0/],
["ie", /MSIE\s(7\.0)/],
["bb10", /BB10;\sTouch.*Version\/([0-9\.]+)/],
["android", /Android\s([0-9\.]+)/],
["ios", /Version\/([0-9\._]+).*Mobile.*Safari.*/],
["safari", /Version\/([0-9\._]+).*Safari/],
["facebook", /FB[AS]V\/([0-9\.]+)/],
["instagram", /Instagram\s([0-9\.]+)/],
["ios-webview", /AppleWebKit\/([0-9\.]+).*Mobile/],
["ios-webview", /AppleWebKit\/([0-9\.]+).*Gecko\)$/],
["curl", /^curl\/([0-9\.]+)$/],
["searchbot", SEARCHBOX_UA_REGEX]
];
var operatingSystemRules = [
["iOS", /iP(hone|od|ad)/],
["Android OS", /Android/],
["BlackBerry OS", /BlackBerry|BB10/],
["Windows Mobile", /IEMobile/],
["Amazon OS", /Kindle/],
["Windows 3.11", /Win16/],
["Windows 95", /(Windows 95)|(Win95)|(Windows_95)/],
["Windows 98", /(Windows 98)|(Win98)/],
["Windows 2000", /(Windows NT 5.0)|(Windows 2000)/],
["Windows XP", /(Windows NT 5.1)|(Windows XP)/],
["Windows Server 2003", /(Windows NT 5.2)/],
["Windows Vista", /(Windows NT 6.0)/],
["Windows 7", /(Windows NT 6.1)/],
["Windows 8", /(Windows NT 6.2)/],
["Windows 8.1", /(Windows NT 6.3)/],
["Windows 10", /(Windows NT 10.0)/],
["Windows ME", /Windows ME/],
["Windows CE", /Windows CE|WinCE|Microsoft Pocket Internet Explorer/],
["Open BSD", /OpenBSD/],
["Sun OS", /SunOS/],
["Chrome OS", /CrOS/],
["Linux", /(Linux)|(X11)/],
["Mac OS", /(Mac_PowerPC)|(Macintosh)/],
["QNX", /QNX/],
["BeOS", /BeOS/],
["OS/2", /OS\/2/]
];
function detect(userAgent) {
if (!!userAgent) {
return parseUserAgent(userAgent);
}
if (typeof document === "undefined" && typeof navigator !== "undefined" && navigator.product === "ReactNative") {
return new ReactNativeInfo();
}
if (typeof navigator !== "undefined") {
return parseUserAgent(navigator.userAgent);
}
return getNodeVersion();
}
function matchUserAgent(ua) {
return ua !== "" && userAgentRules.reduce(function(matched, _a2) {
var browser = _a2[0], regex = _a2[1];
if (matched) {
return matched;
}
var uaMatch = regex.exec(ua);
return !!uaMatch && [browser, uaMatch];
}, false);
}
function parseUserAgent(ua) {
var matchedRule = matchUserAgent(ua);
if (!matchedRule) {
return null;
}
var name = matchedRule[0], match2 = matchedRule[1];
if (name === "searchbot") {
return new BotInfo();
}
var versionParts = match2[1] && match2[1].split(".").join("_").split("_").slice(0, 3);
if (versionParts) {
if (versionParts.length < REQUIRED_VERSION_PARTS) {
versionParts = __spreadArray(__spreadArray([], versionParts, true), createVersionParts(REQUIRED_VERSION_PARTS - versionParts.length), true);
}
} else {
versionParts = [];
}
var version2 = versionParts.join(".");
var os = detectOS(ua);
var searchBotMatch = SEARCHBOT_OS_REGEX.exec(ua);
if (searchBotMatch && searchBotMatch[1]) {
return new SearchBotDeviceInfo(name, version2, os, searchBotMatch[1]);
}
return new BrowserInfo(name, version2, os);
}
function detectOS(ua) {
for (var ii = 0, count = operatingSystemRules.length; ii < count; ii++) {
var _a2 = operatingSystemRules[ii], os = _a2[0], regex = _a2[1];
var match2 = regex.exec(ua);
if (match2) {
return os;
}
}
return null;
}
function getNodeVersion() {
var isNode = typeof process !== "undefined" && process.version;
return isNode ? new NodeInfo(process.version.slice(1)) : null;
}
function createVersionParts(count) {
var output = [];
for (var ii = 0; ii < count; ii++) {
output.push("0");
}
return output;
}
const supportLanguage = /* @__PURE__ */ new Set(["zh", "en"]);
const defaultLocale = (() => {
const languages = castArray(navigator.languages || navigator.language);
for (const language of languages) {
const lang = language.split("-")[0];
if (supportLanguage.has(lang))
return lang;
}
return "en";
})();
const getActionText = ({ linked, named }) => linked(`message.dialog.action.${named("action")}`);
const nHentaiDownloadHosts = [
"i.nhentai.net",
"i2.nhentai.net",
"i3.nhentai.net",
"i5.nhentai.net",
"i7.nhentai.net"
];
var NHentaiDownloadHostSpecial = /* @__PURE__ */ ((NHentaiDownloadHostSpecial2) => {
NHentaiDownloadHostSpecial2["RANDOM"] = "random";
NHentaiDownloadHostSpecial2["BALANCE"] = "balance";
return NHentaiDownloadHostSpecial2;
})(NHentaiDownloadHostSpecial || {});
const booleanValidator = (val) => typeof val === "boolean";
const stringValidator = (val) => typeof val === "string";
const createNumberValidator = (min, max) => (val) => typeof val === "number" && min <= val && val <= max;
const trimFormatter = (val) => val.trim();
const settingDefinitions = {
language: {
key: "language",
default: defaultLocale,
validator: (val) => supportLanguage.has(val)
},
threadNum: {
key: "thread_num",
default: 8,
validator: createNumberValidator(1, 32),
formatter: (val) => Math.floor(val)
},
openOnNewTab: {
key: "open_on_new_tab",
default: true,
validator: booleanValidator
},
customDownloadUrl: {
key: "custom_download_url",
default: "",
validator: stringValidator,
formatter: trimFormatter
},
compressionFilename: {
key: "cf_name",
default: "{{japanese}}.zip",
validator: stringValidator,
formatter: trimFormatter
},
filenameMaxArtistsNumber: {
key: "cf_name_max_artists_number",
default: 3,
validator: createNumberValidator(0, Infinity)
},
filenameArtistsSeparator: {
key: "cf_name_artists_separator",
default: ", ",
validator: stringValidator
},
compressionLevel: {
key: "c_lv",
default: 0,
validator: createNumberValidator(0, 9),
formatter: (val) => Math.floor(val)
},
compressionStreamFiles: {
key: "c_stream_files",
default: false,
validator: booleanValidator
},
streamDownload: {
key: "stream_download",
default: false,
validator: booleanValidator
},
seriesMode: {
key: "series_mode",
default: false,
validator: booleanValidator
},
filenameLength: {
key: "filename_length",
default: 0,
validator: (val) => val === "auto" || typeof val === "number" && val >= 0,
formatter: (val) => typeof val === "number" ? Math.floor(val) : val
},
autoCancelDownloadedManga: {
key: "auto_cancel_downloaded_doujin",
default: false,
validator: booleanValidator
},
autoRetryWhenErrorOccurs: {
key: "auto_retry_when_error_occurs",
default: false,
validator: booleanValidator
},
autoShowAll: {
key: "auto_show_all",
default: false,
validator: booleanValidator
},
showIgnoreButton: {
key: "show_ignore_button",
default: false,
validator: booleanValidator
},
preventConsoleClearing: {
key: "prevent_console_clear",
default: false,
validator: booleanValidator
},
judgeDownloadedByEnglish: {
key: "judge_downloaded_by_english",
default: false,
validator: booleanValidator
},
judgeDownloadedByJapanese: {
key: "judge_downloaded_by_japanese",
default: true,
validator: booleanValidator
},
judgeDownloadedByPretty: {
key: "judge_downloaded_by_pretty",
default: false,
validator: booleanValidator
},
nHentaiDownloadHost: {
key: "nHentai_media_host",
default: nHentaiDownloadHosts[0],
validator: (val) => val === "random" || val === "balance" || nHentaiDownloadHosts.includes(val)
}
};
const browserDetect = detect();
const DISABLE_STREAM_DOWNLOAD = !!browserDetect && (browserDetect.name === "safari" || browserDetect.name === "firefox");
const readSettings = () => mapValues(
settingDefinitions,
({ key, default: defaultVal }) => _GM_getValue(key, defaultVal)
);
const writeableSettings = reactive(readSettings());
const settings = writeableSettings;
if (DISABLE_STREAM_DOWNLOAD && settings.streamDownload)
writeableSettings.streamDownload = false;
const startWatchSettings = functionOnce(() => {
const settingRefs = toRefs(writeableSettings);
forEach(settingRefs, (ref2, key) => {
const cur = settingDefinitions[key];
watch(ref2, (val) => {
if (!cur.validator(val)) {
ref2.value = cur.default;
return;
}
if (cur.formatter) {
const formattedVal = cur.formatter(val);
if (ref2.value !== formattedVal) {
ref2.value = formattedVal;
return;
}
}
logger.log("update setting", cur.key, val);
_GM_setValue(cur.key, val);
});
});
});
const dlQueue = new AsyncQueue();
const zipQueue = new AsyncQueue(WORKER_THREAD_NUM);
dlQueue.canSingleStart = () => !(settings.seriesMode && zipQueue.length);
zipQueue.emitter.on("finish", () => {
if (settings.seriesMode)
dlQueue.start().catch(logger.error);
});
const _withScopeId = (n) => (pushScopeId("data-v-83b954f2"), n = n(), popScopeId(), n);
const _hoisted_1$h = ["title"];
const _hoisted_2$c = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ createBaseVNode("i", { class: "fa fa-times" }, null, -1));
const _hoisted_3$5 = [
_hoisted_2$c
];
const _hoisted_4$2 = { class: "download-item__title" };
const _hoisted_5$2 = { class: "download-item__progress-text" };
const _sfc_main$D = /* @__PURE__ */ defineComponent({
__name: "DownloadItem",
props: {
item: null,
index: null
},
setup(__props) {
const props = __props;
const title = computed(() => {
const { english: english2, japanese: japanese2, pretty } = props.item.gallery.title;
return japanese2 || english2 || pretty;
});
const progressWidth = computed(() => {
const {
gallery: { pages: pages2 },
done,
compressing,
compressingPercent
} = props.item;
const page = pages2.length;
return compressing ? compressingPercent : page && done ? (100 * done / page).toFixed(2) : 0;
});
const canCancel = computed(() => !props.item.compressing);
const cancel = () => {
var _a2;
const { info } = props.index === 0 ? dlQueue.queue[0] : removeAt(dlQueue.queue, props.index);
(_a2 = info == null ? void 0 : info.cancel) == null ? void 0 : _a2.call(info);
};
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass(["download-item", {
"download-item--error": __props.item.error,
"download-item--compressing": __props.item.compressing && !__props.item.error,
"download-item--can-cancel": unref(canCancel)
}]),
title: unref(title)
}, [
unref(canCancel) ? (openBlock(), createElementBlock("div", {
key: 0,
class: "download-item__cancel",
onClick: cancel
}, _hoisted_3$5)) : createCommentVNode("", true),
createBaseVNode("div", _hoisted_4$2, toDisplayString$1(unref(title)), 1),
createBaseVNode("div", {
class: "download-item__progress",
style: normalizeStyle({ width: `${unref(progressWidth)}%` })
}, [
createBaseVNode("div", _hoisted_5$2, toDisplayString$1(unref(progressWidth)) + "%", 1)
], 4)
], 10, _hoisted_1$h);
};
}
});
const _export_sfc$1 = (sfc, props) => {
const target = sfc.__vccOpts || sfc;
for (const [key, val] of props) {
target[key] = val;
}
return target;
};
const DownloadItem = /* @__PURE__ */ _export_sfc$1(_sfc_main$D, [["__scopeId", "data-v-83b954f2"]]);
const _hoisted_1$g = { id: "download-panel" };
const _sfc_main$C = /* @__PURE__ */ defineComponent({
__name: "DownloadList",
props: {
zipList: null,
dlList: null
},
setup(__props) {
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", _hoisted_1$g, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(__props.zipList, (item, index2) => {
return openBlock(), createBlock(DownloadItem, {
key: index2,
item,
index: index2
}, null, 8, ["item", "index"]);
}), 128)),
(openBlock(true), createElementBlock(Fragment$1, null, renderList(__props.dlList, (item, index2) => {
return openBlock(), createBlock(DownloadItem, {
key: index2,
item,
index: index2
}, null, 8, ["item", "index"]);
}), 128))
]);
};
}
});
const DownloadList = /* @__PURE__ */ _export_sfc$1(_sfc_main$C, [["__scopeId", "data-v-f37e74c3"]]);
const _sfc_main$B = /* @__PURE__ */ defineComponent({
__name: "DownloadPanel",
setup(__props) {
const { title } = document;
const zipList = computed(() => zipQueue.queue.map(({ info }) => info));
const dlList = computed(() => dlQueue.queue.map(({ info }) => info));
const infoList = computed(() => [...zipList.value, ...dlList.value]);
const error = computed(() => {
var _a2;
return !!((_a2 = dlList.value[0]) == null ? void 0 : _a2.error);
});
const titleWithStatus = computed(() => {
if (error.value)
return `[×] ${title}`;
const len = infoList.value.length;
return `[${len || "✓"}] ${title}`;
});
watch(infoList, (val) => {
sessionStorage.setItem("downloadQueue", JSON.stringify(val.map(({ gallery: gallery2 }) => gallery2)));
});
watch(titleWithStatus, (val) => {
document.title = val;
});
return (_ctx, _cache) => {
return unref(infoList).length ? (openBlock(), createBlock(DownloadList, {
key: 0,
"zip-list": unref(zipList),
"dl-list": unref(dlList)
}, null, 8, ["zip-list", "dl-list"])) : createCommentVNode("", true);
};
}
});
const composeEventHandlers = (theirsHandler, oursHandler, { checkForDefaultPrevented = true } = {}) => {
const handleEvent = (event) => {
const shouldPrevent = theirsHandler == null ? void 0 : theirsHandler(event);
if (checkForDefaultPrevented === false || !shouldPrevent) {
return oursHandler == null ? void 0 : oursHandler(event);
}
};
return handleEvent;
};
var _a;
const isClient$1 = typeof window !== "undefined";
const isString$1 = (val) => typeof val === "string";
const noop$1 = () => {
};
const isIOS = isClient$1 && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
function resolveUnref(r) {
return typeof r === "function" ? r() : unref(r);
}
function createFilterWrapper$1(filter2, fn2) {
function wrapper(...args) {
return new Promise((resolve2, reject) => {
Promise.resolve(filter2(() => fn2.apply(this, args), { fn: fn2, thisArg: this, args })).then(resolve2).catch(reject);
});
}
return wrapper;
}
function debounceFilter(ms, options = {}) {
let timer;
let maxTimer;
let lastRejector = noop$1;
const _clearTimeout = (timer2) => {
clearTimeout(timer2);
lastRejector();
lastRejector = noop$1;
};
const filter2 = (invoke) => {
const duration = resolveUnref(ms);
const maxDuration = resolveUnref(options.maxWait);
if (timer)
_clearTimeout(timer);
if (duration <= 0 || maxDuration !== void 0 && maxDuration <= 0) {
if (maxTimer) {
_clearTimeout(maxTimer);
maxTimer = null;
}
return Promise.resolve(invoke());
}
return new Promise((resolve2, reject) => {
lastRejector = options.rejectOnCancel ? reject : resolve2;
if (maxDuration && !maxTimer) {
maxTimer = setTimeout(() => {
if (timer)
_clearTimeout(timer);
maxTimer = null;
resolve2(invoke());
}, maxDuration);
}
timer = setTimeout(() => {
if (maxTimer)
_clearTimeout(maxTimer);
maxTimer = null;
resolve2(invoke());
}, duration);
});
};
return filter2;
}
function identity(arg) {
return arg;
}
function tryOnScopeDispose$1(fn2) {
if (getCurrentScope()) {
onScopeDispose(fn2);
return true;
}
return false;
}
function useDebounceFn(fn2, ms = 200, options = {}) {
return createFilterWrapper$1(debounceFilter(ms, options), fn2);
}
function refDebounced(value, ms = 200, options = {}) {
const debounced = ref(value.value);
const updater = useDebounceFn(() => {
debounced.value = value.value;
}, ms, options);
watch(value, () => updater());
return debounced;
}
function tryOnMounted(fn2, sync = true) {
if (getCurrentInstance())
onMounted(fn2);
else if (sync)
fn2();
else
nextTick(fn2);
}
function useTimeoutFn(cb, interval, options = {}) {
const {
immediate = true
} = options;
const isPending = ref(false);
let timer = null;
function clear2() {
if (timer) {
clearTimeout(timer);
timer = null;
}
}
function stop() {
isPending.value = false;
clear2();
}
function start(...args) {
clear2();
isPending.value = true;
timer = setTimeout(() => {
isPending.value = false;
timer = null;
cb(...args);
}, resolveUnref(interval));
}
if (immediate) {
isPending.value = true;
if (isClient$1)
start();
}
tryOnScopeDispose$1(stop);
return {
isPending: readonly(isPending),
start,
stop
};
}
function unrefElement$1(elRef) {
var _a2;
const plain = resolveUnref(elRef);
return (_a2 = plain == null ? void 0 : plain.$el) != null ? _a2 : plain;
}
const defaultWindow$1 = isClient$1 ? window : void 0;
function useEventListener$1(...args) {
let target;
let events;
let listeners;
let options;
if (isString$1(args[0]) || Array.isArray(args[0])) {
[events, listeners, options] = args;
target = defaultWindow$1;
} else {
[target, events, listeners, options] = args;
}
if (!target)
return noop$1;
if (!Array.isArray(events))
events = [events];
if (!Array.isArray(listeners))
listeners = [listeners];
const cleanups = [];
const cleanup = () => {
cleanups.forEach((fn2) => fn2());
cleanups.length = 0;
};
const register = (el, event, listener, options2) => {
el.addEventListener(event, listener, options2);
return () => el.removeEventListener(event, listener, options2);
};
const stopWatch = watch(() => [unrefElement$1(target), resolveUnref(options)], ([el, options2]) => {
cleanup();
if (!el)
return;
cleanups.push(...events.flatMap((event) => {
return listeners.map((listener) => register(el, event, listener, options2));
}));
}, { immediate: true, flush: "post" });
const stop = () => {
stopWatch();
cleanup();
};
tryOnScopeDispose$1(stop);
return stop;
}
let _iOSWorkaround = false;
function onClickOutside(target, handler, options = {}) {
const { window: window2 = defaultWindow$1, ignore = [], capture = true, detectIframe = false } = options;
if (!window2)
return;
if (isIOS && !_iOSWorkaround) {
_iOSWorkaround = true;
Array.from(window2.document.body.children).forEach((el) => el.addEventListener("click", noop$1));
}
let shouldListen = true;
const shouldIgnore = (event) => {
return ignore.some((target2) => {
if (typeof target2 === "string") {
return Array.from(window2.document.querySelectorAll(target2)).some((el) => el === event.target || event.composedPath().includes(el));
} else {
const el = unrefElement$1(target2);
return el && (event.target === el || event.composedPath().includes(el));
}
});
};
const listener = (event) => {
const el = unrefElement$1(target);
if (!el || el === event.target || event.composedPath().includes(el))
return;
if (event.detail === 0)
shouldListen = !shouldIgnore(event);
if (!shouldListen) {
shouldListen = true;
return;
}
handler(event);
};
const cleanup = [
useEventListener$1(window2, "click", listener, { passive: true, capture }),
useEventListener$1(window2, "pointerdown", (e) => {
const el = unrefElement$1(target);
if (el)
shouldListen = !e.composedPath().includes(el) && !shouldIgnore(e);
}, { passive: true }),
detectIframe && useEventListener$1(window2, "blur", (event) => {
var _a2;
const el = unrefElement$1(target);
if (((_a2 = window2.document.activeElement) == null ? void 0 : _a2.tagName) === "IFRAME" && !(el == null ? void 0 : el.contains(window2.document.activeElement)))
handler(event);
})
].filter(Boolean);
const stop = () => cleanup.forEach((fn2) => fn2());
return stop;
}
function useSupported(callback, sync = false) {
const isSupported = ref();
const update = () => isSupported.value = Boolean(callback());
update();
tryOnMounted(update, sync);
return isSupported;
}
const _global$1 = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
const globalKey$1 = "__vueuse_ssr_handlers__";
_global$1[globalKey$1] = _global$1[globalKey$1] || {};
var __getOwnPropSymbols$g = Object.getOwnPropertySymbols;
var __hasOwnProp$g = Object.prototype.hasOwnProperty;
var __propIsEnum$g = Object.prototype.propertyIsEnumerable;
var __objRest$2 = (source, exclude) => {
var target = {};
for (var prop in source)
if (__hasOwnProp$g.call(source, prop) && exclude.indexOf(prop) < 0)
target[prop] = source[prop];
if (source != null && __getOwnPropSymbols$g)
for (var prop of __getOwnPropSymbols$g(source)) {
if (exclude.indexOf(prop) < 0 && __propIsEnum$g.call(source, prop))
target[prop] = source[prop];
}
return target;
};
function useResizeObserver(target, callback, options = {}) {
const _a2 = options, { window: window2 = defaultWindow$1 } = _a2, observerOptions = __objRest$2(_a2, ["window"]);
let observer;
const isSupported = useSupported(() => window2 && "ResizeObserver" in window2);
const cleanup = () => {
if (observer) {
observer.disconnect();
observer = void 0;
}
};
const stopWatch = watch(() => unrefElement$1(target), (el) => {
cleanup();
if (isSupported.value && window2 && el) {
observer = new ResizeObserver(callback);
observer.observe(el, observerOptions);
}
}, { immediate: true, flush: "post" });
const stop = () => {
cleanup();
stopWatch();
};
tryOnScopeDispose$1(stop);
return {
isSupported,
stop
};
}
var SwipeDirection;
(function(SwipeDirection2) {
SwipeDirection2["UP"] = "UP";
SwipeDirection2["RIGHT"] = "RIGHT";
SwipeDirection2["DOWN"] = "DOWN";
SwipeDirection2["LEFT"] = "LEFT";
SwipeDirection2["NONE"] = "NONE";
})(SwipeDirection || (SwipeDirection = {}));
var __defProp = Object.defineProperty;
var __getOwnPropSymbols = Object.getOwnPropertySymbols;
var __hasOwnProp = Object.prototype.hasOwnProperty;
var __propIsEnum = Object.prototype.propertyIsEnumerable;
var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues = (a, b) => {
for (var prop in b || (b = {}))
if (__hasOwnProp.call(b, prop))
__defNormalProp(a, prop, b[prop]);
if (__getOwnPropSymbols)
for (var prop of __getOwnPropSymbols(b)) {
if (__propIsEnum.call(b, prop))
__defNormalProp(a, prop, b[prop]);
}
return a;
};
const _TransitionPresets = {
easeInSine: [0.12, 0, 0.39, 0],
easeOutSine: [0.61, 1, 0.88, 1],
easeInOutSine: [0.37, 0, 0.63, 1],
easeInQuad: [0.11, 0, 0.5, 0],
easeOutQuad: [0.5, 1, 0.89, 1],
easeInOutQuad: [0.45, 0, 0.55, 1],
easeInCubic: [0.32, 0, 0.67, 0],
easeOutCubic: [0.33, 1, 0.68, 1],
easeInOutCubic: [0.65, 0, 0.35, 1],
easeInQuart: [0.5, 0, 0.75, 0],
easeOutQuart: [0.25, 1, 0.5, 1],
easeInOutQuart: [0.76, 0, 0.24, 1],
easeInQuint: [0.64, 0, 0.78, 0],
easeOutQuint: [0.22, 1, 0.36, 1],
easeInOutQuint: [0.83, 0, 0.17, 1],
easeInExpo: [0.7, 0, 0.84, 0],
easeOutExpo: [0.16, 1, 0.3, 1],
easeInOutExpo: [0.87, 0, 0.13, 1],
easeInCirc: [0.55, 0, 1, 0.45],
easeOutCirc: [0, 0.55, 0.45, 1],
easeInOutCirc: [0.85, 0, 0.15, 1],
easeInBack: [0.36, 0, 0.66, -0.56],
easeOutBack: [0.34, 1.56, 0.64, 1],
easeInOutBack: [0.68, -0.6, 0.32, 1.6]
};
__spreadValues({
linear: identity
}, _TransitionPresets);
const isFirefox = () => isClient$1 && /firefox/i.test(window.navigator.userAgent);
const isUndefined = (val) => val === void 0;
const isBoolean$1 = (val) => typeof val === "boolean";
const isNumber$1 = (val) => typeof val === "number";
const isElement = (e) => {
if (typeof Element === "undefined")
return false;
return e instanceof Element;
};
const isStringNumber = (val) => {
if (!isString$2(val)) {
return false;
}
return !Number.isNaN(Number(val));
};
const escapeStringRegexp = (string2 = "") => string2.replace(/[|\\{}()[\]^$+*?.]/g, "\\$&").replace(/-/g, "\\x2d");
const keysOf = (arr) => Object.keys(arr);
const getProp = (obj, path, defaultValue) => {
return {
get value() {
return get(obj, path, defaultValue);
},
set value(val) {
set(obj, path, val);
}
};
};
class ElementPlusError extends Error {
constructor(m) {
super(m);
this.name = "ElementPlusError";
}
}
function throwError(scope, m) {
throw new ElementPlusError(`[${scope}] ${m}`);
}
function debugWarn(scope, message2) {
}
const classNameToArray = (cls = "") => cls.split(" ").filter((item) => !!item.trim());
const hasClass = (el, cls) => {
if (!el || !cls)
return false;
if (cls.includes(" "))
throw new Error("className should not contain space.");
return el.classList.contains(cls);
};
const addClass = (el, cls) => {
if (!el || !cls.trim())
return;
el.classList.add(...classNameToArray(cls));
};
const removeClass = (el, cls) => {
if (!el || !cls.trim())
return;
el.classList.remove(...classNameToArray(cls));
};
const getStyle = (element, styleName) => {
var _a2;
if (!isClient$1 || !element || !styleName)
return "";
let key = camelize(styleName);
if (key === "float")
key = "cssFloat";
try {
const style = element.style[key];
if (style)
return style;
const computed2 = (_a2 = document.defaultView) == null ? void 0 : _a2.getComputedStyle(element, "");
return computed2 ? computed2[key] : "";
} catch (e) {
return element.style[key];
}
};
function addUnit(value, defaultUnit = "px") {
if (!value)
return "";
if (isNumber$1(value) || isStringNumber(value)) {
return `${value}${defaultUnit}`;
} else if (isString$2(value)) {
return value;
}
}
let scrollBarWidth;
const getScrollBarWidth = (namespace) => {
var _a2;
if (!isClient$1)
return 0;
if (scrollBarWidth !== void 0)
return scrollBarWidth;
const outer = document.createElement("div");
outer.className = `${namespace}-scrollbar__wrap`;
outer.style.visibility = "hidden";
outer.style.width = "100px";
outer.style.position = "absolute";
outer.style.top = "-9999px";
document.body.appendChild(outer);
const widthNoScroll = outer.offsetWidth;
outer.style.overflow = "scroll";
const inner = document.createElement("div");
inner.style.width = "100%";
outer.appendChild(inner);
const widthWithScroll = inner.offsetWidth;
(_a2 = outer.parentNode) == null ? void 0 : _a2.removeChild(outer);
scrollBarWidth = widthNoScroll - widthWithScroll;
return scrollBarWidth;
};
function scrollIntoView(container, selected) {
if (!isClient$1)
return;
if (!selected) {
container.scrollTop = 0;
return;
}
const offsetParents = [];
let pointer = selected.offsetParent;
while (pointer !== null && container !== pointer && container.contains(pointer)) {
offsetParents.push(pointer);
pointer = pointer.offsetParent;
}
const top = selected.offsetTop + offsetParents.reduce((prev, curr) => prev + curr.offsetTop, 0);
const bottom = top + selected.offsetHeight;
const viewRectTop = container.scrollTop;
const viewRectBottom = viewRectTop + container.clientHeight;
if (top < viewRectTop) {
container.scrollTop = top;
} else if (bottom > viewRectBottom) {
container.scrollTop = bottom - container.clientHeight;
}
}
/*! Element Plus Icons Vue v2.1.0 */
var export_helper_default = (sfc, props) => {
let target = sfc.__vccOpts || sfc;
for (let [key, val] of props)
target[key] = val;
return target;
};
var arrow_down_vue_vue_type_script_lang_default = {
name: "ArrowDown"
};
var _hoisted_16 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_26 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z"
},
null,
-1
/* HOISTED */
), _hoisted_36 = [
_hoisted_26
];
function _sfc_render6(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_16, _hoisted_36);
}
var arrow_down_default = /* @__PURE__ */ export_helper_default(arrow_down_vue_vue_type_script_lang_default, [["render", _sfc_render6], ["__file", "arrow-down.vue"]]);
var arrow_up_vue_vue_type_script_lang_default = {
name: "ArrowUp"
};
var _hoisted_112 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_212 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0z"
},
null,
-1
/* HOISTED */
), _hoisted_312 = [
_hoisted_212
];
function _sfc_render12(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_112, _hoisted_312);
}
var arrow_up_default = /* @__PURE__ */ export_helper_default(arrow_up_vue_vue_type_script_lang_default, [["render", _sfc_render12], ["__file", "arrow-up.vue"]]);
var circle_check_vue_vue_type_script_lang_default = {
name: "CircleCheck"
};
var _hoisted_149 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_249 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z"
},
null,
-1
/* HOISTED */
), _hoisted_348 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z"
},
null,
-1
/* HOISTED */
), _hoisted_415 = [
_hoisted_249,
_hoisted_348
];
function _sfc_render49(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_149, _hoisted_415);
}
var circle_check_default = /* @__PURE__ */ export_helper_default(circle_check_vue_vue_type_script_lang_default, [["render", _sfc_render49], ["__file", "circle-check.vue"]]);
var circle_close_filled_vue_vue_type_script_lang_default = {
name: "CircleCloseFilled"
};
var _hoisted_150 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_250 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 393.664L407.936 353.6a38.4 38.4 0 1 0-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1 0 54.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1 0 54.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 1 0-54.336-54.336L512 457.664z"
},
null,
-1
/* HOISTED */
), _hoisted_349 = [
_hoisted_250
];
function _sfc_render50(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_150, _hoisted_349);
}
var circle_close_filled_default = /* @__PURE__ */ export_helper_default(circle_close_filled_vue_vue_type_script_lang_default, [["render", _sfc_render50], ["__file", "circle-close-filled.vue"]]);
var circle_close_vue_vue_type_script_lang_default = {
name: "CircleClose"
};
var _hoisted_151 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_251 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248L466.752 512z"
},
null,
-1
/* HOISTED */
), _hoisted_350 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z"
},
null,
-1
/* HOISTED */
), _hoisted_416 = [
_hoisted_251,
_hoisted_350
];
function _sfc_render51(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_151, _hoisted_416);
}
var circle_close_default = /* @__PURE__ */ export_helper_default(circle_close_vue_vue_type_script_lang_default, [["render", _sfc_render51], ["__file", "circle-close.vue"]]);
var close_vue_vue_type_script_lang_default = {
name: "Close"
};
var _hoisted_156 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_256 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z"
},
null,
-1
/* HOISTED */
), _hoisted_355 = [
_hoisted_256
];
function _sfc_render56(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_156, _hoisted_355);
}
var close_default = /* @__PURE__ */ export_helper_default(close_vue_vue_type_script_lang_default, [["render", _sfc_render56], ["__file", "close.vue"]]);
var delete_vue_vue_type_script_lang_default = {
name: "Delete"
};
var _hoisted_180 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_280 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M160 256H96a32 32 0 0 1 0-64h256V95.936a32 32 0 0 1 32-32h256a32 32 0 0 1 32 32V192h256a32 32 0 1 1 0 64h-64v672a32 32 0 0 1-32 32H192a32 32 0 0 1-32-32V256zm448-64v-64H416v64h192zM224 896h576V256H224v640zm192-128a32 32 0 0 1-32-32V416a32 32 0 0 1 64 0v320a32 32 0 0 1-32 32zm192 0a32 32 0 0 1-32-32V416a32 32 0 0 1 64 0v320a32 32 0 0 1-32 32z"
},
null,
-1
/* HOISTED */
), _hoisted_379 = [
_hoisted_280
];
function _sfc_render80(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_180, _hoisted_379);
}
var delete_default = /* @__PURE__ */ export_helper_default(delete_vue_vue_type_script_lang_default, [["render", _sfc_render80], ["__file", "delete.vue"]]);
var download_vue_vue_type_script_lang_default = {
name: "Download"
};
var _hoisted_191 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_291 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M160 832h704a32 32 0 1 1 0 64H160a32 32 0 1 1 0-64zm384-253.696 236.288-236.352 45.248 45.248L508.8 704 192 387.2l45.248-45.248L480 584.704V128h64v450.304z"
},
null,
-1
/* HOISTED */
), _hoisted_390 = [
_hoisted_291
];
function _sfc_render91(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_191, _hoisted_390);
}
var download_default = /* @__PURE__ */ export_helper_default(download_vue_vue_type_script_lang_default, [["render", _sfc_render91], ["__file", "download.vue"]]);
var hide_vue_vue_type_script_lang_default = {
name: "Hide"
};
var _hoisted_1133 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2133 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2L371.2 588.8ZM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z"
},
null,
-1
/* HOISTED */
), _hoisted_3132 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z"
},
null,
-1
/* HOISTED */
), _hoisted_438 = [
_hoisted_2133,
_hoisted_3132
];
function _sfc_render133(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1133, _hoisted_438);
}
var hide_default = /* @__PURE__ */ export_helper_default(hide_vue_vue_type_script_lang_default, [["render", _sfc_render133], ["__file", "hide.vue"]]);
var info_filled_vue_vue_type_script_lang_default = {
name: "InfoFilled"
};
var _hoisted_1143 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2143 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a448 448 0 1 1 0 896.064A448 448 0 0 1 512 64zm67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344zM590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 0 1-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 0 1 7.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z"
},
null,
-1
/* HOISTED */
), _hoisted_3142 = [
_hoisted_2143
];
function _sfc_render143(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1143, _hoisted_3142);
}
var info_filled_default = /* @__PURE__ */ export_helper_default(info_filled_vue_vue_type_script_lang_default, [["render", _sfc_render143], ["__file", "info-filled.vue"]]);
var loading_vue_vue_type_script_lang_default = {
name: "Loading"
};
var _hoisted_1150 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2150 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32zm0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32zm448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32zm-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32zM195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0zm-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z"
},
null,
-1
/* HOISTED */
), _hoisted_3149 = [
_hoisted_2150
];
function _sfc_render150(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1150, _hoisted_3149);
}
var loading_default = /* @__PURE__ */ export_helper_default(loading_vue_vue_type_script_lang_default, [["render", _sfc_render150], ["__file", "loading.vue"]]);
var minus_vue_vue_type_script_lang_default = {
name: "Minus"
};
var _hoisted_1169 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2169 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M128 544h768a32 32 0 1 0 0-64H128a32 32 0 0 0 0 64z"
},
null,
-1
/* HOISTED */
), _hoisted_3168 = [
_hoisted_2169
];
function _sfc_render169(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1169, _hoisted_3168);
}
var minus_default = /* @__PURE__ */ export_helper_default(minus_vue_vue_type_script_lang_default, [["render", _sfc_render169], ["__file", "minus.vue"]]);
var plus_vue_vue_type_script_lang_default = {
name: "Plus"
};
var _hoisted_1201 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2201 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M480 480V128a32 32 0 0 1 64 0v352h352a32 32 0 1 1 0 64H544v352a32 32 0 1 1-64 0V544H128a32 32 0 0 1 0-64h352z"
},
null,
-1
/* HOISTED */
), _hoisted_3200 = [
_hoisted_2201
];
function _sfc_render201(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1201, _hoisted_3200);
}
var plus_default = /* @__PURE__ */ export_helper_default(plus_vue_vue_type_script_lang_default, [["render", _sfc_render201], ["__file", "plus.vue"]]);
var question_filled_vue_vue_type_script_lang_default = {
name: "QuestionFilled"
};
var _hoisted_1211 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2211 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm23.744 191.488c-52.096 0-92.928 14.784-123.2 44.352-30.976 29.568-45.76 70.4-45.76 122.496h80.256c0-29.568 5.632-52.8 17.6-68.992 13.376-19.712 35.2-28.864 66.176-28.864 23.936 0 42.944 6.336 56.32 19.712 12.672 13.376 19.712 31.68 19.712 54.912 0 17.6-6.336 34.496-19.008 49.984l-8.448 9.856c-45.76 40.832-73.216 70.4-82.368 89.408-9.856 19.008-14.08 42.24-14.08 68.992v9.856h80.96v-9.856c0-16.896 3.52-31.68 10.56-45.76 6.336-12.672 15.488-24.64 28.16-35.2 33.792-29.568 54.208-48.576 60.544-55.616 16.896-22.528 26.048-51.392 26.048-86.592 0-42.944-14.08-76.736-42.24-101.376-28.16-25.344-65.472-37.312-111.232-37.312zm-12.672 406.208a54.272 54.272 0 0 0-38.72 14.784 49.408 49.408 0 0 0-15.488 38.016c0 15.488 4.928 28.16 15.488 38.016A54.848 54.848 0 0 0 523.072 768c15.488 0 28.16-4.928 38.72-14.784a51.52 51.52 0 0 0 16.192-38.72 51.968 51.968 0 0 0-15.488-38.016 55.936 55.936 0 0 0-39.424-14.784z"
},
null,
-1
/* HOISTED */
), _hoisted_3210 = [
_hoisted_2211
];
function _sfc_render211(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1211, _hoisted_3210);
}
var question_filled_default = /* @__PURE__ */ export_helper_default(question_filled_vue_vue_type_script_lang_default, [["render", _sfc_render211], ["__file", "question-filled.vue"]]);
var success_filled_vue_vue_type_script_lang_default = {
name: "SuccessFilled"
};
var _hoisted_1249 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2249 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336L456.192 600.384z"
},
null,
-1
/* HOISTED */
), _hoisted_3248 = [
_hoisted_2249
];
function _sfc_render249(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1249, _hoisted_3248);
}
var success_filled_default = /* @__PURE__ */ export_helper_default(success_filled_vue_vue_type_script_lang_default, [["render", _sfc_render249], ["__file", "success-filled.vue"]]);
var upload_vue_vue_type_script_lang_default = {
name: "Upload"
};
var _hoisted_1275 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2275 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M160 832h704a32 32 0 1 1 0 64H160a32 32 0 1 1 0-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z"
},
null,
-1
/* HOISTED */
), _hoisted_3274 = [
_hoisted_2275
];
function _sfc_render275(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1275, _hoisted_3274);
}
var upload_default = /* @__PURE__ */ export_helper_default(upload_vue_vue_type_script_lang_default, [["render", _sfc_render275], ["__file", "upload.vue"]]);
var view_vue_vue_type_script_lang_default = {
name: "View"
};
var _hoisted_1283 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2283 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352zm0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448zm0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160z"
},
null,
-1
/* HOISTED */
), _hoisted_3282 = [
_hoisted_2283
];
function _sfc_render283(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1283, _hoisted_3282);
}
var view_default = /* @__PURE__ */ export_helper_default(view_vue_vue_type_script_lang_default, [["render", _sfc_render283], ["__file", "view.vue"]]);
var warning_filled_vue_vue_type_script_lang_default = {
name: "WarningFilled"
};
var _hoisted_1287 = {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, _hoisted_2287 = /* @__PURE__ */ createBaseVNode(
"path",
{
fill: "currentColor",
d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256zm0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4z"
},
null,
-1
/* HOISTED */
), _hoisted_3286 = [
_hoisted_2287
];
function _sfc_render287(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("svg", _hoisted_1287, _hoisted_3286);
}
var warning_filled_default = /* @__PURE__ */ export_helper_default(warning_filled_vue_vue_type_script_lang_default, [["render", _sfc_render287], ["__file", "warning-filled.vue"]]);
const epPropKey = "__epPropKey";
const definePropType = (val) => val;
const isEpProp = (val) => isObject$3(val) && !!val[epPropKey];
const buildProp = (prop, key) => {
if (!isObject$3(prop) || isEpProp(prop))
return prop;
const { values: values2, required: required2, default: defaultValue, type: type2, validator } = prop;
const _validator = values2 || validator ? (val) => {
let valid = false;
let allowedValues = [];
if (values2) {
allowedValues = Array.from(values2);
if (hasOwn$1(prop, "default")) {
allowedValues.push(defaultValue);
}
valid || (valid = allowedValues.includes(val));
}
if (validator)
valid || (valid = validator(val));
if (!valid && allowedValues.length > 0) {
const allowValuesText = [...new Set(allowedValues)].map((value) => JSON.stringify(value)).join(", ");
warn$1(`Invalid prop: validation failed${key ? ` for prop "${key}"` : ""}. Expected one of [${allowValuesText}], got value ${JSON.stringify(val)}.`);
}
return valid;
} : void 0;
const epProp = {
type: type2,
required: !!required2,
validator: _validator,
[epPropKey]: true
};
if (hasOwn$1(prop, "default"))
epProp.default = defaultValue;
return epProp;
};
const buildProps = (props) => fromPairs(Object.entries(props).map(([key, option]) => [
key,
buildProp(option, key)
]));
const iconPropType = definePropType([
String,
Object,
Function
]);
const CloseComponents = {
Close: close_default
};
const TypeComponents = {
Close: close_default,
SuccessFilled: success_filled_default,
InfoFilled: info_filled_default,
WarningFilled: warning_filled_default,
CircleCloseFilled: circle_close_filled_default
};
const TypeComponentsMap = {
success: success_filled_default,
warning: warning_filled_default,
error: circle_close_filled_default,
info: info_filled_default
};
const ValidateComponentsMap = {
validating: loading_default,
success: circle_check_default,
error: circle_close_default
};
const withInstall = (main, extra) => {
main.install = (app) => {
for (const comp of [main, ...Object.values(extra != null ? extra : {})]) {
app.component(comp.name, comp);
}
};
if (extra) {
for (const [key, comp] of Object.entries(extra)) {
main[key] = comp;
}
}
return main;
};
const withInstallFunction = (fn2, name) => {
fn2.install = (app) => {
fn2._context = app._context;
app.config.globalProperties[name] = fn2;
};
return fn2;
};
const withNoopInstall = (component) => {
component.install = NOOP;
return component;
};
const composeRefs = (...refs) => {
return (el) => {
refs.forEach((ref2) => {
if (isFunction$2(ref2)) {
ref2(el);
} else {
ref2.value = el;
}
});
};
};
const EVENT_CODE = {
tab: "Tab",
enter: "Enter",
space: "Space",
left: "ArrowLeft",
up: "ArrowUp",
right: "ArrowRight",
down: "ArrowDown",
esc: "Escape",
delete: "Delete",
backspace: "Backspace",
numpadEnter: "NumpadEnter",
pageUp: "PageUp",
pageDown: "PageDown",
home: "Home",
end: "End"
};
const UPDATE_MODEL_EVENT = "update:modelValue";
const CHANGE_EVENT = "change";
const INPUT_EVENT = "input";
const componentSizes = ["", "default", "small", "large"];
const componentSizeMap = {
large: 40,
default: 32,
small: 24
};
const getComponentSize = (size2) => {
return componentSizeMap[size2 || "default"];
};
const isValidComponentSize = (val) => ["", ...componentSizes].includes(val);
var PatchFlags = /* @__PURE__ */ ((PatchFlags2) => {
PatchFlags2[PatchFlags2["TEXT"] = 1] = "TEXT";
PatchFlags2[PatchFlags2["CLASS"] = 2] = "CLASS";
PatchFlags2[PatchFlags2["STYLE"] = 4] = "STYLE";
PatchFlags2[PatchFlags2["PROPS"] = 8] = "PROPS";
PatchFlags2[PatchFlags2["FULL_PROPS"] = 16] = "FULL_PROPS";
PatchFlags2[PatchFlags2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
PatchFlags2[PatchFlags2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
PatchFlags2[PatchFlags2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
PatchFlags2[PatchFlags2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
PatchFlags2[PatchFlags2["NEED_PATCH"] = 512] = "NEED_PATCH";
PatchFlags2[PatchFlags2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
PatchFlags2[PatchFlags2["HOISTED"] = -1] = "HOISTED";
PatchFlags2[PatchFlags2["BAIL"] = -2] = "BAIL";
return PatchFlags2;
})(PatchFlags || {});
const isKorean = (text) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(text);
const mutable = (val) => val;
const DEFAULT_EXCLUDE_KEYS = ["class", "style"];
const LISTENER_PREFIX = /^on[A-Z]/;
const useAttrs = (params = {}) => {
const { excludeListeners = false, excludeKeys } = params;
const allExcludeKeys = computed(() => {
return ((excludeKeys == null ? void 0 : excludeKeys.value) || []).concat(DEFAULT_EXCLUDE_KEYS);
});
const instance = getCurrentInstance();
if (!instance) {
return computed(() => ({}));
}
return computed(() => {
var _a2;
return fromPairs(Object.entries((_a2 = instance.proxy) == null ? void 0 : _a2.$attrs).filter(([key]) => !allExcludeKeys.value.includes(key) && !(excludeListeners && LISTENER_PREFIX.test(key))));
});
};
const useDeprecated = ({ from, replacement, scope, version: version2, ref: ref2, type: type2 = "API" }, condition) => {
watch(() => unref(condition), (val) => {
}, {
immediate: true
});
};
const useDraggable = (targetRef, dragRef, draggable) => {
let transform2 = {
offsetX: 0,
offsetY: 0
};
const onMousedown = (e) => {
const downX = e.clientX;
const downY = e.clientY;
const { offsetX, offsetY } = transform2;
const targetRect = targetRef.value.getBoundingClientRect();
const targetLeft = targetRect.left;
const targetTop = targetRect.top;
const targetWidth = targetRect.width;
const targetHeight = targetRect.height;
const clientWidth = document.documentElement.clientWidth;
const clientHeight = document.documentElement.clientHeight;
const minLeft = -targetLeft + offsetX;
const minTop = -targetTop + offsetY;
const maxLeft = clientWidth - targetLeft - targetWidth + offsetX;
const maxTop = clientHeight - targetTop - targetHeight + offsetY;
const onMousemove = (e2) => {
const moveX = Math.min(Math.max(offsetX + e2.clientX - downX, minLeft), maxLeft);
const moveY = Math.min(Math.max(offsetY + e2.clientY - downY, minTop), maxTop);
transform2 = {
offsetX: moveX,
offsetY: moveY
};
targetRef.value.style.transform = `translate(${addUnit(moveX)}, ${addUnit(moveY)})`;
};
const onMouseup = () => {
document.removeEventListener("mousemove", onMousemove);
document.removeEventListener("mouseup", onMouseup);
};
document.addEventListener("mousemove", onMousemove);
document.addEventListener("mouseup", onMouseup);
};
const onDraggable = () => {
if (dragRef.value && targetRef.value) {
dragRef.value.addEventListener("mousedown", onMousedown);
}
};
const offDraggable = () => {
if (dragRef.value && targetRef.value) {
dragRef.value.removeEventListener("mousedown", onMousedown);
}
};
onMounted(() => {
watchEffect(() => {
if (draggable.value) {
onDraggable();
} else {
offDraggable();
}
});
});
onBeforeUnmount(() => {
offDraggable();
});
};
const useFocus = (el) => {
return {
focus: () => {
var _a2, _b;
(_b = (_a2 = el.value) == null ? void 0 : _a2.focus) == null ? void 0 : _b.call(_a2);
}
};
};
var English = {
name: "en",
el: {
colorpicker: {
confirm: "OK",
clear: "Clear",
defaultLabel: "color picker",
description: "current color is {color}. press enter to select a new color."
},
datepicker: {
now: "Now",
today: "Today",
cancel: "Cancel",
clear: "Clear",
confirm: "OK",
dateTablePrompt: "Use the arrow keys and enter to select the day of the month",
monthTablePrompt: "Use the arrow keys and enter to select the month",
yearTablePrompt: "Use the arrow keys and enter to select the year",
selectedDate: "Selected date",
selectDate: "Select date",
selectTime: "Select time",
startDate: "Start Date",
startTime: "Start Time",
endDate: "End Date",
endTime: "End Time",
prevYear: "Previous Year",
nextYear: "Next Year",
prevMonth: "Previous Month",
nextMonth: "Next Month",
year: "",
month1: "January",
month2: "February",
month3: "March",
month4: "April",
month5: "May",
month6: "June",
month7: "July",
month8: "August",
month9: "September",
month10: "October",
month11: "November",
month12: "December",
week: "week",
weeks: {
sun: "Sun",
mon: "Mon",
tue: "Tue",
wed: "Wed",
thu: "Thu",
fri: "Fri",
sat: "Sat"
},
weeksFull: {
sun: "Sunday",
mon: "Monday",
tue: "Tuesday",
wed: "Wednesday",
thu: "Thursday",
fri: "Friday",
sat: "Saturday"
},
months: {
jan: "Jan",
feb: "Feb",
mar: "Mar",
apr: "Apr",
may: "May",
jun: "Jun",
jul: "Jul",
aug: "Aug",
sep: "Sep",
oct: "Oct",
nov: "Nov",
dec: "Dec"
}
},
inputNumber: {
decrease: "decrease number",
increase: "increase number"
},
select: {
loading: "Loading",
noMatch: "No matching data",
noData: "No data",
placeholder: "Select"
},
dropdown: {
toggleDropdown: "Toggle Dropdown"
},
cascader: {
noMatch: "No matching data",
loading: "Loading",
placeholder: "Select",
noData: "No data"
},
pagination: {
goto: "Go to",
pagesize: "/page",
total: "Total {total}",
pageClassifier: "",
page: "Page",
prev: "Go to previous page",
next: "Go to next page",
currentPage: "page {pager}",
prevPages: "Previous {pager} pages",
nextPages: "Next {pager} pages",
deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details"
},
dialog: {
close: "Close this dialog"
},
drawer: {
close: "Close this dialog"
},
messagebox: {
title: "Message",
confirm: "OK",
cancel: "Cancel",
error: "Illegal input",
close: "Close this dialog"
},
upload: {
deleteTip: "press delete to remove",
delete: "Delete",
preview: "Preview",
continue: "Continue"
},
slider: {
defaultLabel: "slider between {min} and {max}",
defaultRangeStartLabel: "pick start value",
defaultRangeEndLabel: "pick end value"
},
table: {
emptyText: "No Data",
confirmFilter: "Confirm",
resetFilter: "Reset",
clearFilter: "All",
sumText: "Sum"
},
tree: {
emptyText: "No Data"
},
transfer: {
noMatch: "No matching data",
noData: "No data",
titles: ["List 1", "List 2"],
filterPlaceholder: "Enter keyword",
noCheckedFormat: "{total} items",
hasCheckedFormat: "{checked}/{total} checked"
},
image: {
error: "FAILED"
},
pageHeader: {
title: "Back"
},
popconfirm: {
confirmButtonText: "Yes",
cancelButtonText: "No"
}
}
};
const buildTranslator = (locale) => (path, option) => translate$1(path, option, unref(locale));
const translate$1 = (path, option, locale) => get(locale, path, path).replace(/\{(\w+)\}/g, (_, key) => {
var _a2;
return `${(_a2 = option == null ? void 0 : option[key]) != null ? _a2 : `{${key}}`}`;
});
const buildLocaleContext = (locale) => {
const lang = computed(() => unref(locale).name);
const localeRef = isRef(locale) ? locale : ref(locale);
return {
lang,
locale: localeRef,
t: buildTranslator(locale)
};
};
const localeContextKey = Symbol("localeContextKey");
const useLocale = (localeOverrides) => {
const locale = localeOverrides || inject(localeContextKey, ref());
return buildLocaleContext(computed(() => locale.value || English));
};
const defaultNamespace = "el";
const statePrefix = "is-";
const _bem = (namespace, block, blockSuffix, element, modifier) => {
let cls = `${namespace}-${block}`;
if (blockSuffix) {
cls += `-${blockSuffix}`;
}
if (element) {
cls += `__${element}`;
}
if (modifier) {
cls += `--${modifier}`;
}
return cls;
};
const namespaceContextKey = Symbol("namespaceContextKey");
const useGetDerivedNamespace = (namespaceOverrides) => {
const derivedNamespace = namespaceOverrides || inject(namespaceContextKey, ref(defaultNamespace));
const namespace = computed(() => {
return unref(derivedNamespace) || defaultNamespace;
});
return namespace;
};
const useNamespace = (block, namespaceOverrides) => {
const namespace = useGetDerivedNamespace(namespaceOverrides);
const b = (blockSuffix = "") => _bem(namespace.value, block, blockSuffix, "", "");
const e = (element) => element ? _bem(namespace.value, block, "", element, "") : "";
const m = (modifier) => modifier ? _bem(namespace.value, block, "", "", modifier) : "";
const be2 = (blockSuffix, element) => blockSuffix && element ? _bem(namespace.value, block, blockSuffix, element, "") : "";
const em = (element, modifier) => element && modifier ? _bem(namespace.value, block, "", element, modifier) : "";
const bm = (blockSuffix, modifier) => blockSuffix && modifier ? _bem(namespace.value, block, blockSuffix, "", modifier) : "";
const bem = (blockSuffix, element, modifier) => blockSuffix && element && modifier ? _bem(namespace.value, block, blockSuffix, element, modifier) : "";
const is = (name, ...args) => {
const state = args.length >= 1 ? args[0] : true;
return name && state ? `${statePrefix}${name}` : "";
};
const cssVar = (object2) => {
const styles = {};
for (const key in object2) {
if (object2[key]) {
styles[`--${namespace.value}-${key}`] = object2[key];
}
}
return styles;
};
const cssVarBlock = (object2) => {
const styles = {};
for (const key in object2) {
if (object2[key]) {
styles[`--${namespace.value}-${block}-${key}`] = object2[key];
}
}
return styles;
};
const cssVarName = (name) => `--${namespace.value}-${name}`;
const cssVarBlockName = (name) => `--${namespace.value}-${block}-${name}`;
return {
namespace,
b,
e,
m,
be: be2,
em,
bm,
bem,
is,
cssVar,
cssVarName,
cssVarBlock,
cssVarBlockName
};
};
const useLockscreen = (trigger2, options = {}) => {
if (!isRef(trigger2)) {
throwError("[useLockscreen]", "You need to pass a ref param to this function");
}
const ns = options.ns || useNamespace("popup");
const hiddenCls = computed$1(() => ns.bm("parent", "hidden"));
if (!isClient$1 || hasClass(document.body, hiddenCls.value)) {
return;
}
let scrollBarWidth2 = 0;
let withoutHiddenClass = false;
let bodyWidth = "0";
const cleanup = () => {
setTimeout(() => {
removeClass(document == null ? void 0 : document.body, hiddenCls.value);
if (withoutHiddenClass && document) {
document.body.style.width = bodyWidth;
}
}, 200);
};
watch(trigger2, (val) => {
if (!val) {
cleanup();
return;
}
withoutHiddenClass = !hasClass(document.body, hiddenCls.value);
if (withoutHiddenClass) {
bodyWidth = document.body.style.width;
}
scrollBarWidth2 = getScrollBarWidth(ns.namespace.value);
const bodyHasOverflow = document.documentElement.clientHeight < document.body.scrollHeight;
const bodyOverflowY = getStyle(document.body, "overflowY");
if (scrollBarWidth2 > 0 && (bodyHasOverflow || bodyOverflowY === "scroll") && withoutHiddenClass) {
document.body.style.width = `calc(100% - ${scrollBarWidth2}px)`;
}
addClass(document.body, hiddenCls.value);
});
onScopeDispose(() => cleanup());
};
const _prop = buildProp({
type: definePropType(Boolean),
default: null
});
const _event = buildProp({
type: definePropType(Function)
});
const createModelToggleComposable = (name) => {
const updateEventKey = `update:${name}`;
const updateEventKeyRaw = `onUpdate:${name}`;
const useModelToggleEmits2 = [updateEventKey];
const useModelToggleProps2 = {
[name]: _prop,
[updateEventKeyRaw]: _event
};
const useModelToggle2 = ({
indicator,
toggleReason,
shouldHideWhenRouteChanges,
shouldProceed,
onShow,
onHide
}) => {
const instance = getCurrentInstance();
const { emit: emit2 } = instance;
const props = instance.props;
const hasUpdateHandler = computed(() => isFunction$2(props[updateEventKeyRaw]));
const isModelBindingAbsent = computed(() => props[name] === null);
const doShow = (event) => {
if (indicator.value === true) {
return;
}
indicator.value = true;
if (toggleReason) {
toggleReason.value = event;
}
if (isFunction$2(onShow)) {
onShow(event);
}
};
const doHide = (event) => {
if (indicator.value === false) {
return;
}
indicator.value = false;
if (toggleReason) {
toggleReason.value = event;
}
if (isFunction$2(onHide)) {
onHide(event);
}
};
const show = (event) => {
if (props.disabled === true || isFunction$2(shouldProceed) && !shouldProceed())
return;
const shouldEmit = hasUpdateHandler.value && isClient$1;
if (shouldEmit) {
emit2(updateEventKey, true);
}
if (isModelBindingAbsent.value || !shouldEmit) {
doShow(event);
}
};
const hide = (event) => {
if (props.disabled === true || !isClient$1)
return;
const shouldEmit = hasUpdateHandler.value && isClient$1;
if (shouldEmit) {
emit2(updateEventKey, false);
}
if (isModelBindingAbsent.value || !shouldEmit) {
doHide(event);
}
};
const onChange = (val) => {
if (!isBoolean$1(val))
return;
if (props.disabled && val) {
if (hasUpdateHandler.value) {
emit2(updateEventKey, false);
}
} else if (indicator.value !== val) {
if (val) {
doShow();
} else {
doHide();
}
}
};
const toggle = () => {
if (indicator.value) {
hide();
} else {
show();
}
};
watch(() => props[name], onChange);
if (shouldHideWhenRouteChanges && instance.appContext.config.globalProperties.$route !== void 0) {
watch(() => ({
...instance.proxy.$route
}), () => {
if (shouldHideWhenRouteChanges.value && indicator.value) {
hide();
}
});
}
onMounted(() => {
onChange(props[name]);
});
return {
hide,
show,
toggle,
hasUpdateHandler
};
};
return {
useModelToggle: useModelToggle2,
useModelToggleProps: useModelToggleProps2,
useModelToggleEmits: useModelToggleEmits2
};
};
const useProp = (name) => {
const vm = getCurrentInstance();
return computed(() => {
var _a2, _b;
return (_b = (_a2 = vm == null ? void 0 : vm.proxy) == null ? void 0 : _a2.$props) == null ? void 0 : _b[name];
});
};
var E = "top", R = "bottom", W = "right", P = "left", me = "auto", G = [E, R, W, P], U = "start", J = "end", Xe = "clippingParents", je = "viewport", K = "popper", Ye = "reference", De = G.reduce(function(t2, e) {
return t2.concat([e + "-" + U, e + "-" + J]);
}, []), Ee = [].concat(G, [me]).reduce(function(t2, e) {
return t2.concat([e, e + "-" + U, e + "-" + J]);
}, []), Ge = "beforeRead", Je = "read", Ke = "afterRead", Qe = "beforeMain", Ze = "main", et = "afterMain", tt = "beforeWrite", nt = "write", rt = "afterWrite", ot = [Ge, Je, Ke, Qe, Ze, et, tt, nt, rt];
function C(t2) {
return t2 ? (t2.nodeName || "").toLowerCase() : null;
}
function H(t2) {
if (t2 == null)
return window;
if (t2.toString() !== "[object Window]") {
var e = t2.ownerDocument;
return e && e.defaultView || window;
}
return t2;
}
function Q(t2) {
var e = H(t2).Element;
return t2 instanceof e || t2 instanceof Element;
}
function B(t2) {
var e = H(t2).HTMLElement;
return t2 instanceof e || t2 instanceof HTMLElement;
}
function Pe(t2) {
if (typeof ShadowRoot == "undefined")
return false;
var e = H(t2).ShadowRoot;
return t2 instanceof e || t2 instanceof ShadowRoot;
}
function Mt(t2) {
var e = t2.state;
Object.keys(e.elements).forEach(function(n) {
var r = e.styles[n] || {}, o = e.attributes[n] || {}, i = e.elements[n];
!B(i) || !C(i) || (Object.assign(i.style, r), Object.keys(o).forEach(function(a) {
var s = o[a];
s === false ? i.removeAttribute(a) : i.setAttribute(a, s === true ? "" : s);
}));
});
}
function Rt(t2) {
var e = t2.state, n = { popper: { position: e.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} };
return Object.assign(e.elements.popper.style, n.popper), e.styles = n, e.elements.arrow && Object.assign(e.elements.arrow.style, n.arrow), function() {
Object.keys(e.elements).forEach(function(r) {
var o = e.elements[r], i = e.attributes[r] || {}, a = Object.keys(e.styles.hasOwnProperty(r) ? e.styles[r] : n[r]), s = a.reduce(function(f, c) {
return f[c] = "", f;
}, {});
!B(o) || !C(o) || (Object.assign(o.style, s), Object.keys(i).forEach(function(f) {
o.removeAttribute(f);
}));
});
};
}
var Ae = { name: "applyStyles", enabled: true, phase: "write", fn: Mt, effect: Rt, requires: ["computeStyles"] };
function q(t2) {
return t2.split("-")[0];
}
var X = Math.max, ve = Math.min, Z = Math.round;
function ee(t2, e) {
e === void 0 && (e = false);
var n = t2.getBoundingClientRect(), r = 1, o = 1;
if (B(t2) && e) {
var i = t2.offsetHeight, a = t2.offsetWidth;
a > 0 && (r = Z(n.width) / a || 1), i > 0 && (o = Z(n.height) / i || 1);
}
return { width: n.width / r, height: n.height / o, top: n.top / o, right: n.right / r, bottom: n.bottom / o, left: n.left / r, x: n.left / r, y: n.top / o };
}
function ke(t2) {
var e = ee(t2), n = t2.offsetWidth, r = t2.offsetHeight;
return Math.abs(e.width - n) <= 1 && (n = e.width), Math.abs(e.height - r) <= 1 && (r = e.height), { x: t2.offsetLeft, y: t2.offsetTop, width: n, height: r };
}
function it(t2, e) {
var n = e.getRootNode && e.getRootNode();
if (t2.contains(e))
return true;
if (n && Pe(n)) {
var r = e;
do {
if (r && t2.isSameNode(r))
return true;
r = r.parentNode || r.host;
} while (r);
}
return false;
}
function N(t2) {
return H(t2).getComputedStyle(t2);
}
function Wt(t2) {
return ["table", "td", "th"].indexOf(C(t2)) >= 0;
}
function I(t2) {
return ((Q(t2) ? t2.ownerDocument : t2.document) || window.document).documentElement;
}
function ge(t2) {
return C(t2) === "html" ? t2 : t2.assignedSlot || t2.parentNode || (Pe(t2) ? t2.host : null) || I(t2);
}
function at(t2) {
return !B(t2) || N(t2).position === "fixed" ? null : t2.offsetParent;
}
function Bt(t2) {
var e = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n = navigator.userAgent.indexOf("Trident") !== -1;
if (n && B(t2)) {
var r = N(t2);
if (r.position === "fixed")
return null;
}
var o = ge(t2);
for (Pe(o) && (o = o.host); B(o) && ["html", "body"].indexOf(C(o)) < 0; ) {
var i = N(o);
if (i.transform !== "none" || i.perspective !== "none" || i.contain === "paint" || ["transform", "perspective"].indexOf(i.willChange) !== -1 || e && i.willChange === "filter" || e && i.filter && i.filter !== "none")
return o;
o = o.parentNode;
}
return null;
}
function se(t2) {
for (var e = H(t2), n = at(t2); n && Wt(n) && N(n).position === "static"; )
n = at(n);
return n && (C(n) === "html" || C(n) === "body" && N(n).position === "static") ? e : n || Bt(t2) || e;
}
function Le(t2) {
return ["top", "bottom"].indexOf(t2) >= 0 ? "x" : "y";
}
function fe(t2, e, n) {
return X(t2, ve(e, n));
}
function St(t2, e, n) {
var r = fe(t2, e, n);
return r > n ? n : r;
}
function st() {
return { top: 0, right: 0, bottom: 0, left: 0 };
}
function ft(t2) {
return Object.assign({}, st(), t2);
}
function ct(t2, e) {
return e.reduce(function(n, r) {
return n[r] = t2, n;
}, {});
}
var Tt = function(t2, e) {
return t2 = typeof t2 == "function" ? t2(Object.assign({}, e.rects, { placement: e.placement })) : t2, ft(typeof t2 != "number" ? t2 : ct(t2, G));
};
function Ht(t2) {
var e, n = t2.state, r = t2.name, o = t2.options, i = n.elements.arrow, a = n.modifiersData.popperOffsets, s = q(n.placement), f = Le(s), c = [P, W].indexOf(s) >= 0, u = c ? "height" : "width";
if (!(!i || !a)) {
var m = Tt(o.padding, n), v = ke(i), l = f === "y" ? E : P, h2 = f === "y" ? R : W, p2 = n.rects.reference[u] + n.rects.reference[f] - a[f] - n.rects.popper[u], g = a[f] - n.rects.reference[f], x = se(i), y = x ? f === "y" ? x.clientHeight || 0 : x.clientWidth || 0 : 0, $2 = p2 / 2 - g / 2, d = m[l], b = y - v[u] - m[h2], w = y / 2 - v[u] / 2 + $2, O = fe(d, w, b), j = f;
n.modifiersData[r] = (e = {}, e[j] = O, e.centerOffset = O - w, e);
}
}
function Ct(t2) {
var e = t2.state, n = t2.options, r = n.element, o = r === void 0 ? "[data-popper-arrow]" : r;
o != null && (typeof o == "string" && (o = e.elements.popper.querySelector(o), !o) || !it(e.elements.popper, o) || (e.elements.arrow = o));
}
var pt = { name: "arrow", enabled: true, phase: "main", fn: Ht, effect: Ct, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] };
function te(t2) {
return t2.split("-")[1];
}
var qt = { top: "auto", right: "auto", bottom: "auto", left: "auto" };
function Vt(t2) {
var e = t2.x, n = t2.y, r = window, o = r.devicePixelRatio || 1;
return { x: Z(e * o) / o || 0, y: Z(n * o) / o || 0 };
}
function ut(t2) {
var e, n = t2.popper, r = t2.popperRect, o = t2.placement, i = t2.variation, a = t2.offsets, s = t2.position, f = t2.gpuAcceleration, c = t2.adaptive, u = t2.roundOffsets, m = t2.isFixed, v = a.x, l = v === void 0 ? 0 : v, h2 = a.y, p2 = h2 === void 0 ? 0 : h2, g = typeof u == "function" ? u({ x: l, y: p2 }) : { x: l, y: p2 };
l = g.x, p2 = g.y;
var x = a.hasOwnProperty("x"), y = a.hasOwnProperty("y"), $2 = P, d = E, b = window;
if (c) {
var w = se(n), O = "clientHeight", j = "clientWidth";
if (w === H(n) && (w = I(n), N(w).position !== "static" && s === "absolute" && (O = "scrollHeight", j = "scrollWidth")), w = w, o === E || (o === P || o === W) && i === J) {
d = R;
var A = m && w === b && b.visualViewport ? b.visualViewport.height : w[O];
p2 -= A - r.height, p2 *= f ? 1 : -1;
}
if (o === P || (o === E || o === R) && i === J) {
$2 = W;
var k = m && w === b && b.visualViewport ? b.visualViewport.width : w[j];
l -= k - r.width, l *= f ? 1 : -1;
}
}
var D = Object.assign({ position: s }, c && qt), S = u === true ? Vt({ x: l, y: p2 }) : { x: l, y: p2 };
if (l = S.x, p2 = S.y, f) {
var L;
return Object.assign({}, D, (L = {}, L[d] = y ? "0" : "", L[$2] = x ? "0" : "", L.transform = (b.devicePixelRatio || 1) <= 1 ? "translate(" + l + "px, " + p2 + "px)" : "translate3d(" + l + "px, " + p2 + "px, 0)", L));
}
return Object.assign({}, D, (e = {}, e[d] = y ? p2 + "px" : "", e[$2] = x ? l + "px" : "", e.transform = "", e));
}
function Nt(t2) {
var e = t2.state, n = t2.options, r = n.gpuAcceleration, o = r === void 0 ? true : r, i = n.adaptive, a = i === void 0 ? true : i, s = n.roundOffsets, f = s === void 0 ? true : s, c = { placement: q(e.placement), variation: te(e.placement), popper: e.elements.popper, popperRect: e.rects.popper, gpuAcceleration: o, isFixed: e.options.strategy === "fixed" };
e.modifiersData.popperOffsets != null && (e.styles.popper = Object.assign({}, e.styles.popper, ut(Object.assign({}, c, { offsets: e.modifiersData.popperOffsets, position: e.options.strategy, adaptive: a, roundOffsets: f })))), e.modifiersData.arrow != null && (e.styles.arrow = Object.assign({}, e.styles.arrow, ut(Object.assign({}, c, { offsets: e.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: f })))), e.attributes.popper = Object.assign({}, e.attributes.popper, { "data-popper-placement": e.placement });
}
var Me = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: Nt, data: {} }, ye = { passive: true };
function It(t2) {
var e = t2.state, n = t2.instance, r = t2.options, o = r.scroll, i = o === void 0 ? true : o, a = r.resize, s = a === void 0 ? true : a, f = H(e.elements.popper), c = [].concat(e.scrollParents.reference, e.scrollParents.popper);
return i && c.forEach(function(u) {
u.addEventListener("scroll", n.update, ye);
}), s && f.addEventListener("resize", n.update, ye), function() {
i && c.forEach(function(u) {
u.removeEventListener("scroll", n.update, ye);
}), s && f.removeEventListener("resize", n.update, ye);
};
}
var Re = { name: "eventListeners", enabled: true, phase: "write", fn: function() {
}, effect: It, data: {} }, _t = { left: "right", right: "left", bottom: "top", top: "bottom" };
function be(t2) {
return t2.replace(/left|right|bottom|top/g, function(e) {
return _t[e];
});
}
var zt = { start: "end", end: "start" };
function lt(t2) {
return t2.replace(/start|end/g, function(e) {
return zt[e];
});
}
function We(t2) {
var e = H(t2), n = e.pageXOffset, r = e.pageYOffset;
return { scrollLeft: n, scrollTop: r };
}
function Be(t2) {
return ee(I(t2)).left + We(t2).scrollLeft;
}
function Ft(t2) {
var e = H(t2), n = I(t2), r = e.visualViewport, o = n.clientWidth, i = n.clientHeight, a = 0, s = 0;
return r && (o = r.width, i = r.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (a = r.offsetLeft, s = r.offsetTop)), { width: o, height: i, x: a + Be(t2), y: s };
}
function Ut(t2) {
var e, n = I(t2), r = We(t2), o = (e = t2.ownerDocument) == null ? void 0 : e.body, i = X(n.scrollWidth, n.clientWidth, o ? o.scrollWidth : 0, o ? o.clientWidth : 0), a = X(n.scrollHeight, n.clientHeight, o ? o.scrollHeight : 0, o ? o.clientHeight : 0), s = -r.scrollLeft + Be(t2), f = -r.scrollTop;
return N(o || n).direction === "rtl" && (s += X(n.clientWidth, o ? o.clientWidth : 0) - i), { width: i, height: a, x: s, y: f };
}
function Se(t2) {
var e = N(t2), n = e.overflow, r = e.overflowX, o = e.overflowY;
return /auto|scroll|overlay|hidden/.test(n + o + r);
}
function dt(t2) {
return ["html", "body", "#document"].indexOf(C(t2)) >= 0 ? t2.ownerDocument.body : B(t2) && Se(t2) ? t2 : dt(ge(t2));
}
function ce(t2, e) {
var n;
e === void 0 && (e = []);
var r = dt(t2), o = r === ((n = t2.ownerDocument) == null ? void 0 : n.body), i = H(r), a = o ? [i].concat(i.visualViewport || [], Se(r) ? r : []) : r, s = e.concat(a);
return o ? s : s.concat(ce(ge(a)));
}
function Te(t2) {
return Object.assign({}, t2, { left: t2.x, top: t2.y, right: t2.x + t2.width, bottom: t2.y + t2.height });
}
function Xt(t2) {
var e = ee(t2);
return e.top = e.top + t2.clientTop, e.left = e.left + t2.clientLeft, e.bottom = e.top + t2.clientHeight, e.right = e.left + t2.clientWidth, e.width = t2.clientWidth, e.height = t2.clientHeight, e.x = e.left, e.y = e.top, e;
}
function ht(t2, e) {
return e === je ? Te(Ft(t2)) : Q(e) ? Xt(e) : Te(Ut(I(t2)));
}
function Yt(t2) {
var e = ce(ge(t2)), n = ["absolute", "fixed"].indexOf(N(t2).position) >= 0, r = n && B(t2) ? se(t2) : t2;
return Q(r) ? e.filter(function(o) {
return Q(o) && it(o, r) && C(o) !== "body";
}) : [];
}
function Gt(t2, e, n) {
var r = e === "clippingParents" ? Yt(t2) : [].concat(e), o = [].concat(r, [n]), i = o[0], a = o.reduce(function(s, f) {
var c = ht(t2, f);
return s.top = X(c.top, s.top), s.right = ve(c.right, s.right), s.bottom = ve(c.bottom, s.bottom), s.left = X(c.left, s.left), s;
}, ht(t2, i));
return a.width = a.right - a.left, a.height = a.bottom - a.top, a.x = a.left, a.y = a.top, a;
}
function mt(t2) {
var e = t2.reference, n = t2.element, r = t2.placement, o = r ? q(r) : null, i = r ? te(r) : null, a = e.x + e.width / 2 - n.width / 2, s = e.y + e.height / 2 - n.height / 2, f;
switch (o) {
case E:
f = { x: a, y: e.y - n.height };
break;
case R:
f = { x: a, y: e.y + e.height };
break;
case W:
f = { x: e.x + e.width, y: s };
break;
case P:
f = { x: e.x - n.width, y: s };
break;
default:
f = { x: e.x, y: e.y };
}
var c = o ? Le(o) : null;
if (c != null) {
var u = c === "y" ? "height" : "width";
switch (i) {
case U:
f[c] = f[c] - (e[u] / 2 - n[u] / 2);
break;
case J:
f[c] = f[c] + (e[u] / 2 - n[u] / 2);
break;
}
}
return f;
}
function ne(t2, e) {
e === void 0 && (e = {});
var n = e, r = n.placement, o = r === void 0 ? t2.placement : r, i = n.boundary, a = i === void 0 ? Xe : i, s = n.rootBoundary, f = s === void 0 ? je : s, c = n.elementContext, u = c === void 0 ? K : c, m = n.altBoundary, v = m === void 0 ? false : m, l = n.padding, h2 = l === void 0 ? 0 : l, p2 = ft(typeof h2 != "number" ? h2 : ct(h2, G)), g = u === K ? Ye : K, x = t2.rects.popper, y = t2.elements[v ? g : u], $2 = Gt(Q(y) ? y : y.contextElement || I(t2.elements.popper), a, f), d = ee(t2.elements.reference), b = mt({ reference: d, element: x, strategy: "absolute", placement: o }), w = Te(Object.assign({}, x, b)), O = u === K ? w : d, j = { top: $2.top - O.top + p2.top, bottom: O.bottom - $2.bottom + p2.bottom, left: $2.left - O.left + p2.left, right: O.right - $2.right + p2.right }, A = t2.modifiersData.offset;
if (u === K && A) {
var k = A[o];
Object.keys(j).forEach(function(D) {
var S = [W, R].indexOf(D) >= 0 ? 1 : -1, L = [E, R].indexOf(D) >= 0 ? "y" : "x";
j[D] += k[L] * S;
});
}
return j;
}
function Jt(t2, e) {
e === void 0 && (e = {});
var n = e, r = n.placement, o = n.boundary, i = n.rootBoundary, a = n.padding, s = n.flipVariations, f = n.allowedAutoPlacements, c = f === void 0 ? Ee : f, u = te(r), m = u ? s ? De : De.filter(function(h2) {
return te(h2) === u;
}) : G, v = m.filter(function(h2) {
return c.indexOf(h2) >= 0;
});
v.length === 0 && (v = m);
var l = v.reduce(function(h2, p2) {
return h2[p2] = ne(t2, { placement: p2, boundary: o, rootBoundary: i, padding: a })[q(p2)], h2;
}, {});
return Object.keys(l).sort(function(h2, p2) {
return l[h2] - l[p2];
});
}
function Kt(t2) {
if (q(t2) === me)
return [];
var e = be(t2);
return [lt(t2), e, lt(e)];
}
function Qt(t2) {
var e = t2.state, n = t2.options, r = t2.name;
if (!e.modifiersData[r]._skip) {
for (var o = n.mainAxis, i = o === void 0 ? true : o, a = n.altAxis, s = a === void 0 ? true : a, f = n.fallbackPlacements, c = n.padding, u = n.boundary, m = n.rootBoundary, v = n.altBoundary, l = n.flipVariations, h2 = l === void 0 ? true : l, p2 = n.allowedAutoPlacements, g = e.options.placement, x = q(g), y = x === g, $2 = f || (y || !h2 ? [be(g)] : Kt(g)), d = [g].concat($2).reduce(function(z, V) {
return z.concat(q(V) === me ? Jt(e, { placement: V, boundary: u, rootBoundary: m, padding: c, flipVariations: h2, allowedAutoPlacements: p2 }) : V);
}, []), b = e.rects.reference, w = e.rects.popper, O = /* @__PURE__ */ new Map(), j = true, A = d[0], k = 0; k < d.length; k++) {
var D = d[k], S = q(D), L = te(D) === U, re = [E, R].indexOf(S) >= 0, oe = re ? "width" : "height", M = ne(e, { placement: D, boundary: u, rootBoundary: m, altBoundary: v, padding: c }), T = re ? L ? W : P : L ? R : E;
b[oe] > w[oe] && (T = be(T));
var pe = be(T), _ = [];
if (i && _.push(M[S] <= 0), s && _.push(M[T] <= 0, M[pe] <= 0), _.every(function(z) {
return z;
})) {
A = D, j = false;
break;
}
O.set(D, _);
}
if (j)
for (var ue = h2 ? 3 : 1, xe = function(z) {
var V = d.find(function(de) {
var ae = O.get(de);
if (ae)
return ae.slice(0, z).every(function(Y) {
return Y;
});
});
if (V)
return A = V, "break";
}, ie = ue; ie > 0; ie--) {
var le = xe(ie);
if (le === "break")
break;
}
e.placement !== A && (e.modifiersData[r]._skip = true, e.placement = A, e.reset = true);
}
}
var vt = { name: "flip", enabled: true, phase: "main", fn: Qt, requiresIfExists: ["offset"], data: { _skip: false } };
function gt(t2, e, n) {
return n === void 0 && (n = { x: 0, y: 0 }), { top: t2.top - e.height - n.y, right: t2.right - e.width + n.x, bottom: t2.bottom - e.height + n.y, left: t2.left - e.width - n.x };
}
function yt(t2) {
return [E, W, R, P].some(function(e) {
return t2[e] >= 0;
});
}
function Zt(t2) {
var e = t2.state, n = t2.name, r = e.rects.reference, o = e.rects.popper, i = e.modifiersData.preventOverflow, a = ne(e, { elementContext: "reference" }), s = ne(e, { altBoundary: true }), f = gt(a, r), c = gt(s, o, i), u = yt(f), m = yt(c);
e.modifiersData[n] = { referenceClippingOffsets: f, popperEscapeOffsets: c, isReferenceHidden: u, hasPopperEscaped: m }, e.attributes.popper = Object.assign({}, e.attributes.popper, { "data-popper-reference-hidden": u, "data-popper-escaped": m });
}
var bt = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Zt };
function en$1(t2, e, n) {
var r = q(t2), o = [P, E].indexOf(r) >= 0 ? -1 : 1, i = typeof n == "function" ? n(Object.assign({}, e, { placement: t2 })) : n, a = i[0], s = i[1];
return a = a || 0, s = (s || 0) * o, [P, W].indexOf(r) >= 0 ? { x: s, y: a } : { x: a, y: s };
}
function tn(t2) {
var e = t2.state, n = t2.options, r = t2.name, o = n.offset, i = o === void 0 ? [0, 0] : o, a = Ee.reduce(function(u, m) {
return u[m] = en$1(m, e.rects, i), u;
}, {}), s = a[e.placement], f = s.x, c = s.y;
e.modifiersData.popperOffsets != null && (e.modifiersData.popperOffsets.x += f, e.modifiersData.popperOffsets.y += c), e.modifiersData[r] = a;
}
var wt = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: tn };
function nn(t2) {
var e = t2.state, n = t2.name;
e.modifiersData[n] = mt({ reference: e.rects.reference, element: e.rects.popper, strategy: "absolute", placement: e.placement });
}
var He = { name: "popperOffsets", enabled: true, phase: "read", fn: nn, data: {} };
function rn(t2) {
return t2 === "x" ? "y" : "x";
}
function on(t2) {
var e = t2.state, n = t2.options, r = t2.name, o = n.mainAxis, i = o === void 0 ? true : o, a = n.altAxis, s = a === void 0 ? false : a, f = n.boundary, c = n.rootBoundary, u = n.altBoundary, m = n.padding, v = n.tether, l = v === void 0 ? true : v, h2 = n.tetherOffset, p2 = h2 === void 0 ? 0 : h2, g = ne(e, { boundary: f, rootBoundary: c, padding: m, altBoundary: u }), x = q(e.placement), y = te(e.placement), $2 = !y, d = Le(x), b = rn(d), w = e.modifiersData.popperOffsets, O = e.rects.reference, j = e.rects.popper, A = typeof p2 == "function" ? p2(Object.assign({}, e.rects, { placement: e.placement })) : p2, k = typeof A == "number" ? { mainAxis: A, altAxis: A } : Object.assign({ mainAxis: 0, altAxis: 0 }, A), D = e.modifiersData.offset ? e.modifiersData.offset[e.placement] : null, S = { x: 0, y: 0 };
if (w) {
if (i) {
var L, re = d === "y" ? E : P, oe = d === "y" ? R : W, M = d === "y" ? "height" : "width", T = w[d], pe = T + g[re], _ = T - g[oe], ue = l ? -j[M] / 2 : 0, xe = y === U ? O[M] : j[M], ie = y === U ? -j[M] : -O[M], le = e.elements.arrow, z = l && le ? ke(le) : { width: 0, height: 0 }, V = e.modifiersData["arrow#persistent"] ? e.modifiersData["arrow#persistent"].padding : st(), de = V[re], ae = V[oe], Y = fe(0, O[M], z[M]), jt = $2 ? O[M] / 2 - ue - Y - de - k.mainAxis : xe - Y - de - k.mainAxis, Dt = $2 ? -O[M] / 2 + ue + Y + ae + k.mainAxis : ie + Y + ae + k.mainAxis, Oe = e.elements.arrow && se(e.elements.arrow), Et = Oe ? d === "y" ? Oe.clientTop || 0 : Oe.clientLeft || 0 : 0, Ce = (L = D == null ? void 0 : D[d]) != null ? L : 0, Pt = T + jt - Ce - Et, At = T + Dt - Ce, qe = fe(l ? ve(pe, Pt) : pe, T, l ? X(_, At) : _);
w[d] = qe, S[d] = qe - T;
}
if (s) {
var Ve, kt = d === "x" ? E : P, Lt = d === "x" ? R : W, F = w[b], he = b === "y" ? "height" : "width", Ne = F + g[kt], Ie = F - g[Lt], $e = [E, P].indexOf(x) !== -1, _e = (Ve = D == null ? void 0 : D[b]) != null ? Ve : 0, ze = $e ? Ne : F - O[he] - j[he] - _e + k.altAxis, Fe = $e ? F + O[he] + j[he] - _e - k.altAxis : Ie, Ue = l && $e ? St(ze, F, Fe) : fe(l ? ze : Ne, F, l ? Fe : Ie);
w[b] = Ue, S[b] = Ue - F;
}
e.modifiersData[r] = S;
}
}
var xt = { name: "preventOverflow", enabled: true, phase: "main", fn: on, requiresIfExists: ["offset"] };
function an(t2) {
return { scrollLeft: t2.scrollLeft, scrollTop: t2.scrollTop };
}
function sn(t2) {
return t2 === H(t2) || !B(t2) ? We(t2) : an(t2);
}
function fn(t2) {
var e = t2.getBoundingClientRect(), n = Z(e.width) / t2.offsetWidth || 1, r = Z(e.height) / t2.offsetHeight || 1;
return n !== 1 || r !== 1;
}
function cn(t2, e, n) {
n === void 0 && (n = false);
var r = B(e), o = B(e) && fn(e), i = I(e), a = ee(t2, o), s = { scrollLeft: 0, scrollTop: 0 }, f = { x: 0, y: 0 };
return (r || !r && !n) && ((C(e) !== "body" || Se(i)) && (s = sn(e)), B(e) ? (f = ee(e, true), f.x += e.clientLeft, f.y += e.clientTop) : i && (f.x = Be(i))), { x: a.left + s.scrollLeft - f.x, y: a.top + s.scrollTop - f.y, width: a.width, height: a.height };
}
function pn(t2) {
var e = /* @__PURE__ */ new Map(), n = /* @__PURE__ */ new Set(), r = [];
t2.forEach(function(i) {
e.set(i.name, i);
});
function o(i) {
n.add(i.name);
var a = [].concat(i.requires || [], i.requiresIfExists || []);
a.forEach(function(s) {
if (!n.has(s)) {
var f = e.get(s);
f && o(f);
}
}), r.push(i);
}
return t2.forEach(function(i) {
n.has(i.name) || o(i);
}), r;
}
function un(t2) {
var e = pn(t2);
return ot.reduce(function(n, r) {
return n.concat(e.filter(function(o) {
return o.phase === r;
}));
}, []);
}
function ln(t2) {
var e;
return function() {
return e || (e = new Promise(function(n) {
Promise.resolve().then(function() {
e = void 0, n(t2());
});
})), e;
};
}
function dn(t2) {
var e = t2.reduce(function(n, r) {
var o = n[r.name];
return n[r.name] = o ? Object.assign({}, o, r, { options: Object.assign({}, o.options, r.options), data: Object.assign({}, o.data, r.data) }) : r, n;
}, {});
return Object.keys(e).map(function(n) {
return e[n];
});
}
var Ot = { placement: "bottom", modifiers: [], strategy: "absolute" };
function $t() {
for (var t2 = arguments.length, e = new Array(t2), n = 0; n < t2; n++)
e[n] = arguments[n];
return !e.some(function(r) {
return !(r && typeof r.getBoundingClientRect == "function");
});
}
function we(t2) {
t2 === void 0 && (t2 = {});
var e = t2, n = e.defaultModifiers, r = n === void 0 ? [] : n, o = e.defaultOptions, i = o === void 0 ? Ot : o;
return function(a, s, f) {
f === void 0 && (f = i);
var c = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, Ot, i), modifiersData: {}, elements: { reference: a, popper: s }, attributes: {}, styles: {} }, u = [], m = false, v = { state: c, setOptions: function(p2) {
var g = typeof p2 == "function" ? p2(c.options) : p2;
h2(), c.options = Object.assign({}, i, c.options, g), c.scrollParents = { reference: Q(a) ? ce(a) : a.contextElement ? ce(a.contextElement) : [], popper: ce(s) };
var x = un(dn([].concat(r, c.options.modifiers)));
return c.orderedModifiers = x.filter(function(y) {
return y.enabled;
}), l(), v.update();
}, forceUpdate: function() {
if (!m) {
var p2 = c.elements, g = p2.reference, x = p2.popper;
if ($t(g, x)) {
c.rects = { reference: cn(g, se(x), c.options.strategy === "fixed"), popper: ke(x) }, c.reset = false, c.placement = c.options.placement, c.orderedModifiers.forEach(function(j) {
return c.modifiersData[j.name] = Object.assign({}, j.data);
});
for (var y = 0; y < c.orderedModifiers.length; y++) {
if (c.reset === true) {
c.reset = false, y = -1;
continue;
}
var $2 = c.orderedModifiers[y], d = $2.fn, b = $2.options, w = b === void 0 ? {} : b, O = $2.name;
typeof d == "function" && (c = d({ state: c, options: w, name: O, instance: v }) || c);
}
}
}
}, update: ln(function() {
return new Promise(function(p2) {
v.forceUpdate(), p2(c);
});
}), destroy: function() {
h2(), m = true;
} };
if (!$t(a, s))
return v;
v.setOptions(f).then(function(p2) {
!m && f.onFirstUpdate && f.onFirstUpdate(p2);
});
function l() {
c.orderedModifiers.forEach(function(p2) {
var g = p2.name, x = p2.options, y = x === void 0 ? {} : x, $2 = p2.effect;
if (typeof $2 == "function") {
var d = $2({ state: c, name: g, instance: v, options: y }), b = function() {
};
u.push(d || b);
}
});
}
function h2() {
u.forEach(function(p2) {
return p2();
}), u = [];
}
return v;
};
}
we();
var mn = [Re, He, Me, Ae];
we({ defaultModifiers: mn });
var gn = [Re, He, Me, Ae, wt, vt, xt, pt, bt], yn = we({ defaultModifiers: gn });
const usePopper = (referenceElementRef, popperElementRef, opts = {}) => {
const stateUpdater = {
name: "updateState",
enabled: true,
phase: "write",
fn: ({ state }) => {
const derivedState = deriveState(state);
Object.assign(states.value, derivedState);
},
requires: ["computeStyles"]
};
const options = computed(() => {
const { onFirstUpdate, placement, strategy, modifiers } = unref(opts);
return {
onFirstUpdate,
placement: placement || "bottom",
strategy: strategy || "absolute",
modifiers: [
...modifiers || [],
stateUpdater,
{ name: "applyStyles", enabled: false }
]
};
});
const instanceRef = shallowRef();
const states = ref({
styles: {
popper: {
position: unref(options).strategy,
left: "0",
top: "0"
},
arrow: {
position: "absolute"
}
},
attributes: {}
});
const destroy = () => {
if (!instanceRef.value)
return;
instanceRef.value.destroy();
instanceRef.value = void 0;
};
watch(options, (newOptions) => {
const instance = unref(instanceRef);
if (instance) {
instance.setOptions(newOptions);
}
}, {
deep: true
});
watch([referenceElementRef, popperElementRef], ([referenceElement, popperElement]) => {
destroy();
if (!referenceElement || !popperElement)
return;
instanceRef.value = yn(referenceElement, popperElement, unref(options));
});
onBeforeUnmount(() => {
destroy();
});
return {
state: computed(() => {
var _a2;
return { ...((_a2 = unref(instanceRef)) == null ? void 0 : _a2.state) || {} };
}),
styles: computed(() => unref(states).styles),
attributes: computed(() => unref(states).attributes),
update: () => {
var _a2;
return (_a2 = unref(instanceRef)) == null ? void 0 : _a2.update();
},
forceUpdate: () => {
var _a2;
return (_a2 = unref(instanceRef)) == null ? void 0 : _a2.forceUpdate();
},
instanceRef: computed(() => unref(instanceRef))
};
};
function deriveState(state) {
const elements = Object.keys(state.elements);
const styles = fromPairs(elements.map((element) => [element, state.styles[element] || {}]));
const attributes = fromPairs(elements.map((element) => [element, state.attributes[element]]));
return {
styles,
attributes
};
}
const useSameTarget = (handleClick) => {
if (!handleClick) {
return { onClick: NOOP, onMousedown: NOOP, onMouseup: NOOP };
}
let mousedownTarget = false;
let mouseupTarget = false;
const onClick = (e) => {
if (mousedownTarget && mouseupTarget) {
handleClick(e);
}
mousedownTarget = mouseupTarget = false;
};
const onMousedown = (e) => {
mousedownTarget = e.target === e.currentTarget;
};
const onMouseup = (e) => {
mouseupTarget = e.target === e.currentTarget;
};
return { onClick, onMousedown, onMouseup };
};
function useTimeout() {
let timeoutHandle;
const registerTimeout = (fn2, delay) => {
cancelTimeout();
timeoutHandle = window.setTimeout(fn2, delay);
};
const cancelTimeout = () => window.clearTimeout(timeoutHandle);
tryOnScopeDispose$1(() => cancelTimeout());
return {
registerTimeout,
cancelTimeout
};
}
const defaultIdInjection = {
prefix: Math.floor(Math.random() * 1e4),
current: 0
};
const ID_INJECTION_KEY = Symbol("elIdInjection");
const useIdInjection = () => {
return getCurrentInstance() ? inject(ID_INJECTION_KEY, defaultIdInjection) : defaultIdInjection;
};
const useId = (deterministicId) => {
const idInjection = useIdInjection();
const namespace = useGetDerivedNamespace();
const idRef = computed(() => unref(deterministicId) || `${namespace.value}-id-${idInjection.prefix}-${idInjection.current++}`);
return idRef;
};
let registeredEscapeHandlers = [];
const cachedHandler = (e) => {
const event = e;
if (event.key === EVENT_CODE.esc) {
registeredEscapeHandlers.forEach((registeredHandler) => registeredHandler(event));
}
};
const useEscapeKeydown = (handler) => {
onMounted(() => {
if (registeredEscapeHandlers.length === 0) {
document.addEventListener("keydown", cachedHandler);
}
if (isClient$1)
registeredEscapeHandlers.push(handler);
});
onBeforeUnmount(() => {
registeredEscapeHandlers = registeredEscapeHandlers.filter((registeredHandler) => registeredHandler !== handler);
if (registeredEscapeHandlers.length === 0) {
if (isClient$1)
document.removeEventListener("keydown", cachedHandler);
}
});
};
let cachedContainer;
const usePopperContainerId = () => {
const namespace = useGetDerivedNamespace();
const idInjection = useIdInjection();
const id = computed(() => {
return `${namespace.value}-popper-container-${idInjection.prefix}`;
});
const selector = computed(() => `#${id.value}`);
return {
id,
selector
};
};
const createContainer = (id) => {
const container = document.createElement("div");
container.id = id;
document.body.appendChild(container);
return container;
};
const usePopperContainer = () => {
const { id, selector } = usePopperContainerId();
onBeforeMount(() => {
if (!isClient$1)
return;
if (!cachedContainer && !document.body.querySelector(selector.value)) {
cachedContainer = createContainer(id.value);
}
});
return {
id,
selector
};
};
const useDelayedToggleProps = buildProps({
showAfter: {
type: Number,
default: 0
},
hideAfter: {
type: Number,
default: 200
},
autoClose: {
type: Number,
default: 0
}
});
const useDelayedToggle = ({
showAfter,
hideAfter,
autoClose,
open: open2,
close
}) => {
const { registerTimeout } = useTimeout();
const {
registerTimeout: registerTimeoutForAutoClose,
cancelTimeout: cancelTimeoutForAutoClose
} = useTimeout();
const onOpen = (event) => {
registerTimeout(() => {
open2(event);
const _autoClose = unref(autoClose);
if (isNumber$1(_autoClose) && _autoClose > 0) {
registerTimeoutForAutoClose(() => {
close(event);
}, _autoClose);
}
}, unref(showAfter));
};
const onClose = (event) => {
cancelTimeoutForAutoClose();
registerTimeout(() => {
close(event);
}, unref(hideAfter));
};
return {
onOpen,
onClose
};
};
const FORWARD_REF_INJECTION_KEY = Symbol("elForwardRef");
const useForwardRef = (forwardRef) => {
const setForwardRef = (el) => {
forwardRef.value = el;
};
provide(FORWARD_REF_INJECTION_KEY, {
setForwardRef
});
};
const useForwardRefDirective = (setForwardRef) => {
return {
mounted(el) {
setForwardRef(el);
},
updated(el) {
setForwardRef(el);
},
unmounted() {
setForwardRef(null);
}
};
};
const zIndex = ref(0);
const defaultInitialZIndex = 2e3;
const zIndexContextKey = Symbol("zIndexContextKey");
const useZIndex = (zIndexOverrides) => {
const zIndexInjection = zIndexOverrides || inject(zIndexContextKey, void 0);
const initialZIndex = computed(() => {
const zIndexFromInjection = unref(zIndexInjection);
return isNumber$1(zIndexFromInjection) ? zIndexFromInjection : defaultInitialZIndex;
});
const currentZIndex = computed(() => initialZIndex.value + zIndex.value);
const nextZIndex = () => {
zIndex.value++;
return currentZIndex.value;
};
return {
initialZIndex,
currentZIndex,
nextZIndex
};
};
function useCursor(input) {
const selectionRef = ref();
function recordCursor() {
if (input.value == void 0)
return;
const { selectionStart, selectionEnd, value } = input.value;
if (selectionStart == null || selectionEnd == null)
return;
const beforeTxt = value.slice(0, Math.max(0, selectionStart));
const afterTxt = value.slice(Math.max(0, selectionEnd));
selectionRef.value = {
selectionStart,
selectionEnd,
value,
beforeTxt,
afterTxt
};
}
function setCursor() {
if (input.value == void 0 || selectionRef.value == void 0)
return;
const { value } = input.value;
const { beforeTxt, afterTxt, selectionStart } = selectionRef.value;
if (beforeTxt == void 0 || afterTxt == void 0 || selectionStart == void 0)
return;
let startPos = value.length;
if (value.endsWith(afterTxt)) {
startPos = value.length - afterTxt.length;
} else if (value.startsWith(beforeTxt)) {
startPos = beforeTxt.length;
} else {
const beforeLastChar = beforeTxt[selectionStart - 1];
const newIndex = value.indexOf(beforeLastChar, selectionStart - 1);
if (newIndex !== -1) {
startPos = newIndex + 1;
}
}
input.value.setSelectionRange(startPos, startPos);
}
return [recordCursor, setCursor];
}
const useSizeProp = buildProp({
type: String,
values: componentSizes,
required: false
});
const SIZE_INJECTION_KEY = Symbol("size");
const useGlobalSize = () => {
const injectedSize = inject(SIZE_INJECTION_KEY, {});
return computed(() => {
return unref(injectedSize.size) || "";
});
};
const configProviderContextKey = Symbol();
const globalConfig = ref();
function useGlobalConfig(key, defaultValue = void 0) {
const config = getCurrentInstance() ? inject(configProviderContextKey, globalConfig) : globalConfig;
if (key) {
return computed(() => {
var _a2, _b;
return (_b = (_a2 = config.value) == null ? void 0 : _a2[key]) != null ? _b : defaultValue;
});
} else {
return config;
}
}
function useGlobalComponentSettings(block, sizeFallback) {
const config = useGlobalConfig();
const ns = useNamespace(block, computed(() => {
var _a2;
return ((_a2 = config.value) == null ? void 0 : _a2.namespace) || defaultNamespace;
}));
const locale = useLocale(computed(() => {
var _a2;
return (_a2 = config.value) == null ? void 0 : _a2.locale;
}));
const zIndex2 = useZIndex(computed(() => {
var _a2;
return ((_a2 = config.value) == null ? void 0 : _a2.zIndex) || defaultInitialZIndex;
}));
const size2 = computed(() => {
var _a2;
return unref(sizeFallback) || ((_a2 = config.value) == null ? void 0 : _a2.size) || "";
});
provideGlobalConfig(computed(() => unref(config) || {}));
return {
ns,
locale,
zIndex: zIndex2,
size: size2
};
}
const provideGlobalConfig = (config, app, global2 = false) => {
var _a2;
const inSetup = !!getCurrentInstance();
const oldConfig = inSetup ? useGlobalConfig() : void 0;
const provideFn = (_a2 = app == null ? void 0 : app.provide) != null ? _a2 : inSetup ? provide : void 0;
if (!provideFn) {
return;
}
const context = computed(() => {
const cfg = unref(config);
if (!(oldConfig == null ? void 0 : oldConfig.value))
return cfg;
return mergeConfig(oldConfig.value, cfg);
});
provideFn(configProviderContextKey, context);
provideFn(localeContextKey, computed(() => context.value.locale));
provideFn(namespaceContextKey, computed(() => context.value.namespace));
provideFn(zIndexContextKey, computed(() => context.value.zIndex));
provideFn(SIZE_INJECTION_KEY, {
size: computed(() => context.value.size || "")
});
if (global2 || !globalConfig.value) {
globalConfig.value = context.value;
}
return context;
};
const mergeConfig = (a, b) => {
var _a2;
const keys2 = [.../* @__PURE__ */ new Set([...keysOf(a), ...keysOf(b)])];
const obj = {};
for (const key of keys2) {
obj[key] = (_a2 = b[key]) != null ? _a2 : a[key];
}
return obj;
};
const configProviderProps = buildProps({
a11y: {
type: Boolean,
default: true
},
locale: {
type: definePropType(Object)
},
size: useSizeProp,
button: {
type: definePropType(Object)
},
experimentalFeatures: {
type: definePropType(Object)
},
keyboardNavigation: {
type: Boolean,
default: true
},
message: {
type: definePropType(Object)
},
zIndex: Number,
namespace: {
type: String,
default: "el"
}
});
const messageConfig = {};
defineComponent({
name: "ElConfigProvider",
props: configProviderProps,
setup(props, { slots }) {
watch(() => props.message, (val) => {
Object.assign(messageConfig, val != null ? val : {});
}, { immediate: true, deep: true });
const config = provideGlobalConfig(props);
return () => renderSlot(slots, "default", { config: config == null ? void 0 : config.value });
}
});
var _export_sfc = (sfc, props) => {
const target = sfc.__vccOpts || sfc;
for (const [key, val] of props) {
target[key] = val;
}
return target;
};
const iconProps = buildProps({
size: {
type: definePropType([Number, String])
},
color: {
type: String
}
});
const __default__$r = defineComponent({
name: "ElIcon",
inheritAttrs: false
});
const _sfc_main$A = /* @__PURE__ */ defineComponent({
...__default__$r,
props: iconProps,
setup(__props) {
const props = __props;
const ns = useNamespace("icon");
const style = computed(() => {
const { size: size2, color } = props;
if (!size2 && !color)
return {};
return {
fontSize: isUndefined(size2) ? void 0 : addUnit(size2),
"--color": color
};
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("i", mergeProps({
class: unref(ns).b(),
style: unref(style)
}, _ctx.$attrs), [
renderSlot(_ctx.$slots, "default")
], 16);
};
}
});
var Icon = /* @__PURE__ */ _export_sfc(_sfc_main$A, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/icon/src/icon.vue"]]);
const ElIcon = withInstall(Icon);
const formContextKey = Symbol("formContextKey");
const formItemContextKey = Symbol("formItemContextKey");
const useFormSize = (fallback, ignore = {}) => {
const emptyRef = ref(void 0);
const size2 = ignore.prop ? emptyRef : useProp("size");
const globalConfig2 = ignore.global ? emptyRef : useGlobalSize();
const form = ignore.form ? { size: void 0 } : inject(formContextKey, void 0);
const formItem = ignore.formItem ? { size: void 0 } : inject(formItemContextKey, void 0);
return computed(() => size2.value || unref(fallback) || (formItem == null ? void 0 : formItem.size) || (form == null ? void 0 : form.size) || globalConfig2.value || "");
};
const useFormDisabled = (fallback) => {
const disabled = useProp("disabled");
const form = inject(formContextKey, void 0);
return computed(() => disabled.value || unref(fallback) || (form == null ? void 0 : form.disabled) || false);
};
const useFormItem = () => {
const form = inject(formContextKey, void 0);
const formItem = inject(formItemContextKey, void 0);
return {
form,
formItem
};
};
const useFormItemInputId = (props, {
formItemContext,
disableIdGeneration,
disableIdManagement
}) => {
if (!disableIdGeneration) {
disableIdGeneration = ref(false);
}
if (!disableIdManagement) {
disableIdManagement = ref(false);
}
const inputId = ref();
let idUnwatch = void 0;
const isLabeledByFormItem = computed(() => {
var _a2;
return !!(!props.label && formItemContext && formItemContext.inputIds && ((_a2 = formItemContext.inputIds) == null ? void 0 : _a2.length) <= 1);
});
onMounted(() => {
idUnwatch = watch([toRef(props, "id"), disableIdGeneration], ([id, disableIdGeneration2]) => {
const newId = id != null ? id : !disableIdGeneration2 ? useId().value : void 0;
if (newId !== inputId.value) {
if (formItemContext == null ? void 0 : formItemContext.removeInputId) {
inputId.value && formItemContext.removeInputId(inputId.value);
if (!(disableIdManagement == null ? void 0 : disableIdManagement.value) && !disableIdGeneration2 && newId) {
formItemContext.addInputId(newId);
}
}
inputId.value = newId;
}
}, { immediate: true });
});
onUnmounted(() => {
idUnwatch && idUnwatch();
if (formItemContext == null ? void 0 : formItemContext.removeInputId) {
inputId.value && formItemContext.removeInputId(inputId.value);
}
});
return {
isLabeledByFormItem,
inputId
};
};
const formMetaProps = buildProps({
size: {
type: String,
values: componentSizes
},
disabled: Boolean
});
const formProps = buildProps({
...formMetaProps,
model: Object,
rules: {
type: definePropType(Object)
},
labelPosition: {
type: String,
values: ["left", "right", "top"],
default: "right"
},
requireAsteriskPosition: {
type: String,
values: ["left", "right"],
default: "left"
},
labelWidth: {
type: [String, Number],
default: ""
},
labelSuffix: {
type: String,
default: ""
},
inline: Boolean,
inlineMessage: Boolean,
statusIcon: Boolean,
showMessage: {
type: Boolean,
default: true
},
validateOnRuleChange: {
type: Boolean,
default: true
},
hideRequiredAsterisk: {
type: Boolean,
default: false
},
scrollToError: Boolean,
scrollIntoViewOptions: {
type: [Object, Boolean]
}
});
const formEmits = {
validate: (prop, isValid, message2) => (isArray$3(prop) || isString$2(prop)) && isBoolean$1(isValid) && isString$2(message2)
};
function useFormLabelWidth() {
const potentialLabelWidthArr = ref([]);
const autoLabelWidth = computed(() => {
if (!potentialLabelWidthArr.value.length)
return "0";
const max = Math.max(...potentialLabelWidthArr.value);
return max ? `${max}px` : "";
});
function getLabelWidthIndex(width) {
const index2 = potentialLabelWidthArr.value.indexOf(width);
if (index2 === -1 && autoLabelWidth.value === "0")
;
return index2;
}
function registerLabelWidth(val, oldVal) {
if (val && oldVal) {
const index2 = getLabelWidthIndex(oldVal);
potentialLabelWidthArr.value.splice(index2, 1, val);
} else if (val) {
potentialLabelWidthArr.value.push(val);
}
}
function deregisterLabelWidth(val) {
const index2 = getLabelWidthIndex(val);
if (index2 > -1) {
potentialLabelWidthArr.value.splice(index2, 1);
}
}
return {
autoLabelWidth,
registerLabelWidth,
deregisterLabelWidth
};
}
const filterFields = (fields, props) => {
const normalized = castArray(props);
return normalized.length > 0 ? fields.filter((field) => field.prop && normalized.includes(field.prop)) : fields;
};
const COMPONENT_NAME$5 = "ElForm";
const __default__$q = defineComponent({
name: COMPONENT_NAME$5
});
const _sfc_main$z = /* @__PURE__ */ defineComponent({
...__default__$q,
props: formProps,
emits: formEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const fields = [];
const formSize = useFormSize();
const ns = useNamespace("form");
const formClasses = computed(() => {
const { labelPosition, inline } = props;
return [
ns.b(),
ns.m(formSize.value || "default"),
{
[ns.m(`label-${labelPosition}`)]: labelPosition,
[ns.m("inline")]: inline
}
];
});
const addField = (field) => {
fields.push(field);
};
const removeField = (field) => {
if (field.prop) {
fields.splice(fields.indexOf(field), 1);
}
};
const resetFields = (properties = []) => {
if (!props.model) {
return;
}
filterFields(fields, properties).forEach((field) => field.resetField());
};
const clearValidate = (props2 = []) => {
filterFields(fields, props2).forEach((field) => field.clearValidate());
};
const isValidatable = computed(() => {
const hasModel = !!props.model;
return hasModel;
});
const obtainValidateFields = (props2) => {
if (fields.length === 0)
return [];
const filteredFields = filterFields(fields, props2);
if (!filteredFields.length) {
return [];
}
return filteredFields;
};
const validate = async (callback) => validateField(void 0, callback);
const doValidateField = async (props2 = []) => {
if (!isValidatable.value)
return false;
const fields2 = obtainValidateFields(props2);
if (fields2.length === 0)
return true;
let validationErrors = {};
for (const field of fields2) {
try {
await field.validate("");
} catch (fields3) {
validationErrors = {
...validationErrors,
...fields3
};
}
}
if (Object.keys(validationErrors).length === 0)
return true;
return Promise.reject(validationErrors);
};
const validateField = async (modelProps = [], callback) => {
const shouldThrow = !isFunction$2(callback);
try {
const result = await doValidateField(modelProps);
if (result === true) {
callback == null ? void 0 : callback(result);
}
return result;
} catch (e) {
if (e instanceof Error)
throw e;
const invalidFields = e;
if (props.scrollToError) {
scrollToField(Object.keys(invalidFields)[0]);
}
callback == null ? void 0 : callback(false, invalidFields);
return shouldThrow && Promise.reject(invalidFields);
}
};
const scrollToField = (prop) => {
var _a2;
const field = filterFields(fields, prop)[0];
if (field) {
(_a2 = field.$el) == null ? void 0 : _a2.scrollIntoView(props.scrollIntoViewOptions);
}
};
watch(() => props.rules, () => {
if (props.validateOnRuleChange) {
validate().catch((err) => debugWarn());
}
}, { deep: true });
provide(formContextKey, reactive({
...toRefs(props),
emit: emit2,
resetFields,
clearValidate,
validateField,
addField,
removeField,
...useFormLabelWidth()
}));
expose2({
validate,
validateField,
resetFields,
clearValidate,
scrollToField
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("form", {
class: normalizeClass(unref(formClasses))
}, [
renderSlot(_ctx.$slots, "default")
], 2);
};
}
});
var Form = /* @__PURE__ */ _export_sfc(_sfc_main$z, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/form/src/form.vue"]]);
function _extends() {
_extends = Object.assign ? Object.assign.bind() : function(target) {
for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
}
return target;
};
return _extends.apply(this, arguments);
}
function _inheritsLoose(subClass, superClass) {
subClass.prototype = Object.create(superClass.prototype);
subClass.prototype.constructor = subClass;
_setPrototypeOf(subClass, superClass);
}
function _getPrototypeOf(o) {
_getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf.bind() : function _getPrototypeOf2(o2) {
return o2.__proto__ || Object.getPrototypeOf(o2);
};
return _getPrototypeOf(o);
}
function _setPrototypeOf(o, p2) {
_setPrototypeOf = Object.setPrototypeOf ? Object.setPrototypeOf.bind() : function _setPrototypeOf2(o2, p3) {
o2.__proto__ = p3;
return o2;
};
return _setPrototypeOf(o, p2);
}
function _isNativeReflectConstruct() {
if (typeof Reflect === "undefined" || !Reflect.construct)
return false;
if (Reflect.construct.sham)
return false;
if (typeof Proxy === "function")
return true;
try {
Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function() {
}));
return true;
} catch (e) {
return false;
}
}
function _construct(Parent, args, Class) {
if (_isNativeReflectConstruct()) {
_construct = Reflect.construct.bind();
} else {
_construct = function _construct2(Parent2, args2, Class2) {
var a = [null];
a.push.apply(a, args2);
var Constructor = Function.bind.apply(Parent2, a);
var instance = new Constructor();
if (Class2)
_setPrototypeOf(instance, Class2.prototype);
return instance;
};
}
return _construct.apply(null, arguments);
}
function _isNativeFunction(fn2) {
return Function.toString.call(fn2).indexOf("[native code]") !== -1;
}
function _wrapNativeSuper(Class) {
var _cache = typeof Map === "function" ? /* @__PURE__ */ new Map() : void 0;
_wrapNativeSuper = function _wrapNativeSuper2(Class2) {
if (Class2 === null || !_isNativeFunction(Class2))
return Class2;
if (typeof Class2 !== "function") {
throw new TypeError("Super expression must either be null or a function");
}
if (typeof _cache !== "undefined") {
if (_cache.has(Class2))
return _cache.get(Class2);
_cache.set(Class2, Wrapper);
}
function Wrapper() {
return _construct(Class2, arguments, _getPrototypeOf(this).constructor);
}
Wrapper.prototype = Object.create(Class2.prototype, {
constructor: {
value: Wrapper,
enumerable: false,
writable: true,
configurable: true
}
});
return _setPrototypeOf(Wrapper, Class2);
};
return _wrapNativeSuper(Class);
}
var formatRegExp = /%[sdj%]/g;
var warning = function warning2() {
};
if (typeof process !== "undefined" && process.env && false) {
warning = function warning2(type2, errors) {
if (typeof console !== "undefined" && console.warn && typeof ASYNC_VALIDATOR_NO_WARNING === "undefined") {
if (errors.every(function(e) {
return typeof e === "string";
})) {
console.warn(type2, errors);
}
}
};
}
function convertFieldsError(errors) {
if (!errors || !errors.length)
return null;
var fields = {};
errors.forEach(function(error) {
var field = error.field;
fields[field] = fields[field] || [];
fields[field].push(error);
});
return fields;
}
function format(template2) {
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
args[_key - 1] = arguments[_key];
}
var i = 0;
var len = args.length;
if (typeof template2 === "function") {
return template2.apply(null, args);
}
if (typeof template2 === "string") {
var str = template2.replace(formatRegExp, function(x) {
if (x === "%%") {
return "%";
}
if (i >= len) {
return x;
}
switch (x) {
case "%s":
return String(args[i++]);
case "%d":
return Number(args[i++]);
case "%j":
try {
return JSON.stringify(args[i++]);
} catch (_) {
return "[Circular]";
}
break;
default:
return x;
}
});
return str;
}
return template2;
}
function isNativeStringType(type2) {
return type2 === "string" || type2 === "url" || type2 === "hex" || type2 === "email" || type2 === "date" || type2 === "pattern";
}
function isEmptyValue(value, type2) {
if (value === void 0 || value === null) {
return true;
}
if (type2 === "array" && Array.isArray(value) && !value.length) {
return true;
}
if (isNativeStringType(type2) && typeof value === "string" && !value) {
return true;
}
return false;
}
function asyncParallelArray(arr, func, callback) {
var results = [];
var total = 0;
var arrLength = arr.length;
function count(errors) {
results.push.apply(results, errors || []);
total++;
if (total === arrLength) {
callback(results);
}
}
arr.forEach(function(a) {
func(a, count);
});
}
function asyncSerialArray(arr, func, callback) {
var index2 = 0;
var arrLength = arr.length;
function next(errors) {
if (errors && errors.length) {
callback(errors);
return;
}
var original = index2;
index2 = index2 + 1;
if (original < arrLength) {
func(arr[original], next);
} else {
callback([]);
}
}
next([]);
}
function flattenObjArr(objArr) {
var ret = [];
Object.keys(objArr).forEach(function(k) {
ret.push.apply(ret, objArr[k] || []);
});
return ret;
}
var AsyncValidationError = /* @__PURE__ */ function(_Error) {
_inheritsLoose(AsyncValidationError2, _Error);
function AsyncValidationError2(errors, fields) {
var _this;
_this = _Error.call(this, "Async Validation Error") || this;
_this.errors = errors;
_this.fields = fields;
return _this;
}
return AsyncValidationError2;
}(/* @__PURE__ */ _wrapNativeSuper(Error));
function asyncMap(objArr, option, func, callback, source) {
if (option.first) {
var _pending = new Promise(function(resolve2, reject) {
var next = function next2(errors) {
callback(errors);
return errors.length ? reject(new AsyncValidationError(errors, convertFieldsError(errors))) : resolve2(source);
};
var flattenArr = flattenObjArr(objArr);
asyncSerialArray(flattenArr, func, next);
});
_pending["catch"](function(e) {
return e;
});
return _pending;
}
var firstFields = option.firstFields === true ? Object.keys(objArr) : option.firstFields || [];
var objArrKeys = Object.keys(objArr);
var objArrLength = objArrKeys.length;
var total = 0;
var results = [];
var pending = new Promise(function(resolve2, reject) {
var next = function next2(errors) {
results.push.apply(results, errors);
total++;
if (total === objArrLength) {
callback(results);
return results.length ? reject(new AsyncValidationError(results, convertFieldsError(results))) : resolve2(source);
}
};
if (!objArrKeys.length) {
callback(results);
resolve2(source);
}
objArrKeys.forEach(function(key) {
var arr = objArr[key];
if (firstFields.indexOf(key) !== -1) {
asyncSerialArray(arr, func, next);
} else {
asyncParallelArray(arr, func, next);
}
});
});
pending["catch"](function(e) {
return e;
});
return pending;
}
function isErrorObj(obj) {
return !!(obj && obj.message !== void 0);
}
function getValue(value, path) {
var v = value;
for (var i = 0; i < path.length; i++) {
if (v == void 0) {
return v;
}
v = v[path[i]];
}
return v;
}
function complementError(rule, source) {
return function(oe) {
var fieldValue;
if (rule.fullFields) {
fieldValue = getValue(source, rule.fullFields);
} else {
fieldValue = source[oe.field || rule.fullField];
}
if (isErrorObj(oe)) {
oe.field = oe.field || rule.fullField;
oe.fieldValue = fieldValue;
return oe;
}
return {
message: typeof oe === "function" ? oe() : oe,
fieldValue,
field: oe.field || rule.fullField
};
};
}
function deepMerge(target, source) {
if (source) {
for (var s in source) {
if (source.hasOwnProperty(s)) {
var value = source[s];
if (typeof value === "object" && typeof target[s] === "object") {
target[s] = _extends({}, target[s], value);
} else {
target[s] = value;
}
}
}
}
return target;
}
var required$1 = function required2(rule, value, source, errors, options, type2) {
if (rule.required && (!source.hasOwnProperty(rule.field) || isEmptyValue(value, type2 || rule.type))) {
errors.push(format(options.messages.required, rule.fullField));
}
};
var whitespace = function whitespace2(rule, value, source, errors, options) {
if (/^\s+$/.test(value) || value === "") {
errors.push(format(options.messages.whitespace, rule.fullField));
}
};
var urlReg;
var getUrlRegex = function() {
if (urlReg) {
return urlReg;
}
var word = "[a-fA-F\\d:]";
var b = function b2(options) {
return options && options.includeBoundaries ? "(?:(?<=\\s|^)(?=" + word + ")|(?<=" + word + ")(?=\\s|$))" : "";
};
var v42 = "(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}";
var v6seg = "[a-fA-F\\d]{1,4}";
var v6 = ("\n(?:\n(?:" + v6seg + ":){7}(?:" + v6seg + "|:)| // 1:2:3:4:5:6:7:: 1:2:3:4:5:6:7:8\n(?:" + v6seg + ":){6}(?:" + v42 + "|:" + v6seg + "|:)| // 1:2:3:4:5:6:: 1:2:3:4:5:6::8 1:2:3:4:5:6::8 1:2:3:4:5:6::1.2.3.4\n(?:" + v6seg + ":){5}(?::" + v42 + "|(?::" + v6seg + "){1,2}|:)| // 1:2:3:4:5:: 1:2:3:4:5::7:8 1:2:3:4:5::8 1:2:3:4:5::7:1.2.3.4\n(?:" + v6seg + ":){4}(?:(?::" + v6seg + "){0,1}:" + v42 + "|(?::" + v6seg + "){1,3}|:)| // 1:2:3:4:: 1:2:3:4::6:7:8 1:2:3:4::8 1:2:3:4::6:7:1.2.3.4\n(?:" + v6seg + ":){3}(?:(?::" + v6seg + "){0,2}:" + v42 + "|(?::" + v6seg + "){1,4}|:)| // 1:2:3:: 1:2:3::5:6:7:8 1:2:3::8 1:2:3::5:6:7:1.2.3.4\n(?:" + v6seg + ":){2}(?:(?::" + v6seg + "){0,3}:" + v42 + "|(?::" + v6seg + "){1,5}|:)| // 1:2:: 1:2::4:5:6:7:8 1:2::8 1:2::4:5:6:7:1.2.3.4\n(?:" + v6seg + ":){1}(?:(?::" + v6seg + "){0,4}:" + v42 + "|(?::" + v6seg + "){1,6}|:)| // 1:: 1::3:4:5:6:7:8 1::8 1::3:4:5:6:7:1.2.3.4\n(?::(?:(?::" + v6seg + "){0,5}:" + v42 + "|(?::" + v6seg + "){1,7}|:)) // ::2:3:4:5:6:7:8 ::2:3:4:5:6:7:8 ::8 ::1.2.3.4\n)(?:%[0-9a-zA-Z]{1,})? // %eth0 %1\n").replace(/\s*\/\/.*$/gm, "").replace(/\n/g, "").trim();
var v46Exact = new RegExp("(?:^" + v42 + "$)|(?:^" + v6 + "$)");
var v4exact = new RegExp("^" + v42 + "$");
var v6exact = new RegExp("^" + v6 + "$");
var ip = function ip2(options) {
return options && options.exact ? v46Exact : new RegExp("(?:" + b(options) + v42 + b(options) + ")|(?:" + b(options) + v6 + b(options) + ")", "g");
};
ip.v4 = function(options) {
return options && options.exact ? v4exact : new RegExp("" + b(options) + v42 + b(options), "g");
};
ip.v6 = function(options) {
return options && options.exact ? v6exact : new RegExp("" + b(options) + v6 + b(options), "g");
};
var protocol = "(?:(?:[a-z]+:)?//)";
var auth = "(?:\\S+(?::\\S*)?@)?";
var ipv4 = ip.v4().source;
var ipv6 = ip.v6().source;
var host2 = "(?:(?:[a-z\\u00a1-\\uffff0-9][-_]*)*[a-z\\u00a1-\\uffff0-9]+)";
var domain = "(?:\\.(?:[a-z\\u00a1-\\uffff0-9]-*)*[a-z\\u00a1-\\uffff0-9]+)*";
var tld = "(?:\\.(?:[a-z\\u00a1-\\uffff]{2,}))";
var port = "(?::\\d{2,5})?";
var path = '(?:[/?#][^\\s"]*)?';
var regex = "(?:" + protocol + "|www\\.)" + auth + "(?:localhost|" + ipv4 + "|" + ipv6 + "|" + host2 + domain + tld + ")" + port + path;
urlReg = new RegExp("(?:^" + regex + "$)", "i");
return urlReg;
};
var pattern$2 = {
// http://emailregex.com/
email: /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+\.)+[a-zA-Z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]{2,}))$/,
// url: new RegExp(
// '^(?!mailto:)(?:(?:http|https|ftp)://|//)(?:\\S+(?::\\S*)?@)?(?:(?:(?:[1-9]\\d?|1\\d\\d|2[01]\\d|22[0-3])(?:\\.(?:1?\\d{1,2}|2[0-4]\\d|25[0-5])){2}(?:\\.(?:[0-9]\\d?|1\\d\\d|2[0-4]\\d|25[0-4]))|(?:(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)(?:\\.(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)*(?:\\.(?:[a-z\\u00a1-\\uffff]{2,})))|localhost)(?::\\d{2,5})?(?:(/|\\?|#)[^\\s]*)?$',
// 'i',
// ),
hex: /^#?([a-f0-9]{6}|[a-f0-9]{3})$/i
};
var types = {
integer: function integer2(value) {
return types.number(value) && parseInt(value, 10) === value;
},
"float": function float(value) {
return types.number(value) && !types.integer(value);
},
array: function array2(value) {
return Array.isArray(value);
},
regexp: function regexp2(value) {
if (value instanceof RegExp) {
return true;
}
try {
return !!new RegExp(value);
} catch (e) {
return false;
}
},
date: function date2(value) {
return typeof value.getTime === "function" && typeof value.getMonth === "function" && typeof value.getYear === "function" && !isNaN(value.getTime());
},
number: function number2(value) {
if (isNaN(value)) {
return false;
}
return typeof value === "number";
},
object: function object2(value) {
return typeof value === "object" && !types.array(value);
},
method: function method2(value) {
return typeof value === "function";
},
email: function email(value) {
return typeof value === "string" && value.length <= 320 && !!value.match(pattern$2.email);
},
url: function url(value) {
return typeof value === "string" && value.length <= 2048 && !!value.match(getUrlRegex());
},
hex: function hex(value) {
return typeof value === "string" && !!value.match(pattern$2.hex);
}
};
var type$1 = function type2(rule, value, source, errors, options) {
if (rule.required && value === void 0) {
required$1(rule, value, source, errors, options);
return;
}
var custom = ["integer", "float", "array", "regexp", "object", "method", "email", "number", "date", "url", "hex"];
var ruleType = rule.type;
if (custom.indexOf(ruleType) > -1) {
if (!types[ruleType](value)) {
errors.push(format(options.messages.types[ruleType], rule.fullField, rule.type));
}
} else if (ruleType && typeof value !== rule.type) {
errors.push(format(options.messages.types[ruleType], rule.fullField, rule.type));
}
};
var range = function range2(rule, value, source, errors, options) {
var len = typeof rule.len === "number";
var min = typeof rule.min === "number";
var max = typeof rule.max === "number";
var spRegexp = /[\uD800-\uDBFF][\uDC00-\uDFFF]/g;
var val = value;
var key = null;
var num = typeof value === "number";
var str = typeof value === "string";
var arr = Array.isArray(value);
if (num) {
key = "number";
} else if (str) {
key = "string";
} else if (arr) {
key = "array";
}
if (!key) {
return false;
}
if (arr) {
val = value.length;
}
if (str) {
val = value.replace(spRegexp, "_").length;
}
if (len) {
if (val !== rule.len) {
errors.push(format(options.messages[key].len, rule.fullField, rule.len));
}
} else if (min && !max && val < rule.min) {
errors.push(format(options.messages[key].min, rule.fullField, rule.min));
} else if (max && !min && val > rule.max) {
errors.push(format(options.messages[key].max, rule.fullField, rule.max));
} else if (min && max && (val < rule.min || val > rule.max)) {
errors.push(format(options.messages[key].range, rule.fullField, rule.min, rule.max));
}
};
var ENUM$1 = "enum";
var enumerable$1 = function enumerable2(rule, value, source, errors, options) {
rule[ENUM$1] = Array.isArray(rule[ENUM$1]) ? rule[ENUM$1] : [];
if (rule[ENUM$1].indexOf(value) === -1) {
errors.push(format(options.messages[ENUM$1], rule.fullField, rule[ENUM$1].join(", ")));
}
};
var pattern$1 = function pattern2(rule, value, source, errors, options) {
if (rule.pattern) {
if (rule.pattern instanceof RegExp) {
rule.pattern.lastIndex = 0;
if (!rule.pattern.test(value)) {
errors.push(format(options.messages.pattern.mismatch, rule.fullField, value, rule.pattern));
}
} else if (typeof rule.pattern === "string") {
var _pattern = new RegExp(rule.pattern);
if (!_pattern.test(value)) {
errors.push(format(options.messages.pattern.mismatch, rule.fullField, value, rule.pattern));
}
}
}
};
var rules = {
required: required$1,
whitespace,
type: type$1,
range,
"enum": enumerable$1,
pattern: pattern$1
};
var string = function string2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value, "string") && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options, "string");
if (!isEmptyValue(value, "string")) {
rules.type(rule, value, source, errors, options);
rules.range(rule, value, source, errors, options);
rules.pattern(rule, value, source, errors, options);
if (rule.whitespace === true) {
rules.whitespace(rule, value, source, errors, options);
}
}
}
callback(errors);
};
var method = function method2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
}
}
callback(errors);
};
var number$1 = function number2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (value === "") {
value = void 0;
}
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
rules.range(rule, value, source, errors, options);
}
}
callback(errors);
};
var _boolean = function _boolean2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
}
}
callback(errors);
};
var regexp = function regexp2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (!isEmptyValue(value)) {
rules.type(rule, value, source, errors, options);
}
}
callback(errors);
};
var integer = function integer2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
rules.range(rule, value, source, errors, options);
}
}
callback(errors);
};
var floatFn = function floatFn2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
rules.range(rule, value, source, errors, options);
}
}
callback(errors);
};
var array = function array2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if ((value === void 0 || value === null) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options, "array");
if (value !== void 0 && value !== null) {
rules.type(rule, value, source, errors, options);
rules.range(rule, value, source, errors, options);
}
}
callback(errors);
};
var object = function object2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules.type(rule, value, source, errors, options);
}
}
callback(errors);
};
var ENUM = "enum";
var enumerable = function enumerable2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (value !== void 0) {
rules[ENUM](rule, value, source, errors, options);
}
}
callback(errors);
};
var pattern = function pattern2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value, "string") && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (!isEmptyValue(value, "string")) {
rules.pattern(rule, value, source, errors, options);
}
}
callback(errors);
};
var date = function date2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value, "date") && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
if (!isEmptyValue(value, "date")) {
var dateObject;
if (value instanceof Date) {
dateObject = value;
} else {
dateObject = new Date(value);
}
rules.type(rule, dateObject, source, errors, options);
if (dateObject) {
rules.range(rule, dateObject.getTime(), source, errors, options);
}
}
}
callback(errors);
};
var required = function required2(rule, value, callback, source, options) {
var errors = [];
var type2 = Array.isArray(value) ? "array" : typeof value;
rules.required(rule, value, source, errors, options, type2);
callback(errors);
};
var type = function type2(rule, value, callback, source, options) {
var ruleType = rule.type;
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value, ruleType) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options, ruleType);
if (!isEmptyValue(value, ruleType)) {
rules.type(rule, value, source, errors, options);
}
}
callback(errors);
};
var any = function any2(rule, value, callback, source, options) {
var errors = [];
var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);
if (validate) {
if (isEmptyValue(value) && !rule.required) {
return callback();
}
rules.required(rule, value, source, errors, options);
}
callback(errors);
};
var validators = {
string,
method,
number: number$1,
"boolean": _boolean,
regexp,
integer,
"float": floatFn,
array,
object,
"enum": enumerable,
pattern,
date,
url: type,
hex: type,
email: type,
required,
any
};
function newMessages() {
return {
"default": "Validation error on field %s",
required: "%s is required",
"enum": "%s must be one of %s",
whitespace: "%s cannot be empty",
date: {
format: "%s date %s is invalid for format %s",
parse: "%s date could not be parsed, %s is invalid ",
invalid: "%s date %s is invalid"
},
types: {
string: "%s is not a %s",
method: "%s is not a %s (function)",
array: "%s is not an %s",
object: "%s is not an %s",
number: "%s is not a %s",
date: "%s is not a %s",
"boolean": "%s is not a %s",
integer: "%s is not an %s",
"float": "%s is not a %s",
regexp: "%s is not a valid %s",
email: "%s is not a valid %s",
url: "%s is not a valid %s",
hex: "%s is not a valid %s"
},
string: {
len: "%s must be exactly %s characters",
min: "%s must be at least %s characters",
max: "%s cannot be longer than %s characters",
range: "%s must be between %s and %s characters"
},
number: {
len: "%s must equal %s",
min: "%s cannot be less than %s",
max: "%s cannot be greater than %s",
range: "%s must be between %s and %s"
},
array: {
len: "%s must be exactly %s in length",
min: "%s cannot be less than %s in length",
max: "%s cannot be greater than %s in length",
range: "%s must be between %s and %s in length"
},
pattern: {
mismatch: "%s value %s does not match pattern %s"
},
clone: function clone2() {
var cloned = JSON.parse(JSON.stringify(this));
cloned.clone = this.clone;
return cloned;
}
};
}
var messages = newMessages();
var Schema = /* @__PURE__ */ function() {
function Schema2(descriptor) {
this.rules = null;
this._messages = messages;
this.define(descriptor);
}
var _proto = Schema2.prototype;
_proto.define = function define(rules2) {
var _this = this;
if (!rules2) {
throw new Error("Cannot configure a schema with no rules");
}
if (typeof rules2 !== "object" || Array.isArray(rules2)) {
throw new Error("Rules must be an object");
}
this.rules = {};
Object.keys(rules2).forEach(function(name) {
var item = rules2[name];
_this.rules[name] = Array.isArray(item) ? item : [item];
});
};
_proto.messages = function messages2(_messages) {
if (_messages) {
this._messages = deepMerge(newMessages(), _messages);
}
return this._messages;
};
_proto.validate = function validate(source_, o, oc) {
var _this2 = this;
if (o === void 0) {
o = {};
}
if (oc === void 0) {
oc = function oc2() {
};
}
var source = source_;
var options = o;
var callback = oc;
if (typeof options === "function") {
callback = options;
options = {};
}
if (!this.rules || Object.keys(this.rules).length === 0) {
if (callback) {
callback(null, source);
}
return Promise.resolve(source);
}
function complete(results) {
var errors = [];
var fields = {};
function add2(e) {
if (Array.isArray(e)) {
var _errors;
errors = (_errors = errors).concat.apply(_errors, e);
} else {
errors.push(e);
}
}
for (var i = 0; i < results.length; i++) {
add2(results[i]);
}
if (!errors.length) {
callback(null, source);
} else {
fields = convertFieldsError(errors);
callback(errors, fields);
}
}
if (options.messages) {
var messages$1 = this.messages();
if (messages$1 === messages) {
messages$1 = newMessages();
}
deepMerge(messages$1, options.messages);
options.messages = messages$1;
} else {
options.messages = this.messages();
}
var series = {};
var keys2 = options.keys || Object.keys(this.rules);
keys2.forEach(function(z) {
var arr = _this2.rules[z];
var value = source[z];
arr.forEach(function(r) {
var rule = r;
if (typeof rule.transform === "function") {
if (source === source_) {
source = _extends({}, source);
}
value = source[z] = rule.transform(value);
}
if (typeof rule === "function") {
rule = {
validator: rule
};
} else {
rule = _extends({}, rule);
}
rule.validator = _this2.getValidationMethod(rule);
if (!rule.validator) {
return;
}
rule.field = z;
rule.fullField = rule.fullField || z;
rule.type = _this2.getType(rule);
series[z] = series[z] || [];
series[z].push({
rule,
value,
source,
field: z
});
});
});
var errorFields = {};
return asyncMap(series, options, function(data, doIt) {
var rule = data.rule;
var deep = (rule.type === "object" || rule.type === "array") && (typeof rule.fields === "object" || typeof rule.defaultField === "object");
deep = deep && (rule.required || !rule.required && data.value);
rule.field = data.field;
function addFullField(key, schema) {
return _extends({}, schema, {
fullField: rule.fullField + "." + key,
fullFields: rule.fullFields ? [].concat(rule.fullFields, [key]) : [key]
});
}
function cb(e) {
if (e === void 0) {
e = [];
}
var errorList = Array.isArray(e) ? e : [e];
if (!options.suppressWarning && errorList.length) {
Schema2.warning("async-validator:", errorList);
}
if (errorList.length && rule.message !== void 0) {
errorList = [].concat(rule.message);
}
var filledErrors = errorList.map(complementError(rule, source));
if (options.first && filledErrors.length) {
errorFields[rule.field] = 1;
return doIt(filledErrors);
}
if (!deep) {
doIt(filledErrors);
} else {
if (rule.required && !data.value) {
if (rule.message !== void 0) {
filledErrors = [].concat(rule.message).map(complementError(rule, source));
} else if (options.error) {
filledErrors = [options.error(rule, format(options.messages.required, rule.field))];
}
return doIt(filledErrors);
}
var fieldsSchema = {};
if (rule.defaultField) {
Object.keys(data.value).map(function(key) {
fieldsSchema[key] = rule.defaultField;
});
}
fieldsSchema = _extends({}, fieldsSchema, data.rule.fields);
var paredFieldsSchema = {};
Object.keys(fieldsSchema).forEach(function(field) {
var fieldSchema = fieldsSchema[field];
var fieldSchemaList = Array.isArray(fieldSchema) ? fieldSchema : [fieldSchema];
paredFieldsSchema[field] = fieldSchemaList.map(addFullField.bind(null, field));
});
var schema = new Schema2(paredFieldsSchema);
schema.messages(options.messages);
if (data.rule.options) {
data.rule.options.messages = options.messages;
data.rule.options.error = options.error;
}
schema.validate(data.value, data.rule.options || options, function(errs) {
var finalErrors = [];
if (filledErrors && filledErrors.length) {
finalErrors.push.apply(finalErrors, filledErrors);
}
if (errs && errs.length) {
finalErrors.push.apply(finalErrors, errs);
}
doIt(finalErrors.length ? finalErrors : null);
});
}
}
var res;
if (rule.asyncValidator) {
res = rule.asyncValidator(rule, data.value, cb, data.source, options);
} else if (rule.validator) {
try {
res = rule.validator(rule, data.value, cb, data.source, options);
} catch (error) {
console.error == null ? void 0 : console.error(error);
if (!options.suppressValidatorError) {
setTimeout(function() {
throw error;
}, 0);
}
cb(error.message);
}
if (res === true) {
cb();
} else if (res === false) {
cb(typeof rule.message === "function" ? rule.message(rule.fullField || rule.field) : rule.message || (rule.fullField || rule.field) + " fails");
} else if (res instanceof Array) {
cb(res);
} else if (res instanceof Error) {
cb(res.message);
}
}
if (res && res.then) {
res.then(function() {
return cb();
}, function(e) {
return cb(e);
});
}
}, function(results) {
complete(results);
}, source);
};
_proto.getType = function getType2(rule) {
if (rule.type === void 0 && rule.pattern instanceof RegExp) {
rule.type = "pattern";
}
if (typeof rule.validator !== "function" && rule.type && !validators.hasOwnProperty(rule.type)) {
throw new Error(format("Unknown rule type %s", rule.type));
}
return rule.type || "string";
};
_proto.getValidationMethod = function getValidationMethod(rule) {
if (typeof rule.validator === "function") {
return rule.validator;
}
var keys2 = Object.keys(rule);
var messageIndex = keys2.indexOf("message");
if (messageIndex !== -1) {
keys2.splice(messageIndex, 1);
}
if (keys2.length === 1 && keys2[0] === "required") {
return validators.required;
}
return validators[this.getType(rule)] || void 0;
};
return Schema2;
}();
Schema.register = function register(type2, validator) {
if (typeof validator !== "function") {
throw new Error("Cannot register a validator by type, validator is not a function");
}
validators[type2] = validator;
};
Schema.warning = warning;
Schema.messages = messages;
Schema.validators = validators;
const formItemValidateStates = [
"",
"error",
"validating",
"success"
];
const formItemProps = buildProps({
label: String,
labelWidth: {
type: [String, Number],
default: ""
},
prop: {
type: definePropType([String, Array])
},
required: {
type: Boolean,
default: void 0
},
rules: {
type: definePropType([Object, Array])
},
error: String,
validateStatus: {
type: String,
values: formItemValidateStates
},
for: String,
inlineMessage: {
type: [String, Boolean],
default: ""
},
showMessage: {
type: Boolean,
default: true
},
size: {
type: String,
values: componentSizes
}
});
const COMPONENT_NAME$4 = "ElLabelWrap";
var FormLabelWrap = defineComponent({
name: COMPONENT_NAME$4,
props: {
isAutoWidth: Boolean,
updateAll: Boolean
},
setup(props, {
slots
}) {
const formContext = inject(formContextKey, void 0);
const formItemContext = inject(formItemContextKey);
if (!formItemContext)
throwError(COMPONENT_NAME$4, "usage: <el-form-item><label-wrap /></el-form-item>");
const ns = useNamespace("form");
const el = ref();
const computedWidth = ref(0);
const getLabelWidth = () => {
var _a2;
if ((_a2 = el.value) == null ? void 0 : _a2.firstElementChild) {
const width = window.getComputedStyle(el.value.firstElementChild).width;
return Math.ceil(Number.parseFloat(width));
} else {
return 0;
}
};
const updateLabelWidth = (action = "update") => {
nextTick(() => {
if (slots.default && props.isAutoWidth) {
if (action === "update") {
computedWidth.value = getLabelWidth();
} else if (action === "remove") {
formContext == null ? void 0 : formContext.deregisterLabelWidth(computedWidth.value);
}
}
});
};
const updateLabelWidthFn = () => updateLabelWidth("update");
onMounted(() => {
updateLabelWidthFn();
});
onBeforeUnmount(() => {
updateLabelWidth("remove");
});
onUpdated(() => updateLabelWidthFn());
watch(computedWidth, (val, oldVal) => {
if (props.updateAll) {
formContext == null ? void 0 : formContext.registerLabelWidth(val, oldVal);
}
});
useResizeObserver(computed(() => {
var _a2, _b;
return (_b = (_a2 = el.value) == null ? void 0 : _a2.firstElementChild) != null ? _b : null;
}), updateLabelWidthFn);
return () => {
var _a2, _b;
if (!slots)
return null;
const {
isAutoWidth
} = props;
if (isAutoWidth) {
const autoLabelWidth = formContext == null ? void 0 : formContext.autoLabelWidth;
const hasLabel = formItemContext == null ? void 0 : formItemContext.hasLabel;
const style = {};
if (hasLabel && autoLabelWidth && autoLabelWidth !== "auto") {
const marginWidth = Math.max(0, Number.parseInt(autoLabelWidth, 10) - computedWidth.value);
const marginPosition = formContext.labelPosition === "left" ? "marginRight" : "marginLeft";
if (marginWidth) {
style[marginPosition] = `${marginWidth}px`;
}
}
return createVNode("div", {
"ref": el,
"class": [ns.be("item", "label-wrap")],
"style": style
}, [(_a2 = slots.default) == null ? void 0 : _a2.call(slots)]);
} else {
return createVNode(Fragment$1, {
"ref": el
}, [(_b = slots.default) == null ? void 0 : _b.call(slots)]);
}
};
}
});
const _hoisted_1$f = ["role", "aria-labelledby"];
const __default__$p = defineComponent({
name: "ElFormItem"
});
const _sfc_main$y = /* @__PURE__ */ defineComponent({
...__default__$p,
props: formItemProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const slots = useSlots();
const formContext = inject(formContextKey, void 0);
const parentFormItemContext = inject(formItemContextKey, void 0);
const _size = useFormSize(void 0, { formItem: false });
const ns = useNamespace("form-item");
const labelId = useId().value;
const inputIds = ref([]);
const validateState = ref("");
const validateStateDebounced = refDebounced(validateState, 100);
const validateMessage = ref("");
const formItemRef = ref();
let initialValue = void 0;
let isResettingField = false;
const labelStyle = computed(() => {
if ((formContext == null ? void 0 : formContext.labelPosition) === "top") {
return {};
}
const labelWidth = addUnit(props.labelWidth || (formContext == null ? void 0 : formContext.labelWidth) || "");
if (labelWidth)
return { width: labelWidth };
return {};
});
const contentStyle = computed(() => {
if ((formContext == null ? void 0 : formContext.labelPosition) === "top" || (formContext == null ? void 0 : formContext.inline)) {
return {};
}
if (!props.label && !props.labelWidth && isNested) {
return {};
}
const labelWidth = addUnit(props.labelWidth || (formContext == null ? void 0 : formContext.labelWidth) || "");
if (!props.label && !slots.label) {
return { marginLeft: labelWidth };
}
return {};
});
const formItemClasses = computed(() => [
ns.b(),
ns.m(_size.value),
ns.is("error", validateState.value === "error"),
ns.is("validating", validateState.value === "validating"),
ns.is("success", validateState.value === "success"),
ns.is("required", isRequired.value || props.required),
ns.is("no-asterisk", formContext == null ? void 0 : formContext.hideRequiredAsterisk),
(formContext == null ? void 0 : formContext.requireAsteriskPosition) === "right" ? "asterisk-right" : "asterisk-left",
{ [ns.m("feedback")]: formContext == null ? void 0 : formContext.statusIcon }
]);
const _inlineMessage = computed(() => isBoolean$1(props.inlineMessage) ? props.inlineMessage : (formContext == null ? void 0 : formContext.inlineMessage) || false);
const validateClasses = computed(() => [
ns.e("error"),
{ [ns.em("error", "inline")]: _inlineMessage.value }
]);
const propString = computed(() => {
if (!props.prop)
return "";
return isString$2(props.prop) ? props.prop : props.prop.join(".");
});
const hasLabel = computed(() => {
return !!(props.label || slots.label);
});
const labelFor = computed(() => {
return props.for || inputIds.value.length === 1 ? inputIds.value[0] : void 0;
});
const isGroup = computed(() => {
return !labelFor.value && hasLabel.value;
});
const isNested = !!parentFormItemContext;
const fieldValue = computed(() => {
const model = formContext == null ? void 0 : formContext.model;
if (!model || !props.prop) {
return;
}
return getProp(model, props.prop).value;
});
const normalizedRules = computed(() => {
const { required: required2 } = props;
const rules2 = [];
if (props.rules) {
rules2.push(...castArray(props.rules));
}
const formRules = formContext == null ? void 0 : formContext.rules;
if (formRules && props.prop) {
const _rules = getProp(formRules, props.prop).value;
if (_rules) {
rules2.push(...castArray(_rules));
}
}
if (required2 !== void 0) {
const requiredRules = rules2.map((rule, i) => [rule, i]).filter(([rule]) => Object.keys(rule).includes("required"));
if (requiredRules.length > 0) {
for (const [rule, i] of requiredRules) {
if (rule.required === required2)
continue;
rules2[i] = { ...rule, required: required2 };
}
} else {
rules2.push({ required: required2 });
}
}
return rules2;
});
const validateEnabled = computed(() => normalizedRules.value.length > 0);
const getFilteredRule = (trigger2) => {
const rules2 = normalizedRules.value;
return rules2.filter((rule) => {
if (!rule.trigger || !trigger2)
return true;
if (Array.isArray(rule.trigger)) {
return rule.trigger.includes(trigger2);
} else {
return rule.trigger === trigger2;
}
}).map(({ trigger: trigger22, ...rule }) => rule);
};
const isRequired = computed(() => normalizedRules.value.some((rule) => rule.required));
const shouldShowError = computed(() => {
var _a2;
return validateStateDebounced.value === "error" && props.showMessage && ((_a2 = formContext == null ? void 0 : formContext.showMessage) != null ? _a2 : true);
});
const currentLabel = computed(() => `${props.label || ""}${(formContext == null ? void 0 : formContext.labelSuffix) || ""}`);
const setValidationState = (state) => {
validateState.value = state;
};
const onValidationFailed = (error) => {
var _a2, _b;
const { errors, fields } = error;
if (!errors || !fields) {
console.error(error);
}
setValidationState("error");
validateMessage.value = errors ? (_b = (_a2 = errors == null ? void 0 : errors[0]) == null ? void 0 : _a2.message) != null ? _b : `${props.prop} is required` : "";
formContext == null ? void 0 : formContext.emit("validate", props.prop, false, validateMessage.value);
};
const onValidationSucceeded = () => {
setValidationState("success");
formContext == null ? void 0 : formContext.emit("validate", props.prop, true, "");
};
const doValidate = async (rules2) => {
const modelName = propString.value;
const validator = new Schema({
[modelName]: rules2
});
return validator.validate({ [modelName]: fieldValue.value }, { firstFields: true }).then(() => {
onValidationSucceeded();
return true;
}).catch((err) => {
onValidationFailed(err);
return Promise.reject(err);
});
};
const validate = async (trigger2, callback) => {
if (isResettingField || !props.prop) {
return false;
}
const hasCallback = isFunction$2(callback);
if (!validateEnabled.value) {
callback == null ? void 0 : callback(false);
return false;
}
const rules2 = getFilteredRule(trigger2);
if (rules2.length === 0) {
callback == null ? void 0 : callback(true);
return true;
}
setValidationState("validating");
return doValidate(rules2).then(() => {
callback == null ? void 0 : callback(true);
return true;
}).catch((err) => {
const { fields } = err;
callback == null ? void 0 : callback(false, fields);
return hasCallback ? false : Promise.reject(fields);
});
};
const clearValidate = () => {
setValidationState("");
validateMessage.value = "";
isResettingField = false;
};
const resetField = async () => {
const model = formContext == null ? void 0 : formContext.model;
if (!model || !props.prop)
return;
const computedValue = getProp(model, props.prop);
isResettingField = true;
computedValue.value = clone(initialValue);
await nextTick();
clearValidate();
isResettingField = false;
};
const addInputId = (id) => {
if (!inputIds.value.includes(id)) {
inputIds.value.push(id);
}
};
const removeInputId = (id) => {
inputIds.value = inputIds.value.filter((listId) => listId !== id);
};
watch(() => props.error, (val) => {
validateMessage.value = val || "";
setValidationState(val ? "error" : "");
}, { immediate: true });
watch(() => props.validateStatus, (val) => setValidationState(val || ""));
const context = reactive({
...toRefs(props),
$el: formItemRef,
size: _size,
validateState,
labelId,
inputIds,
isGroup,
hasLabel,
addInputId,
removeInputId,
resetField,
clearValidate,
validate
});
provide(formItemContextKey, context);
onMounted(() => {
if (props.prop) {
formContext == null ? void 0 : formContext.addField(context);
initialValue = clone(fieldValue.value);
}
});
onBeforeUnmount(() => {
formContext == null ? void 0 : formContext.removeField(context);
});
expose2({
size: _size,
validateMessage,
validateState,
validate,
clearValidate,
resetField
});
return (_ctx, _cache) => {
var _a2;
return openBlock(), createElementBlock("div", {
ref_key: "formItemRef",
ref: formItemRef,
class: normalizeClass(unref(formItemClasses)),
role: unref(isGroup) ? "group" : void 0,
"aria-labelledby": unref(isGroup) ? unref(labelId) : void 0
}, [
createVNode(unref(FormLabelWrap), {
"is-auto-width": unref(labelStyle).width === "auto",
"update-all": ((_a2 = unref(formContext)) == null ? void 0 : _a2.labelWidth) === "auto"
}, {
default: withCtx(() => [
unref(hasLabel) ? (openBlock(), createBlock(resolveDynamicComponent(unref(labelFor) ? "label" : "div"), {
key: 0,
id: unref(labelId),
for: unref(labelFor),
class: normalizeClass(unref(ns).e("label")),
style: normalizeStyle(unref(labelStyle))
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "label", { label: unref(currentLabel) }, () => [
createTextVNode(toDisplayString$1(unref(currentLabel)), 1)
])
]),
_: 3
}, 8, ["id", "for", "class", "style"])) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["is-auto-width", "update-all"]),
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("content")),
style: normalizeStyle(unref(contentStyle))
}, [
renderSlot(_ctx.$slots, "default"),
createVNode(TransitionGroup, {
name: `${unref(ns).namespace.value}-zoom-in-top`
}, {
default: withCtx(() => [
unref(shouldShowError) ? renderSlot(_ctx.$slots, "error", {
key: 0,
error: validateMessage.value
}, () => [
createBaseVNode("div", {
class: normalizeClass(unref(validateClasses))
}, toDisplayString$1(validateMessage.value), 3)
]) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["name"])
], 6)
], 10, _hoisted_1$f);
};
}
});
var FormItem = /* @__PURE__ */ _export_sfc(_sfc_main$y, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/form/src/form-item.vue"]]);
const ElForm = withInstall(Form, {
FormItem
});
const ElFormItem = withNoopInstall(FormItem);
let hiddenTextarea = void 0;
const HIDDEN_STYLE = `
height:0 !important;
visibility:hidden !important;
${isFirefox() ? "" : "overflow:hidden !important;"}
position:absolute !important;
z-index:-1000 !important;
top:0 !important;
right:0 !important;
`;
const CONTEXT_STYLE = [
"letter-spacing",
"line-height",
"padding-top",
"padding-bottom",
"font-family",
"font-weight",
"font-size",
"text-rendering",
"text-transform",
"width",
"text-indent",
"padding-left",
"padding-right",
"border-width",
"box-sizing"
];
function calculateNodeStyling(targetElement) {
const style = window.getComputedStyle(targetElement);
const boxSizing = style.getPropertyValue("box-sizing");
const paddingSize = Number.parseFloat(style.getPropertyValue("padding-bottom")) + Number.parseFloat(style.getPropertyValue("padding-top"));
const borderSize = Number.parseFloat(style.getPropertyValue("border-bottom-width")) + Number.parseFloat(style.getPropertyValue("border-top-width"));
const contextStyle = CONTEXT_STYLE.map((name) => `${name}:${style.getPropertyValue(name)}`).join(";");
return { contextStyle, paddingSize, borderSize, boxSizing };
}
function calcTextareaHeight(targetElement, minRows = 1, maxRows) {
var _a2;
if (!hiddenTextarea) {
hiddenTextarea = document.createElement("textarea");
document.body.appendChild(hiddenTextarea);
}
const { paddingSize, borderSize, boxSizing, contextStyle } = calculateNodeStyling(targetElement);
hiddenTextarea.setAttribute("style", `${contextStyle};${HIDDEN_STYLE}`);
hiddenTextarea.value = targetElement.value || targetElement.placeholder || "";
let height = hiddenTextarea.scrollHeight;
const result = {};
if (boxSizing === "border-box") {
height = height + borderSize;
} else if (boxSizing === "content-box") {
height = height - paddingSize;
}
hiddenTextarea.value = "";
const singleRowHeight = hiddenTextarea.scrollHeight - paddingSize;
if (isNumber$1(minRows)) {
let minHeight = singleRowHeight * minRows;
if (boxSizing === "border-box") {
minHeight = minHeight + paddingSize + borderSize;
}
height = Math.max(minHeight, height);
result.minHeight = `${minHeight}px`;
}
if (isNumber$1(maxRows)) {
let maxHeight = singleRowHeight * maxRows;
if (boxSizing === "border-box") {
maxHeight = maxHeight + paddingSize + borderSize;
}
height = Math.min(maxHeight, height);
}
result.height = `${height}px`;
(_a2 = hiddenTextarea.parentNode) == null ? void 0 : _a2.removeChild(hiddenTextarea);
hiddenTextarea = void 0;
return result;
}
const inputProps = buildProps({
id: {
type: String,
default: void 0
},
size: useSizeProp,
disabled: Boolean,
modelValue: {
type: definePropType([
String,
Number,
Object
]),
default: ""
},
type: {
type: String,
default: "text"
},
resize: {
type: String,
values: ["none", "both", "horizontal", "vertical"]
},
autosize: {
type: definePropType([Boolean, Object]),
default: false
},
autocomplete: {
type: String,
default: "off"
},
formatter: {
type: Function
},
parser: {
type: Function
},
placeholder: {
type: String
},
form: {
type: String
},
readonly: {
type: Boolean,
default: false
},
clearable: {
type: Boolean,
default: false
},
showPassword: {
type: Boolean,
default: false
},
showWordLimit: {
type: Boolean,
default: false
},
suffixIcon: {
type: iconPropType
},
prefixIcon: {
type: iconPropType
},
containerRole: {
type: String,
default: void 0
},
label: {
type: String,
default: void 0
},
tabindex: {
type: [String, Number],
default: 0
},
validateEvent: {
type: Boolean,
default: true
},
inputStyle: {
type: definePropType([Object, Array, String]),
default: () => mutable({})
}
});
const inputEmits = {
[UPDATE_MODEL_EVENT]: (value) => isString$2(value),
input: (value) => isString$2(value),
change: (value) => isString$2(value),
focus: (evt) => evt instanceof FocusEvent,
blur: (evt) => evt instanceof FocusEvent,
clear: () => true,
mouseleave: (evt) => evt instanceof MouseEvent,
mouseenter: (evt) => evt instanceof MouseEvent,
keydown: (evt) => evt instanceof Event,
compositionstart: (evt) => evt instanceof CompositionEvent,
compositionupdate: (evt) => evt instanceof CompositionEvent,
compositionend: (evt) => evt instanceof CompositionEvent
};
const _hoisted_1$e = ["role"];
const _hoisted_2$b = ["id", "type", "disabled", "formatter", "parser", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form"];
const _hoisted_3$4 = ["id", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form"];
const __default__$o = defineComponent({
name: "ElInput",
inheritAttrs: false
});
const _sfc_main$x = /* @__PURE__ */ defineComponent({
...__default__$o,
props: inputProps,
emits: inputEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const rawAttrs = useAttrs$1();
const slots = useSlots();
const containerAttrs = computed(() => {
const comboBoxAttrs = {};
if (props.containerRole === "combobox") {
comboBoxAttrs["aria-haspopup"] = rawAttrs["aria-haspopup"];
comboBoxAttrs["aria-owns"] = rawAttrs["aria-owns"];
comboBoxAttrs["aria-expanded"] = rawAttrs["aria-expanded"];
}
return comboBoxAttrs;
});
const containerKls = computed(() => [
props.type === "textarea" ? nsTextarea.b() : nsInput.b(),
nsInput.m(inputSize.value),
nsInput.is("disabled", inputDisabled.value),
nsInput.is("exceed", inputExceed.value),
{
[nsInput.b("group")]: slots.prepend || slots.append,
[nsInput.bm("group", "append")]: slots.append,
[nsInput.bm("group", "prepend")]: slots.prepend,
[nsInput.m("prefix")]: slots.prefix || props.prefixIcon,
[nsInput.m("suffix")]: slots.suffix || props.suffixIcon || props.clearable || props.showPassword,
[nsInput.bm("suffix", "password-clear")]: showClear.value && showPwdVisible.value
},
rawAttrs.class
]);
const wrapperKls = computed(() => [
nsInput.e("wrapper"),
nsInput.is("focus", focused.value)
]);
const attrs = useAttrs({
excludeKeys: computed(() => {
return Object.keys(containerAttrs.value);
})
});
const { form, formItem } = useFormItem();
const { inputId } = useFormItemInputId(props, {
formItemContext: formItem
});
const inputSize = useFormSize();
const inputDisabled = useFormDisabled();
const nsInput = useNamespace("input");
const nsTextarea = useNamespace("textarea");
const input = shallowRef();
const textarea = shallowRef();
const focused = ref(false);
const hovering = ref(false);
const isComposing = ref(false);
const passwordVisible = ref(false);
const countStyle = ref();
const textareaCalcStyle = shallowRef(props.inputStyle);
const _ref = computed(() => input.value || textarea.value);
const needStatusIcon = computed(() => {
var _a2;
return (_a2 = form == null ? void 0 : form.statusIcon) != null ? _a2 : false;
});
const validateState = computed(() => (formItem == null ? void 0 : formItem.validateState) || "");
const validateIcon = computed(() => validateState.value && ValidateComponentsMap[validateState.value]);
const passwordIcon = computed(() => passwordVisible.value ? view_default : hide_default);
const containerStyle = computed(() => [
rawAttrs.style,
props.inputStyle
]);
const textareaStyle = computed(() => [
props.inputStyle,
textareaCalcStyle.value,
{ resize: props.resize }
]);
const nativeInputValue = computed(() => isNil(props.modelValue) ? "" : String(props.modelValue));
const showClear = computed(() => props.clearable && !inputDisabled.value && !props.readonly && !!nativeInputValue.value && (focused.value || hovering.value));
const showPwdVisible = computed(() => props.showPassword && !inputDisabled.value && !props.readonly && !!nativeInputValue.value && (!!nativeInputValue.value || focused.value));
const isWordLimitVisible = computed(() => props.showWordLimit && !!attrs.value.maxlength && (props.type === "text" || props.type === "textarea") && !inputDisabled.value && !props.readonly && !props.showPassword);
const textLength = computed(() => nativeInputValue.value.length);
const inputExceed = computed(() => !!isWordLimitVisible.value && textLength.value > Number(attrs.value.maxlength));
const suffixVisible = computed(() => !!slots.suffix || !!props.suffixIcon || showClear.value || props.showPassword || isWordLimitVisible.value || !!validateState.value && needStatusIcon.value);
const [recordCursor, setCursor] = useCursor(input);
useResizeObserver(textarea, (entries) => {
onceInitSizeTextarea();
if (!isWordLimitVisible.value || props.resize !== "both")
return;
const entry = entries[0];
const { width } = entry.contentRect;
countStyle.value = {
right: `calc(100% - ${width + 15 + 6}px)`
};
});
const resizeTextarea = () => {
const { type: type2, autosize } = props;
if (!isClient$1 || type2 !== "textarea" || !textarea.value)
return;
if (autosize) {
const minRows = isObject$3(autosize) ? autosize.minRows : void 0;
const maxRows = isObject$3(autosize) ? autosize.maxRows : void 0;
const textareaStyle2 = calcTextareaHeight(textarea.value, minRows, maxRows);
textareaCalcStyle.value = {
overflowY: "hidden",
...textareaStyle2
};
nextTick(() => {
textarea.value.offsetHeight;
textareaCalcStyle.value = textareaStyle2;
});
} else {
textareaCalcStyle.value = {
minHeight: calcTextareaHeight(textarea.value).minHeight
};
}
};
const createOnceInitResize = (resizeTextarea2) => {
let isInit = false;
return () => {
var _a2;
if (isInit || !props.autosize)
return;
const isElHidden = ((_a2 = textarea.value) == null ? void 0 : _a2.offsetParent) === null;
if (!isElHidden) {
resizeTextarea2();
isInit = true;
}
};
};
const onceInitSizeTextarea = createOnceInitResize(resizeTextarea);
const setNativeInputValue = () => {
const input2 = _ref.value;
if (!input2 || input2.value === nativeInputValue.value)
return;
input2.value = nativeInputValue.value;
};
const handleInput = async (event) => {
recordCursor();
let { value } = event.target;
if (props.formatter) {
value = props.parser ? props.parser(value) : value;
value = props.formatter(value);
}
if (isComposing.value)
return;
if (value === nativeInputValue.value) {
setNativeInputValue();
return;
}
emit2(UPDATE_MODEL_EVENT, value);
emit2("input", value);
await nextTick();
setNativeInputValue();
setCursor();
};
const handleChange = (event) => {
emit2("change", event.target.value);
};
const handleCompositionStart = (event) => {
emit2("compositionstart", event);
isComposing.value = true;
};
const handleCompositionUpdate = (event) => {
var _a2;
emit2("compositionupdate", event);
const text = (_a2 = event.target) == null ? void 0 : _a2.value;
const lastCharacter = text[text.length - 1] || "";
isComposing.value = !isKorean(lastCharacter);
};
const handleCompositionEnd = (event) => {
emit2("compositionend", event);
if (isComposing.value) {
isComposing.value = false;
handleInput(event);
}
};
const handlePasswordVisible = () => {
passwordVisible.value = !passwordVisible.value;
focus();
};
const focus = async () => {
var _a2;
await nextTick();
(_a2 = _ref.value) == null ? void 0 : _a2.focus();
};
const blur = () => {
var _a2;
return (_a2 = _ref.value) == null ? void 0 : _a2.blur();
};
const handleFocus = (event) => {
focused.value = true;
emit2("focus", event);
};
const handleBlur = (event) => {
var _a2;
focused.value = false;
emit2("blur", event);
if (props.validateEvent) {
(_a2 = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a2.call(formItem, "blur").catch((err) => debugWarn());
}
};
const handleMouseLeave = (evt) => {
hovering.value = false;
emit2("mouseleave", evt);
};
const handleMouseEnter = (evt) => {
hovering.value = true;
emit2("mouseenter", evt);
};
const handleKeydown = (evt) => {
emit2("keydown", evt);
};
const select = () => {
var _a2;
(_a2 = _ref.value) == null ? void 0 : _a2.select();
};
const clear2 = () => {
emit2(UPDATE_MODEL_EVENT, "");
emit2("change", "");
emit2("clear");
emit2("input", "");
};
watch(() => props.modelValue, () => {
var _a2;
nextTick(() => resizeTextarea());
if (props.validateEvent) {
(_a2 = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a2.call(formItem, "change").catch((err) => debugWarn());
}
});
watch(nativeInputValue, () => setNativeInputValue());
watch(() => props.type, async () => {
await nextTick();
setNativeInputValue();
resizeTextarea();
});
onMounted(() => {
if (!props.formatter && props.parser)
;
setNativeInputValue();
nextTick(resizeTextarea);
});
expose2({
input,
textarea,
ref: _ref,
textareaStyle,
autosize: toRef(props, "autosize"),
focus,
blur,
select,
clear: clear2,
resizeTextarea
});
return (_ctx, _cache) => {
return withDirectives((openBlock(), createElementBlock("div", mergeProps(unref(containerAttrs), {
class: unref(containerKls),
style: unref(containerStyle),
role: _ctx.containerRole,
onMouseenter: handleMouseEnter,
onMouseleave: handleMouseLeave
}), [
createCommentVNode(" input "),
_ctx.type !== "textarea" ? (openBlock(), createElementBlock(Fragment$1, { key: 0 }, [
createCommentVNode(" prepend slot "),
_ctx.$slots.prepend ? (openBlock(), createElementBlock("div", {
key: 0,
class: normalizeClass(unref(nsInput).be("group", "prepend"))
}, [
renderSlot(_ctx.$slots, "prepend")
], 2)) : createCommentVNode("v-if", true),
createBaseVNode("div", {
class: normalizeClass(unref(wrapperKls))
}, [
createCommentVNode(" prefix slot "),
_ctx.$slots.prefix || _ctx.prefixIcon ? (openBlock(), createElementBlock("span", {
key: 0,
class: normalizeClass(unref(nsInput).e("prefix"))
}, [
createBaseVNode("span", {
class: normalizeClass(unref(nsInput).e("prefix-inner")),
onClick: focus
}, [
renderSlot(_ctx.$slots, "prefix"),
_ctx.prefixIcon ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(nsInput).e("icon"))
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.prefixIcon)))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true)
], 2)
], 2)) : createCommentVNode("v-if", true),
createBaseVNode("input", mergeProps({
id: unref(inputId),
ref_key: "input",
ref: input,
class: unref(nsInput).e("inner")
}, unref(attrs), {
type: _ctx.showPassword ? passwordVisible.value ? "text" : "password" : _ctx.type,
disabled: unref(inputDisabled),
formatter: _ctx.formatter,
parser: _ctx.parser,
readonly: _ctx.readonly,
autocomplete: _ctx.autocomplete,
tabindex: _ctx.tabindex,
"aria-label": _ctx.label,
placeholder: _ctx.placeholder,
style: _ctx.inputStyle,
form: props.form,
onCompositionstart: handleCompositionStart,
onCompositionupdate: handleCompositionUpdate,
onCompositionend: handleCompositionEnd,
onInput: handleInput,
onFocus: handleFocus,
onBlur: handleBlur,
onChange: handleChange,
onKeydown: handleKeydown
}), null, 16, _hoisted_2$b),
createCommentVNode(" suffix slot "),
unref(suffixVisible) ? (openBlock(), createElementBlock("span", {
key: 1,
class: normalizeClass(unref(nsInput).e("suffix"))
}, [
createBaseVNode("span", {
class: normalizeClass(unref(nsInput).e("suffix-inner")),
onClick: focus
}, [
!unref(showClear) || !unref(showPwdVisible) || !unref(isWordLimitVisible) ? (openBlock(), createElementBlock(Fragment$1, { key: 0 }, [
renderSlot(_ctx.$slots, "suffix"),
_ctx.suffixIcon ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(nsInput).e("icon"))
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.suffixIcon)))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true)
], 64)) : createCommentVNode("v-if", true),
unref(showClear) ? (openBlock(), createBlock(unref(ElIcon), {
key: 1,
class: normalizeClass([unref(nsInput).e("icon"), unref(nsInput).e("clear")]),
onMousedown: withModifiers(unref(NOOP), ["prevent"]),
onClick: clear2
}, {
default: withCtx(() => [
createVNode(unref(circle_close_default))
]),
_: 1
}, 8, ["class", "onMousedown"])) : createCommentVNode("v-if", true),
unref(showPwdVisible) ? (openBlock(), createBlock(unref(ElIcon), {
key: 2,
class: normalizeClass([unref(nsInput).e("icon"), unref(nsInput).e("password")]),
onClick: handlePasswordVisible
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(unref(passwordIcon))))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true),
unref(isWordLimitVisible) ? (openBlock(), createElementBlock("span", {
key: 3,
class: normalizeClass(unref(nsInput).e("count"))
}, [
createBaseVNode("span", {
class: normalizeClass(unref(nsInput).e("count-inner"))
}, toDisplayString$1(unref(textLength)) + " / " + toDisplayString$1(unref(attrs).maxlength), 3)
], 2)) : createCommentVNode("v-if", true),
unref(validateState) && unref(validateIcon) && unref(needStatusIcon) ? (openBlock(), createBlock(unref(ElIcon), {
key: 4,
class: normalizeClass([
unref(nsInput).e("icon"),
unref(nsInput).e("validateIcon"),
unref(nsInput).is("loading", unref(validateState) === "validating")
])
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(unref(validateIcon))))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true)
], 2)
], 2)) : createCommentVNode("v-if", true)
], 2),
createCommentVNode(" append slot "),
_ctx.$slots.append ? (openBlock(), createElementBlock("div", {
key: 1,
class: normalizeClass(unref(nsInput).be("group", "append"))
}, [
renderSlot(_ctx.$slots, "append")
], 2)) : createCommentVNode("v-if", true)
], 64)) : (openBlock(), createElementBlock(Fragment$1, { key: 1 }, [
createCommentVNode(" textarea "),
createBaseVNode("textarea", mergeProps({
id: unref(inputId),
ref_key: "textarea",
ref: textarea,
class: unref(nsTextarea).e("inner")
}, unref(attrs), {
tabindex: _ctx.tabindex,
disabled: unref(inputDisabled),
readonly: _ctx.readonly,
autocomplete: _ctx.autocomplete,
style: unref(textareaStyle),
"aria-label": _ctx.label,
placeholder: _ctx.placeholder,
form: props.form,
onCompositionstart: handleCompositionStart,
onCompositionupdate: handleCompositionUpdate,
onCompositionend: handleCompositionEnd,
onInput: handleInput,
onFocus: handleFocus,
onBlur: handleBlur,
onChange: handleChange,
onKeydown: handleKeydown
}), null, 16, _hoisted_3$4),
unref(isWordLimitVisible) ? (openBlock(), createElementBlock("span", {
key: 0,
style: normalizeStyle(countStyle.value),
class: normalizeClass(unref(nsInput).e("count"))
}, toDisplayString$1(unref(textLength)) + " / " + toDisplayString$1(unref(attrs).maxlength), 7)) : createCommentVNode("v-if", true)
], 64))
], 16, _hoisted_1$e)), [
[vShow, _ctx.type !== "hidden"]
]);
};
}
});
var Input = /* @__PURE__ */ _export_sfc(_sfc_main$x, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/input/src/input.vue"]]);
const ElInput = withInstall(Input);
const GAP = 4;
const BAR_MAP = {
vertical: {
offset: "offsetHeight",
scroll: "scrollTop",
scrollSize: "scrollHeight",
size: "height",
key: "vertical",
axis: "Y",
client: "clientY",
direction: "top"
},
horizontal: {
offset: "offsetWidth",
scroll: "scrollLeft",
scrollSize: "scrollWidth",
size: "width",
key: "horizontal",
axis: "X",
client: "clientX",
direction: "left"
}
};
const renderThumbStyle = ({
move,
size: size2,
bar
}) => ({
[bar.size]: size2,
transform: `translate${bar.axis}(${move}%)`
});
const scrollbarContextKey = Symbol("scrollbarContextKey");
const thumbProps = buildProps({
vertical: Boolean,
size: String,
move: Number,
ratio: {
type: Number,
required: true
},
always: Boolean
});
const COMPONENT_NAME$3 = "Thumb";
const _sfc_main$w = /* @__PURE__ */ defineComponent({
__name: "thumb",
props: thumbProps,
setup(__props) {
const props = __props;
const scrollbar = inject(scrollbarContextKey);
const ns = useNamespace("scrollbar");
if (!scrollbar)
throwError(COMPONENT_NAME$3, "can not inject scrollbar context");
const instance = ref();
const thumb = ref();
const thumbState = ref({});
const visible = ref(false);
let cursorDown = false;
let cursorLeave = false;
let originalOnSelectStart = isClient$1 ? document.onselectstart : null;
const bar = computed(() => BAR_MAP[props.vertical ? "vertical" : "horizontal"]);
const thumbStyle = computed(() => renderThumbStyle({
size: props.size,
move: props.move,
bar: bar.value
}));
const offsetRatio = computed(() => instance.value[bar.value.offset] ** 2 / scrollbar.wrapElement[bar.value.scrollSize] / props.ratio / thumb.value[bar.value.offset]);
const clickThumbHandler = (e) => {
var _a2;
e.stopPropagation();
if (e.ctrlKey || [1, 2].includes(e.button))
return;
(_a2 = window.getSelection()) == null ? void 0 : _a2.removeAllRanges();
startDrag(e);
const el = e.currentTarget;
if (!el)
return;
thumbState.value[bar.value.axis] = el[bar.value.offset] - (e[bar.value.client] - el.getBoundingClientRect()[bar.value.direction]);
};
const clickTrackHandler = (e) => {
if (!thumb.value || !instance.value || !scrollbar.wrapElement)
return;
const offset = Math.abs(e.target.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]);
const thumbHalf = thumb.value[bar.value.offset] / 2;
const thumbPositionPercentage = (offset - thumbHalf) * 100 * offsetRatio.value / instance.value[bar.value.offset];
scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100;
};
const startDrag = (e) => {
e.stopImmediatePropagation();
cursorDown = true;
document.addEventListener("mousemove", mouseMoveDocumentHandler);
document.addEventListener("mouseup", mouseUpDocumentHandler);
originalOnSelectStart = document.onselectstart;
document.onselectstart = () => false;
};
const mouseMoveDocumentHandler = (e) => {
if (!instance.value || !thumb.value)
return;
if (cursorDown === false)
return;
const prevPage = thumbState.value[bar.value.axis];
if (!prevPage)
return;
const offset = (instance.value.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]) * -1;
const thumbClickPosition = thumb.value[bar.value.offset] - prevPage;
const thumbPositionPercentage = (offset - thumbClickPosition) * 100 * offsetRatio.value / instance.value[bar.value.offset];
scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100;
};
const mouseUpDocumentHandler = () => {
cursorDown = false;
thumbState.value[bar.value.axis] = 0;
document.removeEventListener("mousemove", mouseMoveDocumentHandler);
document.removeEventListener("mouseup", mouseUpDocumentHandler);
restoreOnselectstart();
if (cursorLeave)
visible.value = false;
};
const mouseMoveScrollbarHandler = () => {
cursorLeave = false;
visible.value = !!props.size;
};
const mouseLeaveScrollbarHandler = () => {
cursorLeave = true;
visible.value = cursorDown;
};
onBeforeUnmount(() => {
restoreOnselectstart();
document.removeEventListener("mouseup", mouseUpDocumentHandler);
});
const restoreOnselectstart = () => {
if (document.onselectstart !== originalOnSelectStart)
document.onselectstart = originalOnSelectStart;
};
useEventListener$1(toRef(scrollbar, "scrollbarElement"), "mousemove", mouseMoveScrollbarHandler);
useEventListener$1(toRef(scrollbar, "scrollbarElement"), "mouseleave", mouseLeaveScrollbarHandler);
return (_ctx, _cache) => {
return openBlock(), createBlock(Transition, {
name: unref(ns).b("fade"),
persisted: ""
}, {
default: withCtx(() => [
withDirectives(createBaseVNode("div", {
ref_key: "instance",
ref: instance,
class: normalizeClass([unref(ns).e("bar"), unref(ns).is(unref(bar).key)]),
onMousedown: clickTrackHandler
}, [
createBaseVNode("div", {
ref_key: "thumb",
ref: thumb,
class: normalizeClass(unref(ns).e("thumb")),
style: normalizeStyle(unref(thumbStyle)),
onMousedown: clickThumbHandler
}, null, 38)
], 34), [
[vShow, _ctx.always || visible.value]
])
]),
_: 1
}, 8, ["name"]);
};
}
});
var Thumb = /* @__PURE__ */ _export_sfc(_sfc_main$w, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/thumb.vue"]]);
const barProps = buildProps({
always: {
type: Boolean,
default: true
},
width: String,
height: String,
ratioX: {
type: Number,
default: 1
},
ratioY: {
type: Number,
default: 1
}
});
const _sfc_main$v = /* @__PURE__ */ defineComponent({
__name: "bar",
props: barProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const moveX = ref(0);
const moveY = ref(0);
const handleScroll = (wrap2) => {
if (wrap2) {
const offsetHeight = wrap2.offsetHeight - GAP;
const offsetWidth = wrap2.offsetWidth - GAP;
moveY.value = wrap2.scrollTop * 100 / offsetHeight * props.ratioY;
moveX.value = wrap2.scrollLeft * 100 / offsetWidth * props.ratioX;
}
};
expose2({
handleScroll
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock(Fragment$1, null, [
createVNode(Thumb, {
move: moveX.value,
ratio: _ctx.ratioX,
size: _ctx.width,
always: _ctx.always
}, null, 8, ["move", "ratio", "size", "always"]),
createVNode(Thumb, {
move: moveY.value,
ratio: _ctx.ratioY,
size: _ctx.height,
vertical: "",
always: _ctx.always
}, null, 8, ["move", "ratio", "size", "always"])
], 64);
};
}
});
var Bar = /* @__PURE__ */ _export_sfc(_sfc_main$v, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/bar.vue"]]);
const scrollbarProps = buildProps({
height: {
type: [String, Number],
default: ""
},
maxHeight: {
type: [String, Number],
default: ""
},
native: {
type: Boolean,
default: false
},
wrapStyle: {
type: definePropType([String, Object, Array]),
default: ""
},
wrapClass: {
type: [String, Array],
default: ""
},
viewClass: {
type: [String, Array],
default: ""
},
viewStyle: {
type: [String, Array, Object],
default: ""
},
noresize: Boolean,
tag: {
type: String,
default: "div"
},
always: Boolean,
minSize: {
type: Number,
default: 20
}
});
const scrollbarEmits = {
scroll: ({
scrollTop,
scrollLeft
}) => [scrollTop, scrollLeft].every(isNumber$1)
};
const COMPONENT_NAME$2 = "ElScrollbar";
const __default__$n = defineComponent({
name: COMPONENT_NAME$2
});
const _sfc_main$u = /* @__PURE__ */ defineComponent({
...__default__$n,
props: scrollbarProps,
emits: scrollbarEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const ns = useNamespace("scrollbar");
let stopResizeObserver = void 0;
let stopResizeListener = void 0;
const scrollbarRef = ref();
const wrapRef = ref();
const resizeRef = ref();
const sizeWidth = ref("0");
const sizeHeight = ref("0");
const barRef = ref();
const ratioY = ref(1);
const ratioX = ref(1);
const style = computed(() => {
const style2 = {};
if (props.height)
style2.height = addUnit(props.height);
if (props.maxHeight)
style2.maxHeight = addUnit(props.maxHeight);
return [props.wrapStyle, style2];
});
const wrapKls = computed(() => {
return [
props.wrapClass,
ns.e("wrap"),
{ [ns.em("wrap", "hidden-default")]: !props.native }
];
});
const resizeKls = computed(() => {
return [ns.e("view"), props.viewClass];
});
const handleScroll = () => {
var _a2;
if (wrapRef.value) {
(_a2 = barRef.value) == null ? void 0 : _a2.handleScroll(wrapRef.value);
emit2("scroll", {
scrollTop: wrapRef.value.scrollTop,
scrollLeft: wrapRef.value.scrollLeft
});
}
};
function scrollTo(arg1, arg2) {
if (isObject$3(arg1)) {
wrapRef.value.scrollTo(arg1);
} else if (isNumber$1(arg1) && isNumber$1(arg2)) {
wrapRef.value.scrollTo(arg1, arg2);
}
}
const setScrollTop = (value) => {
if (!isNumber$1(value)) {
return;
}
wrapRef.value.scrollTop = value;
};
const setScrollLeft = (value) => {
if (!isNumber$1(value)) {
return;
}
wrapRef.value.scrollLeft = value;
};
const update = () => {
if (!wrapRef.value)
return;
const offsetHeight = wrapRef.value.offsetHeight - GAP;
const offsetWidth = wrapRef.value.offsetWidth - GAP;
const originalHeight = offsetHeight ** 2 / wrapRef.value.scrollHeight;
const originalWidth = offsetWidth ** 2 / wrapRef.value.scrollWidth;
const height = Math.max(originalHeight, props.minSize);
const width = Math.max(originalWidth, props.minSize);
ratioY.value = originalHeight / (offsetHeight - originalHeight) / (height / (offsetHeight - height));
ratioX.value = originalWidth / (offsetWidth - originalWidth) / (width / (offsetWidth - width));
sizeHeight.value = height + GAP < offsetHeight ? `${height}px` : "";
sizeWidth.value = width + GAP < offsetWidth ? `${width}px` : "";
};
watch(() => props.noresize, (noresize) => {
if (noresize) {
stopResizeObserver == null ? void 0 : stopResizeObserver();
stopResizeListener == null ? void 0 : stopResizeListener();
} else {
({ stop: stopResizeObserver } = useResizeObserver(resizeRef, update));
stopResizeListener = useEventListener$1("resize", update);
}
}, { immediate: true });
watch(() => [props.maxHeight, props.height], () => {
if (!props.native)
nextTick(() => {
var _a2;
update();
if (wrapRef.value) {
(_a2 = barRef.value) == null ? void 0 : _a2.handleScroll(wrapRef.value);
}
});
});
provide(scrollbarContextKey, reactive({
scrollbarElement: scrollbarRef,
wrapElement: wrapRef
}));
onMounted(() => {
if (!props.native)
nextTick(() => {
update();
});
});
onUpdated(() => update());
expose2({
wrapRef,
update,
scrollTo,
setScrollTop,
setScrollLeft,
handleScroll
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
ref_key: "scrollbarRef",
ref: scrollbarRef,
class: normalizeClass(unref(ns).b())
}, [
createBaseVNode("div", {
ref_key: "wrapRef",
ref: wrapRef,
class: normalizeClass(unref(wrapKls)),
style: normalizeStyle(unref(style)),
onScroll: handleScroll
}, [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.tag), {
ref_key: "resizeRef",
ref: resizeRef,
class: normalizeClass(unref(resizeKls)),
style: normalizeStyle(_ctx.viewStyle)
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 8, ["class", "style"]))
], 38),
!_ctx.native ? (openBlock(), createBlock(Bar, {
key: 0,
ref_key: "barRef",
ref: barRef,
height: sizeHeight.value,
width: sizeWidth.value,
always: _ctx.always,
"ratio-x": ratioX.value,
"ratio-y": ratioY.value
}, null, 8, ["height", "width", "always", "ratio-x", "ratio-y"])) : createCommentVNode("v-if", true)
], 2);
};
}
});
var Scrollbar = /* @__PURE__ */ _export_sfc(_sfc_main$u, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/scrollbar.vue"]]);
const ElScrollbar = withInstall(Scrollbar);
const POPPER_INJECTION_KEY = Symbol("popper");
const POPPER_CONTENT_INJECTION_KEY = Symbol("popperContent");
const roleTypes = [
"dialog",
"grid",
"group",
"listbox",
"menu",
"navigation",
"tooltip",
"tree"
];
const popperProps = buildProps({
role: {
type: String,
values: roleTypes,
default: "tooltip"
}
});
const __default__$m = defineComponent({
name: "ElPopper",
inheritAttrs: false
});
const _sfc_main$t = /* @__PURE__ */ defineComponent({
...__default__$m,
props: popperProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const triggerRef2 = ref();
const popperInstanceRef = ref();
const contentRef = ref();
const referenceRef = ref();
const role = computed(() => props.role);
const popperProvides = {
triggerRef: triggerRef2,
popperInstanceRef,
contentRef,
referenceRef,
role
};
expose2(popperProvides);
provide(POPPER_INJECTION_KEY, popperProvides);
return (_ctx, _cache) => {
return renderSlot(_ctx.$slots, "default");
};
}
});
var Popper = /* @__PURE__ */ _export_sfc(_sfc_main$t, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/popper/src/popper.vue"]]);
const popperArrowProps = buildProps({
arrowOffset: {
type: Number,
default: 5
}
});
const __default__$l = defineComponent({
name: "ElPopperArrow",
inheritAttrs: false
});
const _sfc_main$s = /* @__PURE__ */ defineComponent({
...__default__$l,
props: popperArrowProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const ns = useNamespace("popper");
const { arrowOffset, arrowRef, arrowStyle } = inject(POPPER_CONTENT_INJECTION_KEY, void 0);
watch(() => props.arrowOffset, (val) => {
arrowOffset.value = val;
});
onBeforeUnmount(() => {
arrowRef.value = void 0;
});
expose2({
arrowRef
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("span", {
ref_key: "arrowRef",
ref: arrowRef,
class: normalizeClass(unref(ns).e("arrow")),
style: normalizeStyle(unref(arrowStyle)),
"data-popper-arrow": ""
}, null, 6);
};
}
});
var ElPopperArrow = /* @__PURE__ */ _export_sfc(_sfc_main$s, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/popper/src/arrow.vue"]]);
const NAME = "ElOnlyChild";
const OnlyChild = defineComponent({
name: NAME,
setup(_, {
slots,
attrs
}) {
var _a2;
const forwardRefInjection = inject(FORWARD_REF_INJECTION_KEY);
const forwardRefDirective = useForwardRefDirective((_a2 = forwardRefInjection == null ? void 0 : forwardRefInjection.setForwardRef) != null ? _a2 : NOOP);
return () => {
var _a22;
const defaultSlot = (_a22 = slots.default) == null ? void 0 : _a22.call(slots, attrs);
if (!defaultSlot)
return null;
if (defaultSlot.length > 1) {
return null;
}
const firstLegitNode = findFirstLegitChild(defaultSlot);
if (!firstLegitNode) {
return null;
}
return withDirectives(cloneVNode(firstLegitNode, attrs), [[forwardRefDirective]]);
};
}
});
function findFirstLegitChild(node) {
if (!node)
return null;
const children = node;
for (const child of children) {
if (isObject$3(child)) {
switch (child.type) {
case Comment:
continue;
case Text:
case "svg":
return wrapTextContent(child);
case Fragment$1:
return findFirstLegitChild(child.children);
default:
return child;
}
}
return wrapTextContent(child);
}
return null;
}
function wrapTextContent(s) {
const ns = useNamespace("only-child");
return createVNode("span", {
"class": ns.e("content")
}, [s]);
}
const popperTriggerProps = buildProps({
virtualRef: {
type: definePropType(Object)
},
virtualTriggering: Boolean,
onMouseenter: {
type: definePropType(Function)
},
onMouseleave: {
type: definePropType(Function)
},
onClick: {
type: definePropType(Function)
},
onKeydown: {
type: definePropType(Function)
},
onFocus: {
type: definePropType(Function)
},
onBlur: {
type: definePropType(Function)
},
onContextmenu: {
type: definePropType(Function)
},
id: String,
open: Boolean
});
const __default__$k = defineComponent({
name: "ElPopperTrigger",
inheritAttrs: false
});
const _sfc_main$r = /* @__PURE__ */ defineComponent({
...__default__$k,
props: popperTriggerProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const { role, triggerRef: triggerRef2 } = inject(POPPER_INJECTION_KEY, void 0);
useForwardRef(triggerRef2);
const ariaControls = computed(() => {
return ariaHaspopup.value ? props.id : void 0;
});
const ariaDescribedby = computed(() => {
if (role && role.value === "tooltip") {
return props.open && props.id ? props.id : void 0;
}
return void 0;
});
const ariaHaspopup = computed(() => {
if (role && role.value !== "tooltip") {
return role.value;
}
return void 0;
});
const ariaExpanded = computed(() => {
return ariaHaspopup.value ? `${props.open}` : void 0;
});
let virtualTriggerAriaStopWatch = void 0;
onMounted(() => {
watch(() => props.virtualRef, (virtualEl) => {
if (virtualEl) {
triggerRef2.value = unrefElement$1(virtualEl);
}
}, {
immediate: true
});
watch(triggerRef2, (el, prevEl) => {
virtualTriggerAriaStopWatch == null ? void 0 : virtualTriggerAriaStopWatch();
virtualTriggerAriaStopWatch = void 0;
if (isElement(el)) {
[
"onMouseenter",
"onMouseleave",
"onClick",
"onKeydown",
"onFocus",
"onBlur",
"onContextmenu"
].forEach((eventName) => {
var _a2;
const handler = props[eventName];
if (handler) {
el.addEventListener(eventName.slice(2).toLowerCase(), handler);
(_a2 = prevEl == null ? void 0 : prevEl.removeEventListener) == null ? void 0 : _a2.call(prevEl, eventName.slice(2).toLowerCase(), handler);
}
});
virtualTriggerAriaStopWatch = watch([ariaControls, ariaDescribedby, ariaHaspopup, ariaExpanded], (watches) => {
[
"aria-controls",
"aria-describedby",
"aria-haspopup",
"aria-expanded"
].forEach((key, idx) => {
isNil(watches[idx]) ? el.removeAttribute(key) : el.setAttribute(key, watches[idx]);
});
}, { immediate: true });
}
if (isElement(prevEl)) {
[
"aria-controls",
"aria-describedby",
"aria-haspopup",
"aria-expanded"
].forEach((key) => prevEl.removeAttribute(key));
}
}, {
immediate: true
});
});
onBeforeUnmount(() => {
virtualTriggerAriaStopWatch == null ? void 0 : virtualTriggerAriaStopWatch();
virtualTriggerAriaStopWatch = void 0;
});
expose2({
triggerRef: triggerRef2
});
return (_ctx, _cache) => {
return !_ctx.virtualTriggering ? (openBlock(), createBlock(unref(OnlyChild), mergeProps({ key: 0 }, _ctx.$attrs, {
"aria-controls": unref(ariaControls),
"aria-describedby": unref(ariaDescribedby),
"aria-expanded": unref(ariaExpanded),
"aria-haspopup": unref(ariaHaspopup)
}), {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : createCommentVNode("v-if", true);
};
}
});
var ElPopperTrigger = /* @__PURE__ */ _export_sfc(_sfc_main$r, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/popper/src/trigger.vue"]]);
const FOCUS_AFTER_TRAPPED = "focus-trap.focus-after-trapped";
const FOCUS_AFTER_RELEASED = "focus-trap.focus-after-released";
const FOCUSOUT_PREVENTED = "focus-trap.focusout-prevented";
const FOCUS_AFTER_TRAPPED_OPTS = {
cancelable: true,
bubbles: false
};
const FOCUSOUT_PREVENTED_OPTS = {
cancelable: true,
bubbles: false
};
const ON_TRAP_FOCUS_EVT = "focusAfterTrapped";
const ON_RELEASE_FOCUS_EVT = "focusAfterReleased";
const FOCUS_TRAP_INJECTION_KEY = Symbol("elFocusTrap");
const focusReason = ref();
const lastUserFocusTimestamp = ref(0);
const lastAutomatedFocusTimestamp = ref(0);
let focusReasonUserCount = 0;
const obtainAllFocusableElements = (element) => {
const nodes = [];
const walker = document.createTreeWalker(element, NodeFilter.SHOW_ELEMENT, {
acceptNode: (node) => {
const isHiddenInput = node.tagName === "INPUT" && node.type === "hidden";
if (node.disabled || node.hidden || isHiddenInput)
return NodeFilter.FILTER_SKIP;
return node.tabIndex >= 0 || node === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
}
});
while (walker.nextNode())
nodes.push(walker.currentNode);
return nodes;
};
const getVisibleElement = (elements, container) => {
for (const element of elements) {
if (!isHidden(element, container))
return element;
}
};
const isHidden = (element, container) => {
if (getComputedStyle(element).visibility === "hidden")
return true;
while (element) {
if (container && element === container)
return false;
if (getComputedStyle(element).display === "none")
return true;
element = element.parentElement;
}
return false;
};
const getEdges = (container) => {
const focusable = obtainAllFocusableElements(container);
const first = getVisibleElement(focusable, container);
const last2 = getVisibleElement(focusable.reverse(), container);
return [first, last2];
};
const isSelectable = (element) => {
return element instanceof HTMLInputElement && "select" in element;
};
const tryFocus = (element, shouldSelect) => {
if (element && element.focus) {
const prevFocusedElement = document.activeElement;
element.focus({ preventScroll: true });
lastAutomatedFocusTimestamp.value = window.performance.now();
if (element !== prevFocusedElement && isSelectable(element) && shouldSelect) {
element.select();
}
}
};
function removeFromStack(list, item) {
const copy = [...list];
const idx = list.indexOf(item);
if (idx !== -1) {
copy.splice(idx, 1);
}
return copy;
}
const createFocusableStack = () => {
let stack = [];
const push = (layer) => {
const currentLayer = stack[0];
if (currentLayer && layer !== currentLayer) {
currentLayer.pause();
}
stack = removeFromStack(stack, layer);
stack.unshift(layer);
};
const remove2 = (layer) => {
var _a2, _b;
stack = removeFromStack(stack, layer);
(_b = (_a2 = stack[0]) == null ? void 0 : _a2.resume) == null ? void 0 : _b.call(_a2);
};
return {
push,
remove: remove2
};
};
const focusFirstDescendant = (elements, shouldSelect = false) => {
const prevFocusedElement = document.activeElement;
for (const element of elements) {
tryFocus(element, shouldSelect);
if (document.activeElement !== prevFocusedElement)
return;
}
};
const focusableStack = createFocusableStack();
const isFocusCausedByUserEvent = () => {
return lastUserFocusTimestamp.value > lastAutomatedFocusTimestamp.value;
};
const notifyFocusReasonPointer = () => {
focusReason.value = "pointer";
lastUserFocusTimestamp.value = window.performance.now();
};
const notifyFocusReasonKeydown = () => {
focusReason.value = "keyboard";
lastUserFocusTimestamp.value = window.performance.now();
};
const useFocusReason = () => {
onMounted(() => {
if (focusReasonUserCount === 0) {
document.addEventListener("mousedown", notifyFocusReasonPointer);
document.addEventListener("touchstart", notifyFocusReasonPointer);
document.addEventListener("keydown", notifyFocusReasonKeydown);
}
focusReasonUserCount++;
});
onBeforeUnmount(() => {
focusReasonUserCount--;
if (focusReasonUserCount <= 0) {
document.removeEventListener("mousedown", notifyFocusReasonPointer);
document.removeEventListener("touchstart", notifyFocusReasonPointer);
document.removeEventListener("keydown", notifyFocusReasonKeydown);
}
});
return {
focusReason,
lastUserFocusTimestamp,
lastAutomatedFocusTimestamp
};
};
const createFocusOutPreventedEvent = (detail) => {
return new CustomEvent(FOCUSOUT_PREVENTED, {
...FOCUSOUT_PREVENTED_OPTS,
detail
});
};
const _sfc_main$q = defineComponent({
name: "ElFocusTrap",
inheritAttrs: false,
props: {
loop: Boolean,
trapped: Boolean,
focusTrapEl: Object,
focusStartEl: {
type: [Object, String],
default: "first"
}
},
emits: [
ON_TRAP_FOCUS_EVT,
ON_RELEASE_FOCUS_EVT,
"focusin",
"focusout",
"focusout-prevented",
"release-requested"
],
setup(props, { emit: emit2 }) {
const forwardRef = ref();
let lastFocusBeforeTrapped;
let lastFocusAfterTrapped;
const { focusReason: focusReason2 } = useFocusReason();
useEscapeKeydown((event) => {
if (props.trapped && !focusLayer.paused) {
emit2("release-requested", event);
}
});
const focusLayer = {
paused: false,
pause() {
this.paused = true;
},
resume() {
this.paused = false;
}
};
const onKeydown = (e) => {
if (!props.loop && !props.trapped)
return;
if (focusLayer.paused)
return;
const { key, altKey, ctrlKey, metaKey, currentTarget, shiftKey } = e;
const { loop } = props;
const isTabbing = key === EVENT_CODE.tab && !altKey && !ctrlKey && !metaKey;
const currentFocusingEl = document.activeElement;
if (isTabbing && currentFocusingEl) {
const container = currentTarget;
const [first, last2] = getEdges(container);
const isTabbable = first && last2;
if (!isTabbable) {
if (currentFocusingEl === container) {
const focusoutPreventedEvent = createFocusOutPreventedEvent({
focusReason: focusReason2.value
});
emit2("focusout-prevented", focusoutPreventedEvent);
if (!focusoutPreventedEvent.defaultPrevented) {
e.preventDefault();
}
}
} else {
if (!shiftKey && currentFocusingEl === last2) {
const focusoutPreventedEvent = createFocusOutPreventedEvent({
focusReason: focusReason2.value
});
emit2("focusout-prevented", focusoutPreventedEvent);
if (!focusoutPreventedEvent.defaultPrevented) {
e.preventDefault();
if (loop)
tryFocus(first, true);
}
} else if (shiftKey && [first, container].includes(currentFocusingEl)) {
const focusoutPreventedEvent = createFocusOutPreventedEvent({
focusReason: focusReason2.value
});
emit2("focusout-prevented", focusoutPreventedEvent);
if (!focusoutPreventedEvent.defaultPrevented) {
e.preventDefault();
if (loop)
tryFocus(last2, true);
}
}
}
}
};
provide(FOCUS_TRAP_INJECTION_KEY, {
focusTrapRef: forwardRef,
onKeydown
});
watch(() => props.focusTrapEl, (focusTrapEl) => {
if (focusTrapEl) {
forwardRef.value = focusTrapEl;
}
}, { immediate: true });
watch([forwardRef], ([forwardRef2], [oldForwardRef]) => {
if (forwardRef2) {
forwardRef2.addEventListener("keydown", onKeydown);
forwardRef2.addEventListener("focusin", onFocusIn);
forwardRef2.addEventListener("focusout", onFocusOut);
}
if (oldForwardRef) {
oldForwardRef.removeEventListener("keydown", onKeydown);
oldForwardRef.removeEventListener("focusin", onFocusIn);
oldForwardRef.removeEventListener("focusout", onFocusOut);
}
});
const trapOnFocus = (e) => {
emit2(ON_TRAP_FOCUS_EVT, e);
};
const releaseOnFocus = (e) => emit2(ON_RELEASE_FOCUS_EVT, e);
const onFocusIn = (e) => {
const trapContainer = unref(forwardRef);
if (!trapContainer)
return;
const target = e.target;
const relatedTarget = e.relatedTarget;
const isFocusedInTrap = target && trapContainer.contains(target);
if (!props.trapped) {
const isPrevFocusedInTrap = relatedTarget && trapContainer.contains(relatedTarget);
if (!isPrevFocusedInTrap) {
lastFocusBeforeTrapped = relatedTarget;
}
}
if (isFocusedInTrap)
emit2("focusin", e);
if (focusLayer.paused)
return;
if (props.trapped) {
if (isFocusedInTrap) {
lastFocusAfterTrapped = target;
} else {
tryFocus(lastFocusAfterTrapped, true);
}
}
};
const onFocusOut = (e) => {
const trapContainer = unref(forwardRef);
if (focusLayer.paused || !trapContainer)
return;
if (props.trapped) {
const relatedTarget = e.relatedTarget;
if (!isNil(relatedTarget) && !trapContainer.contains(relatedTarget)) {
setTimeout(() => {
if (!focusLayer.paused && props.trapped) {
const focusoutPreventedEvent = createFocusOutPreventedEvent({
focusReason: focusReason2.value
});
emit2("focusout-prevented", focusoutPreventedEvent);
if (!focusoutPreventedEvent.defaultPrevented) {
tryFocus(lastFocusAfterTrapped, true);
}
}
}, 0);
}
} else {
const target = e.target;
const isFocusedInTrap = target && trapContainer.contains(target);
if (!isFocusedInTrap)
emit2("focusout", e);
}
};
async function startTrap() {
await nextTick();
const trapContainer = unref(forwardRef);
if (trapContainer) {
focusableStack.push(focusLayer);
const prevFocusedElement = trapContainer.contains(document.activeElement) ? lastFocusBeforeTrapped : document.activeElement;
lastFocusBeforeTrapped = prevFocusedElement;
const isPrevFocusContained = trapContainer.contains(prevFocusedElement);
if (!isPrevFocusContained) {
const focusEvent = new Event(FOCUS_AFTER_TRAPPED, FOCUS_AFTER_TRAPPED_OPTS);
trapContainer.addEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus);
trapContainer.dispatchEvent(focusEvent);
if (!focusEvent.defaultPrevented) {
nextTick(() => {
let focusStartEl = props.focusStartEl;
if (!isString$2(focusStartEl)) {
tryFocus(focusStartEl);
if (document.activeElement !== focusStartEl) {
focusStartEl = "first";
}
}
if (focusStartEl === "first") {
focusFirstDescendant(obtainAllFocusableElements(trapContainer), true);
}
if (document.activeElement === prevFocusedElement || focusStartEl === "container") {
tryFocus(trapContainer);
}
});
}
}
}
}
function stopTrap() {
const trapContainer = unref(forwardRef);
if (trapContainer) {
trapContainer.removeEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus);
const releasedEvent = new CustomEvent(FOCUS_AFTER_RELEASED, {
...FOCUS_AFTER_TRAPPED_OPTS,
detail: {
focusReason: focusReason2.value
}
});
trapContainer.addEventListener(FOCUS_AFTER_RELEASED, releaseOnFocus);
trapContainer.dispatchEvent(releasedEvent);
if (!releasedEvent.defaultPrevented && (focusReason2.value == "keyboard" || !isFocusCausedByUserEvent() || trapContainer.contains(document.activeElement))) {
tryFocus(lastFocusBeforeTrapped != null ? lastFocusBeforeTrapped : document.body);
}
trapContainer.removeEventListener(FOCUS_AFTER_RELEASED, trapOnFocus);
focusableStack.remove(focusLayer);
}
}
onMounted(() => {
if (props.trapped) {
startTrap();
}
watch(() => props.trapped, (trapped) => {
if (trapped) {
startTrap();
} else {
stopTrap();
}
});
});
onBeforeUnmount(() => {
if (props.trapped) {
stopTrap();
}
});
return {
onKeydown
};
}
});
function _sfc_render$4(_ctx, _cache, $props, $setup, $data, $options) {
return renderSlot(_ctx.$slots, "default", { handleKeydown: _ctx.onKeydown });
}
var ElFocusTrap = /* @__PURE__ */ _export_sfc(_sfc_main$q, [["render", _sfc_render$4], ["__file", "/home/runner/work/element-plus/element-plus/packages/components/focus-trap/src/focus-trap.vue"]]);
const POSITIONING_STRATEGIES = ["fixed", "absolute"];
const popperCoreConfigProps = buildProps({
boundariesPadding: {
type: Number,
default: 0
},
fallbackPlacements: {
type: definePropType(Array),
default: void 0
},
gpuAcceleration: {
type: Boolean,
default: true
},
offset: {
type: Number,
default: 12
},
placement: {
type: String,
values: Ee,
default: "bottom"
},
popperOptions: {
type: definePropType(Object),
default: () => ({})
},
strategy: {
type: String,
values: POSITIONING_STRATEGIES,
default: "absolute"
}
});
const popperContentProps = buildProps({
...popperCoreConfigProps,
id: String,
style: {
type: definePropType([String, Array, Object])
},
className: {
type: definePropType([String, Array, Object])
},
effect: {
type: String,
default: "dark"
},
visible: Boolean,
enterable: {
type: Boolean,
default: true
},
pure: Boolean,
focusOnShow: {
type: Boolean,
default: false
},
trapping: {
type: Boolean,
default: false
},
popperClass: {
type: definePropType([String, Array, Object])
},
popperStyle: {
type: definePropType([String, Array, Object])
},
referenceEl: {
type: definePropType(Object)
},
triggerTargetEl: {
type: definePropType(Object)
},
stopPopperMouseEvent: {
type: Boolean,
default: true
},
ariaLabel: {
type: String,
default: void 0
},
virtualTriggering: Boolean,
zIndex: Number
});
const popperContentEmits = {
mouseenter: (evt) => evt instanceof MouseEvent,
mouseleave: (evt) => evt instanceof MouseEvent,
focus: () => true,
blur: () => true,
close: () => true
};
const buildPopperOptions = (props, modifiers = []) => {
const { placement, strategy, popperOptions } = props;
const options = {
placement,
strategy,
...popperOptions,
modifiers: [...genModifiers(props), ...modifiers]
};
deriveExtraModifiers(options, popperOptions == null ? void 0 : popperOptions.modifiers);
return options;
};
const unwrapMeasurableEl = ($el) => {
if (!isClient$1)
return;
return unrefElement$1($el);
};
function genModifiers(options) {
const { offset, gpuAcceleration, fallbackPlacements } = options;
return [
{
name: "offset",
options: {
offset: [0, offset != null ? offset : 12]
}
},
{
name: "preventOverflow",
options: {
padding: {
top: 2,
bottom: 2,
left: 5,
right: 5
}
}
},
{
name: "flip",
options: {
padding: 5,
fallbackPlacements
}
},
{
name: "computeStyles",
options: {
gpuAcceleration
}
}
];
}
function deriveExtraModifiers(options, modifiers) {
if (modifiers) {
options.modifiers = [...options.modifiers, ...modifiers != null ? modifiers : []];
}
}
const DEFAULT_ARROW_OFFSET = 0;
const usePopperContent = (props) => {
const { popperInstanceRef, contentRef, triggerRef: triggerRef2, role } = inject(POPPER_INJECTION_KEY, void 0);
const arrowRef = ref();
const arrowOffset = ref();
const eventListenerModifier = computed(() => {
return {
name: "eventListeners",
enabled: !!props.visible
};
});
const arrowModifier = computed(() => {
var _a2;
const arrowEl = unref(arrowRef);
const offset = (_a2 = unref(arrowOffset)) != null ? _a2 : DEFAULT_ARROW_OFFSET;
return {
name: "arrow",
enabled: !isUndefined$1(arrowEl),
options: {
element: arrowEl,
padding: offset
}
};
});
const options = computed(() => {
return {
onFirstUpdate: () => {
update();
},
...buildPopperOptions(props, [
unref(arrowModifier),
unref(eventListenerModifier)
])
};
});
const computedReference = computed(() => unwrapMeasurableEl(props.referenceEl) || unref(triggerRef2));
const { attributes, state, styles, update, forceUpdate, instanceRef } = usePopper(computedReference, contentRef, options);
watch(instanceRef, (instance) => popperInstanceRef.value = instance);
onMounted(() => {
watch(() => {
var _a2;
return (_a2 = unref(computedReference)) == null ? void 0 : _a2.getBoundingClientRect();
}, () => {
update();
});
});
return {
attributes,
arrowRef,
contentRef,
instanceRef,
state,
styles,
role,
forceUpdate,
update
};
};
const usePopperContentDOM = (props, {
attributes,
styles,
role
}) => {
const { nextZIndex } = useZIndex();
const ns = useNamespace("popper");
const contentAttrs = computed(() => unref(attributes).popper);
const contentZIndex = ref(props.zIndex || nextZIndex());
const contentClass = computed(() => [
ns.b(),
ns.is("pure", props.pure),
ns.is(props.effect),
props.popperClass
]);
const contentStyle = computed(() => {
return [
{ zIndex: unref(contentZIndex) },
props.popperStyle || {},
unref(styles).popper
];
});
const ariaModal = computed(() => role.value === "dialog" ? "false" : void 0);
const arrowStyle = computed(() => unref(styles).arrow || {});
const updateZIndex = () => {
contentZIndex.value = props.zIndex || nextZIndex();
};
return {
ariaModal,
arrowStyle,
contentAttrs,
contentClass,
contentStyle,
contentZIndex,
updateZIndex
};
};
const usePopperContentFocusTrap = (props, emit2) => {
const trapped = ref(false);
const focusStartRef = ref();
const onFocusAfterTrapped = () => {
emit2("focus");
};
const onFocusAfterReleased = (event) => {
var _a2;
if (((_a2 = event.detail) == null ? void 0 : _a2.focusReason) !== "pointer") {
focusStartRef.value = "first";
emit2("blur");
}
};
const onFocusInTrap = (event) => {
if (props.visible && !trapped.value) {
if (event.target) {
focusStartRef.value = event.target;
}
trapped.value = true;
}
};
const onFocusoutPrevented = (event) => {
if (!props.trapping) {
if (event.detail.focusReason === "pointer") {
event.preventDefault();
}
trapped.value = false;
}
};
const onReleaseRequested = () => {
trapped.value = false;
emit2("close");
};
return {
focusStartRef,
trapped,
onFocusAfterReleased,
onFocusAfterTrapped,
onFocusInTrap,
onFocusoutPrevented,
onReleaseRequested
};
};
const __default__$j = defineComponent({
name: "ElPopperContent"
});
const _sfc_main$p = /* @__PURE__ */ defineComponent({
...__default__$j,
props: popperContentProps,
emits: popperContentEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const {
focusStartRef,
trapped,
onFocusAfterReleased,
onFocusAfterTrapped,
onFocusInTrap,
onFocusoutPrevented,
onReleaseRequested
} = usePopperContentFocusTrap(props, emit2);
const { attributes, arrowRef, contentRef, styles, instanceRef, role, update } = usePopperContent(props);
const {
ariaModal,
arrowStyle,
contentAttrs,
contentClass,
contentStyle,
updateZIndex
} = usePopperContentDOM(props, {
styles,
attributes,
role
});
const formItemContext = inject(formItemContextKey, void 0);
const arrowOffset = ref();
provide(POPPER_CONTENT_INJECTION_KEY, {
arrowStyle,
arrowRef,
arrowOffset
});
if (formItemContext && (formItemContext.addInputId || formItemContext.removeInputId)) {
provide(formItemContextKey, {
...formItemContext,
addInputId: NOOP,
removeInputId: NOOP
});
}
let triggerTargetAriaStopWatch = void 0;
const updatePopper = (shouldUpdateZIndex = true) => {
update();
shouldUpdateZIndex && updateZIndex();
};
const togglePopperAlive = () => {
updatePopper(false);
if (props.visible && props.focusOnShow) {
trapped.value = true;
} else if (props.visible === false) {
trapped.value = false;
}
};
onMounted(() => {
watch(() => props.triggerTargetEl, (triggerTargetEl, prevTriggerTargetEl) => {
triggerTargetAriaStopWatch == null ? void 0 : triggerTargetAriaStopWatch();
triggerTargetAriaStopWatch = void 0;
const el = unref(triggerTargetEl || contentRef.value);
const prevEl = unref(prevTriggerTargetEl || contentRef.value);
if (isElement(el)) {
triggerTargetAriaStopWatch = watch([role, () => props.ariaLabel, ariaModal, () => props.id], (watches) => {
["role", "aria-label", "aria-modal", "id"].forEach((key, idx) => {
isNil(watches[idx]) ? el.removeAttribute(key) : el.setAttribute(key, watches[idx]);
});
}, { immediate: true });
}
if (prevEl !== el && isElement(prevEl)) {
["role", "aria-label", "aria-modal", "id"].forEach((key) => {
prevEl.removeAttribute(key);
});
}
}, { immediate: true });
watch(() => props.visible, togglePopperAlive, { immediate: true });
});
onBeforeUnmount(() => {
triggerTargetAriaStopWatch == null ? void 0 : triggerTargetAriaStopWatch();
triggerTargetAriaStopWatch = void 0;
});
expose2({
popperContentRef: contentRef,
popperInstanceRef: instanceRef,
updatePopper,
contentStyle
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", mergeProps({
ref_key: "contentRef",
ref: contentRef
}, unref(contentAttrs), {
style: unref(contentStyle),
class: unref(contentClass),
tabindex: "-1",
onMouseenter: _cache[0] || (_cache[0] = (e) => _ctx.$emit("mouseenter", e)),
onMouseleave: _cache[1] || (_cache[1] = (e) => _ctx.$emit("mouseleave", e))
}), [
createVNode(unref(ElFocusTrap), {
trapped: unref(trapped),
"trap-on-focus-in": true,
"focus-trap-el": unref(contentRef),
"focus-start-el": unref(focusStartRef),
onFocusAfterTrapped: unref(onFocusAfterTrapped),
onFocusAfterReleased: unref(onFocusAfterReleased),
onFocusin: unref(onFocusInTrap),
onFocusoutPrevented: unref(onFocusoutPrevented),
onReleaseRequested: unref(onReleaseRequested)
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])
], 16);
};
}
});
var ElPopperContent = /* @__PURE__ */ _export_sfc(_sfc_main$p, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/popper/src/content.vue"]]);
const ElPopper = withInstall(Popper);
const TOOLTIP_INJECTION_KEY = Symbol("elTooltip");
const useTooltipContentProps = buildProps({
...useDelayedToggleProps,
...popperContentProps,
appendTo: {
type: definePropType([String, Object])
},
content: {
type: String,
default: ""
},
rawContent: {
type: Boolean,
default: false
},
persistent: Boolean,
ariaLabel: String,
visible: {
type: definePropType(Boolean),
default: null
},
transition: String,
teleported: {
type: Boolean,
default: true
},
disabled: Boolean
});
const useTooltipTriggerProps = buildProps({
...popperTriggerProps,
disabled: Boolean,
trigger: {
type: definePropType([String, Array]),
default: "hover"
},
triggerKeys: {
type: definePropType(Array),
default: () => [EVENT_CODE.enter, EVENT_CODE.space]
}
});
const {
useModelToggleProps: useTooltipModelToggleProps,
useModelToggleEmits: useTooltipModelToggleEmits,
useModelToggle: useTooltipModelToggle
} = createModelToggleComposable("visible");
const useTooltipProps = buildProps({
...popperProps,
...useTooltipModelToggleProps,
...useTooltipContentProps,
...useTooltipTriggerProps,
...popperArrowProps,
showArrow: {
type: Boolean,
default: true
}
});
const tooltipEmits = [
...useTooltipModelToggleEmits,
"before-show",
"before-hide",
"show",
"hide",
"open",
"close"
];
const isTriggerType = (trigger2, type2) => {
if (isArray$3(trigger2)) {
return trigger2.includes(type2);
}
return trigger2 === type2;
};
const whenTrigger = (trigger2, type2, handler) => {
return (e) => {
isTriggerType(unref(trigger2), type2) && handler(e);
};
};
const __default__$i = defineComponent({
name: "ElTooltipTrigger"
});
const _sfc_main$o = /* @__PURE__ */ defineComponent({
...__default__$i,
props: useTooltipTriggerProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const ns = useNamespace("tooltip");
const { controlled, id, open: open2, onOpen, onClose, onToggle } = inject(TOOLTIP_INJECTION_KEY, void 0);
const triggerRef2 = ref(null);
const stopWhenControlledOrDisabled = () => {
if (unref(controlled) || props.disabled) {
return true;
}
};
const trigger2 = toRef(props, "trigger");
const onMouseenter = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "hover", onOpen));
const onMouseleave = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "hover", onClose));
const onClick = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "click", (e) => {
if (e.button === 0) {
onToggle(e);
}
}));
const onFocus = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "focus", onOpen));
const onBlur = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "focus", onClose));
const onContextMenu = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger2, "contextmenu", (e) => {
e.preventDefault();
onToggle(e);
}));
const onKeydown = composeEventHandlers(stopWhenControlledOrDisabled, (e) => {
const { code: code2 } = e;
if (props.triggerKeys.includes(code2)) {
e.preventDefault();
onToggle(e);
}
});
expose2({
triggerRef: triggerRef2
});
return (_ctx, _cache) => {
return openBlock(), createBlock(unref(ElPopperTrigger), {
id: unref(id),
"virtual-ref": _ctx.virtualRef,
open: unref(open2),
"virtual-triggering": _ctx.virtualTriggering,
class: normalizeClass(unref(ns).e("trigger")),
onBlur: unref(onBlur),
onClick: unref(onClick),
onContextmenu: unref(onContextMenu),
onFocus: unref(onFocus),
onMouseenter: unref(onMouseenter),
onMouseleave: unref(onMouseleave),
onKeydown: unref(onKeydown)
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]);
};
}
});
var ElTooltipTrigger = /* @__PURE__ */ _export_sfc(_sfc_main$o, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/trigger.vue"]]);
const __default__$h = defineComponent({
name: "ElTooltipContent",
inheritAttrs: false
});
const _sfc_main$n = /* @__PURE__ */ defineComponent({
...__default__$h,
props: useTooltipContentProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const { selector } = usePopperContainerId();
const ns = useNamespace("tooltip");
const contentRef = ref(null);
const destroyed = ref(false);
const {
controlled,
id,
open: open2,
trigger: trigger2,
onClose,
onOpen,
onShow,
onHide,
onBeforeShow,
onBeforeHide
} = inject(TOOLTIP_INJECTION_KEY, void 0);
const transitionClass = computed(() => {
return props.transition || `${ns.namespace.value}-fade-in-linear`;
});
const persistentRef = computed(() => {
return props.persistent;
});
onBeforeUnmount(() => {
destroyed.value = true;
});
const shouldRender = computed(() => {
return unref(persistentRef) ? true : unref(open2);
});
const shouldShow = computed(() => {
return props.disabled ? false : unref(open2);
});
const appendTo = computed(() => {
return props.appendTo || selector.value;
});
const contentStyle = computed(() => {
var _a2;
return (_a2 = props.style) != null ? _a2 : {};
});
const ariaHidden = computed(() => !unref(open2));
const onTransitionLeave = () => {
onHide();
};
const stopWhenControlled = () => {
if (unref(controlled))
return true;
};
const onContentEnter = composeEventHandlers(stopWhenControlled, () => {
if (props.enterable && unref(trigger2) === "hover") {
onOpen();
}
});
const onContentLeave = composeEventHandlers(stopWhenControlled, () => {
if (unref(trigger2) === "hover") {
onClose();
}
});
const onBeforeEnter = () => {
var _a2, _b;
(_b = (_a2 = contentRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
onBeforeShow == null ? void 0 : onBeforeShow();
};
const onBeforeLeave = () => {
onBeforeHide == null ? void 0 : onBeforeHide();
};
const onAfterShow = () => {
onShow();
stopHandle = onClickOutside(computed(() => {
var _a2;
return (_a2 = contentRef.value) == null ? void 0 : _a2.popperContentRef;
}), () => {
if (unref(controlled))
return;
const $trigger = unref(trigger2);
if ($trigger !== "hover") {
onClose();
}
});
};
const onBlur = () => {
if (!props.virtualTriggering) {
onClose();
}
};
let stopHandle;
watch(() => unref(open2), (val) => {
if (!val) {
stopHandle == null ? void 0 : stopHandle();
}
}, {
flush: "post"
});
watch(() => props.content, () => {
var _a2, _b;
(_b = (_a2 = contentRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
});
expose2({
contentRef
});
return (_ctx, _cache) => {
return openBlock(), createBlock(Teleport, {
disabled: !_ctx.teleported,
to: unref(appendTo)
}, [
createVNode(Transition, {
name: unref(transitionClass),
onAfterLeave: onTransitionLeave,
onBeforeEnter,
onAfterEnter: onAfterShow,
onBeforeLeave
}, {
default: withCtx(() => [
unref(shouldRender) ? withDirectives((openBlock(), createBlock(unref(ElPopperContent), mergeProps({
key: 0,
id: unref(id),
ref_key: "contentRef",
ref: contentRef
}, _ctx.$attrs, {
"aria-label": _ctx.ariaLabel,
"aria-hidden": unref(ariaHidden),
"boundaries-padding": _ctx.boundariesPadding,
"fallback-placements": _ctx.fallbackPlacements,
"gpu-acceleration": _ctx.gpuAcceleration,
offset: _ctx.offset,
placement: _ctx.placement,
"popper-options": _ctx.popperOptions,
strategy: _ctx.strategy,
effect: _ctx.effect,
enterable: _ctx.enterable,
pure: _ctx.pure,
"popper-class": _ctx.popperClass,
"popper-style": [_ctx.popperStyle, unref(contentStyle)],
"reference-el": _ctx.referenceEl,
"trigger-target-el": _ctx.triggerTargetEl,
visible: unref(shouldShow),
"z-index": _ctx.zIndex,
onMouseenter: unref(onContentEnter),
onMouseleave: unref(onContentLeave),
onBlur,
onClose: unref(onClose)
}), {
default: withCtx(() => [
!destroyed.value ? renderSlot(_ctx.$slots, "default", { key: 0 }) : createCommentVNode("v-if", true)
]),
_: 3
}, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [
[vShow, unref(shouldShow)]
]) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["name"])
], 8, ["disabled", "to"]);
};
}
});
var ElTooltipContent = /* @__PURE__ */ _export_sfc(_sfc_main$n, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/content.vue"]]);
const _hoisted_1$d = ["innerHTML"];
const _hoisted_2$a = { key: 1 };
const __default__$g = defineComponent({
name: "ElTooltip"
});
const _sfc_main$m = /* @__PURE__ */ defineComponent({
...__default__$g,
props: useTooltipProps,
emits: tooltipEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
usePopperContainer();
const id = useId();
const popperRef = ref();
const contentRef = ref();
const updatePopper = () => {
var _a2;
const popperComponent = unref(popperRef);
if (popperComponent) {
(_a2 = popperComponent.popperInstanceRef) == null ? void 0 : _a2.update();
}
};
const open2 = ref(false);
const toggleReason = ref();
const { show, hide, hasUpdateHandler } = useTooltipModelToggle({
indicator: open2,
toggleReason
});
const { onOpen, onClose } = useDelayedToggle({
showAfter: toRef(props, "showAfter"),
hideAfter: toRef(props, "hideAfter"),
autoClose: toRef(props, "autoClose"),
open: show,
close: hide
});
const controlled = computed(() => isBoolean$1(props.visible) && !hasUpdateHandler.value);
provide(TOOLTIP_INJECTION_KEY, {
controlled,
id,
open: readonly(open2),
trigger: toRef(props, "trigger"),
onOpen: (event) => {
onOpen(event);
},
onClose: (event) => {
onClose(event);
},
onToggle: (event) => {
if (unref(open2)) {
onClose(event);
} else {
onOpen(event);
}
},
onShow: () => {
emit2("show", toggleReason.value);
},
onHide: () => {
emit2("hide", toggleReason.value);
},
onBeforeShow: () => {
emit2("before-show", toggleReason.value);
},
onBeforeHide: () => {
emit2("before-hide", toggleReason.value);
},
updatePopper
});
watch(() => props.disabled, (disabled) => {
if (disabled && open2.value) {
open2.value = false;
}
});
const isFocusInsideContent = () => {
var _a2, _b;
const popperContent = (_b = (_a2 = contentRef.value) == null ? void 0 : _a2.contentRef) == null ? void 0 : _b.popperContentRef;
return popperContent && popperContent.contains(document.activeElement);
};
onDeactivated(() => open2.value && hide());
expose2({
popperRef,
contentRef,
isFocusInsideContent,
updatePopper,
onOpen,
onClose,
hide
});
return (_ctx, _cache) => {
return openBlock(), createBlock(unref(ElPopper), {
ref_key: "popperRef",
ref: popperRef,
role: _ctx.role
}, {
default: withCtx(() => [
createVNode(ElTooltipTrigger, {
disabled: _ctx.disabled,
trigger: _ctx.trigger,
"trigger-keys": _ctx.triggerKeys,
"virtual-ref": _ctx.virtualRef,
"virtual-triggering": _ctx.virtualTriggering
}, {
default: withCtx(() => [
_ctx.$slots.default ? renderSlot(_ctx.$slots, "default", { key: 0 }) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]),
createVNode(ElTooltipContent, {
ref_key: "contentRef",
ref: contentRef,
"aria-label": _ctx.ariaLabel,
"boundaries-padding": _ctx.boundariesPadding,
content: _ctx.content,
disabled: _ctx.disabled,
effect: _ctx.effect,
enterable: _ctx.enterable,
"fallback-placements": _ctx.fallbackPlacements,
"hide-after": _ctx.hideAfter,
"gpu-acceleration": _ctx.gpuAcceleration,
offset: _ctx.offset,
persistent: _ctx.persistent,
"popper-class": _ctx.popperClass,
"popper-style": _ctx.popperStyle,
placement: _ctx.placement,
"popper-options": _ctx.popperOptions,
pure: _ctx.pure,
"raw-content": _ctx.rawContent,
"reference-el": _ctx.referenceEl,
"trigger-target-el": _ctx.triggerTargetEl,
"show-after": _ctx.showAfter,
strategy: _ctx.strategy,
teleported: _ctx.teleported,
transition: _ctx.transition,
"virtual-triggering": _ctx.virtualTriggering,
"z-index": _ctx.zIndex,
"append-to": _ctx.appendTo
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "content", {}, () => [
_ctx.rawContent ? (openBlock(), createElementBlock("span", {
key: 0,
innerHTML: _ctx.content
}, null, 8, _hoisted_1$d)) : (openBlock(), createElementBlock("span", _hoisted_2$a, toDisplayString$1(_ctx.content), 1))
]),
_ctx.showArrow ? (openBlock(), createBlock(unref(ElPopperArrow), {
key: 0,
"arrow-offset": _ctx.arrowOffset
}, null, 8, ["arrow-offset"])) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])
]),
_: 3
}, 8, ["role"]);
};
}
});
var Tooltip = /* @__PURE__ */ _export_sfc(_sfc_main$m, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/tooltip.vue"]]);
const ElTooltip = withInstall(Tooltip);
const badgeProps = buildProps({
value: {
type: [String, Number],
default: ""
},
max: {
type: Number,
default: 99
},
isDot: Boolean,
hidden: Boolean,
type: {
type: String,
values: ["primary", "success", "warning", "info", "danger"],
default: "danger"
}
});
const _hoisted_1$c = ["textContent"];
const __default__$f = defineComponent({
name: "ElBadge"
});
const _sfc_main$l = /* @__PURE__ */ defineComponent({
...__default__$f,
props: badgeProps,
setup(__props, { expose: expose2 }) {
const props = __props;
const ns = useNamespace("badge");
const content = computed(() => {
if (props.isDot)
return "";
if (isNumber$1(props.value) && isNumber$1(props.max)) {
return props.max < props.value ? `${props.max}+` : `${props.value}`;
}
return `${props.value}`;
});
expose2({
content
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass(unref(ns).b())
}, [
renderSlot(_ctx.$slots, "default"),
createVNode(Transition, {
name: `${unref(ns).namespace.value}-zoom-in-center`,
persisted: ""
}, {
default: withCtx(() => [
withDirectives(createBaseVNode("sup", {
class: normalizeClass([
unref(ns).e("content"),
unref(ns).em("content", _ctx.type),
unref(ns).is("fixed", !!_ctx.$slots.default),
unref(ns).is("dot", _ctx.isDot)
]),
textContent: toDisplayString$1(unref(content))
}, null, 10, _hoisted_1$c), [
[vShow, !_ctx.hidden && (unref(content) || _ctx.isDot)]
])
]),
_: 1
}, 8, ["name"])
], 2);
};
}
});
var Badge = /* @__PURE__ */ _export_sfc(_sfc_main$l, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/badge/src/badge.vue"]]);
const ElBadge = withInstall(Badge);
const buttonGroupContextKey = Symbol("buttonGroupContextKey");
const useButton = (props, emit2) => {
useDeprecated({
from: "type.text",
replacement: "link",
version: "3.0.0",
scope: "props",
ref: "https://element-plus.org/en-US/component/button.html#button-attributes"
}, computed(() => props.type === "text"));
const buttonGroupContext = inject(buttonGroupContextKey, void 0);
const globalConfig2 = useGlobalConfig("button");
const { form } = useFormItem();
const _size = useFormSize(computed(() => buttonGroupContext == null ? void 0 : buttonGroupContext.size));
const _disabled = useFormDisabled();
const _ref = ref();
const slots = useSlots();
const _type = computed(() => props.type || (buttonGroupContext == null ? void 0 : buttonGroupContext.type) || "");
const autoInsertSpace = computed(() => {
var _a2, _b, _c;
return (_c = (_b = props.autoInsertSpace) != null ? _b : (_a2 = globalConfig2.value) == null ? void 0 : _a2.autoInsertSpace) != null ? _c : false;
});
const _props = computed(() => {
if (props.tag === "button") {
return {
ariaDisabled: _disabled.value || props.loading,
disabled: _disabled.value || props.loading,
autofocus: props.autofocus,
type: props.nativeType
};
}
return {};
});
const shouldAddSpace = computed(() => {
var _a2;
const defaultSlot = (_a2 = slots.default) == null ? void 0 : _a2.call(slots);
if (autoInsertSpace.value && (defaultSlot == null ? void 0 : defaultSlot.length) === 1) {
const slot = defaultSlot[0];
if ((slot == null ? void 0 : slot.type) === Text) {
const text = slot.children;
return /^\p{Unified_Ideograph}{2}$/u.test(text.trim());
}
}
return false;
});
const handleClick = (evt) => {
if (props.nativeType === "reset") {
form == null ? void 0 : form.resetFields();
}
emit2("click", evt);
};
return {
_disabled,
_size,
_type,
_ref,
_props,
shouldAddSpace,
handleClick
};
};
const buttonTypes = [
"default",
"primary",
"success",
"warning",
"info",
"danger",
"text",
""
];
const buttonNativeTypes = ["button", "submit", "reset"];
const buttonProps = buildProps({
size: useSizeProp,
disabled: Boolean,
type: {
type: String,
values: buttonTypes,
default: ""
},
icon: {
type: iconPropType
},
nativeType: {
type: String,
values: buttonNativeTypes,
default: "button"
},
loading: Boolean,
loadingIcon: {
type: iconPropType,
default: () => loading_default
},
plain: Boolean,
text: Boolean,
link: Boolean,
bg: Boolean,
autofocus: Boolean,
round: Boolean,
circle: Boolean,
color: String,
dark: Boolean,
autoInsertSpace: {
type: Boolean,
default: void 0
},
tag: {
type: definePropType([String, Object]),
default: "button"
}
});
const buttonEmits = {
click: (evt) => evt instanceof MouseEvent
};
function bound01(n, max) {
if (isOnePointZero(n)) {
n = "100%";
}
var isPercent = isPercentage(n);
n = max === 360 ? n : Math.min(max, Math.max(0, parseFloat(n)));
if (isPercent) {
n = parseInt(String(n * max), 10) / 100;
}
if (Math.abs(n - max) < 1e-6) {
return 1;
}
if (max === 360) {
n = (n < 0 ? n % max + max : n % max) / parseFloat(String(max));
} else {
n = n % max / parseFloat(String(max));
}
return n;
}
function clamp01(val) {
return Math.min(1, Math.max(0, val));
}
function isOnePointZero(n) {
return typeof n === "string" && n.indexOf(".") !== -1 && parseFloat(n) === 1;
}
function isPercentage(n) {
return typeof n === "string" && n.indexOf("%") !== -1;
}
function boundAlpha(a) {
a = parseFloat(a);
if (isNaN(a) || a < 0 || a > 1) {
a = 1;
}
return a;
}
function convertToPercentage(n) {
if (n <= 1) {
return "".concat(Number(n) * 100, "%");
}
return n;
}
function pad2(c) {
return c.length === 1 ? "0" + c : String(c);
}
function rgbToRgb(r, g, b) {
return {
r: bound01(r, 255) * 255,
g: bound01(g, 255) * 255,
b: bound01(b, 255) * 255
};
}
function rgbToHsl(r, g, b) {
r = bound01(r, 255);
g = bound01(g, 255);
b = bound01(b, 255);
var max = Math.max(r, g, b);
var min = Math.min(r, g, b);
var h2 = 0;
var s = 0;
var l = (max + min) / 2;
if (max === min) {
s = 0;
h2 = 0;
} else {
var d = max - min;
s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
switch (max) {
case r:
h2 = (g - b) / d + (g < b ? 6 : 0);
break;
case g:
h2 = (b - r) / d + 2;
break;
case b:
h2 = (r - g) / d + 4;
break;
}
h2 /= 6;
}
return { h: h2, s, l };
}
function hue2rgb(p2, q2, t2) {
if (t2 < 0) {
t2 += 1;
}
if (t2 > 1) {
t2 -= 1;
}
if (t2 < 1 / 6) {
return p2 + (q2 - p2) * (6 * t2);
}
if (t2 < 1 / 2) {
return q2;
}
if (t2 < 2 / 3) {
return p2 + (q2 - p2) * (2 / 3 - t2) * 6;
}
return p2;
}
function hslToRgb(h2, s, l) {
var r;
var g;
var b;
h2 = bound01(h2, 360);
s = bound01(s, 100);
l = bound01(l, 100);
if (s === 0) {
g = l;
b = l;
r = l;
} else {
var q2 = l < 0.5 ? l * (1 + s) : l + s - l * s;
var p2 = 2 * l - q2;
r = hue2rgb(p2, q2, h2 + 1 / 3);
g = hue2rgb(p2, q2, h2);
b = hue2rgb(p2, q2, h2 - 1 / 3);
}
return { r: r * 255, g: g * 255, b: b * 255 };
}
function rgbToHsv(r, g, b) {
r = bound01(r, 255);
g = bound01(g, 255);
b = bound01(b, 255);
var max = Math.max(r, g, b);
var min = Math.min(r, g, b);
var h2 = 0;
var v = max;
var d = max - min;
var s = max === 0 ? 0 : d / max;
if (max === min) {
h2 = 0;
} else {
switch (max) {
case r:
h2 = (g - b) / d + (g < b ? 6 : 0);
break;
case g:
h2 = (b - r) / d + 2;
break;
case b:
h2 = (r - g) / d + 4;
break;
}
h2 /= 6;
}
return { h: h2, s, v };
}
function hsvToRgb(h2, s, v) {
h2 = bound01(h2, 360) * 6;
s = bound01(s, 100);
v = bound01(v, 100);
var i = Math.floor(h2);
var f = h2 - i;
var p2 = v * (1 - s);
var q2 = v * (1 - f * s);
var t2 = v * (1 - (1 - f) * s);
var mod = i % 6;
var r = [v, q2, p2, p2, t2, v][mod];
var g = [t2, v, v, q2, p2, p2][mod];
var b = [p2, p2, t2, v, v, q2][mod];
return { r: r * 255, g: g * 255, b: b * 255 };
}
function rgbToHex(r, g, b, allow3Char) {
var hex = [
pad2(Math.round(r).toString(16)),
pad2(Math.round(g).toString(16)),
pad2(Math.round(b).toString(16))
];
if (allow3Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1))) {
return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0);
}
return hex.join("");
}
function rgbaToHex(r, g, b, a, allow4Char) {
var hex = [
pad2(Math.round(r).toString(16)),
pad2(Math.round(g).toString(16)),
pad2(Math.round(b).toString(16)),
pad2(convertDecimalToHex(a))
];
if (allow4Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1)) && hex[3].startsWith(hex[3].charAt(1))) {
return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0) + hex[3].charAt(0);
}
return hex.join("");
}
function convertDecimalToHex(d) {
return Math.round(parseFloat(d) * 255).toString(16);
}
function convertHexToDecimal(h2) {
return parseIntFromHex(h2) / 255;
}
function parseIntFromHex(val) {
return parseInt(val, 16);
}
function numberInputToObject(color) {
return {
r: color >> 16,
g: (color & 65280) >> 8,
b: color & 255
};
}
var names = {
aliceblue: "#f0f8ff",
antiquewhite: "#faebd7",
aqua: "#00ffff",
aquamarine: "#7fffd4",
azure: "#f0ffff",
beige: "#f5f5dc",
bisque: "#ffe4c4",
black: "#000000",
blanchedalmond: "#ffebcd",
blue: "#0000ff",
blueviolet: "#8a2be2",
brown: "#a52a2a",
burlywood: "#deb887",
cadetblue: "#5f9ea0",
chartreuse: "#7fff00",
chocolate: "#d2691e",
coral: "#ff7f50",
cornflowerblue: "#6495ed",
cornsilk: "#fff8dc",
crimson: "#dc143c",
cyan: "#00ffff",
darkblue: "#00008b",
darkcyan: "#008b8b",
darkgoldenrod: "#b8860b",
darkgray: "#a9a9a9",
darkgreen: "#006400",
darkgrey: "#a9a9a9",
darkkhaki: "#bdb76b",
darkmagenta: "#8b008b",
darkolivegreen: "#556b2f",
darkorange: "#ff8c00",
darkorchid: "#9932cc",
darkred: "#8b0000",
darksalmon: "#e9967a",
darkseagreen: "#8fbc8f",
darkslateblue: "#483d8b",
darkslategray: "#2f4f4f",
darkslategrey: "#2f4f4f",
darkturquoise: "#00ced1",
darkviolet: "#9400d3",
deeppink: "#ff1493",
deepskyblue: "#00bfff",
dimgray: "#696969",
dimgrey: "#696969",
dodgerblue: "#1e90ff",
firebrick: "#b22222",
floralwhite: "#fffaf0",
forestgreen: "#228b22",
fuchsia: "#ff00ff",
gainsboro: "#dcdcdc",
ghostwhite: "#f8f8ff",
goldenrod: "#daa520",
gold: "#ffd700",
gray: "#808080",
green: "#008000",
greenyellow: "#adff2f",
grey: "#808080",
honeydew: "#f0fff0",
hotpink: "#ff69b4",
indianred: "#cd5c5c",
indigo: "#4b0082",
ivory: "#fffff0",
khaki: "#f0e68c",
lavenderblush: "#fff0f5",
lavender: "#e6e6fa",
lawngreen: "#7cfc00",
lemonchiffon: "#fffacd",
lightblue: "#add8e6",
lightcoral: "#f08080",
lightcyan: "#e0ffff",
lightgoldenrodyellow: "#fafad2",
lightgray: "#d3d3d3",
lightgreen: "#90ee90",
lightgrey: "#d3d3d3",
lightpink: "#ffb6c1",
lightsalmon: "#ffa07a",
lightseagreen: "#20b2aa",
lightskyblue: "#87cefa",
lightslategray: "#778899",
lightslategrey: "#778899",
lightsteelblue: "#b0c4de",
lightyellow: "#ffffe0",
lime: "#00ff00",
limegreen: "#32cd32",
linen: "#faf0e6",
magenta: "#ff00ff",
maroon: "#800000",
mediumaquamarine: "#66cdaa",
mediumblue: "#0000cd",
mediumorchid: "#ba55d3",
mediumpurple: "#9370db",
mediumseagreen: "#3cb371",
mediumslateblue: "#7b68ee",
mediumspringgreen: "#00fa9a",
mediumturquoise: "#48d1cc",
mediumvioletred: "#c71585",
midnightblue: "#191970",
mintcream: "#f5fffa",
mistyrose: "#ffe4e1",
moccasin: "#ffe4b5",
navajowhite: "#ffdead",
navy: "#000080",
oldlace: "#fdf5e6",
olive: "#808000",
olivedrab: "#6b8e23",
orange: "#ffa500",
orangered: "#ff4500",
orchid: "#da70d6",
palegoldenrod: "#eee8aa",
palegreen: "#98fb98",
paleturquoise: "#afeeee",
palevioletred: "#db7093",
papayawhip: "#ffefd5",
peachpuff: "#ffdab9",
peru: "#cd853f",
pink: "#ffc0cb",
plum: "#dda0dd",
powderblue: "#b0e0e6",
purple: "#800080",
rebeccapurple: "#663399",
red: "#ff0000",
rosybrown: "#bc8f8f",
royalblue: "#4169e1",
saddlebrown: "#8b4513",
salmon: "#fa8072",
sandybrown: "#f4a460",
seagreen: "#2e8b57",
seashell: "#fff5ee",
sienna: "#a0522d",
silver: "#c0c0c0",
skyblue: "#87ceeb",
slateblue: "#6a5acd",
slategray: "#708090",
slategrey: "#708090",
snow: "#fffafa",
springgreen: "#00ff7f",
steelblue: "#4682b4",
tan: "#d2b48c",
teal: "#008080",
thistle: "#d8bfd8",
tomato: "#ff6347",
turquoise: "#40e0d0",
violet: "#ee82ee",
wheat: "#f5deb3",
white: "#ffffff",
whitesmoke: "#f5f5f5",
yellow: "#ffff00",
yellowgreen: "#9acd32"
};
function inputToRGB(color) {
var rgb = { r: 0, g: 0, b: 0 };
var a = 1;
var s = null;
var v = null;
var l = null;
var ok = false;
var format2 = false;
if (typeof color === "string") {
color = stringInputToObject(color);
}
if (typeof color === "object") {
if (isValidCSSUnit(color.r) && isValidCSSUnit(color.g) && isValidCSSUnit(color.b)) {
rgb = rgbToRgb(color.r, color.g, color.b);
ok = true;
format2 = String(color.r).substr(-1) === "%" ? "prgb" : "rgb";
} else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.v)) {
s = convertToPercentage(color.s);
v = convertToPercentage(color.v);
rgb = hsvToRgb(color.h, s, v);
ok = true;
format2 = "hsv";
} else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.l)) {
s = convertToPercentage(color.s);
l = convertToPercentage(color.l);
rgb = hslToRgb(color.h, s, l);
ok = true;
format2 = "hsl";
}
if (Object.prototype.hasOwnProperty.call(color, "a")) {
a = color.a;
}
}
a = boundAlpha(a);
return {
ok,
format: color.format || format2,
r: Math.min(255, Math.max(rgb.r, 0)),
g: Math.min(255, Math.max(rgb.g, 0)),
b: Math.min(255, Math.max(rgb.b, 0)),
a
};
}
var CSS_INTEGER = "[-\\+]?\\d+%?";
var CSS_NUMBER = "[-\\+]?\\d*\\.\\d+%?";
var CSS_UNIT = "(?:".concat(CSS_NUMBER, ")|(?:").concat(CSS_INTEGER, ")");
var PERMISSIVE_MATCH3 = "[\\s|\\(]+(".concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")\\s*\\)?");
var PERMISSIVE_MATCH4 = "[\\s|\\(]+(".concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")\\s*\\)?");
var matchers = {
CSS_UNIT: new RegExp(CSS_UNIT),
rgb: new RegExp("rgb" + PERMISSIVE_MATCH3),
rgba: new RegExp("rgba" + PERMISSIVE_MATCH4),
hsl: new RegExp("hsl" + PERMISSIVE_MATCH3),
hsla: new RegExp("hsla" + PERMISSIVE_MATCH4),
hsv: new RegExp("hsv" + PERMISSIVE_MATCH3),
hsva: new RegExp("hsva" + PERMISSIVE_MATCH4),
hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/,
hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/
};
function stringInputToObject(color) {
color = color.trim().toLowerCase();
if (color.length === 0) {
return false;
}
var named = false;
if (names[color]) {
color = names[color];
named = true;
} else if (color === "transparent") {
return { r: 0, g: 0, b: 0, a: 0, format: "name" };
}
var match2 = matchers.rgb.exec(color);
if (match2) {
return { r: match2[1], g: match2[2], b: match2[3] };
}
match2 = matchers.rgba.exec(color);
if (match2) {
return { r: match2[1], g: match2[2], b: match2[3], a: match2[4] };
}
match2 = matchers.hsl.exec(color);
if (match2) {
return { h: match2[1], s: match2[2], l: match2[3] };
}
match2 = matchers.hsla.exec(color);
if (match2) {
return { h: match2[1], s: match2[2], l: match2[3], a: match2[4] };
}
match2 = matchers.hsv.exec(color);
if (match2) {
return { h: match2[1], s: match2[2], v: match2[3] };
}
match2 = matchers.hsva.exec(color);
if (match2) {
return { h: match2[1], s: match2[2], v: match2[3], a: match2[4] };
}
match2 = matchers.hex8.exec(color);
if (match2) {
return {
r: parseIntFromHex(match2[1]),
g: parseIntFromHex(match2[2]),
b: parseIntFromHex(match2[3]),
a: convertHexToDecimal(match2[4]),
format: named ? "name" : "hex8"
};
}
match2 = matchers.hex6.exec(color);
if (match2) {
return {
r: parseIntFromHex(match2[1]),
g: parseIntFromHex(match2[2]),
b: parseIntFromHex(match2[3]),
format: named ? "name" : "hex"
};
}
match2 = matchers.hex4.exec(color);
if (match2) {
return {
r: parseIntFromHex(match2[1] + match2[1]),
g: parseIntFromHex(match2[2] + match2[2]),
b: parseIntFromHex(match2[3] + match2[3]),
a: convertHexToDecimal(match2[4] + match2[4]),
format: named ? "name" : "hex8"
};
}
match2 = matchers.hex3.exec(color);
if (match2) {
return {
r: parseIntFromHex(match2[1] + match2[1]),
g: parseIntFromHex(match2[2] + match2[2]),
b: parseIntFromHex(match2[3] + match2[3]),
format: named ? "name" : "hex"
};
}
return false;
}
function isValidCSSUnit(color) {
return Boolean(matchers.CSS_UNIT.exec(String(color)));
}
var TinyColor = (
/** @class */
function() {
function TinyColor2(color, opts) {
if (color === void 0) {
color = "";
}
if (opts === void 0) {
opts = {};
}
var _a2;
if (color instanceof TinyColor2) {
return color;
}
if (typeof color === "number") {
color = numberInputToObject(color);
}
this.originalInput = color;
var rgb = inputToRGB(color);
this.originalInput = color;
this.r = rgb.r;
this.g = rgb.g;
this.b = rgb.b;
this.a = rgb.a;
this.roundA = Math.round(100 * this.a) / 100;
this.format = (_a2 = opts.format) !== null && _a2 !== void 0 ? _a2 : rgb.format;
this.gradientType = opts.gradientType;
if (this.r < 1) {
this.r = Math.round(this.r);
}
if (this.g < 1) {
this.g = Math.round(this.g);
}
if (this.b < 1) {
this.b = Math.round(this.b);
}
this.isValid = rgb.ok;
}
TinyColor2.prototype.isDark = function() {
return this.getBrightness() < 128;
};
TinyColor2.prototype.isLight = function() {
return !this.isDark();
};
TinyColor2.prototype.getBrightness = function() {
var rgb = this.toRgb();
return (rgb.r * 299 + rgb.g * 587 + rgb.b * 114) / 1e3;
};
TinyColor2.prototype.getLuminance = function() {
var rgb = this.toRgb();
var R2;
var G2;
var B2;
var RsRGB = rgb.r / 255;
var GsRGB = rgb.g / 255;
var BsRGB = rgb.b / 255;
if (RsRGB <= 0.03928) {
R2 = RsRGB / 12.92;
} else {
R2 = Math.pow((RsRGB + 0.055) / 1.055, 2.4);
}
if (GsRGB <= 0.03928) {
G2 = GsRGB / 12.92;
} else {
G2 = Math.pow((GsRGB + 0.055) / 1.055, 2.4);
}
if (BsRGB <= 0.03928) {
B2 = BsRGB / 12.92;
} else {
B2 = Math.pow((BsRGB + 0.055) / 1.055, 2.4);
}
return 0.2126 * R2 + 0.7152 * G2 + 0.0722 * B2;
};
TinyColor2.prototype.getAlpha = function() {
return this.a;
};
TinyColor2.prototype.setAlpha = function(alpha) {
this.a = boundAlpha(alpha);
this.roundA = Math.round(100 * this.a) / 100;
return this;
};
TinyColor2.prototype.isMonochrome = function() {
var s = this.toHsl().s;
return s === 0;
};
TinyColor2.prototype.toHsv = function() {
var hsv = rgbToHsv(this.r, this.g, this.b);
return { h: hsv.h * 360, s: hsv.s, v: hsv.v, a: this.a };
};
TinyColor2.prototype.toHsvString = function() {
var hsv = rgbToHsv(this.r, this.g, this.b);
var h2 = Math.round(hsv.h * 360);
var s = Math.round(hsv.s * 100);
var v = Math.round(hsv.v * 100);
return this.a === 1 ? "hsv(".concat(h2, ", ").concat(s, "%, ").concat(v, "%)") : "hsva(".concat(h2, ", ").concat(s, "%, ").concat(v, "%, ").concat(this.roundA, ")");
};
TinyColor2.prototype.toHsl = function() {
var hsl = rgbToHsl(this.r, this.g, this.b);
return { h: hsl.h * 360, s: hsl.s, l: hsl.l, a: this.a };
};
TinyColor2.prototype.toHslString = function() {
var hsl = rgbToHsl(this.r, this.g, this.b);
var h2 = Math.round(hsl.h * 360);
var s = Math.round(hsl.s * 100);
var l = Math.round(hsl.l * 100);
return this.a === 1 ? "hsl(".concat(h2, ", ").concat(s, "%, ").concat(l, "%)") : "hsla(".concat(h2, ", ").concat(s, "%, ").concat(l, "%, ").concat(this.roundA, ")");
};
TinyColor2.prototype.toHex = function(allow3Char) {
if (allow3Char === void 0) {
allow3Char = false;
}
return rgbToHex(this.r, this.g, this.b, allow3Char);
};
TinyColor2.prototype.toHexString = function(allow3Char) {
if (allow3Char === void 0) {
allow3Char = false;
}
return "#" + this.toHex(allow3Char);
};
TinyColor2.prototype.toHex8 = function(allow4Char) {
if (allow4Char === void 0) {
allow4Char = false;
}
return rgbaToHex(this.r, this.g, this.b, this.a, allow4Char);
};
TinyColor2.prototype.toHex8String = function(allow4Char) {
if (allow4Char === void 0) {
allow4Char = false;
}
return "#" + this.toHex8(allow4Char);
};
TinyColor2.prototype.toHexShortString = function(allowShortChar) {
if (allowShortChar === void 0) {
allowShortChar = false;
}
return this.a === 1 ? this.toHexString(allowShortChar) : this.toHex8String(allowShortChar);
};
TinyColor2.prototype.toRgb = function() {
return {
r: Math.round(this.r),
g: Math.round(this.g),
b: Math.round(this.b),
a: this.a
};
};
TinyColor2.prototype.toRgbString = function() {
var r = Math.round(this.r);
var g = Math.round(this.g);
var b = Math.round(this.b);
return this.a === 1 ? "rgb(".concat(r, ", ").concat(g, ", ").concat(b, ")") : "rgba(".concat(r, ", ").concat(g, ", ").concat(b, ", ").concat(this.roundA, ")");
};
TinyColor2.prototype.toPercentageRgb = function() {
var fmt = function(x) {
return "".concat(Math.round(bound01(x, 255) * 100), "%");
};
return {
r: fmt(this.r),
g: fmt(this.g),
b: fmt(this.b),
a: this.a
};
};
TinyColor2.prototype.toPercentageRgbString = function() {
var rnd = function(x) {
return Math.round(bound01(x, 255) * 100);
};
return this.a === 1 ? "rgb(".concat(rnd(this.r), "%, ").concat(rnd(this.g), "%, ").concat(rnd(this.b), "%)") : "rgba(".concat(rnd(this.r), "%, ").concat(rnd(this.g), "%, ").concat(rnd(this.b), "%, ").concat(this.roundA, ")");
};
TinyColor2.prototype.toName = function() {
if (this.a === 0) {
return "transparent";
}
if (this.a < 1) {
return false;
}
var hex = "#" + rgbToHex(this.r, this.g, this.b, false);
for (var _i = 0, _a2 = Object.entries(names); _i < _a2.length; _i++) {
var _b = _a2[_i], key = _b[0], value = _b[1];
if (hex === value) {
return key;
}
}
return false;
};
TinyColor2.prototype.toString = function(format2) {
var formatSet = Boolean(format2);
format2 = format2 !== null && format2 !== void 0 ? format2 : this.format;
var formattedString = false;
var hasAlpha = this.a < 1 && this.a >= 0;
var needsAlphaFormat = !formatSet && hasAlpha && (format2.startsWith("hex") || format2 === "name");
if (needsAlphaFormat) {
if (format2 === "name" && this.a === 0) {
return this.toName();
}
return this.toRgbString();
}
if (format2 === "rgb") {
formattedString = this.toRgbString();
}
if (format2 === "prgb") {
formattedString = this.toPercentageRgbString();
}
if (format2 === "hex" || format2 === "hex6") {
formattedString = this.toHexString();
}
if (format2 === "hex3") {
formattedString = this.toHexString(true);
}
if (format2 === "hex4") {
formattedString = this.toHex8String(true);
}
if (format2 === "hex8") {
formattedString = this.toHex8String();
}
if (format2 === "name") {
formattedString = this.toName();
}
if (format2 === "hsl") {
formattedString = this.toHslString();
}
if (format2 === "hsv") {
formattedString = this.toHsvString();
}
return formattedString || this.toHexString();
};
TinyColor2.prototype.toNumber = function() {
return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
};
TinyColor2.prototype.clone = function() {
return new TinyColor2(this.toString());
};
TinyColor2.prototype.lighten = function(amount) {
if (amount === void 0) {
amount = 10;
}
var hsl = this.toHsl();
hsl.l += amount / 100;
hsl.l = clamp01(hsl.l);
return new TinyColor2(hsl);
};
TinyColor2.prototype.brighten = function(amount) {
if (amount === void 0) {
amount = 10;
}
var rgb = this.toRgb();
rgb.r = Math.max(0, Math.min(255, rgb.r - Math.round(255 * -(amount / 100))));
rgb.g = Math.max(0, Math.min(255, rgb.g - Math.round(255 * -(amount / 100))));
rgb.b = Math.max(0, Math.min(255, rgb.b - Math.round(255 * -(amount / 100))));
return new TinyColor2(rgb);
};
TinyColor2.prototype.darken = function(amount) {
if (amount === void 0) {
amount = 10;
}
var hsl = this.toHsl();
hsl.l -= amount / 100;
hsl.l = clamp01(hsl.l);
return new TinyColor2(hsl);
};
TinyColor2.prototype.tint = function(amount) {
if (amount === void 0) {
amount = 10;
}
return this.mix("white", amount);
};
TinyColor2.prototype.shade = function(amount) {
if (amount === void 0) {
amount = 10;
}
return this.mix("black", amount);
};
TinyColor2.prototype.desaturate = function(amount) {
if (amount === void 0) {
amount = 10;
}
var hsl = this.toHsl();
hsl.s -= amount / 100;
hsl.s = clamp01(hsl.s);
return new TinyColor2(hsl);
};
TinyColor2.prototype.saturate = function(amount) {
if (amount === void 0) {
amount = 10;
}
var hsl = this.toHsl();
hsl.s += amount / 100;
hsl.s = clamp01(hsl.s);
return new TinyColor2(hsl);
};
TinyColor2.prototype.greyscale = function() {
return this.desaturate(100);
};
TinyColor2.prototype.spin = function(amount) {
var hsl = this.toHsl();
var hue = (hsl.h + amount) % 360;
hsl.h = hue < 0 ? 360 + hue : hue;
return new TinyColor2(hsl);
};
TinyColor2.prototype.mix = function(color, amount) {
if (amount === void 0) {
amount = 50;
}
var rgb1 = this.toRgb();
var rgb2 = new TinyColor2(color).toRgb();
var p2 = amount / 100;
var rgba = {
r: (rgb2.r - rgb1.r) * p2 + rgb1.r,
g: (rgb2.g - rgb1.g) * p2 + rgb1.g,
b: (rgb2.b - rgb1.b) * p2 + rgb1.b,
a: (rgb2.a - rgb1.a) * p2 + rgb1.a
};
return new TinyColor2(rgba);
};
TinyColor2.prototype.analogous = function(results, slices) {
if (results === void 0) {
results = 6;
}
if (slices === void 0) {
slices = 30;
}
var hsl = this.toHsl();
var part = 360 / slices;
var ret = [this];
for (hsl.h = (hsl.h - (part * results >> 1) + 720) % 360; --results; ) {
hsl.h = (hsl.h + part) % 360;
ret.push(new TinyColor2(hsl));
}
return ret;
};
TinyColor2.prototype.complement = function() {
var hsl = this.toHsl();
hsl.h = (hsl.h + 180) % 360;
return new TinyColor2(hsl);
};
TinyColor2.prototype.monochromatic = function(results) {
if (results === void 0) {
results = 6;
}
var hsv = this.toHsv();
var h2 = hsv.h;
var s = hsv.s;
var v = hsv.v;
var res = [];
var modification = 1 / results;
while (results--) {
res.push(new TinyColor2({ h: h2, s, v }));
v = (v + modification) % 1;
}
return res;
};
TinyColor2.prototype.splitcomplement = function() {
var hsl = this.toHsl();
var h2 = hsl.h;
return [
this,
new TinyColor2({ h: (h2 + 72) % 360, s: hsl.s, l: hsl.l }),
new TinyColor2({ h: (h2 + 216) % 360, s: hsl.s, l: hsl.l })
];
};
TinyColor2.prototype.onBackground = function(background) {
var fg = this.toRgb();
var bg = new TinyColor2(background).toRgb();
var alpha = fg.a + bg.a * (1 - fg.a);
return new TinyColor2({
r: (fg.r * fg.a + bg.r * bg.a * (1 - fg.a)) / alpha,
g: (fg.g * fg.a + bg.g * bg.a * (1 - fg.a)) / alpha,
b: (fg.b * fg.a + bg.b * bg.a * (1 - fg.a)) / alpha,
a: alpha
});
};
TinyColor2.prototype.triad = function() {
return this.polyad(3);
};
TinyColor2.prototype.tetrad = function() {
return this.polyad(4);
};
TinyColor2.prototype.polyad = function(n) {
var hsl = this.toHsl();
var h2 = hsl.h;
var result = [this];
var increment = 360 / n;
for (var i = 1; i < n; i++) {
result.push(new TinyColor2({ h: (h2 + i * increment) % 360, s: hsl.s, l: hsl.l }));
}
return result;
};
TinyColor2.prototype.equals = function(color) {
return this.toRgbString() === new TinyColor2(color).toRgbString();
};
return TinyColor2;
}()
);
function darken(color, amount = 20) {
return color.mix("#141414", amount).toString();
}
function useButtonCustomStyle(props) {
const _disabled = useFormDisabled();
const ns = useNamespace("button");
return computed(() => {
let styles = {};
const buttonColor = props.color;
if (buttonColor) {
const color = new TinyColor(buttonColor);
const activeBgColor = props.dark ? color.tint(20).toString() : darken(color, 20);
if (props.plain) {
styles = ns.cssVarBlock({
"bg-color": props.dark ? darken(color, 90) : color.tint(90).toString(),
"text-color": buttonColor,
"border-color": props.dark ? darken(color, 50) : color.tint(50).toString(),
"hover-text-color": `var(${ns.cssVarName("color-white")})`,
"hover-bg-color": buttonColor,
"hover-border-color": buttonColor,
"active-bg-color": activeBgColor,
"active-text-color": `var(${ns.cssVarName("color-white")})`,
"active-border-color": activeBgColor
});
if (_disabled.value) {
styles[ns.cssVarBlockName("disabled-bg-color")] = props.dark ? darken(color, 90) : color.tint(90).toString();
styles[ns.cssVarBlockName("disabled-text-color")] = props.dark ? darken(color, 50) : color.tint(50).toString();
styles[ns.cssVarBlockName("disabled-border-color")] = props.dark ? darken(color, 80) : color.tint(80).toString();
}
} else {
const hoverBgColor = props.dark ? darken(color, 30) : color.tint(30).toString();
const textColor = color.isDark() ? `var(${ns.cssVarName("color-white")})` : `var(${ns.cssVarName("color-black")})`;
styles = ns.cssVarBlock({
"bg-color": buttonColor,
"text-color": textColor,
"border-color": buttonColor,
"hover-bg-color": hoverBgColor,
"hover-text-color": textColor,
"hover-border-color": hoverBgColor,
"active-bg-color": activeBgColor,
"active-border-color": activeBgColor
});
if (_disabled.value) {
const disabledButtonColor = props.dark ? darken(color, 50) : color.tint(50).toString();
styles[ns.cssVarBlockName("disabled-bg-color")] = disabledButtonColor;
styles[ns.cssVarBlockName("disabled-text-color")] = props.dark ? "rgba(255, 255, 255, 0.5)" : `var(${ns.cssVarName("color-white")})`;
styles[ns.cssVarBlockName("disabled-border-color")] = disabledButtonColor;
}
}
}
return styles;
});
}
const __default__$e = defineComponent({
name: "ElButton"
});
const _sfc_main$k = /* @__PURE__ */ defineComponent({
...__default__$e,
props: buttonProps,
emits: buttonEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const buttonStyle = useButtonCustomStyle(props);
const ns = useNamespace("button");
const { _ref, _size, _type, _disabled, _props, shouldAddSpace, handleClick } = useButton(props, emit2);
expose2({
ref: _ref,
size: _size,
type: _type,
disabled: _disabled,
shouldAddSpace
});
return (_ctx, _cache) => {
return openBlock(), createBlock(resolveDynamicComponent(_ctx.tag), mergeProps({
ref_key: "_ref",
ref: _ref
}, unref(_props), {
class: [
unref(ns).b(),
unref(ns).m(unref(_type)),
unref(ns).m(unref(_size)),
unref(ns).is("disabled", unref(_disabled)),
unref(ns).is("loading", _ctx.loading),
unref(ns).is("plain", _ctx.plain),
unref(ns).is("round", _ctx.round),
unref(ns).is("circle", _ctx.circle),
unref(ns).is("text", _ctx.text),
unref(ns).is("link", _ctx.link),
unref(ns).is("has-bg", _ctx.bg)
],
style: unref(buttonStyle),
onClick: unref(handleClick)
}), {
default: withCtx(() => [
_ctx.loading ? (openBlock(), createElementBlock(Fragment$1, { key: 0 }, [
_ctx.$slots.loading ? renderSlot(_ctx.$slots, "loading", { key: 0 }) : (openBlock(), createBlock(unref(ElIcon), {
key: 1,
class: normalizeClass(unref(ns).is("loading"))
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.loadingIcon)))
]),
_: 1
}, 8, ["class"]))
], 64)) : _ctx.icon || _ctx.$slots.icon ? (openBlock(), createBlock(unref(ElIcon), { key: 1 }, {
default: withCtx(() => [
_ctx.icon ? (openBlock(), createBlock(resolveDynamicComponent(_ctx.icon), { key: 0 })) : renderSlot(_ctx.$slots, "icon", { key: 1 })
]),
_: 3
})) : createCommentVNode("v-if", true),
_ctx.$slots.default ? (openBlock(), createElementBlock("span", {
key: 2,
class: normalizeClass({ [unref(ns).em("text", "expand")]: unref(shouldAddSpace) })
}, [
renderSlot(_ctx.$slots, "default")
], 2)) : createCommentVNode("v-if", true)
]),
_: 3
}, 16, ["class", "style", "onClick"]);
};
}
});
var Button = /* @__PURE__ */ _export_sfc(_sfc_main$k, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/button/src/button.vue"]]);
const buttonGroupProps = {
size: buttonProps.size,
type: buttonProps.type
};
const __default__$d = defineComponent({
name: "ElButtonGroup"
});
const _sfc_main$j = /* @__PURE__ */ defineComponent({
...__default__$d,
props: buttonGroupProps,
setup(__props) {
const props = __props;
provide(buttonGroupContextKey, reactive({
size: toRef(props, "size"),
type: toRef(props, "type")
}));
const ns = useNamespace("button");
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass(`${unref(ns).b("group")}`)
}, [
renderSlot(_ctx.$slots, "default")
], 2);
};
}
});
var ButtonGroup = /* @__PURE__ */ _export_sfc(_sfc_main$j, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/button/src/button-group.vue"]]);
const ElButton = withInstall(Button, {
ButtonGroup
});
withNoopInstall(ButtonGroup);
const nodeList = /* @__PURE__ */ new Map();
let startClick;
if (isClient$1) {
document.addEventListener("mousedown", (e) => startClick = e);
document.addEventListener("mouseup", (e) => {
for (const handlers2 of nodeList.values()) {
for (const { documentHandler } of handlers2) {
documentHandler(e, startClick);
}
}
});
}
function createDocumentHandler(el, binding) {
let excludes = [];
if (Array.isArray(binding.arg)) {
excludes = binding.arg;
} else if (isElement(binding.arg)) {
excludes.push(binding.arg);
}
return function(mouseup, mousedown) {
const popperRef = binding.instance.popperRef;
const mouseUpTarget = mouseup.target;
const mouseDownTarget = mousedown == null ? void 0 : mousedown.target;
const isBound = !binding || !binding.instance;
const isTargetExists = !mouseUpTarget || !mouseDownTarget;
const isContainedByEl = el.contains(mouseUpTarget) || el.contains(mouseDownTarget);
const isSelf = el === mouseUpTarget;
const isTargetExcluded = excludes.length && excludes.some((item) => item == null ? void 0 : item.contains(mouseUpTarget)) || excludes.length && excludes.includes(mouseDownTarget);
const isContainedByPopper = popperRef && (popperRef.contains(mouseUpTarget) || popperRef.contains(mouseDownTarget));
if (isBound || isTargetExists || isContainedByEl || isSelf || isTargetExcluded || isContainedByPopper) {
return;
}
binding.value(mouseup, mousedown);
};
}
const ClickOutside = {
beforeMount(el, binding) {
if (!nodeList.has(el)) {
nodeList.set(el, []);
}
nodeList.get(el).push({
documentHandler: createDocumentHandler(el, binding),
bindingFn: binding.value
});
},
updated(el, binding) {
if (!nodeList.has(el)) {
nodeList.set(el, []);
}
const handlers2 = nodeList.get(el);
const oldHandlerIndex = handlers2.findIndex((item) => item.bindingFn === binding.oldValue);
const newHandler = {
documentHandler: createDocumentHandler(el, binding),
bindingFn: binding.value
};
if (oldHandlerIndex >= 0) {
handlers2.splice(oldHandlerIndex, 1, newHandler);
} else {
handlers2.push(newHandler);
}
},
unmounted(el) {
nodeList.delete(el);
}
};
const REPEAT_INTERVAL = 100;
const REPEAT_DELAY = 600;
const vRepeatClick = {
beforeMount(el, binding) {
const value = binding.value;
const { interval = REPEAT_INTERVAL, delay = REPEAT_DELAY } = isFunction$2(value) ? {} : value;
let intervalId;
let delayId;
const handler = () => isFunction$2(value) ? value() : value.handler();
const clear2 = () => {
if (delayId) {
clearTimeout(delayId);
delayId = void 0;
}
if (intervalId) {
clearInterval(intervalId);
intervalId = void 0;
}
};
el.addEventListener("mousedown", (evt) => {
if (evt.button !== 0)
return;
clear2();
handler();
document.addEventListener("mouseup", () => clear2(), {
once: true
});
delayId = setTimeout(() => {
intervalId = setInterval(() => {
handler();
}, interval);
}, delay);
});
}
};
const checkboxProps = {
modelValue: {
type: [Number, String, Boolean],
default: void 0
},
label: {
type: [String, Boolean, Number, Object]
},
indeterminate: Boolean,
disabled: Boolean,
checked: Boolean,
name: {
type: String,
default: void 0
},
trueLabel: {
type: [String, Number],
default: void 0
},
falseLabel: {
type: [String, Number],
default: void 0
},
id: {
type: String,
default: void 0
},
controls: {
type: String,
default: void 0
},
border: Boolean,
size: useSizeProp,
tabindex: [String, Number],
validateEvent: {
type: Boolean,
default: true
}
};
const checkboxEmits = {
[UPDATE_MODEL_EVENT]: (val) => isString$2(val) || isNumber$1(val) || isBoolean$1(val),
change: (val) => isString$2(val) || isNumber$1(val) || isBoolean$1(val)
};
const checkboxGroupContextKey = Symbol("checkboxGroupContextKey");
const useCheckboxDisabled = ({
model,
isChecked
}) => {
const checkboxGroup = inject(checkboxGroupContextKey, void 0);
const isLimitDisabled = computed(() => {
var _a2, _b;
const max = (_a2 = checkboxGroup == null ? void 0 : checkboxGroup.max) == null ? void 0 : _a2.value;
const min = (_b = checkboxGroup == null ? void 0 : checkboxGroup.min) == null ? void 0 : _b.value;
return !isUndefined(max) && model.value.length >= max && !isChecked.value || !isUndefined(min) && model.value.length <= min && isChecked.value;
});
const isDisabled = useFormDisabled(computed(() => (checkboxGroup == null ? void 0 : checkboxGroup.disabled.value) || isLimitDisabled.value));
return {
isDisabled,
isLimitDisabled
};
};
const useCheckboxEvent = (props, {
model,
isLimitExceeded,
hasOwnLabel,
isDisabled,
isLabeledByFormItem
}) => {
const checkboxGroup = inject(checkboxGroupContextKey, void 0);
const { formItem } = useFormItem();
const { emit: emit2 } = getCurrentInstance();
function getLabeledValue(value) {
var _a2, _b;
return value === props.trueLabel || value === true ? (_a2 = props.trueLabel) != null ? _a2 : true : (_b = props.falseLabel) != null ? _b : false;
}
function emitChangeEvent(checked, e) {
emit2("change", getLabeledValue(checked), e);
}
function handleChange(e) {
if (isLimitExceeded.value)
return;
const target = e.target;
emit2("change", getLabeledValue(target.checked), e);
}
async function onClickRoot(e) {
if (isLimitExceeded.value)
return;
if (!hasOwnLabel.value && !isDisabled.value && isLabeledByFormItem.value) {
const eventTargets = e.composedPath();
const hasLabel = eventTargets.some((item) => item.tagName === "LABEL");
if (!hasLabel) {
model.value = getLabeledValue([false, props.falseLabel].includes(model.value));
await nextTick();
emitChangeEvent(model.value, e);
}
}
}
const validateEvent = computed(() => (checkboxGroup == null ? void 0 : checkboxGroup.validateEvent) || props.validateEvent);
watch(() => props.modelValue, () => {
if (validateEvent.value) {
formItem == null ? void 0 : formItem.validate("change").catch((err) => debugWarn());
}
});
return {
handleChange,
onClickRoot
};
};
const useCheckboxModel = (props) => {
const selfModel = ref(false);
const { emit: emit2 } = getCurrentInstance();
const checkboxGroup = inject(checkboxGroupContextKey, void 0);
const isGroup = computed(() => isUndefined(checkboxGroup) === false);
const isLimitExceeded = ref(false);
const model = computed({
get() {
var _a2, _b;
return isGroup.value ? (_a2 = checkboxGroup == null ? void 0 : checkboxGroup.modelValue) == null ? void 0 : _a2.value : (_b = props.modelValue) != null ? _b : selfModel.value;
},
set(val) {
var _a2, _b;
if (isGroup.value && isArray$3(val)) {
isLimitExceeded.value = ((_a2 = checkboxGroup == null ? void 0 : checkboxGroup.max) == null ? void 0 : _a2.value) !== void 0 && val.length > (checkboxGroup == null ? void 0 : checkboxGroup.max.value);
isLimitExceeded.value === false && ((_b = checkboxGroup == null ? void 0 : checkboxGroup.changeEvent) == null ? void 0 : _b.call(checkboxGroup, val));
} else {
emit2(UPDATE_MODEL_EVENT, val);
selfModel.value = val;
}
}
});
return {
model,
isGroup,
isLimitExceeded
};
};
const useCheckboxStatus = (props, slots, { model }) => {
const checkboxGroup = inject(checkboxGroupContextKey, void 0);
const isFocused = ref(false);
const isChecked = computed(() => {
const value = model.value;
if (isBoolean$1(value)) {
return value;
} else if (isArray$3(value)) {
if (isObject$3(props.label)) {
return value.map(toRaw).some((o) => isEqual(o, props.label));
} else {
return value.map(toRaw).includes(props.label);
}
} else if (value !== null && value !== void 0) {
return value === props.trueLabel;
} else {
return !!value;
}
});
const checkboxButtonSize = useFormSize(computed(() => {
var _a2;
return (_a2 = checkboxGroup == null ? void 0 : checkboxGroup.size) == null ? void 0 : _a2.value;
}), {
prop: true
});
const checkboxSize = useFormSize(computed(() => {
var _a2;
return (_a2 = checkboxGroup == null ? void 0 : checkboxGroup.size) == null ? void 0 : _a2.value;
}));
const hasOwnLabel = computed(() => {
return !!(slots.default || props.label);
});
return {
checkboxButtonSize,
isChecked,
isFocused,
checkboxSize,
hasOwnLabel
};
};
const setStoreValue = (props, { model }) => {
function addToStore() {
if (isArray$3(model.value) && !model.value.includes(props.label)) {
model.value.push(props.label);
} else {
model.value = props.trueLabel || true;
}
}
props.checked && addToStore();
};
const useCheckbox = (props, slots) => {
const { formItem: elFormItem2 } = useFormItem();
const { model, isGroup, isLimitExceeded } = useCheckboxModel(props);
const {
isFocused,
isChecked,
checkboxButtonSize,
checkboxSize,
hasOwnLabel
} = useCheckboxStatus(props, slots, { model });
const { isDisabled } = useCheckboxDisabled({ model, isChecked });
const { inputId, isLabeledByFormItem } = useFormItemInputId(props, {
formItemContext: elFormItem2,
disableIdGeneration: hasOwnLabel,
disableIdManagement: isGroup
});
const { handleChange, onClickRoot } = useCheckboxEvent(props, {
model,
isLimitExceeded,
hasOwnLabel,
isDisabled,
isLabeledByFormItem
});
setStoreValue(props, { model });
return {
inputId,
isLabeledByFormItem,
isChecked,
isDisabled,
isFocused,
checkboxButtonSize,
checkboxSize,
hasOwnLabel,
model,
handleChange,
onClickRoot
};
};
const _hoisted_1$b = ["tabindex", "role", "aria-checked"];
const _hoisted_2$9 = ["id", "aria-hidden", "name", "tabindex", "disabled", "true-value", "false-value"];
const _hoisted_3$3 = ["id", "aria-hidden", "disabled", "value", "name", "tabindex"];
const __default__$c = defineComponent({
name: "ElCheckbox"
});
const _sfc_main$i = /* @__PURE__ */ defineComponent({
...__default__$c,
props: checkboxProps,
emits: checkboxEmits,
setup(__props) {
const props = __props;
const slots = useSlots();
const {
inputId,
isLabeledByFormItem,
isChecked,
isDisabled,
isFocused,
checkboxSize,
hasOwnLabel,
model,
handleChange,
onClickRoot
} = useCheckbox(props, slots);
const ns = useNamespace("checkbox");
const compKls = computed(() => {
return [
ns.b(),
ns.m(checkboxSize.value),
ns.is("disabled", isDisabled.value),
ns.is("bordered", props.border),
ns.is("checked", isChecked.value)
];
});
const spanKls = computed(() => {
return [
ns.e("input"),
ns.is("disabled", isDisabled.value),
ns.is("checked", isChecked.value),
ns.is("indeterminate", props.indeterminate),
ns.is("focus", isFocused.value)
];
});
return (_ctx, _cache) => {
return openBlock(), createBlock(resolveDynamicComponent(!unref(hasOwnLabel) && unref(isLabeledByFormItem) ? "span" : "label"), {
class: normalizeClass(unref(compKls)),
"aria-controls": _ctx.indeterminate ? _ctx.controls : null,
onClick: unref(onClickRoot)
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(unref(spanKls)),
tabindex: _ctx.indeterminate ? 0 : void 0,
role: _ctx.indeterminate ? "checkbox" : void 0,
"aria-checked": _ctx.indeterminate ? "mixed" : void 0
}, [
_ctx.trueLabel || _ctx.falseLabel ? withDirectives((openBlock(), createElementBlock("input", {
key: 0,
id: unref(inputId),
"onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => isRef(model) ? model.value = $event : null),
class: normalizeClass(unref(ns).e("original")),
type: "checkbox",
"aria-hidden": _ctx.indeterminate ? "true" : "false",
name: _ctx.name,
tabindex: _ctx.tabindex,
disabled: unref(isDisabled),
"true-value": _ctx.trueLabel,
"false-value": _ctx.falseLabel,
onChange: _cache[1] || (_cache[1] = (...args) => unref(handleChange) && unref(handleChange)(...args)),
onFocus: _cache[2] || (_cache[2] = ($event) => isFocused.value = true),
onBlur: _cache[3] || (_cache[3] = ($event) => isFocused.value = false)
}, null, 42, _hoisted_2$9)), [
[vModelCheckbox, unref(model)]
]) : withDirectives((openBlock(), createElementBlock("input", {
key: 1,
id: unref(inputId),
"onUpdate:modelValue": _cache[4] || (_cache[4] = ($event) => isRef(model) ? model.value = $event : null),
class: normalizeClass(unref(ns).e("original")),
type: "checkbox",
"aria-hidden": _ctx.indeterminate ? "true" : "false",
disabled: unref(isDisabled),
value: _ctx.label,
name: _ctx.name,
tabindex: _ctx.tabindex,
onChange: _cache[5] || (_cache[5] = (...args) => unref(handleChange) && unref(handleChange)(...args)),
onFocus: _cache[6] || (_cache[6] = ($event) => isFocused.value = true),
onBlur: _cache[7] || (_cache[7] = ($event) => isFocused.value = false)
}, null, 42, _hoisted_3$3)), [
[vModelCheckbox, unref(model)]
]),
createBaseVNode("span", {
class: normalizeClass(unref(ns).e("inner"))
}, null, 2)
], 10, _hoisted_1$b),
unref(hasOwnLabel) ? (openBlock(), createElementBlock("span", {
key: 0,
class: normalizeClass(unref(ns).e("label"))
}, [
renderSlot(_ctx.$slots, "default"),
!_ctx.$slots.default ? (openBlock(), createElementBlock(Fragment$1, { key: 0 }, [
createTextVNode(toDisplayString$1(_ctx.label), 1)
], 64)) : createCommentVNode("v-if", true)
], 2)) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["class", "aria-controls", "onClick"]);
};
}
});
var Checkbox = /* @__PURE__ */ _export_sfc(_sfc_main$i, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/checkbox/src/checkbox.vue"]]);
const _hoisted_1$a = ["name", "tabindex", "disabled", "true-value", "false-value"];
const _hoisted_2$8 = ["name", "tabindex", "disabled", "value"];
const __default__$b = defineComponent({
name: "ElCheckboxButton"
});
const _sfc_main$h = /* @__PURE__ */ defineComponent({
...__default__$b,
props: checkboxProps,
emits: checkboxEmits,
setup(__props) {
const props = __props;
const slots = useSlots();
const {
isFocused,
isChecked,
isDisabled,
checkboxButtonSize,
model,
handleChange
} = useCheckbox(props, slots);
const checkboxGroup = inject(checkboxGroupContextKey, void 0);
const ns = useNamespace("checkbox");
const activeStyle = computed(() => {
var _a2, _b, _c, _d;
const fillValue = (_b = (_a2 = checkboxGroup == null ? void 0 : checkboxGroup.fill) == null ? void 0 : _a2.value) != null ? _b : "";
return {
backgroundColor: fillValue,
borderColor: fillValue,
color: (_d = (_c = checkboxGroup == null ? void 0 : checkboxGroup.textColor) == null ? void 0 : _c.value) != null ? _d : "",
boxShadow: fillValue ? `-1px 0 0 0 ${fillValue}` : void 0
};
});
const labelKls = computed(() => {
return [
ns.b("button"),
ns.bm("button", checkboxButtonSize.value),
ns.is("disabled", isDisabled.value),
ns.is("checked", isChecked.value),
ns.is("focus", isFocused.value)
];
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("label", {
class: normalizeClass(unref(labelKls))
}, [
_ctx.trueLabel || _ctx.falseLabel ? withDirectives((openBlock(), createElementBlock("input", {
key: 0,
"onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => isRef(model) ? model.value = $event : null),
class: normalizeClass(unref(ns).be("button", "original")),
type: "checkbox",
name: _ctx.name,
tabindex: _ctx.tabindex,
disabled: unref(isDisabled),
"true-value": _ctx.trueLabel,
"false-value": _ctx.falseLabel,
onChange: _cache[1] || (_cache[1] = (...args) => unref(handleChange) && unref(handleChange)(...args)),
onFocus: _cache[2] || (_cache[2] = ($event) => isFocused.value = true),
onBlur: _cache[3] || (_cache[3] = ($event) => isFocused.value = false)
}, null, 42, _hoisted_1$a)), [
[vModelCheckbox, unref(model)]
]) : withDirectives((openBlock(), createElementBlock("input", {
key: 1,
"onUpdate:modelValue": _cache[4] || (_cache[4] = ($event) => isRef(model) ? model.value = $event : null),
class: normalizeClass(unref(ns).be("button", "original")),
type: "checkbox",
name: _ctx.name,
tabindex: _ctx.tabindex,
disabled: unref(isDisabled),
value: _ctx.label,
onChange: _cache[5] || (_cache[5] = (...args) => unref(handleChange) && unref(handleChange)(...args)),
onFocus: _cache[6] || (_cache[6] = ($event) => isFocused.value = true),
onBlur: _cache[7] || (_cache[7] = ($event) => isFocused.value = false)
}, null, 42, _hoisted_2$8)), [
[vModelCheckbox, unref(model)]
]),
_ctx.$slots.default || _ctx.label ? (openBlock(), createElementBlock("span", {
key: 2,
class: normalizeClass(unref(ns).be("button", "inner")),
style: normalizeStyle(unref(isChecked) ? unref(activeStyle) : void 0)
}, [
renderSlot(_ctx.$slots, "default", {}, () => [
createTextVNode(toDisplayString$1(_ctx.label), 1)
])
], 6)) : createCommentVNode("v-if", true)
], 2);
};
}
});
var CheckboxButton = /* @__PURE__ */ _export_sfc(_sfc_main$h, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/checkbox/src/checkbox-button.vue"]]);
const checkboxGroupProps = buildProps({
modelValue: {
type: definePropType(Array),
default: () => []
},
disabled: Boolean,
min: Number,
max: Number,
size: useSizeProp,
label: String,
fill: String,
textColor: String,
tag: {
type: String,
default: "div"
},
validateEvent: {
type: Boolean,
default: true
}
});
const checkboxGroupEmits = {
[UPDATE_MODEL_EVENT]: (val) => isArray$3(val),
change: (val) => isArray$3(val)
};
const __default__$a = defineComponent({
name: "ElCheckboxGroup"
});
const _sfc_main$g = /* @__PURE__ */ defineComponent({
...__default__$a,
props: checkboxGroupProps,
emits: checkboxGroupEmits,
setup(__props, { emit: emit2 }) {
const props = __props;
const ns = useNamespace("checkbox");
const { formItem } = useFormItem();
const { inputId: groupId, isLabeledByFormItem } = useFormItemInputId(props, {
formItemContext: formItem
});
const changeEvent = async (value) => {
emit2(UPDATE_MODEL_EVENT, value);
await nextTick();
emit2("change", value);
};
const modelValue = computed({
get() {
return props.modelValue;
},
set(val) {
changeEvent(val);
}
});
provide(checkboxGroupContextKey, {
...pick$1(toRefs(props), [
"size",
"min",
"max",
"disabled",
"validateEvent",
"fill",
"textColor"
]),
modelValue,
changeEvent
});
watch(() => props.modelValue, () => {
if (props.validateEvent) {
formItem == null ? void 0 : formItem.validate("change").catch((err) => debugWarn());
}
});
return (_ctx, _cache) => {
var _a2;
return openBlock(), createBlock(resolveDynamicComponent(_ctx.tag), {
id: unref(groupId),
class: normalizeClass(unref(ns).b("group")),
role: "group",
"aria-label": !unref(isLabeledByFormItem) ? _ctx.label || "checkbox-group" : void 0,
"aria-labelledby": unref(isLabeledByFormItem) ? (_a2 = unref(formItem)) == null ? void 0 : _a2.labelId : void 0
}, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 8, ["id", "class", "aria-label", "aria-labelledby"]);
};
}
});
var CheckboxGroup = /* @__PURE__ */ _export_sfc(_sfc_main$g, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/checkbox/src/checkbox-group.vue"]]);
const ElCheckbox = withInstall(Checkbox, {
CheckboxButton,
CheckboxGroup
});
withNoopInstall(CheckboxButton);
withNoopInstall(CheckboxGroup);
const tagProps = buildProps({
closable: Boolean,
type: {
type: String,
values: ["success", "info", "warning", "danger", ""],
default: ""
},
hit: Boolean,
disableTransitions: Boolean,
color: {
type: String,
default: ""
},
size: {
type: String,
values: componentSizes,
default: ""
},
effect: {
type: String,
values: ["dark", "light", "plain"],
default: "light"
},
round: Boolean
});
const tagEmits = {
close: (evt) => evt instanceof MouseEvent,
click: (evt) => evt instanceof MouseEvent
};
const __default__$9 = defineComponent({
name: "ElTag"
});
const _sfc_main$f = /* @__PURE__ */ defineComponent({
...__default__$9,
props: tagProps,
emits: tagEmits,
setup(__props, { emit: emit2 }) {
const props = __props;
const tagSize = useFormSize();
const ns = useNamespace("tag");
const classes = computed(() => {
const { type: type2, hit, effect, closable, round } = props;
return [
ns.b(),
ns.is("closable", closable),
ns.m(type2),
ns.m(tagSize.value),
ns.m(effect),
ns.is("hit", hit),
ns.is("round", round)
];
});
const handleClose = (event) => {
emit2("close", event);
};
const handleClick = (event) => {
emit2("click", event);
};
return (_ctx, _cache) => {
return _ctx.disableTransitions ? (openBlock(), createElementBlock("span", {
key: 0,
class: normalizeClass(unref(classes)),
style: normalizeStyle({ backgroundColor: _ctx.color }),
onClick: handleClick
}, [
createBaseVNode("span", {
class: normalizeClass(unref(ns).e("content"))
}, [
renderSlot(_ctx.$slots, "default")
], 2),
_ctx.closable ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(ns).e("close")),
onClick: withModifiers(handleClose, ["stop"])
}, {
default: withCtx(() => [
createVNode(unref(close_default))
]),
_: 1
}, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)
], 6)) : (openBlock(), createBlock(Transition, {
key: 1,
name: `${unref(ns).namespace.value}-zoom-in-center`,
appear: ""
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(unref(classes)),
style: normalizeStyle({ backgroundColor: _ctx.color }),
onClick: handleClick
}, [
createBaseVNode("span", {
class: normalizeClass(unref(ns).e("content"))
}, [
renderSlot(_ctx.$slots, "default")
], 2),
_ctx.closable ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(ns).e("close")),
onClick: withModifiers(handleClose, ["stop"])
}, {
default: withCtx(() => [
createVNode(unref(close_default))
]),
_: 1
}, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)
], 6)
]),
_: 3
}, 8, ["name"]));
};
}
});
var Tag = /* @__PURE__ */ _export_sfc(_sfc_main$f, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/tag/src/tag.vue"]]);
const ElTag = withInstall(Tag);
const overlayProps = buildProps({
mask: {
type: Boolean,
default: true
},
customMaskEvent: {
type: Boolean,
default: false
},
overlayClass: {
type: definePropType([
String,
Array,
Object
])
},
zIndex: {
type: definePropType([String, Number])
}
});
const overlayEmits = {
click: (evt) => evt instanceof MouseEvent
};
const BLOCK = "overlay";
var Overlay = defineComponent({
name: "ElOverlay",
props: overlayProps,
emits: overlayEmits,
setup(props, { slots, emit: emit2 }) {
const ns = useNamespace(BLOCK);
const onMaskClick = (e) => {
emit2("click", e);
};
const { onClick, onMousedown, onMouseup } = useSameTarget(props.customMaskEvent ? void 0 : onMaskClick);
return () => {
return props.mask ? createVNode("div", {
class: [ns.b(), props.overlayClass],
style: {
zIndex: props.zIndex
},
onClick,
onMousedown,
onMouseup
}, [renderSlot(slots, "default")], PatchFlags.STYLE | PatchFlags.CLASS | PatchFlags.PROPS, ["onClick", "onMouseup", "onMousedown"]) : h("div", {
class: props.overlayClass,
style: {
zIndex: props.zIndex,
position: "fixed",
top: "0px",
right: "0px",
bottom: "0px",
left: "0px"
}
}, [renderSlot(slots, "default")]);
};
}
});
const ElOverlay = Overlay;
const dialogInjectionKey = Symbol("dialogInjectionKey");
const dialogContentProps = buildProps({
center: {
type: Boolean,
default: false
},
alignCenter: {
type: Boolean,
default: false
},
closeIcon: {
type: iconPropType
},
customClass: {
type: String,
default: ""
},
draggable: {
type: Boolean,
default: false
},
fullscreen: {
type: Boolean,
default: false
},
showClose: {
type: Boolean,
default: true
},
title: {
type: String,
default: ""
}
});
const dialogContentEmits = {
close: () => true
};
const _hoisted_1$9 = ["aria-label"];
const _hoisted_2$7 = ["id"];
const __default__$8 = defineComponent({ name: "ElDialogContent" });
const _sfc_main$e = /* @__PURE__ */ defineComponent({
...__default__$8,
props: dialogContentProps,
emits: dialogContentEmits,
setup(__props) {
const props = __props;
const { t: t2 } = useLocale();
const { Close } = CloseComponents;
const { dialogRef, headerRef, bodyId, ns, style } = inject(dialogInjectionKey);
const { focusTrapRef } = inject(FOCUS_TRAP_INJECTION_KEY);
const composedDialogRef = composeRefs(focusTrapRef, dialogRef);
const draggable = computed(() => props.draggable);
useDraggable(dialogRef, headerRef, draggable);
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
ref: unref(composedDialogRef),
class: normalizeClass([
unref(ns).b(),
unref(ns).is("fullscreen", _ctx.fullscreen),
unref(ns).is("draggable", unref(draggable)),
unref(ns).is("align-center", _ctx.alignCenter),
{ [unref(ns).m("center")]: _ctx.center },
_ctx.customClass
]),
style: normalizeStyle(unref(style)),
tabindex: "-1"
}, [
createBaseVNode("header", {
ref_key: "headerRef",
ref: headerRef,
class: normalizeClass(unref(ns).e("header"))
}, [
renderSlot(_ctx.$slots, "header", {}, () => [
createBaseVNode("span", {
role: "heading",
class: normalizeClass(unref(ns).e("title"))
}, toDisplayString$1(_ctx.title), 3)
]),
_ctx.showClose ? (openBlock(), createElementBlock("button", {
key: 0,
"aria-label": unref(t2)("el.dialog.close"),
class: normalizeClass(unref(ns).e("headerbtn")),
type: "button",
onClick: _cache[0] || (_cache[0] = ($event) => _ctx.$emit("close"))
}, [
createVNode(unref(ElIcon), {
class: normalizeClass(unref(ns).e("close"))
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.closeIcon || unref(Close))))
]),
_: 1
}, 8, ["class"])
], 10, _hoisted_1$9)) : createCommentVNode("v-if", true)
], 2),
createBaseVNode("div", {
id: unref(bodyId),
class: normalizeClass(unref(ns).e("body"))
}, [
renderSlot(_ctx.$slots, "default")
], 10, _hoisted_2$7),
_ctx.$slots.footer ? (openBlock(), createElementBlock("footer", {
key: 0,
class: normalizeClass(unref(ns).e("footer"))
}, [
renderSlot(_ctx.$slots, "footer")
], 2)) : createCommentVNode("v-if", true)
], 6);
};
}
});
var ElDialogContent = /* @__PURE__ */ _export_sfc(_sfc_main$e, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/dialog/src/dialog-content.vue"]]);
const dialogProps = buildProps({
...dialogContentProps,
appendToBody: {
type: Boolean,
default: false
},
beforeClose: {
type: definePropType(Function)
},
destroyOnClose: {
type: Boolean,
default: false
},
closeOnClickModal: {
type: Boolean,
default: true
},
closeOnPressEscape: {
type: Boolean,
default: true
},
lockScroll: {
type: Boolean,
default: true
},
modal: {
type: Boolean,
default: true
},
openDelay: {
type: Number,
default: 0
},
closeDelay: {
type: Number,
default: 0
},
top: {
type: String
},
modelValue: {
type: Boolean,
default: false
},
modalClass: String,
width: {
type: [String, Number]
},
zIndex: {
type: Number
},
trapFocus: {
type: Boolean,
default: false
}
});
const dialogEmits = {
open: () => true,
opened: () => true,
close: () => true,
closed: () => true,
[UPDATE_MODEL_EVENT]: (value) => isBoolean$1(value),
openAutoFocus: () => true,
closeAutoFocus: () => true
};
const useDialog = (props, targetRef) => {
const instance = getCurrentInstance();
const emit2 = instance.emit;
const { nextZIndex } = useZIndex();
let lastPosition = "";
const titleId = useId();
const bodyId = useId();
const visible = ref(false);
const closed = ref(false);
const rendered = ref(false);
const zIndex2 = ref(props.zIndex || nextZIndex());
let openTimer = void 0;
let closeTimer = void 0;
const namespace = useGlobalConfig("namespace", defaultNamespace);
const style = computed(() => {
const style2 = {};
const varPrefix = `--${namespace.value}-dialog`;
if (!props.fullscreen) {
if (props.top) {
style2[`${varPrefix}-margin-top`] = props.top;
}
if (props.width) {
style2[`${varPrefix}-width`] = addUnit(props.width);
}
}
return style2;
});
const overlayDialogStyle = computed(() => {
if (props.alignCenter) {
return { display: "flex" };
}
return {};
});
function afterEnter() {
emit2("opened");
}
function afterLeave() {
emit2("closed");
emit2(UPDATE_MODEL_EVENT, false);
if (props.destroyOnClose) {
rendered.value = false;
}
}
function beforeLeave() {
emit2("close");
}
function open2() {
closeTimer == null ? void 0 : closeTimer();
openTimer == null ? void 0 : openTimer();
if (props.openDelay && props.openDelay > 0) {
({ stop: openTimer } = useTimeoutFn(() => doOpen(), props.openDelay));
} else {
doOpen();
}
}
function close() {
openTimer == null ? void 0 : openTimer();
closeTimer == null ? void 0 : closeTimer();
if (props.closeDelay && props.closeDelay > 0) {
({ stop: closeTimer } = useTimeoutFn(() => doClose(), props.closeDelay));
} else {
doClose();
}
}
function handleClose() {
function hide(shouldCancel) {
if (shouldCancel)
return;
closed.value = true;
visible.value = false;
}
if (props.beforeClose) {
props.beforeClose(hide);
} else {
close();
}
}
function onModalClick() {
if (props.closeOnClickModal) {
handleClose();
}
}
function doOpen() {
if (!isClient$1)
return;
visible.value = true;
}
function doClose() {
visible.value = false;
}
function onOpenAutoFocus() {
emit2("openAutoFocus");
}
function onCloseAutoFocus() {
emit2("closeAutoFocus");
}
function onFocusoutPrevented(event) {
var _a2;
if (((_a2 = event.detail) == null ? void 0 : _a2.focusReason) === "pointer") {
event.preventDefault();
}
}
if (props.lockScroll) {
useLockscreen(visible);
}
function onCloseRequested() {
if (props.closeOnPressEscape) {
handleClose();
}
}
watch(() => props.modelValue, (val) => {
if (val) {
closed.value = false;
open2();
rendered.value = true;
zIndex2.value = props.zIndex ? zIndex2.value++ : nextZIndex();
nextTick(() => {
emit2("open");
if (targetRef.value) {
targetRef.value.scrollTop = 0;
}
});
} else {
if (visible.value) {
close();
}
}
});
watch(() => props.fullscreen, (val) => {
if (!targetRef.value)
return;
if (val) {
lastPosition = targetRef.value.style.transform;
targetRef.value.style.transform = "";
} else {
targetRef.value.style.transform = lastPosition;
}
});
onMounted(() => {
if (props.modelValue) {
visible.value = true;
rendered.value = true;
open2();
}
});
return {
afterEnter,
afterLeave,
beforeLeave,
handleClose,
onModalClick,
close,
doClose,
onOpenAutoFocus,
onCloseAutoFocus,
onCloseRequested,
onFocusoutPrevented,
titleId,
bodyId,
closed,
style,
overlayDialogStyle,
rendered,
visible,
zIndex: zIndex2
};
};
const _hoisted_1$8 = ["aria-label", "aria-labelledby", "aria-describedby"];
const __default__$7 = defineComponent({
name: "ElDialog",
inheritAttrs: false
});
const _sfc_main$d = /* @__PURE__ */ defineComponent({
...__default__$7,
props: dialogProps,
emits: dialogEmits,
setup(__props, { expose: expose2 }) {
const props = __props;
const slots = useSlots();
useDeprecated({
scope: "el-dialog",
from: "the title slot",
replacement: "the header slot",
version: "3.0.0",
ref: "https://element-plus.org/en-US/component/dialog.html#slots"
}, computed(() => !!slots.title));
useDeprecated({
scope: "el-dialog",
from: "custom-class",
replacement: "class",
version: "2.3.0",
ref: "https://element-plus.org/en-US/component/dialog.html#attributes",
type: "Attribute"
}, computed(() => !!props.customClass));
const ns = useNamespace("dialog");
const dialogRef = ref();
const headerRef = ref();
const dialogContentRef = ref();
const {
visible,
titleId,
bodyId,
style,
overlayDialogStyle,
rendered,
zIndex: zIndex2,
afterEnter,
afterLeave,
beforeLeave,
handleClose,
onModalClick,
onOpenAutoFocus,
onCloseAutoFocus,
onCloseRequested,
onFocusoutPrevented
} = useDialog(props, dialogRef);
provide(dialogInjectionKey, {
dialogRef,
headerRef,
bodyId,
ns,
rendered,
style
});
const overlayEvent = useSameTarget(onModalClick);
const draggable = computed(() => props.draggable && !props.fullscreen);
expose2({
visible,
dialogContentRef
});
return (_ctx, _cache) => {
return openBlock(), createBlock(Teleport, {
to: "body",
disabled: !_ctx.appendToBody
}, [
createVNode(Transition, {
name: "dialog-fade",
onAfterEnter: unref(afterEnter),
onAfterLeave: unref(afterLeave),
onBeforeLeave: unref(beforeLeave),
persisted: ""
}, {
default: withCtx(() => [
withDirectives(createVNode(unref(ElOverlay), {
"custom-mask-event": "",
mask: _ctx.modal,
"overlay-class": _ctx.modalClass,
"z-index": unref(zIndex2)
}, {
default: withCtx(() => [
createBaseVNode("div", {
role: "dialog",
"aria-modal": "true",
"aria-label": _ctx.title || void 0,
"aria-labelledby": !_ctx.title ? unref(titleId) : void 0,
"aria-describedby": unref(bodyId),
class: normalizeClass(`${unref(ns).namespace.value}-overlay-dialog`),
style: normalizeStyle(unref(overlayDialogStyle)),
onClick: _cache[0] || (_cache[0] = (...args) => unref(overlayEvent).onClick && unref(overlayEvent).onClick(...args)),
onMousedown: _cache[1] || (_cache[1] = (...args) => unref(overlayEvent).onMousedown && unref(overlayEvent).onMousedown(...args)),
onMouseup: _cache[2] || (_cache[2] = (...args) => unref(overlayEvent).onMouseup && unref(overlayEvent).onMouseup(...args))
}, [
createVNode(unref(ElFocusTrap), {
loop: "",
trapped: unref(visible),
"focus-start-el": "container",
onFocusAfterTrapped: unref(onOpenAutoFocus),
onFocusAfterReleased: unref(onCloseAutoFocus),
onFocusoutPrevented: unref(onFocusoutPrevented),
onReleaseRequested: unref(onCloseRequested)
}, {
default: withCtx(() => [
unref(rendered) ? (openBlock(), createBlock(ElDialogContent, mergeProps({
key: 0,
ref_key: "dialogContentRef",
ref: dialogContentRef
}, _ctx.$attrs, {
"custom-class": _ctx.customClass,
center: _ctx.center,
"align-center": _ctx.alignCenter,
"close-icon": _ctx.closeIcon,
draggable: unref(draggable),
fullscreen: _ctx.fullscreen,
"show-close": _ctx.showClose,
title: _ctx.title,
onClose: unref(handleClose)
}), createSlots({
header: withCtx(() => [
!_ctx.$slots.title ? renderSlot(_ctx.$slots, "header", {
key: 0,
close: unref(handleClose),
titleId: unref(titleId),
titleClass: unref(ns).e("title")
}) : renderSlot(_ctx.$slots, "title", { key: 1 })
]),
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 2
}, [
_ctx.$slots.footer ? {
name: "footer",
fn: withCtx(() => [
renderSlot(_ctx.$slots, "footer")
])
} : void 0
]), 1040, ["custom-class", "center", "align-center", "close-icon", "draggable", "fullscreen", "show-close", "title", "onClose"])) : createCommentVNode("v-if", true)
]),
_: 3
}, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])
], 46, _hoisted_1$8)
]),
_: 3
}, 8, ["mask", "overlay-class", "z-index"]), [
[vShow, unref(visible)]
])
]),
_: 3
}, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])
], 8, ["disabled"]);
};
}
});
var Dialog = /* @__PURE__ */ _export_sfc(_sfc_main$d, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/dialog/src/dialog.vue"]]);
const ElDialog = withInstall(Dialog);
const dividerProps = buildProps({
direction: {
type: String,
values: ["horizontal", "vertical"],
default: "horizontal"
},
contentPosition: {
type: String,
values: ["left", "center", "right"],
default: "center"
},
borderStyle: {
type: definePropType(String),
default: "solid"
}
});
const __default__$6 = defineComponent({
name: "ElDivider"
});
const _sfc_main$c = /* @__PURE__ */ defineComponent({
...__default__$6,
props: dividerProps,
setup(__props) {
const props = __props;
const ns = useNamespace("divider");
const dividerStyle = computed(() => {
return ns.cssVar({
"border-style": props.borderStyle
});
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass([unref(ns).b(), unref(ns).m(_ctx.direction)]),
style: normalizeStyle(unref(dividerStyle)),
role: "separator"
}, [
_ctx.$slots.default && _ctx.direction !== "vertical" ? (openBlock(), createElementBlock("div", {
key: 0,
class: normalizeClass([unref(ns).e("text"), unref(ns).is(_ctx.contentPosition)])
}, [
renderSlot(_ctx.$slots, "default")
], 2)) : createCommentVNode("v-if", true)
], 6);
};
}
});
var Divider = /* @__PURE__ */ _export_sfc(_sfc_main$c, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/divider/src/divider.vue"]]);
const ElDivider = withInstall(Divider);
const inputNumberProps = buildProps({
id: {
type: String,
default: void 0
},
step: {
type: Number,
default: 1
},
stepStrictly: Boolean,
max: {
type: Number,
default: Number.POSITIVE_INFINITY
},
min: {
type: Number,
default: Number.NEGATIVE_INFINITY
},
modelValue: Number,
readonly: Boolean,
disabled: Boolean,
size: useSizeProp,
controls: {
type: Boolean,
default: true
},
controlsPosition: {
type: String,
default: "",
values: ["", "right"]
},
valueOnClear: {
type: [String, Number, null],
validator: (val) => val === null || isNumber$1(val) || ["min", "max"].includes(val),
default: null
},
name: String,
label: String,
placeholder: String,
precision: {
type: Number,
validator: (val) => val >= 0 && val === Number.parseInt(`${val}`, 10)
},
validateEvent: {
type: Boolean,
default: true
}
});
const inputNumberEmits = {
[CHANGE_EVENT]: (cur, prev) => prev !== cur,
blur: (e) => e instanceof FocusEvent,
focus: (e) => e instanceof FocusEvent,
[INPUT_EVENT]: (val) => isNumber$1(val) || isNil(val),
[UPDATE_MODEL_EVENT]: (val) => isNumber$1(val) || isNil(val)
};
const _hoisted_1$7 = ["aria-label", "onKeydown"];
const _hoisted_2$6 = ["aria-label", "onKeydown"];
const __default__$5 = defineComponent({
name: "ElInputNumber"
});
const _sfc_main$b = /* @__PURE__ */ defineComponent({
...__default__$5,
props: inputNumberProps,
emits: inputNumberEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const { t: t2 } = useLocale();
const ns = useNamespace("input-number");
const input = ref();
const data = reactive({
currentValue: props.modelValue,
userInput: null
});
const { formItem } = useFormItem();
const minDisabled = computed(() => isNumber$1(props.modelValue) && props.modelValue <= props.min);
const maxDisabled = computed(() => isNumber$1(props.modelValue) && props.modelValue >= props.max);
const numPrecision = computed(() => {
const stepPrecision = getPrecision(props.step);
if (!isUndefined(props.precision)) {
if (stepPrecision > props.precision)
;
return props.precision;
} else {
return Math.max(getPrecision(props.modelValue), stepPrecision);
}
});
const controlsAtRight = computed(() => {
return props.controls && props.controlsPosition === "right";
});
const inputNumberSize = useFormSize();
const inputNumberDisabled = useFormDisabled();
const displayValue = computed(() => {
if (data.userInput !== null) {
return data.userInput;
}
let currentValue = data.currentValue;
if (isNil(currentValue))
return "";
if (isNumber$1(currentValue)) {
if (Number.isNaN(currentValue))
return "";
if (!isUndefined(props.precision)) {
currentValue = currentValue.toFixed(props.precision);
}
}
return currentValue;
});
const toPrecision = (num, pre) => {
if (isUndefined(pre))
pre = numPrecision.value;
if (pre === 0)
return Math.round(num);
let snum = String(num);
const pointPos = snum.indexOf(".");
if (pointPos === -1)
return num;
const nums = snum.replace(".", "").split("");
const datum = nums[pointPos + pre];
if (!datum)
return num;
const length = snum.length;
if (snum.charAt(length - 1) === "5") {
snum = `${snum.slice(0, Math.max(0, length - 1))}6`;
}
return Number.parseFloat(Number(snum).toFixed(pre));
};
const getPrecision = (value) => {
if (isNil(value))
return 0;
const valueString = value.toString();
const dotPosition = valueString.indexOf(".");
let precision = 0;
if (dotPosition !== -1) {
precision = valueString.length - dotPosition - 1;
}
return precision;
};
const ensurePrecision = (val, coefficient = 1) => {
if (!isNumber$1(val))
return data.currentValue;
return toPrecision(val + props.step * coefficient);
};
const increase = () => {
if (props.readonly || inputNumberDisabled.value || maxDisabled.value)
return;
const value = Number(displayValue.value) || 0;
const newVal = ensurePrecision(value);
setCurrentValue(newVal);
emit2(INPUT_EVENT, data.currentValue);
};
const decrease = () => {
if (props.readonly || inputNumberDisabled.value || minDisabled.value)
return;
const value = Number(displayValue.value) || 0;
const newVal = ensurePrecision(value, -1);
setCurrentValue(newVal);
emit2(INPUT_EVENT, data.currentValue);
};
const verifyValue = (value, update) => {
const { max, min, step, precision, stepStrictly, valueOnClear } = props;
let newVal = Number(value);
if (isNil(value) || Number.isNaN(newVal)) {
return null;
}
if (value === "") {
if (valueOnClear === null) {
return null;
}
newVal = isString$2(valueOnClear) ? { min, max }[valueOnClear] : valueOnClear;
}
if (stepStrictly) {
newVal = toPrecision(Math.round(newVal / step) * step, precision);
}
if (!isUndefined(precision)) {
newVal = toPrecision(newVal, precision);
}
if (newVal > max || newVal < min) {
newVal = newVal > max ? max : min;
update && emit2(UPDATE_MODEL_EVENT, newVal);
}
return newVal;
};
const setCurrentValue = (value, emitChange = true) => {
var _a2;
const oldVal = data.currentValue;
const newVal = verifyValue(value);
if (!emitChange) {
emit2(UPDATE_MODEL_EVENT, newVal);
return;
}
if (oldVal === newVal)
return;
data.userInput = null;
emit2(UPDATE_MODEL_EVENT, newVal);
emit2(CHANGE_EVENT, newVal, oldVal);
if (props.validateEvent) {
(_a2 = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a2.call(formItem, "change").catch((err) => debugWarn());
}
data.currentValue = newVal;
};
const handleInput = (value) => {
data.userInput = value;
const newVal = value === "" ? null : Number(value);
emit2(INPUT_EVENT, newVal);
setCurrentValue(newVal, false);
};
const handleInputChange = (value) => {
const newVal = value !== "" ? Number(value) : "";
if (isNumber$1(newVal) && !Number.isNaN(newVal) || value === "") {
setCurrentValue(newVal);
}
data.userInput = null;
};
const focus = () => {
var _a2, _b;
(_b = (_a2 = input.value) == null ? void 0 : _a2.focus) == null ? void 0 : _b.call(_a2);
};
const blur = () => {
var _a2, _b;
(_b = (_a2 = input.value) == null ? void 0 : _a2.blur) == null ? void 0 : _b.call(_a2);
};
const handleFocus = (event) => {
emit2("focus", event);
};
const handleBlur = (event) => {
var _a2;
emit2("blur", event);
if (props.validateEvent) {
(_a2 = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a2.call(formItem, "blur").catch((err) => debugWarn());
}
};
watch(() => props.modelValue, (value) => {
const userInput = verifyValue(data.userInput);
const newValue = verifyValue(value, true);
if (!isNumber$1(userInput) && (!userInput || userInput !== newValue)) {
data.currentValue = newValue;
data.userInput = null;
}
}, { immediate: true });
onMounted(() => {
var _a2;
const { min, max, modelValue } = props;
const innerInput = (_a2 = input.value) == null ? void 0 : _a2.input;
innerInput.setAttribute("role", "spinbutton");
if (Number.isFinite(max)) {
innerInput.setAttribute("aria-valuemax", String(max));
} else {
innerInput.removeAttribute("aria-valuemax");
}
if (Number.isFinite(min)) {
innerInput.setAttribute("aria-valuemin", String(min));
} else {
innerInput.removeAttribute("aria-valuemin");
}
innerInput.setAttribute("aria-valuenow", String(data.currentValue));
innerInput.setAttribute("aria-disabled", String(inputNumberDisabled.value));
if (!isNumber$1(modelValue) && modelValue != null) {
let val = Number(modelValue);
if (Number.isNaN(val)) {
val = null;
}
emit2(UPDATE_MODEL_EVENT, val);
}
});
onUpdated(() => {
var _a2;
const innerInput = (_a2 = input.value) == null ? void 0 : _a2.input;
innerInput == null ? void 0 : innerInput.setAttribute("aria-valuenow", `${data.currentValue}`);
});
expose2({
focus,
blur
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass([
unref(ns).b(),
unref(ns).m(unref(inputNumberSize)),
unref(ns).is("disabled", unref(inputNumberDisabled)),
unref(ns).is("without-controls", !_ctx.controls),
unref(ns).is("controls-right", unref(controlsAtRight))
]),
onDragstart: _cache[1] || (_cache[1] = withModifiers(() => {
}, ["prevent"]))
}, [
_ctx.controls ? withDirectives((openBlock(), createElementBlock("span", {
key: 0,
role: "button",
"aria-label": unref(t2)("el.inputNumber.decrease"),
class: normalizeClass([unref(ns).e("decrease"), unref(ns).is("disabled", unref(minDisabled))]),
onKeydown: withKeys(decrease, ["enter"])
}, [
createVNode(unref(ElIcon), null, {
default: withCtx(() => [
unref(controlsAtRight) ? (openBlock(), createBlock(unref(arrow_down_default), { key: 0 })) : (openBlock(), createBlock(unref(minus_default), { key: 1 }))
]),
_: 1
})
], 42, _hoisted_1$7)), [
[unref(vRepeatClick), decrease]
]) : createCommentVNode("v-if", true),
_ctx.controls ? withDirectives((openBlock(), createElementBlock("span", {
key: 1,
role: "button",
"aria-label": unref(t2)("el.inputNumber.increase"),
class: normalizeClass([unref(ns).e("increase"), unref(ns).is("disabled", unref(maxDisabled))]),
onKeydown: withKeys(increase, ["enter"])
}, [
createVNode(unref(ElIcon), null, {
default: withCtx(() => [
unref(controlsAtRight) ? (openBlock(), createBlock(unref(arrow_up_default), { key: 0 })) : (openBlock(), createBlock(unref(plus_default), { key: 1 }))
]),
_: 1
})
], 42, _hoisted_2$6)), [
[unref(vRepeatClick), increase]
]) : createCommentVNode("v-if", true),
createVNode(unref(ElInput), {
id: _ctx.id,
ref_key: "input",
ref: input,
type: "number",
step: _ctx.step,
"model-value": unref(displayValue),
placeholder: _ctx.placeholder,
readonly: _ctx.readonly,
disabled: unref(inputNumberDisabled),
size: unref(inputNumberSize),
max: _ctx.max,
min: _ctx.min,
name: _ctx.name,
label: _ctx.label,
"validate-event": false,
onWheel: _cache[0] || (_cache[0] = withModifiers(() => {
}, ["prevent"])),
onKeydown: [
withKeys(withModifiers(increase, ["prevent"]), ["up"]),
withKeys(withModifiers(decrease, ["prevent"]), ["down"])
],
onBlur: handleBlur,
onFocus: handleFocus,
onInput: handleInput,
onChange: handleInputChange
}, null, 8, ["id", "step", "model-value", "placeholder", "readonly", "disabled", "size", "max", "min", "name", "label", "onKeydown"])
], 34);
};
}
});
var InputNumber = /* @__PURE__ */ _export_sfc(_sfc_main$b, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/input-number/src/input-number.vue"]]);
const ElInputNumber = withInstall(InputNumber);
const selectGroupKey = Symbol("ElSelectGroup");
const selectKey = Symbol("ElSelect");
function useOption(props, states) {
const select = inject(selectKey);
const selectGroup = inject(selectGroupKey, { disabled: false });
const isObject2 = computed(() => {
return Object.prototype.toString.call(props.value).toLowerCase() === "[object object]";
});
const itemSelected = computed(() => {
if (!select.props.multiple) {
return isEqual2(props.value, select.props.modelValue);
} else {
return contains(select.props.modelValue, props.value);
}
});
const limitReached = computed(() => {
if (select.props.multiple) {
const modelValue = select.props.modelValue || [];
return !itemSelected.value && modelValue.length >= select.props.multipleLimit && select.props.multipleLimit > 0;
} else {
return false;
}
});
const currentLabel = computed(() => {
return props.label || (isObject2.value ? "" : props.value);
});
const currentValue = computed(() => {
return props.value || props.label || "";
});
const isDisabled = computed(() => {
return props.disabled || states.groupDisabled || limitReached.value;
});
const instance = getCurrentInstance();
const contains = (arr = [], target) => {
if (!isObject2.value) {
return arr && arr.includes(target);
} else {
const valueKey = select.props.valueKey;
return arr && arr.some((item) => {
return toRaw(get(item, valueKey)) === get(target, valueKey);
});
}
};
const isEqual2 = (a, b) => {
if (!isObject2.value) {
return a === b;
} else {
const { valueKey } = select.props;
return get(a, valueKey) === get(b, valueKey);
}
};
const hoverItem = () => {
if (!props.disabled && !selectGroup.disabled) {
select.hoverIndex = select.optionsArray.indexOf(instance.proxy);
}
};
watch(() => currentLabel.value, () => {
if (!props.created && !select.props.remote)
select.setSelected();
});
watch(() => props.value, (val, oldVal) => {
const { remote, valueKey } = select.props;
if (!Object.is(val, oldVal)) {
select.onOptionDestroy(oldVal, instance.proxy);
select.onOptionCreate(instance.proxy);
}
if (!props.created && !remote) {
if (valueKey && typeof val === "object" && typeof oldVal === "object" && val[valueKey] === oldVal[valueKey]) {
return;
}
select.setSelected();
}
});
watch(() => selectGroup.disabled, () => {
states.groupDisabled = selectGroup.disabled;
}, { immediate: true });
const { queryChange } = toRaw(select);
watch(queryChange, (changes) => {
const { query } = unref(changes);
const regexp2 = new RegExp(escapeStringRegexp(query), "i");
states.visible = regexp2.test(currentLabel.value) || props.created;
if (!states.visible) {
select.filteredOptionsCount--;
}
}, { immediate: true });
return {
select,
currentLabel,
currentValue,
itemSelected,
isDisabled,
hoverItem
};
}
const _sfc_main$a = defineComponent({
name: "ElOption",
componentName: "ElOption",
props: {
value: {
required: true,
type: [String, Number, Boolean, Object]
},
label: [String, Number],
created: Boolean,
disabled: {
type: Boolean,
default: false
}
},
setup(props) {
const ns = useNamespace("select");
const states = reactive({
index: -1,
groupDisabled: false,
visible: true,
hitState: false,
hover: false
});
const { currentLabel, itemSelected, isDisabled, select, hoverItem } = useOption(props, states);
const { visible, hover } = toRefs(states);
const vm = getCurrentInstance().proxy;
select.onOptionCreate(vm);
onBeforeUnmount(() => {
const key = vm.value;
const { selected } = select;
const selectedOptions = select.props.multiple ? selected : [selected];
const doesSelected = selectedOptions.some((item) => {
return item.value === vm.value;
});
nextTick(() => {
if (select.cachedOptions.get(key) === vm && !doesSelected) {
select.cachedOptions.delete(key);
}
});
select.onOptionDestroy(key, vm);
});
function selectOptionClick() {
if (props.disabled !== true && states.groupDisabled !== true) {
select.handleOptionSelect(vm, true);
}
}
return {
ns,
currentLabel,
itemSelected,
isDisabled,
select,
hoverItem,
visible,
hover,
selectOptionClick,
states
};
}
});
function _sfc_render$3(_ctx, _cache, $props, $setup, $data, $options) {
return withDirectives((openBlock(), createElementBlock("li", {
class: normalizeClass([
_ctx.ns.be("dropdown", "item"),
_ctx.ns.is("disabled", _ctx.isDisabled),
{
selected: _ctx.itemSelected,
hover: _ctx.hover
}
]),
onMouseenter: _cache[0] || (_cache[0] = (...args) => _ctx.hoverItem && _ctx.hoverItem(...args)),
onClick: _cache[1] || (_cache[1] = withModifiers((...args) => _ctx.selectOptionClick && _ctx.selectOptionClick(...args), ["stop"]))
}, [
renderSlot(_ctx.$slots, "default", {}, () => [
createBaseVNode("span", null, toDisplayString$1(_ctx.currentLabel), 1)
])
], 34)), [
[vShow, _ctx.visible]
]);
}
var Option = /* @__PURE__ */ _export_sfc(_sfc_main$a, [["render", _sfc_render$3], ["__file", "/home/runner/work/element-plus/element-plus/packages/components/select/src/option.vue"]]);
const _sfc_main$9 = defineComponent({
name: "ElSelectDropdown",
componentName: "ElSelectDropdown",
setup() {
const select = inject(selectKey);
const ns = useNamespace("select");
const popperClass = computed(() => select.props.popperClass);
const isMultiple = computed(() => select.props.multiple);
const isFitInputWidth = computed(() => select.props.fitInputWidth);
const minWidth = ref("");
function updateMinWidth() {
var _a2;
minWidth.value = `${(_a2 = select.selectWrapper) == null ? void 0 : _a2.offsetWidth}px`;
}
onMounted(() => {
updateMinWidth();
useResizeObserver(select.selectWrapper, updateMinWidth);
});
return {
ns,
minWidth,
popperClass,
isMultiple,
isFitInputWidth
};
}
});
function _sfc_render$2(_ctx, _cache, $props, $setup, $data, $options) {
return openBlock(), createElementBlock("div", {
class: normalizeClass([_ctx.ns.b("dropdown"), _ctx.ns.is("multiple", _ctx.isMultiple), _ctx.popperClass]),
style: normalizeStyle({ [_ctx.isFitInputWidth ? "width" : "minWidth"]: _ctx.minWidth })
}, [
renderSlot(_ctx.$slots, "default")
], 6);
}
var ElSelectMenu = /* @__PURE__ */ _export_sfc(_sfc_main$9, [["render", _sfc_render$2], ["__file", "/home/runner/work/element-plus/element-plus/packages/components/select/src/select-dropdown.vue"]]);
function useSelectStates(props) {
const { t: t2 } = useLocale();
return reactive({
options: /* @__PURE__ */ new Map(),
cachedOptions: /* @__PURE__ */ new Map(),
createdLabel: null,
createdSelected: false,
selected: props.multiple ? [] : {},
inputLength: 20,
inputWidth: 0,
optionsCount: 0,
filteredOptionsCount: 0,
visible: false,
softFocus: false,
selectedLabel: "",
hoverIndex: -1,
query: "",
previousQuery: null,
inputHovering: false,
cachedPlaceHolder: "",
currentPlaceholder: t2("el.select.placeholder"),
menuVisibleOnFocus: false,
isOnComposition: false,
isSilentBlur: false,
prefixWidth: 11,
tagInMultiLine: false,
mouseEnter: false
});
}
const useSelect = (props, states, ctx) => {
const { t: t2 } = useLocale();
const ns = useNamespace("select");
useDeprecated({
from: "suffixTransition",
replacement: "override style scheme",
version: "2.3.0",
scope: "props",
ref: "https://element-plus.org/en-US/component/select.html#select-attributes"
}, computed(() => props.suffixTransition === false));
const reference = ref(null);
const input = ref(null);
const iOSInput = ref(null);
const tooltipRef = ref(null);
const tags2 = ref(null);
const selectWrapper = ref(null);
const scrollbar = ref(null);
const hoverOption = ref(-1);
const queryChange = shallowRef({ query: "" });
const groupQueryChange = shallowRef("");
const optionList = ref([]);
let originClientHeight = 0;
const { form, formItem } = useFormItem();
const readonly2 = computed(() => !props.filterable || props.multiple || !states.visible);
const selectDisabled = computed(() => props.disabled || (form == null ? void 0 : form.disabled));
const showClose = computed(() => {
const hasValue = props.multiple ? Array.isArray(props.modelValue) && props.modelValue.length > 0 : props.modelValue !== void 0 && props.modelValue !== null && props.modelValue !== "";
const criteria = props.clearable && !selectDisabled.value && states.inputHovering && hasValue;
return criteria;
});
const iconComponent = computed(() => props.remote && props.filterable && !props.remoteShowSuffix ? "" : props.suffixIcon);
const iconReverse = computed(() => ns.is("reverse", iconComponent.value && states.visible && props.suffixTransition));
const debounce$1 = computed(() => props.remote ? 300 : 0);
const emptyText = computed(() => {
if (props.loading) {
return props.loadingText || t2("el.select.loading");
} else {
if (props.remote && states.query === "" && states.options.size === 0)
return false;
if (props.filterable && states.query && states.options.size > 0 && states.filteredOptionsCount === 0) {
return props.noMatchText || t2("el.select.noMatch");
}
if (states.options.size === 0) {
return props.noDataText || t2("el.select.noData");
}
}
return null;
});
const optionsArray = computed(() => {
const list = Array.from(states.options.values());
const newList = [];
optionList.value.forEach((item) => {
const index2 = list.findIndex((i) => i.currentLabel === item);
if (index2 > -1) {
newList.push(list[index2]);
}
});
return newList.length ? newList : list;
});
const cachedOptionsArray = computed(() => Array.from(states.cachedOptions.values()));
const showNewOption = computed(() => {
const hasExistingOption = optionsArray.value.filter((option) => {
return !option.created;
}).some((option) => {
return option.currentLabel === states.query;
});
return props.filterable && props.allowCreate && states.query !== "" && !hasExistingOption;
});
const selectSize = useFormSize();
const collapseTagSize = computed(() => ["small"].includes(selectSize.value) ? "small" : "default");
const dropMenuVisible = computed({
get() {
return states.visible && emptyText.value !== false;
},
set(val) {
states.visible = val;
}
});
watch([() => selectDisabled.value, () => selectSize.value, () => form == null ? void 0 : form.size], () => {
nextTick(() => {
resetInputHeight();
});
});
watch(() => props.placeholder, (val) => {
states.cachedPlaceHolder = states.currentPlaceholder = val;
});
watch(() => props.modelValue, (val, oldVal) => {
if (props.multiple) {
resetInputHeight();
if (val && val.length > 0 || input.value && states.query !== "") {
states.currentPlaceholder = "";
} else {
states.currentPlaceholder = states.cachedPlaceHolder;
}
if (props.filterable && !props.reserveKeyword) {
states.query = "";
handleQueryChange(states.query);
}
}
setSelected2();
if (props.filterable && !props.multiple) {
states.inputLength = 20;
}
if (!isEqual(val, oldVal) && props.validateEvent) {
formItem == null ? void 0 : formItem.validate("change").catch((err) => debugWarn());
}
}, {
flush: "post",
deep: true
});
watch(() => states.visible, (val) => {
var _a2, _b, _c, _d, _e;
if (!val) {
if (props.filterable) {
if (isFunction$2(props.filterMethod)) {
props.filterMethod("");
}
if (isFunction$2(props.remoteMethod)) {
props.remoteMethod("");
}
}
input.value && input.value.blur();
states.query = "";
states.previousQuery = null;
states.selectedLabel = "";
states.inputLength = 20;
states.menuVisibleOnFocus = false;
resetHoverIndex();
nextTick(() => {
if (input.value && input.value.value === "" && states.selected.length === 0) {
states.currentPlaceholder = states.cachedPlaceHolder;
}
});
if (!props.multiple) {
if (states.selected) {
if (props.filterable && props.allowCreate && states.createdSelected && states.createdLabel) {
states.selectedLabel = states.createdLabel;
} else {
states.selectedLabel = states.selected.currentLabel;
}
if (props.filterable)
states.query = states.selectedLabel;
}
if (props.filterable) {
states.currentPlaceholder = states.cachedPlaceHolder;
}
}
} else {
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
if (props.filterable) {
states.filteredOptionsCount = states.optionsCount;
states.query = props.remote ? "" : states.selectedLabel;
(_d = (_c = iOSInput.value) == null ? void 0 : _c.focus) == null ? void 0 : _d.call(_c);
if (props.multiple) {
(_e = input.value) == null ? void 0 : _e.focus();
} else {
if (states.selectedLabel) {
states.currentPlaceholder = `${states.selectedLabel}`;
states.selectedLabel = "";
}
}
handleQueryChange(states.query);
if (!props.multiple && !props.remote) {
queryChange.value.query = "";
triggerRef(queryChange);
triggerRef(groupQueryChange);
}
}
}
ctx.emit("visible-change", val);
});
watch(() => states.options.entries(), () => {
var _a2, _b, _c;
if (!isClient$1)
return;
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
if (props.multiple) {
resetInputHeight();
}
const inputs = ((_c = selectWrapper.value) == null ? void 0 : _c.querySelectorAll("input")) || [];
if (!Array.from(inputs).includes(document.activeElement)) {
setSelected2();
}
if (props.defaultFirstOption && (props.filterable || props.remote) && states.filteredOptionsCount) {
checkDefaultFirstOption();
}
}, {
flush: "post"
});
watch(() => states.hoverIndex, (val) => {
if (isNumber$1(val) && val > -1) {
hoverOption.value = optionsArray.value[val] || {};
} else {
hoverOption.value = {};
}
optionsArray.value.forEach((option) => {
option.hover = hoverOption.value === option;
});
});
const resetInputHeight = () => {
nextTick(() => {
var _a2, _b;
if (!reference.value)
return;
const input2 = reference.value.$el.querySelector("input");
originClientHeight = originClientHeight || (input2.clientHeight > 0 ? input2.clientHeight + 2 : 0);
const _tags = tags2.value;
const gotSize = getComponentSize(selectSize.value || (form == null ? void 0 : form.size));
const sizeInMap = selectSize.value || gotSize === originClientHeight || originClientHeight <= 0 ? gotSize : originClientHeight;
const isElHidden = input2.offsetParent === null;
!isElHidden && (input2.style.height = `${(states.selected.length === 0 ? sizeInMap : Math.max(_tags ? _tags.clientHeight + (_tags.clientHeight > sizeInMap ? 6 : 0) : 0, sizeInMap)) - 2}px`);
states.tagInMultiLine = Number.parseFloat(input2.style.height) >= sizeInMap;
if (states.visible && emptyText.value !== false) {
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
}
});
};
const handleQueryChange = async (val) => {
if (states.previousQuery === val || states.isOnComposition)
return;
if (states.previousQuery === null && (isFunction$2(props.filterMethod) || isFunction$2(props.remoteMethod))) {
states.previousQuery = val;
return;
}
states.previousQuery = val;
nextTick(() => {
var _a2, _b;
if (states.visible)
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
});
states.hoverIndex = -1;
if (props.multiple && props.filterable) {
nextTick(() => {
const length = input.value.value.length * 15 + 20;
states.inputLength = props.collapseTags ? Math.min(50, length) : length;
managePlaceholder();
resetInputHeight();
});
}
if (props.remote && isFunction$2(props.remoteMethod)) {
states.hoverIndex = -1;
props.remoteMethod(val);
} else if (isFunction$2(props.filterMethod)) {
props.filterMethod(val);
triggerRef(groupQueryChange);
} else {
states.filteredOptionsCount = states.optionsCount;
queryChange.value.query = val;
triggerRef(queryChange);
triggerRef(groupQueryChange);
}
if (props.defaultFirstOption && (props.filterable || props.remote) && states.filteredOptionsCount) {
await nextTick();
checkDefaultFirstOption();
}
};
const managePlaceholder = () => {
if (states.currentPlaceholder !== "") {
states.currentPlaceholder = input.value.value ? "" : states.cachedPlaceHolder;
}
};
const checkDefaultFirstOption = () => {
const optionsInDropdown = optionsArray.value.filter((n) => n.visible && !n.disabled && !n.states.groupDisabled);
const userCreatedOption = optionsInDropdown.find((n) => n.created);
const firstOriginOption = optionsInDropdown[0];
states.hoverIndex = getValueIndex(optionsArray.value, userCreatedOption || firstOriginOption);
};
const setSelected2 = () => {
var _a2;
if (!props.multiple) {
const option = getOption(props.modelValue);
if ((_a2 = option.props) == null ? void 0 : _a2.created) {
states.createdLabel = option.props.value;
states.createdSelected = true;
} else {
states.createdSelected = false;
}
states.selectedLabel = option.currentLabel;
states.selected = option;
if (props.filterable)
states.query = states.selectedLabel;
return;
} else {
states.selectedLabel = "";
}
const result = [];
if (Array.isArray(props.modelValue)) {
props.modelValue.forEach((value) => {
result.push(getOption(value));
});
}
states.selected = result;
nextTick(() => {
resetInputHeight();
});
};
const getOption = (value) => {
let option;
const isObjectValue = toRawType(value).toLowerCase() === "object";
const isNull = toRawType(value).toLowerCase() === "null";
const isUndefined2 = toRawType(value).toLowerCase() === "undefined";
for (let i = states.cachedOptions.size - 1; i >= 0; i--) {
const cachedOption = cachedOptionsArray.value[i];
const isEqualValue = isObjectValue ? get(cachedOption.value, props.valueKey) === get(value, props.valueKey) : cachedOption.value === value;
if (isEqualValue) {
option = {
value,
currentLabel: cachedOption.currentLabel,
isDisabled: cachedOption.isDisabled
};
break;
}
}
if (option)
return option;
const label = isObjectValue ? value.label : !isNull && !isUndefined2 ? value : "";
const newOption = {
value,
currentLabel: label
};
if (props.multiple) {
newOption.hitState = false;
}
return newOption;
};
const resetHoverIndex = () => {
setTimeout(() => {
const valueKey = props.valueKey;
if (!props.multiple) {
states.hoverIndex = optionsArray.value.findIndex((item) => {
return getValueKey(item) === getValueKey(states.selected);
});
} else {
if (states.selected.length > 0) {
states.hoverIndex = Math.min.apply(null, states.selected.map((selected) => {
return optionsArray.value.findIndex((item) => {
return get(item, valueKey) === get(selected, valueKey);
});
}));
} else {
states.hoverIndex = -1;
}
}
}, 300);
};
const handleResize = () => {
var _a2, _b;
resetInputWidth();
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2);
if (props.multiple)
resetInputHeight();
};
const resetInputWidth = () => {
var _a2;
states.inputWidth = (_a2 = reference.value) == null ? void 0 : _a2.$el.offsetWidth;
};
const onInputChange = () => {
if (props.filterable && states.query !== states.selectedLabel) {
states.query = states.selectedLabel;
handleQueryChange(states.query);
}
};
const debouncedOnInputChange = debounce(() => {
onInputChange();
}, debounce$1.value);
const debouncedQueryChange = debounce((e) => {
handleQueryChange(e.target.value);
}, debounce$1.value);
const emitChange = (val) => {
if (!isEqual(props.modelValue, val)) {
ctx.emit(CHANGE_EVENT, val);
}
};
const deletePrevTag = (e) => {
if (e.code === EVENT_CODE.delete)
return;
if (e.target.value.length <= 0 && !toggleLastOptionHitState()) {
const value = props.modelValue.slice();
value.pop();
ctx.emit(UPDATE_MODEL_EVENT, value);
emitChange(value);
}
if (e.target.value.length === 1 && props.modelValue.length === 0) {
states.currentPlaceholder = states.cachedPlaceHolder;
}
};
const deleteTag = (event, tag) => {
const index2 = states.selected.indexOf(tag);
if (index2 > -1 && !selectDisabled.value) {
const value = props.modelValue.slice();
value.splice(index2, 1);
ctx.emit(UPDATE_MODEL_EVENT, value);
emitChange(value);
ctx.emit("remove-tag", tag.value);
}
event.stopPropagation();
};
const deleteSelected = (event) => {
event.stopPropagation();
const value = props.multiple ? [] : "";
if (!isString$2(value)) {
for (const item of states.selected) {
if (item.isDisabled)
value.push(item.value);
}
}
ctx.emit(UPDATE_MODEL_EVENT, value);
emitChange(value);
states.hoverIndex = -1;
states.visible = false;
ctx.emit("clear");
};
const handleOptionSelect = (option, byClick) => {
var _a2;
if (props.multiple) {
const value = (props.modelValue || []).slice();
const optionIndex = getValueIndex(value, option.value);
if (optionIndex > -1) {
value.splice(optionIndex, 1);
} else if (props.multipleLimit <= 0 || value.length < props.multipleLimit) {
value.push(option.value);
}
ctx.emit(UPDATE_MODEL_EVENT, value);
emitChange(value);
if (option.created) {
states.query = "";
handleQueryChange("");
states.inputLength = 20;
}
if (props.filterable)
(_a2 = input.value) == null ? void 0 : _a2.focus();
} else {
ctx.emit(UPDATE_MODEL_EVENT, option.value);
emitChange(option.value);
states.visible = false;
}
states.isSilentBlur = byClick;
setSoftFocus();
if (states.visible)
return;
nextTick(() => {
scrollToOption(option);
});
};
const getValueIndex = (arr = [], value) => {
if (!isObject$3(value))
return arr.indexOf(value);
const valueKey = props.valueKey;
let index2 = -1;
arr.some((item, i) => {
if (toRaw(get(item, valueKey)) === get(value, valueKey)) {
index2 = i;
return true;
}
return false;
});
return index2;
};
const setSoftFocus = () => {
states.softFocus = true;
const _input = input.value || reference.value;
if (_input) {
_input == null ? void 0 : _input.focus();
}
};
const scrollToOption = (option) => {
var _a2, _b, _c, _d, _e;
const targetOption = Array.isArray(option) ? option[0] : option;
let target = null;
if (targetOption == null ? void 0 : targetOption.value) {
const options = optionsArray.value.filter((item) => item.value === targetOption.value);
if (options.length > 0) {
target = options[0].$el;
}
}
if (tooltipRef.value && target) {
const menu = (_d = (_c = (_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.popperRef) == null ? void 0 : _b.contentRef) == null ? void 0 : _c.querySelector) == null ? void 0 : _d.call(_c, `.${ns.be("dropdown", "wrap")}`);
if (menu) {
scrollIntoView(menu, target);
}
}
(_e = scrollbar.value) == null ? void 0 : _e.handleScroll();
};
const onOptionCreate = (vm) => {
states.optionsCount++;
states.filteredOptionsCount++;
states.options.set(vm.value, vm);
states.cachedOptions.set(vm.value, vm);
};
const onOptionDestroy = (key, vm) => {
if (states.options.get(key) === vm) {
states.optionsCount--;
states.filteredOptionsCount--;
states.options.delete(key);
}
};
const resetInputState = (e) => {
if (e.code !== EVENT_CODE.backspace)
toggleLastOptionHitState(false);
states.inputLength = input.value.value.length * 15 + 20;
resetInputHeight();
};
const toggleLastOptionHitState = (hit) => {
if (!Array.isArray(states.selected))
return;
const option = states.selected[states.selected.length - 1];
if (!option)
return;
if (hit === true || hit === false) {
option.hitState = hit;
return hit;
}
option.hitState = !option.hitState;
return option.hitState;
};
const handleComposition = (event) => {
const text = event.target.value;
if (event.type === "compositionend") {
states.isOnComposition = false;
nextTick(() => handleQueryChange(text));
} else {
const lastCharacter = text[text.length - 1] || "";
states.isOnComposition = !isKorean(lastCharacter);
}
};
const handleMenuEnter = () => {
nextTick(() => scrollToOption(states.selected));
};
const handleFocus = (event) => {
if (!states.softFocus) {
if (props.automaticDropdown || props.filterable) {
if (props.filterable && !states.visible) {
states.menuVisibleOnFocus = true;
}
states.visible = true;
}
ctx.emit("focus", event);
} else {
states.softFocus = false;
}
};
const blur = () => {
var _a2, _b, _c;
states.visible = false;
(_a2 = reference.value) == null ? void 0 : _a2.blur();
(_c = (_b = iOSInput.value) == null ? void 0 : _b.blur) == null ? void 0 : _c.call(_b);
};
const handleBlur = (event) => {
nextTick(() => {
if (states.isSilentBlur) {
states.isSilentBlur = false;
} else {
ctx.emit("blur", event);
}
});
states.softFocus = false;
};
const handleClearClick = (event) => {
deleteSelected(event);
};
const handleClose = () => {
states.visible = false;
};
const handleKeydownEscape = (event) => {
if (states.visible) {
event.preventDefault();
event.stopPropagation();
states.visible = false;
}
};
const toggleMenu = (e) => {
var _a2;
if (e && !states.mouseEnter) {
return;
}
if (!selectDisabled.value) {
if (states.menuVisibleOnFocus) {
states.menuVisibleOnFocus = false;
} else {
if (!tooltipRef.value || !tooltipRef.value.isFocusInsideContent()) {
states.visible = !states.visible;
}
}
if (states.visible) {
(_a2 = input.value || reference.value) == null ? void 0 : _a2.focus();
}
}
};
const selectOption = () => {
if (!states.visible) {
toggleMenu();
} else {
if (optionsArray.value[states.hoverIndex]) {
handleOptionSelect(optionsArray.value[states.hoverIndex], void 0);
}
}
};
const getValueKey = (item) => {
return isObject$3(item.value) ? get(item.value, props.valueKey) : item.value;
};
const optionsAllDisabled = computed(() => optionsArray.value.filter((option) => option.visible).every((option) => option.disabled));
const showTagList = computed(() => states.selected.slice(0, props.maxCollapseTags));
const collapseTagList = computed(() => states.selected.slice(props.maxCollapseTags));
const navigateOptions = (direction) => {
if (!states.visible) {
states.visible = true;
return;
}
if (states.options.size === 0 || states.filteredOptionsCount === 0)
return;
if (states.isOnComposition)
return;
if (!optionsAllDisabled.value) {
if (direction === "next") {
states.hoverIndex++;
if (states.hoverIndex === states.options.size) {
states.hoverIndex = 0;
}
} else if (direction === "prev") {
states.hoverIndex--;
if (states.hoverIndex < 0) {
states.hoverIndex = states.options.size - 1;
}
}
const option = optionsArray.value[states.hoverIndex];
if (option.disabled === true || option.states.groupDisabled === true || !option.visible) {
navigateOptions(direction);
}
nextTick(() => scrollToOption(hoverOption.value));
}
};
const handleMouseEnter = () => {
states.mouseEnter = true;
};
const handleMouseLeave = () => {
states.mouseEnter = false;
};
return {
optionList,
optionsArray,
selectSize,
handleResize,
debouncedOnInputChange,
debouncedQueryChange,
deletePrevTag,
deleteTag,
deleteSelected,
handleOptionSelect,
scrollToOption,
readonly: readonly2,
resetInputHeight,
showClose,
iconComponent,
iconReverse,
showNewOption,
collapseTagSize,
setSelected: setSelected2,
managePlaceholder,
selectDisabled,
emptyText,
toggleLastOptionHitState,
resetInputState,
handleComposition,
onOptionCreate,
onOptionDestroy,
handleMenuEnter,
handleFocus,
blur,
handleBlur,
handleClearClick,
handleClose,
handleKeydownEscape,
toggleMenu,
selectOption,
getValueKey,
navigateOptions,
dropMenuVisible,
queryChange,
groupQueryChange,
showTagList,
collapseTagList,
reference,
input,
iOSInput,
tooltipRef,
tags: tags2,
selectWrapper,
scrollbar,
handleMouseEnter,
handleMouseLeave
};
};
var ElOptions = defineComponent({
name: "ElOptions",
emits: ["update-options"],
setup(_, { slots, emit: emit2 }) {
let cachedOptions = [];
function isSameOptions(a, b) {
if (a.length !== b.length)
return false;
for (const [index2] of a.entries()) {
if (a[index2] != b[index2]) {
return false;
}
}
return true;
}
return () => {
var _a2, _b;
const children = (_a2 = slots.default) == null ? void 0 : _a2.call(slots);
const filteredOptions = [];
function filterOptions(children2) {
if (!Array.isArray(children2))
return;
children2.forEach((item) => {
var _a22, _b2, _c, _d;
const name = (_a22 = (item == null ? void 0 : item.type) || {}) == null ? void 0 : _a22.name;
if (name === "ElOptionGroup") {
filterOptions(!isString$2(item.children) && !Array.isArray(item.children) && isFunction$2((_b2 = item.children) == null ? void 0 : _b2.default) ? (_c = item.children) == null ? void 0 : _c.default() : item.children);
} else if (name === "ElOption") {
filteredOptions.push((_d = item.props) == null ? void 0 : _d.label);
} else if (Array.isArray(item.children)) {
filterOptions(item.children);
}
});
}
if (children.length) {
filterOptions((_b = children[0]) == null ? void 0 : _b.children);
}
if (!isSameOptions(filteredOptions, cachedOptions)) {
cachedOptions = filteredOptions;
emit2("update-options", filteredOptions);
}
return children;
};
}
});
const COMPONENT_NAME$1 = "ElSelect";
const _sfc_main$8 = defineComponent({
name: COMPONENT_NAME$1,
componentName: COMPONENT_NAME$1,
components: {
ElInput,
ElSelectMenu,
ElOption: Option,
ElOptions,
ElTag,
ElScrollbar,
ElTooltip,
ElIcon
},
directives: { ClickOutside },
props: {
name: String,
id: String,
modelValue: {
type: [Array, String, Number, Boolean, Object],
default: void 0
},
autocomplete: {
type: String,
default: "off"
},
automaticDropdown: Boolean,
size: {
type: String,
validator: isValidComponentSize
},
effect: {
type: String,
default: "light"
},
disabled: Boolean,
clearable: Boolean,
filterable: Boolean,
allowCreate: Boolean,
loading: Boolean,
popperClass: {
type: String,
default: ""
},
popperOptions: {
type: Object,
default: () => ({})
},
remote: Boolean,
loadingText: String,
noMatchText: String,
noDataText: String,
remoteMethod: Function,
filterMethod: Function,
multiple: Boolean,
multipleLimit: {
type: Number,
default: 0
},
placeholder: {
type: String
},
defaultFirstOption: Boolean,
reserveKeyword: {
type: Boolean,
default: true
},
valueKey: {
type: String,
default: "value"
},
collapseTags: Boolean,
collapseTagsTooltip: {
type: Boolean,
default: false
},
maxCollapseTags: {
type: Number,
default: 1
},
teleported: useTooltipContentProps.teleported,
persistent: {
type: Boolean,
default: true
},
clearIcon: {
type: iconPropType,
default: circle_close_default
},
fitInputWidth: {
type: Boolean,
default: false
},
suffixIcon: {
type: iconPropType,
default: arrow_down_default
},
tagType: { ...tagProps.type, default: "info" },
validateEvent: {
type: Boolean,
default: true
},
remoteShowSuffix: {
type: Boolean,
default: false
},
suffixTransition: {
type: Boolean,
default: true
},
placement: {
type: String,
values: Ee,
default: "bottom-start"
}
},
emits: [
UPDATE_MODEL_EVENT,
CHANGE_EVENT,
"remove-tag",
"clear",
"visible-change",
"focus",
"blur"
],
setup(props, ctx) {
const nsSelect = useNamespace("select");
const nsInput = useNamespace("input");
const { t: t2 } = useLocale();
const states = useSelectStates(props);
const {
optionList,
optionsArray,
selectSize,
readonly: readonly2,
handleResize,
collapseTagSize,
debouncedOnInputChange,
debouncedQueryChange,
deletePrevTag,
deleteTag,
deleteSelected,
handleOptionSelect,
scrollToOption,
setSelected: setSelected2,
resetInputHeight,
managePlaceholder,
showClose,
selectDisabled,
iconComponent,
iconReverse,
showNewOption,
emptyText,
toggleLastOptionHitState,
resetInputState,
handleComposition,
onOptionCreate,
onOptionDestroy,
handleMenuEnter,
handleFocus,
blur,
handleBlur,
handleClearClick,
handleClose,
handleKeydownEscape,
toggleMenu,
selectOption,
getValueKey,
navigateOptions,
dropMenuVisible,
reference,
input,
iOSInput,
tooltipRef,
tags: tags2,
selectWrapper,
scrollbar,
queryChange,
groupQueryChange,
handleMouseEnter,
handleMouseLeave,
showTagList,
collapseTagList
} = useSelect(props, states, ctx);
const { focus } = useFocus(reference);
const {
inputWidth,
selected,
inputLength,
filteredOptionsCount,
visible,
softFocus,
selectedLabel,
hoverIndex,
query,
inputHovering,
currentPlaceholder,
menuVisibleOnFocus,
isOnComposition,
isSilentBlur,
options,
cachedOptions,
optionsCount,
prefixWidth,
tagInMultiLine
} = toRefs(states);
const wrapperKls = computed(() => {
const classList = [nsSelect.b()];
const _selectSize = unref(selectSize);
if (_selectSize) {
classList.push(nsSelect.m(_selectSize));
}
if (props.disabled) {
classList.push(nsSelect.m("disabled"));
}
return classList;
});
const selectTagsStyle = computed(() => ({
maxWidth: `${unref(inputWidth) - 32}px`,
width: "100%"
}));
const tagTextStyle = computed(() => {
const maxWidth = unref(inputWidth) > 123 ? unref(inputWidth) - 123 : unref(inputWidth) - 75;
return { maxWidth: `${maxWidth}px` };
});
provide(selectKey, reactive({
props,
options,
optionsArray,
cachedOptions,
optionsCount,
filteredOptionsCount,
hoverIndex,
handleOptionSelect,
onOptionCreate,
onOptionDestroy,
selectWrapper,
selected,
setSelected: setSelected2,
queryChange,
groupQueryChange
}));
onMounted(() => {
states.cachedPlaceHolder = currentPlaceholder.value = props.placeholder || (() => t2("el.select.placeholder"));
if (props.multiple && Array.isArray(props.modelValue) && props.modelValue.length > 0) {
currentPlaceholder.value = "";
}
useResizeObserver(selectWrapper, handleResize);
if (props.remote && props.multiple) {
resetInputHeight();
}
nextTick(() => {
const refEl = reference.value && reference.value.$el;
if (!refEl)
return;
inputWidth.value = refEl.getBoundingClientRect().width;
if (ctx.slots.prefix) {
const prefix = refEl.querySelector(`.${nsInput.e("prefix")}`);
prefixWidth.value = Math.max(prefix.getBoundingClientRect().width + 5, 30);
}
});
setSelected2();
});
if (props.multiple && !Array.isArray(props.modelValue)) {
ctx.emit(UPDATE_MODEL_EVENT, []);
}
if (!props.multiple && Array.isArray(props.modelValue)) {
ctx.emit(UPDATE_MODEL_EVENT, "");
}
const popperPaneRef = computed(() => {
var _a2, _b;
return (_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.popperRef) == null ? void 0 : _b.contentRef;
});
const onOptionsRendered = (v) => {
optionList.value = v;
};
return {
isIOS,
onOptionsRendered,
tagInMultiLine,
prefixWidth,
selectSize,
readonly: readonly2,
handleResize,
collapseTagSize,
debouncedOnInputChange,
debouncedQueryChange,
deletePrevTag,
deleteTag,
deleteSelected,
handleOptionSelect,
scrollToOption,
inputWidth,
selected,
inputLength,
filteredOptionsCount,
visible,
softFocus,
selectedLabel,
hoverIndex,
query,
inputHovering,
currentPlaceholder,
menuVisibleOnFocus,
isOnComposition,
isSilentBlur,
options,
resetInputHeight,
managePlaceholder,
showClose,
selectDisabled,
iconComponent,
iconReverse,
showNewOption,
emptyText,
toggleLastOptionHitState,
resetInputState,
handleComposition,
handleMenuEnter,
handleFocus,
blur,
handleBlur,
handleClearClick,
handleClose,
handleKeydownEscape,
toggleMenu,
selectOption,
getValueKey,
navigateOptions,
dropMenuVisible,
focus,
reference,
input,
iOSInput,
tooltipRef,
popperPaneRef,
tags: tags2,
selectWrapper,
scrollbar,
wrapperKls,
selectTagsStyle,
nsSelect,
tagTextStyle,
handleMouseEnter,
handleMouseLeave,
showTagList,
collapseTagList
};
}
});
const _hoisted_1$6 = ["disabled", "autocomplete"];
const _hoisted_2$5 = ["disabled"];
const _hoisted_3$2 = { style: { "height": "100%", "display": "flex", "justify-content": "center", "align-items": "center" } };
function _sfc_render$1(_ctx, _cache, $props, $setup, $data, $options) {
const _component_el_tag = resolveComponent("el-tag");
const _component_el_tooltip = resolveComponent("el-tooltip");
const _component_el_icon = resolveComponent("el-icon");
const _component_el_input = resolveComponent("el-input");
const _component_el_option = resolveComponent("el-option");
const _component_el_options = resolveComponent("el-options");
const _component_el_scrollbar = resolveComponent("el-scrollbar");
const _component_el_select_menu = resolveComponent("el-select-menu");
const _directive_click_outside = resolveDirective("click-outside");
return withDirectives((openBlock(), createElementBlock("div", {
ref: "selectWrapper",
class: normalizeClass(_ctx.wrapperKls),
onMouseenter: _cache[21] || (_cache[21] = (...args) => _ctx.handleMouseEnter && _ctx.handleMouseEnter(...args)),
onMouseleave: _cache[22] || (_cache[22] = (...args) => _ctx.handleMouseLeave && _ctx.handleMouseLeave(...args)),
onClick: _cache[23] || (_cache[23] = withModifiers((...args) => _ctx.toggleMenu && _ctx.toggleMenu(...args), ["stop"]))
}, [
createVNode(_component_el_tooltip, {
ref: "tooltipRef",
visible: _ctx.dropMenuVisible,
placement: _ctx.placement,
teleported: _ctx.teleported,
"popper-class": [_ctx.nsSelect.e("popper"), _ctx.popperClass],
"popper-options": _ctx.popperOptions,
"fallback-placements": ["bottom-start", "top-start", "right", "left"],
effect: _ctx.effect,
pure: "",
trigger: "click",
transition: `${_ctx.nsSelect.namespace.value}-zoom-in-top`,
"stop-popper-mouse-event": false,
"gpu-acceleration": false,
persistent: _ctx.persistent,
onShow: _ctx.handleMenuEnter
}, {
default: withCtx(() => [
createBaseVNode("div", {
class: "select-trigger",
onMouseenter: _cache[19] || (_cache[19] = ($event) => _ctx.inputHovering = true),
onMouseleave: _cache[20] || (_cache[20] = ($event) => _ctx.inputHovering = false)
}, [
_ctx.multiple ? (openBlock(), createElementBlock("div", {
key: 0,
ref: "tags",
class: normalizeClass([
_ctx.nsSelect.e("tags"),
_ctx.nsSelect.is("disabled", _ctx.selectDisabled)
]),
style: normalizeStyle(_ctx.selectTagsStyle)
}, [
_ctx.collapseTags && _ctx.selected.length ? (openBlock(), createBlock(Transition, {
key: 0,
onAfterLeave: _ctx.resetInputHeight
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass([
_ctx.nsSelect.b("tags-wrapper"),
{ "has-prefix": _ctx.prefixWidth && _ctx.selected.length }
])
}, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(_ctx.showTagList, (item) => {
return openBlock(), createBlock(_component_el_tag, {
key: _ctx.getValueKey(item),
closable: !_ctx.selectDisabled && !item.isDisabled,
size: _ctx.collapseTagSize,
hit: item.hitState,
type: _ctx.tagType,
"disable-transitions": "",
onClose: ($event) => _ctx.deleteTag($event, item)
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(_ctx.nsSelect.e("tags-text")),
style: normalizeStyle(_ctx.tagTextStyle)
}, toDisplayString$1(item.currentLabel), 7)
]),
_: 2
}, 1032, ["closable", "size", "hit", "type", "onClose"]);
}), 128)),
_ctx.selected.length > _ctx.maxCollapseTags ? (openBlock(), createBlock(_component_el_tag, {
key: 0,
closable: false,
size: _ctx.collapseTagSize,
type: _ctx.tagType,
"disable-transitions": ""
}, {
default: withCtx(() => [
_ctx.collapseTagsTooltip ? (openBlock(), createBlock(_component_el_tooltip, {
key: 0,
disabled: _ctx.dropMenuVisible,
"fallback-placements": ["bottom", "top", "right", "left"],
effect: _ctx.effect,
placement: "bottom",
teleported: _ctx.teleported
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(_ctx.nsSelect.e("tags-text"))
}, "+ " + toDisplayString$1(_ctx.selected.length - _ctx.maxCollapseTags), 3)
]),
content: withCtx(() => [
createBaseVNode("div", {
class: normalizeClass(_ctx.nsSelect.e("collapse-tags"))
}, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(_ctx.collapseTagList, (item) => {
return openBlock(), createElementBlock("div", {
key: _ctx.getValueKey(item),
class: normalizeClass(_ctx.nsSelect.e("collapse-tag"))
}, [
createVNode(_component_el_tag, {
class: "in-tooltip",
closable: !_ctx.selectDisabled && !item.isDisabled,
size: _ctx.collapseTagSize,
hit: item.hitState,
type: _ctx.tagType,
"disable-transitions": "",
style: { margin: "2px" },
onClose: ($event) => _ctx.deleteTag($event, item)
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(_ctx.nsSelect.e("tags-text")),
style: normalizeStyle({
maxWidth: _ctx.inputWidth - 75 + "px"
})
}, toDisplayString$1(item.currentLabel), 7)
]),
_: 2
}, 1032, ["closable", "size", "hit", "type", "onClose"])
], 2);
}), 128))
], 2)
]),
_: 1
}, 8, ["disabled", "effect", "teleported"])) : (openBlock(), createElementBlock("span", {
key: 1,
class: normalizeClass(_ctx.nsSelect.e("tags-text"))
}, "+ " + toDisplayString$1(_ctx.selected.length - _ctx.maxCollapseTags), 3))
]),
_: 1
}, 8, ["size", "type"])) : createCommentVNode("v-if", true)
], 2)
]),
_: 1
}, 8, ["onAfterLeave"])) : createCommentVNode("v-if", true),
!_ctx.collapseTags ? (openBlock(), createBlock(Transition, {
key: 1,
onAfterLeave: _ctx.resetInputHeight
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass([
_ctx.nsSelect.b("tags-wrapper"),
{ "has-prefix": _ctx.prefixWidth && _ctx.selected.length }
])
}, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(_ctx.selected, (item) => {
return openBlock(), createBlock(_component_el_tag, {
key: _ctx.getValueKey(item),
closable: !_ctx.selectDisabled && !item.isDisabled,
size: _ctx.collapseTagSize,
hit: item.hitState,
type: _ctx.tagType,
"disable-transitions": "",
onClose: ($event) => _ctx.deleteTag($event, item)
}, {
default: withCtx(() => [
createBaseVNode("span", {
class: normalizeClass(_ctx.nsSelect.e("tags-text")),
style: normalizeStyle({ maxWidth: _ctx.inputWidth - 75 + "px" })
}, toDisplayString$1(item.currentLabel), 7)
]),
_: 2
}, 1032, ["closable", "size", "hit", "type", "onClose"]);
}), 128))
], 2)
]),
_: 1
}, 8, ["onAfterLeave"])) : createCommentVNode("v-if", true),
_ctx.filterable ? withDirectives((openBlock(), createElementBlock("input", {
key: 2,
ref: "input",
"onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => _ctx.query = $event),
type: "text",
class: normalizeClass([
_ctx.nsSelect.e("input"),
_ctx.nsSelect.is(_ctx.selectSize),
_ctx.nsSelect.is("disabled", _ctx.selectDisabled)
]),
disabled: _ctx.selectDisabled,
autocomplete: _ctx.autocomplete,
style: normalizeStyle({
marginLeft: _ctx.prefixWidth && !_ctx.selected.length || _ctx.tagInMultiLine ? `${_ctx.prefixWidth}px` : "",
flexGrow: 1,
width: `${_ctx.inputLength / (_ctx.inputWidth - 32)}%`,
maxWidth: `${_ctx.inputWidth - 42}px`
}),
onFocus: _cache[1] || (_cache[1] = (...args) => _ctx.handleFocus && _ctx.handleFocus(...args)),
onBlur: _cache[2] || (_cache[2] = (...args) => _ctx.handleBlur && _ctx.handleBlur(...args)),
onKeyup: _cache[3] || (_cache[3] = (...args) => _ctx.managePlaceholder && _ctx.managePlaceholder(...args)),
onKeydown: [
_cache[4] || (_cache[4] = (...args) => _ctx.resetInputState && _ctx.resetInputState(...args)),
_cache[5] || (_cache[5] = withKeys(withModifiers(($event) => _ctx.navigateOptions("next"), ["prevent"]), ["down"])),
_cache[6] || (_cache[6] = withKeys(withModifiers(($event) => _ctx.navigateOptions("prev"), ["prevent"]), ["up"])),
_cache[7] || (_cache[7] = withKeys((...args) => _ctx.handleKeydownEscape && _ctx.handleKeydownEscape(...args), ["esc"])),
_cache[8] || (_cache[8] = withKeys(withModifiers((...args) => _ctx.selectOption && _ctx.selectOption(...args), ["stop", "prevent"]), ["enter"])),
_cache[9] || (_cache[9] = withKeys((...args) => _ctx.deletePrevTag && _ctx.deletePrevTag(...args), ["delete"])),
_cache[10] || (_cache[10] = withKeys(($event) => _ctx.visible = false, ["tab"]))
],
onCompositionstart: _cache[11] || (_cache[11] = (...args) => _ctx.handleComposition && _ctx.handleComposition(...args)),
onCompositionupdate: _cache[12] || (_cache[12] = (...args) => _ctx.handleComposition && _ctx.handleComposition(...args)),
onCompositionend: _cache[13] || (_cache[13] = (...args) => _ctx.handleComposition && _ctx.handleComposition(...args)),
onInput: _cache[14] || (_cache[14] = (...args) => _ctx.debouncedQueryChange && _ctx.debouncedQueryChange(...args))
}, null, 46, _hoisted_1$6)), [
[vModelText, _ctx.query]
]) : createCommentVNode("v-if", true)
], 6)) : createCommentVNode("v-if", true),
createCommentVNode(" fix: https://github.com/element-plus/element-plus/issues/11415 "),
_ctx.isIOS && !_ctx.multiple && _ctx.filterable && _ctx.readonly ? (openBlock(), createElementBlock("input", {
key: 1,
ref: "iOSInput",
class: normalizeClass([
_ctx.nsSelect.e("input"),
_ctx.nsSelect.is(_ctx.selectSize),
_ctx.nsSelect.em("input", "iOS")
]),
disabled: _ctx.selectDisabled,
type: "text"
}, null, 10, _hoisted_2$5)) : createCommentVNode("v-if", true),
createVNode(_component_el_input, {
id: _ctx.id,
ref: "reference",
modelValue: _ctx.selectedLabel,
"onUpdate:modelValue": _cache[15] || (_cache[15] = ($event) => _ctx.selectedLabel = $event),
type: "text",
placeholder: typeof _ctx.currentPlaceholder === "function" ? _ctx.currentPlaceholder() : _ctx.currentPlaceholder,
name: _ctx.name,
autocomplete: _ctx.autocomplete,
size: _ctx.selectSize,
disabled: _ctx.selectDisabled,
readonly: _ctx.readonly,
"validate-event": false,
class: normalizeClass([_ctx.nsSelect.is("focus", _ctx.visible)]),
tabindex: _ctx.multiple && _ctx.filterable ? -1 : void 0,
onFocus: _ctx.handleFocus,
onBlur: _ctx.handleBlur,
onInput: _ctx.debouncedOnInputChange,
onPaste: _ctx.debouncedOnInputChange,
onCompositionstart: _ctx.handleComposition,
onCompositionupdate: _ctx.handleComposition,
onCompositionend: _ctx.handleComposition,
onKeydown: [
_cache[16] || (_cache[16] = withKeys(withModifiers(($event) => _ctx.navigateOptions("next"), ["stop", "prevent"]), ["down"])),
_cache[17] || (_cache[17] = withKeys(withModifiers(($event) => _ctx.navigateOptions("prev"), ["stop", "prevent"]), ["up"])),
withKeys(withModifiers(_ctx.selectOption, ["stop", "prevent"]), ["enter"]),
withKeys(_ctx.handleKeydownEscape, ["esc"]),
_cache[18] || (_cache[18] = withKeys(($event) => _ctx.visible = false, ["tab"]))
]
}, createSlots({
suffix: withCtx(() => [
_ctx.iconComponent && !_ctx.showClose ? (openBlock(), createBlock(_component_el_icon, {
key: 0,
class: normalizeClass([_ctx.nsSelect.e("caret"), _ctx.nsSelect.e("icon"), _ctx.iconReverse])
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.iconComponent)))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true),
_ctx.showClose && _ctx.clearIcon ? (openBlock(), createBlock(_component_el_icon, {
key: 1,
class: normalizeClass([_ctx.nsSelect.e("caret"), _ctx.nsSelect.e("icon")]),
onClick: _ctx.handleClearClick
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.clearIcon)))
]),
_: 1
}, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)
]),
_: 2
}, [
_ctx.$slots.prefix ? {
name: "prefix",
fn: withCtx(() => [
createBaseVNode("div", _hoisted_3$2, [
renderSlot(_ctx.$slots, "prefix")
])
])
} : void 0
]), 1032, ["id", "modelValue", "placeholder", "name", "autocomplete", "size", "disabled", "readonly", "class", "tabindex", "onFocus", "onBlur", "onInput", "onPaste", "onCompositionstart", "onCompositionupdate", "onCompositionend", "onKeydown"])
], 32)
]),
content: withCtx(() => [
createVNode(_component_el_select_menu, null, {
default: withCtx(() => [
withDirectives(createVNode(_component_el_scrollbar, {
ref: "scrollbar",
tag: "ul",
"wrap-class": _ctx.nsSelect.be("dropdown", "wrap"),
"view-class": _ctx.nsSelect.be("dropdown", "list"),
class: normalizeClass([
_ctx.nsSelect.is("empty", !_ctx.allowCreate && Boolean(_ctx.query) && _ctx.filteredOptionsCount === 0)
])
}, {
default: withCtx(() => [
_ctx.showNewOption ? (openBlock(), createBlock(_component_el_option, {
key: 0,
value: _ctx.query,
created: true
}, null, 8, ["value"])) : createCommentVNode("v-if", true),
createVNode(_component_el_options, { onUpdateOptions: _ctx.onOptionsRendered }, {
default: withCtx(() => [
renderSlot(_ctx.$slots, "default")
]),
_: 3
}, 8, ["onUpdateOptions"])
]),
_: 3
}, 8, ["wrap-class", "view-class", "class"]), [
[vShow, _ctx.options.size > 0 && !_ctx.loading]
]),
_ctx.emptyText && (!_ctx.allowCreate || _ctx.loading || _ctx.allowCreate && _ctx.options.size === 0) ? (openBlock(), createElementBlock(Fragment$1, { key: 0 }, [
_ctx.$slots.empty ? renderSlot(_ctx.$slots, "empty", { key: 0 }) : (openBlock(), createElementBlock("p", {
key: 1,
class: normalizeClass(_ctx.nsSelect.be("dropdown", "empty"))
}, toDisplayString$1(_ctx.emptyText), 3))
], 64)) : createCommentVNode("v-if", true)
]),
_: 3
})
]),
_: 3
}, 8, ["visible", "placement", "teleported", "popper-class", "popper-options", "effect", "transition", "persistent", "onShow"])
], 34)), [
[_directive_click_outside, _ctx.handleClose, _ctx.popperPaneRef]
]);
}
var Select = /* @__PURE__ */ _export_sfc(_sfc_main$8, [["render", _sfc_render$1], ["__file", "/home/runner/work/element-plus/element-plus/packages/components/select/src/select.vue"]]);
const _sfc_main$7 = defineComponent({
name: "ElOptionGroup",
componentName: "ElOptionGroup",
props: {
label: String,
disabled: {
type: Boolean,
default: false
}
},
setup(props) {
const ns = useNamespace("select");
const visible = ref(true);
const instance = getCurrentInstance();
const children = ref([]);
provide(selectGroupKey, reactive({
...toRefs(props)
}));
const select = inject(selectKey);
onMounted(() => {
children.value = flattedChildren(instance.subTree);
});
const flattedChildren = (node) => {
const children2 = [];
if (Array.isArray(node.children)) {
node.children.forEach((child) => {
var _a2;
if (child.type && child.type.name === "ElOption" && child.component && child.component.proxy) {
children2.push(child.component.proxy);
} else if ((_a2 = child.children) == null ? void 0 : _a2.length) {
children2.push(...flattedChildren(child));
}
});
}
return children2;
};
const { groupQueryChange } = toRaw(select);
watch(groupQueryChange, () => {
visible.value = children.value.some((option) => option.visible === true);
}, { flush: "post" });
return {
visible,
ns
};
}
});
function _sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
return withDirectives((openBlock(), createElementBlock("ul", {
class: normalizeClass(_ctx.ns.be("group", "wrap"))
}, [
createBaseVNode("li", {
class: normalizeClass(_ctx.ns.be("group", "title"))
}, toDisplayString$1(_ctx.label), 3),
createBaseVNode("li", null, [
createBaseVNode("ul", {
class: normalizeClass(_ctx.ns.b("group"))
}, [
renderSlot(_ctx.$slots, "default")
], 2)
])
], 2)), [
[vShow, _ctx.visible]
]);
}
var OptionGroup = /* @__PURE__ */ _export_sfc(_sfc_main$7, [["render", _sfc_render], ["__file", "/home/runner/work/element-plus/element-plus/packages/components/select/src/option-group.vue"]]);
const ElSelect = withInstall(Select, {
Option,
OptionGroup
});
const ElOption = withNoopInstall(Option);
withNoopInstall(OptionGroup);
const popconfirmProps = buildProps({
title: String,
confirmButtonText: String,
cancelButtonText: String,
confirmButtonType: {
type: String,
values: buttonTypes,
default: "primary"
},
cancelButtonType: {
type: String,
values: buttonTypes,
default: "text"
},
icon: {
type: iconPropType,
default: () => question_filled_default
},
iconColor: {
type: String,
default: "#f90"
},
hideIcon: {
type: Boolean,
default: false
},
hideAfter: {
type: Number,
default: 200
},
teleported: useTooltipContentProps.teleported,
persistent: useTooltipContentProps.persistent,
width: {
type: [String, Number],
default: 150
}
});
const popconfirmEmits = {
confirm: (e) => e instanceof MouseEvent,
cancel: (e) => e instanceof MouseEvent
};
const __default__$4 = defineComponent({
name: "ElPopconfirm"
});
const _sfc_main$6 = /* @__PURE__ */ defineComponent({
...__default__$4,
props: popconfirmProps,
emits: popconfirmEmits,
setup(__props, { emit: emit2 }) {
const props = __props;
const { t: t2 } = useLocale();
const ns = useNamespace("popconfirm");
const tooltipRef = ref();
const hidePopper = () => {
var _a2, _b;
(_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.onClose) == null ? void 0 : _b.call(_a2);
};
const style = computed(() => {
return {
width: addUnit(props.width)
};
});
const confirm = (e) => {
emit2("confirm", e);
hidePopper();
};
const cancel = (e) => {
emit2("cancel", e);
hidePopper();
};
const finalConfirmButtonText = computed(() => props.confirmButtonText || t2("el.popconfirm.confirmButtonText"));
const finalCancelButtonText = computed(() => props.cancelButtonText || t2("el.popconfirm.cancelButtonText"));
return (_ctx, _cache) => {
return openBlock(), createBlock(unref(ElTooltip), mergeProps({
ref_key: "tooltipRef",
ref: tooltipRef,
trigger: "click",
effect: "light"
}, _ctx.$attrs, {
"popper-class": `${unref(ns).namespace.value}-popover`,
"popper-style": unref(style),
teleported: _ctx.teleported,
"fallback-placements": ["bottom", "top", "right", "left"],
"hide-after": _ctx.hideAfter,
persistent: _ctx.persistent
}), {
content: withCtx(() => [
createBaseVNode("div", {
class: normalizeClass(unref(ns).b())
}, [
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("main"))
}, [
!_ctx.hideIcon && _ctx.icon ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(ns).e("icon")),
style: normalizeStyle({ color: _ctx.iconColor })
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.icon)))
]),
_: 1
}, 8, ["class", "style"])) : createCommentVNode("v-if", true),
createTextVNode(" " + toDisplayString$1(_ctx.title), 1)
], 2),
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("action"))
}, [
createVNode(unref(ElButton), {
size: "small",
type: _ctx.cancelButtonType === "text" ? "" : _ctx.cancelButtonType,
text: _ctx.cancelButtonType === "text",
onClick: cancel
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(finalCancelButtonText)), 1)
]),
_: 1
}, 8, ["type", "text"]),
createVNode(unref(ElButton), {
size: "small",
type: _ctx.confirmButtonType === "text" ? "" : _ctx.confirmButtonType,
text: _ctx.confirmButtonType === "text",
onClick: confirm
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(finalConfirmButtonText)), 1)
]),
_: 1
}, 8, ["type", "text"])
], 2)
], 2)
]),
default: withCtx(() => [
_ctx.$slots.reference ? renderSlot(_ctx.$slots, "reference", { key: 0 }) : createCommentVNode("v-if", true)
]),
_: 3
}, 16, ["popper-class", "popper-style", "teleported", "hide-after", "persistent"]);
};
}
});
var Popconfirm = /* @__PURE__ */ _export_sfc(_sfc_main$6, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/popconfirm/src/popconfirm.vue"]]);
const ElPopconfirm = withInstall(Popconfirm);
const sliderContextKey = Symbol("sliderContextKey");
const sliderProps = buildProps({
modelValue: {
type: definePropType([Number, Array]),
default: 0
},
id: {
type: String,
default: void 0
},
min: {
type: Number,
default: 0
},
max: {
type: Number,
default: 100
},
step: {
type: Number,
default: 1
},
showInput: Boolean,
showInputControls: {
type: Boolean,
default: true
},
size: useSizeProp,
inputSize: useSizeProp,
showStops: Boolean,
showTooltip: {
type: Boolean,
default: true
},
formatTooltip: {
type: definePropType(Function),
default: void 0
},
disabled: Boolean,
range: Boolean,
vertical: Boolean,
height: String,
debounce: {
type: Number,
default: 300
},
label: {
type: String,
default: void 0
},
rangeStartLabel: {
type: String,
default: void 0
},
rangeEndLabel: {
type: String,
default: void 0
},
formatValueText: {
type: definePropType(Function),
default: void 0
},
tooltipClass: {
type: String,
default: void 0
},
placement: {
type: String,
values: Ee,
default: "top"
},
marks: {
type: definePropType(Object)
},
validateEvent: {
type: Boolean,
default: true
}
});
const isValidValue = (value) => isNumber$1(value) || isArray$3(value) && value.every(isNumber$1);
const sliderEmits = {
[UPDATE_MODEL_EVENT]: isValidValue,
[INPUT_EVENT]: isValidValue,
[CHANGE_EVENT]: isValidValue
};
const useLifecycle = (props, initData, resetSize) => {
const sliderWrapper = ref();
onMounted(async () => {
if (props.range) {
if (Array.isArray(props.modelValue)) {
initData.firstValue = Math.max(props.min, props.modelValue[0]);
initData.secondValue = Math.min(props.max, props.modelValue[1]);
} else {
initData.firstValue = props.min;
initData.secondValue = props.max;
}
initData.oldValue = [initData.firstValue, initData.secondValue];
} else {
if (typeof props.modelValue !== "number" || Number.isNaN(props.modelValue)) {
initData.firstValue = props.min;
} else {
initData.firstValue = Math.min(props.max, Math.max(props.min, props.modelValue));
}
initData.oldValue = initData.firstValue;
}
useEventListener$1(window, "resize", resetSize);
await nextTick();
resetSize();
});
return {
sliderWrapper
};
};
const useMarks = (props) => {
return computed(() => {
if (!props.marks) {
return [];
}
const marksKeys = Object.keys(props.marks);
return marksKeys.map(Number.parseFloat).sort((a, b) => a - b).filter((point) => point <= props.max && point >= props.min).map((point) => ({
point,
position: (point - props.min) * 100 / (props.max - props.min),
mark: props.marks[point]
}));
});
};
const useSlide = (props, initData, emit2) => {
const { form: elForm2, formItem: elFormItem2 } = useFormItem();
const slider = shallowRef();
const firstButton = ref();
const secondButton = ref();
const buttonRefs = {
firstButton,
secondButton
};
const sliderDisabled = computed(() => {
return props.disabled || (elForm2 == null ? void 0 : elForm2.disabled) || false;
});
const minValue = computed(() => {
return Math.min(initData.firstValue, initData.secondValue);
});
const maxValue = computed(() => {
return Math.max(initData.firstValue, initData.secondValue);
});
const barSize = computed(() => {
return props.range ? `${100 * (maxValue.value - minValue.value) / (props.max - props.min)}%` : `${100 * (initData.firstValue - props.min) / (props.max - props.min)}%`;
});
const barStart = computed(() => {
return props.range ? `${100 * (minValue.value - props.min) / (props.max - props.min)}%` : "0%";
});
const runwayStyle = computed(() => {
return props.vertical ? { height: props.height } : {};
});
const barStyle = computed(() => {
return props.vertical ? {
height: barSize.value,
bottom: barStart.value
} : {
width: barSize.value,
left: barStart.value
};
});
const resetSize = () => {
if (slider.value) {
initData.sliderSize = slider.value[`client${props.vertical ? "Height" : "Width"}`];
}
};
const getButtonRefByPercent = (percent) => {
const targetValue = props.min + percent * (props.max - props.min) / 100;
if (!props.range) {
return firstButton;
}
let buttonRefName;
if (Math.abs(minValue.value - targetValue) < Math.abs(maxValue.value - targetValue)) {
buttonRefName = initData.firstValue < initData.secondValue ? "firstButton" : "secondButton";
} else {
buttonRefName = initData.firstValue > initData.secondValue ? "firstButton" : "secondButton";
}
return buttonRefs[buttonRefName];
};
const setPosition = (percent) => {
const buttonRef = getButtonRefByPercent(percent);
buttonRef.value.setPosition(percent);
return buttonRef;
};
const setFirstValue = (firstValue) => {
initData.firstValue = firstValue;
_emit(props.range ? [minValue.value, maxValue.value] : firstValue);
};
const setSecondValue = (secondValue) => {
initData.secondValue = secondValue;
if (props.range) {
_emit([minValue.value, maxValue.value]);
}
};
const _emit = (val) => {
emit2(UPDATE_MODEL_EVENT, val);
emit2(INPUT_EVENT, val);
};
const emitChange = async () => {
await nextTick();
emit2(CHANGE_EVENT, props.range ? [minValue.value, maxValue.value] : props.modelValue);
};
const handleSliderPointerEvent = (event) => {
var _a2, _b, _c, _d, _e, _f;
if (sliderDisabled.value || initData.dragging)
return;
resetSize();
let newPercent = 0;
if (props.vertical) {
const clientY = (_c = (_b = (_a2 = event.touches) == null ? void 0 : _a2.item(0)) == null ? void 0 : _b.clientY) != null ? _c : event.clientY;
const sliderOffsetBottom = slider.value.getBoundingClientRect().bottom;
newPercent = (sliderOffsetBottom - clientY) / initData.sliderSize * 100;
} else {
const clientX = (_f = (_e = (_d = event.touches) == null ? void 0 : _d.item(0)) == null ? void 0 : _e.clientX) != null ? _f : event.clientX;
const sliderOffsetLeft = slider.value.getBoundingClientRect().left;
newPercent = (clientX - sliderOffsetLeft) / initData.sliderSize * 100;
}
if (newPercent < 0 || newPercent > 100)
return;
return setPosition(newPercent);
};
const onSliderWrapperPrevent = (event) => {
var _a2, _b;
if (((_a2 = buttonRefs["firstButton"].value) == null ? void 0 : _a2.dragging) || ((_b = buttonRefs["secondButton"].value) == null ? void 0 : _b.dragging)) {
event.preventDefault();
}
};
const onSliderDown = async (event) => {
const buttonRef = handleSliderPointerEvent(event);
if (buttonRef) {
await nextTick();
buttonRef.value.onButtonDown(event);
}
};
const onSliderClick = (event) => {
const buttonRef = handleSliderPointerEvent(event);
if (buttonRef) {
emitChange();
}
};
return {
elFormItem: elFormItem2,
slider,
firstButton,
secondButton,
sliderDisabled,
minValue,
maxValue,
runwayStyle,
barStyle,
resetSize,
setPosition,
emitChange,
onSliderWrapperPrevent,
onSliderClick,
onSliderDown,
setFirstValue,
setSecondValue
};
};
const { left, down, right, up, home, end, pageUp, pageDown } = EVENT_CODE;
const useTooltip = (props, formatTooltip, showTooltip) => {
const tooltip = ref();
const tooltipVisible = ref(false);
const enableFormat = computed(() => {
return formatTooltip.value instanceof Function;
});
const formatValue = computed(() => {
return enableFormat.value && formatTooltip.value(props.modelValue) || props.modelValue;
});
const displayTooltip = debounce(() => {
showTooltip.value && (tooltipVisible.value = true);
}, 50);
const hideTooltip = debounce(() => {
showTooltip.value && (tooltipVisible.value = false);
}, 50);
return {
tooltip,
tooltipVisible,
formatValue,
displayTooltip,
hideTooltip
};
};
const useSliderButton = (props, initData, emit2) => {
const {
disabled,
min,
max,
step,
showTooltip,
precision,
sliderSize,
formatTooltip,
emitChange,
resetSize,
updateDragging
} = inject(sliderContextKey);
const { tooltip, tooltipVisible, formatValue, displayTooltip, hideTooltip } = useTooltip(props, formatTooltip, showTooltip);
const button = ref();
const currentPosition = computed(() => {
return `${(props.modelValue - min.value) / (max.value - min.value) * 100}%`;
});
const wrapperStyle = computed(() => {
return props.vertical ? { bottom: currentPosition.value } : { left: currentPosition.value };
});
const handleMouseEnter = () => {
initData.hovering = true;
displayTooltip();
};
const handleMouseLeave = () => {
initData.hovering = false;
if (!initData.dragging) {
hideTooltip();
}
};
const onButtonDown = (event) => {
if (disabled.value)
return;
event.preventDefault();
onDragStart(event);
window.addEventListener("mousemove", onDragging);
window.addEventListener("touchmove", onDragging);
window.addEventListener("mouseup", onDragEnd);
window.addEventListener("touchend", onDragEnd);
window.addEventListener("contextmenu", onDragEnd);
button.value.focus();
};
const incrementPosition = (amount) => {
if (disabled.value)
return;
initData.newPosition = Number.parseFloat(currentPosition.value) + amount / (max.value - min.value) * 100;
setPosition(initData.newPosition);
emitChange();
};
const onLeftKeyDown = () => {
incrementPosition(-step.value);
};
const onRightKeyDown = () => {
incrementPosition(step.value);
};
const onPageDownKeyDown = () => {
incrementPosition(-step.value * 4);
};
const onPageUpKeyDown = () => {
incrementPosition(step.value * 4);
};
const onHomeKeyDown = () => {
if (disabled.value)
return;
setPosition(0);
emitChange();
};
const onEndKeyDown = () => {
if (disabled.value)
return;
setPosition(100);
emitChange();
};
const onKeyDown = (event) => {
let isPreventDefault = true;
if ([left, down].includes(event.key)) {
onLeftKeyDown();
} else if ([right, up].includes(event.key)) {
onRightKeyDown();
} else if (event.key === home) {
onHomeKeyDown();
} else if (event.key === end) {
onEndKeyDown();
} else if (event.key === pageDown) {
onPageDownKeyDown();
} else if (event.key === pageUp) {
onPageUpKeyDown();
} else {
isPreventDefault = false;
}
isPreventDefault && event.preventDefault();
};
const getClientXY = (event) => {
let clientX;
let clientY;
if (event.type.startsWith("touch")) {
clientY = event.touches[0].clientY;
clientX = event.touches[0].clientX;
} else {
clientY = event.clientY;
clientX = event.clientX;
}
return {
clientX,
clientY
};
};
const onDragStart = (event) => {
initData.dragging = true;
initData.isClick = true;
const { clientX, clientY } = getClientXY(event);
if (props.vertical) {
initData.startY = clientY;
} else {
initData.startX = clientX;
}
initData.startPosition = Number.parseFloat(currentPosition.value);
initData.newPosition = initData.startPosition;
};
const onDragging = (event) => {
if (initData.dragging) {
initData.isClick = false;
displayTooltip();
resetSize();
let diff;
const { clientX, clientY } = getClientXY(event);
if (props.vertical) {
initData.currentY = clientY;
diff = (initData.startY - initData.currentY) / sliderSize.value * 100;
} else {
initData.currentX = clientX;
diff = (initData.currentX - initData.startX) / sliderSize.value * 100;
}
initData.newPosition = initData.startPosition + diff;
setPosition(initData.newPosition);
}
};
const onDragEnd = () => {
if (initData.dragging) {
setTimeout(() => {
initData.dragging = false;
if (!initData.hovering) {
hideTooltip();
}
if (!initData.isClick) {
setPosition(initData.newPosition);
}
emitChange();
}, 0);
window.removeEventListener("mousemove", onDragging);
window.removeEventListener("touchmove", onDragging);
window.removeEventListener("mouseup", onDragEnd);
window.removeEventListener("touchend", onDragEnd);
window.removeEventListener("contextmenu", onDragEnd);
}
};
const setPosition = async (newPosition) => {
if (newPosition === null || Number.isNaN(+newPosition))
return;
if (newPosition < 0) {
newPosition = 0;
} else if (newPosition > 100) {
newPosition = 100;
}
const lengthPerStep = 100 / ((max.value - min.value) / step.value);
const steps = Math.round(newPosition / lengthPerStep);
let value = steps * lengthPerStep * (max.value - min.value) * 0.01 + min.value;
value = Number.parseFloat(value.toFixed(precision.value));
if (value !== props.modelValue) {
emit2(UPDATE_MODEL_EVENT, value);
}
if (!initData.dragging && props.modelValue !== initData.oldValue) {
initData.oldValue = props.modelValue;
}
await nextTick();
initData.dragging && displayTooltip();
tooltip.value.updatePopper();
};
watch(() => initData.dragging, (val) => {
updateDragging(val);
});
return {
disabled,
button,
tooltip,
tooltipVisible,
showTooltip,
wrapperStyle,
formatValue,
handleMouseEnter,
handleMouseLeave,
onButtonDown,
onKeyDown,
setPosition
};
};
const useStops = (props, initData, minValue, maxValue) => {
const stops = computed(() => {
if (!props.showStops || props.min > props.max)
return [];
if (props.step === 0) {
return [];
}
const stopCount = (props.max - props.min) / props.step;
const stepWidth = 100 * props.step / (props.max - props.min);
const result = Array.from({ length: stopCount - 1 }).map((_, index2) => (index2 + 1) * stepWidth);
if (props.range) {
return result.filter((step) => {
return step < 100 * (minValue.value - props.min) / (props.max - props.min) || step > 100 * (maxValue.value - props.min) / (props.max - props.min);
});
} else {
return result.filter((step) => step > 100 * (initData.firstValue - props.min) / (props.max - props.min));
}
});
const getStopStyle = (position) => {
return props.vertical ? { bottom: `${position}%` } : { left: `${position}%` };
};
return {
stops,
getStopStyle
};
};
const useWatch = (props, initData, minValue, maxValue, emit2, elFormItem2) => {
const _emit = (val) => {
emit2(UPDATE_MODEL_EVENT, val);
emit2(INPUT_EVENT, val);
};
const valueChanged = () => {
if (props.range) {
return ![minValue.value, maxValue.value].every((item, index2) => item === initData.oldValue[index2]);
} else {
return props.modelValue !== initData.oldValue;
}
};
const setValues = () => {
var _a2, _b;
if (props.min > props.max) {
throwError("Slider", "min should not be greater than max.");
}
const val = props.modelValue;
if (props.range && Array.isArray(val)) {
if (val[1] < props.min) {
_emit([props.min, props.min]);
} else if (val[0] > props.max) {
_emit([props.max, props.max]);
} else if (val[0] < props.min) {
_emit([props.min, val[1]]);
} else if (val[1] > props.max) {
_emit([val[0], props.max]);
} else {
initData.firstValue = val[0];
initData.secondValue = val[1];
if (valueChanged()) {
if (props.validateEvent) {
(_a2 = elFormItem2 == null ? void 0 : elFormItem2.validate) == null ? void 0 : _a2.call(elFormItem2, "change").catch((err) => debugWarn());
}
initData.oldValue = val.slice();
}
}
} else if (!props.range && typeof val === "number" && !Number.isNaN(val)) {
if (val < props.min) {
_emit(props.min);
} else if (val > props.max) {
_emit(props.max);
} else {
initData.firstValue = val;
if (valueChanged()) {
if (props.validateEvent) {
(_b = elFormItem2 == null ? void 0 : elFormItem2.validate) == null ? void 0 : _b.call(elFormItem2, "change").catch((err) => debugWarn());
}
initData.oldValue = val;
}
}
}
};
setValues();
watch(() => initData.dragging, (val) => {
if (!val) {
setValues();
}
});
watch(() => props.modelValue, (val, oldVal) => {
if (initData.dragging || Array.isArray(val) && Array.isArray(oldVal) && val.every((item, index2) => item === oldVal[index2]) && initData.firstValue === val[0] && initData.secondValue === val[1]) {
return;
}
setValues();
}, {
deep: true
});
watch(() => [props.min, props.max], () => {
setValues();
});
};
const sliderButtonProps = buildProps({
modelValue: {
type: Number,
default: 0
},
vertical: Boolean,
tooltipClass: String,
placement: {
type: String,
values: Ee,
default: "top"
}
});
const sliderButtonEmits = {
[UPDATE_MODEL_EVENT]: (value) => isNumber$1(value)
};
const _hoisted_1$5 = ["tabindex"];
const __default__$3 = defineComponent({
name: "ElSliderButton"
});
const _sfc_main$5 = /* @__PURE__ */ defineComponent({
...__default__$3,
props: sliderButtonProps,
emits: sliderButtonEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const ns = useNamespace("slider");
const initData = reactive({
hovering: false,
dragging: false,
isClick: false,
startX: 0,
currentX: 0,
startY: 0,
currentY: 0,
startPosition: 0,
newPosition: 0,
oldValue: props.modelValue
});
const {
disabled,
button,
tooltip,
showTooltip,
tooltipVisible,
wrapperStyle,
formatValue,
handleMouseEnter,
handleMouseLeave,
onButtonDown,
onKeyDown,
setPosition
} = useSliderButton(props, initData, emit2);
const { hovering, dragging } = toRefs(initData);
expose2({
onButtonDown,
onKeyDown,
setPosition,
hovering,
dragging
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
ref_key: "button",
ref: button,
class: normalizeClass([unref(ns).e("button-wrapper"), { hover: unref(hovering), dragging: unref(dragging) }]),
style: normalizeStyle(unref(wrapperStyle)),
tabindex: unref(disabled) ? -1 : 0,
onMouseenter: _cache[0] || (_cache[0] = (...args) => unref(handleMouseEnter) && unref(handleMouseEnter)(...args)),
onMouseleave: _cache[1] || (_cache[1] = (...args) => unref(handleMouseLeave) && unref(handleMouseLeave)(...args)),
onMousedown: _cache[2] || (_cache[2] = (...args) => unref(onButtonDown) && unref(onButtonDown)(...args)),
onTouchstart: _cache[3] || (_cache[3] = (...args) => unref(onButtonDown) && unref(onButtonDown)(...args)),
onFocus: _cache[4] || (_cache[4] = (...args) => unref(handleMouseEnter) && unref(handleMouseEnter)(...args)),
onBlur: _cache[5] || (_cache[5] = (...args) => unref(handleMouseLeave) && unref(handleMouseLeave)(...args)),
onKeydown: _cache[6] || (_cache[6] = (...args) => unref(onKeyDown) && unref(onKeyDown)(...args))
}, [
createVNode(unref(ElTooltip), {
ref_key: "tooltip",
ref: tooltip,
visible: unref(tooltipVisible),
placement: _ctx.placement,
"fallback-placements": ["top", "bottom", "right", "left"],
"stop-popper-mouse-event": false,
"popper-class": _ctx.tooltipClass,
disabled: !unref(showTooltip),
persistent: ""
}, {
content: withCtx(() => [
createBaseVNode("span", null, toDisplayString$1(unref(formatValue)), 1)
]),
default: withCtx(() => [
createBaseVNode("div", {
class: normalizeClass([unref(ns).e("button"), { hover: unref(hovering), dragging: unref(dragging) }])
}, null, 2)
]),
_: 1
}, 8, ["visible", "placement", "popper-class", "disabled"])
], 46, _hoisted_1$5);
};
}
});
var SliderButton = /* @__PURE__ */ _export_sfc(_sfc_main$5, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/slider/src/button.vue"]]);
const sliderMarkerProps = buildProps({
mark: {
type: definePropType([String, Object]),
default: void 0
}
});
var SliderMarker = defineComponent({
name: "ElSliderMarker",
props: sliderMarkerProps,
setup(props) {
const ns = useNamespace("slider");
const label = computed(() => {
return isString$2(props.mark) ? props.mark : props.mark.label;
});
const style = computed(() => isString$2(props.mark) ? void 0 : props.mark.style);
return () => h("div", {
class: ns.e("marks-text"),
style: style.value
}, label.value);
}
});
const _hoisted_1$4 = ["id", "role", "aria-label", "aria-labelledby"];
const _hoisted_2$4 = { key: 1 };
const __default__$2 = defineComponent({
name: "ElSlider"
});
const _sfc_main$4 = /* @__PURE__ */ defineComponent({
...__default__$2,
props: sliderProps,
emits: sliderEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const ns = useNamespace("slider");
const { t: t2 } = useLocale();
const initData = reactive({
firstValue: 0,
secondValue: 0,
oldValue: 0,
dragging: false,
sliderSize: 1
});
const {
elFormItem: elFormItem2,
slider,
firstButton,
secondButton,
sliderDisabled,
minValue,
maxValue,
runwayStyle,
barStyle,
resetSize,
emitChange,
onSliderWrapperPrevent,
onSliderClick,
onSliderDown,
setFirstValue,
setSecondValue
} = useSlide(props, initData, emit2);
const { stops, getStopStyle } = useStops(props, initData, minValue, maxValue);
const { inputId, isLabeledByFormItem } = useFormItemInputId(props, {
formItemContext: elFormItem2
});
const sliderWrapperSize = useFormSize();
const sliderInputSize = computed(() => props.inputSize || sliderWrapperSize.value);
const groupLabel = computed(() => {
return props.label || t2("el.slider.defaultLabel", {
min: props.min,
max: props.max
});
});
const firstButtonLabel = computed(() => {
if (props.range) {
return props.rangeStartLabel || t2("el.slider.defaultRangeStartLabel");
} else {
return groupLabel.value;
}
});
const firstValueText = computed(() => {
return props.formatValueText ? props.formatValueText(firstValue.value) : `${firstValue.value}`;
});
const secondButtonLabel = computed(() => {
return props.rangeEndLabel || t2("el.slider.defaultRangeEndLabel");
});
const secondValueText = computed(() => {
return props.formatValueText ? props.formatValueText(secondValue.value) : `${secondValue.value}`;
});
const sliderKls = computed(() => [
ns.b(),
ns.m(sliderWrapperSize.value),
ns.is("vertical", props.vertical),
{ [ns.m("with-input")]: props.showInput }
]);
const markList = useMarks(props);
useWatch(props, initData, minValue, maxValue, emit2, elFormItem2);
const precision = computed(() => {
const precisions = [props.min, props.max, props.step].map((item) => {
const decimal = `${item}`.split(".")[1];
return decimal ? decimal.length : 0;
});
return Math.max.apply(null, precisions);
});
const { sliderWrapper } = useLifecycle(props, initData, resetSize);
const { firstValue, secondValue, sliderSize } = toRefs(initData);
const updateDragging = (val) => {
initData.dragging = val;
};
provide(sliderContextKey, {
...toRefs(props),
sliderSize,
disabled: sliderDisabled,
precision,
emitChange,
resetSize,
updateDragging
});
expose2({
onSliderClick
});
return (_ctx, _cache) => {
var _a2, _b;
return openBlock(), createElementBlock("div", {
id: _ctx.range ? unref(inputId) : void 0,
ref_key: "sliderWrapper",
ref: sliderWrapper,
class: normalizeClass(unref(sliderKls)),
role: _ctx.range ? "group" : void 0,
"aria-label": _ctx.range && !unref(isLabeledByFormItem) ? unref(groupLabel) : void 0,
"aria-labelledby": _ctx.range && unref(isLabeledByFormItem) ? (_a2 = unref(elFormItem2)) == null ? void 0 : _a2.labelId : void 0,
onTouchstart: _cache[2] || (_cache[2] = (...args) => unref(onSliderWrapperPrevent) && unref(onSliderWrapperPrevent)(...args)),
onTouchmove: _cache[3] || (_cache[3] = (...args) => unref(onSliderWrapperPrevent) && unref(onSliderWrapperPrevent)(...args))
}, [
createBaseVNode("div", {
ref_key: "slider",
ref: slider,
class: normalizeClass([
unref(ns).e("runway"),
{ "show-input": _ctx.showInput && !_ctx.range },
unref(ns).is("disabled", unref(sliderDisabled))
]),
style: normalizeStyle(unref(runwayStyle)),
onMousedown: _cache[0] || (_cache[0] = (...args) => unref(onSliderDown) && unref(onSliderDown)(...args)),
onTouchstart: _cache[1] || (_cache[1] = (...args) => unref(onSliderDown) && unref(onSliderDown)(...args))
}, [
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("bar")),
style: normalizeStyle(unref(barStyle))
}, null, 6),
createVNode(SliderButton, {
id: !_ctx.range ? unref(inputId) : void 0,
ref_key: "firstButton",
ref: firstButton,
"model-value": unref(firstValue),
vertical: _ctx.vertical,
"tooltip-class": _ctx.tooltipClass,
placement: _ctx.placement,
role: "slider",
"aria-label": _ctx.range || !unref(isLabeledByFormItem) ? unref(firstButtonLabel) : void 0,
"aria-labelledby": !_ctx.range && unref(isLabeledByFormItem) ? (_b = unref(elFormItem2)) == null ? void 0 : _b.labelId : void 0,
"aria-valuemin": _ctx.min,
"aria-valuemax": _ctx.range ? unref(secondValue) : _ctx.max,
"aria-valuenow": unref(firstValue),
"aria-valuetext": unref(firstValueText),
"aria-orientation": _ctx.vertical ? "vertical" : "horizontal",
"aria-disabled": unref(sliderDisabled),
"onUpdate:modelValue": unref(setFirstValue)
}, null, 8, ["id", "model-value", "vertical", "tooltip-class", "placement", "aria-label", "aria-labelledby", "aria-valuemin", "aria-valuemax", "aria-valuenow", "aria-valuetext", "aria-orientation", "aria-disabled", "onUpdate:modelValue"]),
_ctx.range ? (openBlock(), createBlock(SliderButton, {
key: 0,
ref_key: "secondButton",
ref: secondButton,
"model-value": unref(secondValue),
vertical: _ctx.vertical,
"tooltip-class": _ctx.tooltipClass,
placement: _ctx.placement,
role: "slider",
"aria-label": unref(secondButtonLabel),
"aria-valuemin": unref(firstValue),
"aria-valuemax": _ctx.max,
"aria-valuenow": unref(secondValue),
"aria-valuetext": unref(secondValueText),
"aria-orientation": _ctx.vertical ? "vertical" : "horizontal",
"aria-disabled": unref(sliderDisabled),
"onUpdate:modelValue": unref(setSecondValue)
}, null, 8, ["model-value", "vertical", "tooltip-class", "placement", "aria-label", "aria-valuemin", "aria-valuemax", "aria-valuenow", "aria-valuetext", "aria-orientation", "aria-disabled", "onUpdate:modelValue"])) : createCommentVNode("v-if", true),
_ctx.showStops ? (openBlock(), createElementBlock("div", _hoisted_2$4, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(unref(stops), (item, key) => {
return openBlock(), createElementBlock("div", {
key,
class: normalizeClass(unref(ns).e("stop")),
style: normalizeStyle(unref(getStopStyle)(item))
}, null, 6);
}), 128))
])) : createCommentVNode("v-if", true),
unref(markList).length > 0 ? (openBlock(), createElementBlock(Fragment$1, { key: 2 }, [
createBaseVNode("div", null, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(unref(markList), (item, key) => {
return openBlock(), createElementBlock("div", {
key,
style: normalizeStyle(unref(getStopStyle)(item.position)),
class: normalizeClass([unref(ns).e("stop"), unref(ns).e("marks-stop")])
}, null, 6);
}), 128))
]),
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("marks"))
}, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(unref(markList), (item, key) => {
return openBlock(), createBlock(unref(SliderMarker), {
key,
mark: item.mark,
style: normalizeStyle(unref(getStopStyle)(item.position))
}, null, 8, ["mark", "style"]);
}), 128))
], 2)
], 64)) : createCommentVNode("v-if", true)
], 38),
_ctx.showInput && !_ctx.range ? (openBlock(), createBlock(unref(ElInputNumber), {
key: 0,
ref: "input",
"model-value": unref(firstValue),
class: normalizeClass(unref(ns).e("input")),
step: _ctx.step,
disabled: unref(sliderDisabled),
controls: _ctx.showInputControls,
min: _ctx.min,
max: _ctx.max,
debounce: _ctx.debounce,
size: unref(sliderInputSize),
"onUpdate:modelValue": unref(setFirstValue),
onChange: unref(emitChange)
}, null, 8, ["model-value", "class", "step", "disabled", "controls", "min", "max", "debounce", "size", "onUpdate:modelValue", "onChange"])) : createCommentVNode("v-if", true)
], 42, _hoisted_1$4);
};
}
});
var Slider = /* @__PURE__ */ _export_sfc(_sfc_main$4, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/slider/src/slider.vue"]]);
const ElSlider = withInstall(Slider);
const switchProps = buildProps({
modelValue: {
type: [Boolean, String, Number],
default: false
},
value: {
type: [Boolean, String, Number],
default: false
},
disabled: {
type: Boolean,
default: false
},
width: {
type: [String, Number],
default: ""
},
inlinePrompt: {
type: Boolean,
default: false
},
activeIcon: {
type: iconPropType
},
inactiveIcon: {
type: iconPropType
},
activeText: {
type: String,
default: ""
},
inactiveText: {
type: String,
default: ""
},
activeColor: {
type: String,
default: ""
},
inactiveColor: {
type: String,
default: ""
},
borderColor: {
type: String,
default: ""
},
activeValue: {
type: [Boolean, String, Number],
default: true
},
inactiveValue: {
type: [Boolean, String, Number],
default: false
},
name: {
type: String,
default: ""
},
validateEvent: {
type: Boolean,
default: true
},
id: String,
loading: {
type: Boolean,
default: false
},
beforeChange: {
type: definePropType(Function)
},
size: {
type: String,
validator: isValidComponentSize
},
tabindex: {
type: [String, Number]
}
});
const switchEmits = {
[UPDATE_MODEL_EVENT]: (val) => isBoolean$1(val) || isString$2(val) || isNumber$1(val),
[CHANGE_EVENT]: (val) => isBoolean$1(val) || isString$2(val) || isNumber$1(val),
[INPUT_EVENT]: (val) => isBoolean$1(val) || isString$2(val) || isNumber$1(val)
};
const _hoisted_1$3 = ["onClick"];
const _hoisted_2$3 = ["id", "aria-checked", "aria-disabled", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"];
const _hoisted_3$1 = ["aria-hidden"];
const _hoisted_4$1 = ["aria-hidden"];
const _hoisted_5$1 = ["aria-hidden"];
const COMPONENT_NAME = "ElSwitch";
const __default__$1 = defineComponent({
name: COMPONENT_NAME
});
const _sfc_main$3 = /* @__PURE__ */ defineComponent({
...__default__$1,
props: switchProps,
emits: switchEmits,
setup(__props, { expose: expose2, emit: emit2 }) {
const props = __props;
const vm = getCurrentInstance();
const { formItem } = useFormItem();
const switchSize = useFormSize();
const ns = useNamespace("switch");
useDeprecated({
from: '"value"',
replacement: '"model-value" or "v-model"',
scope: COMPONENT_NAME,
version: "2.3.0",
ref: "https://element-plus.org/en-US/component/switch.html#attributes",
type: "Attribute"
}, computed(() => {
var _a2;
return !!((_a2 = vm.vnode.props) == null ? void 0 : _a2.value);
}));
const { inputId } = useFormItemInputId(props, {
formItemContext: formItem
});
const switchDisabled = useFormDisabled(computed(() => props.loading));
const isControlled = ref(props.modelValue !== false);
const input = ref();
const core = ref();
const switchKls = computed(() => [
ns.b(),
ns.m(switchSize.value),
ns.is("disabled", switchDisabled.value),
ns.is("checked", checked.value)
]);
const coreStyle = computed(() => ({
width: addUnit(props.width)
}));
watch(() => props.modelValue, () => {
isControlled.value = true;
});
watch(() => props.value, () => {
isControlled.value = false;
});
const actualValue = computed(() => {
return isControlled.value ? props.modelValue : props.value;
});
const checked = computed(() => actualValue.value === props.activeValue);
if (![props.activeValue, props.inactiveValue].includes(actualValue.value)) {
emit2(UPDATE_MODEL_EVENT, props.inactiveValue);
emit2(CHANGE_EVENT, props.inactiveValue);
emit2(INPUT_EVENT, props.inactiveValue);
}
watch(checked, (val) => {
var _a2;
input.value.checked = val;
if (props.validateEvent) {
(_a2 = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a2.call(formItem, "change").catch((err) => debugWarn());
}
});
const handleChange = () => {
const val = checked.value ? props.inactiveValue : props.activeValue;
emit2(UPDATE_MODEL_EVENT, val);
emit2(CHANGE_EVENT, val);
emit2(INPUT_EVENT, val);
nextTick(() => {
input.value.checked = checked.value;
});
};
const switchValue = () => {
if (switchDisabled.value)
return;
const { beforeChange } = props;
if (!beforeChange) {
handleChange();
return;
}
const shouldChange = beforeChange();
const isPromiseOrBool = [
isPromise(shouldChange),
isBoolean$1(shouldChange)
].includes(true);
if (!isPromiseOrBool) {
throwError(COMPONENT_NAME, "beforeChange must return type `Promise<boolean>` or `boolean`");
}
if (isPromise(shouldChange)) {
shouldChange.then((result) => {
if (result) {
handleChange();
}
}).catch((e) => {
});
} else if (shouldChange) {
handleChange();
}
};
const styles = computed(() => {
return ns.cssVarBlock({
...props.activeColor ? { "on-color": props.activeColor } : null,
...props.inactiveColor ? { "off-color": props.inactiveColor } : null,
...props.borderColor ? { "border-color": props.borderColor } : null
});
});
const focus = () => {
var _a2, _b;
(_b = (_a2 = input.value) == null ? void 0 : _a2.focus) == null ? void 0 : _b.call(_a2);
};
onMounted(() => {
input.value.checked = checked.value;
});
expose2({
focus,
checked
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("div", {
class: normalizeClass(unref(switchKls)),
style: normalizeStyle(unref(styles)),
onClick: withModifiers(switchValue, ["prevent"])
}, [
createBaseVNode("input", {
id: unref(inputId),
ref_key: "input",
ref: input,
class: normalizeClass(unref(ns).e("input")),
type: "checkbox",
role: "switch",
"aria-checked": unref(checked),
"aria-disabled": unref(switchDisabled),
name: _ctx.name,
"true-value": _ctx.activeValue,
"false-value": _ctx.inactiveValue,
disabled: unref(switchDisabled),
tabindex: _ctx.tabindex,
onChange: handleChange,
onKeydown: withKeys(switchValue, ["enter"])
}, null, 42, _hoisted_2$3),
!_ctx.inlinePrompt && (_ctx.inactiveIcon || _ctx.inactiveText) ? (openBlock(), createElementBlock("span", {
key: 0,
class: normalizeClass([
unref(ns).e("label"),
unref(ns).em("label", "left"),
unref(ns).is("active", !unref(checked))
])
}, [
_ctx.inactiveIcon ? (openBlock(), createBlock(unref(ElIcon), { key: 0 }, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.inactiveIcon)))
]),
_: 1
})) : createCommentVNode("v-if", true),
!_ctx.inactiveIcon && _ctx.inactiveText ? (openBlock(), createElementBlock("span", {
key: 1,
"aria-hidden": unref(checked)
}, toDisplayString$1(_ctx.inactiveText), 9, _hoisted_3$1)) : createCommentVNode("v-if", true)
], 2)) : createCommentVNode("v-if", true),
createBaseVNode("span", {
ref_key: "core",
ref: core,
class: normalizeClass(unref(ns).e("core")),
style: normalizeStyle(unref(coreStyle))
}, [
_ctx.inlinePrompt ? (openBlock(), createElementBlock("div", {
key: 0,
class: normalizeClass(unref(ns).e("inner"))
}, [
_ctx.activeIcon || _ctx.inactiveIcon ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(ns).is("icon"))
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(unref(checked) ? _ctx.activeIcon : _ctx.inactiveIcon)))
]),
_: 1
}, 8, ["class"])) : _ctx.activeText || _ctx.inactiveText ? (openBlock(), createElementBlock("span", {
key: 1,
class: normalizeClass(unref(ns).is("text")),
"aria-hidden": !unref(checked)
}, toDisplayString$1(unref(checked) ? _ctx.activeText : _ctx.inactiveText), 11, _hoisted_4$1)) : createCommentVNode("v-if", true)
], 2)) : createCommentVNode("v-if", true),
createBaseVNode("div", {
class: normalizeClass(unref(ns).e("action"))
}, [
_ctx.loading ? (openBlock(), createBlock(unref(ElIcon), {
key: 0,
class: normalizeClass(unref(ns).is("loading"))
}, {
default: withCtx(() => [
createVNode(unref(loading_default))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true)
], 2)
], 6),
!_ctx.inlinePrompt && (_ctx.activeIcon || _ctx.activeText) ? (openBlock(), createElementBlock("span", {
key: 1,
class: normalizeClass([
unref(ns).e("label"),
unref(ns).em("label", "right"),
unref(ns).is("active", unref(checked))
])
}, [
_ctx.activeIcon ? (openBlock(), createBlock(unref(ElIcon), { key: 0 }, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(_ctx.activeIcon)))
]),
_: 1
})) : createCommentVNode("v-if", true),
!_ctx.activeIcon && _ctx.activeText ? (openBlock(), createElementBlock("span", {
key: 1,
"aria-hidden": !unref(checked)
}, toDisplayString$1(_ctx.activeText), 9, _hoisted_5$1)) : createCommentVNode("v-if", true)
], 2)) : createCommentVNode("v-if", true)
], 14, _hoisted_1$3);
};
}
});
var Switch = /* @__PURE__ */ _export_sfc(_sfc_main$3, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/switch/src/switch.vue"]]);
const ElSwitch = withInstall(Switch);
const messageTypes = ["success", "info", "warning", "error"];
const messageDefaults = mutable({
customClass: "",
center: false,
dangerouslyUseHTMLString: false,
duration: 3e3,
icon: void 0,
id: "",
message: "",
onClose: void 0,
showClose: false,
type: "info",
offset: 16,
zIndex: 0,
grouping: false,
repeatNum: 1,
appendTo: isClient$1 ? document.body : void 0
});
const messageProps = buildProps({
customClass: {
type: String,
default: messageDefaults.customClass
},
center: {
type: Boolean,
default: messageDefaults.center
},
dangerouslyUseHTMLString: {
type: Boolean,
default: messageDefaults.dangerouslyUseHTMLString
},
duration: {
type: Number,
default: messageDefaults.duration
},
icon: {
type: iconPropType,
default: messageDefaults.icon
},
id: {
type: String,
default: messageDefaults.id
},
message: {
type: definePropType([
String,
Object,
Function
]),
default: messageDefaults.message
},
onClose: {
type: definePropType(Function),
required: false
},
showClose: {
type: Boolean,
default: messageDefaults.showClose
},
type: {
type: String,
values: messageTypes,
default: messageDefaults.type
},
offset: {
type: Number,
default: messageDefaults.offset
},
zIndex: {
type: Number,
default: messageDefaults.zIndex
},
grouping: {
type: Boolean,
default: messageDefaults.grouping
},
repeatNum: {
type: Number,
default: messageDefaults.repeatNum
}
});
const messageEmits = {
destroy: () => true
};
const instances = shallowReactive([]);
const getInstance = (id) => {
const idx = instances.findIndex((instance) => instance.id === id);
const current = instances[idx];
let prev;
if (idx > 0) {
prev = instances[idx - 1];
}
return { current, prev };
};
const getLastOffset = (id) => {
const { prev } = getInstance(id);
if (!prev)
return 0;
return prev.vm.exposed.bottom.value;
};
const getOffsetOrSpace = (id, offset) => {
const idx = instances.findIndex((instance) => instance.id === id);
return idx > 0 ? 20 : offset;
};
const _hoisted_1$2 = ["id"];
const _hoisted_2$2 = ["innerHTML"];
const __default__ = defineComponent({
name: "ElMessage"
});
const _sfc_main$2 = /* @__PURE__ */ defineComponent({
...__default__,
props: messageProps,
emits: messageEmits,
setup(__props, { expose: expose2 }) {
const props = __props;
const { Close } = TypeComponents;
const { ns, zIndex: zIndex2 } = useGlobalComponentSettings("message");
const { currentZIndex, nextZIndex } = zIndex2;
const messageRef = ref();
const visible = ref(false);
const height = ref(0);
let stopTimer = void 0;
const badgeType = computed(() => props.type ? props.type === "error" ? "danger" : props.type : "info");
const typeClass = computed(() => {
const type2 = props.type;
return { [ns.bm("icon", type2)]: type2 && TypeComponentsMap[type2] };
});
const iconComponent = computed(() => props.icon || TypeComponentsMap[props.type] || "");
const lastOffset = computed(() => getLastOffset(props.id));
const offset = computed(() => getOffsetOrSpace(props.id, props.offset) + lastOffset.value);
const bottom = computed(() => height.value + offset.value);
const customStyle = computed(() => ({
top: `${offset.value}px`,
zIndex: currentZIndex.value
}));
function startTimer() {
if (props.duration === 0)
return;
({ stop: stopTimer } = useTimeoutFn(() => {
close();
}, props.duration));
}
function clearTimer() {
stopTimer == null ? void 0 : stopTimer();
}
function close() {
visible.value = false;
}
function keydown({ code: code2 }) {
if (code2 === EVENT_CODE.esc) {
close();
}
}
onMounted(() => {
startTimer();
nextZIndex();
visible.value = true;
});
watch(() => props.repeatNum, () => {
clearTimer();
startTimer();
});
useEventListener$1(document, "keydown", keydown);
useResizeObserver(messageRef, () => {
height.value = messageRef.value.getBoundingClientRect().height;
});
expose2({
visible,
bottom,
close
});
return (_ctx, _cache) => {
return openBlock(), createBlock(Transition, {
name: unref(ns).b("fade"),
onBeforeLeave: _ctx.onClose,
onAfterLeave: _cache[0] || (_cache[0] = ($event) => _ctx.$emit("destroy")),
persisted: ""
}, {
default: withCtx(() => [
withDirectives(createBaseVNode("div", {
id: _ctx.id,
ref_key: "messageRef",
ref: messageRef,
class: normalizeClass([
unref(ns).b(),
{ [unref(ns).m(_ctx.type)]: _ctx.type && !_ctx.icon },
unref(ns).is("center", _ctx.center),
unref(ns).is("closable", _ctx.showClose),
_ctx.customClass
]),
style: normalizeStyle(unref(customStyle)),
role: "alert",
onMouseenter: clearTimer,
onMouseleave: startTimer
}, [
_ctx.repeatNum > 1 ? (openBlock(), createBlock(unref(ElBadge), {
key: 0,
value: _ctx.repeatNum,
type: unref(badgeType),
class: normalizeClass(unref(ns).e("badge"))
}, null, 8, ["value", "type", "class"])) : createCommentVNode("v-if", true),
unref(iconComponent) ? (openBlock(), createBlock(unref(ElIcon), {
key: 1,
class: normalizeClass([unref(ns).e("icon"), unref(typeClass)])
}, {
default: withCtx(() => [
(openBlock(), createBlock(resolveDynamicComponent(unref(iconComponent))))
]),
_: 1
}, 8, ["class"])) : createCommentVNode("v-if", true),
renderSlot(_ctx.$slots, "default", {}, () => [
!_ctx.dangerouslyUseHTMLString ? (openBlock(), createElementBlock("p", {
key: 0,
class: normalizeClass(unref(ns).e("content"))
}, toDisplayString$1(_ctx.message), 3)) : (openBlock(), createElementBlock(Fragment$1, { key: 1 }, [
createCommentVNode(" Caution here, message could've been compromised, never use user's input as message "),
createBaseVNode("p", {
class: normalizeClass(unref(ns).e("content")),
innerHTML: _ctx.message
}, null, 10, _hoisted_2$2)
], 2112))
]),
_ctx.showClose ? (openBlock(), createBlock(unref(ElIcon), {
key: 2,
class: normalizeClass(unref(ns).e("closeBtn")),
onClick: withModifiers(close, ["stop"])
}, {
default: withCtx(() => [
createVNode(unref(Close))
]),
_: 1
}, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)
], 46, _hoisted_1$2), [
[vShow, visible.value]
])
]),
_: 3
}, 8, ["name", "onBeforeLeave"]);
};
}
});
var MessageConstructor = /* @__PURE__ */ _export_sfc(_sfc_main$2, [["__file", "/home/runner/work/element-plus/element-plus/packages/components/message/src/message.vue"]]);
let seed = 1;
const normalizeOptions = (params) => {
const options = !params || isString$2(params) || isVNode$1(params) || isFunction$2(params) ? { message: params } : params;
const normalized = {
...messageDefaults,
...options
};
if (!normalized.appendTo) {
normalized.appendTo = document.body;
} else if (isString$2(normalized.appendTo)) {
let appendTo = document.querySelector(normalized.appendTo);
if (!isElement(appendTo)) {
appendTo = document.body;
}
normalized.appendTo = appendTo;
}
return normalized;
};
const closeMessage = (instance) => {
const idx = instances.indexOf(instance);
if (idx === -1)
return;
instances.splice(idx, 1);
const { handler } = instance;
handler.close();
};
const createMessage = ({ appendTo, ...options }, context) => {
const id = `message_${seed++}`;
const userOnClose = options.onClose;
const container = document.createElement("div");
const props = {
...options,
id,
onClose: () => {
userOnClose == null ? void 0 : userOnClose();
closeMessage(instance);
},
onDestroy: () => {
render(null, container);
}
};
const vnode = createVNode(MessageConstructor, props, isFunction$2(props.message) || isVNode$1(props.message) ? {
default: isFunction$2(props.message) ? props.message : () => props.message
} : null);
vnode.appContext = context || message._context;
render(vnode, container);
appendTo.appendChild(container.firstElementChild);
const vm = vnode.component;
const handler = {
close: () => {
vm.exposed.visible.value = false;
}
};
const instance = {
id,
vnode,
vm,
handler,
props: vnode.component.props
};
return instance;
};
const message = (options = {}, context) => {
if (!isClient$1)
return { close: () => void 0 };
if (isNumber$1(messageConfig.max) && instances.length >= messageConfig.max) {
return { close: () => void 0 };
}
const normalized = normalizeOptions(options);
if (normalized.grouping && instances.length) {
const instance2 = instances.find(({ vnode: vm }) => {
var _a2;
return ((_a2 = vm.props) == null ? void 0 : _a2.message) === normalized.message;
});
if (instance2) {
instance2.props.repeatNum += 1;
instance2.props.type = normalized.type;
return instance2.handler;
}
}
const instance = createMessage(normalized, context);
instances.push(instance);
return instance.handler;
};
messageTypes.forEach((type2) => {
message[type2] = (options = {}, appContext) => {
const normalized = normalizeOptions(options);
return message({ ...normalized, type: type2 }, appContext);
};
});
function closeAll(type2) {
for (const instance of instances) {
if (!type2 || type2 === instance.props.type) {
instance.handler.close();
}
}
}
message.closeAll = closeAll;
message._context = null;
const ElMessage = withInstallFunction(message, "$message");
/*!
* shared v9.2.2
* (c) 2022 kazuya kawaguchi
* Released under the MIT License.
*/
const inBrowser = typeof window !== "undefined";
const hasSymbol = typeof Symbol === "function" && typeof Symbol.toStringTag === "symbol";
const makeSymbol = (name) => hasSymbol ? Symbol(name) : name;
const generateFormatCacheKey = (locale, key, source) => friendlyJSONstringify({ l: locale, k: key, s: source });
const friendlyJSONstringify = (json) => JSON.stringify(json).replace(/\u2028/g, "\\u2028").replace(/\u2029/g, "\\u2029").replace(/\u0027/g, "\\u0027");
const isNumber = (val) => typeof val === "number" && isFinite(val);
const isDate = (val) => toTypeString(val) === "[object Date]";
const isRegExp = (val) => toTypeString(val) === "[object RegExp]";
const isEmptyObject = (val) => isPlainObject(val) && Object.keys(val).length === 0;
function warn(msg, err) {
if (typeof console !== "undefined") {
console.warn(`[intlify] ` + msg);
if (err) {
console.warn(err.stack);
}
}
}
const assign = Object.assign;
let _globalThis;
const getGlobalThis = () => {
return _globalThis || (_globalThis = typeof globalThis !== "undefined" ? globalThis : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : {});
};
function escapeHtml(rawText) {
return rawText.replace(/</g, "<").replace(/>/g, ">").replace(/"/g, """).replace(/'/g, "'");
}
const hasOwnProperty = Object.prototype.hasOwnProperty;
function hasOwn(obj, key) {
return hasOwnProperty.call(obj, key);
}
const isArray = Array.isArray;
const isFunction = (val) => typeof val === "function";
const isString = (val) => typeof val === "string";
const isBoolean = (val) => typeof val === "boolean";
const isObject$1 = (val) => (
// eslint-disable-line
val !== null && typeof val === "object"
);
const objectToString = Object.prototype.toString;
const toTypeString = (value) => objectToString.call(value);
const isPlainObject = (val) => toTypeString(val) === "[object Object]";
const toDisplayString = (val) => {
return val == null ? "" : isArray(val) || isPlainObject(val) && val.toString === objectToString ? JSON.stringify(val, null, 2) : String(val);
};
/*!
* message-compiler v9.2.2
* (c) 2022 kazuya kawaguchi
* Released under the MIT License.
*/
const CompileErrorCodes = {
// tokenizer error codes
EXPECTED_TOKEN: 1,
INVALID_TOKEN_IN_PLACEHOLDER: 2,
UNTERMINATED_SINGLE_QUOTE_IN_PLACEHOLDER: 3,
UNKNOWN_ESCAPE_SEQUENCE: 4,
INVALID_UNICODE_ESCAPE_SEQUENCE: 5,
UNBALANCED_CLOSING_BRACE: 6,
UNTERMINATED_CLOSING_BRACE: 7,
EMPTY_PLACEHOLDER: 8,
NOT_ALLOW_NEST_PLACEHOLDER: 9,
INVALID_LINKED_FORMAT: 10,
// parser error codes
MUST_HAVE_MESSAGES_IN_PLURAL: 11,
UNEXPECTED_EMPTY_LINKED_MODIFIER: 12,
UNEXPECTED_EMPTY_LINKED_KEY: 13,
UNEXPECTED_LEXICAL_ANALYSIS: 14,
// Special value for higher-order compilers to pick up the last code
// to avoid collision of error codes. This should always be kept as the last
// item.
__EXTEND_POINT__: 15
};
function createCompileError(code2, loc, options = {}) {
const { domain, messages: messages2, args } = options;
const msg = code2;
const error = new SyntaxError(String(msg));
error.code = code2;
if (loc) {
error.location = loc;
}
error.domain = domain;
return error;
}
function defaultOnError(error) {
throw error;
}
function createPosition(line, column, offset) {
return { line, column, offset };
}
function createLocation(start, end2, source) {
const loc = { start, end: end2 };
if (source != null) {
loc.source = source;
}
return loc;
}
const CHAR_SP = " ";
const CHAR_CR = "\r";
const CHAR_LF = "\n";
const CHAR_LS = String.fromCharCode(8232);
const CHAR_PS = String.fromCharCode(8233);
function createScanner(str) {
const _buf = str;
let _index = 0;
let _line = 1;
let _column = 1;
let _peekOffset = 0;
const isCRLF = (index3) => _buf[index3] === CHAR_CR && _buf[index3 + 1] === CHAR_LF;
const isLF = (index3) => _buf[index3] === CHAR_LF;
const isPS = (index3) => _buf[index3] === CHAR_PS;
const isLS = (index3) => _buf[index3] === CHAR_LS;
const isLineEnd = (index3) => isCRLF(index3) || isLF(index3) || isPS(index3) || isLS(index3);
const index2 = () => _index;
const line = () => _line;
const column = () => _column;
const peekOffset = () => _peekOffset;
const charAt = (offset) => isCRLF(offset) || isPS(offset) || isLS(offset) ? CHAR_LF : _buf[offset];
const currentChar = () => charAt(_index);
const currentPeek = () => charAt(_index + _peekOffset);
function next() {
_peekOffset = 0;
if (isLineEnd(_index)) {
_line++;
_column = 0;
}
if (isCRLF(_index)) {
_index++;
}
_index++;
_column++;
return _buf[_index];
}
function peek() {
if (isCRLF(_index + _peekOffset)) {
_peekOffset++;
}
_peekOffset++;
return _buf[_index + _peekOffset];
}
function reset() {
_index = 0;
_line = 1;
_column = 1;
_peekOffset = 0;
}
function resetPeek(offset = 0) {
_peekOffset = offset;
}
function skipToPeek() {
const target = _index + _peekOffset;
while (target !== _index) {
next();
}
_peekOffset = 0;
}
return {
index: index2,
line,
column,
peekOffset,
charAt,
currentChar,
currentPeek,
next,
peek,
reset,
resetPeek,
skipToPeek
};
}
const EOF = void 0;
const LITERAL_DELIMITER = "'";
const ERROR_DOMAIN$1 = "tokenizer";
function createTokenizer(source, options = {}) {
const location2 = options.location !== false;
const _scnr = createScanner(source);
const currentOffset = () => _scnr.index();
const currentPosition = () => createPosition(_scnr.line(), _scnr.column(), _scnr.index());
const _initLoc = currentPosition();
const _initOffset = currentOffset();
const _context = {
currentType: 14,
offset: _initOffset,
startLoc: _initLoc,
endLoc: _initLoc,
lastType: 14,
lastOffset: _initOffset,
lastStartLoc: _initLoc,
lastEndLoc: _initLoc,
braceNest: 0,
inLinked: false,
text: ""
};
const context = () => _context;
const { onError } = options;
function emitError(code2, pos, offset, ...args) {
const ctx = context();
pos.column += offset;
pos.offset += offset;
if (onError) {
const loc = createLocation(ctx.startLoc, pos);
const err = createCompileError(code2, loc, {
domain: ERROR_DOMAIN$1,
args
});
onError(err);
}
}
function getToken(context2, type2, value) {
context2.endLoc = currentPosition();
context2.currentType = type2;
const token = { type: type2 };
if (location2) {
token.loc = createLocation(context2.startLoc, context2.endLoc);
}
if (value != null) {
token.value = value;
}
return token;
}
const getEndToken = (context2) => getToken(
context2,
14
/* EOF */
);
function eat(scnr, ch) {
if (scnr.currentChar() === ch) {
scnr.next();
return ch;
} else {
emitError(CompileErrorCodes.EXPECTED_TOKEN, currentPosition(), 0, ch);
return "";
}
}
function peekSpaces(scnr) {
let buf = "";
while (scnr.currentPeek() === CHAR_SP || scnr.currentPeek() === CHAR_LF) {
buf += scnr.currentPeek();
scnr.peek();
}
return buf;
}
function skipSpaces(scnr) {
const buf = peekSpaces(scnr);
scnr.skipToPeek();
return buf;
}
function isIdentifierStart(ch) {
if (ch === EOF) {
return false;
}
const cc = ch.charCodeAt(0);
return cc >= 97 && cc <= 122 || // a-z
cc >= 65 && cc <= 90 || // A-Z
cc === 95;
}
function isNumberStart(ch) {
if (ch === EOF) {
return false;
}
const cc = ch.charCodeAt(0);
return cc >= 48 && cc <= 57;
}
function isNamedIdentifierStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 2) {
return false;
}
peekSpaces(scnr);
const ret = isIdentifierStart(scnr.currentPeek());
scnr.resetPeek();
return ret;
}
function isListIdentifierStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 2) {
return false;
}
peekSpaces(scnr);
const ch = scnr.currentPeek() === "-" ? scnr.peek() : scnr.currentPeek();
const ret = isNumberStart(ch);
scnr.resetPeek();
return ret;
}
function isLiteralStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 2) {
return false;
}
peekSpaces(scnr);
const ret = scnr.currentPeek() === LITERAL_DELIMITER;
scnr.resetPeek();
return ret;
}
function isLinkedDotStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 8) {
return false;
}
peekSpaces(scnr);
const ret = scnr.currentPeek() === ".";
scnr.resetPeek();
return ret;
}
function isLinkedModifierStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 9) {
return false;
}
peekSpaces(scnr);
const ret = isIdentifierStart(scnr.currentPeek());
scnr.resetPeek();
return ret;
}
function isLinkedDelimiterStart(scnr, context2) {
const { currentType } = context2;
if (!(currentType === 8 || currentType === 12)) {
return false;
}
peekSpaces(scnr);
const ret = scnr.currentPeek() === ":";
scnr.resetPeek();
return ret;
}
function isLinkedReferStart(scnr, context2) {
const { currentType } = context2;
if (currentType !== 10) {
return false;
}
const fn2 = () => {
const ch = scnr.currentPeek();
if (ch === "{") {
return isIdentifierStart(scnr.peek());
} else if (ch === "@" || ch === "%" || ch === "|" || ch === ":" || ch === "." || ch === CHAR_SP || !ch) {
return false;
} else if (ch === CHAR_LF) {
scnr.peek();
return fn2();
} else {
return isIdentifierStart(ch);
}
};
const ret = fn2();
scnr.resetPeek();
return ret;
}
function isPluralStart(scnr) {
peekSpaces(scnr);
const ret = scnr.currentPeek() === "|";
scnr.resetPeek();
return ret;
}
function detectModuloStart(scnr) {
const spaces = peekSpaces(scnr);
const ret = scnr.currentPeek() === "%" && scnr.peek() === "{";
scnr.resetPeek();
return {
isModulo: ret,
hasSpace: spaces.length > 0
};
}
function isTextStart(scnr, reset = true) {
const fn2 = (hasSpace = false, prev = "", detectModulo = false) => {
const ch = scnr.currentPeek();
if (ch === "{") {
return prev === "%" ? false : hasSpace;
} else if (ch === "@" || !ch) {
return prev === "%" ? true : hasSpace;
} else if (ch === "%") {
scnr.peek();
return fn2(hasSpace, "%", true);
} else if (ch === "|") {
return prev === "%" || detectModulo ? true : !(prev === CHAR_SP || prev === CHAR_LF);
} else if (ch === CHAR_SP) {
scnr.peek();
return fn2(true, CHAR_SP, detectModulo);
} else if (ch === CHAR_LF) {
scnr.peek();
return fn2(true, CHAR_LF, detectModulo);
} else {
return true;
}
};
const ret = fn2();
reset && scnr.resetPeek();
return ret;
}
function takeChar(scnr, fn2) {
const ch = scnr.currentChar();
if (ch === EOF) {
return EOF;
}
if (fn2(ch)) {
scnr.next();
return ch;
}
return null;
}
function takeIdentifierChar(scnr) {
const closure = (ch) => {
const cc = ch.charCodeAt(0);
return cc >= 97 && cc <= 122 || // a-z
cc >= 65 && cc <= 90 || // A-Z
cc >= 48 && cc <= 57 || // 0-9
cc === 95 || // _
cc === 36;
};
return takeChar(scnr, closure);
}
function takeDigit(scnr) {
const closure = (ch) => {
const cc = ch.charCodeAt(0);
return cc >= 48 && cc <= 57;
};
return takeChar(scnr, closure);
}
function takeHexDigit(scnr) {
const closure = (ch) => {
const cc = ch.charCodeAt(0);
return cc >= 48 && cc <= 57 || // 0-9
cc >= 65 && cc <= 70 || // A-F
cc >= 97 && cc <= 102;
};
return takeChar(scnr, closure);
}
function getDigits(scnr) {
let ch = "";
let num = "";
while (ch = takeDigit(scnr)) {
num += ch;
}
return num;
}
function readModulo(scnr) {
skipSpaces(scnr);
const ch = scnr.currentChar();
if (ch !== "%") {
emitError(CompileErrorCodes.EXPECTED_TOKEN, currentPosition(), 0, ch);
}
scnr.next();
return "%";
}
function readText(scnr) {
let buf = "";
while (true) {
const ch = scnr.currentChar();
if (ch === "{" || ch === "}" || ch === "@" || ch === "|" || !ch) {
break;
} else if (ch === "%") {
if (isTextStart(scnr)) {
buf += ch;
scnr.next();
} else {
break;
}
} else if (ch === CHAR_SP || ch === CHAR_LF) {
if (isTextStart(scnr)) {
buf += ch;
scnr.next();
} else if (isPluralStart(scnr)) {
break;
} else {
buf += ch;
scnr.next();
}
} else {
buf += ch;
scnr.next();
}
}
return buf;
}
function readNamedIdentifier(scnr) {
skipSpaces(scnr);
let ch = "";
let name = "";
while (ch = takeIdentifierChar(scnr)) {
name += ch;
}
if (scnr.currentChar() === EOF) {
emitError(CompileErrorCodes.UNTERMINATED_CLOSING_BRACE, currentPosition(), 0);
}
return name;
}
function readListIdentifier(scnr) {
skipSpaces(scnr);
let value = "";
if (scnr.currentChar() === "-") {
scnr.next();
value += `-${getDigits(scnr)}`;
} else {
value += getDigits(scnr);
}
if (scnr.currentChar() === EOF) {
emitError(CompileErrorCodes.UNTERMINATED_CLOSING_BRACE, currentPosition(), 0);
}
return value;
}
function readLiteral(scnr) {
skipSpaces(scnr);
eat(scnr, `'`);
let ch = "";
let literal = "";
const fn2 = (x) => x !== LITERAL_DELIMITER && x !== CHAR_LF;
while (ch = takeChar(scnr, fn2)) {
if (ch === "\\") {
literal += readEscapeSequence(scnr);
} else {
literal += ch;
}
}
const current = scnr.currentChar();
if (current === CHAR_LF || current === EOF) {
emitError(CompileErrorCodes.UNTERMINATED_SINGLE_QUOTE_IN_PLACEHOLDER, currentPosition(), 0);
if (current === CHAR_LF) {
scnr.next();
eat(scnr, `'`);
}
return literal;
}
eat(scnr, `'`);
return literal;
}
function readEscapeSequence(scnr) {
const ch = scnr.currentChar();
switch (ch) {
case "\\":
case `'`:
scnr.next();
return `\\${ch}`;
case "u":
return readUnicodeEscapeSequence(scnr, ch, 4);
case "U":
return readUnicodeEscapeSequence(scnr, ch, 6);
default:
emitError(CompileErrorCodes.UNKNOWN_ESCAPE_SEQUENCE, currentPosition(), 0, ch);
return "";
}
}
function readUnicodeEscapeSequence(scnr, unicode, digits) {
eat(scnr, unicode);
let sequence = "";
for (let i = 0; i < digits; i++) {
const ch = takeHexDigit(scnr);
if (!ch) {
emitError(CompileErrorCodes.INVALID_UNICODE_ESCAPE_SEQUENCE, currentPosition(), 0, `\\${unicode}${sequence}${scnr.currentChar()}`);
break;
}
sequence += ch;
}
return `\\${unicode}${sequence}`;
}
function readInvalidIdentifier(scnr) {
skipSpaces(scnr);
let ch = "";
let identifiers = "";
const closure = (ch2) => ch2 !== "{" && ch2 !== "}" && ch2 !== CHAR_SP && ch2 !== CHAR_LF;
while (ch = takeChar(scnr, closure)) {
identifiers += ch;
}
return identifiers;
}
function readLinkedModifier(scnr) {
let ch = "";
let name = "";
while (ch = takeIdentifierChar(scnr)) {
name += ch;
}
return name;
}
function readLinkedRefer(scnr) {
const fn2 = (detect2 = false, buf) => {
const ch = scnr.currentChar();
if (ch === "{" || ch === "%" || ch === "@" || ch === "|" || !ch) {
return buf;
} else if (ch === CHAR_SP) {
return buf;
} else if (ch === CHAR_LF) {
buf += ch;
scnr.next();
return fn2(detect2, buf);
} else {
buf += ch;
scnr.next();
return fn2(true, buf);
}
};
return fn2(false, "");
}
function readPlural(scnr) {
skipSpaces(scnr);
const plural = eat(
scnr,
"|"
/* Pipe */
);
skipSpaces(scnr);
return plural;
}
function readTokenInPlaceholder(scnr, context2) {
let token = null;
const ch = scnr.currentChar();
switch (ch) {
case "{":
if (context2.braceNest >= 1) {
emitError(CompileErrorCodes.NOT_ALLOW_NEST_PLACEHOLDER, currentPosition(), 0);
}
scnr.next();
token = getToken(
context2,
2,
"{"
/* BraceLeft */
);
skipSpaces(scnr);
context2.braceNest++;
return token;
case "}":
if (context2.braceNest > 0 && context2.currentType === 2) {
emitError(CompileErrorCodes.EMPTY_PLACEHOLDER, currentPosition(), 0);
}
scnr.next();
token = getToken(
context2,
3,
"}"
/* BraceRight */
);
context2.braceNest--;
context2.braceNest > 0 && skipSpaces(scnr);
if (context2.inLinked && context2.braceNest === 0) {
context2.inLinked = false;
}
return token;
case "@":
if (context2.braceNest > 0) {
emitError(CompileErrorCodes.UNTERMINATED_CLOSING_BRACE, currentPosition(), 0);
}
token = readTokenInLinked(scnr, context2) || getEndToken(context2);
context2.braceNest = 0;
return token;
default:
let validNamedIdentifier = true;
let validListIdentifier = true;
let validLiteral = true;
if (isPluralStart(scnr)) {
if (context2.braceNest > 0) {
emitError(CompileErrorCodes.UNTERMINATED_CLOSING_BRACE, currentPosition(), 0);
}
token = getToken(context2, 1, readPlural(scnr));
context2.braceNest = 0;
context2.inLinked = false;
return token;
}
if (context2.braceNest > 0 && (context2.currentType === 5 || context2.currentType === 6 || context2.currentType === 7)) {
emitError(CompileErrorCodes.UNTERMINATED_CLOSING_BRACE, currentPosition(), 0);
context2.braceNest = 0;
return readToken(scnr, context2);
}
if (validNamedIdentifier = isNamedIdentifierStart(scnr, context2)) {
token = getToken(context2, 5, readNamedIdentifier(scnr));
skipSpaces(scnr);
return token;
}
if (validListIdentifier = isListIdentifierStart(scnr, context2)) {
token = getToken(context2, 6, readListIdentifier(scnr));
skipSpaces(scnr);
return token;
}
if (validLiteral = isLiteralStart(scnr, context2)) {
token = getToken(context2, 7, readLiteral(scnr));
skipSpaces(scnr);
return token;
}
if (!validNamedIdentifier && !validListIdentifier && !validLiteral) {
token = getToken(context2, 13, readInvalidIdentifier(scnr));
emitError(CompileErrorCodes.INVALID_TOKEN_IN_PLACEHOLDER, currentPosition(), 0, token.value);
skipSpaces(scnr);
return token;
}
break;
}
return token;
}
function readTokenInLinked(scnr, context2) {
const { currentType } = context2;
let token = null;
const ch = scnr.currentChar();
if ((currentType === 8 || currentType === 9 || currentType === 12 || currentType === 10) && (ch === CHAR_LF || ch === CHAR_SP)) {
emitError(CompileErrorCodes.INVALID_LINKED_FORMAT, currentPosition(), 0);
}
switch (ch) {
case "@":
scnr.next();
token = getToken(
context2,
8,
"@"
/* LinkedAlias */
);
context2.inLinked = true;
return token;
case ".":
skipSpaces(scnr);
scnr.next();
return getToken(
context2,
9,
"."
/* LinkedDot */
);
case ":":
skipSpaces(scnr);
scnr.next();
return getToken(
context2,
10,
":"
/* LinkedDelimiter */
);
default:
if (isPluralStart(scnr)) {
token = getToken(context2, 1, readPlural(scnr));
context2.braceNest = 0;
context2.inLinked = false;
return token;
}
if (isLinkedDotStart(scnr, context2) || isLinkedDelimiterStart(scnr, context2)) {
skipSpaces(scnr);
return readTokenInLinked(scnr, context2);
}
if (isLinkedModifierStart(scnr, context2)) {
skipSpaces(scnr);
return getToken(context2, 12, readLinkedModifier(scnr));
}
if (isLinkedReferStart(scnr, context2)) {
skipSpaces(scnr);
if (ch === "{") {
return readTokenInPlaceholder(scnr, context2) || token;
} else {
return getToken(context2, 11, readLinkedRefer(scnr));
}
}
if (currentType === 8) {
emitError(CompileErrorCodes.INVALID_LINKED_FORMAT, currentPosition(), 0);
}
context2.braceNest = 0;
context2.inLinked = false;
return readToken(scnr, context2);
}
}
function readToken(scnr, context2) {
let token = {
type: 14
/* EOF */
};
if (context2.braceNest > 0) {
return readTokenInPlaceholder(scnr, context2) || getEndToken(context2);
}
if (context2.inLinked) {
return readTokenInLinked(scnr, context2) || getEndToken(context2);
}
const ch = scnr.currentChar();
switch (ch) {
case "{":
return readTokenInPlaceholder(scnr, context2) || getEndToken(context2);
case "}":
emitError(CompileErrorCodes.UNBALANCED_CLOSING_BRACE, currentPosition(), 0);
scnr.next();
return getToken(
context2,
3,
"}"
/* BraceRight */
);
case "@":
return readTokenInLinked(scnr, context2) || getEndToken(context2);
default:
if (isPluralStart(scnr)) {
token = getToken(context2, 1, readPlural(scnr));
context2.braceNest = 0;
context2.inLinked = false;
return token;
}
const { isModulo, hasSpace } = detectModuloStart(scnr);
if (isModulo) {
return hasSpace ? getToken(context2, 0, readText(scnr)) : getToken(context2, 4, readModulo(scnr));
}
if (isTextStart(scnr)) {
return getToken(context2, 0, readText(scnr));
}
break;
}
return token;
}
function nextToken() {
const { currentType, offset, startLoc, endLoc } = _context;
_context.lastType = currentType;
_context.lastOffset = offset;
_context.lastStartLoc = startLoc;
_context.lastEndLoc = endLoc;
_context.offset = currentOffset();
_context.startLoc = currentPosition();
if (_scnr.currentChar() === EOF) {
return getToken(
_context,
14
/* EOF */
);
}
return readToken(_scnr, _context);
}
return {
nextToken,
currentOffset,
currentPosition,
context
};
}
const ERROR_DOMAIN = "parser";
const KNOWN_ESCAPES = /(?:\\\\|\\'|\\u([0-9a-fA-F]{4})|\\U([0-9a-fA-F]{6}))/g;
function fromEscapeSequence(match2, codePoint4, codePoint6) {
switch (match2) {
case `\\\\`:
return `\\`;
case `\\'`:
return `'`;
default: {
const codePoint = parseInt(codePoint4 || codePoint6, 16);
if (codePoint <= 55295 || codePoint >= 57344) {
return String.fromCodePoint(codePoint);
}
return "�";
}
}
}
function createParser(options = {}) {
const location2 = options.location !== false;
const { onError } = options;
function emitError(tokenzer, code2, start, offset, ...args) {
const end2 = tokenzer.currentPosition();
end2.offset += offset;
end2.column += offset;
if (onError) {
const loc = createLocation(start, end2);
const err = createCompileError(code2, loc, {
domain: ERROR_DOMAIN,
args
});
onError(err);
}
}
function startNode(type2, offset, loc) {
const node = {
type: type2,
start: offset,
end: offset
};
if (location2) {
node.loc = { start: loc, end: loc };
}
return node;
}
function endNode(node, offset, pos, type2) {
node.end = offset;
if (type2) {
node.type = type2;
}
if (location2 && node.loc) {
node.loc.end = pos;
}
}
function parseText(tokenizer, value) {
const context = tokenizer.context();
const node = startNode(3, context.offset, context.startLoc);
node.value = value;
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseList(tokenizer, index2) {
const context = tokenizer.context();
const { lastOffset: offset, lastStartLoc: loc } = context;
const node = startNode(5, offset, loc);
node.index = parseInt(index2, 10);
tokenizer.nextToken();
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseNamed(tokenizer, key) {
const context = tokenizer.context();
const { lastOffset: offset, lastStartLoc: loc } = context;
const node = startNode(4, offset, loc);
node.key = key;
tokenizer.nextToken();
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseLiteral(tokenizer, value) {
const context = tokenizer.context();
const { lastOffset: offset, lastStartLoc: loc } = context;
const node = startNode(9, offset, loc);
node.value = value.replace(KNOWN_ESCAPES, fromEscapeSequence);
tokenizer.nextToken();
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseLinkedModifier(tokenizer) {
const token = tokenizer.nextToken();
const context = tokenizer.context();
const { lastOffset: offset, lastStartLoc: loc } = context;
const node = startNode(8, offset, loc);
if (token.type !== 12) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_EMPTY_LINKED_MODIFIER, context.lastStartLoc, 0);
node.value = "";
endNode(node, offset, loc);
return {
nextConsumeToken: token,
node
};
}
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
node.value = token.value || "";
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return {
node
};
}
function parseLinkedKey(tokenizer, value) {
const context = tokenizer.context();
const node = startNode(7, context.offset, context.startLoc);
node.value = value;
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseLinked(tokenizer) {
const context = tokenizer.context();
const linkedNode = startNode(6, context.offset, context.startLoc);
let token = tokenizer.nextToken();
if (token.type === 9) {
const parsed = parseLinkedModifier(tokenizer);
linkedNode.modifier = parsed.node;
token = parsed.nextConsumeToken || tokenizer.nextToken();
}
if (token.type !== 10) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
token = tokenizer.nextToken();
if (token.type === 2) {
token = tokenizer.nextToken();
}
switch (token.type) {
case 11:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
linkedNode.key = parseLinkedKey(tokenizer, token.value || "");
break;
case 5:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
linkedNode.key = parseNamed(tokenizer, token.value || "");
break;
case 6:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
linkedNode.key = parseList(tokenizer, token.value || "");
break;
case 7:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
linkedNode.key = parseLiteral(tokenizer, token.value || "");
break;
default:
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_EMPTY_LINKED_KEY, context.lastStartLoc, 0);
const nextContext = tokenizer.context();
const emptyLinkedKeyNode = startNode(7, nextContext.offset, nextContext.startLoc);
emptyLinkedKeyNode.value = "";
endNode(emptyLinkedKeyNode, nextContext.offset, nextContext.startLoc);
linkedNode.key = emptyLinkedKeyNode;
endNode(linkedNode, nextContext.offset, nextContext.startLoc);
return {
nextConsumeToken: token,
node: linkedNode
};
}
endNode(linkedNode, tokenizer.currentOffset(), tokenizer.currentPosition());
return {
node: linkedNode
};
}
function parseMessage(tokenizer) {
const context = tokenizer.context();
const startOffset = context.currentType === 1 ? tokenizer.currentOffset() : context.offset;
const startLoc = context.currentType === 1 ? context.endLoc : context.startLoc;
const node = startNode(2, startOffset, startLoc);
node.items = [];
let nextToken = null;
do {
const token = nextToken || tokenizer.nextToken();
nextToken = null;
switch (token.type) {
case 0:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
node.items.push(parseText(tokenizer, token.value || ""));
break;
case 6:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
node.items.push(parseList(tokenizer, token.value || ""));
break;
case 5:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
node.items.push(parseNamed(tokenizer, token.value || ""));
break;
case 7:
if (token.value == null) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, getTokenCaption(token));
}
node.items.push(parseLiteral(tokenizer, token.value || ""));
break;
case 8:
const parsed = parseLinked(tokenizer);
node.items.push(parsed.node);
nextToken = parsed.nextConsumeToken || null;
break;
}
} while (context.currentType !== 14 && context.currentType !== 1);
const endOffset = context.currentType === 1 ? context.lastOffset : tokenizer.currentOffset();
const endLoc = context.currentType === 1 ? context.lastEndLoc : tokenizer.currentPosition();
endNode(node, endOffset, endLoc);
return node;
}
function parsePlural(tokenizer, offset, loc, msgNode) {
const context = tokenizer.context();
let hasEmptyMessage = msgNode.items.length === 0;
const node = startNode(1, offset, loc);
node.cases = [];
node.cases.push(msgNode);
do {
const msg = parseMessage(tokenizer);
if (!hasEmptyMessage) {
hasEmptyMessage = msg.items.length === 0;
}
node.cases.push(msg);
} while (context.currentType !== 14);
if (hasEmptyMessage) {
emitError(tokenizer, CompileErrorCodes.MUST_HAVE_MESSAGES_IN_PLURAL, loc, 0);
}
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
function parseResource(tokenizer) {
const context = tokenizer.context();
const { offset, startLoc } = context;
const msgNode = parseMessage(tokenizer);
if (context.currentType === 14) {
return msgNode;
} else {
return parsePlural(tokenizer, offset, startLoc, msgNode);
}
}
function parse2(source) {
const tokenizer = createTokenizer(source, assign({}, options));
const context = tokenizer.context();
const node = startNode(0, context.offset, context.startLoc);
if (location2 && node.loc) {
node.loc.source = source;
}
node.body = parseResource(tokenizer);
if (context.currentType !== 14) {
emitError(tokenizer, CompileErrorCodes.UNEXPECTED_LEXICAL_ANALYSIS, context.lastStartLoc, 0, source[context.offset] || "");
}
endNode(node, tokenizer.currentOffset(), tokenizer.currentPosition());
return node;
}
return { parse: parse2 };
}
function getTokenCaption(token) {
if (token.type === 14) {
return "EOF";
}
const name = (token.value || "").replace(/\r?\n/gu, "\\n");
return name.length > 10 ? name.slice(0, 9) + "…" : name;
}
function createTransformer(ast, options = {}) {
const _context = {
ast,
helpers: /* @__PURE__ */ new Set()
};
const context = () => _context;
const helper = (name) => {
_context.helpers.add(name);
return name;
};
return { context, helper };
}
function traverseNodes(nodes, transformer) {
for (let i = 0; i < nodes.length; i++) {
traverseNode(nodes[i], transformer);
}
}
function traverseNode(node, transformer) {
switch (node.type) {
case 1:
traverseNodes(node.cases, transformer);
transformer.helper(
"plural"
/* PLURAL */
);
break;
case 2:
traverseNodes(node.items, transformer);
break;
case 6:
const linked = node;
traverseNode(linked.key, transformer);
transformer.helper(
"linked"
/* LINKED */
);
transformer.helper(
"type"
/* TYPE */
);
break;
case 5:
transformer.helper(
"interpolate"
/* INTERPOLATE */
);
transformer.helper(
"list"
/* LIST */
);
break;
case 4:
transformer.helper(
"interpolate"
/* INTERPOLATE */
);
transformer.helper(
"named"
/* NAMED */
);
break;
}
}
function transform(ast, options = {}) {
const transformer = createTransformer(ast);
transformer.helper(
"normalize"
/* NORMALIZE */
);
ast.body && traverseNode(ast.body, transformer);
const context = transformer.context();
ast.helpers = Array.from(context.helpers);
}
function createCodeGenerator(ast, options) {
const { sourceMap, filename, breakLineCode, needIndent: _needIndent } = options;
const _context = {
source: ast.loc.source,
filename,
code: "",
column: 1,
line: 1,
offset: 0,
map: void 0,
breakLineCode,
needIndent: _needIndent,
indentLevel: 0
};
const context = () => _context;
function push(code2, node) {
_context.code += code2;
}
function _newline(n, withBreakLine = true) {
const _breakLineCode = withBreakLine ? breakLineCode : "";
push(_needIndent ? _breakLineCode + ` `.repeat(n) : _breakLineCode);
}
function indent(withNewLine = true) {
const level = ++_context.indentLevel;
withNewLine && _newline(level);
}
function deindent(withNewLine = true) {
const level = --_context.indentLevel;
withNewLine && _newline(level);
}
function newline() {
_newline(_context.indentLevel);
}
const helper = (key) => `_${key}`;
const needIndent = () => _context.needIndent;
return {
context,
push,
indent,
deindent,
newline,
helper,
needIndent
};
}
function generateLinkedNode(generator, node) {
const { helper } = generator;
generator.push(`${helper(
"linked"
/* LINKED */
)}(`);
generateNode(generator, node.key);
if (node.modifier) {
generator.push(`, `);
generateNode(generator, node.modifier);
generator.push(`, _type`);
} else {
generator.push(`, undefined, _type`);
}
generator.push(`)`);
}
function generateMessageNode(generator, node) {
const { helper, needIndent } = generator;
generator.push(`${helper(
"normalize"
/* NORMALIZE */
)}([`);
generator.indent(needIndent());
const length = node.items.length;
for (let i = 0; i < length; i++) {
generateNode(generator, node.items[i]);
if (i === length - 1) {
break;
}
generator.push(", ");
}
generator.deindent(needIndent());
generator.push("])");
}
function generatePluralNode(generator, node) {
const { helper, needIndent } = generator;
if (node.cases.length > 1) {
generator.push(`${helper(
"plural"
/* PLURAL */
)}([`);
generator.indent(needIndent());
const length = node.cases.length;
for (let i = 0; i < length; i++) {
generateNode(generator, node.cases[i]);
if (i === length - 1) {
break;
}
generator.push(", ");
}
generator.deindent(needIndent());
generator.push(`])`);
}
}
function generateResource(generator, node) {
if (node.body) {
generateNode(generator, node.body);
} else {
generator.push("null");
}
}
function generateNode(generator, node) {
const { helper } = generator;
switch (node.type) {
case 0:
generateResource(generator, node);
break;
case 1:
generatePluralNode(generator, node);
break;
case 2:
generateMessageNode(generator, node);
break;
case 6:
generateLinkedNode(generator, node);
break;
case 8:
generator.push(JSON.stringify(node.value), node);
break;
case 7:
generator.push(JSON.stringify(node.value), node);
break;
case 5:
generator.push(`${helper(
"interpolate"
/* INTERPOLATE */
)}(${helper(
"list"
/* LIST */
)}(${node.index}))`, node);
break;
case 4:
generator.push(`${helper(
"interpolate"
/* INTERPOLATE */
)}(${helper(
"named"
/* NAMED */
)}(${JSON.stringify(node.key)}))`, node);
break;
case 9:
generator.push(JSON.stringify(node.value), node);
break;
case 3:
generator.push(JSON.stringify(node.value), node);
break;
}
}
const generate = (ast, options = {}) => {
const mode = isString(options.mode) ? options.mode : "normal";
const filename = isString(options.filename) ? options.filename : "message.intl";
const sourceMap = !!options.sourceMap;
const breakLineCode = options.breakLineCode != null ? options.breakLineCode : mode === "arrow" ? ";" : "\n";
const needIndent = options.needIndent ? options.needIndent : mode !== "arrow";
const helpers = ast.helpers || [];
const generator = createCodeGenerator(ast, {
mode,
filename,
sourceMap,
breakLineCode,
needIndent
});
generator.push(mode === "normal" ? `function __msg__ (ctx) {` : `(ctx) => {`);
generator.indent(needIndent);
if (helpers.length > 0) {
generator.push(`const { ${helpers.map((s) => `${s}: _${s}`).join(", ")} } = ctx`);
generator.newline();
}
generator.push(`return `);
generateNode(generator, ast);
generator.deindent(needIndent);
generator.push(`}`);
const { code: code2, map: map2 } = generator.context();
return {
ast,
code: code2,
map: map2 ? map2.toJSON() : void 0
// eslint-disable-line @typescript-eslint/no-explicit-any
};
};
function baseCompile(source, options = {}) {
const assignedOptions = assign({}, options);
const parser2 = createParser(assignedOptions);
const ast = parser2.parse(source);
transform(ast, assignedOptions);
return generate(ast, assignedOptions);
}
/*!
* devtools-if v9.2.2
* (c) 2022 kazuya kawaguchi
* Released under the MIT License.
*/
const IntlifyDevToolsHooks = {
I18nInit: "i18n:init",
FunctionTranslate: "function:translate"
};
/*!
* core-base v9.2.2
* (c) 2022 kazuya kawaguchi
* Released under the MIT License.
*/
const pathStateMachine = [];
pathStateMachine[
0
/* BEFORE_PATH */
] = {
[
"w"
/* WORKSPACE */
]: [
0
/* BEFORE_PATH */
],
[
"i"
/* IDENT */
]: [
3,
0
/* APPEND */
],
[
"["
/* LEFT_BRACKET */
]: [
4
/* IN_SUB_PATH */
],
[
"o"
/* END_OF_FAIL */
]: [
7
/* AFTER_PATH */
]
};
pathStateMachine[
1
/* IN_PATH */
] = {
[
"w"
/* WORKSPACE */
]: [
1
/* IN_PATH */
],
[
"."
/* DOT */
]: [
2
/* BEFORE_IDENT */
],
[
"["
/* LEFT_BRACKET */
]: [
4
/* IN_SUB_PATH */
],
[
"o"
/* END_OF_FAIL */
]: [
7
/* AFTER_PATH */
]
};
pathStateMachine[
2
/* BEFORE_IDENT */
] = {
[
"w"
/* WORKSPACE */
]: [
2
/* BEFORE_IDENT */
],
[
"i"
/* IDENT */
]: [
3,
0
/* APPEND */
],
[
"0"
/* ZERO */
]: [
3,
0
/* APPEND */
]
};
pathStateMachine[
3
/* IN_IDENT */
] = {
[
"i"
/* IDENT */
]: [
3,
0
/* APPEND */
],
[
"0"
/* ZERO */
]: [
3,
0
/* APPEND */
],
[
"w"
/* WORKSPACE */
]: [
1,
1
/* PUSH */
],
[
"."
/* DOT */
]: [
2,
1
/* PUSH */
],
[
"["
/* LEFT_BRACKET */
]: [
4,
1
/* PUSH */
],
[
"o"
/* END_OF_FAIL */
]: [
7,
1
/* PUSH */
]
};
pathStateMachine[
4
/* IN_SUB_PATH */
] = {
[
"'"
/* SINGLE_QUOTE */
]: [
5,
0
/* APPEND */
],
[
'"'
/* DOUBLE_QUOTE */
]: [
6,
0
/* APPEND */
],
[
"["
/* LEFT_BRACKET */
]: [
4,
2
/* INC_SUB_PATH_DEPTH */
],
[
"]"
/* RIGHT_BRACKET */
]: [
1,
3
/* PUSH_SUB_PATH */
],
[
"o"
/* END_OF_FAIL */
]: 8,
[
"l"
/* ELSE */
]: [
4,
0
/* APPEND */
]
};
pathStateMachine[
5
/* IN_SINGLE_QUOTE */
] = {
[
"'"
/* SINGLE_QUOTE */
]: [
4,
0
/* APPEND */
],
[
"o"
/* END_OF_FAIL */
]: 8,
[
"l"
/* ELSE */
]: [
5,
0
/* APPEND */
]
};
pathStateMachine[
6
/* IN_DOUBLE_QUOTE */
] = {
[
'"'
/* DOUBLE_QUOTE */
]: [
4,
0
/* APPEND */
],
[
"o"
/* END_OF_FAIL */
]: 8,
[
"l"
/* ELSE */
]: [
6,
0
/* APPEND */
]
};
const literalValueRE = /^\s?(?:true|false|-?[\d.]+|'[^']*'|"[^"]*")\s?$/;
function isLiteral(exp) {
return literalValueRE.test(exp);
}
function stripQuotes(str) {
const a = str.charCodeAt(0);
const b = str.charCodeAt(str.length - 1);
return a === b && (a === 34 || a === 39) ? str.slice(1, -1) : str;
}
function getPathCharType(ch) {
if (ch === void 0 || ch === null) {
return "o";
}
const code2 = ch.charCodeAt(0);
switch (code2) {
case 91:
case 93:
case 46:
case 34:
case 39:
return ch;
case 95:
case 36:
case 45:
return "i";
case 9:
case 10:
case 13:
case 160:
case 65279:
case 8232:
case 8233:
return "w";
}
return "i";
}
function formatSubPath(path) {
const trimmed = path.trim();
if (path.charAt(0) === "0" && isNaN(parseInt(path))) {
return false;
}
return isLiteral(trimmed) ? stripQuotes(trimmed) : "*" + trimmed;
}
function parse(path) {
const keys2 = [];
let index2 = -1;
let mode = 0;
let subPathDepth = 0;
let c;
let key;
let newChar;
let type2;
let transition;
let action;
let typeMap;
const actions = [];
actions[
0
/* APPEND */
] = () => {
if (key === void 0) {
key = newChar;
} else {
key += newChar;
}
};
actions[
1
/* PUSH */
] = () => {
if (key !== void 0) {
keys2.push(key);
key = void 0;
}
};
actions[
2
/* INC_SUB_PATH_DEPTH */
] = () => {
actions[
0
/* APPEND */
]();
subPathDepth++;
};
actions[
3
/* PUSH_SUB_PATH */
] = () => {
if (subPathDepth > 0) {
subPathDepth--;
mode = 4;
actions[
0
/* APPEND */
]();
} else {
subPathDepth = 0;
if (key === void 0) {
return false;
}
key = formatSubPath(key);
if (key === false) {
return false;
} else {
actions[
1
/* PUSH */
]();
}
}
};
function maybeUnescapeQuote() {
const nextChar = path[index2 + 1];
if (mode === 5 && nextChar === "'" || mode === 6 && nextChar === '"') {
index2++;
newChar = "\\" + nextChar;
actions[
0
/* APPEND */
]();
return true;
}
}
while (mode !== null) {
index2++;
c = path[index2];
if (c === "\\" && maybeUnescapeQuote()) {
continue;
}
type2 = getPathCharType(c);
typeMap = pathStateMachine[mode];
transition = typeMap[type2] || typeMap[
"l"
/* ELSE */
] || 8;
if (transition === 8) {
return;
}
mode = transition[0];
if (transition[1] !== void 0) {
action = actions[transition[1]];
if (action) {
newChar = c;
if (action() === false) {
return;
}
}
}
if (mode === 7) {
return keys2;
}
}
}
const cache = /* @__PURE__ */ new Map();
function resolveWithKeyValue(obj, path) {
return isObject$1(obj) ? obj[path] : null;
}
function resolveValue(obj, path) {
if (!isObject$1(obj)) {
return null;
}
let hit = cache.get(path);
if (!hit) {
hit = parse(path);
if (hit) {
cache.set(path, hit);
}
}
if (!hit) {
return null;
}
const len = hit.length;
let last2 = obj;
let i = 0;
while (i < len) {
const val = last2[hit[i]];
if (val === void 0) {
return null;
}
last2 = val;
i++;
}
return last2;
}
const DEFAULT_MODIFIER = (str) => str;
const DEFAULT_MESSAGE = (ctx) => "";
const DEFAULT_MESSAGE_DATA_TYPE = "text";
const DEFAULT_NORMALIZE = (values2) => values2.length === 0 ? "" : values2.join("");
const DEFAULT_INTERPOLATE = toDisplayString;
function pluralDefault(choice, choicesLength) {
choice = Math.abs(choice);
if (choicesLength === 2) {
return choice ? choice > 1 ? 1 : 0 : 1;
}
return choice ? Math.min(choice, 2) : 0;
}
function getPluralIndex(options) {
const index2 = isNumber(options.pluralIndex) ? options.pluralIndex : -1;
return options.named && (isNumber(options.named.count) || isNumber(options.named.n)) ? isNumber(options.named.count) ? options.named.count : isNumber(options.named.n) ? options.named.n : index2 : index2;
}
function normalizeNamed(pluralIndex, props) {
if (!props.count) {
props.count = pluralIndex;
}
if (!props.n) {
props.n = pluralIndex;
}
}
function createMessageContext(options = {}) {
const locale = options.locale;
const pluralIndex = getPluralIndex(options);
const pluralRule = isObject$1(options.pluralRules) && isString(locale) && isFunction(options.pluralRules[locale]) ? options.pluralRules[locale] : pluralDefault;
const orgPluralRule = isObject$1(options.pluralRules) && isString(locale) && isFunction(options.pluralRules[locale]) ? pluralDefault : void 0;
const plural = (messages2) => {
return messages2[pluralRule(pluralIndex, messages2.length, orgPluralRule)];
};
const _list = options.list || [];
const list = (index2) => _list[index2];
const _named = options.named || {};
isNumber(options.pluralIndex) && normalizeNamed(pluralIndex, _named);
const named = (key) => _named[key];
function message2(key) {
const msg = isFunction(options.messages) ? options.messages(key) : isObject$1(options.messages) ? options.messages[key] : false;
return !msg ? options.parent ? options.parent.message(key) : DEFAULT_MESSAGE : msg;
}
const _modifier = (name) => options.modifiers ? options.modifiers[name] : DEFAULT_MODIFIER;
const normalize = isPlainObject(options.processor) && isFunction(options.processor.normalize) ? options.processor.normalize : DEFAULT_NORMALIZE;
const interpolate = isPlainObject(options.processor) && isFunction(options.processor.interpolate) ? options.processor.interpolate : DEFAULT_INTERPOLATE;
const type2 = isPlainObject(options.processor) && isString(options.processor.type) ? options.processor.type : DEFAULT_MESSAGE_DATA_TYPE;
const linked = (key, ...args) => {
const [arg1, arg2] = args;
let type3 = "text";
let modifier = "";
if (args.length === 1) {
if (isObject$1(arg1)) {
modifier = arg1.modifier || modifier;
type3 = arg1.type || type3;
} else if (isString(arg1)) {
modifier = arg1 || modifier;
}
} else if (args.length === 2) {
if (isString(arg1)) {
modifier = arg1 || modifier;
}
if (isString(arg2)) {
type3 = arg2 || type3;
}
}
let msg = message2(key)(ctx);
if (type3 === "vnode" && isArray(msg) && modifier) {
msg = msg[0];
}
return modifier ? _modifier(modifier)(msg, type3) : msg;
};
const ctx = {
[
"list"
/* LIST */
]: list,
[
"named"
/* NAMED */
]: named,
[
"plural"
/* PLURAL */
]: plural,
[
"linked"
/* LINKED */
]: linked,
[
"message"
/* MESSAGE */
]: message2,
[
"type"
/* TYPE */
]: type2,
[
"interpolate"
/* INTERPOLATE */
]: interpolate,
[
"normalize"
/* NORMALIZE */
]: normalize
};
return ctx;
}
let devtools = null;
function setDevToolsHook(hook) {
devtools = hook;
}
function initI18nDevTools(i18n2, version2, meta) {
devtools && devtools.emit(IntlifyDevToolsHooks.I18nInit, {
timestamp: Date.now(),
i18n: i18n2,
version: version2,
meta
});
}
const translateDevTools = /* @__PURE__ */ createDevToolsHook(IntlifyDevToolsHooks.FunctionTranslate);
function createDevToolsHook(hook) {
return (payloads) => devtools && devtools.emit(hook, payloads);
}
function fallbackWithSimple(ctx, fallback, start) {
return [.../* @__PURE__ */ new Set([
start,
...isArray(fallback) ? fallback : isObject$1(fallback) ? Object.keys(fallback) : isString(fallback) ? [fallback] : [start]
])];
}
function fallbackWithLocaleChain(ctx, fallback, start) {
const startLocale = isString(start) ? start : DEFAULT_LOCALE;
const context = ctx;
if (!context.__localeChainCache) {
context.__localeChainCache = /* @__PURE__ */ new Map();
}
let chain = context.__localeChainCache.get(startLocale);
if (!chain) {
chain = [];
let block = [start];
while (isArray(block)) {
block = appendBlockToChain(chain, block, fallback);
}
const defaults = isArray(fallback) || !isPlainObject(fallback) ? fallback : fallback["default"] ? fallback["default"] : null;
block = isString(defaults) ? [defaults] : defaults;
if (isArray(block)) {
appendBlockToChain(chain, block, false);
}
context.__localeChainCache.set(startLocale, chain);
}
return chain;
}
function appendBlockToChain(chain, block, blocks) {
let follow = true;
for (let i = 0; i < block.length && isBoolean(follow); i++) {
const locale = block[i];
if (isString(locale)) {
follow = appendLocaleToChain(chain, block[i], blocks);
}
}
return follow;
}
function appendLocaleToChain(chain, locale, blocks) {
let follow;
const tokens = locale.split("-");
do {
const target = tokens.join("-");
follow = appendItemToChain(chain, target, blocks);
tokens.splice(-1, 1);
} while (tokens.length && follow === true);
return follow;
}
function appendItemToChain(chain, target, blocks) {
let follow = false;
if (!chain.includes(target)) {
follow = true;
if (target) {
follow = target[target.length - 1] !== "!";
const locale = target.replace(/!/g, "");
chain.push(locale);
if ((isArray(blocks) || isPlainObject(blocks)) && blocks[locale]) {
follow = blocks[locale];
}
}
}
return follow;
}
const VERSION$1 = "9.2.2";
const NOT_REOSLVED = -1;
const DEFAULT_LOCALE = "en-US";
const MISSING_RESOLVE_VALUE = "";
const capitalize = (str) => `${str.charAt(0).toLocaleUpperCase()}${str.substr(1)}`;
function getDefaultLinkedModifiers() {
return {
upper: (val, type2) => {
return type2 === "text" && isString(val) ? val.toUpperCase() : type2 === "vnode" && isObject$1(val) && "__v_isVNode" in val ? val.children.toUpperCase() : val;
},
lower: (val, type2) => {
return type2 === "text" && isString(val) ? val.toLowerCase() : type2 === "vnode" && isObject$1(val) && "__v_isVNode" in val ? val.children.toLowerCase() : val;
},
capitalize: (val, type2) => {
return type2 === "text" && isString(val) ? capitalize(val) : type2 === "vnode" && isObject$1(val) && "__v_isVNode" in val ? capitalize(val.children) : val;
}
};
}
let _compiler;
function registerMessageCompiler(compiler) {
_compiler = compiler;
}
let _resolver;
function registerMessageResolver(resolver) {
_resolver = resolver;
}
let _fallbacker;
function registerLocaleFallbacker(fallbacker) {
_fallbacker = fallbacker;
}
let _additionalMeta = null;
const setAdditionalMeta = (meta) => {
_additionalMeta = meta;
};
const getAdditionalMeta = () => _additionalMeta;
let _fallbackContext = null;
const setFallbackContext = (context) => {
_fallbackContext = context;
};
const getFallbackContext = () => _fallbackContext;
let _cid = 0;
function createCoreContext(options = {}) {
const version2 = isString(options.version) ? options.version : VERSION$1;
const locale = isString(options.locale) ? options.locale : DEFAULT_LOCALE;
const fallbackLocale = isArray(options.fallbackLocale) || isPlainObject(options.fallbackLocale) || isString(options.fallbackLocale) || options.fallbackLocale === false ? options.fallbackLocale : locale;
const messages2 = isPlainObject(options.messages) ? options.messages : { [locale]: {} };
const datetimeFormats = isPlainObject(options.datetimeFormats) ? options.datetimeFormats : { [locale]: {} };
const numberFormats = isPlainObject(options.numberFormats) ? options.numberFormats : { [locale]: {} };
const modifiers = assign({}, options.modifiers || {}, getDefaultLinkedModifiers());
const pluralRules = options.pluralRules || {};
const missing = isFunction(options.missing) ? options.missing : null;
const missingWarn = isBoolean(options.missingWarn) || isRegExp(options.missingWarn) ? options.missingWarn : true;
const fallbackWarn = isBoolean(options.fallbackWarn) || isRegExp(options.fallbackWarn) ? options.fallbackWarn : true;
const fallbackFormat = !!options.fallbackFormat;
const unresolving = !!options.unresolving;
const postTranslation = isFunction(options.postTranslation) ? options.postTranslation : null;
const processor = isPlainObject(options.processor) ? options.processor : null;
const warnHtmlMessage = isBoolean(options.warnHtmlMessage) ? options.warnHtmlMessage : true;
const escapeParameter = !!options.escapeParameter;
const messageCompiler = isFunction(options.messageCompiler) ? options.messageCompiler : _compiler;
const messageResolver = isFunction(options.messageResolver) ? options.messageResolver : _resolver || resolveWithKeyValue;
const localeFallbacker = isFunction(options.localeFallbacker) ? options.localeFallbacker : _fallbacker || fallbackWithSimple;
const fallbackContext = isObject$1(options.fallbackContext) ? options.fallbackContext : void 0;
const onWarn = isFunction(options.onWarn) ? options.onWarn : warn;
const internalOptions = options;
const __datetimeFormatters = isObject$1(internalOptions.__datetimeFormatters) ? internalOptions.__datetimeFormatters : /* @__PURE__ */ new Map();
const __numberFormatters = isObject$1(internalOptions.__numberFormatters) ? internalOptions.__numberFormatters : /* @__PURE__ */ new Map();
const __meta = isObject$1(internalOptions.__meta) ? internalOptions.__meta : {};
_cid++;
const context = {
version: version2,
cid: _cid,
locale,
fallbackLocale,
messages: messages2,
modifiers,
pluralRules,
missing,
missingWarn,
fallbackWarn,
fallbackFormat,
unresolving,
postTranslation,
processor,
warnHtmlMessage,
escapeParameter,
messageCompiler,
messageResolver,
localeFallbacker,
fallbackContext,
onWarn,
__meta
};
{
context.datetimeFormats = datetimeFormats;
context.numberFormats = numberFormats;
context.__datetimeFormatters = __datetimeFormatters;
context.__numberFormatters = __numberFormatters;
}
if (__INTLIFY_PROD_DEVTOOLS__) {
initI18nDevTools(context, version2, __meta);
}
return context;
}
function handleMissing(context, key, locale, missingWarn, type2) {
const { missing, onWarn } = context;
if (missing !== null) {
const ret = missing(context, locale, key, type2);
return isString(ret) ? ret : key;
} else {
return key;
}
}
function updateFallbackLocale(ctx, locale, fallback) {
const context = ctx;
context.__localeChainCache = /* @__PURE__ */ new Map();
ctx.localeFallbacker(ctx, fallback, locale);
}
const defaultOnCacheKey = (source) => source;
let compileCache = /* @__PURE__ */ Object.create(null);
function compileToFunction(source, options = {}) {
{
const onCacheKey = options.onCacheKey || defaultOnCacheKey;
const key = onCacheKey(source);
const cached = compileCache[key];
if (cached) {
return cached;
}
let occurred = false;
const onError = options.onError || defaultOnError;
options.onError = (err) => {
occurred = true;
onError(err);
};
const { code: code2 } = baseCompile(source, options);
const msg = new Function(`return ${code2}`)();
return !occurred ? compileCache[key] = msg : msg;
}
}
let code$1 = CompileErrorCodes.__EXTEND_POINT__;
const inc$1 = () => ++code$1;
const CoreErrorCodes = {
INVALID_ARGUMENT: code$1,
INVALID_DATE_ARGUMENT: inc$1(),
INVALID_ISO_DATE_ARGUMENT: inc$1(),
__EXTEND_POINT__: inc$1()
// 18
};
function createCoreError(code2) {
return createCompileError(code2, null, void 0);
}
const NOOP_MESSAGE_FUNCTION = () => "";
const isMessageFunction = (val) => isFunction(val);
function translate(context, ...args) {
const { fallbackFormat, postTranslation, unresolving, messageCompiler, fallbackLocale, messages: messages2 } = context;
const [key, options] = parseTranslateArgs(...args);
const missingWarn = isBoolean(options.missingWarn) ? options.missingWarn : context.missingWarn;
const fallbackWarn = isBoolean(options.fallbackWarn) ? options.fallbackWarn : context.fallbackWarn;
const escapeParameter = isBoolean(options.escapeParameter) ? options.escapeParameter : context.escapeParameter;
const resolvedMessage = !!options.resolvedMessage;
const defaultMsgOrKey = isString(options.default) || isBoolean(options.default) ? !isBoolean(options.default) ? options.default : !messageCompiler ? () => key : key : fallbackFormat ? !messageCompiler ? () => key : key : "";
const enableDefaultMsg = fallbackFormat || defaultMsgOrKey !== "";
const locale = isString(options.locale) ? options.locale : context.locale;
escapeParameter && escapeParams(options);
let [formatScope, targetLocale, message2] = !resolvedMessage ? resolveMessageFormat(context, key, locale, fallbackLocale, fallbackWarn, missingWarn) : [
key,
locale,
messages2[locale] || {}
];
let format2 = formatScope;
let cacheBaseKey = key;
if (!resolvedMessage && !(isString(format2) || isMessageFunction(format2))) {
if (enableDefaultMsg) {
format2 = defaultMsgOrKey;
cacheBaseKey = format2;
}
}
if (!resolvedMessage && (!(isString(format2) || isMessageFunction(format2)) || !isString(targetLocale))) {
return unresolving ? NOT_REOSLVED : key;
}
let occurred = false;
const errorDetector = () => {
occurred = true;
};
const msg = !isMessageFunction(format2) ? compileMessageFormat(context, key, targetLocale, format2, cacheBaseKey, errorDetector) : format2;
if (occurred) {
return format2;
}
const ctxOptions = getMessageContextOptions(context, targetLocale, message2, options);
const msgContext = createMessageContext(ctxOptions);
const messaged = evaluateMessage(context, msg, msgContext);
const ret = postTranslation ? postTranslation(messaged, key) : messaged;
if (__INTLIFY_PROD_DEVTOOLS__) {
const payloads = {
timestamp: Date.now(),
key: isString(key) ? key : isMessageFunction(format2) ? format2.key : "",
locale: targetLocale || (isMessageFunction(format2) ? format2.locale : ""),
format: isString(format2) ? format2 : isMessageFunction(format2) ? format2.source : "",
message: ret
};
payloads.meta = assign({}, context.__meta, getAdditionalMeta() || {});
translateDevTools(payloads);
}
return ret;
}
function escapeParams(options) {
if (isArray(options.list)) {
options.list = options.list.map((item) => isString(item) ? escapeHtml(item) : item);
} else if (isObject$1(options.named)) {
Object.keys(options.named).forEach((key) => {
if (isString(options.named[key])) {
options.named[key] = escapeHtml(options.named[key]);
}
});
}
}
function resolveMessageFormat(context, key, locale, fallbackLocale, fallbackWarn, missingWarn) {
const { messages: messages2, onWarn, messageResolver: resolveValue2, localeFallbacker } = context;
const locales = localeFallbacker(context, fallbackLocale, locale);
let message2 = {};
let targetLocale;
let format2 = null;
const type2 = "translate";
for (let i = 0; i < locales.length; i++) {
targetLocale = locales[i];
message2 = messages2[targetLocale] || {};
if ((format2 = resolveValue2(message2, key)) === null) {
format2 = message2[key];
}
if (isString(format2) || isFunction(format2))
break;
const missingRet = handleMissing(
context,
// eslint-disable-line @typescript-eslint/no-explicit-any
key,
targetLocale,
missingWarn,
type2
);
if (missingRet !== key) {
format2 = missingRet;
}
}
return [format2, targetLocale, message2];
}
function compileMessageFormat(context, key, targetLocale, format2, cacheBaseKey, errorDetector) {
const { messageCompiler, warnHtmlMessage } = context;
if (isMessageFunction(format2)) {
const msg2 = format2;
msg2.locale = msg2.locale || targetLocale;
msg2.key = msg2.key || key;
return msg2;
}
if (messageCompiler == null) {
const msg2 = () => format2;
msg2.locale = targetLocale;
msg2.key = key;
return msg2;
}
const msg = messageCompiler(format2, getCompileOptions(context, targetLocale, cacheBaseKey, format2, warnHtmlMessage, errorDetector));
msg.locale = targetLocale;
msg.key = key;
msg.source = format2;
return msg;
}
function evaluateMessage(context, msg, msgCtx) {
const messaged = msg(msgCtx);
return messaged;
}
function parseTranslateArgs(...args) {
const [arg1, arg2, arg3] = args;
const options = {};
if (!isString(arg1) && !isNumber(arg1) && !isMessageFunction(arg1)) {
throw createCoreError(CoreErrorCodes.INVALID_ARGUMENT);
}
const key = isNumber(arg1) ? String(arg1) : isMessageFunction(arg1) ? arg1 : arg1;
if (isNumber(arg2)) {
options.plural = arg2;
} else if (isString(arg2)) {
options.default = arg2;
} else if (isPlainObject(arg2) && !isEmptyObject(arg2)) {
options.named = arg2;
} else if (isArray(arg2)) {
options.list = arg2;
}
if (isNumber(arg3)) {
options.plural = arg3;
} else if (isString(arg3)) {
options.default = arg3;
} else if (isPlainObject(arg3)) {
assign(options, arg3);
}
return [key, options];
}
function getCompileOptions(context, locale, key, source, warnHtmlMessage, errorDetector) {
return {
warnHtmlMessage,
onError: (err) => {
errorDetector && errorDetector(err);
{
throw err;
}
},
onCacheKey: (source2) => generateFormatCacheKey(locale, key, source2)
};
}
function getMessageContextOptions(context, locale, message2, options) {
const { modifiers, pluralRules, messageResolver: resolveValue2, fallbackLocale, fallbackWarn, missingWarn, fallbackContext } = context;
const resolveMessage = (key) => {
let val = resolveValue2(message2, key);
if (val == null && fallbackContext) {
const [, , message3] = resolveMessageFormat(fallbackContext, key, locale, fallbackLocale, fallbackWarn, missingWarn);
val = resolveValue2(message3, key);
}
if (isString(val)) {
let occurred = false;
const errorDetector = () => {
occurred = true;
};
const msg = compileMessageFormat(context, key, locale, val, key, errorDetector);
return !occurred ? msg : NOOP_MESSAGE_FUNCTION;
} else if (isMessageFunction(val)) {
return val;
} else {
return NOOP_MESSAGE_FUNCTION;
}
};
const ctxOptions = {
locale,
modifiers,
pluralRules,
messages: resolveMessage
};
if (context.processor) {
ctxOptions.processor = context.processor;
}
if (options.list) {
ctxOptions.list = options.list;
}
if (options.named) {
ctxOptions.named = options.named;
}
if (isNumber(options.plural)) {
ctxOptions.pluralIndex = options.plural;
}
return ctxOptions;
}
function datetime(context, ...args) {
const { datetimeFormats, unresolving, fallbackLocale, onWarn, localeFallbacker } = context;
const { __datetimeFormatters } = context;
const [key, value, options, overrides] = parseDateTimeArgs(...args);
const missingWarn = isBoolean(options.missingWarn) ? options.missingWarn : context.missingWarn;
isBoolean(options.fallbackWarn) ? options.fallbackWarn : context.fallbackWarn;
const part = !!options.part;
const locale = isString(options.locale) ? options.locale : context.locale;
const locales = localeFallbacker(
context,
// eslint-disable-line @typescript-eslint/no-explicit-any
fallbackLocale,
locale
);
if (!isString(key) || key === "") {
return new Intl.DateTimeFormat(locale, overrides).format(value);
}
let datetimeFormat = {};
let targetLocale;
let format2 = null;
const type2 = "datetime format";
for (let i = 0; i < locales.length; i++) {
targetLocale = locales[i];
datetimeFormat = datetimeFormats[targetLocale] || {};
format2 = datetimeFormat[key];
if (isPlainObject(format2))
break;
handleMissing(context, key, targetLocale, missingWarn, type2);
}
if (!isPlainObject(format2) || !isString(targetLocale)) {
return unresolving ? NOT_REOSLVED : key;
}
let id = `${targetLocale}__${key}`;
if (!isEmptyObject(overrides)) {
id = `${id}__${JSON.stringify(overrides)}`;
}
let formatter = __datetimeFormatters.get(id);
if (!formatter) {
formatter = new Intl.DateTimeFormat(targetLocale, assign({}, format2, overrides));
__datetimeFormatters.set(id, formatter);
}
return !part ? formatter.format(value) : formatter.formatToParts(value);
}
const DATETIME_FORMAT_OPTIONS_KEYS = [
"localeMatcher",
"weekday",
"era",
"year",
"month",
"day",
"hour",
"minute",
"second",
"timeZoneName",
"formatMatcher",
"hour12",
"timeZone",
"dateStyle",
"timeStyle",
"calendar",
"dayPeriod",
"numberingSystem",
"hourCycle",
"fractionalSecondDigits"
];
function parseDateTimeArgs(...args) {
const [arg1, arg2, arg3, arg4] = args;
const options = {};
let overrides = {};
let value;
if (isString(arg1)) {
const matches = arg1.match(/(\d{4}-\d{2}-\d{2})(T|\s)?(.*)/);
if (!matches) {
throw createCoreError(CoreErrorCodes.INVALID_ISO_DATE_ARGUMENT);
}
const dateTime = matches[3] ? matches[3].trim().startsWith("T") ? `${matches[1].trim()}${matches[3].trim()}` : `${matches[1].trim()}T${matches[3].trim()}` : matches[1].trim();
value = new Date(dateTime);
try {
value.toISOString();
} catch (e) {
throw createCoreError(CoreErrorCodes.INVALID_ISO_DATE_ARGUMENT);
}
} else if (isDate(arg1)) {
if (isNaN(arg1.getTime())) {
throw createCoreError(CoreErrorCodes.INVALID_DATE_ARGUMENT);
}
value = arg1;
} else if (isNumber(arg1)) {
value = arg1;
} else {
throw createCoreError(CoreErrorCodes.INVALID_ARGUMENT);
}
if (isString(arg2)) {
options.key = arg2;
} else if (isPlainObject(arg2)) {
Object.keys(arg2).forEach((key) => {
if (DATETIME_FORMAT_OPTIONS_KEYS.includes(key)) {
overrides[key] = arg2[key];
} else {
options[key] = arg2[key];
}
});
}
if (isString(arg3)) {
options.locale = arg3;
} else if (isPlainObject(arg3)) {
overrides = arg3;
}
if (isPlainObject(arg4)) {
overrides = arg4;
}
return [options.key || "", value, options, overrides];
}
function clearDateTimeFormat(ctx, locale, format2) {
const context = ctx;
for (const key in format2) {
const id = `${locale}__${key}`;
if (!context.__datetimeFormatters.has(id)) {
continue;
}
context.__datetimeFormatters.delete(id);
}
}
function number(context, ...args) {
const { numberFormats, unresolving, fallbackLocale, onWarn, localeFallbacker } = context;
const { __numberFormatters } = context;
const [key, value, options, overrides] = parseNumberArgs(...args);
const missingWarn = isBoolean(options.missingWarn) ? options.missingWarn : context.missingWarn;
isBoolean(options.fallbackWarn) ? options.fallbackWarn : context.fallbackWarn;
const part = !!options.part;
const locale = isString(options.locale) ? options.locale : context.locale;
const locales = localeFallbacker(
context,
// eslint-disable-line @typescript-eslint/no-explicit-any
fallbackLocale,
locale
);
if (!isString(key) || key === "") {
return new Intl.NumberFormat(locale, overrides).format(value);
}
let numberFormat = {};
let targetLocale;
let format2 = null;
const type2 = "number format";
for (let i = 0; i < locales.length; i++) {
targetLocale = locales[i];
numberFormat = numberFormats[targetLocale] || {};
format2 = numberFormat[key];
if (isPlainObject(format2))
break;
handleMissing(context, key, targetLocale, missingWarn, type2);
}
if (!isPlainObject(format2) || !isString(targetLocale)) {
return unresolving ? NOT_REOSLVED : key;
}
let id = `${targetLocale}__${key}`;
if (!isEmptyObject(overrides)) {
id = `${id}__${JSON.stringify(overrides)}`;
}
let formatter = __numberFormatters.get(id);
if (!formatter) {
formatter = new Intl.NumberFormat(targetLocale, assign({}, format2, overrides));
__numberFormatters.set(id, formatter);
}
return !part ? formatter.format(value) : formatter.formatToParts(value);
}
const NUMBER_FORMAT_OPTIONS_KEYS = [
"localeMatcher",
"style",
"currency",
"currencyDisplay",
"currencySign",
"useGrouping",
"minimumIntegerDigits",
"minimumFractionDigits",
"maximumFractionDigits",
"minimumSignificantDigits",
"maximumSignificantDigits",
"compactDisplay",
"notation",
"signDisplay",
"unit",
"unitDisplay",
"roundingMode",
"roundingPriority",
"roundingIncrement",
"trailingZeroDisplay"
];
function parseNumberArgs(...args) {
const [arg1, arg2, arg3, arg4] = args;
const options = {};
let overrides = {};
if (!isNumber(arg1)) {
throw createCoreError(CoreErrorCodes.INVALID_ARGUMENT);
}
const value = arg1;
if (isString(arg2)) {
options.key = arg2;
} else if (isPlainObject(arg2)) {
Object.keys(arg2).forEach((key) => {
if (NUMBER_FORMAT_OPTIONS_KEYS.includes(key)) {
overrides[key] = arg2[key];
} else {
options[key] = arg2[key];
}
});
}
if (isString(arg3)) {
options.locale = arg3;
} else if (isPlainObject(arg3)) {
overrides = arg3;
}
if (isPlainObject(arg4)) {
overrides = arg4;
}
return [options.key || "", value, options, overrides];
}
function clearNumberFormat(ctx, locale, format2) {
const context = ctx;
for (const key in format2) {
const id = `${locale}__${key}`;
if (!context.__numberFormatters.has(id)) {
continue;
}
context.__numberFormatters.delete(id);
}
}
{
if (typeof __INTLIFY_PROD_DEVTOOLS__ !== "boolean") {
getGlobalThis().__INTLIFY_PROD_DEVTOOLS__ = false;
}
}
/*!
* vue-i18n v9.2.2
* (c) 2022 kazuya kawaguchi
* Released under the MIT License.
*/
const VERSION = "9.2.2";
function initFeatureFlags() {
if (typeof __VUE_I18N_FULL_INSTALL__ !== "boolean") {
getGlobalThis().__VUE_I18N_FULL_INSTALL__ = true;
}
if (typeof __VUE_I18N_LEGACY_API__ !== "boolean") {
getGlobalThis().__VUE_I18N_LEGACY_API__ = true;
}
if (typeof __INTLIFY_PROD_DEVTOOLS__ !== "boolean") {
getGlobalThis().__INTLIFY_PROD_DEVTOOLS__ = false;
}
}
let code = CompileErrorCodes.__EXTEND_POINT__;
const inc = () => ++code;
const I18nErrorCodes = {
// composer module errors
UNEXPECTED_RETURN_TYPE: code,
// legacy module errors
INVALID_ARGUMENT: inc(),
// i18n module errors
MUST_BE_CALL_SETUP_TOP: inc(),
NOT_INSLALLED: inc(),
NOT_AVAILABLE_IN_LEGACY_MODE: inc(),
// directive module errors
REQUIRED_VALUE: inc(),
INVALID_VALUE: inc(),
// vue-devtools errors
CANNOT_SETUP_VUE_DEVTOOLS_PLUGIN: inc(),
NOT_INSLALLED_WITH_PROVIDE: inc(),
// unexpected error
UNEXPECTED_ERROR: inc(),
// not compatible legacy vue-i18n constructor
NOT_COMPATIBLE_LEGACY_VUE_I18N: inc(),
// bridge support vue 2.x only
BRIDGE_SUPPORT_VUE_2_ONLY: inc(),
// need to define `i18n` option in `allowComposition: true` and `useScope: 'local' at `useI18n``
MUST_DEFINE_I18N_OPTION_IN_ALLOW_COMPOSITION: inc(),
// Not available Compostion API in Legacy API mode. Please make sure that the legacy API mode is working properly
NOT_AVAILABLE_COMPOSITION_IN_LEGACY: inc(),
// for enhancement
__EXTEND_POINT__: inc()
// 29
};
function createI18nError(code2, ...args) {
return createCompileError(code2, null, void 0);
}
const TransrateVNodeSymbol = /* @__PURE__ */ makeSymbol("__transrateVNode");
const DatetimePartsSymbol = /* @__PURE__ */ makeSymbol("__datetimeParts");
const NumberPartsSymbol = /* @__PURE__ */ makeSymbol("__numberParts");
const SetPluralRulesSymbol = makeSymbol("__setPluralRules");
const InejctWithOption = /* @__PURE__ */ makeSymbol("__injectWithOption");
function handleFlatJson(obj) {
if (!isObject$1(obj)) {
return obj;
}
for (const key in obj) {
if (!hasOwn(obj, key)) {
continue;
}
if (!key.includes(".")) {
if (isObject$1(obj[key])) {
handleFlatJson(obj[key]);
}
} else {
const subKeys = key.split(".");
const lastIndex = subKeys.length - 1;
let currentObj = obj;
for (let i = 0; i < lastIndex; i++) {
if (!(subKeys[i] in currentObj)) {
currentObj[subKeys[i]] = {};
}
currentObj = currentObj[subKeys[i]];
}
currentObj[subKeys[lastIndex]] = obj[key];
delete obj[key];
if (isObject$1(currentObj[subKeys[lastIndex]])) {
handleFlatJson(currentObj[subKeys[lastIndex]]);
}
}
}
return obj;
}
function getLocaleMessages(locale, options) {
const { messages: messages2, __i18n, messageResolver, flatJson } = options;
const ret = isPlainObject(messages2) ? messages2 : isArray(__i18n) ? {} : { [locale]: {} };
if (isArray(__i18n)) {
__i18n.forEach((custom) => {
if ("locale" in custom && "resource" in custom) {
const { locale: locale2, resource } = custom;
if (locale2) {
ret[locale2] = ret[locale2] || {};
deepCopy(resource, ret[locale2]);
} else {
deepCopy(resource, ret);
}
} else {
isString(custom) && deepCopy(JSON.parse(custom), ret);
}
});
}
if (messageResolver == null && flatJson) {
for (const key in ret) {
if (hasOwn(ret, key)) {
handleFlatJson(ret[key]);
}
}
}
return ret;
}
const isNotObjectOrIsArray = (val) => !isObject$1(val) || isArray(val);
function deepCopy(src, des) {
if (isNotObjectOrIsArray(src) || isNotObjectOrIsArray(des)) {
throw createI18nError(I18nErrorCodes.INVALID_VALUE);
}
for (const key in src) {
if (hasOwn(src, key)) {
if (isNotObjectOrIsArray(src[key]) || isNotObjectOrIsArray(des[key])) {
des[key] = src[key];
} else {
deepCopy(src[key], des[key]);
}
}
}
}
function getComponentOptions(instance) {
return instance.type;
}
function adjustI18nResources(global2, options, componentOptions) {
let messages2 = isObject$1(options.messages) ? options.messages : {};
if ("__i18nGlobal" in componentOptions) {
messages2 = getLocaleMessages(global2.locale.value, {
messages: messages2,
__i18n: componentOptions.__i18nGlobal
});
}
const locales = Object.keys(messages2);
if (locales.length) {
locales.forEach((locale) => {
global2.mergeLocaleMessage(locale, messages2[locale]);
});
}
{
if (isObject$1(options.datetimeFormats)) {
const locales2 = Object.keys(options.datetimeFormats);
if (locales2.length) {
locales2.forEach((locale) => {
global2.mergeDateTimeFormat(locale, options.datetimeFormats[locale]);
});
}
}
if (isObject$1(options.numberFormats)) {
const locales2 = Object.keys(options.numberFormats);
if (locales2.length) {
locales2.forEach((locale) => {
global2.mergeNumberFormat(locale, options.numberFormats[locale]);
});
}
}
}
}
function createTextNode(key) {
return createVNode(Text, null, key, 0);
}
const DEVTOOLS_META = "__INTLIFY_META__";
let composerID = 0;
function defineCoreMissingHandler(missing) {
return (ctx, locale, key, type2) => {
return missing(locale, key, getCurrentInstance() || void 0, type2);
};
}
const getMetaInfo = () => {
const instance = getCurrentInstance();
let meta = null;
return instance && (meta = getComponentOptions(instance)[DEVTOOLS_META]) ? { [DEVTOOLS_META]: meta } : null;
};
function createComposer(options = {}, VueI18nLegacy) {
const { __root } = options;
const _isGlobal = __root === void 0;
let _inheritLocale = isBoolean(options.inheritLocale) ? options.inheritLocale : true;
const _locale = ref(
// prettier-ignore
__root && _inheritLocale ? __root.locale.value : isString(options.locale) ? options.locale : DEFAULT_LOCALE
);
const _fallbackLocale = ref(
// prettier-ignore
__root && _inheritLocale ? __root.fallbackLocale.value : isString(options.fallbackLocale) || isArray(options.fallbackLocale) || isPlainObject(options.fallbackLocale) || options.fallbackLocale === false ? options.fallbackLocale : _locale.value
);
const _messages = ref(getLocaleMessages(_locale.value, options));
const _datetimeFormats = ref(isPlainObject(options.datetimeFormats) ? options.datetimeFormats : { [_locale.value]: {} });
const _numberFormats = ref(isPlainObject(options.numberFormats) ? options.numberFormats : { [_locale.value]: {} });
let _missingWarn = __root ? __root.missingWarn : isBoolean(options.missingWarn) || isRegExp(options.missingWarn) ? options.missingWarn : true;
let _fallbackWarn = __root ? __root.fallbackWarn : isBoolean(options.fallbackWarn) || isRegExp(options.fallbackWarn) ? options.fallbackWarn : true;
let _fallbackRoot = __root ? __root.fallbackRoot : isBoolean(options.fallbackRoot) ? options.fallbackRoot : true;
let _fallbackFormat = !!options.fallbackFormat;
let _missing = isFunction(options.missing) ? options.missing : null;
let _runtimeMissing = isFunction(options.missing) ? defineCoreMissingHandler(options.missing) : null;
let _postTranslation = isFunction(options.postTranslation) ? options.postTranslation : null;
let _warnHtmlMessage = __root ? __root.warnHtmlMessage : isBoolean(options.warnHtmlMessage) ? options.warnHtmlMessage : true;
let _escapeParameter = !!options.escapeParameter;
const _modifiers = __root ? __root.modifiers : isPlainObject(options.modifiers) ? options.modifiers : {};
let _pluralRules = options.pluralRules || __root && __root.pluralRules;
let _context;
const getCoreContext = () => {
_isGlobal && setFallbackContext(null);
const ctxOptions = {
version: VERSION,
locale: _locale.value,
fallbackLocale: _fallbackLocale.value,
messages: _messages.value,
modifiers: _modifiers,
pluralRules: _pluralRules,
missing: _runtimeMissing === null ? void 0 : _runtimeMissing,
missingWarn: _missingWarn,
fallbackWarn: _fallbackWarn,
fallbackFormat: _fallbackFormat,
unresolving: true,
postTranslation: _postTranslation === null ? void 0 : _postTranslation,
warnHtmlMessage: _warnHtmlMessage,
escapeParameter: _escapeParameter,
messageResolver: options.messageResolver,
__meta: { framework: "vue" }
};
{
ctxOptions.datetimeFormats = _datetimeFormats.value;
ctxOptions.numberFormats = _numberFormats.value;
ctxOptions.__datetimeFormatters = isPlainObject(_context) ? _context.__datetimeFormatters : void 0;
ctxOptions.__numberFormatters = isPlainObject(_context) ? _context.__numberFormatters : void 0;
}
const ctx = createCoreContext(ctxOptions);
_isGlobal && setFallbackContext(ctx);
return ctx;
};
_context = getCoreContext();
updateFallbackLocale(_context, _locale.value, _fallbackLocale.value);
function trackReactivityValues() {
return [
_locale.value,
_fallbackLocale.value,
_messages.value,
_datetimeFormats.value,
_numberFormats.value
];
}
const locale = computed({
get: () => _locale.value,
set: (val) => {
_locale.value = val;
_context.locale = _locale.value;
}
});
const fallbackLocale = computed({
get: () => _fallbackLocale.value,
set: (val) => {
_fallbackLocale.value = val;
_context.fallbackLocale = _fallbackLocale.value;
updateFallbackLocale(_context, _locale.value, val);
}
});
const messages2 = computed(() => _messages.value);
const datetimeFormats = /* @__PURE__ */ computed(() => _datetimeFormats.value);
const numberFormats = /* @__PURE__ */ computed(() => _numberFormats.value);
function getPostTranslationHandler() {
return isFunction(_postTranslation) ? _postTranslation : null;
}
function setPostTranslationHandler(handler) {
_postTranslation = handler;
_context.postTranslation = handler;
}
function getMissingHandler() {
return _missing;
}
function setMissingHandler(handler) {
if (handler !== null) {
_runtimeMissing = defineCoreMissingHandler(handler);
}
_missing = handler;
_context.missing = _runtimeMissing;
}
const wrapWithDeps = (fn2, argumentParser, warnType, fallbackSuccess, fallbackFail, successCondition) => {
trackReactivityValues();
let ret;
if (__INTLIFY_PROD_DEVTOOLS__) {
try {
setAdditionalMeta(getMetaInfo());
if (!_isGlobal) {
_context.fallbackContext = __root ? getFallbackContext() : void 0;
}
ret = fn2(_context);
} finally {
setAdditionalMeta(null);
if (!_isGlobal) {
_context.fallbackContext = void 0;
}
}
} else {
ret = fn2(_context);
}
if (isNumber(ret) && ret === NOT_REOSLVED) {
const [key, arg2] = argumentParser();
return __root && _fallbackRoot ? fallbackSuccess(__root) : fallbackFail(key);
} else if (successCondition(ret)) {
return ret;
} else {
throw createI18nError(I18nErrorCodes.UNEXPECTED_RETURN_TYPE);
}
};
function t2(...args) {
return wrapWithDeps((context) => Reflect.apply(translate, null, [context, ...args]), () => parseTranslateArgs(...args), "translate", (root2) => Reflect.apply(root2.t, root2, [...args]), (key) => key, (val) => isString(val));
}
function rt2(...args) {
const [arg1, arg2, arg3] = args;
if (arg3 && !isObject$1(arg3)) {
throw createI18nError(I18nErrorCodes.INVALID_ARGUMENT);
}
return t2(...[arg1, arg2, assign({ resolvedMessage: true }, arg3 || {})]);
}
function d(...args) {
return wrapWithDeps((context) => Reflect.apply(datetime, null, [context, ...args]), () => parseDateTimeArgs(...args), "datetime format", (root2) => Reflect.apply(root2.d, root2, [...args]), () => MISSING_RESOLVE_VALUE, (val) => isString(val));
}
function n(...args) {
return wrapWithDeps((context) => Reflect.apply(number, null, [context, ...args]), () => parseNumberArgs(...args), "number format", (root2) => Reflect.apply(root2.n, root2, [...args]), () => MISSING_RESOLVE_VALUE, (val) => isString(val));
}
function normalize(values2) {
return values2.map((val) => isString(val) || isNumber(val) || isBoolean(val) ? createTextNode(String(val)) : val);
}
const interpolate = (val) => val;
const processor = {
normalize,
interpolate,
type: "vnode"
};
function transrateVNode(...args) {
return wrapWithDeps(
(context) => {
let ret;
const _context2 = context;
try {
_context2.processor = processor;
ret = Reflect.apply(translate, null, [_context2, ...args]);
} finally {
_context2.processor = null;
}
return ret;
},
() => parseTranslateArgs(...args),
"translate",
// eslint-disable-next-line @typescript-eslint/no-explicit-any
(root2) => root2[TransrateVNodeSymbol](...args),
(key) => [createTextNode(key)],
(val) => isArray(val)
);
}
function numberParts(...args) {
return wrapWithDeps(
(context) => Reflect.apply(number, null, [context, ...args]),
() => parseNumberArgs(...args),
"number format",
// eslint-disable-next-line @typescript-eslint/no-explicit-any
(root2) => root2[NumberPartsSymbol](...args),
() => [],
(val) => isString(val) || isArray(val)
);
}
function datetimeParts(...args) {
return wrapWithDeps(
(context) => Reflect.apply(datetime, null, [context, ...args]),
() => parseDateTimeArgs(...args),
"datetime format",
// eslint-disable-next-line @typescript-eslint/no-explicit-any
(root2) => root2[DatetimePartsSymbol](...args),
() => [],
(val) => isString(val) || isArray(val)
);
}
function setPluralRules(rules2) {
_pluralRules = rules2;
_context.pluralRules = _pluralRules;
}
function te2(key, locale2) {
const targetLocale = isString(locale2) ? locale2 : _locale.value;
const message2 = getLocaleMessage(targetLocale);
return _context.messageResolver(message2, key) !== null;
}
function resolveMessages(key) {
let messages3 = null;
const locales = fallbackWithLocaleChain(_context, _fallbackLocale.value, _locale.value);
for (let i = 0; i < locales.length; i++) {
const targetLocaleMessages = _messages.value[locales[i]] || {};
const messageValue = _context.messageResolver(targetLocaleMessages, key);
if (messageValue != null) {
messages3 = messageValue;
break;
}
}
return messages3;
}
function tm(key) {
const messages3 = resolveMessages(key);
return messages3 != null ? messages3 : __root ? __root.tm(key) || {} : {};
}
function getLocaleMessage(locale2) {
return _messages.value[locale2] || {};
}
function setLocaleMessage(locale2, message2) {
_messages.value[locale2] = message2;
_context.messages = _messages.value;
}
function mergeLocaleMessage(locale2, message2) {
_messages.value[locale2] = _messages.value[locale2] || {};
deepCopy(message2, _messages.value[locale2]);
_context.messages = _messages.value;
}
function getDateTimeFormat(locale2) {
return _datetimeFormats.value[locale2] || {};
}
function setDateTimeFormat(locale2, format2) {
_datetimeFormats.value[locale2] = format2;
_context.datetimeFormats = _datetimeFormats.value;
clearDateTimeFormat(_context, locale2, format2);
}
function mergeDateTimeFormat(locale2, format2) {
_datetimeFormats.value[locale2] = assign(_datetimeFormats.value[locale2] || {}, format2);
_context.datetimeFormats = _datetimeFormats.value;
clearDateTimeFormat(_context, locale2, format2);
}
function getNumberFormat(locale2) {
return _numberFormats.value[locale2] || {};
}
function setNumberFormat(locale2, format2) {
_numberFormats.value[locale2] = format2;
_context.numberFormats = _numberFormats.value;
clearNumberFormat(_context, locale2, format2);
}
function mergeNumberFormat(locale2, format2) {
_numberFormats.value[locale2] = assign(_numberFormats.value[locale2] || {}, format2);
_context.numberFormats = _numberFormats.value;
clearNumberFormat(_context, locale2, format2);
}
composerID++;
if (__root && inBrowser) {
watch(__root.locale, (val) => {
if (_inheritLocale) {
_locale.value = val;
_context.locale = val;
updateFallbackLocale(_context, _locale.value, _fallbackLocale.value);
}
});
watch(__root.fallbackLocale, (val) => {
if (_inheritLocale) {
_fallbackLocale.value = val;
_context.fallbackLocale = val;
updateFallbackLocale(_context, _locale.value, _fallbackLocale.value);
}
});
}
const composer = {
id: composerID,
locale,
fallbackLocale,
get inheritLocale() {
return _inheritLocale;
},
set inheritLocale(val) {
_inheritLocale = val;
if (val && __root) {
_locale.value = __root.locale.value;
_fallbackLocale.value = __root.fallbackLocale.value;
updateFallbackLocale(_context, _locale.value, _fallbackLocale.value);
}
},
get availableLocales() {
return Object.keys(_messages.value).sort();
},
messages: messages2,
get modifiers() {
return _modifiers;
},
get pluralRules() {
return _pluralRules || {};
},
get isGlobal() {
return _isGlobal;
},
get missingWarn() {
return _missingWarn;
},
set missingWarn(val) {
_missingWarn = val;
_context.missingWarn = _missingWarn;
},
get fallbackWarn() {
return _fallbackWarn;
},
set fallbackWarn(val) {
_fallbackWarn = val;
_context.fallbackWarn = _fallbackWarn;
},
get fallbackRoot() {
return _fallbackRoot;
},
set fallbackRoot(val) {
_fallbackRoot = val;
},
get fallbackFormat() {
return _fallbackFormat;
},
set fallbackFormat(val) {
_fallbackFormat = val;
_context.fallbackFormat = _fallbackFormat;
},
get warnHtmlMessage() {
return _warnHtmlMessage;
},
set warnHtmlMessage(val) {
_warnHtmlMessage = val;
_context.warnHtmlMessage = val;
},
get escapeParameter() {
return _escapeParameter;
},
set escapeParameter(val) {
_escapeParameter = val;
_context.escapeParameter = val;
},
t: t2,
getLocaleMessage,
setLocaleMessage,
mergeLocaleMessage,
getPostTranslationHandler,
setPostTranslationHandler,
getMissingHandler,
setMissingHandler,
[SetPluralRulesSymbol]: setPluralRules
};
{
composer.datetimeFormats = datetimeFormats;
composer.numberFormats = numberFormats;
composer.rt = rt2;
composer.te = te2;
composer.tm = tm;
composer.d = d;
composer.n = n;
composer.getDateTimeFormat = getDateTimeFormat;
composer.setDateTimeFormat = setDateTimeFormat;
composer.mergeDateTimeFormat = mergeDateTimeFormat;
composer.getNumberFormat = getNumberFormat;
composer.setNumberFormat = setNumberFormat;
composer.mergeNumberFormat = mergeNumberFormat;
composer[InejctWithOption] = options.__injectWithOption;
composer[TransrateVNodeSymbol] = transrateVNode;
composer[DatetimePartsSymbol] = datetimeParts;
composer[NumberPartsSymbol] = numberParts;
}
return composer;
}
function convertComposerOptions(options) {
const locale = isString(options.locale) ? options.locale : DEFAULT_LOCALE;
const fallbackLocale = isString(options.fallbackLocale) || isArray(options.fallbackLocale) || isPlainObject(options.fallbackLocale) || options.fallbackLocale === false ? options.fallbackLocale : locale;
const missing = isFunction(options.missing) ? options.missing : void 0;
const missingWarn = isBoolean(options.silentTranslationWarn) || isRegExp(options.silentTranslationWarn) ? !options.silentTranslationWarn : true;
const fallbackWarn = isBoolean(options.silentFallbackWarn) || isRegExp(options.silentFallbackWarn) ? !options.silentFallbackWarn : true;
const fallbackRoot = isBoolean(options.fallbackRoot) ? options.fallbackRoot : true;
const fallbackFormat = !!options.formatFallbackMessages;
const modifiers = isPlainObject(options.modifiers) ? options.modifiers : {};
const pluralizationRules = options.pluralizationRules;
const postTranslation = isFunction(options.postTranslation) ? options.postTranslation : void 0;
const warnHtmlMessage = isString(options.warnHtmlInMessage) ? options.warnHtmlInMessage !== "off" : true;
const escapeParameter = !!options.escapeParameterHtml;
const inheritLocale = isBoolean(options.sync) ? options.sync : true;
let messages2 = options.messages;
if (isPlainObject(options.sharedMessages)) {
const sharedMessages = options.sharedMessages;
const locales = Object.keys(sharedMessages);
messages2 = locales.reduce((messages3, locale2) => {
const message2 = messages3[locale2] || (messages3[locale2] = {});
assign(message2, sharedMessages[locale2]);
return messages3;
}, messages2 || {});
}
const { __i18n, __root, __injectWithOption } = options;
const datetimeFormats = options.datetimeFormats;
const numberFormats = options.numberFormats;
const flatJson = options.flatJson;
return {
locale,
fallbackLocale,
messages: messages2,
flatJson,
datetimeFormats,
numberFormats,
missing,
missingWarn,
fallbackWarn,
fallbackRoot,
fallbackFormat,
modifiers,
pluralRules: pluralizationRules,
postTranslation,
warnHtmlMessage,
escapeParameter,
messageResolver: options.messageResolver,
inheritLocale,
__i18n,
__root,
__injectWithOption
};
}
function createVueI18n(options = {}, VueI18nLegacy) {
{
const composer = createComposer(convertComposerOptions(options));
const vueI18n = {
// id
id: composer.id,
// locale
get locale() {
return composer.locale.value;
},
set locale(val) {
composer.locale.value = val;
},
// fallbackLocale
get fallbackLocale() {
return composer.fallbackLocale.value;
},
set fallbackLocale(val) {
composer.fallbackLocale.value = val;
},
// messages
get messages() {
return composer.messages.value;
},
// datetimeFormats
get datetimeFormats() {
return composer.datetimeFormats.value;
},
// numberFormats
get numberFormats() {
return composer.numberFormats.value;
},
// availableLocales
get availableLocales() {
return composer.availableLocales;
},
// formatter
get formatter() {
return {
interpolate() {
return [];
}
};
},
set formatter(val) {
},
// missing
get missing() {
return composer.getMissingHandler();
},
set missing(handler) {
composer.setMissingHandler(handler);
},
// silentTranslationWarn
get silentTranslationWarn() {
return isBoolean(composer.missingWarn) ? !composer.missingWarn : composer.missingWarn;
},
set silentTranslationWarn(val) {
composer.missingWarn = isBoolean(val) ? !val : val;
},
// silentFallbackWarn
get silentFallbackWarn() {
return isBoolean(composer.fallbackWarn) ? !composer.fallbackWarn : composer.fallbackWarn;
},
set silentFallbackWarn(val) {
composer.fallbackWarn = isBoolean(val) ? !val : val;
},
// modifiers
get modifiers() {
return composer.modifiers;
},
// formatFallbackMessages
get formatFallbackMessages() {
return composer.fallbackFormat;
},
set formatFallbackMessages(val) {
composer.fallbackFormat = val;
},
// postTranslation
get postTranslation() {
return composer.getPostTranslationHandler();
},
set postTranslation(handler) {
composer.setPostTranslationHandler(handler);
},
// sync
get sync() {
return composer.inheritLocale;
},
set sync(val) {
composer.inheritLocale = val;
},
// warnInHtmlMessage
get warnHtmlInMessage() {
return composer.warnHtmlMessage ? "warn" : "off";
},
set warnHtmlInMessage(val) {
composer.warnHtmlMessage = val !== "off";
},
// escapeParameterHtml
get escapeParameterHtml() {
return composer.escapeParameter;
},
set escapeParameterHtml(val) {
composer.escapeParameter = val;
},
// preserveDirectiveContent
get preserveDirectiveContent() {
return true;
},
set preserveDirectiveContent(val) {
},
// pluralizationRules
get pluralizationRules() {
return composer.pluralRules || {};
},
// for internal
__composer: composer,
// t
t(...args) {
const [arg1, arg2, arg3] = args;
const options2 = {};
let list = null;
let named = null;
if (!isString(arg1)) {
throw createI18nError(I18nErrorCodes.INVALID_ARGUMENT);
}
const key = arg1;
if (isString(arg2)) {
options2.locale = arg2;
} else if (isArray(arg2)) {
list = arg2;
} else if (isPlainObject(arg2)) {
named = arg2;
}
if (isArray(arg3)) {
list = arg3;
} else if (isPlainObject(arg3)) {
named = arg3;
}
return Reflect.apply(composer.t, composer, [
key,
list || named || {},
options2
]);
},
rt(...args) {
return Reflect.apply(composer.rt, composer, [...args]);
},
// tc
tc(...args) {
const [arg1, arg2, arg3] = args;
const options2 = { plural: 1 };
let list = null;
let named = null;
if (!isString(arg1)) {
throw createI18nError(I18nErrorCodes.INVALID_ARGUMENT);
}
const key = arg1;
if (isString(arg2)) {
options2.locale = arg2;
} else if (isNumber(arg2)) {
options2.plural = arg2;
} else if (isArray(arg2)) {
list = arg2;
} else if (isPlainObject(arg2)) {
named = arg2;
}
if (isString(arg3)) {
options2.locale = arg3;
} else if (isArray(arg3)) {
list = arg3;
} else if (isPlainObject(arg3)) {
named = arg3;
}
return Reflect.apply(composer.t, composer, [
key,
list || named || {},
options2
]);
},
// te
te(key, locale) {
return composer.te(key, locale);
},
// tm
tm(key) {
return composer.tm(key);
},
// getLocaleMessage
getLocaleMessage(locale) {
return composer.getLocaleMessage(locale);
},
// setLocaleMessage
setLocaleMessage(locale, message2) {
composer.setLocaleMessage(locale, message2);
},
// mergeLocaleMessage
mergeLocaleMessage(locale, message2) {
composer.mergeLocaleMessage(locale, message2);
},
// d
d(...args) {
return Reflect.apply(composer.d, composer, [...args]);
},
// getDateTimeFormat
getDateTimeFormat(locale) {
return composer.getDateTimeFormat(locale);
},
// setDateTimeFormat
setDateTimeFormat(locale, format2) {
composer.setDateTimeFormat(locale, format2);
},
// mergeDateTimeFormat
mergeDateTimeFormat(locale, format2) {
composer.mergeDateTimeFormat(locale, format2);
},
// n
n(...args) {
return Reflect.apply(composer.n, composer, [...args]);
},
// getNumberFormat
getNumberFormat(locale) {
return composer.getNumberFormat(locale);
},
// setNumberFormat
setNumberFormat(locale, format2) {
composer.setNumberFormat(locale, format2);
},
// mergeNumberFormat
mergeNumberFormat(locale, format2) {
composer.mergeNumberFormat(locale, format2);
},
// getChoiceIndex
// eslint-disable-next-line @typescript-eslint/no-unused-vars
getChoiceIndex(choice, choicesLength) {
return -1;
},
// for internal
__onComponentInstanceCreated(target) {
const { componentInstanceCreatedListener } = options;
if (componentInstanceCreatedListener) {
componentInstanceCreatedListener(target, vueI18n);
}
}
};
return vueI18n;
}
}
const baseFormatProps = {
tag: {
type: [String, Object]
},
locale: {
type: String
},
scope: {
type: String,
// NOTE: avoid https://github.com/microsoft/rushstack/issues/1050
validator: (val) => val === "parent" || val === "global",
default: "parent"
/* ComponetI18nScope */
},
i18n: {
type: Object
}
};
function getInterpolateArg({ slots }, keys2) {
if (keys2.length === 1 && keys2[0] === "default") {
const ret = slots.default ? slots.default() : [];
return ret.reduce((slot, current) => {
return slot = [
...slot,
...isArray(current.children) ? current.children : [current]
];
}, []);
} else {
return keys2.reduce((arg, key) => {
const slot = slots[key];
if (slot) {
arg[key] = slot();
}
return arg;
}, {});
}
}
function getFragmentableTag(tag) {
return Fragment$1;
}
const Translation = (
/* defineComponent */
{
/* eslint-disable */
name: "i18n-t",
props: assign({
keypath: {
type: String,
required: true
},
plural: {
type: [Number, String],
// eslint-disable-next-line @typescript-eslint/no-explicit-any
validator: (val) => isNumber(val) || !isNaN(val)
}
}, baseFormatProps),
/* eslint-enable */
// eslint-disable-next-line @typescript-eslint/no-explicit-any
setup(props, context) {
const { slots, attrs } = context;
const i18n2 = props.i18n || useI18n({
useScope: props.scope,
__useComponent: true
});
return () => {
const keys2 = Object.keys(slots).filter((key) => key !== "_");
const options = {};
if (props.locale) {
options.locale = props.locale;
}
if (props.plural !== void 0) {
options.plural = isString(props.plural) ? +props.plural : props.plural;
}
const arg = getInterpolateArg(context, keys2);
const children = i18n2[TransrateVNodeSymbol](props.keypath, arg, options);
const assignedAttrs = assign({}, attrs);
const tag = isString(props.tag) || isObject$1(props.tag) ? props.tag : getFragmentableTag();
return h(tag, assignedAttrs, children);
};
}
}
);
function isVNode(target) {
return isArray(target) && !isString(target[0]);
}
function renderFormatter(props, context, slotKeys, partFormatter) {
const { slots, attrs } = context;
return () => {
const options = { part: true };
let overrides = {};
if (props.locale) {
options.locale = props.locale;
}
if (isString(props.format)) {
options.key = props.format;
} else if (isObject$1(props.format)) {
if (isString(props.format.key)) {
options.key = props.format.key;
}
overrides = Object.keys(props.format).reduce((options2, prop) => {
return slotKeys.includes(prop) ? assign({}, options2, { [prop]: props.format[prop] }) : options2;
}, {});
}
const parts = partFormatter(...[props.value, options, overrides]);
let children = [options.key];
if (isArray(parts)) {
children = parts.map((part, index2) => {
const slot = slots[part.type];
const node = slot ? slot({ [part.type]: part.value, index: index2, parts }) : [part.value];
if (isVNode(node)) {
node[0].key = `${part.type}-${index2}`;
}
return node;
});
} else if (isString(parts)) {
children = [parts];
}
const assignedAttrs = assign({}, attrs);
const tag = isString(props.tag) || isObject$1(props.tag) ? props.tag : getFragmentableTag();
return h(tag, assignedAttrs, children);
};
}
const NumberFormat = (
/* defineComponent */
{
/* eslint-disable */
name: "i18n-n",
props: assign({
value: {
type: Number,
required: true
},
format: {
type: [String, Object]
}
}, baseFormatProps),
/* eslint-enable */
// eslint-disable-next-line @typescript-eslint/no-explicit-any
setup(props, context) {
const i18n2 = props.i18n || useI18n({ useScope: "parent", __useComponent: true });
return renderFormatter(props, context, NUMBER_FORMAT_OPTIONS_KEYS, (...args) => (
// eslint-disable-next-line @typescript-eslint/no-explicit-any
i18n2[NumberPartsSymbol](...args)
));
}
}
);
const DatetimeFormat = (
/*defineComponent */
{
/* eslint-disable */
name: "i18n-d",
props: assign({
value: {
type: [Number, Date],
required: true
},
format: {
type: [String, Object]
}
}, baseFormatProps),
/* eslint-enable */
// eslint-disable-next-line @typescript-eslint/no-explicit-any
setup(props, context) {
const i18n2 = props.i18n || useI18n({ useScope: "parent", __useComponent: true });
return renderFormatter(props, context, DATETIME_FORMAT_OPTIONS_KEYS, (...args) => (
// eslint-disable-next-line @typescript-eslint/no-explicit-any
i18n2[DatetimePartsSymbol](...args)
));
}
}
);
function getComposer$2(i18n2, instance) {
const i18nInternal = i18n2;
if (i18n2.mode === "composition") {
return i18nInternal.__getInstance(instance) || i18n2.global;
} else {
const vueI18n = i18nInternal.__getInstance(instance);
return vueI18n != null ? vueI18n.__composer : i18n2.global.__composer;
}
}
function vTDirective(i18n2) {
const _process = (binding) => {
const { instance, modifiers, value } = binding;
if (!instance || !instance.$) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
const composer = getComposer$2(i18n2, instance.$);
const parsedValue = parseValue(value);
return [
Reflect.apply(composer.t, composer, [...makeParams(parsedValue)]),
composer
];
};
const register = (el, binding) => {
const [textContent, composer] = _process(binding);
if (inBrowser && i18n2.global === composer) {
el.__i18nWatcher = watch(composer.locale, () => {
binding.instance && binding.instance.$forceUpdate();
});
}
el.__composer = composer;
el.textContent = textContent;
};
const unregister = (el) => {
if (inBrowser && el.__i18nWatcher) {
el.__i18nWatcher();
el.__i18nWatcher = void 0;
delete el.__i18nWatcher;
}
if (el.__composer) {
el.__composer = void 0;
delete el.__composer;
}
};
const update = (el, { value }) => {
if (el.__composer) {
const composer = el.__composer;
const parsedValue = parseValue(value);
el.textContent = Reflect.apply(composer.t, composer, [
...makeParams(parsedValue)
]);
}
};
const getSSRProps = (binding) => {
const [textContent] = _process(binding);
return { textContent };
};
return {
created: register,
unmounted: unregister,
beforeUpdate: update,
getSSRProps
};
}
function parseValue(value) {
if (isString(value)) {
return { path: value };
} else if (isPlainObject(value)) {
if (!("path" in value)) {
throw createI18nError(I18nErrorCodes.REQUIRED_VALUE, "path");
}
return value;
} else {
throw createI18nError(I18nErrorCodes.INVALID_VALUE);
}
}
function makeParams(value) {
const { path, locale, args, choice, plural } = value;
const options = {};
const named = args || {};
if (isString(locale)) {
options.locale = locale;
}
if (isNumber(choice)) {
options.plural = choice;
}
if (isNumber(plural)) {
options.plural = plural;
}
return [path, named, options];
}
function apply(app, i18n2, ...options) {
const pluginOptions = isPlainObject(options[0]) ? options[0] : {};
const useI18nComponentName = !!pluginOptions.useI18nComponentName;
const globalInstall = isBoolean(pluginOptions.globalInstall) ? pluginOptions.globalInstall : true;
if (globalInstall) {
app.component(!useI18nComponentName ? Translation.name : "i18n", Translation);
app.component(NumberFormat.name, NumberFormat);
app.component(DatetimeFormat.name, DatetimeFormat);
}
{
app.directive("t", vTDirective(i18n2));
}
}
function defineMixin(vuei18n, composer, i18n2) {
return {
beforeCreate() {
const instance = getCurrentInstance();
if (!instance) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
const options = this.$options;
if (options.i18n) {
const optionsI18n = options.i18n;
if (options.__i18n) {
optionsI18n.__i18n = options.__i18n;
}
optionsI18n.__root = composer;
if (this === this.$root) {
this.$i18n = mergeToRoot(vuei18n, optionsI18n);
} else {
optionsI18n.__injectWithOption = true;
this.$i18n = createVueI18n(optionsI18n);
}
} else if (options.__i18n) {
if (this === this.$root) {
this.$i18n = mergeToRoot(vuei18n, options);
} else {
this.$i18n = createVueI18n({
__i18n: options.__i18n,
__injectWithOption: true,
__root: composer
});
}
} else {
this.$i18n = vuei18n;
}
if (options.__i18nGlobal) {
adjustI18nResources(composer, options, options);
}
vuei18n.__onComponentInstanceCreated(this.$i18n);
i18n2.__setInstance(instance, this.$i18n);
this.$t = (...args) => this.$i18n.t(...args);
this.$rt = (...args) => this.$i18n.rt(...args);
this.$tc = (...args) => this.$i18n.tc(...args);
this.$te = (key, locale) => this.$i18n.te(key, locale);
this.$d = (...args) => this.$i18n.d(...args);
this.$n = (...args) => this.$i18n.n(...args);
this.$tm = (key) => this.$i18n.tm(key);
},
mounted() {
},
unmounted() {
const instance = getCurrentInstance();
if (!instance) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
delete this.$t;
delete this.$rt;
delete this.$tc;
delete this.$te;
delete this.$d;
delete this.$n;
delete this.$tm;
i18n2.__deleteInstance(instance);
delete this.$i18n;
}
};
}
function mergeToRoot(root2, options) {
root2.locale = options.locale || root2.locale;
root2.fallbackLocale = options.fallbackLocale || root2.fallbackLocale;
root2.missing = options.missing || root2.missing;
root2.silentTranslationWarn = options.silentTranslationWarn || root2.silentFallbackWarn;
root2.silentFallbackWarn = options.silentFallbackWarn || root2.silentFallbackWarn;
root2.formatFallbackMessages = options.formatFallbackMessages || root2.formatFallbackMessages;
root2.postTranslation = options.postTranslation || root2.postTranslation;
root2.warnHtmlInMessage = options.warnHtmlInMessage || root2.warnHtmlInMessage;
root2.escapeParameterHtml = options.escapeParameterHtml || root2.escapeParameterHtml;
root2.sync = options.sync || root2.sync;
root2.__composer[SetPluralRulesSymbol](options.pluralizationRules || root2.pluralizationRules);
const messages2 = getLocaleMessages(root2.locale, {
messages: options.messages,
__i18n: options.__i18n
});
Object.keys(messages2).forEach((locale) => root2.mergeLocaleMessage(locale, messages2[locale]));
if (options.datetimeFormats) {
Object.keys(options.datetimeFormats).forEach((locale) => root2.mergeDateTimeFormat(locale, options.datetimeFormats[locale]));
}
if (options.numberFormats) {
Object.keys(options.numberFormats).forEach((locale) => root2.mergeNumberFormat(locale, options.numberFormats[locale]));
}
return root2;
}
const I18nInjectionKey = /* @__PURE__ */ makeSymbol("global-vue-i18n");
function createI18n(options = {}, VueI18nLegacy) {
const __legacyMode = __VUE_I18N_LEGACY_API__ && isBoolean(options.legacy) ? options.legacy : __VUE_I18N_LEGACY_API__;
const __globalInjection = isBoolean(options.globalInjection) ? options.globalInjection : true;
const __allowComposition = __VUE_I18N_LEGACY_API__ && __legacyMode ? !!options.allowComposition : true;
const __instances = /* @__PURE__ */ new Map();
const [globalScope, __global] = createGlobal(options, __legacyMode);
const symbol = makeSymbol("");
function __getInstance(component) {
return __instances.get(component) || null;
}
function __setInstance(component, instance) {
__instances.set(component, instance);
}
function __deleteInstance(component) {
__instances.delete(component);
}
{
const i18n2 = {
// mode
get mode() {
return __VUE_I18N_LEGACY_API__ && __legacyMode ? "legacy" : "composition";
},
// allowComposition
get allowComposition() {
return __allowComposition;
},
// install plugin
async install(app, ...options2) {
app.__VUE_I18N_SYMBOL__ = symbol;
app.provide(app.__VUE_I18N_SYMBOL__, i18n2);
if (!__legacyMode && __globalInjection) {
injectGlobalFields(app, i18n2.global);
}
if (__VUE_I18N_FULL_INSTALL__) {
apply(app, i18n2, ...options2);
}
if (__VUE_I18N_LEGACY_API__ && __legacyMode) {
app.mixin(defineMixin(__global, __global.__composer, i18n2));
}
const unmountApp = app.unmount;
app.unmount = () => {
i18n2.dispose();
unmountApp();
};
},
// global accessor
get global() {
return __global;
},
dispose() {
globalScope.stop();
},
// @internal
__instances,
// @internal
__getInstance,
// @internal
__setInstance,
// @internal
__deleteInstance
};
return i18n2;
}
}
function useI18n(options = {}) {
const instance = getCurrentInstance();
if (instance == null) {
throw createI18nError(I18nErrorCodes.MUST_BE_CALL_SETUP_TOP);
}
if (!instance.isCE && instance.appContext.app != null && !instance.appContext.app.__VUE_I18N_SYMBOL__) {
throw createI18nError(I18nErrorCodes.NOT_INSLALLED);
}
const i18n2 = getI18nInstance(instance);
const global2 = getGlobalComposer(i18n2);
const componentOptions = getComponentOptions(instance);
const scope = getScope(options, componentOptions);
if (__VUE_I18N_LEGACY_API__) {
if (i18n2.mode === "legacy" && !options.__useComponent) {
if (!i18n2.allowComposition) {
throw createI18nError(I18nErrorCodes.NOT_AVAILABLE_IN_LEGACY_MODE);
}
return useI18nForLegacy(instance, scope, global2, options);
}
}
if (scope === "global") {
adjustI18nResources(global2, options, componentOptions);
return global2;
}
if (scope === "parent") {
let composer2 = getComposer(i18n2, instance, options.__useComponent);
if (composer2 == null) {
composer2 = global2;
}
return composer2;
}
const i18nInternal = i18n2;
let composer = i18nInternal.__getInstance(instance);
if (composer == null) {
const composerOptions = assign({}, options);
if ("__i18n" in componentOptions) {
composerOptions.__i18n = componentOptions.__i18n;
}
if (global2) {
composerOptions.__root = global2;
}
composer = createComposer(composerOptions);
setupLifeCycle(i18nInternal, instance);
i18nInternal.__setInstance(instance, composer);
}
return composer;
}
function createGlobal(options, legacyMode, VueI18nLegacy) {
const scope = effectScope();
{
const obj = __VUE_I18N_LEGACY_API__ && legacyMode ? scope.run(() => createVueI18n(options)) : scope.run(() => createComposer(options));
if (obj == null) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
return [scope, obj];
}
}
function getI18nInstance(instance) {
{
const i18n2 = inject(!instance.isCE ? instance.appContext.app.__VUE_I18N_SYMBOL__ : I18nInjectionKey);
if (!i18n2) {
throw createI18nError(!instance.isCE ? I18nErrorCodes.UNEXPECTED_ERROR : I18nErrorCodes.NOT_INSLALLED_WITH_PROVIDE);
}
return i18n2;
}
}
function getScope(options, componentOptions) {
return isEmptyObject(options) ? "__i18n" in componentOptions ? "local" : "global" : !options.useScope ? "local" : options.useScope;
}
function getGlobalComposer(i18n2) {
return i18n2.mode === "composition" ? i18n2.global : i18n2.global.__composer;
}
function getComposer(i18n2, target, useComponent = false) {
let composer = null;
const root2 = target.root;
let current = target.parent;
while (current != null) {
const i18nInternal = i18n2;
if (i18n2.mode === "composition") {
composer = i18nInternal.__getInstance(current);
} else {
if (__VUE_I18N_LEGACY_API__) {
const vueI18n = i18nInternal.__getInstance(current);
if (vueI18n != null) {
composer = vueI18n.__composer;
if (useComponent && composer && !composer[InejctWithOption]) {
composer = null;
}
}
}
}
if (composer != null) {
break;
}
if (root2 === current) {
break;
}
current = current.parent;
}
return composer;
}
function setupLifeCycle(i18n2, target, composer) {
{
onMounted(() => {
}, target);
onUnmounted(() => {
i18n2.__deleteInstance(target);
}, target);
}
}
function useI18nForLegacy(instance, scope, root2, options = {}) {
const isLocale = scope === "local";
const _composer = shallowRef(null);
if (isLocale && instance.proxy && !(instance.proxy.$options.i18n || instance.proxy.$options.__i18n)) {
throw createI18nError(I18nErrorCodes.MUST_DEFINE_I18N_OPTION_IN_ALLOW_COMPOSITION);
}
const _inheritLocale = isBoolean(options.inheritLocale) ? options.inheritLocale : true;
const _locale = ref(
// prettier-ignore
isLocale && _inheritLocale ? root2.locale.value : isString(options.locale) ? options.locale : DEFAULT_LOCALE
);
const _fallbackLocale = ref(
// prettier-ignore
isLocale && _inheritLocale ? root2.fallbackLocale.value : isString(options.fallbackLocale) || isArray(options.fallbackLocale) || isPlainObject(options.fallbackLocale) || options.fallbackLocale === false ? options.fallbackLocale : _locale.value
);
const _messages = ref(getLocaleMessages(_locale.value, options));
const _datetimeFormats = ref(isPlainObject(options.datetimeFormats) ? options.datetimeFormats : { [_locale.value]: {} });
const _numberFormats = ref(isPlainObject(options.numberFormats) ? options.numberFormats : { [_locale.value]: {} });
const _missingWarn = isLocale ? root2.missingWarn : isBoolean(options.missingWarn) || isRegExp(options.missingWarn) ? options.missingWarn : true;
const _fallbackWarn = isLocale ? root2.fallbackWarn : isBoolean(options.fallbackWarn) || isRegExp(options.fallbackWarn) ? options.fallbackWarn : true;
const _fallbackRoot = isLocale ? root2.fallbackRoot : isBoolean(options.fallbackRoot) ? options.fallbackRoot : true;
const _fallbackFormat = !!options.fallbackFormat;
const _missing = isFunction(options.missing) ? options.missing : null;
const _postTranslation = isFunction(options.postTranslation) ? options.postTranslation : null;
const _warnHtmlMessage = isLocale ? root2.warnHtmlMessage : isBoolean(options.warnHtmlMessage) ? options.warnHtmlMessage : true;
const _escapeParameter = !!options.escapeParameter;
const _modifiers = isLocale ? root2.modifiers : isPlainObject(options.modifiers) ? options.modifiers : {};
const _pluralRules = options.pluralRules || isLocale && root2.pluralRules;
function trackReactivityValues() {
return [
_locale.value,
_fallbackLocale.value,
_messages.value,
_datetimeFormats.value,
_numberFormats.value
];
}
const locale = computed({
get: () => {
return _composer.value ? _composer.value.locale.value : _locale.value;
},
set: (val) => {
if (_composer.value) {
_composer.value.locale.value = val;
}
_locale.value = val;
}
});
const fallbackLocale = computed({
get: () => {
return _composer.value ? _composer.value.fallbackLocale.value : _fallbackLocale.value;
},
set: (val) => {
if (_composer.value) {
_composer.value.fallbackLocale.value = val;
}
_fallbackLocale.value = val;
}
});
const messages2 = computed(() => {
if (_composer.value) {
return _composer.value.messages.value;
} else {
return _messages.value;
}
});
const datetimeFormats = computed(() => _datetimeFormats.value);
const numberFormats = computed(() => _numberFormats.value);
function getPostTranslationHandler() {
return _composer.value ? _composer.value.getPostTranslationHandler() : _postTranslation;
}
function setPostTranslationHandler(handler) {
if (_composer.value) {
_composer.value.setPostTranslationHandler(handler);
}
}
function getMissingHandler() {
return _composer.value ? _composer.value.getMissingHandler() : _missing;
}
function setMissingHandler(handler) {
if (_composer.value) {
_composer.value.setMissingHandler(handler);
}
}
function warpWithDeps(fn2) {
trackReactivityValues();
return fn2();
}
function t2(...args) {
return _composer.value ? warpWithDeps(() => Reflect.apply(_composer.value.t, null, [...args])) : warpWithDeps(() => "");
}
function rt2(...args) {
return _composer.value ? Reflect.apply(_composer.value.rt, null, [...args]) : "";
}
function d(...args) {
return _composer.value ? warpWithDeps(() => Reflect.apply(_composer.value.d, null, [...args])) : warpWithDeps(() => "");
}
function n(...args) {
return _composer.value ? warpWithDeps(() => Reflect.apply(_composer.value.n, null, [...args])) : warpWithDeps(() => "");
}
function tm(key) {
return _composer.value ? _composer.value.tm(key) : {};
}
function te2(key, locale2) {
return _composer.value ? _composer.value.te(key, locale2) : false;
}
function getLocaleMessage(locale2) {
return _composer.value ? _composer.value.getLocaleMessage(locale2) : {};
}
function setLocaleMessage(locale2, message2) {
if (_composer.value) {
_composer.value.setLocaleMessage(locale2, message2);
_messages.value[locale2] = message2;
}
}
function mergeLocaleMessage(locale2, message2) {
if (_composer.value) {
_composer.value.mergeLocaleMessage(locale2, message2);
}
}
function getDateTimeFormat(locale2) {
return _composer.value ? _composer.value.getDateTimeFormat(locale2) : {};
}
function setDateTimeFormat(locale2, format2) {
if (_composer.value) {
_composer.value.setDateTimeFormat(locale2, format2);
_datetimeFormats.value[locale2] = format2;
}
}
function mergeDateTimeFormat(locale2, format2) {
if (_composer.value) {
_composer.value.mergeDateTimeFormat(locale2, format2);
}
}
function getNumberFormat(locale2) {
return _composer.value ? _composer.value.getNumberFormat(locale2) : {};
}
function setNumberFormat(locale2, format2) {
if (_composer.value) {
_composer.value.setNumberFormat(locale2, format2);
_numberFormats.value[locale2] = format2;
}
}
function mergeNumberFormat(locale2, format2) {
if (_composer.value) {
_composer.value.mergeNumberFormat(locale2, format2);
}
}
const wrapper = {
get id() {
return _composer.value ? _composer.value.id : -1;
},
locale,
fallbackLocale,
messages: messages2,
datetimeFormats,
numberFormats,
get inheritLocale() {
return _composer.value ? _composer.value.inheritLocale : _inheritLocale;
},
set inheritLocale(val) {
if (_composer.value) {
_composer.value.inheritLocale = val;
}
},
get availableLocales() {
return _composer.value ? _composer.value.availableLocales : Object.keys(_messages.value);
},
get modifiers() {
return _composer.value ? _composer.value.modifiers : _modifiers;
},
get pluralRules() {
return _composer.value ? _composer.value.pluralRules : _pluralRules;
},
get isGlobal() {
return _composer.value ? _composer.value.isGlobal : false;
},
get missingWarn() {
return _composer.value ? _composer.value.missingWarn : _missingWarn;
},
set missingWarn(val) {
if (_composer.value) {
_composer.value.missingWarn = val;
}
},
get fallbackWarn() {
return _composer.value ? _composer.value.fallbackWarn : _fallbackWarn;
},
set fallbackWarn(val) {
if (_composer.value) {
_composer.value.missingWarn = val;
}
},
get fallbackRoot() {
return _composer.value ? _composer.value.fallbackRoot : _fallbackRoot;
},
set fallbackRoot(val) {
if (_composer.value) {
_composer.value.fallbackRoot = val;
}
},
get fallbackFormat() {
return _composer.value ? _composer.value.fallbackFormat : _fallbackFormat;
},
set fallbackFormat(val) {
if (_composer.value) {
_composer.value.fallbackFormat = val;
}
},
get warnHtmlMessage() {
return _composer.value ? _composer.value.warnHtmlMessage : _warnHtmlMessage;
},
set warnHtmlMessage(val) {
if (_composer.value) {
_composer.value.warnHtmlMessage = val;
}
},
get escapeParameter() {
return _composer.value ? _composer.value.escapeParameter : _escapeParameter;
},
set escapeParameter(val) {
if (_composer.value) {
_composer.value.escapeParameter = val;
}
},
t: t2,
getPostTranslationHandler,
setPostTranslationHandler,
getMissingHandler,
setMissingHandler,
rt: rt2,
d,
n,
tm,
te: te2,
getLocaleMessage,
setLocaleMessage,
mergeLocaleMessage,
getDateTimeFormat,
setDateTimeFormat,
mergeDateTimeFormat,
getNumberFormat,
setNumberFormat,
mergeNumberFormat
};
function sync(composer) {
composer.locale.value = _locale.value;
composer.fallbackLocale.value = _fallbackLocale.value;
Object.keys(_messages.value).forEach((locale2) => {
composer.mergeLocaleMessage(locale2, _messages.value[locale2]);
});
Object.keys(_datetimeFormats.value).forEach((locale2) => {
composer.mergeDateTimeFormat(locale2, _datetimeFormats.value[locale2]);
});
Object.keys(_numberFormats.value).forEach((locale2) => {
composer.mergeNumberFormat(locale2, _numberFormats.value[locale2]);
});
composer.escapeParameter = _escapeParameter;
composer.fallbackFormat = _fallbackFormat;
composer.fallbackRoot = _fallbackRoot;
composer.fallbackWarn = _fallbackWarn;
composer.missingWarn = _missingWarn;
composer.warnHtmlMessage = _warnHtmlMessage;
}
onBeforeMount(() => {
if (instance.proxy == null || instance.proxy.$i18n == null) {
throw createI18nError(I18nErrorCodes.NOT_AVAILABLE_COMPOSITION_IN_LEGACY);
}
const composer = _composer.value = instance.proxy.$i18n.__composer;
if (scope === "global") {
_locale.value = composer.locale.value;
_fallbackLocale.value = composer.fallbackLocale.value;
_messages.value = composer.messages.value;
_datetimeFormats.value = composer.datetimeFormats.value;
_numberFormats.value = composer.numberFormats.value;
} else if (isLocale) {
sync(composer);
}
});
return wrapper;
}
const globalExportProps = [
"locale",
"fallbackLocale",
"availableLocales"
];
const globalExportMethods = ["t", "rt", "d", "n", "tm"];
function injectGlobalFields(app, composer) {
const i18n2 = /* @__PURE__ */ Object.create(null);
globalExportProps.forEach((prop) => {
const desc = Object.getOwnPropertyDescriptor(composer, prop);
if (!desc) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
const wrap2 = isRef(desc.value) ? {
get() {
return desc.value.value;
},
// eslint-disable-next-line @typescript-eslint/no-explicit-any
set(val) {
desc.value.value = val;
}
} : {
get() {
return desc.get && desc.get();
}
};
Object.defineProperty(i18n2, prop, wrap2);
});
app.config.globalProperties.$i18n = i18n2;
globalExportMethods.forEach((method2) => {
const desc = Object.getOwnPropertyDescriptor(composer, method2);
if (!desc || !desc.value) {
throw createI18nError(I18nErrorCodes.UNEXPECTED_ERROR);
}
Object.defineProperty(app.config.globalProperties, `$${method2}`, desc);
});
}
registerMessageCompiler(compileToFunction);
registerMessageResolver(resolveValue);
registerLocaleFallbacker(fallbackWithLocaleChain);
{
initFeatureFlags();
}
if (__INTLIFY_PROD_DEVTOOLS__) {
const target = getGlobalThis();
target.__INTLIFY__ = true;
setDevToolsHook(target.__INTLIFY_DEVTOOLS_GLOBAL_HOOK__);
}
var FileSaver_min = { exports: {} };
(function(module2, exports2) {
(function(a, b) {
b();
})(commonjsGlobal, function() {
function b(a2, b2) {
return "undefined" == typeof b2 ? b2 = { autoBom: false } : "object" != typeof b2 && (console.warn("Deprecated: Expected third argument to be a object"), b2 = { autoBom: !b2 }), b2.autoBom && /^\s*(?:text\/\S*|application\/xml|\S*\/\S*\+xml)\s*;.*charset\s*=\s*utf-8/i.test(a2.type) ? new Blob(["\uFEFF", a2], { type: a2.type }) : a2;
}
function c(a2, b2, c2) {
var d2 = new XMLHttpRequest();
d2.open("GET", a2), d2.responseType = "blob", d2.onload = function() {
g(d2.response, b2, c2);
}, d2.onerror = function() {
console.error("could not download file");
}, d2.send();
}
function d(a2) {
var b2 = new XMLHttpRequest();
b2.open("HEAD", a2, false);
try {
b2.send();
} catch (a3) {
}
return 200 <= b2.status && 299 >= b2.status;
}
function e(a2) {
try {
a2.dispatchEvent(new MouseEvent("click"));
} catch (c2) {
var b2 = document.createEvent("MouseEvents");
b2.initMouseEvent("click", true, true, window, 0, 0, 0, 80, 20, false, false, false, false, 0, null), a2.dispatchEvent(b2);
}
}
var f = "object" == typeof window && window.window === window ? window : "object" == typeof self && self.self === self ? self : "object" == typeof commonjsGlobal && commonjsGlobal.global === commonjsGlobal ? commonjsGlobal : void 0, a = f.navigator && /Macintosh/.test(navigator.userAgent) && /AppleWebKit/.test(navigator.userAgent) && !/Safari/.test(navigator.userAgent), g = f.saveAs || ("object" != typeof window || window !== f ? function() {
} : "download" in HTMLAnchorElement.prototype && !a ? function(b2, g2, h2) {
var i = f.URL || f.webkitURL, j = document.createElement("a");
g2 = g2 || b2.name || "download", j.download = g2, j.rel = "noopener", "string" == typeof b2 ? (j.href = b2, j.origin === location.origin ? e(j) : d(j.href) ? c(b2, g2, h2) : e(j, j.target = "_blank")) : (j.href = i.createObjectURL(b2), setTimeout(function() {
i.revokeObjectURL(j.href);
}, 4e4), setTimeout(function() {
e(j);
}, 0));
} : "msSaveOrOpenBlob" in navigator ? function(f2, g2, h2) {
if (g2 = g2 || f2.name || "download", "string" != typeof f2)
navigator.msSaveOrOpenBlob(b(f2, h2), g2);
else if (d(f2))
c(f2, g2, h2);
else {
var i = document.createElement("a");
i.href = f2, i.target = "_blank", setTimeout(function() {
e(i);
});
}
} : function(b2, d2, e2, g2) {
if (g2 = g2 || open("", "_blank"), g2 && (g2.document.title = g2.document.body.innerText = "downloading..."), "string" == typeof b2)
return c(b2, d2, e2);
var h2 = "application/octet-stream" === b2.type, i = /constructor/i.test(f.HTMLElement) || f.safari, j = /CriOS\/[\d]+/.test(navigator.userAgent);
if ((j || h2 && i || a) && "undefined" != typeof FileReader) {
var k = new FileReader();
k.onloadend = function() {
var a2 = k.result;
a2 = j ? a2 : a2.replace(/^data:[^;]*;/, "data:attachment/file;"), g2 ? g2.location.href = a2 : location = a2, g2 = null;
}, k.readAsDataURL(b2);
} else {
var l = f.URL || f.webkitURL, m = l.createObjectURL(b2);
g2 ? g2.location = m : location.href = m, g2 = null, setTimeout(function() {
l.revokeObjectURL(m);
}, 4e4);
}
});
f.saveAs = g.saveAs = g, module2.exports = g;
});
})(FileSaver_min);
var FileSaver_minExports = FileSaver_min.exports;
function commonjsRequire(path) {
throw new Error('Could not dynamically require "' + path + '". Please configure the dynamicRequireTargets or/and ignoreDynamicRequires option of @rollup/plugin-commonjs appropriately for this require call to work.');
}
var localforage$1 = { exports: {} };
/*!
localForage -- Offline Storage, Improved
Version 1.10.0
https://localforage.github.io/localForage
(c) 2013-2017 Mozilla, Apache License 2.0
*/
(function(module2, exports2) {
(function(f) {
{
module2.exports = f();
}
})(function() {
return function e(t2, n, r) {
function s(o2, u) {
if (!n[o2]) {
if (!t2[o2]) {
var a = typeof commonjsRequire == "function" && commonjsRequire;
if (!u && a)
return a(o2, true);
if (i)
return i(o2, true);
var f = new Error("Cannot find module '" + o2 + "'");
throw f.code = "MODULE_NOT_FOUND", f;
}
var l = n[o2] = { exports: {} };
t2[o2][0].call(l.exports, function(e2) {
var n2 = t2[o2][1][e2];
return s(n2 ? n2 : e2);
}, l, l.exports, e, t2, n, r);
}
return n[o2].exports;
}
var i = typeof commonjsRequire == "function" && commonjsRequire;
for (var o = 0; o < r.length; o++)
s(r[o]);
return s;
}({ 1: [function(_dereq_, module3, exports3) {
(function(global2) {
var Mutation = global2.MutationObserver || global2.WebKitMutationObserver;
var scheduleDrain;
{
if (Mutation) {
var called = 0;
var observer = new Mutation(nextTick2);
var element = global2.document.createTextNode("");
observer.observe(element, {
characterData: true
});
scheduleDrain = function() {
element.data = called = ++called % 2;
};
} else if (!global2.setImmediate && typeof global2.MessageChannel !== "undefined") {
var channel = new global2.MessageChannel();
channel.port1.onmessage = nextTick2;
scheduleDrain = function() {
channel.port2.postMessage(0);
};
} else if ("document" in global2 && "onreadystatechange" in global2.document.createElement("script")) {
scheduleDrain = function() {
var scriptEl = global2.document.createElement("script");
scriptEl.onreadystatechange = function() {
nextTick2();
scriptEl.onreadystatechange = null;
scriptEl.parentNode.removeChild(scriptEl);
scriptEl = null;
};
global2.document.documentElement.appendChild(scriptEl);
};
} else {
scheduleDrain = function() {
setTimeout(nextTick2, 0);
};
}
}
var draining;
var queue2 = [];
function nextTick2() {
draining = true;
var i, oldQueue;
var len = queue2.length;
while (len) {
oldQueue = queue2;
queue2 = [];
i = -1;
while (++i < len) {
oldQueue[i]();
}
len = queue2.length;
}
draining = false;
}
module3.exports = immediate;
function immediate(task) {
if (queue2.push(task) === 1 && !draining) {
scheduleDrain();
}
}
}).call(this, typeof commonjsGlobal !== "undefined" ? commonjsGlobal : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {});
}, {}], 2: [function(_dereq_, module3, exports3) {
var immediate = _dereq_(1);
function INTERNAL() {
}
var handlers2 = {};
var REJECTED = ["REJECTED"];
var FULFILLED = ["FULFILLED"];
var PENDING = ["PENDING"];
module3.exports = Promise2;
function Promise2(resolver) {
if (typeof resolver !== "function") {
throw new TypeError("resolver must be a function");
}
this.state = PENDING;
this.queue = [];
this.outcome = void 0;
if (resolver !== INTERNAL) {
safelyResolveThenable(this, resolver);
}
}
Promise2.prototype["catch"] = function(onRejected) {
return this.then(null, onRejected);
};
Promise2.prototype.then = function(onFulfilled, onRejected) {
if (typeof onFulfilled !== "function" && this.state === FULFILLED || typeof onRejected !== "function" && this.state === REJECTED) {
return this;
}
var promise = new this.constructor(INTERNAL);
if (this.state !== PENDING) {
var resolver = this.state === FULFILLED ? onFulfilled : onRejected;
unwrap(promise, resolver, this.outcome);
} else {
this.queue.push(new QueueItem(promise, onFulfilled, onRejected));
}
return promise;
};
function QueueItem(promise, onFulfilled, onRejected) {
this.promise = promise;
if (typeof onFulfilled === "function") {
this.onFulfilled = onFulfilled;
this.callFulfilled = this.otherCallFulfilled;
}
if (typeof onRejected === "function") {
this.onRejected = onRejected;
this.callRejected = this.otherCallRejected;
}
}
QueueItem.prototype.callFulfilled = function(value) {
handlers2.resolve(this.promise, value);
};
QueueItem.prototype.otherCallFulfilled = function(value) {
unwrap(this.promise, this.onFulfilled, value);
};
QueueItem.prototype.callRejected = function(value) {
handlers2.reject(this.promise, value);
};
QueueItem.prototype.otherCallRejected = function(value) {
unwrap(this.promise, this.onRejected, value);
};
function unwrap(promise, func, value) {
immediate(function() {
var returnValue;
try {
returnValue = func(value);
} catch (e) {
return handlers2.reject(promise, e);
}
if (returnValue === promise) {
handlers2.reject(promise, new TypeError("Cannot resolve promise with itself"));
} else {
handlers2.resolve(promise, returnValue);
}
});
}
handlers2.resolve = function(self2, value) {
var result = tryCatch(getThen, value);
if (result.status === "error") {
return handlers2.reject(self2, result.value);
}
var thenable = result.value;
if (thenable) {
safelyResolveThenable(self2, thenable);
} else {
self2.state = FULFILLED;
self2.outcome = value;
var i = -1;
var len = self2.queue.length;
while (++i < len) {
self2.queue[i].callFulfilled(value);
}
}
return self2;
};
handlers2.reject = function(self2, error) {
self2.state = REJECTED;
self2.outcome = error;
var i = -1;
var len = self2.queue.length;
while (++i < len) {
self2.queue[i].callRejected(error);
}
return self2;
};
function getThen(obj) {
var then = obj && obj.then;
if (obj && (typeof obj === "object" || typeof obj === "function") && typeof then === "function") {
return function appyThen() {
then.apply(obj, arguments);
};
}
}
function safelyResolveThenable(self2, thenable) {
var called = false;
function onError(value) {
if (called) {
return;
}
called = true;
handlers2.reject(self2, value);
}
function onSuccess(value) {
if (called) {
return;
}
called = true;
handlers2.resolve(self2, value);
}
function tryToUnwrap() {
thenable(onSuccess, onError);
}
var result = tryCatch(tryToUnwrap);
if (result.status === "error") {
onError(result.value);
}
}
function tryCatch(func, value) {
var out = {};
try {
out.value = func(value);
out.status = "success";
} catch (e) {
out.status = "error";
out.value = e;
}
return out;
}
Promise2.resolve = resolve2;
function resolve2(value) {
if (value instanceof this) {
return value;
}
return handlers2.resolve(new this(INTERNAL), value);
}
Promise2.reject = reject;
function reject(reason) {
var promise = new this(INTERNAL);
return handlers2.reject(promise, reason);
}
Promise2.all = all;
function all(iterable) {
var self2 = this;
if (Object.prototype.toString.call(iterable) !== "[object Array]") {
return this.reject(new TypeError("must be an array"));
}
var len = iterable.length;
var called = false;
if (!len) {
return this.resolve([]);
}
var values2 = new Array(len);
var resolved = 0;
var i = -1;
var promise = new this(INTERNAL);
while (++i < len) {
allResolver(iterable[i], i);
}
return promise;
function allResolver(value, i2) {
self2.resolve(value).then(resolveFromAll, function(error) {
if (!called) {
called = true;
handlers2.reject(promise, error);
}
});
function resolveFromAll(outValue) {
values2[i2] = outValue;
if (++resolved === len && !called) {
called = true;
handlers2.resolve(promise, values2);
}
}
}
}
Promise2.race = race;
function race(iterable) {
var self2 = this;
if (Object.prototype.toString.call(iterable) !== "[object Array]") {
return this.reject(new TypeError("must be an array"));
}
var len = iterable.length;
var called = false;
if (!len) {
return this.resolve([]);
}
var i = -1;
var promise = new this(INTERNAL);
while (++i < len) {
resolver(iterable[i]);
}
return promise;
function resolver(value) {
self2.resolve(value).then(function(response) {
if (!called) {
called = true;
handlers2.resolve(promise, response);
}
}, function(error) {
if (!called) {
called = true;
handlers2.reject(promise, error);
}
});
}
}
}, { "1": 1 }], 3: [function(_dereq_, module3, exports3) {
(function(global2) {
if (typeof global2.Promise !== "function") {
global2.Promise = _dereq_(2);
}
}).call(this, typeof commonjsGlobal !== "undefined" ? commonjsGlobal : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {});
}, { "2": 2 }], 4: [function(_dereq_, module3, exports3) {
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function(obj) {
return typeof obj;
} : function(obj) {
return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
};
function _classCallCheck(instance, Constructor) {
if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
}
}
function getIDB() {
try {
if (typeof indexedDB !== "undefined") {
return indexedDB;
}
if (typeof webkitIndexedDB !== "undefined") {
return webkitIndexedDB;
}
if (typeof mozIndexedDB !== "undefined") {
return mozIndexedDB;
}
if (typeof OIndexedDB !== "undefined") {
return OIndexedDB;
}
if (typeof msIndexedDB !== "undefined") {
return msIndexedDB;
}
} catch (e) {
return;
}
}
var idb = getIDB();
function isIndexedDBValid() {
try {
if (!idb || !idb.open) {
return false;
}
var isSafari = typeof openDatabase !== "undefined" && /(Safari|iPhone|iPad|iPod)/.test(navigator.userAgent) && !/Chrome/.test(navigator.userAgent) && !/BlackBerry/.test(navigator.platform);
var hasFetch = typeof fetch === "function" && fetch.toString().indexOf("[native code") !== -1;
return (!isSafari || hasFetch) && typeof indexedDB !== "undefined" && // some outdated implementations of IDB that appear on Samsung
// and HTC Android devices <4.4 are missing IDBKeyRange
// See: https://github.com/mozilla/localForage/issues/128
// See: https://github.com/mozilla/localForage/issues/272
typeof IDBKeyRange !== "undefined";
} catch (e) {
return false;
}
}
function createBlob(parts, properties) {
parts = parts || [];
properties = properties || {};
try {
return new Blob(parts, properties);
} catch (e) {
if (e.name !== "TypeError") {
throw e;
}
var Builder = typeof BlobBuilder !== "undefined" ? BlobBuilder : typeof MSBlobBuilder !== "undefined" ? MSBlobBuilder : typeof MozBlobBuilder !== "undefined" ? MozBlobBuilder : WebKitBlobBuilder;
var builder = new Builder();
for (var i = 0; i < parts.length; i += 1) {
builder.append(parts[i]);
}
return builder.getBlob(properties.type);
}
}
if (typeof Promise === "undefined") {
_dereq_(3);
}
var Promise$12 = Promise;
function executeCallback2(promise, callback) {
if (callback) {
promise.then(function(result) {
callback(null, result);
}, function(error) {
callback(error);
});
}
}
function executeTwoCallbacks(promise, callback, errorCallback) {
if (typeof callback === "function") {
promise.then(callback);
}
if (typeof errorCallback === "function") {
promise["catch"](errorCallback);
}
}
function normalizeKey2(key2) {
if (typeof key2 !== "string") {
console.warn(key2 + " used as a key, but it is not a string.");
key2 = String(key2);
}
return key2;
}
function getCallback() {
if (arguments.length && typeof arguments[arguments.length - 1] === "function") {
return arguments[arguments.length - 1];
}
}
var DETECT_BLOB_SUPPORT_STORE = "local-forage-detect-blob-support";
var supportsBlobs = void 0;
var dbContexts = {};
var toString2 = Object.prototype.toString;
var READ_ONLY = "readonly";
var READ_WRITE = "readwrite";
function _binStringToArrayBuffer(bin) {
var length2 = bin.length;
var buf = new ArrayBuffer(length2);
var arr = new Uint8Array(buf);
for (var i = 0; i < length2; i++) {
arr[i] = bin.charCodeAt(i);
}
return buf;
}
function _checkBlobSupportWithoutCaching(idb2) {
return new Promise$12(function(resolve2) {
var txn = idb2.transaction(DETECT_BLOB_SUPPORT_STORE, READ_WRITE);
var blob2 = createBlob([""]);
txn.objectStore(DETECT_BLOB_SUPPORT_STORE).put(blob2, "key");
txn.onabort = function(e) {
e.preventDefault();
e.stopPropagation();
resolve2(false);
};
txn.oncomplete = function() {
var matchedChrome = navigator.userAgent.match(/Chrome\/(\d+)/);
var matchedEdge = navigator.userAgent.match(/Edge\//);
resolve2(matchedEdge || !matchedChrome || parseInt(matchedChrome[1], 10) >= 43);
};
})["catch"](function() {
return false;
});
}
function _checkBlobSupport(idb2) {
if (typeof supportsBlobs === "boolean") {
return Promise$12.resolve(supportsBlobs);
}
return _checkBlobSupportWithoutCaching(idb2).then(function(value) {
supportsBlobs = value;
return supportsBlobs;
});
}
function _deferReadiness(dbInfo) {
var dbContext = dbContexts[dbInfo.name];
var deferredOperation = {};
deferredOperation.promise = new Promise$12(function(resolve2, reject) {
deferredOperation.resolve = resolve2;
deferredOperation.reject = reject;
});
dbContext.deferredOperations.push(deferredOperation);
if (!dbContext.dbReady) {
dbContext.dbReady = deferredOperation.promise;
} else {
dbContext.dbReady = dbContext.dbReady.then(function() {
return deferredOperation.promise;
});
}
}
function _advanceReadiness(dbInfo) {
var dbContext = dbContexts[dbInfo.name];
var deferredOperation = dbContext.deferredOperations.pop();
if (deferredOperation) {
deferredOperation.resolve();
return deferredOperation.promise;
}
}
function _rejectReadiness(dbInfo, err) {
var dbContext = dbContexts[dbInfo.name];
var deferredOperation = dbContext.deferredOperations.pop();
if (deferredOperation) {
deferredOperation.reject(err);
return deferredOperation.promise;
}
}
function _getConnection(dbInfo, upgradeNeeded) {
return new Promise$12(function(resolve2, reject) {
dbContexts[dbInfo.name] = dbContexts[dbInfo.name] || createDbContext();
if (dbInfo.db) {
if (upgradeNeeded) {
_deferReadiness(dbInfo);
dbInfo.db.close();
} else {
return resolve2(dbInfo.db);
}
}
var dbArgs = [dbInfo.name];
if (upgradeNeeded) {
dbArgs.push(dbInfo.version);
}
var openreq = idb.open.apply(idb, dbArgs);
if (upgradeNeeded) {
openreq.onupgradeneeded = function(e) {
var db = openreq.result;
try {
db.createObjectStore(dbInfo.storeName);
if (e.oldVersion <= 1) {
db.createObjectStore(DETECT_BLOB_SUPPORT_STORE);
}
} catch (ex) {
if (ex.name === "ConstraintError") {
console.warn('The database "' + dbInfo.name + '" has been upgraded from version ' + e.oldVersion + " to version " + e.newVersion + ', but the storage "' + dbInfo.storeName + '" already exists.');
} else {
throw ex;
}
}
};
}
openreq.onerror = function(e) {
e.preventDefault();
reject(openreq.error);
};
openreq.onsuccess = function() {
var db = openreq.result;
db.onversionchange = function(e) {
e.target.close();
};
resolve2(db);
_advanceReadiness(dbInfo);
};
});
}
function _getOriginalConnection(dbInfo) {
return _getConnection(dbInfo, false);
}
function _getUpgradedConnection(dbInfo) {
return _getConnection(dbInfo, true);
}
function _isUpgradeNeeded(dbInfo, defaultVersion) {
if (!dbInfo.db) {
return true;
}
var isNewStore = !dbInfo.db.objectStoreNames.contains(dbInfo.storeName);
var isDowngrade = dbInfo.version < dbInfo.db.version;
var isUpgrade = dbInfo.version > dbInfo.db.version;
if (isDowngrade) {
if (dbInfo.version !== defaultVersion) {
console.warn('The database "' + dbInfo.name + `" can't be downgraded from version ` + dbInfo.db.version + " to version " + dbInfo.version + ".");
}
dbInfo.version = dbInfo.db.version;
}
if (isUpgrade || isNewStore) {
if (isNewStore) {
var incVersion = dbInfo.db.version + 1;
if (incVersion > dbInfo.version) {
dbInfo.version = incVersion;
}
}
return true;
}
return false;
}
function _encodeBlob(blob2) {
return new Promise$12(function(resolve2, reject) {
var reader = new FileReader();
reader.onerror = reject;
reader.onloadend = function(e) {
var base64 = btoa(e.target.result || "");
resolve2({
__local_forage_encoded_blob: true,
data: base64,
type: blob2.type
});
};
reader.readAsBinaryString(blob2);
});
}
function _decodeBlob(encodedBlob) {
var arrayBuff = _binStringToArrayBuffer(atob(encodedBlob.data));
return createBlob([arrayBuff], { type: encodedBlob.type });
}
function _isEncodedBlob(value) {
return value && value.__local_forage_encoded_blob;
}
function _fullyReady(callback) {
var self2 = this;
var promise = self2._initReady().then(function() {
var dbContext = dbContexts[self2._dbInfo.name];
if (dbContext && dbContext.dbReady) {
return dbContext.dbReady;
}
});
executeTwoCallbacks(promise, callback, callback);
return promise;
}
function _tryReconnect(dbInfo) {
_deferReadiness(dbInfo);
var dbContext = dbContexts[dbInfo.name];
var forages = dbContext.forages;
for (var i = 0; i < forages.length; i++) {
var forage = forages[i];
if (forage._dbInfo.db) {
forage._dbInfo.db.close();
forage._dbInfo.db = null;
}
}
dbInfo.db = null;
return _getOriginalConnection(dbInfo).then(function(db) {
dbInfo.db = db;
if (_isUpgradeNeeded(dbInfo)) {
return _getUpgradedConnection(dbInfo);
}
return db;
}).then(function(db) {
dbInfo.db = dbContext.db = db;
for (var i2 = 0; i2 < forages.length; i2++) {
forages[i2]._dbInfo.db = db;
}
})["catch"](function(err) {
_rejectReadiness(dbInfo, err);
throw err;
});
}
function createTransaction(dbInfo, mode, callback, retries) {
if (retries === void 0) {
retries = 1;
}
try {
var tx = dbInfo.db.transaction(dbInfo.storeName, mode);
callback(null, tx);
} catch (err) {
if (retries > 0 && (!dbInfo.db || err.name === "InvalidStateError" || err.name === "NotFoundError")) {
return Promise$12.resolve().then(function() {
if (!dbInfo.db || err.name === "NotFoundError" && !dbInfo.db.objectStoreNames.contains(dbInfo.storeName) && dbInfo.version <= dbInfo.db.version) {
if (dbInfo.db) {
dbInfo.version = dbInfo.db.version + 1;
}
return _getUpgradedConnection(dbInfo);
}
}).then(function() {
return _tryReconnect(dbInfo).then(function() {
createTransaction(dbInfo, mode, callback, retries - 1);
});
})["catch"](callback);
}
callback(err);
}
}
function createDbContext() {
return {
// Running localForages sharing a database.
forages: [],
// Shared database.
db: null,
// Database readiness (promise).
dbReady: null,
// Deferred operations on the database.
deferredOperations: []
};
}
function _initStorage(options) {
var self2 = this;
var dbInfo = {
db: null
};
if (options) {
for (var i in options) {
dbInfo[i] = options[i];
}
}
var dbContext = dbContexts[dbInfo.name];
if (!dbContext) {
dbContext = createDbContext();
dbContexts[dbInfo.name] = dbContext;
}
dbContext.forages.push(self2);
if (!self2._initReady) {
self2._initReady = self2.ready;
self2.ready = _fullyReady;
}
var initPromises = [];
function ignoreErrors() {
return Promise$12.resolve();
}
for (var j = 0; j < dbContext.forages.length; j++) {
var forage = dbContext.forages[j];
if (forage !== self2) {
initPromises.push(forage._initReady()["catch"](ignoreErrors));
}
}
var forages = dbContext.forages.slice(0);
return Promise$12.all(initPromises).then(function() {
dbInfo.db = dbContext.db;
return _getOriginalConnection(dbInfo);
}).then(function(db) {
dbInfo.db = db;
if (_isUpgradeNeeded(dbInfo, self2._defaultConfig.version)) {
return _getUpgradedConnection(dbInfo);
}
return db;
}).then(function(db) {
dbInfo.db = dbContext.db = db;
self2._dbInfo = dbInfo;
for (var k = 0; k < forages.length; k++) {
var forage2 = forages[k];
if (forage2 !== self2) {
forage2._dbInfo.db = dbInfo.db;
forage2._dbInfo.version = dbInfo.version;
}
}
});
}
function getItem(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_ONLY, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store.get(key2);
req.onsuccess = function() {
var value = req.result;
if (value === void 0) {
value = null;
}
if (_isEncodedBlob(value)) {
value = _decodeBlob(value);
}
resolve2(value);
};
req.onerror = function() {
reject(req.error);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function iterate(iterator, callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_ONLY, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store.openCursor();
var iterationNumber = 1;
req.onsuccess = function() {
var cursor = req.result;
if (cursor) {
var value = cursor.value;
if (_isEncodedBlob(value)) {
value = _decodeBlob(value);
}
var result = iterator(value, cursor.key, iterationNumber++);
if (result !== void 0) {
resolve2(result);
} else {
cursor["continue"]();
}
} else {
resolve2();
}
};
req.onerror = function() {
reject(req.error);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function setItem(key2, value, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
var dbInfo;
self2.ready().then(function() {
dbInfo = self2._dbInfo;
if (toString2.call(value) === "[object Blob]") {
return _checkBlobSupport(dbInfo.db).then(function(blobSupport) {
if (blobSupport) {
return value;
}
return _encodeBlob(value);
});
}
return value;
}).then(function(value2) {
createTransaction(self2._dbInfo, READ_WRITE, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
if (value2 === null) {
value2 = void 0;
}
var req = store.put(value2, key2);
transaction.oncomplete = function() {
if (value2 === void 0) {
value2 = null;
}
resolve2(value2);
};
transaction.onabort = transaction.onerror = function() {
var err2 = req.error ? req.error : req.transaction.error;
reject(err2);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function removeItem(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_WRITE, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store["delete"](key2);
transaction.oncomplete = function() {
resolve2();
};
transaction.onerror = function() {
reject(req.error);
};
transaction.onabort = function() {
var err2 = req.error ? req.error : req.transaction.error;
reject(err2);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function clear2(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_WRITE, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store.clear();
transaction.oncomplete = function() {
resolve2();
};
transaction.onabort = transaction.onerror = function() {
var err2 = req.error ? req.error : req.transaction.error;
reject(err2);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function length(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_ONLY, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store.count();
req.onsuccess = function() {
resolve2(req.result);
};
req.onerror = function() {
reject(req.error);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function key(n, callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
if (n < 0) {
resolve2(null);
return;
}
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_ONLY, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var advanced = false;
var req = store.openKeyCursor();
req.onsuccess = function() {
var cursor = req.result;
if (!cursor) {
resolve2(null);
return;
}
if (n === 0) {
resolve2(cursor.key);
} else {
if (!advanced) {
advanced = true;
cursor.advance(n);
} else {
resolve2(cursor.key);
}
}
};
req.onerror = function() {
reject(req.error);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function keys2(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
createTransaction(self2._dbInfo, READ_ONLY, function(err, transaction) {
if (err) {
return reject(err);
}
try {
var store = transaction.objectStore(self2._dbInfo.storeName);
var req = store.openKeyCursor();
var keys3 = [];
req.onsuccess = function() {
var cursor = req.result;
if (!cursor) {
resolve2(keys3);
return;
}
keys3.push(cursor.key);
cursor["continue"]();
};
req.onerror = function() {
reject(req.error);
};
} catch (e) {
reject(e);
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function dropInstance(options, callback) {
callback = getCallback.apply(this, arguments);
var currentConfig = this.config();
options = typeof options !== "function" && options || {};
if (!options.name) {
options.name = options.name || currentConfig.name;
options.storeName = options.storeName || currentConfig.storeName;
}
var self2 = this;
var promise;
if (!options.name) {
promise = Promise$12.reject("Invalid arguments");
} else {
var isCurrentDb = options.name === currentConfig.name && self2._dbInfo.db;
var dbPromise = isCurrentDb ? Promise$12.resolve(self2._dbInfo.db) : _getOriginalConnection(options).then(function(db) {
var dbContext = dbContexts[options.name];
var forages = dbContext.forages;
dbContext.db = db;
for (var i = 0; i < forages.length; i++) {
forages[i]._dbInfo.db = db;
}
return db;
});
if (!options.storeName) {
promise = dbPromise.then(function(db) {
_deferReadiness(options);
var dbContext = dbContexts[options.name];
var forages = dbContext.forages;
db.close();
for (var i = 0; i < forages.length; i++) {
var forage = forages[i];
forage._dbInfo.db = null;
}
var dropDBPromise = new Promise$12(function(resolve2, reject) {
var req = idb.deleteDatabase(options.name);
req.onerror = function() {
var db2 = req.result;
if (db2) {
db2.close();
}
reject(req.error);
};
req.onblocked = function() {
console.warn('dropInstance blocked for database "' + options.name + '" until all open connections are closed');
};
req.onsuccess = function() {
var db2 = req.result;
if (db2) {
db2.close();
}
resolve2(db2);
};
});
return dropDBPromise.then(function(db2) {
dbContext.db = db2;
for (var i2 = 0; i2 < forages.length; i2++) {
var _forage = forages[i2];
_advanceReadiness(_forage._dbInfo);
}
})["catch"](function(err) {
(_rejectReadiness(options, err) || Promise$12.resolve())["catch"](function() {
});
throw err;
});
});
} else {
promise = dbPromise.then(function(db) {
if (!db.objectStoreNames.contains(options.storeName)) {
return;
}
var newVersion = db.version + 1;
_deferReadiness(options);
var dbContext = dbContexts[options.name];
var forages = dbContext.forages;
db.close();
for (var i = 0; i < forages.length; i++) {
var forage = forages[i];
forage._dbInfo.db = null;
forage._dbInfo.version = newVersion;
}
var dropObjectPromise = new Promise$12(function(resolve2, reject) {
var req = idb.open(options.name, newVersion);
req.onerror = function(err) {
var db2 = req.result;
db2.close();
reject(err);
};
req.onupgradeneeded = function() {
var db2 = req.result;
db2.deleteObjectStore(options.storeName);
};
req.onsuccess = function() {
var db2 = req.result;
db2.close();
resolve2(db2);
};
});
return dropObjectPromise.then(function(db2) {
dbContext.db = db2;
for (var j = 0; j < forages.length; j++) {
var _forage2 = forages[j];
_forage2._dbInfo.db = db2;
_advanceReadiness(_forage2._dbInfo);
}
})["catch"](function(err) {
(_rejectReadiness(options, err) || Promise$12.resolve())["catch"](function() {
});
throw err;
});
});
}
}
executeCallback2(promise, callback);
return promise;
}
var asyncStorage = {
_driver: "asyncStorage",
_initStorage,
_support: isIndexedDBValid(),
iterate,
getItem,
setItem,
removeItem,
clear: clear2,
length,
key,
keys: keys2,
dropInstance
};
function isWebSQLValid() {
return typeof openDatabase === "function";
}
var BASE_CHARS = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
var BLOB_TYPE_PREFIX = "~~local_forage_type~";
var BLOB_TYPE_PREFIX_REGEX = /^~~local_forage_type~([^~]+)~/;
var SERIALIZED_MARKER = "__lfsc__:";
var SERIALIZED_MARKER_LENGTH = SERIALIZED_MARKER.length;
var TYPE_ARRAYBUFFER = "arbf";
var TYPE_BLOB = "blob";
var TYPE_INT8ARRAY = "si08";
var TYPE_UINT8ARRAY = "ui08";
var TYPE_UINT8CLAMPEDARRAY = "uic8";
var TYPE_INT16ARRAY = "si16";
var TYPE_INT32ARRAY = "si32";
var TYPE_UINT16ARRAY = "ur16";
var TYPE_UINT32ARRAY = "ui32";
var TYPE_FLOAT32ARRAY = "fl32";
var TYPE_FLOAT64ARRAY = "fl64";
var TYPE_SERIALIZED_MARKER_LENGTH = SERIALIZED_MARKER_LENGTH + TYPE_ARRAYBUFFER.length;
var toString$1 = Object.prototype.toString;
function stringToBuffer(serializedString) {
var bufferLength = serializedString.length * 0.75;
var len = serializedString.length;
var i;
var p2 = 0;
var encoded1, encoded2, encoded3, encoded4;
if (serializedString[serializedString.length - 1] === "=") {
bufferLength--;
if (serializedString[serializedString.length - 2] === "=") {
bufferLength--;
}
}
var buffer = new ArrayBuffer(bufferLength);
var bytes = new Uint8Array(buffer);
for (i = 0; i < len; i += 4) {
encoded1 = BASE_CHARS.indexOf(serializedString[i]);
encoded2 = BASE_CHARS.indexOf(serializedString[i + 1]);
encoded3 = BASE_CHARS.indexOf(serializedString[i + 2]);
encoded4 = BASE_CHARS.indexOf(serializedString[i + 3]);
bytes[p2++] = encoded1 << 2 | encoded2 >> 4;
bytes[p2++] = (encoded2 & 15) << 4 | encoded3 >> 2;
bytes[p2++] = (encoded3 & 3) << 6 | encoded4 & 63;
}
return buffer;
}
function bufferToString(buffer) {
var bytes = new Uint8Array(buffer);
var base64String = "";
var i;
for (i = 0; i < bytes.length; i += 3) {
base64String += BASE_CHARS[bytes[i] >> 2];
base64String += BASE_CHARS[(bytes[i] & 3) << 4 | bytes[i + 1] >> 4];
base64String += BASE_CHARS[(bytes[i + 1] & 15) << 2 | bytes[i + 2] >> 6];
base64String += BASE_CHARS[bytes[i + 2] & 63];
}
if (bytes.length % 3 === 2) {
base64String = base64String.substring(0, base64String.length - 1) + "=";
} else if (bytes.length % 3 === 1) {
base64String = base64String.substring(0, base64String.length - 2) + "==";
}
return base64String;
}
function serialize(value, callback) {
var valueType = "";
if (value) {
valueType = toString$1.call(value);
}
if (value && (valueType === "[object ArrayBuffer]" || value.buffer && toString$1.call(value.buffer) === "[object ArrayBuffer]")) {
var buffer;
var marker = SERIALIZED_MARKER;
if (value instanceof ArrayBuffer) {
buffer = value;
marker += TYPE_ARRAYBUFFER;
} else {
buffer = value.buffer;
if (valueType === "[object Int8Array]") {
marker += TYPE_INT8ARRAY;
} else if (valueType === "[object Uint8Array]") {
marker += TYPE_UINT8ARRAY;
} else if (valueType === "[object Uint8ClampedArray]") {
marker += TYPE_UINT8CLAMPEDARRAY;
} else if (valueType === "[object Int16Array]") {
marker += TYPE_INT16ARRAY;
} else if (valueType === "[object Uint16Array]") {
marker += TYPE_UINT16ARRAY;
} else if (valueType === "[object Int32Array]") {
marker += TYPE_INT32ARRAY;
} else if (valueType === "[object Uint32Array]") {
marker += TYPE_UINT32ARRAY;
} else if (valueType === "[object Float32Array]") {
marker += TYPE_FLOAT32ARRAY;
} else if (valueType === "[object Float64Array]") {
marker += TYPE_FLOAT64ARRAY;
} else {
callback(new Error("Failed to get type for BinaryArray"));
}
}
callback(marker + bufferToString(buffer));
} else if (valueType === "[object Blob]") {
var fileReader = new FileReader();
fileReader.onload = function() {
var str = BLOB_TYPE_PREFIX + value.type + "~" + bufferToString(this.result);
callback(SERIALIZED_MARKER + TYPE_BLOB + str);
};
fileReader.readAsArrayBuffer(value);
} else {
try {
callback(JSON.stringify(value));
} catch (e) {
console.error("Couldn't convert value into a JSON string: ", value);
callback(null, e);
}
}
}
function deserialize(value) {
if (value.substring(0, SERIALIZED_MARKER_LENGTH) !== SERIALIZED_MARKER) {
return JSON.parse(value);
}
var serializedString = value.substring(TYPE_SERIALIZED_MARKER_LENGTH);
var type2 = value.substring(SERIALIZED_MARKER_LENGTH, TYPE_SERIALIZED_MARKER_LENGTH);
var blobType;
if (type2 === TYPE_BLOB && BLOB_TYPE_PREFIX_REGEX.test(serializedString)) {
var matcher = serializedString.match(BLOB_TYPE_PREFIX_REGEX);
blobType = matcher[1];
serializedString = serializedString.substring(matcher[0].length);
}
var buffer = stringToBuffer(serializedString);
switch (type2) {
case TYPE_ARRAYBUFFER:
return buffer;
case TYPE_BLOB:
return createBlob([buffer], { type: blobType });
case TYPE_INT8ARRAY:
return new Int8Array(buffer);
case TYPE_UINT8ARRAY:
return new Uint8Array(buffer);
case TYPE_UINT8CLAMPEDARRAY:
return new Uint8ClampedArray(buffer);
case TYPE_INT16ARRAY:
return new Int16Array(buffer);
case TYPE_UINT16ARRAY:
return new Uint16Array(buffer);
case TYPE_INT32ARRAY:
return new Int32Array(buffer);
case TYPE_UINT32ARRAY:
return new Uint32Array(buffer);
case TYPE_FLOAT32ARRAY:
return new Float32Array(buffer);
case TYPE_FLOAT64ARRAY:
return new Float64Array(buffer);
default:
throw new Error("Unkown type: " + type2);
}
}
var localforageSerializer = {
serialize,
deserialize,
stringToBuffer,
bufferToString
};
function createDbTable(t2, dbInfo, callback, errorCallback) {
t2.executeSql("CREATE TABLE IF NOT EXISTS " + dbInfo.storeName + " (id INTEGER PRIMARY KEY, key unique, value)", [], callback, errorCallback);
}
function _initStorage$1(options) {
var self2 = this;
var dbInfo = {
db: null
};
if (options) {
for (var i in options) {
dbInfo[i] = typeof options[i] !== "string" ? options[i].toString() : options[i];
}
}
var dbInfoPromise = new Promise$12(function(resolve2, reject) {
try {
dbInfo.db = openDatabase(dbInfo.name, String(dbInfo.version), dbInfo.description, dbInfo.size);
} catch (e) {
return reject(e);
}
dbInfo.db.transaction(function(t2) {
createDbTable(t2, dbInfo, function() {
self2._dbInfo = dbInfo;
resolve2();
}, function(t3, error) {
reject(error);
});
}, reject);
});
dbInfo.serializer = localforageSerializer;
return dbInfoPromise;
}
function tryExecuteSql(t2, dbInfo, sqlStatement, args, callback, errorCallback) {
t2.executeSql(sqlStatement, args, callback, function(t3, error) {
if (error.code === error.SYNTAX_ERR) {
t3.executeSql("SELECT name FROM sqlite_master WHERE type='table' AND name = ?", [dbInfo.storeName], function(t4, results) {
if (!results.rows.length) {
createDbTable(t4, dbInfo, function() {
t4.executeSql(sqlStatement, args, callback, errorCallback);
}, errorCallback);
} else {
errorCallback(t4, error);
}
}, errorCallback);
} else {
errorCallback(t3, error);
}
}, errorCallback);
}
function getItem$1(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "SELECT * FROM " + dbInfo.storeName + " WHERE key = ? LIMIT 1", [key2], function(t3, results) {
var result = results.rows.length ? results.rows.item(0).value : null;
if (result) {
result = dbInfo.serializer.deserialize(result);
}
resolve2(result);
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function iterate$1(iterator, callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "SELECT * FROM " + dbInfo.storeName, [], function(t3, results) {
var rows = results.rows;
var length2 = rows.length;
for (var i = 0; i < length2; i++) {
var item = rows.item(i);
var result = item.value;
if (result) {
result = dbInfo.serializer.deserialize(result);
}
result = iterator(result, item.key, i + 1);
if (result !== void 0) {
resolve2(result);
return;
}
}
resolve2();
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function _setItem(key2, value, callback, retriesLeft) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
if (value === void 0) {
value = null;
}
var originalValue = value;
var dbInfo = self2._dbInfo;
dbInfo.serializer.serialize(value, function(value2, error) {
if (error) {
reject(error);
} else {
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "INSERT OR REPLACE INTO " + dbInfo.storeName + " (key, value) VALUES (?, ?)", [key2, value2], function() {
resolve2(originalValue);
}, function(t3, error2) {
reject(error2);
});
}, function(sqlError) {
if (sqlError.code === sqlError.QUOTA_ERR) {
if (retriesLeft > 0) {
resolve2(_setItem.apply(self2, [key2, originalValue, callback, retriesLeft - 1]));
return;
}
reject(sqlError);
}
});
}
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function setItem$1(key2, value, callback) {
return _setItem.apply(this, [key2, value, callback, 1]);
}
function removeItem$1(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "DELETE FROM " + dbInfo.storeName + " WHERE key = ?", [key2], function() {
resolve2();
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function clear$1(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "DELETE FROM " + dbInfo.storeName, [], function() {
resolve2();
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function length$1(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "SELECT COUNT(key) as c FROM " + dbInfo.storeName, [], function(t3, results) {
var result = results.rows.item(0).c;
resolve2(result);
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function key$1(n, callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "SELECT key FROM " + dbInfo.storeName + " WHERE id = ? LIMIT 1", [n + 1], function(t3, results) {
var result = results.rows.length ? results.rows.item(0).key : null;
resolve2(result);
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function keys$1(callback) {
var self2 = this;
var promise = new Promise$12(function(resolve2, reject) {
self2.ready().then(function() {
var dbInfo = self2._dbInfo;
dbInfo.db.transaction(function(t2) {
tryExecuteSql(t2, dbInfo, "SELECT key FROM " + dbInfo.storeName, [], function(t3, results) {
var keys3 = [];
for (var i = 0; i < results.rows.length; i++) {
keys3.push(results.rows.item(i).key);
}
resolve2(keys3);
}, function(t3, error) {
reject(error);
});
});
})["catch"](reject);
});
executeCallback2(promise, callback);
return promise;
}
function getAllStoreNames(db) {
return new Promise$12(function(resolve2, reject) {
db.transaction(function(t2) {
t2.executeSql("SELECT name FROM sqlite_master WHERE type='table' AND name <> '__WebKitDatabaseInfoTable__'", [], function(t3, results) {
var storeNames = [];
for (var i = 0; i < results.rows.length; i++) {
storeNames.push(results.rows.item(i).name);
}
resolve2({
db,
storeNames
});
}, function(t3, error) {
reject(error);
});
}, function(sqlError) {
reject(sqlError);
});
});
}
function dropInstance$1(options, callback) {
callback = getCallback.apply(this, arguments);
var currentConfig = this.config();
options = typeof options !== "function" && options || {};
if (!options.name) {
options.name = options.name || currentConfig.name;
options.storeName = options.storeName || currentConfig.storeName;
}
var self2 = this;
var promise;
if (!options.name) {
promise = Promise$12.reject("Invalid arguments");
} else {
promise = new Promise$12(function(resolve2) {
var db;
if (options.name === currentConfig.name) {
db = self2._dbInfo.db;
} else {
db = openDatabase(options.name, "", "", 0);
}
if (!options.storeName) {
resolve2(getAllStoreNames(db));
} else {
resolve2({
db,
storeNames: [options.storeName]
});
}
}).then(function(operationInfo) {
return new Promise$12(function(resolve2, reject) {
operationInfo.db.transaction(function(t2) {
function dropTable(storeName) {
return new Promise$12(function(resolve3, reject2) {
t2.executeSql("DROP TABLE IF EXISTS " + storeName, [], function() {
resolve3();
}, function(t3, error) {
reject2(error);
});
});
}
var operations = [];
for (var i = 0, len = operationInfo.storeNames.length; i < len; i++) {
operations.push(dropTable(operationInfo.storeNames[i]));
}
Promise$12.all(operations).then(function() {
resolve2();
})["catch"](function(e) {
reject(e);
});
}, function(sqlError) {
reject(sqlError);
});
});
});
}
executeCallback2(promise, callback);
return promise;
}
var webSQLStorage = {
_driver: "webSQLStorage",
_initStorage: _initStorage$1,
_support: isWebSQLValid(),
iterate: iterate$1,
getItem: getItem$1,
setItem: setItem$1,
removeItem: removeItem$1,
clear: clear$1,
length: length$1,
key: key$1,
keys: keys$1,
dropInstance: dropInstance$1
};
function isLocalStorageValid() {
try {
return typeof localStorage !== "undefined" && "setItem" in localStorage && // in IE8 typeof localStorage.setItem === 'object'
!!localStorage.setItem;
} catch (e) {
return false;
}
}
function _getKeyPrefix(options, defaultConfig) {
var keyPrefix = options.name + "/";
if (options.storeName !== defaultConfig.storeName) {
keyPrefix += options.storeName + "/";
}
return keyPrefix;
}
function checkIfLocalStorageThrows() {
var localStorageTestKey = "_localforage_support_test";
try {
localStorage.setItem(localStorageTestKey, true);
localStorage.removeItem(localStorageTestKey);
return false;
} catch (e) {
return true;
}
}
function _isLocalStorageUsable() {
return !checkIfLocalStorageThrows() || localStorage.length > 0;
}
function _initStorage$2(options) {
var self2 = this;
var dbInfo = {};
if (options) {
for (var i in options) {
dbInfo[i] = options[i];
}
}
dbInfo.keyPrefix = _getKeyPrefix(options, self2._defaultConfig);
if (!_isLocalStorageUsable()) {
return Promise$12.reject();
}
self2._dbInfo = dbInfo;
dbInfo.serializer = localforageSerializer;
return Promise$12.resolve();
}
function clear$2(callback) {
var self2 = this;
var promise = self2.ready().then(function() {
var keyPrefix = self2._dbInfo.keyPrefix;
for (var i = localStorage.length - 1; i >= 0; i--) {
var key2 = localStorage.key(i);
if (key2.indexOf(keyPrefix) === 0) {
localStorage.removeItem(key2);
}
}
});
executeCallback2(promise, callback);
return promise;
}
function getItem$2(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = self2.ready().then(function() {
var dbInfo = self2._dbInfo;
var result = localStorage.getItem(dbInfo.keyPrefix + key2);
if (result) {
result = dbInfo.serializer.deserialize(result);
}
return result;
});
executeCallback2(promise, callback);
return promise;
}
function iterate$2(iterator, callback) {
var self2 = this;
var promise = self2.ready().then(function() {
var dbInfo = self2._dbInfo;
var keyPrefix = dbInfo.keyPrefix;
var keyPrefixLength = keyPrefix.length;
var length2 = localStorage.length;
var iterationNumber = 1;
for (var i = 0; i < length2; i++) {
var key2 = localStorage.key(i);
if (key2.indexOf(keyPrefix) !== 0) {
continue;
}
var value = localStorage.getItem(key2);
if (value) {
value = dbInfo.serializer.deserialize(value);
}
value = iterator(value, key2.substring(keyPrefixLength), iterationNumber++);
if (value !== void 0) {
return value;
}
}
});
executeCallback2(promise, callback);
return promise;
}
function key$2(n, callback) {
var self2 = this;
var promise = self2.ready().then(function() {
var dbInfo = self2._dbInfo;
var result;
try {
result = localStorage.key(n);
} catch (error) {
result = null;
}
if (result) {
result = result.substring(dbInfo.keyPrefix.length);
}
return result;
});
executeCallback2(promise, callback);
return promise;
}
function keys$2(callback) {
var self2 = this;
var promise = self2.ready().then(function() {
var dbInfo = self2._dbInfo;
var length2 = localStorage.length;
var keys3 = [];
for (var i = 0; i < length2; i++) {
var itemKey = localStorage.key(i);
if (itemKey.indexOf(dbInfo.keyPrefix) === 0) {
keys3.push(itemKey.substring(dbInfo.keyPrefix.length));
}
}
return keys3;
});
executeCallback2(promise, callback);
return promise;
}
function length$2(callback) {
var self2 = this;
var promise = self2.keys().then(function(keys3) {
return keys3.length;
});
executeCallback2(promise, callback);
return promise;
}
function removeItem$2(key2, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = self2.ready().then(function() {
var dbInfo = self2._dbInfo;
localStorage.removeItem(dbInfo.keyPrefix + key2);
});
executeCallback2(promise, callback);
return promise;
}
function setItem$2(key2, value, callback) {
var self2 = this;
key2 = normalizeKey2(key2);
var promise = self2.ready().then(function() {
if (value === void 0) {
value = null;
}
var originalValue = value;
return new Promise$12(function(resolve2, reject) {
var dbInfo = self2._dbInfo;
dbInfo.serializer.serialize(value, function(value2, error) {
if (error) {
reject(error);
} else {
try {
localStorage.setItem(dbInfo.keyPrefix + key2, value2);
resolve2(originalValue);
} catch (e) {
if (e.name === "QuotaExceededError" || e.name === "NS_ERROR_DOM_QUOTA_REACHED") {
reject(e);
}
reject(e);
}
}
});
});
});
executeCallback2(promise, callback);
return promise;
}
function dropInstance$2(options, callback) {
callback = getCallback.apply(this, arguments);
options = typeof options !== "function" && options || {};
if (!options.name) {
var currentConfig = this.config();
options.name = options.name || currentConfig.name;
options.storeName = options.storeName || currentConfig.storeName;
}
var self2 = this;
var promise;
if (!options.name) {
promise = Promise$12.reject("Invalid arguments");
} else {
promise = new Promise$12(function(resolve2) {
if (!options.storeName) {
resolve2(options.name + "/");
} else {
resolve2(_getKeyPrefix(options, self2._defaultConfig));
}
}).then(function(keyPrefix) {
for (var i = localStorage.length - 1; i >= 0; i--) {
var key2 = localStorage.key(i);
if (key2.indexOf(keyPrefix) === 0) {
localStorage.removeItem(key2);
}
}
});
}
executeCallback2(promise, callback);
return promise;
}
var localStorageWrapper = {
_driver: "localStorageWrapper",
_initStorage: _initStorage$2,
_support: isLocalStorageValid(),
iterate: iterate$2,
getItem: getItem$2,
setItem: setItem$2,
removeItem: removeItem$2,
clear: clear$2,
length: length$2,
key: key$2,
keys: keys$2,
dropInstance: dropInstance$2
};
var sameValue = function sameValue2(x, y) {
return x === y || typeof x === "number" && typeof y === "number" && isNaN(x) && isNaN(y);
};
var includes = function includes2(array2, searchElement) {
var len = array2.length;
var i = 0;
while (i < len) {
if (sameValue(array2[i], searchElement)) {
return true;
}
i++;
}
return false;
};
var isArray2 = Array.isArray || function(arg) {
return Object.prototype.toString.call(arg) === "[object Array]";
};
var DefinedDrivers = {};
var DriverSupport = {};
var DefaultDrivers = {
INDEXEDDB: asyncStorage,
WEBSQL: webSQLStorage,
LOCALSTORAGE: localStorageWrapper
};
var DefaultDriverOrder = [DefaultDrivers.INDEXEDDB._driver, DefaultDrivers.WEBSQL._driver, DefaultDrivers.LOCALSTORAGE._driver];
var OptionalDriverMethods = ["dropInstance"];
var LibraryMethods = ["clear", "getItem", "iterate", "key", "keys", "length", "removeItem", "setItem"].concat(OptionalDriverMethods);
var DefaultConfig = {
description: "",
driver: DefaultDriverOrder.slice(),
name: "localforage",
// Default DB size is _JUST UNDER_ 5MB, as it's the highest size
// we can use without a prompt.
size: 4980736,
storeName: "keyvaluepairs",
version: 1
};
function callWhenReady(localForageInstance, libraryMethod) {
localForageInstance[libraryMethod] = function() {
var _args = arguments;
return localForageInstance.ready().then(function() {
return localForageInstance[libraryMethod].apply(localForageInstance, _args);
});
};
}
function extend2() {
for (var i = 1; i < arguments.length; i++) {
var arg = arguments[i];
if (arg) {
for (var _key in arg) {
if (arg.hasOwnProperty(_key)) {
if (isArray2(arg[_key])) {
arguments[0][_key] = arg[_key].slice();
} else {
arguments[0][_key] = arg[_key];
}
}
}
}
}
return arguments[0];
}
var LocalForage = function() {
function LocalForage2(options) {
_classCallCheck(this, LocalForage2);
for (var driverTypeKey in DefaultDrivers) {
if (DefaultDrivers.hasOwnProperty(driverTypeKey)) {
var driver = DefaultDrivers[driverTypeKey];
var driverName = driver._driver;
this[driverTypeKey] = driverName;
if (!DefinedDrivers[driverName]) {
this.defineDriver(driver);
}
}
}
this._defaultConfig = extend2({}, DefaultConfig);
this._config = extend2({}, this._defaultConfig, options);
this._driverSet = null;
this._initDriver = null;
this._ready = false;
this._dbInfo = null;
this._wrapLibraryMethodsWithReady();
this.setDriver(this._config.driver)["catch"](function() {
});
}
LocalForage2.prototype.config = function config(options) {
if ((typeof options === "undefined" ? "undefined" : _typeof(options)) === "object") {
if (this._ready) {
return new Error("Can't call config() after localforage has been used.");
}
for (var i in options) {
if (i === "storeName") {
options[i] = options[i].replace(/\W/g, "_");
}
if (i === "version" && typeof options[i] !== "number") {
return new Error("Database version must be a number.");
}
this._config[i] = options[i];
}
if ("driver" in options && options.driver) {
return this.setDriver(this._config.driver);
}
return true;
} else if (typeof options === "string") {
return this._config[options];
} else {
return this._config;
}
};
LocalForage2.prototype.defineDriver = function defineDriver(driverObject, callback, errorCallback) {
var promise = new Promise$12(function(resolve2, reject) {
try {
var driverName = driverObject._driver;
var complianceError = new Error("Custom driver not compliant; see https://mozilla.github.io/localForage/#definedriver");
if (!driverObject._driver) {
reject(complianceError);
return;
}
var driverMethods = LibraryMethods.concat("_initStorage");
for (var i = 0, len = driverMethods.length; i < len; i++) {
var driverMethodName = driverMethods[i];
var isRequired = !includes(OptionalDriverMethods, driverMethodName);
if ((isRequired || driverObject[driverMethodName]) && typeof driverObject[driverMethodName] !== "function") {
reject(complianceError);
return;
}
}
var configureMissingMethods = function configureMissingMethods2() {
var methodNotImplementedFactory = function methodNotImplementedFactory2(methodName) {
return function() {
var error = new Error("Method " + methodName + " is not implemented by the current driver");
var promise2 = Promise$12.reject(error);
executeCallback2(promise2, arguments[arguments.length - 1]);
return promise2;
};
};
for (var _i = 0, _len = OptionalDriverMethods.length; _i < _len; _i++) {
var optionalDriverMethod = OptionalDriverMethods[_i];
if (!driverObject[optionalDriverMethod]) {
driverObject[optionalDriverMethod] = methodNotImplementedFactory(optionalDriverMethod);
}
}
};
configureMissingMethods();
var setDriverSupport = function setDriverSupport2(support) {
if (DefinedDrivers[driverName]) {
console.info("Redefining LocalForage driver: " + driverName);
}
DefinedDrivers[driverName] = driverObject;
DriverSupport[driverName] = support;
resolve2();
};
if ("_support" in driverObject) {
if (driverObject._support && typeof driverObject._support === "function") {
driverObject._support().then(setDriverSupport, reject);
} else {
setDriverSupport(!!driverObject._support);
}
} else {
setDriverSupport(true);
}
} catch (e) {
reject(e);
}
});
executeTwoCallbacks(promise, callback, errorCallback);
return promise;
};
LocalForage2.prototype.driver = function driver() {
return this._driver || null;
};
LocalForage2.prototype.getDriver = function getDriver(driverName, callback, errorCallback) {
var getDriverPromise = DefinedDrivers[driverName] ? Promise$12.resolve(DefinedDrivers[driverName]) : Promise$12.reject(new Error("Driver not found."));
executeTwoCallbacks(getDriverPromise, callback, errorCallback);
return getDriverPromise;
};
LocalForage2.prototype.getSerializer = function getSerializer(callback) {
var serializerPromise = Promise$12.resolve(localforageSerializer);
executeTwoCallbacks(serializerPromise, callback);
return serializerPromise;
};
LocalForage2.prototype.ready = function ready(callback) {
var self2 = this;
var promise = self2._driverSet.then(function() {
if (self2._ready === null) {
self2._ready = self2._initDriver();
}
return self2._ready;
});
executeTwoCallbacks(promise, callback, callback);
return promise;
};
LocalForage2.prototype.setDriver = function setDriver(drivers, callback, errorCallback) {
var self2 = this;
if (!isArray2(drivers)) {
drivers = [drivers];
}
var supportedDrivers = this._getSupportedDrivers(drivers);
function setDriverToConfig() {
self2._config.driver = self2.driver();
}
function extendSelfWithDriver(driver) {
self2._extend(driver);
setDriverToConfig();
self2._ready = self2._initStorage(self2._config);
return self2._ready;
}
function initDriver(supportedDrivers2) {
return function() {
var currentDriverIndex = 0;
function driverPromiseLoop() {
while (currentDriverIndex < supportedDrivers2.length) {
var driverName = supportedDrivers2[currentDriverIndex];
currentDriverIndex++;
self2._dbInfo = null;
self2._ready = null;
return self2.getDriver(driverName).then(extendSelfWithDriver)["catch"](driverPromiseLoop);
}
setDriverToConfig();
var error = new Error("No available storage method found.");
self2._driverSet = Promise$12.reject(error);
return self2._driverSet;
}
return driverPromiseLoop();
};
}
var oldDriverSetDone = this._driverSet !== null ? this._driverSet["catch"](function() {
return Promise$12.resolve();
}) : Promise$12.resolve();
this._driverSet = oldDriverSetDone.then(function() {
var driverName = supportedDrivers[0];
self2._dbInfo = null;
self2._ready = null;
return self2.getDriver(driverName).then(function(driver) {
self2._driver = driver._driver;
setDriverToConfig();
self2._wrapLibraryMethodsWithReady();
self2._initDriver = initDriver(supportedDrivers);
});
})["catch"](function() {
setDriverToConfig();
var error = new Error("No available storage method found.");
self2._driverSet = Promise$12.reject(error);
return self2._driverSet;
});
executeTwoCallbacks(this._driverSet, callback, errorCallback);
return this._driverSet;
};
LocalForage2.prototype.supports = function supports(driverName) {
return !!DriverSupport[driverName];
};
LocalForage2.prototype._extend = function _extend(libraryMethodsAndProperties) {
extend2(this, libraryMethodsAndProperties);
};
LocalForage2.prototype._getSupportedDrivers = function _getSupportedDrivers(drivers) {
var supportedDrivers = [];
for (var i = 0, len = drivers.length; i < len; i++) {
var driverName = drivers[i];
if (this.supports(driverName)) {
supportedDrivers.push(driverName);
}
}
return supportedDrivers;
};
LocalForage2.prototype._wrapLibraryMethodsWithReady = function _wrapLibraryMethodsWithReady() {
for (var i = 0, len = LibraryMethods.length; i < len; i++) {
callWhenReady(this, LibraryMethods[i]);
}
};
LocalForage2.prototype.createInstance = function createInstance(options) {
return new LocalForage2(options);
};
return LocalForage2;
}();
var localforage_js = new LocalForage();
module3.exports = localforage_js;
}, { "3": 3 }] }, {}, [4])(4);
});
})(localforage$1);
var localforageExports = localforage$1.exports;
const localforage = /* @__PURE__ */ getDefaultExportFromCjs(localforageExports);
function getSerializerPromise(localForageInstance) {
if (getSerializerPromise.result) {
return getSerializerPromise.result;
}
if (!localForageInstance || typeof localForageInstance.getSerializer !== "function") {
return Promise.reject(new Error("localforage.getSerializer() was not available! localforage v1.4+ is required!"));
}
getSerializerPromise.result = localForageInstance.getSerializer();
return getSerializerPromise.result;
}
function executeCallback(promise, callback) {
if (callback) {
promise.then(function(result) {
callback(null, result);
}, function(error) {
callback(error);
});
}
}
function forEachItem(items, keyFn, valueFn, loopFn) {
function ensurePropGetterMethod(propFn, defaultPropName) {
var propName = propFn || defaultPropName;
if ((!propFn || typeof propFn !== "function") && typeof propName === "string") {
propFn = function propFn2(item2) {
return item2[propName];
};
}
return propFn;
}
var result = [];
if (Object.prototype.toString.call(items) === "[object Array]") {
keyFn = ensurePropGetterMethod(keyFn, "key");
valueFn = ensurePropGetterMethod(valueFn, "value");
for (var i = 0, len = items.length; i < len; i++) {
var item = items[i];
result.push(loopFn(keyFn(item), valueFn(item)));
}
} else {
for (var prop in items) {
if (items.hasOwnProperty(prop)) {
result.push(loopFn(prop, items[prop]));
}
}
}
return result;
}
function setItemsIndexedDB(items, keyFn, valueFn, callback) {
var localforageInstance = this;
var promise = localforageInstance.ready().then(function() {
return new Promise(function(resolve2, reject) {
var dbInfo = localforageInstance._dbInfo;
var transaction = dbInfo.db.transaction(dbInfo.storeName, "readwrite");
var store = transaction.objectStore(dbInfo.storeName);
var lastError;
transaction.oncomplete = function() {
resolve2(items);
};
transaction.onabort = transaction.onerror = function(event) {
reject(lastError || event.target);
};
function requestOnError(evt) {
var request2 = evt.target || this;
lastError = request2.error || request2.transaction.error;
reject(lastError);
}
forEachItem(items, keyFn, valueFn, function(key, value) {
if (value === null) {
value = void 0;
}
var request2 = store.put(value, key);
request2.onerror = requestOnError;
});
});
});
executeCallback(promise, callback);
return promise;
}
function setItemsWebsql(items, keyFn, valueFn, callback) {
var localforageInstance = this;
var promise = new Promise(function(resolve2, reject) {
localforageInstance.ready().then(function() {
return getSerializerPromise(localforageInstance);
}).then(function(serializer) {
var dbInfo = localforageInstance._dbInfo;
dbInfo.db.transaction(
function(t2) {
var query = "INSERT OR REPLACE INTO " + dbInfo.storeName + " (key, value) VALUES (?, ?)";
var itemPromises = forEachItem(items, keyFn, valueFn, function(key, value) {
return new Promise(function(resolve3, reject2) {
serializer.serialize(value, function(value2, error) {
if (error) {
reject2(error);
} else {
t2.executeSql(query, [key, value2], function() {
resolve3();
}, function(t3, error2) {
reject2(error2);
});
}
});
});
});
Promise.all(itemPromises).then(function() {
resolve2(items);
}, reject);
},
function(sqlError) {
reject(sqlError);
}
/*, function() {
if (resolving) {
resolve(items);
}
}*/
);
}).catch(reject);
});
executeCallback(promise, callback);
return promise;
}
function setItemsGeneric(items, keyFn, valueFn, callback) {
var localforageInstance = this;
var itemPromises = forEachItem(items, keyFn, valueFn, function(key, value) {
return localforageInstance.setItem(key, value);
});
var promise = Promise.all(itemPromises);
executeCallback(promise, callback);
return promise;
}
function localforageSetItems(items, keyFn, valueFn, callback) {
var localforageInstance = this;
var currentDriver = localforageInstance.driver();
if (currentDriver === localforageInstance.INDEXEDDB) {
return setItemsIndexedDB.call(localforageInstance, items, keyFn, valueFn, callback);
} else if (currentDriver === localforageInstance.WEBSQL) {
return setItemsWebsql.call(localforageInstance, items, keyFn, valueFn, callback);
} else {
return setItemsGeneric.call(localforageInstance, items, keyFn, valueFn, callback);
}
}
function extendPrototype(localforage$$1) {
var localforagePrototype = Object.getPrototypeOf(localforage$$1);
if (localforagePrototype) {
localforagePrototype.setItems = localforageSetItems;
localforagePrototype.setItems.indexedDB = function() {
return setItemsIndexedDB.apply(this, arguments);
};
localforagePrototype.setItems.websql = function() {
return setItemsWebsql.apply(this, arguments);
};
localforagePrototype.setItems.generic = function() {
return setItemsGeneric.apply(this, arguments);
};
}
}
extendPrototype(localforage);
var md5$1 = { exports: {} };
var crypt = { exports: {} };
(function() {
var base64map = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/", crypt$1 = {
// Bit-wise rotation left
rotl: function(n, b) {
return n << b | n >>> 32 - b;
},
// Bit-wise rotation right
rotr: function(n, b) {
return n << 32 - b | n >>> b;
},
// Swap big-endian to little-endian and vice versa
endian: function(n) {
if (n.constructor == Number) {
return crypt$1.rotl(n, 8) & 16711935 | crypt$1.rotl(n, 24) & 4278255360;
}
for (var i = 0; i < n.length; i++)
n[i] = crypt$1.endian(n[i]);
return n;
},
// Generate an array of any length of random bytes
randomBytes: function(n) {
for (var bytes = []; n > 0; n--)
bytes.push(Math.floor(Math.random() * 256));
return bytes;
},
// Convert a byte array to big-endian 32-bit words
bytesToWords: function(bytes) {
for (var words2 = [], i = 0, b = 0; i < bytes.length; i++, b += 8)
words2[b >>> 5] |= bytes[i] << 24 - b % 32;
return words2;
},
// Convert big-endian 32-bit words to a byte array
wordsToBytes: function(words2) {
for (var bytes = [], b = 0; b < words2.length * 32; b += 8)
bytes.push(words2[b >>> 5] >>> 24 - b % 32 & 255);
return bytes;
},
// Convert a byte array to a hex string
bytesToHex: function(bytes) {
for (var hex = [], i = 0; i < bytes.length; i++) {
hex.push((bytes[i] >>> 4).toString(16));
hex.push((bytes[i] & 15).toString(16));
}
return hex.join("");
},
// Convert a hex string to a byte array
hexToBytes: function(hex) {
for (var bytes = [], c = 0; c < hex.length; c += 2)
bytes.push(parseInt(hex.substr(c, 2), 16));
return bytes;
},
// Convert a byte array to a base-64 string
bytesToBase64: function(bytes) {
for (var base64 = [], i = 0; i < bytes.length; i += 3) {
var triplet = bytes[i] << 16 | bytes[i + 1] << 8 | bytes[i + 2];
for (var j = 0; j < 4; j++)
if (i * 8 + j * 6 <= bytes.length * 8)
base64.push(base64map.charAt(triplet >>> 6 * (3 - j) & 63));
else
base64.push("=");
}
return base64.join("");
},
// Convert a base-64 string to a byte array
base64ToBytes: function(base64) {
base64 = base64.replace(/[^A-Z0-9+\/]/ig, "");
for (var bytes = [], i = 0, imod4 = 0; i < base64.length; imod4 = ++i % 4) {
if (imod4 == 0)
continue;
bytes.push((base64map.indexOf(base64.charAt(i - 1)) & Math.pow(2, -2 * imod4 + 8) - 1) << imod4 * 2 | base64map.indexOf(base64.charAt(i)) >>> 6 - imod4 * 2);
}
return bytes;
}
};
crypt.exports = crypt$1;
})();
var cryptExports = crypt.exports;
var charenc = {
// UTF-8 encoding
utf8: {
// Convert a string to a byte array
stringToBytes: function(str) {
return charenc.bin.stringToBytes(unescape(encodeURIComponent(str)));
},
// Convert a byte array to a string
bytesToString: function(bytes) {
return decodeURIComponent(escape(charenc.bin.bytesToString(bytes)));
}
},
// Binary encoding
bin: {
// Convert a string to a byte array
stringToBytes: function(str) {
for (var bytes = [], i = 0; i < str.length; i++)
bytes.push(str.charCodeAt(i) & 255);
return bytes;
},
// Convert a byte array to a string
bytesToString: function(bytes) {
for (var str = [], i = 0; i < bytes.length; i++)
str.push(String.fromCharCode(bytes[i]));
return str.join("");
}
}
};
var charenc_1 = charenc;
/*!
* Determine if an object is a Buffer
*
* @author Feross Aboukhadijeh <https://feross.org>
* @license MIT
*/
var isBuffer_1 = function(obj) {
return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer);
};
function isBuffer(obj) {
return !!obj.constructor && typeof obj.constructor.isBuffer === "function" && obj.constructor.isBuffer(obj);
}
function isSlowBuffer(obj) {
return typeof obj.readFloatLE === "function" && typeof obj.slice === "function" && isBuffer(obj.slice(0, 0));
}
(function() {
var crypt2 = cryptExports, utf8 = charenc_1.utf8, isBuffer2 = isBuffer_1, bin = charenc_1.bin, md52 = function(message2, options) {
if (message2.constructor == String)
if (options && options.encoding === "binary")
message2 = bin.stringToBytes(message2);
else
message2 = utf8.stringToBytes(message2);
else if (isBuffer2(message2))
message2 = Array.prototype.slice.call(message2, 0);
else if (!Array.isArray(message2) && message2.constructor !== Uint8Array)
message2 = message2.toString();
var m = crypt2.bytesToWords(message2), l = message2.length * 8, a = 1732584193, b = -271733879, c = -1732584194, d = 271733878;
for (var i = 0; i < m.length; i++) {
m[i] = (m[i] << 8 | m[i] >>> 24) & 16711935 | (m[i] << 24 | m[i] >>> 8) & 4278255360;
}
m[l >>> 5] |= 128 << l % 32;
m[(l + 64 >>> 9 << 4) + 14] = l;
var FF = md52._ff, GG = md52._gg, HH = md52._hh, II = md52._ii;
for (var i = 0; i < m.length; i += 16) {
var aa = a, bb = b, cc = c, dd = d;
a = FF(a, b, c, d, m[i + 0], 7, -680876936);
d = FF(d, a, b, c, m[i + 1], 12, -389564586);
c = FF(c, d, a, b, m[i + 2], 17, 606105819);
b = FF(b, c, d, a, m[i + 3], 22, -1044525330);
a = FF(a, b, c, d, m[i + 4], 7, -176418897);
d = FF(d, a, b, c, m[i + 5], 12, 1200080426);
c = FF(c, d, a, b, m[i + 6], 17, -1473231341);
b = FF(b, c, d, a, m[i + 7], 22, -45705983);
a = FF(a, b, c, d, m[i + 8], 7, 1770035416);
d = FF(d, a, b, c, m[i + 9], 12, -1958414417);
c = FF(c, d, a, b, m[i + 10], 17, -42063);
b = FF(b, c, d, a, m[i + 11], 22, -1990404162);
a = FF(a, b, c, d, m[i + 12], 7, 1804603682);
d = FF(d, a, b, c, m[i + 13], 12, -40341101);
c = FF(c, d, a, b, m[i + 14], 17, -1502002290);
b = FF(b, c, d, a, m[i + 15], 22, 1236535329);
a = GG(a, b, c, d, m[i + 1], 5, -165796510);
d = GG(d, a, b, c, m[i + 6], 9, -1069501632);
c = GG(c, d, a, b, m[i + 11], 14, 643717713);
b = GG(b, c, d, a, m[i + 0], 20, -373897302);
a = GG(a, b, c, d, m[i + 5], 5, -701558691);
d = GG(d, a, b, c, m[i + 10], 9, 38016083);
c = GG(c, d, a, b, m[i + 15], 14, -660478335);
b = GG(b, c, d, a, m[i + 4], 20, -405537848);
a = GG(a, b, c, d, m[i + 9], 5, 568446438);
d = GG(d, a, b, c, m[i + 14], 9, -1019803690);
c = GG(c, d, a, b, m[i + 3], 14, -187363961);
b = GG(b, c, d, a, m[i + 8], 20, 1163531501);
a = GG(a, b, c, d, m[i + 13], 5, -1444681467);
d = GG(d, a, b, c, m[i + 2], 9, -51403784);
c = GG(c, d, a, b, m[i + 7], 14, 1735328473);
b = GG(b, c, d, a, m[i + 12], 20, -1926607734);
a = HH(a, b, c, d, m[i + 5], 4, -378558);
d = HH(d, a, b, c, m[i + 8], 11, -2022574463);
c = HH(c, d, a, b, m[i + 11], 16, 1839030562);
b = HH(b, c, d, a, m[i + 14], 23, -35309556);
a = HH(a, b, c, d, m[i + 1], 4, -1530992060);
d = HH(d, a, b, c, m[i + 4], 11, 1272893353);
c = HH(c, d, a, b, m[i + 7], 16, -155497632);
b = HH(b, c, d, a, m[i + 10], 23, -1094730640);
a = HH(a, b, c, d, m[i + 13], 4, 681279174);
d = HH(d, a, b, c, m[i + 0], 11, -358537222);
c = HH(c, d, a, b, m[i + 3], 16, -722521979);
b = HH(b, c, d, a, m[i + 6], 23, 76029189);
a = HH(a, b, c, d, m[i + 9], 4, -640364487);
d = HH(d, a, b, c, m[i + 12], 11, -421815835);
c = HH(c, d, a, b, m[i + 15], 16, 530742520);
b = HH(b, c, d, a, m[i + 2], 23, -995338651);
a = II(a, b, c, d, m[i + 0], 6, -198630844);
d = II(d, a, b, c, m[i + 7], 10, 1126891415);
c = II(c, d, a, b, m[i + 14], 15, -1416354905);
b = II(b, c, d, a, m[i + 5], 21, -57434055);
a = II(a, b, c, d, m[i + 12], 6, 1700485571);
d = II(d, a, b, c, m[i + 3], 10, -1894986606);
c = II(c, d, a, b, m[i + 10], 15, -1051523);
b = II(b, c, d, a, m[i + 1], 21, -2054922799);
a = II(a, b, c, d, m[i + 8], 6, 1873313359);
d = II(d, a, b, c, m[i + 15], 10, -30611744);
c = II(c, d, a, b, m[i + 6], 15, -1560198380);
b = II(b, c, d, a, m[i + 13], 21, 1309151649);
a = II(a, b, c, d, m[i + 4], 6, -145523070);
d = II(d, a, b, c, m[i + 11], 10, -1120210379);
c = II(c, d, a, b, m[i + 2], 15, 718787259);
b = II(b, c, d, a, m[i + 9], 21, -343485551);
a = a + aa >>> 0;
b = b + bb >>> 0;
c = c + cc >>> 0;
d = d + dd >>> 0;
}
return crypt2.endian([a, b, c, d]);
};
md52._ff = function(a, b, c, d, x, s, t2) {
var n = a + (b & c | ~b & d) + (x >>> 0) + t2;
return (n << s | n >>> 32 - s) + b;
};
md52._gg = function(a, b, c, d, x, s, t2) {
var n = a + (b & d | c & ~d) + (x >>> 0) + t2;
return (n << s | n >>> 32 - s) + b;
};
md52._hh = function(a, b, c, d, x, s, t2) {
var n = a + (b ^ c ^ d) + (x >>> 0) + t2;
return (n << s | n >>> 32 - s) + b;
};
md52._ii = function(a, b, c, d, x, s, t2) {
var n = a + (c ^ (b | ~d)) + (x >>> 0) + t2;
return (n << s | n >>> 32 - s) + b;
};
md52._blocksize = 16;
md52._digestsize = 16;
md5$1.exports = function(message2, options) {
if (message2 === void 0 || message2 === null)
throw new Error("Illegal argument " + message2);
var digestbytes = crypt2.wordsToBytes(md52(message2, options));
return options && options.asBytes ? digestbytes : options && options.asString ? bin.bytesToString(digestbytes) : crypt2.bytesToHex(digestbytes);
};
})();
var md5Exports = md5$1.exports;
const md5 = /* @__PURE__ */ getDefaultExportFromCjs(md5Exports);
const dateTimeFormatter = new Intl.DateTimeFormat(void 0, {
year: "numeric",
month: "2-digit",
day: "2-digit",
hour: "2-digit",
minute: "2-digit",
second: "2-digit",
hour12: false
});
/**
* @license
* Copyright 2019 Google LLC
* SPDX-License-Identifier: Apache-2.0
*/
const proxyMarker = Symbol("Comlink.proxy");
const createEndpoint = Symbol("Comlink.endpoint");
const releaseProxy = Symbol("Comlink.releaseProxy");
const finalizer = Symbol("Comlink.finalizer");
const throwMarker = Symbol("Comlink.thrown");
const isObject = (val) => typeof val === "object" && val !== null || typeof val === "function";
const proxyTransferHandler = {
canHandle: (val) => isObject(val) && val[proxyMarker],
serialize(obj) {
const { port1, port2 } = new MessageChannel();
expose(obj, port1);
return [port2, [port2]];
},
deserialize(port) {
port.start();
return wrap(port);
}
};
const throwTransferHandler = {
canHandle: (value) => isObject(value) && throwMarker in value,
serialize({ value }) {
let serialized;
if (value instanceof Error) {
serialized = {
isError: true,
value: {
message: value.message,
name: value.name,
stack: value.stack
}
};
} else {
serialized = { isError: false, value };
}
return [serialized, []];
},
deserialize(serialized) {
if (serialized.isError) {
throw Object.assign(new Error(serialized.value.message), serialized.value);
}
throw serialized.value;
}
};
const transferHandlers = /* @__PURE__ */ new Map([
["proxy", proxyTransferHandler],
["throw", throwTransferHandler]
]);
function isAllowedOrigin(allowedOrigins, origin) {
for (const allowedOrigin of allowedOrigins) {
if (origin === allowedOrigin || allowedOrigin === "*") {
return true;
}
if (allowedOrigin instanceof RegExp && allowedOrigin.test(origin)) {
return true;
}
}
return false;
}
function expose(obj, ep = globalThis, allowedOrigins = ["*"]) {
ep.addEventListener("message", function callback(ev) {
if (!ev || !ev.data) {
return;
}
if (!isAllowedOrigin(allowedOrigins, ev.origin)) {
console.warn(`Invalid origin '${ev.origin}' for comlink proxy`);
return;
}
const { id, type: type2, path } = Object.assign({ path: [] }, ev.data);
const argumentList = (ev.data.argumentList || []).map(fromWireValue);
let returnValue;
try {
const parent = path.slice(0, -1).reduce((obj2, prop) => obj2[prop], obj);
const rawValue = path.reduce((obj2, prop) => obj2[prop], obj);
switch (type2) {
case "GET":
{
returnValue = rawValue;
}
break;
case "SET":
{
parent[path.slice(-1)[0]] = fromWireValue(ev.data.value);
returnValue = true;
}
break;
case "APPLY":
{
returnValue = rawValue.apply(parent, argumentList);
}
break;
case "CONSTRUCT":
{
const value = new rawValue(...argumentList);
returnValue = proxy(value);
}
break;
case "ENDPOINT":
{
const { port1, port2 } = new MessageChannel();
expose(obj, port2);
returnValue = transfer(port1, [port1]);
}
break;
case "RELEASE":
{
returnValue = void 0;
}
break;
default:
return;
}
} catch (value) {
returnValue = { value, [throwMarker]: 0 };
}
Promise.resolve(returnValue).catch((value) => {
return { value, [throwMarker]: 0 };
}).then((returnValue2) => {
const [wireValue, transferables] = toWireValue(returnValue2);
ep.postMessage(Object.assign(Object.assign({}, wireValue), { id }), transferables);
if (type2 === "RELEASE") {
ep.removeEventListener("message", callback);
closeEndPoint(ep);
if (finalizer in obj && typeof obj[finalizer] === "function") {
obj[finalizer]();
}
}
}).catch((error) => {
const [wireValue, transferables] = toWireValue({
value: new TypeError("Unserializable return value"),
[throwMarker]: 0
});
ep.postMessage(Object.assign(Object.assign({}, wireValue), { id }), transferables);
});
});
if (ep.start) {
ep.start();
}
}
function isMessagePort(endpoint) {
return endpoint.constructor.name === "MessagePort";
}
function closeEndPoint(endpoint) {
if (isMessagePort(endpoint))
endpoint.close();
}
function wrap(ep, target) {
return createProxy(ep, [], target);
}
function throwIfProxyReleased(isReleased) {
if (isReleased) {
throw new Error("Proxy has been released and is not useable");
}
}
function releaseEndpoint(ep) {
return requestResponseMessage(ep, {
type: "RELEASE"
}).then(() => {
closeEndPoint(ep);
});
}
const proxyCounter = /* @__PURE__ */ new WeakMap();
const proxyFinalizers = "FinalizationRegistry" in globalThis && new FinalizationRegistry((ep) => {
const newCount = (proxyCounter.get(ep) || 0) - 1;
proxyCounter.set(ep, newCount);
if (newCount === 0) {
releaseEndpoint(ep);
}
});
function registerProxy(proxy2, ep) {
const newCount = (proxyCounter.get(ep) || 0) + 1;
proxyCounter.set(ep, newCount);
if (proxyFinalizers) {
proxyFinalizers.register(proxy2, ep, proxy2);
}
}
function unregisterProxy(proxy2) {
if (proxyFinalizers) {
proxyFinalizers.unregister(proxy2);
}
}
function createProxy(ep, path = [], target = function() {
}) {
let isProxyReleased = false;
const proxy2 = new Proxy(target, {
get(_target, prop) {
throwIfProxyReleased(isProxyReleased);
if (prop === releaseProxy) {
return () => {
unregisterProxy(proxy2);
releaseEndpoint(ep);
isProxyReleased = true;
};
}
if (prop === "then") {
if (path.length === 0) {
return { then: () => proxy2 };
}
const r = requestResponseMessage(ep, {
type: "GET",
path: path.map((p2) => p2.toString())
}).then(fromWireValue);
return r.then.bind(r);
}
return createProxy(ep, [...path, prop]);
},
set(_target, prop, rawValue) {
throwIfProxyReleased(isProxyReleased);
const [value, transferables] = toWireValue(rawValue);
return requestResponseMessage(ep, {
type: "SET",
path: [...path, prop].map((p2) => p2.toString()),
value
}, transferables).then(fromWireValue);
},
apply(_target, _thisArg, rawArgumentList) {
throwIfProxyReleased(isProxyReleased);
const last2 = path[path.length - 1];
if (last2 === createEndpoint) {
return requestResponseMessage(ep, {
type: "ENDPOINT"
}).then(fromWireValue);
}
if (last2 === "bind") {
return createProxy(ep, path.slice(0, -1));
}
const [argumentList, transferables] = processArguments(rawArgumentList);
return requestResponseMessage(ep, {
type: "APPLY",
path: path.map((p2) => p2.toString()),
argumentList
}, transferables).then(fromWireValue);
},
construct(_target, rawArgumentList) {
throwIfProxyReleased(isProxyReleased);
const [argumentList, transferables] = processArguments(rawArgumentList);
return requestResponseMessage(ep, {
type: "CONSTRUCT",
path: path.map((p2) => p2.toString()),
argumentList
}, transferables).then(fromWireValue);
}
});
registerProxy(proxy2, ep);
return proxy2;
}
function myFlat(arr) {
return Array.prototype.concat.apply([], arr);
}
function processArguments(argumentList) {
const processed = argumentList.map(toWireValue);
return [processed.map((v) => v[0]), myFlat(processed.map((v) => v[1]))];
}
const transferCache = /* @__PURE__ */ new WeakMap();
function transfer(obj, transfers) {
transferCache.set(obj, transfers);
return obj;
}
function proxy(obj) {
return Object.assign(obj, { [proxyMarker]: true });
}
function toWireValue(value) {
for (const [name, handler] of transferHandlers) {
if (handler.canHandle(value)) {
const [serializedValue, transferables] = handler.serialize(value);
return [
{
type: "HANDLER",
name,
value: serializedValue
},
transferables
];
}
}
return [
{
type: "RAW",
value
},
transferCache.get(value) || []
];
}
function fromWireValue(value) {
switch (value.type) {
case "HANDLER":
return transferHandlers.get(value.name).deserialize(value.value);
case "RAW":
return value.value;
}
}
function requestResponseMessage(ep, msg, transfers) {
return new Promise((resolve2) => {
const id = generateUUID();
ep.addEventListener("message", function l(ev) {
if (!ev.data || !ev.data.id || ev.data.id !== id) {
return;
}
ep.removeEventListener("message", l);
resolve2(ev.data);
});
if (ep.start) {
ep.start();
}
ep.postMessage(Object.assign({ id }, msg), transfers);
});
}
function generateUUID() {
return new Array(4).fill(0).map(() => Math.floor(Math.random() * Number.MAX_SAFE_INTEGER).toString(16)).join("-");
}
const encodedJs = "dmFyIF9fZGVmUHJvcCA9IE9iamVjdC5kZWZpbmVQcm9wZXJ0eTsKdmFyIF9fZGVmTm9ybWFsUHJvcCA9IChvYmosIGtleSwgdmFsdWUpID0+IGtleSBpbiBvYmogPyBfX2RlZlByb3Aob2JqLCBrZXksIHsgZW51bWVyYWJsZTogdHJ1ZSwgY29uZmlndXJhYmxlOiB0cnVlLCB3cml0YWJsZTogdHJ1ZSwgdmFsdWUgfSkgOiBvYmpba2V5XSA9IHZhbHVlOwp2YXIgX19wdWJsaWNGaWVsZCA9IChvYmosIGtleSwgdmFsdWUpID0+IHsKICBfX2RlZk5vcm1hbFByb3Aob2JqLCB0eXBlb2Yga2V5ICE9PSAic3ltYm9sIiA/IGtleSArICIiIDoga2V5LCB2YWx1ZSk7CiAgcmV0dXJuIHZhbHVlOwp9OwooZnVuY3Rpb24oKSB7CiAgInVzZSBzdHJpY3QiOwogIHZhciBjb21tb25qc0dsb2JhbCA9IHR5cGVvZiBnbG9iYWxUaGlzICE9PSAidW5kZWZpbmVkIiA/IGdsb2JhbFRoaXMgOiB0eXBlb2Ygd2luZG93ICE9PSAidW5kZWZpbmVkIiA/IHdpbmRvdyA6IHR5cGVvZiBnbG9iYWwgIT09ICJ1bmRlZmluZWQiID8gZ2xvYmFsIDogdHlwZW9mIHNlbGYgIT09ICJ1bmRlZmluZWQiID8gc2VsZiA6IHt9OwogIGZ1bmN0aW9uIGdldERlZmF1bHRFeHBvcnRGcm9tQ2pzKHgpIHsKICAgIHJldHVybiB4ICYmIHguX19lc01vZHVsZSAmJiBPYmplY3QucHJvdG90eXBlLmhhc093blByb3BlcnR5LmNhbGwoeCwgImRlZmF1bHQiKSA/IHhbImRlZmF1bHQiXSA6IHg7CiAgfQogIGZ1bmN0aW9uIGNvbW1vbmpzUmVxdWlyZShwYXRoKSB7CiAgICB0aHJvdyBuZXcgRXJyb3IoJ0NvdWxkIG5vdCBkeW5hbWljYWxseSByZXF1aXJlICInICsgcGF0aCArICciLiBQbGVhc2UgY29uZmlndXJlIHRoZSBkeW5hbWljUmVxdWlyZVRhcmdldHMgb3IvYW5kIGlnbm9yZUR5bmFtaWNSZXF1aXJlcyBvcHRpb24gb2YgQHJvbGx1cC9wbHVnaW4tY29tbW9uanMgYXBwcm9wcmlhdGVseSBmb3IgdGhpcyByZXF1aXJlIGNhbGwgdG8gd29yay4nKTsKICB9CiAgdmFyIGpzemlwX21pbiA9IHsgZXhwb3J0czoge30gfTsKICAvKiEKICAKICAJSlNaaXAgdjMuMTAuMSAtIEEgSmF2YVNjcmlwdCBjbGFzcyBmb3IgZ2VuZXJhdGluZyBhbmQgcmVhZGluZyB6aXAgZmlsZXMKICAJPGh0dHA6Ly9zdHVhcnRrLmNvbS9qc3ppcD4KICAKICAJKGMpIDIwMDktMjAxNiBTdHVhcnQgS25pZ2h0bGV5IDxzdHVhcnQgW2F0XSBzdHVhcnRrLmNvbT4KICAJRHVhbCBsaWNlbmNlZCB1bmRlciB0aGUgTUlUIGxpY2Vuc2Ugb3IgR1BMdjMuIFNlZSBodHRwczovL3Jhdy5naXRodWIuY29tL1N0dWsvanN6aXAvbWFpbi9MSUNFTlNFLm1hcmtkb3duLgogIAogIAlKU1ppcCB1c2VzIHRoZSBsaWJyYXJ5IHBha28gcmVsZWFzZWQgdW5kZXIgdGhlIE1JVCBsaWNlbnNlIDoKICAJaHR0cHM6Ly9naXRodWIuY29tL25vZGVjYS9wYWtvL2Jsb2IvbWFpbi9MSUNFTlNFCiAgCSovCiAgKGZ1bmN0aW9uKG1vZHVsZSwgZXhwb3J0cykgewogICAgIWZ1bmN0aW9uKGUpIHsKICAgICAgbW9kdWxlLmV4cG9ydHMgPSBlKCk7CiAgICB9KGZ1bmN0aW9uKCkgewogICAgICByZXR1cm4gZnVuY3Rpb24gcyhhLCBvLCBoKSB7CiAgICAgICAgZnVuY3Rpb24gdShyLCBlMikgewogICAgICAgICAgaWYgKCFvW3JdKSB7CiAgICAgICAgICAgIGlmICghYVtyXSkgewogICAgICAgICAgICAgIHZhciB0ID0gImZ1bmN0aW9uIiA9PSB0eXBlb2YgY29tbW9uanNSZXF1aXJlICYmIGNvbW1vbmpzUmVxdWlyZTsKICAgICAgICAgICAgICBpZiAoIWUyICYmIHQpCiAgICAgICAgICAgICAgICByZXR1cm4gdChyLCB0cnVlKTsKICAgICAgICAgICAgICBpZiAobCkKICAgICAgICAgICAgICAgIHJldHVybiBsKHIsIHRydWUpOwogICAgICAgICAgICAgIHZhciBuID0gbmV3IEVycm9yKCJDYW5ub3QgZmluZCBtb2R1bGUgJyIgKyByICsgIiciKTsKICAgICAgICAgICAgICB0aHJvdyBuLmNvZGUgPSAiTU9EVUxFX05PVF9GT1VORCIsIG47CiAgICAgICAgICAgIH0KICAgICAgICAgICAgdmFyIGkgPSBvW3JdID0geyBleHBvcnRzOiB7fSB9OwogICAgICAgICAgICBhW3JdWzBdLmNhbGwoaS5leHBvcnRzLCBmdW5jdGlvbihlMykgewogICAgICAgICAgICAgIHZhciB0MiA9IGFbcl1bMV1bZTNdOwogICAgICAgICAgICAgIHJldHVybiB1KHQyIHx8IGUzKTsKICAgICAgICAgICAgfSwgaSwgaS5leHBvcnRzLCBzLCBhLCBvLCBoKTsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiBvW3JdLmV4cG9ydHM7CiAgICAgICAgfQogICAgICAgIGZvciAodmFyIGwgPSAiZnVuY3Rpb24iID09IHR5cGVvZiBjb21tb25qc1JlcXVpcmUgJiYgY29tbW9uanNSZXF1aXJlLCBlID0gMDsgZSA8IGgubGVuZ3RoOyBlKyspCiAgICAgICAgICB1KGhbZV0pOwogICAgICAgIHJldHVybiB1OwogICAgICB9KHsgMTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgZCA9IGUoIi4vdXRpbHMiKSwgYyA9IGUoIi4vc3VwcG9ydCIpLCBwID0gIkFCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaYWJjZGVmZ2hpamtsbW5vcHFyc3R1dnd4eXowMTIzNDU2Nzg5Ky89IjsKICAgICAgICByLmVuY29kZSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBmb3IgKHZhciB0MiwgcjIsIG4sIGksIHMsIGEsIG8sIGggPSBbXSwgdSA9IDAsIGwgPSBlMi5sZW5ndGgsIGYgPSBsLCBjMiA9ICJzdHJpbmciICE9PSBkLmdldFR5cGVPZihlMik7IHUgPCBlMi5sZW5ndGg7ICkKICAgICAgICAgICAgZiA9IGwgLSB1LCBuID0gYzIgPyAodDIgPSBlMlt1KytdLCByMiA9IHUgPCBsID8gZTJbdSsrXSA6IDAsIHUgPCBsID8gZTJbdSsrXSA6IDApIDogKHQyID0gZTIuY2hhckNvZGVBdCh1KyspLCByMiA9IHUgPCBsID8gZTIuY2hhckNvZGVBdCh1KyspIDogMCwgdSA8IGwgPyBlMi5jaGFyQ29kZUF0KHUrKykgOiAwKSwgaSA9IHQyID4+IDIsIHMgPSAoMyAmIHQyKSA8PCA0IHwgcjIgPj4gNCwgYSA9IDEgPCBmID8gKDE1ICYgcjIpIDw8IDIgfCBuID4+IDYgOiA2NCwgbyA9IDIgPCBmID8gNjMgJiBuIDogNjQsIGgucHVzaChwLmNoYXJBdChpKSArIHAuY2hhckF0KHMpICsgcC5jaGFyQXQoYSkgKyBwLmNoYXJBdChvKSk7CiAgICAgICAgICByZXR1cm4gaC5qb2luKCIiKTsKICAgICAgICB9LCByLmRlY29kZSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIsIHIyLCBuLCBpLCBzLCBhLCBvID0gMCwgaCA9IDAsIHUgPSAiZGF0YToiOwogICAgICAgICAgaWYgKGUyLnN1YnN0cigwLCB1Lmxlbmd0aCkgPT09IHUpCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiSW52YWxpZCBiYXNlNjQgaW5wdXQsIGl0IGxvb2tzIGxpa2UgYSBkYXRhIHVybC4iKTsKICAgICAgICAgIHZhciBsLCBmID0gMyAqIChlMiA9IGUyLnJlcGxhY2UoL1teQS1aYS16MC05Ky89XS9nLCAiIikpLmxlbmd0aCAvIDQ7CiAgICAgICAgICBpZiAoZTIuY2hhckF0KGUyLmxlbmd0aCAtIDEpID09PSBwLmNoYXJBdCg2NCkgJiYgZi0tLCBlMi5jaGFyQXQoZTIubGVuZ3RoIC0gMikgPT09IHAuY2hhckF0KDY0KSAmJiBmLS0sIGYgJSAxICE9IDApCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiSW52YWxpZCBiYXNlNjQgaW5wdXQsIGJhZCBjb250ZW50IGxlbmd0aC4iKTsKICAgICAgICAgIGZvciAobCA9IGMudWludDhhcnJheSA/IG5ldyBVaW50OEFycmF5KDAgfCBmKSA6IG5ldyBBcnJheSgwIHwgZik7IG8gPCBlMi5sZW5ndGg7ICkKICAgICAgICAgICAgdDIgPSBwLmluZGV4T2YoZTIuY2hhckF0KG8rKykpIDw8IDIgfCAoaSA9IHAuaW5kZXhPZihlMi5jaGFyQXQobysrKSkpID4+IDQsIHIyID0gKDE1ICYgaSkgPDwgNCB8IChzID0gcC5pbmRleE9mKGUyLmNoYXJBdChvKyspKSkgPj4gMiwgbiA9ICgzICYgcykgPDwgNiB8IChhID0gcC5pbmRleE9mKGUyLmNoYXJBdChvKyspKSksIGxbaCsrXSA9IHQyLCA2NCAhPT0gcyAmJiAobFtoKytdID0gcjIpLCA2NCAhPT0gYSAmJiAobFtoKytdID0gbik7CiAgICAgICAgICByZXR1cm4gbDsKICAgICAgICB9OwogICAgICB9LCB7ICIuL3N1cHBvcnQiOiAzMCwgIi4vdXRpbHMiOiAzMiB9XSwgMjogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9IGUoIi4vZXh0ZXJuYWwiKSwgaSA9IGUoIi4vc3RyZWFtL0RhdGFXb3JrZXIiKSwgcyA9IGUoIi4vc3RyZWFtL0NyYzMyUHJvYmUiKSwgYSA9IGUoIi4vc3RyZWFtL0RhdGFMZW5ndGhQcm9iZSIpOwogICAgICAgIGZ1bmN0aW9uIG8oZTIsIHQyLCByMiwgbjIsIGkyKSB7CiAgICAgICAgICB0aGlzLmNvbXByZXNzZWRTaXplID0gZTIsIHRoaXMudW5jb21wcmVzc2VkU2l6ZSA9IHQyLCB0aGlzLmNyYzMyID0gcjIsIHRoaXMuY29tcHJlc3Npb24gPSBuMiwgdGhpcy5jb21wcmVzc2VkQ29udGVudCA9IGkyOwogICAgICAgIH0KICAgICAgICBvLnByb3RvdHlwZSA9IHsgZ2V0Q29udGVudFdvcmtlcjogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTIgPSBuZXcgaShuLlByb21pc2UucmVzb2x2ZSh0aGlzLmNvbXByZXNzZWRDb250ZW50KSkucGlwZSh0aGlzLmNvbXByZXNzaW9uLnVuY29tcHJlc3NXb3JrZXIoKSkucGlwZShuZXcgYSgiZGF0YV9sZW5ndGgiKSksIHQyID0gdGhpczsKICAgICAgICAgIHJldHVybiBlMi5vbigiZW5kIiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIGlmICh0aGlzLnN0cmVhbUluZm8uZGF0YV9sZW5ndGggIT09IHQyLnVuY29tcHJlc3NlZFNpemUpCiAgICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJCdWcgOiB1bmNvbXByZXNzZWQgZGF0YSBzaXplIG1pc21hdGNoIik7CiAgICAgICAgICB9KSwgZTI7CiAgICAgICAgfSwgZ2V0Q29tcHJlc3NlZFdvcmtlcjogZnVuY3Rpb24oKSB7CiAgICAgICAgICByZXR1cm4gbmV3IGkobi5Qcm9taXNlLnJlc29sdmUodGhpcy5jb21wcmVzc2VkQ29udGVudCkpLndpdGhTdHJlYW1JbmZvKCJjb21wcmVzc2VkU2l6ZSIsIHRoaXMuY29tcHJlc3NlZFNpemUpLndpdGhTdHJlYW1JbmZvKCJ1bmNvbXByZXNzZWRTaXplIiwgdGhpcy51bmNvbXByZXNzZWRTaXplKS53aXRoU3RyZWFtSW5mbygiY3JjMzIiLCB0aGlzLmNyYzMyKS53aXRoU3RyZWFtSW5mbygiY29tcHJlc3Npb24iLCB0aGlzLmNvbXByZXNzaW9uKTsKICAgICAgICB9IH0sIG8uY3JlYXRlV29ya2VyRnJvbSA9IGZ1bmN0aW9uKGUyLCB0MiwgcjIpIHsKICAgICAgICAgIHJldHVybiBlMi5waXBlKG5ldyBzKCkpLnBpcGUobmV3IGEoInVuY29tcHJlc3NlZFNpemUiKSkucGlwZSh0Mi5jb21wcmVzc1dvcmtlcihyMikpLnBpcGUobmV3IGEoImNvbXByZXNzZWRTaXplIikpLndpdGhTdHJlYW1JbmZvKCJjb21wcmVzc2lvbiIsIHQyKTsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBvOwogICAgICB9LCB7ICIuL2V4dGVybmFsIjogNiwgIi4vc3RyZWFtL0NyYzMyUHJvYmUiOiAyNSwgIi4vc3RyZWFtL0RhdGFMZW5ndGhQcm9iZSI6IDI2LCAiLi9zdHJlYW0vRGF0YVdvcmtlciI6IDI3IH1dLCAzOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9zdHJlYW0vR2VuZXJpY1dvcmtlciIpOwogICAgICAgIHIuU1RPUkUgPSB7IG1hZ2ljOiAiXDBcMCIsIGNvbXByZXNzV29ya2VyOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHJldHVybiBuZXcgbigiU1RPUkUgY29tcHJlc3Npb24iKTsKICAgICAgICB9LCB1bmNvbXByZXNzV29ya2VyOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHJldHVybiBuZXcgbigiU1RPUkUgZGVjb21wcmVzc2lvbiIpOwogICAgICAgIH0gfSwgci5ERUZMQVRFID0gZSgiLi9mbGF0ZSIpOwogICAgICB9LCB7ICIuL2ZsYXRlIjogNywgIi4vc3RyZWFtL0dlbmVyaWNXb3JrZXIiOiAyOCB9XSwgNDogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9IGUoIi4vdXRpbHMiKTsKICAgICAgICB2YXIgbyA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgZm9yICh2YXIgZTIsIHQyID0gW10sIHIyID0gMDsgcjIgPCAyNTY7IHIyKyspIHsKICAgICAgICAgICAgZTIgPSByMjsKICAgICAgICAgICAgZm9yICh2YXIgbjIgPSAwOyBuMiA8IDg7IG4yKyspCiAgICAgICAgICAgICAgZTIgPSAxICYgZTIgPyAzOTg4MjkyMzg0IF4gZTIgPj4+IDEgOiBlMiA+Pj4gMTsKICAgICAgICAgICAgdDJbcjJdID0gZTI7CiAgICAgICAgICB9CiAgICAgICAgICByZXR1cm4gdDI7CiAgICAgICAgfSgpOwogICAgICAgIHQuZXhwb3J0cyA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIHZvaWQgMCAhPT0gZTIgJiYgZTIubGVuZ3RoID8gInN0cmluZyIgIT09IG4uZ2V0VHlwZU9mKGUyKSA/IGZ1bmN0aW9uKGUzLCB0MywgcjIsIG4yKSB7CiAgICAgICAgICAgIHZhciBpID0gbywgcyA9IG4yICsgcjI7CiAgICAgICAgICAgIGUzIF49IC0xOwogICAgICAgICAgICBmb3IgKHZhciBhID0gbjI7IGEgPCBzOyBhKyspCiAgICAgICAgICAgICAgZTMgPSBlMyA+Pj4gOCBeIGlbMjU1ICYgKGUzIF4gdDNbYV0pXTsKICAgICAgICAgICAgcmV0dXJuIC0xIF4gZTM7CiAgICAgICAgICB9KDAgfCB0MiwgZTIsIGUyLmxlbmd0aCwgMCkgOiBmdW5jdGlvbihlMywgdDMsIHIyLCBuMikgewogICAgICAgICAgICB2YXIgaSA9IG8sIHMgPSBuMiArIHIyOwogICAgICAgICAgICBlMyBePSAtMTsKICAgICAgICAgICAgZm9yICh2YXIgYSA9IG4yOyBhIDwgczsgYSsrKQogICAgICAgICAgICAgIGUzID0gZTMgPj4+IDggXiBpWzI1NSAmIChlMyBeIHQzLmNoYXJDb2RlQXQoYSkpXTsKICAgICAgICAgICAgcmV0dXJuIC0xIF4gZTM7CiAgICAgICAgICB9KDAgfCB0MiwgZTIsIGUyLmxlbmd0aCwgMCkgOiAwOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4vdXRpbHMiOiAzMiB9XSwgNTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICByLmJhc2U2NCA9IGZhbHNlLCByLmJpbmFyeSA9IGZhbHNlLCByLmRpciA9IGZhbHNlLCByLmNyZWF0ZUZvbGRlcnMgPSB0cnVlLCByLmRhdGUgPSBudWxsLCByLmNvbXByZXNzaW9uID0gbnVsbCwgci5jb21wcmVzc2lvbk9wdGlvbnMgPSBudWxsLCByLmNvbW1lbnQgPSBudWxsLCByLnVuaXhQZXJtaXNzaW9ucyA9IG51bGwsIHIuZG9zUGVybWlzc2lvbnMgPSBudWxsOwogICAgICB9LCB7fV0sIDY6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSBudWxsOwogICAgICAgIG4gPSAidW5kZWZpbmVkIiAhPSB0eXBlb2YgUHJvbWlzZSA/IFByb21pc2UgOiBlKCJsaWUiKSwgdC5leHBvcnRzID0geyBQcm9taXNlOiBuIH07CiAgICAgIH0sIHsgbGllOiAzNyB9XSwgNzogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9ICJ1bmRlZmluZWQiICE9IHR5cGVvZiBVaW50OEFycmF5ICYmICJ1bmRlZmluZWQiICE9IHR5cGVvZiBVaW50MTZBcnJheSAmJiAidW5kZWZpbmVkIiAhPSB0eXBlb2YgVWludDMyQXJyYXksIGkgPSBlKCJwYWtvIiksIHMgPSBlKCIuL3V0aWxzIiksIGEgPSBlKCIuL3N0cmVhbS9HZW5lcmljV29ya2VyIiksIG8gPSBuID8gInVpbnQ4YXJyYXkiIDogImFycmF5IjsKICAgICAgICBmdW5jdGlvbiBoKGUyLCB0MikgewogICAgICAgICAgYS5jYWxsKHRoaXMsICJGbGF0ZVdvcmtlci8iICsgZTIpLCB0aGlzLl9wYWtvID0gbnVsbCwgdGhpcy5fcGFrb0FjdGlvbiA9IGUyLCB0aGlzLl9wYWtvT3B0aW9ucyA9IHQyLCB0aGlzLm1ldGEgPSB7fTsKICAgICAgICB9CiAgICAgICAgci5tYWdpYyA9ICJcYlwwIiwgcy5pbmhlcml0cyhoLCBhKSwgaC5wcm90b3R5cGUucHJvY2Vzc0NodW5rID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHRoaXMubWV0YSA9IGUyLm1ldGEsIG51bGwgPT09IHRoaXMuX3Bha28gJiYgdGhpcy5fY3JlYXRlUGFrbygpLCB0aGlzLl9wYWtvLnB1c2gocy50cmFuc2Zvcm1UbyhvLCBlMi5kYXRhKSwgZmFsc2UpOwogICAgICAgIH0sIGgucHJvdG90eXBlLmZsdXNoID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICBhLnByb3RvdHlwZS5mbHVzaC5jYWxsKHRoaXMpLCBudWxsID09PSB0aGlzLl9wYWtvICYmIHRoaXMuX2NyZWF0ZVBha28oKSwgdGhpcy5fcGFrby5wdXNoKFtdLCB0cnVlKTsKICAgICAgICB9LCBoLnByb3RvdHlwZS5jbGVhblVwID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICBhLnByb3RvdHlwZS5jbGVhblVwLmNhbGwodGhpcyksIHRoaXMuX3Bha28gPSBudWxsOwogICAgICAgIH0sIGgucHJvdG90eXBlLl9jcmVhdGVQYWtvID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICB0aGlzLl9wYWtvID0gbmV3IGlbdGhpcy5fcGFrb0FjdGlvbl0oeyByYXc6IHRydWUsIGxldmVsOiB0aGlzLl9wYWtvT3B0aW9ucy5sZXZlbCB8fCAtMSB9KTsKICAgICAgICAgIHZhciB0MiA9IHRoaXM7CiAgICAgICAgICB0aGlzLl9wYWtvLm9uRGF0YSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICAgIHQyLnB1c2goeyBkYXRhOiBlMiwgbWV0YTogdDIubWV0YSB9KTsKICAgICAgICAgIH07CiAgICAgICAgfSwgci5jb21wcmVzc1dvcmtlciA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gbmV3IGgoIkRlZmxhdGUiLCBlMik7CiAgICAgICAgfSwgci51bmNvbXByZXNzV29ya2VyID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICByZXR1cm4gbmV3IGgoIkluZmxhdGUiLCB7fSk7CiAgICAgICAgfTsKICAgICAgfSwgeyAiLi9zdHJlYW0vR2VuZXJpY1dvcmtlciI6IDI4LCAiLi91dGlscyI6IDMyLCBwYWtvOiAzOCB9XSwgODogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICBmdW5jdGlvbiBBKGUyLCB0MikgewogICAgICAgICAgdmFyIHIyLCBuMiA9ICIiOwogICAgICAgICAgZm9yIChyMiA9IDA7IHIyIDwgdDI7IHIyKyspCiAgICAgICAgICAgIG4yICs9IFN0cmluZy5mcm9tQ2hhckNvZGUoMjU1ICYgZTIpLCBlMiA+Pj49IDg7CiAgICAgICAgICByZXR1cm4gbjI7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIG4oZTIsIHQyLCByMiwgbjIsIGkyLCBzMikgewogICAgICAgICAgdmFyIGEsIG8sIGggPSBlMi5maWxlLCB1ID0gZTIuY29tcHJlc3Npb24sIGwgPSBzMiAhPT0gTy51dGY4ZW5jb2RlLCBmID0gSS50cmFuc2Zvcm1Ubygic3RyaW5nIiwgczIoaC5uYW1lKSksIGMgPSBJLnRyYW5zZm9ybVRvKCJzdHJpbmciLCBPLnV0ZjhlbmNvZGUoaC5uYW1lKSksIGQgPSBoLmNvbW1lbnQsIHAgPSBJLnRyYW5zZm9ybVRvKCJzdHJpbmciLCBzMihkKSksIG0gPSBJLnRyYW5zZm9ybVRvKCJzdHJpbmciLCBPLnV0ZjhlbmNvZGUoZCkpLCBfID0gYy5sZW5ndGggIT09IGgubmFtZS5sZW5ndGgsIGcgPSBtLmxlbmd0aCAhPT0gZC5sZW5ndGgsIGIgPSAiIiwgdiA9ICIiLCB5ID0gIiIsIHcgPSBoLmRpciwgayA9IGguZGF0ZSwgeCA9IHsgY3JjMzI6IDAsIGNvbXByZXNzZWRTaXplOiAwLCB1bmNvbXByZXNzZWRTaXplOiAwIH07CiAgICAgICAgICB0MiAmJiAhcjIgfHwgKHguY3JjMzIgPSBlMi5jcmMzMiwgeC5jb21wcmVzc2VkU2l6ZSA9IGUyLmNvbXByZXNzZWRTaXplLCB4LnVuY29tcHJlc3NlZFNpemUgPSBlMi51bmNvbXByZXNzZWRTaXplKTsKICAgICAgICAgIHZhciBTID0gMDsKICAgICAgICAgIHQyICYmIChTIHw9IDgpLCBsIHx8ICFfICYmICFnIHx8IChTIHw9IDIwNDgpOwogICAgICAgICAgdmFyIHogPSAwLCBDID0gMDsKICAgICAgICAgIHcgJiYgKHogfD0gMTYpLCAiVU5JWCIgPT09IGkyID8gKEMgPSA3OTgsIHogfD0gZnVuY3Rpb24oZTMsIHQzKSB7CiAgICAgICAgICAgIHZhciByMyA9IGUzOwogICAgICAgICAgICByZXR1cm4gZTMgfHwgKHIzID0gdDMgPyAxNjg5MyA6IDMzMjA0KSwgKDY1NTM1ICYgcjMpIDw8IDE2OwogICAgICAgICAgfShoLnVuaXhQZXJtaXNzaW9ucywgdykpIDogKEMgPSAyMCwgeiB8PSBmdW5jdGlvbihlMykgewogICAgICAgICAgICByZXR1cm4gNjMgJiAoZTMgfHwgMCk7CiAgICAgICAgICB9KGguZG9zUGVybWlzc2lvbnMpKSwgYSA9IGsuZ2V0VVRDSG91cnMoKSwgYSA8PD0gNiwgYSB8PSBrLmdldFVUQ01pbnV0ZXMoKSwgYSA8PD0gNSwgYSB8PSBrLmdldFVUQ1NlY29uZHMoKSAvIDIsIG8gPSBrLmdldFVUQ0Z1bGxZZWFyKCkgLSAxOTgwLCBvIDw8PSA0LCBvIHw9IGsuZ2V0VVRDTW9udGgoKSArIDEsIG8gPDw9IDUsIG8gfD0gay5nZXRVVENEYXRlKCksIF8gJiYgKHYgPSBBKDEsIDEpICsgQShCKGYpLCA0KSArIGMsIGIgKz0gInVwIiArIEEodi5sZW5ndGgsIDIpICsgdiksIGcgJiYgKHkgPSBBKDEsIDEpICsgQShCKHApLCA0KSArIG0sIGIgKz0gInVjIiArIEEoeS5sZW5ndGgsIDIpICsgeSk7CiAgICAgICAgICB2YXIgRSA9ICIiOwogICAgICAgICAgcmV0dXJuIEUgKz0gIlxuXDAiLCBFICs9IEEoUywgMiksIEUgKz0gdS5tYWdpYywgRSArPSBBKGEsIDIpLCBFICs9IEEobywgMiksIEUgKz0gQSh4LmNyYzMyLCA0KSwgRSArPSBBKHguY29tcHJlc3NlZFNpemUsIDQpLCBFICs9IEEoeC51bmNvbXByZXNzZWRTaXplLCA0KSwgRSArPSBBKGYubGVuZ3RoLCAyKSwgRSArPSBBKGIubGVuZ3RoLCAyKSwgeyBmaWxlUmVjb3JkOiBSLkxPQ0FMX0ZJTEVfSEVBREVSICsgRSArIGYgKyBiLCBkaXJSZWNvcmQ6IFIuQ0VOVFJBTF9GSUxFX0hFQURFUiArIEEoQywgMikgKyBFICsgQShwLmxlbmd0aCwgMikgKyAiXDBcMFwwXDAiICsgQSh6LCA0KSArIEEobjIsIDQpICsgZiArIGIgKyBwIH07CiAgICAgICAgfQogICAgICAgIHZhciBJID0gZSgiLi4vdXRpbHMiKSwgaSA9IGUoIi4uL3N0cmVhbS9HZW5lcmljV29ya2VyIiksIE8gPSBlKCIuLi91dGY4IiksIEIgPSBlKCIuLi9jcmMzMiIpLCBSID0gZSgiLi4vc2lnbmF0dXJlIik7CiAgICAgICAgZnVuY3Rpb24gcyhlMiwgdDIsIHIyLCBuMikgewogICAgICAgICAgaS5jYWxsKHRoaXMsICJaaXBGaWxlV29ya2VyIiksIHRoaXMuYnl0ZXNXcml0dGVuID0gMCwgdGhpcy56aXBDb21tZW50ID0gdDIsIHRoaXMuemlwUGxhdGZvcm0gPSByMiwgdGhpcy5lbmNvZGVGaWxlTmFtZSA9IG4yLCB0aGlzLnN0cmVhbUZpbGVzID0gZTIsIHRoaXMuYWNjdW11bGF0ZSA9IGZhbHNlLCB0aGlzLmNvbnRlbnRCdWZmZXIgPSBbXSwgdGhpcy5kaXJSZWNvcmRzID0gW10sIHRoaXMuY3VycmVudFNvdXJjZU9mZnNldCA9IDAsIHRoaXMuZW50cmllc0NvdW50ID0gMCwgdGhpcy5jdXJyZW50RmlsZSA9IG51bGwsIHRoaXMuX3NvdXJjZXMgPSBbXTsKICAgICAgICB9CiAgICAgICAgSS5pbmhlcml0cyhzLCBpKSwgcy5wcm90b3R5cGUucHVzaCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBlMi5tZXRhLnBlcmNlbnQgfHwgMCwgcjIgPSB0aGlzLmVudHJpZXNDb3VudCwgbjIgPSB0aGlzLl9zb3VyY2VzLmxlbmd0aDsKICAgICAgICAgIHRoaXMuYWNjdW11bGF0ZSA/IHRoaXMuY29udGVudEJ1ZmZlci5wdXNoKGUyKSA6ICh0aGlzLmJ5dGVzV3JpdHRlbiArPSBlMi5kYXRhLmxlbmd0aCwgaS5wcm90b3R5cGUucHVzaC5jYWxsKHRoaXMsIHsgZGF0YTogZTIuZGF0YSwgbWV0YTogeyBjdXJyZW50RmlsZTogdGhpcy5jdXJyZW50RmlsZSwgcGVyY2VudDogcjIgPyAodDIgKyAxMDAgKiAocjIgLSBuMiAtIDEpKSAvIHIyIDogMTAwIH0gfSkpOwogICAgICAgIH0sIHMucHJvdG90eXBlLm9wZW5lZFNvdXJjZSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLmN1cnJlbnRTb3VyY2VPZmZzZXQgPSB0aGlzLmJ5dGVzV3JpdHRlbiwgdGhpcy5jdXJyZW50RmlsZSA9IGUyLmZpbGUubmFtZTsKICAgICAgICAgIHZhciB0MiA9IHRoaXMuc3RyZWFtRmlsZXMgJiYgIWUyLmZpbGUuZGlyOwogICAgICAgICAgaWYgKHQyKSB7CiAgICAgICAgICAgIHZhciByMiA9IG4oZTIsIHQyLCBmYWxzZSwgdGhpcy5jdXJyZW50U291cmNlT2Zmc2V0LCB0aGlzLnppcFBsYXRmb3JtLCB0aGlzLmVuY29kZUZpbGVOYW1lKTsKICAgICAgICAgICAgdGhpcy5wdXNoKHsgZGF0YTogcjIuZmlsZVJlY29yZCwgbWV0YTogeyBwZXJjZW50OiAwIH0gfSk7CiAgICAgICAgICB9IGVsc2UKICAgICAgICAgICAgdGhpcy5hY2N1bXVsYXRlID0gdHJ1ZTsKICAgICAgICB9LCBzLnByb3RvdHlwZS5jbG9zZWRTb3VyY2UgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5hY2N1bXVsYXRlID0gZmFsc2U7CiAgICAgICAgICB2YXIgdDIgPSB0aGlzLnN0cmVhbUZpbGVzICYmICFlMi5maWxlLmRpciwgcjIgPSBuKGUyLCB0MiwgdHJ1ZSwgdGhpcy5jdXJyZW50U291cmNlT2Zmc2V0LCB0aGlzLnppcFBsYXRmb3JtLCB0aGlzLmVuY29kZUZpbGVOYW1lKTsKICAgICAgICAgIGlmICh0aGlzLmRpclJlY29yZHMucHVzaChyMi5kaXJSZWNvcmQpLCB0MikKICAgICAgICAgICAgdGhpcy5wdXNoKHsgZGF0YTogZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgICByZXR1cm4gUi5EQVRBX0RFU0NSSVBUT1IgKyBBKGUzLmNyYzMyLCA0KSArIEEoZTMuY29tcHJlc3NlZFNpemUsIDQpICsgQShlMy51bmNvbXByZXNzZWRTaXplLCA0KTsKICAgICAgICAgICAgfShlMiksIG1ldGE6IHsgcGVyY2VudDogMTAwIH0gfSk7CiAgICAgICAgICBlbHNlCiAgICAgICAgICAgIGZvciAodGhpcy5wdXNoKHsgZGF0YTogcjIuZmlsZVJlY29yZCwgbWV0YTogeyBwZXJjZW50OiAwIH0gfSk7IHRoaXMuY29udGVudEJ1ZmZlci5sZW5ndGg7ICkKICAgICAgICAgICAgICB0aGlzLnB1c2godGhpcy5jb250ZW50QnVmZmVyLnNoaWZ0KCkpOwogICAgICAgICAgdGhpcy5jdXJyZW50RmlsZSA9IG51bGw7CiAgICAgICAgfSwgcy5wcm90b3R5cGUuZmx1c2ggPSBmdW5jdGlvbigpIHsKICAgICAgICAgIGZvciAodmFyIGUyID0gdGhpcy5ieXRlc1dyaXR0ZW4sIHQyID0gMDsgdDIgPCB0aGlzLmRpclJlY29yZHMubGVuZ3RoOyB0MisrKQogICAgICAgICAgICB0aGlzLnB1c2goeyBkYXRhOiB0aGlzLmRpclJlY29yZHNbdDJdLCBtZXRhOiB7IHBlcmNlbnQ6IDEwMCB9IH0pOwogICAgICAgICAgdmFyIHIyID0gdGhpcy5ieXRlc1dyaXR0ZW4gLSBlMiwgbjIgPSBmdW5jdGlvbihlMywgdDMsIHIzLCBuMywgaTIpIHsKICAgICAgICAgICAgdmFyIHMyID0gSS50cmFuc2Zvcm1Ubygic3RyaW5nIiwgaTIobjMpKTsKICAgICAgICAgICAgcmV0dXJuIFIuQ0VOVFJBTF9ESVJFQ1RPUllfRU5EICsgIlwwXDBcMFwwIiArIEEoZTMsIDIpICsgQShlMywgMikgKyBBKHQzLCA0KSArIEEocjMsIDQpICsgQShzMi5sZW5ndGgsIDIpICsgczI7CiAgICAgICAgICB9KHRoaXMuZGlyUmVjb3Jkcy5sZW5ndGgsIHIyLCBlMiwgdGhpcy56aXBDb21tZW50LCB0aGlzLmVuY29kZUZpbGVOYW1lKTsKICAgICAgICAgIHRoaXMucHVzaCh7IGRhdGE6IG4yLCBtZXRhOiB7IHBlcmNlbnQ6IDEwMCB9IH0pOwogICAgICAgIH0sIHMucHJvdG90eXBlLnByZXBhcmVOZXh0U291cmNlID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICB0aGlzLnByZXZpb3VzID0gdGhpcy5fc291cmNlcy5zaGlmdCgpLCB0aGlzLm9wZW5lZFNvdXJjZSh0aGlzLnByZXZpb3VzLnN0cmVhbUluZm8pLCB0aGlzLmlzUGF1c2VkID8gdGhpcy5wcmV2aW91cy5wYXVzZSgpIDogdGhpcy5wcmV2aW91cy5yZXN1bWUoKTsKICAgICAgICB9LCBzLnByb3RvdHlwZS5yZWdpc3RlclByZXZpb3VzID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHRoaXMuX3NvdXJjZXMucHVzaChlMik7CiAgICAgICAgICB2YXIgdDIgPSB0aGlzOwogICAgICAgICAgcmV0dXJuIGUyLm9uKCJkYXRhIiwgZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdDIucHJvY2Vzc0NodW5rKGUzKTsKICAgICAgICAgIH0pLCBlMi5vbigiZW5kIiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIHQyLmNsb3NlZFNvdXJjZSh0Mi5wcmV2aW91cy5zdHJlYW1JbmZvKSwgdDIuX3NvdXJjZXMubGVuZ3RoID8gdDIucHJlcGFyZU5leHRTb3VyY2UoKSA6IHQyLmVuZCgpOwogICAgICAgICAgfSksIGUyLm9uKCJlcnJvciIsIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHQyLmVycm9yKGUzKTsKICAgICAgICAgIH0pLCB0aGlzOwogICAgICAgIH0sIHMucHJvdG90eXBlLnJlc3VtZSA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgcmV0dXJuICEhaS5wcm90b3R5cGUucmVzdW1lLmNhbGwodGhpcykgJiYgKCF0aGlzLnByZXZpb3VzICYmIHRoaXMuX3NvdXJjZXMubGVuZ3RoID8gKHRoaXMucHJlcGFyZU5leHRTb3VyY2UoKSwgdHJ1ZSkgOiB0aGlzLnByZXZpb3VzIHx8IHRoaXMuX3NvdXJjZXMubGVuZ3RoIHx8IHRoaXMuZ2VuZXJhdGVkRXJyb3IgPyB2b2lkIDAgOiAodGhpcy5lbmQoKSwgdHJ1ZSkpOwogICAgICAgIH0sIHMucHJvdG90eXBlLmVycm9yID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHZhciB0MiA9IHRoaXMuX3NvdXJjZXM7CiAgICAgICAgICBpZiAoIWkucHJvdG90eXBlLmVycm9yLmNhbGwodGhpcywgZTIpKQogICAgICAgICAgICByZXR1cm4gZmFsc2U7CiAgICAgICAgICBmb3IgKHZhciByMiA9IDA7IHIyIDwgdDIubGVuZ3RoOyByMisrKQogICAgICAgICAgICB0cnkgewogICAgICAgICAgICAgIHQyW3IyXS5lcnJvcihlMik7CiAgICAgICAgICAgIH0gY2F0Y2ggKGUzKSB7CiAgICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiB0cnVlOwogICAgICAgIH0sIHMucHJvdG90eXBlLmxvY2sgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIGkucHJvdG90eXBlLmxvY2suY2FsbCh0aGlzKTsKICAgICAgICAgIGZvciAodmFyIGUyID0gdGhpcy5fc291cmNlcywgdDIgPSAwOyB0MiA8IGUyLmxlbmd0aDsgdDIrKykKICAgICAgICAgICAgZTJbdDJdLmxvY2soKTsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBzOwogICAgICB9LCB7ICIuLi9jcmMzMiI6IDQsICIuLi9zaWduYXR1cmUiOiAyMywgIi4uL3N0cmVhbS9HZW5lcmljV29ya2VyIjogMjgsICIuLi91dGY4IjogMzEsICIuLi91dGlscyI6IDMyIH1dLCA5OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciB1ID0gZSgiLi4vY29tcHJlc3Npb25zIiksIG4gPSBlKCIuL1ppcEZpbGVXb3JrZXIiKTsKICAgICAgICByLmdlbmVyYXRlV29ya2VyID0gZnVuY3Rpb24oZTIsIGEsIHQyKSB7CiAgICAgICAgICB2YXIgbyA9IG5ldyBuKGEuc3RyZWFtRmlsZXMsIHQyLCBhLnBsYXRmb3JtLCBhLmVuY29kZUZpbGVOYW1lKSwgaCA9IDA7CiAgICAgICAgICB0cnkgewogICAgICAgICAgICBlMi5mb3JFYWNoKGZ1bmN0aW9uKGUzLCB0MykgewogICAgICAgICAgICAgIGgrKzsKICAgICAgICAgICAgICB2YXIgcjIgPSBmdW5jdGlvbihlNCwgdDQpIHsKICAgICAgICAgICAgICAgIHZhciByMyA9IGU0IHx8IHQ0LCBuMyA9IHVbcjNdOwogICAgICAgICAgICAgICAgaWYgKCFuMykKICAgICAgICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKHIzICsgIiBpcyBub3QgYSB2YWxpZCBjb21wcmVzc2lvbiBtZXRob2QgISIpOwogICAgICAgICAgICAgICAgcmV0dXJuIG4zOwogICAgICAgICAgICAgIH0odDMub3B0aW9ucy5jb21wcmVzc2lvbiwgYS5jb21wcmVzc2lvbiksIG4yID0gdDMub3B0aW9ucy5jb21wcmVzc2lvbk9wdGlvbnMgfHwgYS5jb21wcmVzc2lvbk9wdGlvbnMgfHwge30sIGkgPSB0My5kaXIsIHMgPSB0My5kYXRlOwogICAgICAgICAgICAgIHQzLl9jb21wcmVzc1dvcmtlcihyMiwgbjIpLndpdGhTdHJlYW1JbmZvKCJmaWxlIiwgeyBuYW1lOiBlMywgZGlyOiBpLCBkYXRlOiBzLCBjb21tZW50OiB0My5jb21tZW50IHx8ICIiLCB1bml4UGVybWlzc2lvbnM6IHQzLnVuaXhQZXJtaXNzaW9ucywgZG9zUGVybWlzc2lvbnM6IHQzLmRvc1Blcm1pc3Npb25zIH0pLnBpcGUobyk7CiAgICAgICAgICAgIH0pLCBvLmVudHJpZXNDb3VudCA9IGg7CiAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICBvLmVycm9yKGUzKTsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiBvOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4uL2NvbXByZXNzaW9ucyI6IDMsICIuL1ppcEZpbGVXb3JrZXIiOiA4IH1dLCAxMDogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICBmdW5jdGlvbiBuKCkgewogICAgICAgICAgaWYgKCEodGhpcyBpbnN0YW5jZW9mIG4pKQogICAgICAgICAgICByZXR1cm4gbmV3IG4oKTsKICAgICAgICAgIGlmIChhcmd1bWVudHMubGVuZ3RoKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIlRoZSBjb25zdHJ1Y3RvciB3aXRoIHBhcmFtZXRlcnMgaGFzIGJlZW4gcmVtb3ZlZCBpbiBKU1ppcCAzLjAsIHBsZWFzZSBjaGVjayB0aGUgdXBncmFkZSBndWlkZS4iKTsKICAgICAgICAgIHRoaXMuZmlsZXMgPSAvKiBAX19QVVJFX18gKi8gT2JqZWN0LmNyZWF0ZShudWxsKSwgdGhpcy5jb21tZW50ID0gbnVsbCwgdGhpcy5yb290ID0gIiIsIHRoaXMuY2xvbmUgPSBmdW5jdGlvbigpIHsKICAgICAgICAgICAgdmFyIGUyID0gbmV3IG4oKTsKICAgICAgICAgICAgZm9yICh2YXIgdDIgaW4gdGhpcykKICAgICAgICAgICAgICAiZnVuY3Rpb24iICE9IHR5cGVvZiB0aGlzW3QyXSAmJiAoZTJbdDJdID0gdGhpc1t0Ml0pOwogICAgICAgICAgICByZXR1cm4gZTI7CiAgICAgICAgICB9OwogICAgICAgIH0KICAgICAgICAobi5wcm90b3R5cGUgPSBlKCIuL29iamVjdCIpKS5sb2FkQXN5bmMgPSBlKCIuL2xvYWQiKSwgbi5zdXBwb3J0ID0gZSgiLi9zdXBwb3J0IiksIG4uZGVmYXVsdHMgPSBlKCIuL2RlZmF1bHRzIiksIG4udmVyc2lvbiA9ICIzLjEwLjEiLCBuLmxvYWRBc3luYyA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIG5ldyBuKCkubG9hZEFzeW5jKGUyLCB0Mik7CiAgICAgICAgfSwgbi5leHRlcm5hbCA9IGUoIi4vZXh0ZXJuYWwiKSwgdC5leHBvcnRzID0gbjsKICAgICAgfSwgeyAiLi9kZWZhdWx0cyI6IDUsICIuL2V4dGVybmFsIjogNiwgIi4vbG9hZCI6IDExLCAiLi9vYmplY3QiOiAxNSwgIi4vc3VwcG9ydCI6IDMwIH1dLCAxMTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgdSA9IGUoIi4vdXRpbHMiKSwgaSA9IGUoIi4vZXh0ZXJuYWwiKSwgbiA9IGUoIi4vdXRmOCIpLCBzID0gZSgiLi96aXBFbnRyaWVzIiksIGEgPSBlKCIuL3N0cmVhbS9DcmMzMlByb2JlIiksIGwgPSBlKCIuL25vZGVqc1V0aWxzIik7CiAgICAgICAgZnVuY3Rpb24gZihuMikgewogICAgICAgICAgcmV0dXJuIG5ldyBpLlByb21pc2UoZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICAgIHZhciByMiA9IG4yLmRlY29tcHJlc3NlZC5nZXRDb250ZW50V29ya2VyKCkucGlwZShuZXcgYSgpKTsKICAgICAgICAgICAgcjIub24oImVycm9yIiwgZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgICB0MihlMyk7CiAgICAgICAgICAgIH0pLm9uKCJlbmQiLCBmdW5jdGlvbigpIHsKICAgICAgICAgICAgICByMi5zdHJlYW1JbmZvLmNyYzMyICE9PSBuMi5kZWNvbXByZXNzZWQuY3JjMzIgPyB0MihuZXcgRXJyb3IoIkNvcnJ1cHRlZCB6aXAgOiBDUkMzMiBtaXNtYXRjaCIpKSA6IGUyKCk7CiAgICAgICAgICAgIH0pLnJlc3VtZSgpOwogICAgICAgICAgfSk7CiAgICAgICAgfQogICAgICAgIHQuZXhwb3J0cyA9IGZ1bmN0aW9uKGUyLCBvKSB7CiAgICAgICAgICB2YXIgaCA9IHRoaXM7CiAgICAgICAgICByZXR1cm4gbyA9IHUuZXh0ZW5kKG8gfHwge30sIHsgYmFzZTY0OiBmYWxzZSwgY2hlY2tDUkMzMjogZmFsc2UsIG9wdGltaXplZEJpbmFyeVN0cmluZzogZmFsc2UsIGNyZWF0ZUZvbGRlcnM6IGZhbHNlLCBkZWNvZGVGaWxlTmFtZTogbi51dGY4ZGVjb2RlIH0pLCBsLmlzTm9kZSAmJiBsLmlzU3RyZWFtKGUyKSA/IGkuUHJvbWlzZS5yZWplY3QobmV3IEVycm9yKCJKU1ppcCBjYW4ndCBhY2NlcHQgYSBzdHJlYW0gd2hlbiBsb2FkaW5nIGEgemlwIGZpbGUuIikpIDogdS5wcmVwYXJlQ29udGVudCgidGhlIGxvYWRlZCB6aXAgZmlsZSIsIGUyLCB0cnVlLCBvLm9wdGltaXplZEJpbmFyeVN0cmluZywgby5iYXNlNjQpLnRoZW4oZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdmFyIHQyID0gbmV3IHMobyk7CiAgICAgICAgICAgIHJldHVybiB0Mi5sb2FkKGUzKSwgdDI7CiAgICAgICAgICB9KS50aGVuKGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHZhciB0MiA9IFtpLlByb21pc2UucmVzb2x2ZShlMyldLCByMiA9IGUzLmZpbGVzOwogICAgICAgICAgICBpZiAoby5jaGVja0NSQzMyKQogICAgICAgICAgICAgIGZvciAodmFyIG4yID0gMDsgbjIgPCByMi5sZW5ndGg7IG4yKyspCiAgICAgICAgICAgICAgICB0Mi5wdXNoKGYocjJbbjJdKSk7CiAgICAgICAgICAgIHJldHVybiBpLlByb21pc2UuYWxsKHQyKTsKICAgICAgICAgIH0pLnRoZW4oZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgZm9yICh2YXIgdDIgPSBlMy5zaGlmdCgpLCByMiA9IHQyLmZpbGVzLCBuMiA9IDA7IG4yIDwgcjIubGVuZ3RoOyBuMisrKSB7CiAgICAgICAgICAgICAgdmFyIGkyID0gcjJbbjJdLCBzMiA9IGkyLmZpbGVOYW1lU3RyLCBhMiA9IHUucmVzb2x2ZShpMi5maWxlTmFtZVN0cik7CiAgICAgICAgICAgICAgaC5maWxlKGEyLCBpMi5kZWNvbXByZXNzZWQsIHsgYmluYXJ5OiB0cnVlLCBvcHRpbWl6ZWRCaW5hcnlTdHJpbmc6IHRydWUsIGRhdGU6IGkyLmRhdGUsIGRpcjogaTIuZGlyLCBjb21tZW50OiBpMi5maWxlQ29tbWVudFN0ci5sZW5ndGggPyBpMi5maWxlQ29tbWVudFN0ciA6IG51bGwsIHVuaXhQZXJtaXNzaW9uczogaTIudW5peFBlcm1pc3Npb25zLCBkb3NQZXJtaXNzaW9uczogaTIuZG9zUGVybWlzc2lvbnMsIGNyZWF0ZUZvbGRlcnM6IG8uY3JlYXRlRm9sZGVycyB9KSwgaTIuZGlyIHx8IChoLmZpbGUoYTIpLnVuc2FmZU9yaWdpbmFsTmFtZSA9IHMyKTsKICAgICAgICAgICAgfQogICAgICAgICAgICByZXR1cm4gdDIuemlwQ29tbWVudC5sZW5ndGggJiYgKGguY29tbWVudCA9IHQyLnppcENvbW1lbnQpLCBoOwogICAgICAgICAgfSk7CiAgICAgICAgfTsKICAgICAgfSwgeyAiLi9leHRlcm5hbCI6IDYsICIuL25vZGVqc1V0aWxzIjogMTQsICIuL3N0cmVhbS9DcmMzMlByb2JlIjogMjUsICIuL3V0ZjgiOiAzMSwgIi4vdXRpbHMiOiAzMiwgIi4vemlwRW50cmllcyI6IDMzIH1dLCAxMjogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9IGUoIi4uL3V0aWxzIiksIGkgPSBlKCIuLi9zdHJlYW0vR2VuZXJpY1dvcmtlciIpOwogICAgICAgIGZ1bmN0aW9uIHMoZTIsIHQyKSB7CiAgICAgICAgICBpLmNhbGwodGhpcywgIk5vZGVqcyBzdHJlYW0gaW5wdXQgYWRhcHRlciBmb3IgIiArIGUyKSwgdGhpcy5fdXBzdHJlYW1FbmRlZCA9IGZhbHNlLCB0aGlzLl9iaW5kU3RyZWFtKHQyKTsKICAgICAgICB9CiAgICAgICAgbi5pbmhlcml0cyhzLCBpKSwgcy5wcm90b3R5cGUuX2JpbmRTdHJlYW0gPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyID0gdGhpczsKICAgICAgICAgICh0aGlzLl9zdHJlYW0gPSBlMikucGF1c2UoKSwgZTIub24oImRhdGEiLCBmdW5jdGlvbihlMykgewogICAgICAgICAgICB0Mi5wdXNoKHsgZGF0YTogZTMsIG1ldGE6IHsgcGVyY2VudDogMCB9IH0pOwogICAgICAgICAgfSkub24oImVycm9yIiwgZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdDIuaXNQYXVzZWQgPyB0aGlzLmdlbmVyYXRlZEVycm9yID0gZTMgOiB0Mi5lcnJvcihlMyk7CiAgICAgICAgICB9KS5vbigiZW5kIiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIHQyLmlzUGF1c2VkID8gdDIuX3Vwc3RyZWFtRW5kZWQgPSB0cnVlIDogdDIuZW5kKCk7CiAgICAgICAgICB9KTsKICAgICAgICB9LCBzLnByb3RvdHlwZS5wYXVzZSA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgcmV0dXJuICEhaS5wcm90b3R5cGUucGF1c2UuY2FsbCh0aGlzKSAmJiAodGhpcy5fc3RyZWFtLnBhdXNlKCksIHRydWUpOwogICAgICAgIH0sIHMucHJvdG90eXBlLnJlc3VtZSA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgcmV0dXJuICEhaS5wcm90b3R5cGUucmVzdW1lLmNhbGwodGhpcykgJiYgKHRoaXMuX3Vwc3RyZWFtRW5kZWQgPyB0aGlzLmVuZCgpIDogdGhpcy5fc3RyZWFtLnJlc3VtZSgpLCB0cnVlKTsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBzOwogICAgICB9LCB7ICIuLi9zdHJlYW0vR2VuZXJpY1dvcmtlciI6IDI4LCAiLi4vdXRpbHMiOiAzMiB9XSwgMTM6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIGkgPSBlKCJyZWFkYWJsZS1zdHJlYW0iKS5SZWFkYWJsZTsKICAgICAgICBmdW5jdGlvbiBuKGUyLCB0MiwgcjIpIHsKICAgICAgICAgIGkuY2FsbCh0aGlzLCB0MiksIHRoaXMuX2hlbHBlciA9IGUyOwogICAgICAgICAgdmFyIG4yID0gdGhpczsKICAgICAgICAgIGUyLm9uKCJkYXRhIiwgZnVuY3Rpb24oZTMsIHQzKSB7CiAgICAgICAgICAgIG4yLnB1c2goZTMpIHx8IG4yLl9oZWxwZXIucGF1c2UoKSwgcjIgJiYgcjIodDMpOwogICAgICAgICAgfSkub24oImVycm9yIiwgZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgbjIuZW1pdCgiZXJyb3IiLCBlMyk7CiAgICAgICAgICB9KS5vbigiZW5kIiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIG4yLnB1c2gobnVsbCk7CiAgICAgICAgICB9KTsKICAgICAgICB9CiAgICAgICAgZSgiLi4vdXRpbHMiKS5pbmhlcml0cyhuLCBpKSwgbi5wcm90b3R5cGUuX3JlYWQgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIHRoaXMuX2hlbHBlci5yZXN1bWUoKTsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBuOwogICAgICB9LCB7ICIuLi91dGlscyI6IDMyLCAicmVhZGFibGUtc3RyZWFtIjogMTYgfV0sIDE0OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHQuZXhwb3J0cyA9IHsgaXNOb2RlOiAidW5kZWZpbmVkIiAhPSB0eXBlb2YgQnVmZmVyLCBuZXdCdWZmZXJGcm9tOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIGlmIChCdWZmZXIuZnJvbSAmJiBCdWZmZXIuZnJvbSAhPT0gVWludDhBcnJheS5mcm9tKQogICAgICAgICAgICByZXR1cm4gQnVmZmVyLmZyb20oZTIsIHQyKTsKICAgICAgICAgIGlmICgibnVtYmVyIiA9PSB0eXBlb2YgZTIpCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcignVGhlICJkYXRhIiBhcmd1bWVudCBtdXN0IG5vdCBiZSBhIG51bWJlcicpOwogICAgICAgICAgcmV0dXJuIG5ldyBCdWZmZXIoZTIsIHQyKTsKICAgICAgICB9LCBhbGxvY0J1ZmZlcjogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmIChCdWZmZXIuYWxsb2MpCiAgICAgICAgICAgIHJldHVybiBCdWZmZXIuYWxsb2MoZTIpOwogICAgICAgICAgdmFyIHQyID0gbmV3IEJ1ZmZlcihlMik7CiAgICAgICAgICByZXR1cm4gdDIuZmlsbCgwKSwgdDI7CiAgICAgICAgfSwgaXNCdWZmZXI6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gQnVmZmVyLmlzQnVmZmVyKGUyKTsKICAgICAgICB9LCBpc1N0cmVhbTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBlMiAmJiAiZnVuY3Rpb24iID09IHR5cGVvZiBlMi5vbiAmJiAiZnVuY3Rpb24iID09IHR5cGVvZiBlMi5wYXVzZSAmJiAiZnVuY3Rpb24iID09IHR5cGVvZiBlMi5yZXN1bWU7CiAgICAgICAgfSB9OwogICAgICB9LCB7fV0sIDE1OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIGZ1bmN0aW9uIHMoZTIsIHQyLCByMikgewogICAgICAgICAgdmFyIG4yLCBpMiA9IHUuZ2V0VHlwZU9mKHQyKSwgczIgPSB1LmV4dGVuZChyMiB8fCB7fSwgZik7CiAgICAgICAgICBzMi5kYXRlID0gczIuZGF0ZSB8fCAvKiBAX19QVVJFX18gKi8gbmV3IERhdGUoKSwgbnVsbCAhPT0gczIuY29tcHJlc3Npb24gJiYgKHMyLmNvbXByZXNzaW9uID0gczIuY29tcHJlc3Npb24udG9VcHBlckNhc2UoKSksICJzdHJpbmciID09IHR5cGVvZiBzMi51bml4UGVybWlzc2lvbnMgJiYgKHMyLnVuaXhQZXJtaXNzaW9ucyA9IHBhcnNlSW50KHMyLnVuaXhQZXJtaXNzaW9ucywgOCkpLCBzMi51bml4UGVybWlzc2lvbnMgJiYgMTYzODQgJiBzMi51bml4UGVybWlzc2lvbnMgJiYgKHMyLmRpciA9IHRydWUpLCBzMi5kb3NQZXJtaXNzaW9ucyAmJiAxNiAmIHMyLmRvc1Blcm1pc3Npb25zICYmIChzMi5kaXIgPSB0cnVlKSwgczIuZGlyICYmIChlMiA9IGcoZTIpKSwgczIuY3JlYXRlRm9sZGVycyAmJiAobjIgPSBfKGUyKSkgJiYgYi5jYWxsKHRoaXMsIG4yLCB0cnVlKTsKICAgICAgICAgIHZhciBhMiA9ICJzdHJpbmciID09PSBpMiAmJiBmYWxzZSA9PT0gczIuYmluYXJ5ICYmIGZhbHNlID09PSBzMi5iYXNlNjQ7CiAgICAgICAgICByMiAmJiB2b2lkIDAgIT09IHIyLmJpbmFyeSB8fCAoczIuYmluYXJ5ID0gIWEyKSwgKHQyIGluc3RhbmNlb2YgYyAmJiAwID09PSB0Mi51bmNvbXByZXNzZWRTaXplIHx8IHMyLmRpciB8fCAhdDIgfHwgMCA9PT0gdDIubGVuZ3RoKSAmJiAoczIuYmFzZTY0ID0gZmFsc2UsIHMyLmJpbmFyeSA9IHRydWUsIHQyID0gIiIsIHMyLmNvbXByZXNzaW9uID0gIlNUT1JFIiwgaTIgPSAic3RyaW5nIik7CiAgICAgICAgICB2YXIgbzIgPSBudWxsOwogICAgICAgICAgbzIgPSB0MiBpbnN0YW5jZW9mIGMgfHwgdDIgaW5zdGFuY2VvZiBsID8gdDIgOiBwLmlzTm9kZSAmJiBwLmlzU3RyZWFtKHQyKSA/IG5ldyBtKGUyLCB0MikgOiB1LnByZXBhcmVDb250ZW50KGUyLCB0MiwgczIuYmluYXJ5LCBzMi5vcHRpbWl6ZWRCaW5hcnlTdHJpbmcsIHMyLmJhc2U2NCk7CiAgICAgICAgICB2YXIgaDIgPSBuZXcgZChlMiwgbzIsIHMyKTsKICAgICAgICAgIHRoaXMuZmlsZXNbZTJdID0gaDI7CiAgICAgICAgfQogICAgICAgIHZhciBpID0gZSgiLi91dGY4IiksIHUgPSBlKCIuL3V0aWxzIiksIGwgPSBlKCIuL3N0cmVhbS9HZW5lcmljV29ya2VyIiksIGEgPSBlKCIuL3N0cmVhbS9TdHJlYW1IZWxwZXIiKSwgZiA9IGUoIi4vZGVmYXVsdHMiKSwgYyA9IGUoIi4vY29tcHJlc3NlZE9iamVjdCIpLCBkID0gZSgiLi96aXBPYmplY3QiKSwgbyA9IGUoIi4vZ2VuZXJhdGUiKSwgcCA9IGUoIi4vbm9kZWpzVXRpbHMiKSwgbSA9IGUoIi4vbm9kZWpzL05vZGVqc1N0cmVhbUlucHV0QWRhcHRlciIpLCBfID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgICIvIiA9PT0gZTIuc2xpY2UoLTEpICYmIChlMiA9IGUyLnN1YnN0cmluZygwLCBlMi5sZW5ndGggLSAxKSk7CiAgICAgICAgICB2YXIgdDIgPSBlMi5sYXN0SW5kZXhPZigiLyIpOwogICAgICAgICAgcmV0dXJuIDAgPCB0MiA/IGUyLnN1YnN0cmluZygwLCB0MikgOiAiIjsKICAgICAgICB9LCBnID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiAiLyIgIT09IGUyLnNsaWNlKC0xKSAmJiAoZTIgKz0gIi8iKSwgZTI7CiAgICAgICAgfSwgYiA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIHQyID0gdm9pZCAwICE9PSB0MiA/IHQyIDogZi5jcmVhdGVGb2xkZXJzLCBlMiA9IGcoZTIpLCB0aGlzLmZpbGVzW2UyXSB8fCBzLmNhbGwodGhpcywgZTIsIG51bGwsIHsgZGlyOiB0cnVlLCBjcmVhdGVGb2xkZXJzOiB0MiB9KSwgdGhpcy5maWxlc1tlMl07CiAgICAgICAgfTsKICAgICAgICBmdW5jdGlvbiBoKGUyKSB7CiAgICAgICAgICByZXR1cm4gIltvYmplY3QgUmVnRXhwXSIgPT09IE9iamVjdC5wcm90b3R5cGUudG9TdHJpbmcuY2FsbChlMik7CiAgICAgICAgfQogICAgICAgIHZhciBuID0geyBsb2FkOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiVGhpcyBtZXRob2QgaGFzIGJlZW4gcmVtb3ZlZCBpbiBKU1ppcCAzLjAsIHBsZWFzZSBjaGVjayB0aGUgdXBncmFkZSBndWlkZS4iKTsKICAgICAgICB9LCBmb3JFYWNoOiBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyLCByMiwgbjI7CiAgICAgICAgICBmb3IgKHQyIGluIHRoaXMuZmlsZXMpCiAgICAgICAgICAgIG4yID0gdGhpcy5maWxlc1t0Ml0sIChyMiA9IHQyLnNsaWNlKHRoaXMucm9vdC5sZW5ndGgsIHQyLmxlbmd0aCkpICYmIHQyLnNsaWNlKDAsIHRoaXMucm9vdC5sZW5ndGgpID09PSB0aGlzLnJvb3QgJiYgZTIocjIsIG4yKTsKICAgICAgICB9LCBmaWx0ZXI6IGZ1bmN0aW9uKHIyKSB7CiAgICAgICAgICB2YXIgbjIgPSBbXTsKICAgICAgICAgIHJldHVybiB0aGlzLmZvckVhY2goZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICAgIHIyKGUyLCB0MikgJiYgbjIucHVzaCh0Mik7CiAgICAgICAgICB9KSwgbjI7CiAgICAgICAgfSwgZmlsZTogZnVuY3Rpb24oZTIsIHQyLCByMikgewogICAgICAgICAgaWYgKDEgIT09IGFyZ3VtZW50cy5sZW5ndGgpCiAgICAgICAgICAgIHJldHVybiBlMiA9IHRoaXMucm9vdCArIGUyLCBzLmNhbGwodGhpcywgZTIsIHQyLCByMiksIHRoaXM7CiAgICAgICAgICBpZiAoaChlMikpIHsKICAgICAgICAgICAgdmFyIG4yID0gZTI7CiAgICAgICAgICAgIHJldHVybiB0aGlzLmZpbHRlcihmdW5jdGlvbihlMywgdDMpIHsKICAgICAgICAgICAgICByZXR1cm4gIXQzLmRpciAmJiBuMi50ZXN0KGUzKTsKICAgICAgICAgICAgfSk7CiAgICAgICAgICB9CiAgICAgICAgICB2YXIgaTIgPSB0aGlzLmZpbGVzW3RoaXMucm9vdCArIGUyXTsKICAgICAgICAgIHJldHVybiBpMiAmJiAhaTIuZGlyID8gaTIgOiBudWxsOwogICAgICAgIH0sIGZvbGRlcjogZnVuY3Rpb24ocjIpIHsKICAgICAgICAgIGlmICghcjIpCiAgICAgICAgICAgIHJldHVybiB0aGlzOwogICAgICAgICAgaWYgKGgocjIpKQogICAgICAgICAgICByZXR1cm4gdGhpcy5maWx0ZXIoZnVuY3Rpb24oZTMsIHQzKSB7CiAgICAgICAgICAgICAgcmV0dXJuIHQzLmRpciAmJiByMi50ZXN0KGUzKTsKICAgICAgICAgICAgfSk7CiAgICAgICAgICB2YXIgZTIgPSB0aGlzLnJvb3QgKyByMiwgdDIgPSBiLmNhbGwodGhpcywgZTIpLCBuMiA9IHRoaXMuY2xvbmUoKTsKICAgICAgICAgIHJldHVybiBuMi5yb290ID0gdDIubmFtZSwgbjI7CiAgICAgICAgfSwgcmVtb3ZlOiBmdW5jdGlvbihyMikgewogICAgICAgICAgcjIgPSB0aGlzLnJvb3QgKyByMjsKICAgICAgICAgIHZhciBlMiA9IHRoaXMuZmlsZXNbcjJdOwogICAgICAgICAgaWYgKGUyIHx8ICgiLyIgIT09IHIyLnNsaWNlKC0xKSAmJiAocjIgKz0gIi8iKSwgZTIgPSB0aGlzLmZpbGVzW3IyXSksIGUyICYmICFlMi5kaXIpCiAgICAgICAgICAgIGRlbGV0ZSB0aGlzLmZpbGVzW3IyXTsKICAgICAgICAgIGVsc2UKICAgICAgICAgICAgZm9yICh2YXIgdDIgPSB0aGlzLmZpbHRlcihmdW5jdGlvbihlMywgdDMpIHsKICAgICAgICAgICAgICByZXR1cm4gdDMubmFtZS5zbGljZSgwLCByMi5sZW5ndGgpID09PSByMjsKICAgICAgICAgICAgfSksIG4yID0gMDsgbjIgPCB0Mi5sZW5ndGg7IG4yKyspCiAgICAgICAgICAgICAgZGVsZXRlIHRoaXMuZmlsZXNbdDJbbjJdLm5hbWVdOwogICAgICAgICAgcmV0dXJuIHRoaXM7CiAgICAgICAgfSwgZ2VuZXJhdGU6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJUaGlzIG1ldGhvZCBoYXMgYmVlbiByZW1vdmVkIGluIEpTWmlwIDMuMCwgcGxlYXNlIGNoZWNrIHRoZSB1cGdyYWRlIGd1aWRlLiIpOwogICAgICAgIH0sIGdlbmVyYXRlSW50ZXJuYWxTdHJlYW06IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIsIHIyID0ge307CiAgICAgICAgICB0cnkgewogICAgICAgICAgICBpZiAoKHIyID0gdS5leHRlbmQoZTIgfHwge30sIHsgc3RyZWFtRmlsZXM6IGZhbHNlLCBjb21wcmVzc2lvbjogIlNUT1JFIiwgY29tcHJlc3Npb25PcHRpb25zOiBudWxsLCB0eXBlOiAiIiwgcGxhdGZvcm06ICJET1MiLCBjb21tZW50OiBudWxsLCBtaW1lVHlwZTogImFwcGxpY2F0aW9uL3ppcCIsIGVuY29kZUZpbGVOYW1lOiBpLnV0ZjhlbmNvZGUgfSkpLnR5cGUgPSByMi50eXBlLnRvTG93ZXJDYXNlKCksIHIyLmNvbXByZXNzaW9uID0gcjIuY29tcHJlc3Npb24udG9VcHBlckNhc2UoKSwgImJpbmFyeXN0cmluZyIgPT09IHIyLnR5cGUgJiYgKHIyLnR5cGUgPSAic3RyaW5nIiksICFyMi50eXBlKQogICAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiTm8gb3V0cHV0IHR5cGUgc3BlY2lmaWVkLiIpOwogICAgICAgICAgICB1LmNoZWNrU3VwcG9ydChyMi50eXBlKSwgImRhcndpbiIgIT09IHIyLnBsYXRmb3JtICYmICJmcmVlYnNkIiAhPT0gcjIucGxhdGZvcm0gJiYgImxpbnV4IiAhPT0gcjIucGxhdGZvcm0gJiYgInN1bm9zIiAhPT0gcjIucGxhdGZvcm0gfHwgKHIyLnBsYXRmb3JtID0gIlVOSVgiKSwgIndpbjMyIiA9PT0gcjIucGxhdGZvcm0gJiYgKHIyLnBsYXRmb3JtID0gIkRPUyIpOwogICAgICAgICAgICB2YXIgbjIgPSByMi5jb21tZW50IHx8IHRoaXMuY29tbWVudCB8fCAiIjsKICAgICAgICAgICAgdDIgPSBvLmdlbmVyYXRlV29ya2VyKHRoaXMsIHIyLCBuMik7CiAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICAodDIgPSBuZXcgbCgiZXJyb3IiKSkuZXJyb3IoZTMpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIG5ldyBhKHQyLCByMi50eXBlIHx8ICJzdHJpbmciLCByMi5taW1lVHlwZSk7CiAgICAgICAgfSwgZ2VuZXJhdGVBc3luYzogZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICByZXR1cm4gdGhpcy5nZW5lcmF0ZUludGVybmFsU3RyZWFtKGUyKS5hY2N1bXVsYXRlKHQyKTsKICAgICAgICB9LCBnZW5lcmF0ZU5vZGVTdHJlYW06IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIChlMiA9IGUyIHx8IHt9KS50eXBlIHx8IChlMi50eXBlID0gIm5vZGVidWZmZXIiKSwgdGhpcy5nZW5lcmF0ZUludGVybmFsU3RyZWFtKGUyKS50b05vZGVqc1N0cmVhbSh0Mik7CiAgICAgICAgfSB9OwogICAgICAgIHQuZXhwb3J0cyA9IG47CiAgICAgIH0sIHsgIi4vY29tcHJlc3NlZE9iamVjdCI6IDIsICIuL2RlZmF1bHRzIjogNSwgIi4vZ2VuZXJhdGUiOiA5LCAiLi9ub2RlanMvTm9kZWpzU3RyZWFtSW5wdXRBZGFwdGVyIjogMTIsICIuL25vZGVqc1V0aWxzIjogMTQsICIuL3N0cmVhbS9HZW5lcmljV29ya2VyIjogMjgsICIuL3N0cmVhbS9TdHJlYW1IZWxwZXIiOiAyOSwgIi4vdXRmOCI6IDMxLCAiLi91dGlscyI6IDMyLCAiLi96aXBPYmplY3QiOiAzNSB9XSwgMTY6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdC5leHBvcnRzID0gZSgic3RyZWFtIik7CiAgICAgIH0sIHsgc3RyZWFtOiB2b2lkIDAgfV0sIDE3OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9EYXRhUmVhZGVyIik7CiAgICAgICAgZnVuY3Rpb24gaShlMikgewogICAgICAgICAgbi5jYWxsKHRoaXMsIGUyKTsKICAgICAgICAgIGZvciAodmFyIHQyID0gMDsgdDIgPCB0aGlzLmRhdGEubGVuZ3RoOyB0MisrKQogICAgICAgICAgICBlMlt0Ml0gPSAyNTUgJiBlMlt0Ml07CiAgICAgICAgfQogICAgICAgIGUoIi4uL3V0aWxzIikuaW5oZXJpdHMoaSwgbiksIGkucHJvdG90eXBlLmJ5dGVBdCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gdGhpcy5kYXRhW3RoaXMuemVybyArIGUyXTsKICAgICAgICB9LCBpLnByb3RvdHlwZS5sYXN0SW5kZXhPZlNpZ25hdHVyZSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBmb3IgKHZhciB0MiA9IGUyLmNoYXJDb2RlQXQoMCksIHIyID0gZTIuY2hhckNvZGVBdCgxKSwgbjIgPSBlMi5jaGFyQ29kZUF0KDIpLCBpMiA9IGUyLmNoYXJDb2RlQXQoMyksIHMgPSB0aGlzLmxlbmd0aCAtIDQ7IDAgPD0gczsgLS1zKQogICAgICAgICAgICBpZiAodGhpcy5kYXRhW3NdID09PSB0MiAmJiB0aGlzLmRhdGFbcyArIDFdID09PSByMiAmJiB0aGlzLmRhdGFbcyArIDJdID09PSBuMiAmJiB0aGlzLmRhdGFbcyArIDNdID09PSBpMikKICAgICAgICAgICAgICByZXR1cm4gcyAtIHRoaXMuemVybzsKICAgICAgICAgIHJldHVybiAtMTsKICAgICAgICB9LCBpLnByb3RvdHlwZS5yZWFkQW5kQ2hlY2tTaWduYXR1cmUgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyID0gZTIuY2hhckNvZGVBdCgwKSwgcjIgPSBlMi5jaGFyQ29kZUF0KDEpLCBuMiA9IGUyLmNoYXJDb2RlQXQoMiksIGkyID0gZTIuY2hhckNvZGVBdCgzKSwgcyA9IHRoaXMucmVhZERhdGEoNCk7CiAgICAgICAgICByZXR1cm4gdDIgPT09IHNbMF0gJiYgcjIgPT09IHNbMV0gJiYgbjIgPT09IHNbMl0gJiYgaTIgPT09IHNbM107CiAgICAgICAgfSwgaS5wcm90b3R5cGUucmVhZERhdGEgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgaWYgKHRoaXMuY2hlY2tPZmZzZXQoZTIpLCAwID09PSBlMikKICAgICAgICAgICAgcmV0dXJuIFtdOwogICAgICAgICAgdmFyIHQyID0gdGhpcy5kYXRhLnNsaWNlKHRoaXMuemVybyArIHRoaXMuaW5kZXgsIHRoaXMuemVybyArIHRoaXMuaW5kZXggKyBlMik7CiAgICAgICAgICByZXR1cm4gdGhpcy5pbmRleCArPSBlMiwgdDI7CiAgICAgICAgfSwgdC5leHBvcnRzID0gaTsKICAgICAgfSwgeyAiLi4vdXRpbHMiOiAzMiwgIi4vRGF0YVJlYWRlciI6IDE4IH1dLCAxODogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9IGUoIi4uL3V0aWxzIik7CiAgICAgICAgZnVuY3Rpb24gaShlMikgewogICAgICAgICAgdGhpcy5kYXRhID0gZTIsIHRoaXMubGVuZ3RoID0gZTIubGVuZ3RoLCB0aGlzLmluZGV4ID0gMCwgdGhpcy56ZXJvID0gMDsKICAgICAgICB9CiAgICAgICAgaS5wcm90b3R5cGUgPSB7IGNoZWNrT2Zmc2V0OiBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5jaGVja0luZGV4KHRoaXMuaW5kZXggKyBlMik7CiAgICAgICAgfSwgY2hlY2tJbmRleDogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmICh0aGlzLmxlbmd0aCA8IHRoaXMuemVybyArIGUyIHx8IGUyIDwgMCkKICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJFbmQgb2YgZGF0YSByZWFjaGVkIChkYXRhIGxlbmd0aCA9ICIgKyB0aGlzLmxlbmd0aCArICIsIGFza2VkIGluZGV4ID0gIiArIGUyICsgIikuIENvcnJ1cHRlZCB6aXAgPyIpOwogICAgICAgIH0sIHNldEluZGV4OiBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5jaGVja0luZGV4KGUyKSwgdGhpcy5pbmRleCA9IGUyOwogICAgICAgIH0sIHNraXA6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLnNldEluZGV4KHRoaXMuaW5kZXggKyBlMik7CiAgICAgICAgfSwgYnl0ZUF0OiBmdW5jdGlvbigpIHsKICAgICAgICB9LCByZWFkSW50OiBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyLCByMiA9IDA7CiAgICAgICAgICBmb3IgKHRoaXMuY2hlY2tPZmZzZXQoZTIpLCB0MiA9IHRoaXMuaW5kZXggKyBlMiAtIDE7IHQyID49IHRoaXMuaW5kZXg7IHQyLS0pCiAgICAgICAgICAgIHIyID0gKHIyIDw8IDgpICsgdGhpcy5ieXRlQXQodDIpOwogICAgICAgICAgcmV0dXJuIHRoaXMuaW5kZXggKz0gZTIsIHIyOwogICAgICAgIH0sIHJlYWRTdHJpbmc6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gbi50cmFuc2Zvcm1Ubygic3RyaW5nIiwgdGhpcy5yZWFkRGF0YShlMikpOwogICAgICAgIH0sIHJlYWREYXRhOiBmdW5jdGlvbigpIHsKICAgICAgICB9LCBsYXN0SW5kZXhPZlNpZ25hdHVyZTogZnVuY3Rpb24oKSB7CiAgICAgICAgfSwgcmVhZEFuZENoZWNrU2lnbmF0dXJlOiBmdW5jdGlvbigpIHsKICAgICAgICB9LCByZWFkRGF0ZTogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTIgPSB0aGlzLnJlYWRJbnQoNCk7CiAgICAgICAgICByZXR1cm4gbmV3IERhdGUoRGF0ZS5VVEMoMTk4MCArIChlMiA+PiAyNSAmIDEyNyksIChlMiA+PiAyMSAmIDE1KSAtIDEsIGUyID4+IDE2ICYgMzEsIGUyID4+IDExICYgMzEsIGUyID4+IDUgJiA2MywgKDMxICYgZTIpIDw8IDEpKTsKICAgICAgICB9IH0sIHQuZXhwb3J0cyA9IGk7CiAgICAgIH0sIHsgIi4uL3V0aWxzIjogMzIgfV0sIDE5OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9VaW50OEFycmF5UmVhZGVyIik7CiAgICAgICAgZnVuY3Rpb24gaShlMikgewogICAgICAgICAgbi5jYWxsKHRoaXMsIGUyKTsKICAgICAgICB9CiAgICAgICAgZSgiLi4vdXRpbHMiKS5pbmhlcml0cyhpLCBuKSwgaS5wcm90b3R5cGUucmVhZERhdGEgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5jaGVja09mZnNldChlMik7CiAgICAgICAgICB2YXIgdDIgPSB0aGlzLmRhdGEuc2xpY2UodGhpcy56ZXJvICsgdGhpcy5pbmRleCwgdGhpcy56ZXJvICsgdGhpcy5pbmRleCArIGUyKTsKICAgICAgICAgIHJldHVybiB0aGlzLmluZGV4ICs9IGUyLCB0MjsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBpOwogICAgICB9LCB7ICIuLi91dGlscyI6IDMyLCAiLi9VaW50OEFycmF5UmVhZGVyIjogMjEgfV0sIDIwOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9EYXRhUmVhZGVyIik7CiAgICAgICAgZnVuY3Rpb24gaShlMikgewogICAgICAgICAgbi5jYWxsKHRoaXMsIGUyKTsKICAgICAgICB9CiAgICAgICAgZSgiLi4vdXRpbHMiKS5pbmhlcml0cyhpLCBuKSwgaS5wcm90b3R5cGUuYnl0ZUF0ID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiB0aGlzLmRhdGEuY2hhckNvZGVBdCh0aGlzLnplcm8gKyBlMik7CiAgICAgICAgfSwgaS5wcm90b3R5cGUubGFzdEluZGV4T2ZTaWduYXR1cmUgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIHRoaXMuZGF0YS5sYXN0SW5kZXhPZihlMikgLSB0aGlzLnplcm87CiAgICAgICAgfSwgaS5wcm90b3R5cGUucmVhZEFuZENoZWNrU2lnbmF0dXJlID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBlMiA9PT0gdGhpcy5yZWFkRGF0YSg0KTsKICAgICAgICB9LCBpLnByb3RvdHlwZS5yZWFkRGF0YSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLmNoZWNrT2Zmc2V0KGUyKTsKICAgICAgICAgIHZhciB0MiA9IHRoaXMuZGF0YS5zbGljZSh0aGlzLnplcm8gKyB0aGlzLmluZGV4LCB0aGlzLnplcm8gKyB0aGlzLmluZGV4ICsgZTIpOwogICAgICAgICAgcmV0dXJuIHRoaXMuaW5kZXggKz0gZTIsIHQyOwogICAgICAgIH0sIHQuZXhwb3J0cyA9IGk7CiAgICAgIH0sIHsgIi4uL3V0aWxzIjogMzIsICIuL0RhdGFSZWFkZXIiOiAxOCB9XSwgMjE6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSBlKCIuL0FycmF5UmVhZGVyIik7CiAgICAgICAgZnVuY3Rpb24gaShlMikgewogICAgICAgICAgbi5jYWxsKHRoaXMsIGUyKTsKICAgICAgICB9CiAgICAgICAgZSgiLi4vdXRpbHMiKS5pbmhlcml0cyhpLCBuKSwgaS5wcm90b3R5cGUucmVhZERhdGEgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgaWYgKHRoaXMuY2hlY2tPZmZzZXQoZTIpLCAwID09PSBlMikKICAgICAgICAgICAgcmV0dXJuIG5ldyBVaW50OEFycmF5KDApOwogICAgICAgICAgdmFyIHQyID0gdGhpcy5kYXRhLnN1YmFycmF5KHRoaXMuemVybyArIHRoaXMuaW5kZXgsIHRoaXMuemVybyArIHRoaXMuaW5kZXggKyBlMik7CiAgICAgICAgICByZXR1cm4gdGhpcy5pbmRleCArPSBlMiwgdDI7CiAgICAgICAgfSwgdC5leHBvcnRzID0gaTsKICAgICAgfSwgeyAiLi4vdXRpbHMiOiAzMiwgIi4vQXJyYXlSZWFkZXIiOiAxNyB9XSwgMjI6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSBlKCIuLi91dGlscyIpLCBpID0gZSgiLi4vc3VwcG9ydCIpLCBzID0gZSgiLi9BcnJheVJlYWRlciIpLCBhID0gZSgiLi9TdHJpbmdSZWFkZXIiKSwgbyA9IGUoIi4vTm9kZUJ1ZmZlclJlYWRlciIpLCBoID0gZSgiLi9VaW50OEFycmF5UmVhZGVyIik7CiAgICAgICAgdC5leHBvcnRzID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHZhciB0MiA9IG4uZ2V0VHlwZU9mKGUyKTsKICAgICAgICAgIHJldHVybiBuLmNoZWNrU3VwcG9ydCh0MiksICJzdHJpbmciICE9PSB0MiB8fCBpLnVpbnQ4YXJyYXkgPyAibm9kZWJ1ZmZlciIgPT09IHQyID8gbmV3IG8oZTIpIDogaS51aW50OGFycmF5ID8gbmV3IGgobi50cmFuc2Zvcm1UbygidWludDhhcnJheSIsIGUyKSkgOiBuZXcgcyhuLnRyYW5zZm9ybVRvKCJhcnJheSIsIGUyKSkgOiBuZXcgYShlMik7CiAgICAgICAgfTsKICAgICAgfSwgeyAiLi4vc3VwcG9ydCI6IDMwLCAiLi4vdXRpbHMiOiAzMiwgIi4vQXJyYXlSZWFkZXIiOiAxNywgIi4vTm9kZUJ1ZmZlclJlYWRlciI6IDE5LCAiLi9TdHJpbmdSZWFkZXIiOiAyMCwgIi4vVWludDhBcnJheVJlYWRlciI6IDIxIH1dLCAyMzogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICByLkxPQ0FMX0ZJTEVfSEVBREVSID0gIlBLAwQiLCByLkNFTlRSQUxfRklMRV9IRUFERVIgPSAiUEsBAiIsIHIuQ0VOVFJBTF9ESVJFQ1RPUllfRU5EID0gIlBLBQYiLCByLlpJUDY0X0NFTlRSQUxfRElSRUNUT1JZX0xPQ0FUT1IgPSAiUEsGXHgwNyIsIHIuWklQNjRfQ0VOVFJBTF9ESVJFQ1RPUllfRU5EID0gIlBLBgYiLCByLkRBVEFfREVTQ1JJUFRPUiA9ICJQS1x4MDdcYiI7CiAgICAgIH0sIHt9XSwgMjQ6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSBlKCIuL0dlbmVyaWNXb3JrZXIiKSwgaSA9IGUoIi4uL3V0aWxzIik7CiAgICAgICAgZnVuY3Rpb24gcyhlMikgewogICAgICAgICAgbi5jYWxsKHRoaXMsICJDb252ZXJ0V29ya2VyIHRvICIgKyBlMiksIHRoaXMuZGVzdFR5cGUgPSBlMjsKICAgICAgICB9CiAgICAgICAgaS5pbmhlcml0cyhzLCBuKSwgcy5wcm90b3R5cGUucHJvY2Vzc0NodW5rID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHRoaXMucHVzaCh7IGRhdGE6IGkudHJhbnNmb3JtVG8odGhpcy5kZXN0VHlwZSwgZTIuZGF0YSksIG1ldGE6IGUyLm1ldGEgfSk7CiAgICAgICAgfSwgdC5leHBvcnRzID0gczsKICAgICAgfSwgeyAiLi4vdXRpbHMiOiAzMiwgIi4vR2VuZXJpY1dvcmtlciI6IDI4IH1dLCAyNTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9IGUoIi4vR2VuZXJpY1dvcmtlciIpLCBpID0gZSgiLi4vY3JjMzIiKTsKICAgICAgICBmdW5jdGlvbiBzKCkgewogICAgICAgICAgbi5jYWxsKHRoaXMsICJDcmMzMlByb2JlIiksIHRoaXMud2l0aFN0cmVhbUluZm8oImNyYzMyIiwgMCk7CiAgICAgICAgfQogICAgICAgIGUoIi4uL3V0aWxzIikuaW5oZXJpdHMocywgbiksIHMucHJvdG90eXBlLnByb2Nlc3NDaHVuayA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLnN0cmVhbUluZm8uY3JjMzIgPSBpKGUyLmRhdGEsIHRoaXMuc3RyZWFtSW5mby5jcmMzMiB8fCAwKSwgdGhpcy5wdXNoKGUyKTsKICAgICAgICB9LCB0LmV4cG9ydHMgPSBzOwogICAgICB9LCB7ICIuLi9jcmMzMiI6IDQsICIuLi91dGlscyI6IDMyLCAiLi9HZW5lcmljV29ya2VyIjogMjggfV0sIDI2OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi4vdXRpbHMiKSwgaSA9IGUoIi4vR2VuZXJpY1dvcmtlciIpOwogICAgICAgIGZ1bmN0aW9uIHMoZTIpIHsKICAgICAgICAgIGkuY2FsbCh0aGlzLCAiRGF0YUxlbmd0aFByb2JlIGZvciAiICsgZTIpLCB0aGlzLnByb3BOYW1lID0gZTIsIHRoaXMud2l0aFN0cmVhbUluZm8oZTIsIDApOwogICAgICAgIH0KICAgICAgICBuLmluaGVyaXRzKHMsIGkpLCBzLnByb3RvdHlwZS5wcm9jZXNzQ2h1bmsgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgaWYgKGUyKSB7CiAgICAgICAgICAgIHZhciB0MiA9IHRoaXMuc3RyZWFtSW5mb1t0aGlzLnByb3BOYW1lXSB8fCAwOwogICAgICAgICAgICB0aGlzLnN0cmVhbUluZm9bdGhpcy5wcm9wTmFtZV0gPSB0MiArIGUyLmRhdGEubGVuZ3RoOwogICAgICAgICAgfQogICAgICAgICAgaS5wcm90b3R5cGUucHJvY2Vzc0NodW5rLmNhbGwodGhpcywgZTIpOwogICAgICAgIH0sIHQuZXhwb3J0cyA9IHM7CiAgICAgIH0sIHsgIi4uL3V0aWxzIjogMzIsICIuL0dlbmVyaWNXb3JrZXIiOiAyOCB9XSwgMjc6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSBlKCIuLi91dGlscyIpLCBpID0gZSgiLi9HZW5lcmljV29ya2VyIik7CiAgICAgICAgZnVuY3Rpb24gcyhlMikgewogICAgICAgICAgaS5jYWxsKHRoaXMsICJEYXRhV29ya2VyIik7CiAgICAgICAgICB2YXIgdDIgPSB0aGlzOwogICAgICAgICAgdGhpcy5kYXRhSXNSZWFkeSA9IGZhbHNlLCB0aGlzLmluZGV4ID0gMCwgdGhpcy5tYXggPSAwLCB0aGlzLmRhdGEgPSBudWxsLCB0aGlzLnR5cGUgPSAiIiwgdGhpcy5fdGlja1NjaGVkdWxlZCA9IGZhbHNlLCBlMi50aGVuKGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHQyLmRhdGFJc1JlYWR5ID0gdHJ1ZSwgdDIuZGF0YSA9IGUzLCB0Mi5tYXggPSBlMyAmJiBlMy5sZW5ndGggfHwgMCwgdDIudHlwZSA9IG4uZ2V0VHlwZU9mKGUzKSwgdDIuaXNQYXVzZWQgfHwgdDIuX3RpY2tBbmRSZXBlYXQoKTsKICAgICAgICAgIH0sIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHQyLmVycm9yKGUzKTsKICAgICAgICAgIH0pOwogICAgICAgIH0KICAgICAgICBuLmluaGVyaXRzKHMsIGkpLCBzLnByb3RvdHlwZS5jbGVhblVwID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICBpLnByb3RvdHlwZS5jbGVhblVwLmNhbGwodGhpcyksIHRoaXMuZGF0YSA9IG51bGw7CiAgICAgICAgfSwgcy5wcm90b3R5cGUucmVzdW1lID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICByZXR1cm4gISFpLnByb3RvdHlwZS5yZXN1bWUuY2FsbCh0aGlzKSAmJiAoIXRoaXMuX3RpY2tTY2hlZHVsZWQgJiYgdGhpcy5kYXRhSXNSZWFkeSAmJiAodGhpcy5fdGlja1NjaGVkdWxlZCA9IHRydWUsIG4uZGVsYXkodGhpcy5fdGlja0FuZFJlcGVhdCwgW10sIHRoaXMpKSwgdHJ1ZSk7CiAgICAgICAgfSwgcy5wcm90b3R5cGUuX3RpY2tBbmRSZXBlYXQgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIHRoaXMuX3RpY2tTY2hlZHVsZWQgPSBmYWxzZSwgdGhpcy5pc1BhdXNlZCB8fCB0aGlzLmlzRmluaXNoZWQgfHwgKHRoaXMuX3RpY2soKSwgdGhpcy5pc0ZpbmlzaGVkIHx8IChuLmRlbGF5KHRoaXMuX3RpY2tBbmRSZXBlYXQsIFtdLCB0aGlzKSwgdGhpcy5fdGlja1NjaGVkdWxlZCA9IHRydWUpKTsKICAgICAgICB9LCBzLnByb3RvdHlwZS5fdGljayA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgaWYgKHRoaXMuaXNQYXVzZWQgfHwgdGhpcy5pc0ZpbmlzaGVkKQogICAgICAgICAgICByZXR1cm4gZmFsc2U7CiAgICAgICAgICB2YXIgZTIgPSBudWxsLCB0MiA9IE1hdGgubWluKHRoaXMubWF4LCB0aGlzLmluZGV4ICsgMTYzODQpOwogICAgICAgICAgaWYgKHRoaXMuaW5kZXggPj0gdGhpcy5tYXgpCiAgICAgICAgICAgIHJldHVybiB0aGlzLmVuZCgpOwogICAgICAgICAgc3dpdGNoICh0aGlzLnR5cGUpIHsKICAgICAgICAgICAgY2FzZSAic3RyaW5nIjoKICAgICAgICAgICAgICBlMiA9IHRoaXMuZGF0YS5zdWJzdHJpbmcodGhpcy5pbmRleCwgdDIpOwogICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICBjYXNlICJ1aW50OGFycmF5IjoKICAgICAgICAgICAgICBlMiA9IHRoaXMuZGF0YS5zdWJhcnJheSh0aGlzLmluZGV4LCB0Mik7CiAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgIGNhc2UgImFycmF5IjoKICAgICAgICAgICAgY2FzZSAibm9kZWJ1ZmZlciI6CiAgICAgICAgICAgICAgZTIgPSB0aGlzLmRhdGEuc2xpY2UodGhpcy5pbmRleCwgdDIpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIHRoaXMuaW5kZXggPSB0MiwgdGhpcy5wdXNoKHsgZGF0YTogZTIsIG1ldGE6IHsgcGVyY2VudDogdGhpcy5tYXggPyB0aGlzLmluZGV4IC8gdGhpcy5tYXggKiAxMDAgOiAwIH0gfSk7CiAgICAgICAgfSwgdC5leHBvcnRzID0gczsKICAgICAgfSwgeyAiLi4vdXRpbHMiOiAzMiwgIi4vR2VuZXJpY1dvcmtlciI6IDI4IH1dLCAyODogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICBmdW5jdGlvbiBuKGUyKSB7CiAgICAgICAgICB0aGlzLm5hbWUgPSBlMiB8fCAiZGVmYXVsdCIsIHRoaXMuc3RyZWFtSW5mbyA9IHt9LCB0aGlzLmdlbmVyYXRlZEVycm9yID0gbnVsbCwgdGhpcy5leHRyYVN0cmVhbUluZm8gPSB7fSwgdGhpcy5pc1BhdXNlZCA9IHRydWUsIHRoaXMuaXNGaW5pc2hlZCA9IGZhbHNlLCB0aGlzLmlzTG9ja2VkID0gZmFsc2UsIHRoaXMuX2xpc3RlbmVycyA9IHsgZGF0YTogW10sIGVuZDogW10sIGVycm9yOiBbXSB9LCB0aGlzLnByZXZpb3VzID0gbnVsbDsKICAgICAgICB9CiAgICAgICAgbi5wcm90b3R5cGUgPSB7IHB1c2g6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLmVtaXQoImRhdGEiLCBlMik7CiAgICAgICAgfSwgZW5kOiBmdW5jdGlvbigpIHsKICAgICAgICAgIGlmICh0aGlzLmlzRmluaXNoZWQpCiAgICAgICAgICAgIHJldHVybiBmYWxzZTsKICAgICAgICAgIHRoaXMuZmx1c2goKTsKICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgIHRoaXMuZW1pdCgiZW5kIiksIHRoaXMuY2xlYW5VcCgpLCB0aGlzLmlzRmluaXNoZWQgPSB0cnVlOwogICAgICAgICAgfSBjYXRjaCAoZTIpIHsKICAgICAgICAgICAgdGhpcy5lbWl0KCJlcnJvciIsIGUyKTsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiB0cnVlOwogICAgICAgIH0sIGVycm9yOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuICF0aGlzLmlzRmluaXNoZWQgJiYgKHRoaXMuaXNQYXVzZWQgPyB0aGlzLmdlbmVyYXRlZEVycm9yID0gZTIgOiAodGhpcy5pc0ZpbmlzaGVkID0gdHJ1ZSwgdGhpcy5lbWl0KCJlcnJvciIsIGUyKSwgdGhpcy5wcmV2aW91cyAmJiB0aGlzLnByZXZpb3VzLmVycm9yKGUyKSwgdGhpcy5jbGVhblVwKCkpLCB0cnVlKTsKICAgICAgICB9LCBvbjogZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICByZXR1cm4gdGhpcy5fbGlzdGVuZXJzW2UyXS5wdXNoKHQyKSwgdGhpczsKICAgICAgICB9LCBjbGVhblVwOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHRoaXMuc3RyZWFtSW5mbyA9IHRoaXMuZ2VuZXJhdGVkRXJyb3IgPSB0aGlzLmV4dHJhU3RyZWFtSW5mbyA9IG51bGwsIHRoaXMuX2xpc3RlbmVycyA9IFtdOwogICAgICAgIH0sIGVtaXQ6IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgaWYgKHRoaXMuX2xpc3RlbmVyc1tlMl0pCiAgICAgICAgICAgIGZvciAodmFyIHIyID0gMDsgcjIgPCB0aGlzLl9saXN0ZW5lcnNbZTJdLmxlbmd0aDsgcjIrKykKICAgICAgICAgICAgICB0aGlzLl9saXN0ZW5lcnNbZTJdW3IyXS5jYWxsKHRoaXMsIHQyKTsKICAgICAgICB9LCBwaXBlOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGUyLnJlZ2lzdGVyUHJldmlvdXModGhpcyk7CiAgICAgICAgfSwgcmVnaXN0ZXJQcmV2aW91czogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmICh0aGlzLmlzTG9ja2VkKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIlRoZSBzdHJlYW0gJyIgKyB0aGlzICsgIicgaGFzIGFscmVhZHkgYmVlbiB1c2VkLiIpOwogICAgICAgICAgdGhpcy5zdHJlYW1JbmZvID0gZTIuc3RyZWFtSW5mbywgdGhpcy5tZXJnZVN0cmVhbUluZm8oKSwgdGhpcy5wcmV2aW91cyA9IGUyOwogICAgICAgICAgdmFyIHQyID0gdGhpczsKICAgICAgICAgIHJldHVybiBlMi5vbigiZGF0YSIsIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHQyLnByb2Nlc3NDaHVuayhlMyk7CiAgICAgICAgICB9KSwgZTIub24oImVuZCIsIGZ1bmN0aW9uKCkgewogICAgICAgICAgICB0Mi5lbmQoKTsKICAgICAgICAgIH0pLCBlMi5vbigiZXJyb3IiLCBmdW5jdGlvbihlMykgewogICAgICAgICAgICB0Mi5lcnJvcihlMyk7CiAgICAgICAgICB9KSwgdGhpczsKICAgICAgICB9LCBwYXVzZTogZnVuY3Rpb24oKSB7CiAgICAgICAgICByZXR1cm4gIXRoaXMuaXNQYXVzZWQgJiYgIXRoaXMuaXNGaW5pc2hlZCAmJiAodGhpcy5pc1BhdXNlZCA9IHRydWUsIHRoaXMucHJldmlvdXMgJiYgdGhpcy5wcmV2aW91cy5wYXVzZSgpLCB0cnVlKTsKICAgICAgICB9LCByZXN1bWU6IGZ1bmN0aW9uKCkgewogICAgICAgICAgaWYgKCF0aGlzLmlzUGF1c2VkIHx8IHRoaXMuaXNGaW5pc2hlZCkKICAgICAgICAgICAgcmV0dXJuIGZhbHNlOwogICAgICAgICAgdmFyIGUyID0gdGhpcy5pc1BhdXNlZCA9IGZhbHNlOwogICAgICAgICAgcmV0dXJuIHRoaXMuZ2VuZXJhdGVkRXJyb3IgJiYgKHRoaXMuZXJyb3IodGhpcy5nZW5lcmF0ZWRFcnJvciksIGUyID0gdHJ1ZSksIHRoaXMucHJldmlvdXMgJiYgdGhpcy5wcmV2aW91cy5yZXN1bWUoKSwgIWUyOwogICAgICAgIH0sIGZsdXNoOiBmdW5jdGlvbigpIHsKICAgICAgICB9LCBwcm9jZXNzQ2h1bms6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLnB1c2goZTIpOwogICAgICAgIH0sIHdpdGhTdHJlYW1JbmZvOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHJldHVybiB0aGlzLmV4dHJhU3RyZWFtSW5mb1tlMl0gPSB0MiwgdGhpcy5tZXJnZVN0cmVhbUluZm8oKSwgdGhpczsKICAgICAgICB9LCBtZXJnZVN0cmVhbUluZm86IGZ1bmN0aW9uKCkgewogICAgICAgICAgZm9yICh2YXIgZTIgaW4gdGhpcy5leHRyYVN0cmVhbUluZm8pCiAgICAgICAgICAgIE9iamVjdC5wcm90b3R5cGUuaGFzT3duUHJvcGVydHkuY2FsbCh0aGlzLmV4dHJhU3RyZWFtSW5mbywgZTIpICYmICh0aGlzLnN0cmVhbUluZm9bZTJdID0gdGhpcy5leHRyYVN0cmVhbUluZm9bZTJdKTsKICAgICAgICB9LCBsb2NrOiBmdW5jdGlvbigpIHsKICAgICAgICAgIGlmICh0aGlzLmlzTG9ja2VkKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIlRoZSBzdHJlYW0gJyIgKyB0aGlzICsgIicgaGFzIGFscmVhZHkgYmVlbiB1c2VkLiIpOwogICAgICAgICAgdGhpcy5pc0xvY2tlZCA9IHRydWUsIHRoaXMucHJldmlvdXMgJiYgdGhpcy5wcmV2aW91cy5sb2NrKCk7CiAgICAgICAgfSwgdG9TdHJpbmc6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdmFyIGUyID0gIldvcmtlciAiICsgdGhpcy5uYW1lOwogICAgICAgICAgcmV0dXJuIHRoaXMucHJldmlvdXMgPyB0aGlzLnByZXZpb3VzICsgIiAtPiAiICsgZTIgOiBlMjsKICAgICAgICB9IH0sIHQuZXhwb3J0cyA9IG47CiAgICAgIH0sIHt9XSwgMjk6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIGggPSBlKCIuLi91dGlscyIpLCBpID0gZSgiLi9Db252ZXJ0V29ya2VyIiksIHMgPSBlKCIuL0dlbmVyaWNXb3JrZXIiKSwgdSA9IGUoIi4uL2Jhc2U2NCIpLCBuID0gZSgiLi4vc3VwcG9ydCIpLCBhID0gZSgiLi4vZXh0ZXJuYWwiKSwgbyA9IG51bGw7CiAgICAgICAgaWYgKG4ubm9kZXN0cmVhbSkKICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgIG8gPSBlKCIuLi9ub2RlanMvTm9kZWpzU3RyZWFtT3V0cHV0QWRhcHRlciIpOwogICAgICAgICAgfSBjYXRjaCAoZTIpIHsKICAgICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBsKGUyLCBvMikgewogICAgICAgICAgcmV0dXJuIG5ldyBhLlByb21pc2UoZnVuY3Rpb24odDIsIHIyKSB7CiAgICAgICAgICAgIHZhciBuMiA9IFtdLCBpMiA9IGUyLl9pbnRlcm5hbFR5cGUsIHMyID0gZTIuX291dHB1dFR5cGUsIGEyID0gZTIuX21pbWVUeXBlOwogICAgICAgICAgICBlMi5vbigiZGF0YSIsIGZ1bmN0aW9uKGUzLCB0MykgewogICAgICAgICAgICAgIG4yLnB1c2goZTMpLCBvMiAmJiBvMih0Myk7CiAgICAgICAgICAgIH0pLm9uKCJlcnJvciIsIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgICAgbjIgPSBbXSwgcjIoZTMpOwogICAgICAgICAgICB9KS5vbigiZW5kIiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgdHJ5IHsKICAgICAgICAgICAgICAgIHZhciBlMyA9IGZ1bmN0aW9uKGU0LCB0MywgcjMpIHsKICAgICAgICAgICAgICAgICAgc3dpdGNoIChlNCkgewogICAgICAgICAgICAgICAgICAgIGNhc2UgImJsb2IiOgogICAgICAgICAgICAgICAgICAgICAgcmV0dXJuIGgubmV3QmxvYihoLnRyYW5zZm9ybVRvKCJhcnJheWJ1ZmZlciIsIHQzKSwgcjMpOwogICAgICAgICAgICAgICAgICAgIGNhc2UgImJhc2U2NCI6CiAgICAgICAgICAgICAgICAgICAgICByZXR1cm4gdS5lbmNvZGUodDMpOwogICAgICAgICAgICAgICAgICAgIGRlZmF1bHQ6CiAgICAgICAgICAgICAgICAgICAgICByZXR1cm4gaC50cmFuc2Zvcm1UbyhlNCwgdDMpOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICB9KHMyLCBmdW5jdGlvbihlNCwgdDMpIHsKICAgICAgICAgICAgICAgICAgdmFyIHIzLCBuMyA9IDAsIGkzID0gbnVsbCwgczMgPSAwOwogICAgICAgICAgICAgICAgICBmb3IgKHIzID0gMDsgcjMgPCB0My5sZW5ndGg7IHIzKyspCiAgICAgICAgICAgICAgICAgICAgczMgKz0gdDNbcjNdLmxlbmd0aDsKICAgICAgICAgICAgICAgICAgc3dpdGNoIChlNCkgewogICAgICAgICAgICAgICAgICAgIGNhc2UgInN0cmluZyI6CiAgICAgICAgICAgICAgICAgICAgICByZXR1cm4gdDMuam9pbigiIik7CiAgICAgICAgICAgICAgICAgICAgY2FzZSAiYXJyYXkiOgogICAgICAgICAgICAgICAgICAgICAgcmV0dXJuIEFycmF5LnByb3RvdHlwZS5jb25jYXQuYXBwbHkoW10sIHQzKTsKICAgICAgICAgICAgICAgICAgICBjYXNlICJ1aW50OGFycmF5IjoKICAgICAgICAgICAgICAgICAgICAgIGZvciAoaTMgPSBuZXcgVWludDhBcnJheShzMyksIHIzID0gMDsgcjMgPCB0My5sZW5ndGg7IHIzKyspCiAgICAgICAgICAgICAgICAgICAgICAgIGkzLnNldCh0M1tyM10sIG4zKSwgbjMgKz0gdDNbcjNdLmxlbmd0aDsKICAgICAgICAgICAgICAgICAgICAgIHJldHVybiBpMzsKICAgICAgICAgICAgICAgICAgICBjYXNlICJub2RlYnVmZmVyIjoKICAgICAgICAgICAgICAgICAgICAgIHJldHVybiBCdWZmZXIuY29uY2F0KHQzKTsKICAgICAgICAgICAgICAgICAgICBkZWZhdWx0OgogICAgICAgICAgICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJjb25jYXQgOiB1bnN1cHBvcnRlZCB0eXBlICciICsgZTQgKyAiJyIpOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICB9KGkyLCBuMiksIGEyKTsKICAgICAgICAgICAgICAgIHQyKGUzKTsKICAgICAgICAgICAgICB9IGNhdGNoIChlNCkgewogICAgICAgICAgICAgICAgcjIoZTQpOwogICAgICAgICAgICAgIH0KICAgICAgICAgICAgICBuMiA9IFtdOwogICAgICAgICAgICB9KS5yZXN1bWUoKTsKICAgICAgICAgIH0pOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBmKGUyLCB0MiwgcjIpIHsKICAgICAgICAgIHZhciBuMiA9IHQyOwogICAgICAgICAgc3dpdGNoICh0MikgewogICAgICAgICAgICBjYXNlICJibG9iIjoKICAgICAgICAgICAgY2FzZSAiYXJyYXlidWZmZXIiOgogICAgICAgICAgICAgIG4yID0gInVpbnQ4YXJyYXkiOwogICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICBjYXNlICJiYXNlNjQiOgogICAgICAgICAgICAgIG4yID0gInN0cmluZyI7CiAgICAgICAgICB9CiAgICAgICAgICB0cnkgewogICAgICAgICAgICB0aGlzLl9pbnRlcm5hbFR5cGUgPSBuMiwgdGhpcy5fb3V0cHV0VHlwZSA9IHQyLCB0aGlzLl9taW1lVHlwZSA9IHIyLCBoLmNoZWNrU3VwcG9ydChuMiksIHRoaXMuX3dvcmtlciA9IGUyLnBpcGUobmV3IGkobjIpKSwgZTIubG9jaygpOwogICAgICAgICAgfSBjYXRjaCAoZTMpIHsKICAgICAgICAgICAgdGhpcy5fd29ya2VyID0gbmV3IHMoImVycm9yIiksIHRoaXMuX3dvcmtlci5lcnJvcihlMyk7CiAgICAgICAgICB9CiAgICAgICAgfQogICAgICAgIGYucHJvdG90eXBlID0geyBhY2N1bXVsYXRlOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGwodGhpcywgZTIpOwogICAgICAgIH0sIG9uOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiA9IHRoaXM7CiAgICAgICAgICByZXR1cm4gImRhdGEiID09PSBlMiA/IHRoaXMuX3dvcmtlci5vbihlMiwgZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdDIuY2FsbChyMiwgZTMuZGF0YSwgZTMubWV0YSk7CiAgICAgICAgICB9KSA6IHRoaXMuX3dvcmtlci5vbihlMiwgZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIGguZGVsYXkodDIsIGFyZ3VtZW50cywgcjIpOwogICAgICAgICAgfSksIHRoaXM7CiAgICAgICAgfSwgcmVzdW1lOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHJldHVybiBoLmRlbGF5KHRoaXMuX3dvcmtlci5yZXN1bWUsIFtdLCB0aGlzLl93b3JrZXIpLCB0aGlzOwogICAgICAgIH0sIHBhdXNlOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHJldHVybiB0aGlzLl93b3JrZXIucGF1c2UoKSwgdGhpczsKICAgICAgICB9LCB0b05vZGVqc1N0cmVhbTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmIChoLmNoZWNrU3VwcG9ydCgibm9kZXN0cmVhbSIpLCAibm9kZWJ1ZmZlciIgIT09IHRoaXMuX291dHB1dFR5cGUpCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcih0aGlzLl9vdXRwdXRUeXBlICsgIiBpcyBub3Qgc3VwcG9ydGVkIGJ5IHRoaXMgbWV0aG9kIik7CiAgICAgICAgICByZXR1cm4gbmV3IG8odGhpcywgeyBvYmplY3RNb2RlOiAibm9kZWJ1ZmZlciIgIT09IHRoaXMuX291dHB1dFR5cGUgfSwgZTIpOwogICAgICAgIH0gfSwgdC5leHBvcnRzID0gZjsKICAgICAgfSwgeyAiLi4vYmFzZTY0IjogMSwgIi4uL2V4dGVybmFsIjogNiwgIi4uL25vZGVqcy9Ob2RlanNTdHJlYW1PdXRwdXRBZGFwdGVyIjogMTMsICIuLi9zdXBwb3J0IjogMzAsICIuLi91dGlscyI6IDMyLCAiLi9Db252ZXJ0V29ya2VyIjogMjQsICIuL0dlbmVyaWNXb3JrZXIiOiAyOCB9XSwgMzA6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgaWYgKHIuYmFzZTY0ID0gdHJ1ZSwgci5hcnJheSA9IHRydWUsIHIuc3RyaW5nID0gdHJ1ZSwgci5hcnJheWJ1ZmZlciA9ICJ1bmRlZmluZWQiICE9IHR5cGVvZiBBcnJheUJ1ZmZlciAmJiAidW5kZWZpbmVkIiAhPSB0eXBlb2YgVWludDhBcnJheSwgci5ub2RlYnVmZmVyID0gInVuZGVmaW5lZCIgIT0gdHlwZW9mIEJ1ZmZlciwgci51aW50OGFycmF5ID0gInVuZGVmaW5lZCIgIT0gdHlwZW9mIFVpbnQ4QXJyYXksICJ1bmRlZmluZWQiID09IHR5cGVvZiBBcnJheUJ1ZmZlcikKICAgICAgICAgIHIuYmxvYiA9IGZhbHNlOwogICAgICAgIGVsc2UgewogICAgICAgICAgdmFyIG4gPSBuZXcgQXJyYXlCdWZmZXIoMCk7CiAgICAgICAgICB0cnkgewogICAgICAgICAgICByLmJsb2IgPSAwID09PSBuZXcgQmxvYihbbl0sIHsgdHlwZTogImFwcGxpY2F0aW9uL3ppcCIgfSkuc2l6ZTsKICAgICAgICAgIH0gY2F0Y2ggKGUyKSB7CiAgICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgICAgdmFyIGkgPSBuZXcgKHNlbGYuQmxvYkJ1aWxkZXIgfHwgc2VsZi5XZWJLaXRCbG9iQnVpbGRlciB8fCBzZWxmLk1vekJsb2JCdWlsZGVyIHx8IHNlbGYuTVNCbG9iQnVpbGRlcikoKTsKICAgICAgICAgICAgICBpLmFwcGVuZChuKSwgci5ibG9iID0gMCA9PT0gaS5nZXRCbG9iKCJhcHBsaWNhdGlvbi96aXAiKS5zaXplOwogICAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICAgIHIuYmxvYiA9IGZhbHNlOwogICAgICAgICAgICB9CiAgICAgICAgICB9CiAgICAgICAgfQogICAgICAgIHRyeSB7CiAgICAgICAgICByLm5vZGVzdHJlYW0gPSAhIWUoInJlYWRhYmxlLXN0cmVhbSIpLlJlYWRhYmxlOwogICAgICAgIH0gY2F0Y2ggKGUyKSB7CiAgICAgICAgICByLm5vZGVzdHJlYW0gPSBmYWxzZTsKICAgICAgICB9CiAgICAgIH0sIHsgInJlYWRhYmxlLXN0cmVhbSI6IDE2IH1dLCAzMTogW2Z1bmN0aW9uKGUsIHQsIHMpIHsKICAgICAgICBmb3IgKHZhciBvID0gZSgiLi91dGlscyIpLCBoID0gZSgiLi9zdXBwb3J0IiksIHIgPSBlKCIuL25vZGVqc1V0aWxzIiksIG4gPSBlKCIuL3N0cmVhbS9HZW5lcmljV29ya2VyIiksIHUgPSBuZXcgQXJyYXkoMjU2KSwgaSA9IDA7IGkgPCAyNTY7IGkrKykKICAgICAgICAgIHVbaV0gPSAyNTIgPD0gaSA/IDYgOiAyNDggPD0gaSA/IDUgOiAyNDAgPD0gaSA/IDQgOiAyMjQgPD0gaSA/IDMgOiAxOTIgPD0gaSA/IDIgOiAxOwogICAgICAgIHVbMjU0XSA9IHVbMjU0XSA9IDE7CiAgICAgICAgZnVuY3Rpb24gYSgpIHsKICAgICAgICAgIG4uY2FsbCh0aGlzLCAidXRmLTggZGVjb2RlIiksIHRoaXMubGVmdE92ZXIgPSBudWxsOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBsKCkgewogICAgICAgICAgbi5jYWxsKHRoaXMsICJ1dGYtOCBlbmNvZGUiKTsKICAgICAgICB9CiAgICAgICAgcy51dGY4ZW5jb2RlID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBoLm5vZGVidWZmZXIgPyByLm5ld0J1ZmZlckZyb20oZTIsICJ1dGYtOCIpIDogZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdmFyIHQyLCByMiwgbjIsIGkyLCBzMiwgYTIgPSBlMy5sZW5ndGgsIG8yID0gMDsKICAgICAgICAgICAgZm9yIChpMiA9IDA7IGkyIDwgYTI7IGkyKyspCiAgICAgICAgICAgICAgNTUyOTYgPT0gKDY0NTEyICYgKHIyID0gZTMuY2hhckNvZGVBdChpMikpKSAmJiBpMiArIDEgPCBhMiAmJiA1NjMyMCA9PSAoNjQ1MTIgJiAobjIgPSBlMy5jaGFyQ29kZUF0KGkyICsgMSkpKSAmJiAocjIgPSA2NTUzNiArIChyMiAtIDU1Mjk2IDw8IDEwKSArIChuMiAtIDU2MzIwKSwgaTIrKyksIG8yICs9IHIyIDwgMTI4ID8gMSA6IHIyIDwgMjA0OCA/IDIgOiByMiA8IDY1NTM2ID8gMyA6IDQ7CiAgICAgICAgICAgIGZvciAodDIgPSBoLnVpbnQ4YXJyYXkgPyBuZXcgVWludDhBcnJheShvMikgOiBuZXcgQXJyYXkobzIpLCBpMiA9IHMyID0gMDsgczIgPCBvMjsgaTIrKykKICAgICAgICAgICAgICA1NTI5NiA9PSAoNjQ1MTIgJiAocjIgPSBlMy5jaGFyQ29kZUF0KGkyKSkpICYmIGkyICsgMSA8IGEyICYmIDU2MzIwID09ICg2NDUxMiAmIChuMiA9IGUzLmNoYXJDb2RlQXQoaTIgKyAxKSkpICYmIChyMiA9IDY1NTM2ICsgKHIyIC0gNTUyOTYgPDwgMTApICsgKG4yIC0gNTYzMjApLCBpMisrKSwgcjIgPCAxMjggPyB0MltzMisrXSA9IHIyIDogKHIyIDwgMjA0OCA/IHQyW3MyKytdID0gMTkyIHwgcjIgPj4+IDYgOiAocjIgPCA2NTUzNiA/IHQyW3MyKytdID0gMjI0IHwgcjIgPj4+IDEyIDogKHQyW3MyKytdID0gMjQwIHwgcjIgPj4+IDE4LCB0MltzMisrXSA9IDEyOCB8IHIyID4+PiAxMiAmIDYzKSwgdDJbczIrK10gPSAxMjggfCByMiA+Pj4gNiAmIDYzKSwgdDJbczIrK10gPSAxMjggfCA2MyAmIHIyKTsKICAgICAgICAgICAgcmV0dXJuIHQyOwogICAgICAgICAgfShlMik7CiAgICAgICAgfSwgcy51dGY4ZGVjb2RlID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBoLm5vZGVidWZmZXIgPyBvLnRyYW5zZm9ybVRvKCJub2RlYnVmZmVyIiwgZTIpLnRvU3RyaW5nKCJ1dGYtOCIpIDogZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgdmFyIHQyLCByMiwgbjIsIGkyLCBzMiA9IGUzLmxlbmd0aCwgYTIgPSBuZXcgQXJyYXkoMiAqIHMyKTsKICAgICAgICAgICAgZm9yICh0MiA9IHIyID0gMDsgdDIgPCBzMjsgKQogICAgICAgICAgICAgIGlmICgobjIgPSBlM1t0MisrXSkgPCAxMjgpCiAgICAgICAgICAgICAgICBhMltyMisrXSA9IG4yOwogICAgICAgICAgICAgIGVsc2UgaWYgKDQgPCAoaTIgPSB1W24yXSkpCiAgICAgICAgICAgICAgICBhMltyMisrXSA9IDY1NTMzLCB0MiArPSBpMiAtIDE7CiAgICAgICAgICAgICAgZWxzZSB7CiAgICAgICAgICAgICAgICBmb3IgKG4yICY9IDIgPT09IGkyID8gMzEgOiAzID09PSBpMiA/IDE1IDogNzsgMSA8IGkyICYmIHQyIDwgczI7ICkKICAgICAgICAgICAgICAgICAgbjIgPSBuMiA8PCA2IHwgNjMgJiBlM1t0MisrXSwgaTItLTsKICAgICAgICAgICAgICAgIDEgPCBpMiA/IGEyW3IyKytdID0gNjU1MzMgOiBuMiA8IDY1NTM2ID8gYTJbcjIrK10gPSBuMiA6IChuMiAtPSA2NTUzNiwgYTJbcjIrK10gPSA1NTI5NiB8IG4yID4+IDEwICYgMTAyMywgYTJbcjIrK10gPSA1NjMyMCB8IDEwMjMgJiBuMik7CiAgICAgICAgICAgICAgfQogICAgICAgICAgICByZXR1cm4gYTIubGVuZ3RoICE9PSByMiAmJiAoYTIuc3ViYXJyYXkgPyBhMiA9IGEyLnN1YmFycmF5KDAsIHIyKSA6IGEyLmxlbmd0aCA9IHIyKSwgby5hcHBseUZyb21DaGFyQ29kZShhMik7CiAgICAgICAgICB9KGUyID0gby50cmFuc2Zvcm1UbyhoLnVpbnQ4YXJyYXkgPyAidWludDhhcnJheSIgOiAiYXJyYXkiLCBlMikpOwogICAgICAgIH0sIG8uaW5oZXJpdHMoYSwgbiksIGEucHJvdG90eXBlLnByb2Nlc3NDaHVuayA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBvLnRyYW5zZm9ybVRvKGgudWludDhhcnJheSA/ICJ1aW50OGFycmF5IiA6ICJhcnJheSIsIGUyLmRhdGEpOwogICAgICAgICAgaWYgKHRoaXMubGVmdE92ZXIgJiYgdGhpcy5sZWZ0T3Zlci5sZW5ndGgpIHsKICAgICAgICAgICAgaWYgKGgudWludDhhcnJheSkgewogICAgICAgICAgICAgIHZhciByMiA9IHQyOwogICAgICAgICAgICAgICh0MiA9IG5ldyBVaW50OEFycmF5KHIyLmxlbmd0aCArIHRoaXMubGVmdE92ZXIubGVuZ3RoKSkuc2V0KHRoaXMubGVmdE92ZXIsIDApLCB0Mi5zZXQocjIsIHRoaXMubGVmdE92ZXIubGVuZ3RoKTsKICAgICAgICAgICAgfSBlbHNlCiAgICAgICAgICAgICAgdDIgPSB0aGlzLmxlZnRPdmVyLmNvbmNhdCh0Mik7CiAgICAgICAgICAgIHRoaXMubGVmdE92ZXIgPSBudWxsOwogICAgICAgICAgfQogICAgICAgICAgdmFyIG4yID0gZnVuY3Rpb24oZTMsIHQzKSB7CiAgICAgICAgICAgIHZhciByMzsKICAgICAgICAgICAgZm9yICgodDMgPSB0MyB8fCBlMy5sZW5ndGgpID4gZTMubGVuZ3RoICYmICh0MyA9IGUzLmxlbmd0aCksIHIzID0gdDMgLSAxOyAwIDw9IHIzICYmIDEyOCA9PSAoMTkyICYgZTNbcjNdKTsgKQogICAgICAgICAgICAgIHIzLS07CiAgICAgICAgICAgIHJldHVybiByMyA8IDAgPyB0MyA6IDAgPT09IHIzID8gdDMgOiByMyArIHVbZTNbcjNdXSA+IHQzID8gcjMgOiB0MzsKICAgICAgICAgIH0odDIpLCBpMiA9IHQyOwogICAgICAgICAgbjIgIT09IHQyLmxlbmd0aCAmJiAoaC51aW50OGFycmF5ID8gKGkyID0gdDIuc3ViYXJyYXkoMCwgbjIpLCB0aGlzLmxlZnRPdmVyID0gdDIuc3ViYXJyYXkobjIsIHQyLmxlbmd0aCkpIDogKGkyID0gdDIuc2xpY2UoMCwgbjIpLCB0aGlzLmxlZnRPdmVyID0gdDIuc2xpY2UobjIsIHQyLmxlbmd0aCkpKSwgdGhpcy5wdXNoKHsgZGF0YTogcy51dGY4ZGVjb2RlKGkyKSwgbWV0YTogZTIubWV0YSB9KTsKICAgICAgICB9LCBhLnByb3RvdHlwZS5mbHVzaCA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgdGhpcy5sZWZ0T3ZlciAmJiB0aGlzLmxlZnRPdmVyLmxlbmd0aCAmJiAodGhpcy5wdXNoKHsgZGF0YTogcy51dGY4ZGVjb2RlKHRoaXMubGVmdE92ZXIpLCBtZXRhOiB7fSB9KSwgdGhpcy5sZWZ0T3ZlciA9IG51bGwpOwogICAgICAgIH0sIHMuVXRmOERlY29kZVdvcmtlciA9IGEsIG8uaW5oZXJpdHMobCwgbiksIGwucHJvdG90eXBlLnByb2Nlc3NDaHVuayA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLnB1c2goeyBkYXRhOiBzLnV0ZjhlbmNvZGUoZTIuZGF0YSksIG1ldGE6IGUyLm1ldGEgfSk7CiAgICAgICAgfSwgcy5VdGY4RW5jb2RlV29ya2VyID0gbDsKICAgICAgfSwgeyAiLi9ub2RlanNVdGlscyI6IDE0LCAiLi9zdHJlYW0vR2VuZXJpY1dvcmtlciI6IDI4LCAiLi9zdXBwb3J0IjogMzAsICIuL3V0aWxzIjogMzIgfV0sIDMyOiBbZnVuY3Rpb24oZSwgdCwgYSkgewogICAgICAgIHZhciBvID0gZSgiLi9zdXBwb3J0IiksIGggPSBlKCIuL2Jhc2U2NCIpLCByID0gZSgiLi9ub2RlanNVdGlscyIpLCB1ID0gZSgiLi9leHRlcm5hbCIpOwogICAgICAgIGZ1bmN0aW9uIG4oZTIpIHsKICAgICAgICAgIHJldHVybiBlMjsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gbChlMiwgdDIpIHsKICAgICAgICAgIGZvciAodmFyIHIyID0gMDsgcjIgPCBlMi5sZW5ndGg7ICsrcjIpCiAgICAgICAgICAgIHQyW3IyXSA9IDI1NSAmIGUyLmNoYXJDb2RlQXQocjIpOwogICAgICAgICAgcmV0dXJuIHQyOwogICAgICAgIH0KICAgICAgICBlKCJzZXRpbW1lZGlhdGUiKSwgYS5uZXdCbG9iID0gZnVuY3Rpb24odDIsIHIyKSB7CiAgICAgICAgICBhLmNoZWNrU3VwcG9ydCgiYmxvYiIpOwogICAgICAgICAgdHJ5IHsKICAgICAgICAgICAgcmV0dXJuIG5ldyBCbG9iKFt0Ml0sIHsgdHlwZTogcjIgfSk7CiAgICAgICAgICB9IGNhdGNoIChlMikgewogICAgICAgICAgICB0cnkgewogICAgICAgICAgICAgIHZhciBuMiA9IG5ldyAoc2VsZi5CbG9iQnVpbGRlciB8fCBzZWxmLldlYktpdEJsb2JCdWlsZGVyIHx8IHNlbGYuTW96QmxvYkJ1aWxkZXIgfHwgc2VsZi5NU0Jsb2JCdWlsZGVyKSgpOwogICAgICAgICAgICAgIHJldHVybiBuMi5hcHBlbmQodDIpLCBuMi5nZXRCbG9iKHIyKTsKICAgICAgICAgICAgfSBjYXRjaCAoZTMpIHsKICAgICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIkJ1ZyA6IGNhbid0IGNvbnN0cnVjdCB0aGUgQmxvYi4iKTsKICAgICAgICAgICAgfQogICAgICAgICAgfQogICAgICAgIH07CiAgICAgICAgdmFyIGkgPSB7IHN0cmluZ2lmeUJ5Q2h1bms6IGZ1bmN0aW9uKGUyLCB0MiwgcjIpIHsKICAgICAgICAgIHZhciBuMiA9IFtdLCBpMiA9IDAsIHMyID0gZTIubGVuZ3RoOwogICAgICAgICAgaWYgKHMyIDw9IHIyKQogICAgICAgICAgICByZXR1cm4gU3RyaW5nLmZyb21DaGFyQ29kZS5hcHBseShudWxsLCBlMik7CiAgICAgICAgICBmb3IgKDsgaTIgPCBzMjsgKQogICAgICAgICAgICAiYXJyYXkiID09PSB0MiB8fCAibm9kZWJ1ZmZlciIgPT09IHQyID8gbjIucHVzaChTdHJpbmcuZnJvbUNoYXJDb2RlLmFwcGx5KG51bGwsIGUyLnNsaWNlKGkyLCBNYXRoLm1pbihpMiArIHIyLCBzMikpKSkgOiBuMi5wdXNoKFN0cmluZy5mcm9tQ2hhckNvZGUuYXBwbHkobnVsbCwgZTIuc3ViYXJyYXkoaTIsIE1hdGgubWluKGkyICsgcjIsIHMyKSkpKSwgaTIgKz0gcjI7CiAgICAgICAgICByZXR1cm4gbjIuam9pbigiIik7CiAgICAgICAgfSwgc3RyaW5naWZ5QnlDaGFyOiBmdW5jdGlvbihlMikgewogICAgICAgICAgZm9yICh2YXIgdDIgPSAiIiwgcjIgPSAwOyByMiA8IGUyLmxlbmd0aDsgcjIrKykKICAgICAgICAgICAgdDIgKz0gU3RyaW5nLmZyb21DaGFyQ29kZShlMltyMl0pOwogICAgICAgICAgcmV0dXJuIHQyOwogICAgICAgIH0sIGFwcGx5Q2FuQmVVc2VkOiB7IHVpbnQ4YXJyYXk6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdHJ5IHsKICAgICAgICAgICAgcmV0dXJuIG8udWludDhhcnJheSAmJiAxID09PSBTdHJpbmcuZnJvbUNoYXJDb2RlLmFwcGx5KG51bGwsIG5ldyBVaW50OEFycmF5KDEpKS5sZW5ndGg7CiAgICAgICAgICB9IGNhdGNoIChlMikgewogICAgICAgICAgICByZXR1cm4gZmFsc2U7CiAgICAgICAgICB9CiAgICAgICAgfSgpLCBub2RlYnVmZmVyOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgIHJldHVybiBvLm5vZGVidWZmZXIgJiYgMSA9PT0gU3RyaW5nLmZyb21DaGFyQ29kZS5hcHBseShudWxsLCByLmFsbG9jQnVmZmVyKDEpKS5sZW5ndGg7CiAgICAgICAgICB9IGNhdGNoIChlMikgewogICAgICAgICAgICByZXR1cm4gZmFsc2U7CiAgICAgICAgICB9CiAgICAgICAgfSgpIH0gfTsKICAgICAgICBmdW5jdGlvbiBzKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSA2NTUzNiwgcjIgPSBhLmdldFR5cGVPZihlMiksIG4yID0gdHJ1ZTsKICAgICAgICAgIGlmICgidWludDhhcnJheSIgPT09IHIyID8gbjIgPSBpLmFwcGx5Q2FuQmVVc2VkLnVpbnQ4YXJyYXkgOiAibm9kZWJ1ZmZlciIgPT09IHIyICYmIChuMiA9IGkuYXBwbHlDYW5CZVVzZWQubm9kZWJ1ZmZlciksIG4yKQogICAgICAgICAgICBmb3IgKDsgMSA8IHQyOyApCiAgICAgICAgICAgICAgdHJ5IHsKICAgICAgICAgICAgICAgIHJldHVybiBpLnN0cmluZ2lmeUJ5Q2h1bmsoZTIsIHIyLCB0Mik7CiAgICAgICAgICAgICAgfSBjYXRjaCAoZTMpIHsKICAgICAgICAgICAgICAgIHQyID0gTWF0aC5mbG9vcih0MiAvIDIpOwogICAgICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiBpLnN0cmluZ2lmeUJ5Q2hhcihlMik7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIGYoZTIsIHQyKSB7CiAgICAgICAgICBmb3IgKHZhciByMiA9IDA7IHIyIDwgZTIubGVuZ3RoOyByMisrKQogICAgICAgICAgICB0MltyMl0gPSBlMltyMl07CiAgICAgICAgICByZXR1cm4gdDI7CiAgICAgICAgfQogICAgICAgIGEuYXBwbHlGcm9tQ2hhckNvZGUgPSBzOwogICAgICAgIHZhciBjID0ge307CiAgICAgICAgYy5zdHJpbmcgPSB7IHN0cmluZzogbiwgYXJyYXk6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gbChlMiwgbmV3IEFycmF5KGUyLmxlbmd0aCkpOwogICAgICAgIH0sIGFycmF5YnVmZmVyOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGMuc3RyaW5nLnVpbnQ4YXJyYXkoZTIpLmJ1ZmZlcjsKICAgICAgICB9LCB1aW50OGFycmF5OiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGwoZTIsIG5ldyBVaW50OEFycmF5KGUyLmxlbmd0aCkpOwogICAgICAgIH0sIG5vZGVidWZmZXI6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gbChlMiwgci5hbGxvY0J1ZmZlcihlMi5sZW5ndGgpKTsKICAgICAgICB9IH0sIGMuYXJyYXkgPSB7IHN0cmluZzogcywgYXJyYXk6IG4sIGFycmF5YnVmZmVyOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIG5ldyBVaW50OEFycmF5KGUyKS5idWZmZXI7CiAgICAgICAgfSwgdWludDhhcnJheTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBuZXcgVWludDhBcnJheShlMik7CiAgICAgICAgfSwgbm9kZWJ1ZmZlcjogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiByLm5ld0J1ZmZlckZyb20oZTIpOwogICAgICAgIH0gfSwgYy5hcnJheWJ1ZmZlciA9IHsgc3RyaW5nOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIHMobmV3IFVpbnQ4QXJyYXkoZTIpKTsKICAgICAgICB9LCBhcnJheTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBmKG5ldyBVaW50OEFycmF5KGUyKSwgbmV3IEFycmF5KGUyLmJ5dGVMZW5ndGgpKTsKICAgICAgICB9LCBhcnJheWJ1ZmZlcjogbiwgdWludDhhcnJheTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBuZXcgVWludDhBcnJheShlMik7CiAgICAgICAgfSwgbm9kZWJ1ZmZlcjogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiByLm5ld0J1ZmZlckZyb20obmV3IFVpbnQ4QXJyYXkoZTIpKTsKICAgICAgICB9IH0sIGMudWludDhhcnJheSA9IHsgc3RyaW5nOiBzLCBhcnJheTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBmKGUyLCBuZXcgQXJyYXkoZTIubGVuZ3RoKSk7CiAgICAgICAgfSwgYXJyYXlidWZmZXI6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gZTIuYnVmZmVyOwogICAgICAgIH0sIHVpbnQ4YXJyYXk6IG4sIG5vZGVidWZmZXI6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gci5uZXdCdWZmZXJGcm9tKGUyKTsKICAgICAgICB9IH0sIGMubm9kZWJ1ZmZlciA9IHsgc3RyaW5nOiBzLCBhcnJheTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHJldHVybiBmKGUyLCBuZXcgQXJyYXkoZTIubGVuZ3RoKSk7CiAgICAgICAgfSwgYXJyYXlidWZmZXI6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gYy5ub2RlYnVmZmVyLnVpbnQ4YXJyYXkoZTIpLmJ1ZmZlcjsKICAgICAgICB9LCB1aW50OGFycmF5OiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGYoZTIsIG5ldyBVaW50OEFycmF5KGUyLmxlbmd0aCkpOwogICAgICAgIH0sIG5vZGVidWZmZXI6IG4gfSwgYS50cmFuc2Zvcm1UbyA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgaWYgKHQyID0gdDIgfHwgIiIsICFlMikKICAgICAgICAgICAgcmV0dXJuIHQyOwogICAgICAgICAgYS5jaGVja1N1cHBvcnQoZTIpOwogICAgICAgICAgdmFyIHIyID0gYS5nZXRUeXBlT2YodDIpOwogICAgICAgICAgcmV0dXJuIGNbcjJdW2UyXSh0Mik7CiAgICAgICAgfSwgYS5yZXNvbHZlID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGZvciAodmFyIHQyID0gZTIuc3BsaXQoIi8iKSwgcjIgPSBbXSwgbjIgPSAwOyBuMiA8IHQyLmxlbmd0aDsgbjIrKykgewogICAgICAgICAgICB2YXIgaTIgPSB0MltuMl07CiAgICAgICAgICAgICIuIiA9PT0gaTIgfHwgIiIgPT09IGkyICYmIDAgIT09IG4yICYmIG4yICE9PSB0Mi5sZW5ndGggLSAxIHx8ICgiLi4iID09PSBpMiA/IHIyLnBvcCgpIDogcjIucHVzaChpMikpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIHIyLmpvaW4oIi8iKTsKICAgICAgICB9LCBhLmdldFR5cGVPZiA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICByZXR1cm4gInN0cmluZyIgPT0gdHlwZW9mIGUyID8gInN0cmluZyIgOiAiW29iamVjdCBBcnJheV0iID09PSBPYmplY3QucHJvdG90eXBlLnRvU3RyaW5nLmNhbGwoZTIpID8gImFycmF5IiA6IG8ubm9kZWJ1ZmZlciAmJiByLmlzQnVmZmVyKGUyKSA/ICJub2RlYnVmZmVyIiA6IG8udWludDhhcnJheSAmJiBlMiBpbnN0YW5jZW9mIFVpbnQ4QXJyYXkgPyAidWludDhhcnJheSIgOiBvLmFycmF5YnVmZmVyICYmIGUyIGluc3RhbmNlb2YgQXJyYXlCdWZmZXIgPyAiYXJyYXlidWZmZXIiIDogdm9pZCAwOwogICAgICAgIH0sIGEuY2hlY2tTdXBwb3J0ID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmICghb1tlMi50b0xvd2VyQ2FzZSgpXSkKICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKGUyICsgIiBpcyBub3Qgc3VwcG9ydGVkIGJ5IHRoaXMgcGxhdGZvcm0iKTsKICAgICAgICB9LCBhLk1BWF9WQUxVRV8xNkJJVFMgPSA2NTUzNSwgYS5NQVhfVkFMVUVfMzJCSVRTID0gLTEsIGEucHJldHR5ID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHZhciB0MiwgcjIsIG4yID0gIiI7CiAgICAgICAgICBmb3IgKHIyID0gMDsgcjIgPCAoZTIgfHwgIiIpLmxlbmd0aDsgcjIrKykKICAgICAgICAgICAgbjIgKz0gIlxceCIgKyAoKHQyID0gZTIuY2hhckNvZGVBdChyMikpIDwgMTYgPyAiMCIgOiAiIikgKyB0Mi50b1N0cmluZygxNikudG9VcHBlckNhc2UoKTsKICAgICAgICAgIHJldHVybiBuMjsKICAgICAgICB9LCBhLmRlbGF5ID0gZnVuY3Rpb24oZTIsIHQyLCByMikgewogICAgICAgICAgc2V0SW1tZWRpYXRlKGZ1bmN0aW9uKCkgewogICAgICAgICAgICBlMi5hcHBseShyMiB8fCBudWxsLCB0MiB8fCBbXSk7CiAgICAgICAgICB9KTsKICAgICAgICB9LCBhLmluaGVyaXRzID0gZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICBmdW5jdGlvbiByMigpIHsKICAgICAgICAgIH0KICAgICAgICAgIHIyLnByb3RvdHlwZSA9IHQyLnByb3RvdHlwZSwgZTIucHJvdG90eXBlID0gbmV3IHIyKCk7CiAgICAgICAgfSwgYS5leHRlbmQgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIHZhciBlMiwgdDIsIHIyID0ge307CiAgICAgICAgICBmb3IgKGUyID0gMDsgZTIgPCBhcmd1bWVudHMubGVuZ3RoOyBlMisrKQogICAgICAgICAgICBmb3IgKHQyIGluIGFyZ3VtZW50c1tlMl0pCiAgICAgICAgICAgICAgT2JqZWN0LnByb3RvdHlwZS5oYXNPd25Qcm9wZXJ0eS5jYWxsKGFyZ3VtZW50c1tlMl0sIHQyKSAmJiB2b2lkIDAgPT09IHIyW3QyXSAmJiAocjJbdDJdID0gYXJndW1lbnRzW2UyXVt0Ml0pOwogICAgICAgICAgcmV0dXJuIHIyOwogICAgICAgIH0sIGEucHJlcGFyZUNvbnRlbnQgPSBmdW5jdGlvbihyMiwgZTIsIG4yLCBpMiwgczIpIHsKICAgICAgICAgIHJldHVybiB1LlByb21pc2UucmVzb2x2ZShlMikudGhlbihmdW5jdGlvbihuMykgewogICAgICAgICAgICByZXR1cm4gby5ibG9iICYmIChuMyBpbnN0YW5jZW9mIEJsb2IgfHwgLTEgIT09IFsiW29iamVjdCBGaWxlXSIsICJbb2JqZWN0IEJsb2JdIl0uaW5kZXhPZihPYmplY3QucHJvdG90eXBlLnRvU3RyaW5nLmNhbGwobjMpKSkgJiYgInVuZGVmaW5lZCIgIT0gdHlwZW9mIEZpbGVSZWFkZXIgPyBuZXcgdS5Qcm9taXNlKGZ1bmN0aW9uKHQyLCByMykgewogICAgICAgICAgICAgIHZhciBlMyA9IG5ldyBGaWxlUmVhZGVyKCk7CiAgICAgICAgICAgICAgZTMub25sb2FkID0gZnVuY3Rpb24oZTQpIHsKICAgICAgICAgICAgICAgIHQyKGU0LnRhcmdldC5yZXN1bHQpOwogICAgICAgICAgICAgIH0sIGUzLm9uZXJyb3IgPSBmdW5jdGlvbihlNCkgewogICAgICAgICAgICAgICAgcjMoZTQudGFyZ2V0LmVycm9yKTsKICAgICAgICAgICAgICB9LCBlMy5yZWFkQXNBcnJheUJ1ZmZlcihuMyk7CiAgICAgICAgICAgIH0pIDogbjM7CiAgICAgICAgICB9KS50aGVuKGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHZhciB0MiA9IGEuZ2V0VHlwZU9mKGUzKTsKICAgICAgICAgICAgcmV0dXJuIHQyID8gKCJhcnJheWJ1ZmZlciIgPT09IHQyID8gZTMgPSBhLnRyYW5zZm9ybVRvKCJ1aW50OGFycmF5IiwgZTMpIDogInN0cmluZyIgPT09IHQyICYmIChzMiA/IGUzID0gaC5kZWNvZGUoZTMpIDogbjIgJiYgdHJ1ZSAhPT0gaTIgJiYgKGUzID0gZnVuY3Rpb24oZTQpIHsKICAgICAgICAgICAgICByZXR1cm4gbChlNCwgby51aW50OGFycmF5ID8gbmV3IFVpbnQ4QXJyYXkoZTQubGVuZ3RoKSA6IG5ldyBBcnJheShlNC5sZW5ndGgpKTsKICAgICAgICAgICAgfShlMykpKSwgZTMpIDogdS5Qcm9taXNlLnJlamVjdChuZXcgRXJyb3IoIkNhbid0IHJlYWQgdGhlIGRhdGEgb2YgJyIgKyByMiArICInLiBJcyBpdCBpbiBhIHN1cHBvcnRlZCBKYXZhU2NyaXB0IHR5cGUgKFN0cmluZywgQmxvYiwgQXJyYXlCdWZmZXIsIGV0YykgPyIpKTsKICAgICAgICAgIH0pOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4vYmFzZTY0IjogMSwgIi4vZXh0ZXJuYWwiOiA2LCAiLi9ub2RlanNVdGlscyI6IDE0LCAiLi9zdXBwb3J0IjogMzAsIHNldGltbWVkaWF0ZTogNTQgfV0sIDMzOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9yZWFkZXIvcmVhZGVyRm9yIiksIGkgPSBlKCIuL3V0aWxzIiksIHMgPSBlKCIuL3NpZ25hdHVyZSIpLCBhID0gZSgiLi96aXBFbnRyeSIpLCBvID0gZSgiLi9zdXBwb3J0Iik7CiAgICAgICAgZnVuY3Rpb24gaChlMikgewogICAgICAgICAgdGhpcy5maWxlcyA9IFtdLCB0aGlzLmxvYWRPcHRpb25zID0gZTI7CiAgICAgICAgfQogICAgICAgIGgucHJvdG90eXBlID0geyBjaGVja1NpZ25hdHVyZTogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmICghdGhpcy5yZWFkZXIucmVhZEFuZENoZWNrU2lnbmF0dXJlKGUyKSkgewogICAgICAgICAgICB0aGlzLnJlYWRlci5pbmRleCAtPSA0OwogICAgICAgICAgICB2YXIgdDIgPSB0aGlzLnJlYWRlci5yZWFkU3RyaW5nKDQpOwogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIkNvcnJ1cHRlZCB6aXAgb3IgYnVnOiB1bmV4cGVjdGVkIHNpZ25hdHVyZSAoIiArIGkucHJldHR5KHQyKSArICIsIGV4cGVjdGVkICIgKyBpLnByZXR0eShlMikgKyAiKSIpOwogICAgICAgICAgfQogICAgICAgIH0sIGlzU2lnbmF0dXJlOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiA9IHRoaXMucmVhZGVyLmluZGV4OwogICAgICAgICAgdGhpcy5yZWFkZXIuc2V0SW5kZXgoZTIpOwogICAgICAgICAgdmFyIG4yID0gdGhpcy5yZWFkZXIucmVhZFN0cmluZyg0KSA9PT0gdDI7CiAgICAgICAgICByZXR1cm4gdGhpcy5yZWFkZXIuc2V0SW5kZXgocjIpLCBuMjsKICAgICAgICB9LCByZWFkQmxvY2tFbmRPZkNlbnRyYWw6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdGhpcy5kaXNrTnVtYmVyID0gdGhpcy5yZWFkZXIucmVhZEludCgyKSwgdGhpcy5kaXNrV2l0aENlbnRyYWxEaXJTdGFydCA9IHRoaXMucmVhZGVyLnJlYWRJbnQoMiksIHRoaXMuY2VudHJhbERpclJlY29yZHNPblRoaXNEaXNrID0gdGhpcy5yZWFkZXIucmVhZEludCgyKSwgdGhpcy5jZW50cmFsRGlyUmVjb3JkcyA9IHRoaXMucmVhZGVyLnJlYWRJbnQoMiksIHRoaXMuY2VudHJhbERpclNpemUgPSB0aGlzLnJlYWRlci5yZWFkSW50KDQpLCB0aGlzLmNlbnRyYWxEaXJPZmZzZXQgPSB0aGlzLnJlYWRlci5yZWFkSW50KDQpLCB0aGlzLnppcENvbW1lbnRMZW5ndGggPSB0aGlzLnJlYWRlci5yZWFkSW50KDIpOwogICAgICAgICAgdmFyIGUyID0gdGhpcy5yZWFkZXIucmVhZERhdGEodGhpcy56aXBDb21tZW50TGVuZ3RoKSwgdDIgPSBvLnVpbnQ4YXJyYXkgPyAidWludDhhcnJheSIgOiAiYXJyYXkiLCByMiA9IGkudHJhbnNmb3JtVG8odDIsIGUyKTsKICAgICAgICAgIHRoaXMuemlwQ29tbWVudCA9IHRoaXMubG9hZE9wdGlvbnMuZGVjb2RlRmlsZU5hbWUocjIpOwogICAgICAgIH0sIHJlYWRCbG9ja1ppcDY0RW5kT2ZDZW50cmFsOiBmdW5jdGlvbigpIHsKICAgICAgICAgIHRoaXMuemlwNjRFbmRPZkNlbnRyYWxTaXplID0gdGhpcy5yZWFkZXIucmVhZEludCg4KSwgdGhpcy5yZWFkZXIuc2tpcCg0KSwgdGhpcy5kaXNrTnVtYmVyID0gdGhpcy5yZWFkZXIucmVhZEludCg0KSwgdGhpcy5kaXNrV2l0aENlbnRyYWxEaXJTdGFydCA9IHRoaXMucmVhZGVyLnJlYWRJbnQoNCksIHRoaXMuY2VudHJhbERpclJlY29yZHNPblRoaXNEaXNrID0gdGhpcy5yZWFkZXIucmVhZEludCg4KSwgdGhpcy5jZW50cmFsRGlyUmVjb3JkcyA9IHRoaXMucmVhZGVyLnJlYWRJbnQoOCksIHRoaXMuY2VudHJhbERpclNpemUgPSB0aGlzLnJlYWRlci5yZWFkSW50KDgpLCB0aGlzLmNlbnRyYWxEaXJPZmZzZXQgPSB0aGlzLnJlYWRlci5yZWFkSW50KDgpLCB0aGlzLnppcDY0RXh0ZW5zaWJsZURhdGEgPSB7fTsKICAgICAgICAgIGZvciAodmFyIGUyLCB0MiwgcjIsIG4yID0gdGhpcy56aXA2NEVuZE9mQ2VudHJhbFNpemUgLSA0NDsgMCA8IG4yOyApCiAgICAgICAgICAgIGUyID0gdGhpcy5yZWFkZXIucmVhZEludCgyKSwgdDIgPSB0aGlzLnJlYWRlci5yZWFkSW50KDQpLCByMiA9IHRoaXMucmVhZGVyLnJlYWREYXRhKHQyKSwgdGhpcy56aXA2NEV4dGVuc2libGVEYXRhW2UyXSA9IHsgaWQ6IGUyLCBsZW5ndGg6IHQyLCB2YWx1ZTogcjIgfTsKICAgICAgICB9LCByZWFkQmxvY2taaXA2NEVuZE9mQ2VudHJhbExvY2F0b3I6IGZ1bmN0aW9uKCkgewogICAgICAgICAgaWYgKHRoaXMuZGlza1dpdGhaaXA2NENlbnRyYWxEaXJTdGFydCA9IHRoaXMucmVhZGVyLnJlYWRJbnQoNCksIHRoaXMucmVsYXRpdmVPZmZzZXRFbmRPZlppcDY0Q2VudHJhbERpciA9IHRoaXMucmVhZGVyLnJlYWRJbnQoOCksIHRoaXMuZGlza3NDb3VudCA9IHRoaXMucmVhZGVyLnJlYWRJbnQoNCksIDEgPCB0aGlzLmRpc2tzQ291bnQpCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiTXVsdGktdm9sdW1lcyB6aXAgYXJlIG5vdCBzdXBwb3J0ZWQiKTsKICAgICAgICB9LCByZWFkTG9jYWxGaWxlczogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTIsIHQyOwogICAgICAgICAgZm9yIChlMiA9IDA7IGUyIDwgdGhpcy5maWxlcy5sZW5ndGg7IGUyKyspCiAgICAgICAgICAgIHQyID0gdGhpcy5maWxlc1tlMl0sIHRoaXMucmVhZGVyLnNldEluZGV4KHQyLmxvY2FsSGVhZGVyT2Zmc2V0KSwgdGhpcy5jaGVja1NpZ25hdHVyZShzLkxPQ0FMX0ZJTEVfSEVBREVSKSwgdDIucmVhZExvY2FsUGFydCh0aGlzLnJlYWRlciksIHQyLmhhbmRsZVVURjgoKSwgdDIucHJvY2Vzc0F0dHJpYnV0ZXMoKTsKICAgICAgICB9LCByZWFkQ2VudHJhbERpcjogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTI7CiAgICAgICAgICBmb3IgKHRoaXMucmVhZGVyLnNldEluZGV4KHRoaXMuY2VudHJhbERpck9mZnNldCk7IHRoaXMucmVhZGVyLnJlYWRBbmRDaGVja1NpZ25hdHVyZShzLkNFTlRSQUxfRklMRV9IRUFERVIpOyApCiAgICAgICAgICAgIChlMiA9IG5ldyBhKHsgemlwNjQ6IHRoaXMuemlwNjQgfSwgdGhpcy5sb2FkT3B0aW9ucykpLnJlYWRDZW50cmFsUGFydCh0aGlzLnJlYWRlciksIHRoaXMuZmlsZXMucHVzaChlMik7CiAgICAgICAgICBpZiAodGhpcy5jZW50cmFsRGlyUmVjb3JkcyAhPT0gdGhpcy5maWxlcy5sZW5ndGggJiYgMCAhPT0gdGhpcy5jZW50cmFsRGlyUmVjb3JkcyAmJiAwID09PSB0aGlzLmZpbGVzLmxlbmd0aCkKICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJDb3JydXB0ZWQgemlwIG9yIGJ1ZzogZXhwZWN0ZWQgIiArIHRoaXMuY2VudHJhbERpclJlY29yZHMgKyAiIHJlY29yZHMgaW4gY2VudHJhbCBkaXIsIGdvdCAiICsgdGhpcy5maWxlcy5sZW5ndGgpOwogICAgICAgIH0sIHJlYWRFbmRPZkNlbnRyYWw6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdmFyIGUyID0gdGhpcy5yZWFkZXIubGFzdEluZGV4T2ZTaWduYXR1cmUocy5DRU5UUkFMX0RJUkVDVE9SWV9FTkQpOwogICAgICAgICAgaWYgKGUyIDwgMCkKICAgICAgICAgICAgdGhyb3cgIXRoaXMuaXNTaWduYXR1cmUoMCwgcy5MT0NBTF9GSUxFX0hFQURFUikgPyBuZXcgRXJyb3IoIkNhbid0IGZpbmQgZW5kIG9mIGNlbnRyYWwgZGlyZWN0b3J5IDogaXMgdGhpcyBhIHppcCBmaWxlID8gSWYgaXQgaXMsIHNlZSBodHRwczovL3N0dWsuZ2l0aHViLmlvL2pzemlwL2RvY3VtZW50YXRpb24vaG93dG8vcmVhZF96aXAuaHRtbCIpIDogbmV3IEVycm9yKCJDb3JydXB0ZWQgemlwOiBjYW4ndCBmaW5kIGVuZCBvZiBjZW50cmFsIGRpcmVjdG9yeSIpOwogICAgICAgICAgdGhpcy5yZWFkZXIuc2V0SW5kZXgoZTIpOwogICAgICAgICAgdmFyIHQyID0gZTI7CiAgICAgICAgICBpZiAodGhpcy5jaGVja1NpZ25hdHVyZShzLkNFTlRSQUxfRElSRUNUT1JZX0VORCksIHRoaXMucmVhZEJsb2NrRW5kT2ZDZW50cmFsKCksIHRoaXMuZGlza051bWJlciA9PT0gaS5NQVhfVkFMVUVfMTZCSVRTIHx8IHRoaXMuZGlza1dpdGhDZW50cmFsRGlyU3RhcnQgPT09IGkuTUFYX1ZBTFVFXzE2QklUUyB8fCB0aGlzLmNlbnRyYWxEaXJSZWNvcmRzT25UaGlzRGlzayA9PT0gaS5NQVhfVkFMVUVfMTZCSVRTIHx8IHRoaXMuY2VudHJhbERpclJlY29yZHMgPT09IGkuTUFYX1ZBTFVFXzE2QklUUyB8fCB0aGlzLmNlbnRyYWxEaXJTaXplID09PSBpLk1BWF9WQUxVRV8zMkJJVFMgfHwgdGhpcy5jZW50cmFsRGlyT2Zmc2V0ID09PSBpLk1BWF9WQUxVRV8zMkJJVFMpIHsKICAgICAgICAgICAgaWYgKHRoaXMuemlwNjQgPSB0cnVlLCAoZTIgPSB0aGlzLnJlYWRlci5sYXN0SW5kZXhPZlNpZ25hdHVyZShzLlpJUDY0X0NFTlRSQUxfRElSRUNUT1JZX0xPQ0FUT1IpKSA8IDApCiAgICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJDb3JydXB0ZWQgemlwOiBjYW4ndCBmaW5kIHRoZSBaSVA2NCBlbmQgb2YgY2VudHJhbCBkaXJlY3RvcnkgbG9jYXRvciIpOwogICAgICAgICAgICBpZiAodGhpcy5yZWFkZXIuc2V0SW5kZXgoZTIpLCB0aGlzLmNoZWNrU2lnbmF0dXJlKHMuWklQNjRfQ0VOVFJBTF9ESVJFQ1RPUllfTE9DQVRPUiksIHRoaXMucmVhZEJsb2NrWmlwNjRFbmRPZkNlbnRyYWxMb2NhdG9yKCksICF0aGlzLmlzU2lnbmF0dXJlKHRoaXMucmVsYXRpdmVPZmZzZXRFbmRPZlppcDY0Q2VudHJhbERpciwgcy5aSVA2NF9DRU5UUkFMX0RJUkVDVE9SWV9FTkQpICYmICh0aGlzLnJlbGF0aXZlT2Zmc2V0RW5kT2ZaaXA2NENlbnRyYWxEaXIgPSB0aGlzLnJlYWRlci5sYXN0SW5kZXhPZlNpZ25hdHVyZShzLlpJUDY0X0NFTlRSQUxfRElSRUNUT1JZX0VORCksIHRoaXMucmVsYXRpdmVPZmZzZXRFbmRPZlppcDY0Q2VudHJhbERpciA8IDApKQogICAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiQ29ycnVwdGVkIHppcDogY2FuJ3QgZmluZCB0aGUgWklQNjQgZW5kIG9mIGNlbnRyYWwgZGlyZWN0b3J5Iik7CiAgICAgICAgICAgIHRoaXMucmVhZGVyLnNldEluZGV4KHRoaXMucmVsYXRpdmVPZmZzZXRFbmRPZlppcDY0Q2VudHJhbERpciksIHRoaXMuY2hlY2tTaWduYXR1cmUocy5aSVA2NF9DRU5UUkFMX0RJUkVDVE9SWV9FTkQpLCB0aGlzLnJlYWRCbG9ja1ppcDY0RW5kT2ZDZW50cmFsKCk7CiAgICAgICAgICB9CiAgICAgICAgICB2YXIgcjIgPSB0aGlzLmNlbnRyYWxEaXJPZmZzZXQgKyB0aGlzLmNlbnRyYWxEaXJTaXplOwogICAgICAgICAgdGhpcy56aXA2NCAmJiAocjIgKz0gMjAsIHIyICs9IDEyICsgdGhpcy56aXA2NEVuZE9mQ2VudHJhbFNpemUpOwogICAgICAgICAgdmFyIG4yID0gdDIgLSByMjsKICAgICAgICAgIGlmICgwIDwgbjIpCiAgICAgICAgICAgIHRoaXMuaXNTaWduYXR1cmUodDIsIHMuQ0VOVFJBTF9GSUxFX0hFQURFUikgfHwgKHRoaXMucmVhZGVyLnplcm8gPSBuMik7CiAgICAgICAgICBlbHNlIGlmIChuMiA8IDApCiAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiQ29ycnVwdGVkIHppcDogbWlzc2luZyAiICsgTWF0aC5hYnMobjIpICsgIiBieXRlcy4iKTsKICAgICAgICB9LCBwcmVwYXJlUmVhZGVyOiBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5yZWFkZXIgPSBuKGUyKTsKICAgICAgICB9LCBsb2FkOiBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5wcmVwYXJlUmVhZGVyKGUyKSwgdGhpcy5yZWFkRW5kT2ZDZW50cmFsKCksIHRoaXMucmVhZENlbnRyYWxEaXIoKSwgdGhpcy5yZWFkTG9jYWxGaWxlcygpOwogICAgICAgIH0gfSwgdC5leHBvcnRzID0gaDsKICAgICAgfSwgeyAiLi9yZWFkZXIvcmVhZGVyRm9yIjogMjIsICIuL3NpZ25hdHVyZSI6IDIzLCAiLi9zdXBwb3J0IjogMzAsICIuL3V0aWxzIjogMzIsICIuL3ppcEVudHJ5IjogMzQgfV0sIDM0OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBuID0gZSgiLi9yZWFkZXIvcmVhZGVyRm9yIiksIHMgPSBlKCIuL3V0aWxzIiksIGkgPSBlKCIuL2NvbXByZXNzZWRPYmplY3QiKSwgYSA9IGUoIi4vY3JjMzIiKSwgbyA9IGUoIi4vdXRmOCIpLCBoID0gZSgiLi9jb21wcmVzc2lvbnMiKSwgdSA9IGUoIi4vc3VwcG9ydCIpOwogICAgICAgIGZ1bmN0aW9uIGwoZTIsIHQyKSB7CiAgICAgICAgICB0aGlzLm9wdGlvbnMgPSBlMiwgdGhpcy5sb2FkT3B0aW9ucyA9IHQyOwogICAgICAgIH0KICAgICAgICBsLnByb3RvdHlwZSA9IHsgaXNFbmNyeXB0ZWQ6IGZ1bmN0aW9uKCkgewogICAgICAgICAgcmV0dXJuIDEgPT0gKDEgJiB0aGlzLmJpdEZsYWcpOwogICAgICAgIH0sIHVzZVVURjg6IGZ1bmN0aW9uKCkgewogICAgICAgICAgcmV0dXJuIDIwNDggPT0gKDIwNDggJiB0aGlzLmJpdEZsYWcpOwogICAgICAgIH0sIHJlYWRMb2NhbFBhcnQ6IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIsIHIyOwogICAgICAgICAgaWYgKGUyLnNraXAoMjIpLCB0aGlzLmZpbGVOYW1lTGVuZ3RoID0gZTIucmVhZEludCgyKSwgcjIgPSBlMi5yZWFkSW50KDIpLCB0aGlzLmZpbGVOYW1lID0gZTIucmVhZERhdGEodGhpcy5maWxlTmFtZUxlbmd0aCksIGUyLnNraXAocjIpLCAtMSA9PT0gdGhpcy5jb21wcmVzc2VkU2l6ZSB8fCAtMSA9PT0gdGhpcy51bmNvbXByZXNzZWRTaXplKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIkJ1ZyBvciBjb3JydXB0ZWQgemlwIDogZGlkbid0IGdldCBlbm91Z2ggaW5mb3JtYXRpb24gZnJvbSB0aGUgY2VudHJhbCBkaXJlY3RvcnkgKGNvbXByZXNzZWRTaXplID09PSAtMSB8fCB1bmNvbXByZXNzZWRTaXplID09PSAtMSkiKTsKICAgICAgICAgIGlmIChudWxsID09PSAodDIgPSBmdW5jdGlvbihlMykgewogICAgICAgICAgICBmb3IgKHZhciB0MyBpbiBoKQogICAgICAgICAgICAgIGlmIChPYmplY3QucHJvdG90eXBlLmhhc093blByb3BlcnR5LmNhbGwoaCwgdDMpICYmIGhbdDNdLm1hZ2ljID09PSBlMykKICAgICAgICAgICAgICAgIHJldHVybiBoW3QzXTsKICAgICAgICAgICAgcmV0dXJuIG51bGw7CiAgICAgICAgICB9KHRoaXMuY29tcHJlc3Npb25NZXRob2QpKSkKICAgICAgICAgICAgdGhyb3cgbmV3IEVycm9yKCJDb3JydXB0ZWQgemlwIDogY29tcHJlc3Npb24gIiArIHMucHJldHR5KHRoaXMuY29tcHJlc3Npb25NZXRob2QpICsgIiB1bmtub3duIChpbm5lciBmaWxlIDogIiArIHMudHJhbnNmb3JtVG8oInN0cmluZyIsIHRoaXMuZmlsZU5hbWUpICsgIikiKTsKICAgICAgICAgIHRoaXMuZGVjb21wcmVzc2VkID0gbmV3IGkodGhpcy5jb21wcmVzc2VkU2l6ZSwgdGhpcy51bmNvbXByZXNzZWRTaXplLCB0aGlzLmNyYzMyLCB0MiwgZTIucmVhZERhdGEodGhpcy5jb21wcmVzc2VkU2l6ZSkpOwogICAgICAgIH0sIHJlYWRDZW50cmFsUGFydDogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHRoaXMudmVyc2lvbk1hZGVCeSA9IGUyLnJlYWRJbnQoMiksIGUyLnNraXAoMiksIHRoaXMuYml0RmxhZyA9IGUyLnJlYWRJbnQoMiksIHRoaXMuY29tcHJlc3Npb25NZXRob2QgPSBlMi5yZWFkU3RyaW5nKDIpLCB0aGlzLmRhdGUgPSBlMi5yZWFkRGF0ZSgpLCB0aGlzLmNyYzMyID0gZTIucmVhZEludCg0KSwgdGhpcy5jb21wcmVzc2VkU2l6ZSA9IGUyLnJlYWRJbnQoNCksIHRoaXMudW5jb21wcmVzc2VkU2l6ZSA9IGUyLnJlYWRJbnQoNCk7CiAgICAgICAgICB2YXIgdDIgPSBlMi5yZWFkSW50KDIpOwogICAgICAgICAgaWYgKHRoaXMuZXh0cmFGaWVsZHNMZW5ndGggPSBlMi5yZWFkSW50KDIpLCB0aGlzLmZpbGVDb21tZW50TGVuZ3RoID0gZTIucmVhZEludCgyKSwgdGhpcy5kaXNrTnVtYmVyU3RhcnQgPSBlMi5yZWFkSW50KDIpLCB0aGlzLmludGVybmFsRmlsZUF0dHJpYnV0ZXMgPSBlMi5yZWFkSW50KDIpLCB0aGlzLmV4dGVybmFsRmlsZUF0dHJpYnV0ZXMgPSBlMi5yZWFkSW50KDQpLCB0aGlzLmxvY2FsSGVhZGVyT2Zmc2V0ID0gZTIucmVhZEludCg0KSwgdGhpcy5pc0VuY3J5cHRlZCgpKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIkVuY3J5cHRlZCB6aXAgYXJlIG5vdCBzdXBwb3J0ZWQiKTsKICAgICAgICAgIGUyLnNraXAodDIpLCB0aGlzLnJlYWRFeHRyYUZpZWxkcyhlMiksIHRoaXMucGFyc2VaSVA2NEV4dHJhRmllbGQoZTIpLCB0aGlzLmZpbGVDb21tZW50ID0gZTIucmVhZERhdGEodGhpcy5maWxlQ29tbWVudExlbmd0aCk7CiAgICAgICAgfSwgcHJvY2Vzc0F0dHJpYnV0ZXM6IGZ1bmN0aW9uKCkgewogICAgICAgICAgdGhpcy51bml4UGVybWlzc2lvbnMgPSBudWxsLCB0aGlzLmRvc1Blcm1pc3Npb25zID0gbnVsbDsKICAgICAgICAgIHZhciBlMiA9IHRoaXMudmVyc2lvbk1hZGVCeSA+PiA4OwogICAgICAgICAgdGhpcy5kaXIgPSAhISgxNiAmIHRoaXMuZXh0ZXJuYWxGaWxlQXR0cmlidXRlcyksIDAgPT0gZTIgJiYgKHRoaXMuZG9zUGVybWlzc2lvbnMgPSA2MyAmIHRoaXMuZXh0ZXJuYWxGaWxlQXR0cmlidXRlcyksIDMgPT0gZTIgJiYgKHRoaXMudW5peFBlcm1pc3Npb25zID0gdGhpcy5leHRlcm5hbEZpbGVBdHRyaWJ1dGVzID4+IDE2ICYgNjU1MzUpLCB0aGlzLmRpciB8fCAiLyIgIT09IHRoaXMuZmlsZU5hbWVTdHIuc2xpY2UoLTEpIHx8ICh0aGlzLmRpciA9IHRydWUpOwogICAgICAgIH0sIHBhcnNlWklQNjRFeHRyYUZpZWxkOiBmdW5jdGlvbigpIHsKICAgICAgICAgIGlmICh0aGlzLmV4dHJhRmllbGRzWzFdKSB7CiAgICAgICAgICAgIHZhciBlMiA9IG4odGhpcy5leHRyYUZpZWxkc1sxXS52YWx1ZSk7CiAgICAgICAgICAgIHRoaXMudW5jb21wcmVzc2VkU2l6ZSA9PT0gcy5NQVhfVkFMVUVfMzJCSVRTICYmICh0aGlzLnVuY29tcHJlc3NlZFNpemUgPSBlMi5yZWFkSW50KDgpKSwgdGhpcy5jb21wcmVzc2VkU2l6ZSA9PT0gcy5NQVhfVkFMVUVfMzJCSVRTICYmICh0aGlzLmNvbXByZXNzZWRTaXplID0gZTIucmVhZEludCg4KSksIHRoaXMubG9jYWxIZWFkZXJPZmZzZXQgPT09IHMuTUFYX1ZBTFVFXzMyQklUUyAmJiAodGhpcy5sb2NhbEhlYWRlck9mZnNldCA9IGUyLnJlYWRJbnQoOCkpLCB0aGlzLmRpc2tOdW1iZXJTdGFydCA9PT0gcy5NQVhfVkFMVUVfMzJCSVRTICYmICh0aGlzLmRpc2tOdW1iZXJTdGFydCA9IGUyLnJlYWRJbnQoNCkpOwogICAgICAgICAgfQogICAgICAgIH0sIHJlYWRFeHRyYUZpZWxkczogZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHZhciB0MiwgcjIsIG4yLCBpMiA9IGUyLmluZGV4ICsgdGhpcy5leHRyYUZpZWxkc0xlbmd0aDsKICAgICAgICAgIGZvciAodGhpcy5leHRyYUZpZWxkcyB8fCAodGhpcy5leHRyYUZpZWxkcyA9IHt9KTsgZTIuaW5kZXggKyA0IDwgaTI7ICkKICAgICAgICAgICAgdDIgPSBlMi5yZWFkSW50KDIpLCByMiA9IGUyLnJlYWRJbnQoMiksIG4yID0gZTIucmVhZERhdGEocjIpLCB0aGlzLmV4dHJhRmllbGRzW3QyXSA9IHsgaWQ6IHQyLCBsZW5ndGg6IHIyLCB2YWx1ZTogbjIgfTsKICAgICAgICAgIGUyLnNldEluZGV4KGkyKTsKICAgICAgICB9LCBoYW5kbGVVVEY4OiBmdW5jdGlvbigpIHsKICAgICAgICAgIHZhciBlMiA9IHUudWludDhhcnJheSA/ICJ1aW50OGFycmF5IiA6ICJhcnJheSI7CiAgICAgICAgICBpZiAodGhpcy51c2VVVEY4KCkpCiAgICAgICAgICAgIHRoaXMuZmlsZU5hbWVTdHIgPSBvLnV0ZjhkZWNvZGUodGhpcy5maWxlTmFtZSksIHRoaXMuZmlsZUNvbW1lbnRTdHIgPSBvLnV0ZjhkZWNvZGUodGhpcy5maWxlQ29tbWVudCk7CiAgICAgICAgICBlbHNlIHsKICAgICAgICAgICAgdmFyIHQyID0gdGhpcy5maW5kRXh0cmFGaWVsZFVuaWNvZGVQYXRoKCk7CiAgICAgICAgICAgIGlmIChudWxsICE9PSB0MikKICAgICAgICAgICAgICB0aGlzLmZpbGVOYW1lU3RyID0gdDI7CiAgICAgICAgICAgIGVsc2UgewogICAgICAgICAgICAgIHZhciByMiA9IHMudHJhbnNmb3JtVG8oZTIsIHRoaXMuZmlsZU5hbWUpOwogICAgICAgICAgICAgIHRoaXMuZmlsZU5hbWVTdHIgPSB0aGlzLmxvYWRPcHRpb25zLmRlY29kZUZpbGVOYW1lKHIyKTsKICAgICAgICAgICAgfQogICAgICAgICAgICB2YXIgbjIgPSB0aGlzLmZpbmRFeHRyYUZpZWxkVW5pY29kZUNvbW1lbnQoKTsKICAgICAgICAgICAgaWYgKG51bGwgIT09IG4yKQogICAgICAgICAgICAgIHRoaXMuZmlsZUNvbW1lbnRTdHIgPSBuMjsKICAgICAgICAgICAgZWxzZSB7CiAgICAgICAgICAgICAgdmFyIGkyID0gcy50cmFuc2Zvcm1UbyhlMiwgdGhpcy5maWxlQ29tbWVudCk7CiAgICAgICAgICAgICAgdGhpcy5maWxlQ29tbWVudFN0ciA9IHRoaXMubG9hZE9wdGlvbnMuZGVjb2RlRmlsZU5hbWUoaTIpOwogICAgICAgICAgICB9CiAgICAgICAgICB9CiAgICAgICAgfSwgZmluZEV4dHJhRmllbGRVbmljb2RlUGF0aDogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTIgPSB0aGlzLmV4dHJhRmllbGRzWzI4Nzg5XTsKICAgICAgICAgIGlmIChlMikgewogICAgICAgICAgICB2YXIgdDIgPSBuKGUyLnZhbHVlKTsKICAgICAgICAgICAgcmV0dXJuIDEgIT09IHQyLnJlYWRJbnQoMSkgPyBudWxsIDogYSh0aGlzLmZpbGVOYW1lKSAhPT0gdDIucmVhZEludCg0KSA/IG51bGwgOiBvLnV0ZjhkZWNvZGUodDIucmVhZERhdGEoZTIubGVuZ3RoIC0gNSkpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIG51bGw7CiAgICAgICAgfSwgZmluZEV4dHJhRmllbGRVbmljb2RlQ29tbWVudDogZnVuY3Rpb24oKSB7CiAgICAgICAgICB2YXIgZTIgPSB0aGlzLmV4dHJhRmllbGRzWzI1NDYxXTsKICAgICAgICAgIGlmIChlMikgewogICAgICAgICAgICB2YXIgdDIgPSBuKGUyLnZhbHVlKTsKICAgICAgICAgICAgcmV0dXJuIDEgIT09IHQyLnJlYWRJbnQoMSkgPyBudWxsIDogYSh0aGlzLmZpbGVDb21tZW50KSAhPT0gdDIucmVhZEludCg0KSA/IG51bGwgOiBvLnV0ZjhkZWNvZGUodDIucmVhZERhdGEoZTIubGVuZ3RoIC0gNSkpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIG51bGw7CiAgICAgICAgfSB9LCB0LmV4cG9ydHMgPSBsOwogICAgICB9LCB7ICIuL2NvbXByZXNzZWRPYmplY3QiOiAyLCAiLi9jb21wcmVzc2lvbnMiOiAzLCAiLi9jcmMzMiI6IDQsICIuL3JlYWRlci9yZWFkZXJGb3IiOiAyMiwgIi4vc3VwcG9ydCI6IDMwLCAiLi91dGY4IjogMzEsICIuL3V0aWxzIjogMzIgfV0sIDM1OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIGZ1bmN0aW9uIG4oZTIsIHQyLCByMikgewogICAgICAgICAgdGhpcy5uYW1lID0gZTIsIHRoaXMuZGlyID0gcjIuZGlyLCB0aGlzLmRhdGUgPSByMi5kYXRlLCB0aGlzLmNvbW1lbnQgPSByMi5jb21tZW50LCB0aGlzLnVuaXhQZXJtaXNzaW9ucyA9IHIyLnVuaXhQZXJtaXNzaW9ucywgdGhpcy5kb3NQZXJtaXNzaW9ucyA9IHIyLmRvc1Blcm1pc3Npb25zLCB0aGlzLl9kYXRhID0gdDIsIHRoaXMuX2RhdGFCaW5hcnkgPSByMi5iaW5hcnksIHRoaXMub3B0aW9ucyA9IHsgY29tcHJlc3Npb246IHIyLmNvbXByZXNzaW9uLCBjb21wcmVzc2lvbk9wdGlvbnM6IHIyLmNvbXByZXNzaW9uT3B0aW9ucyB9OwogICAgICAgIH0KICAgICAgICB2YXIgcyA9IGUoIi4vc3RyZWFtL1N0cmVhbUhlbHBlciIpLCBpID0gZSgiLi9zdHJlYW0vRGF0YVdvcmtlciIpLCBhID0gZSgiLi91dGY4IiksIG8gPSBlKCIuL2NvbXByZXNzZWRPYmplY3QiKSwgaCA9IGUoIi4vc3RyZWFtL0dlbmVyaWNXb3JrZXIiKTsKICAgICAgICBuLnByb3RvdHlwZSA9IHsgaW50ZXJuYWxTdHJlYW06IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBudWxsLCByMiA9ICJzdHJpbmciOwogICAgICAgICAgdHJ5IHsKICAgICAgICAgICAgaWYgKCFlMikKICAgICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoIk5vIG91dHB1dCB0eXBlIHNwZWNpZmllZC4iKTsKICAgICAgICAgICAgdmFyIG4yID0gInN0cmluZyIgPT09IChyMiA9IGUyLnRvTG93ZXJDYXNlKCkpIHx8ICJ0ZXh0IiA9PT0gcjI7CiAgICAgICAgICAgICJiaW5hcnlzdHJpbmciICE9PSByMiAmJiAidGV4dCIgIT09IHIyIHx8IChyMiA9ICJzdHJpbmciKSwgdDIgPSB0aGlzLl9kZWNvbXByZXNzV29ya2VyKCk7CiAgICAgICAgICAgIHZhciBpMiA9ICF0aGlzLl9kYXRhQmluYXJ5OwogICAgICAgICAgICBpMiAmJiAhbjIgJiYgKHQyID0gdDIucGlwZShuZXcgYS5VdGY4RW5jb2RlV29ya2VyKCkpKSwgIWkyICYmIG4yICYmICh0MiA9IHQyLnBpcGUobmV3IGEuVXRmOERlY29kZVdvcmtlcigpKSk7CiAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICAodDIgPSBuZXcgaCgiZXJyb3IiKSkuZXJyb3IoZTMpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIG5ldyBzKHQyLCByMiwgIiIpOwogICAgICAgIH0sIGFzeW5jOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHJldHVybiB0aGlzLmludGVybmFsU3RyZWFtKGUyKS5hY2N1bXVsYXRlKHQyKTsKICAgICAgICB9LCBub2RlU3RyZWFtOiBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHJldHVybiB0aGlzLmludGVybmFsU3RyZWFtKGUyIHx8ICJub2RlYnVmZmVyIikudG9Ob2RlanNTdHJlYW0odDIpOwogICAgICAgIH0sIF9jb21wcmVzc1dvcmtlcjogZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICBpZiAodGhpcy5fZGF0YSBpbnN0YW5jZW9mIG8gJiYgdGhpcy5fZGF0YS5jb21wcmVzc2lvbi5tYWdpYyA9PT0gZTIubWFnaWMpCiAgICAgICAgICAgIHJldHVybiB0aGlzLl9kYXRhLmdldENvbXByZXNzZWRXb3JrZXIoKTsKICAgICAgICAgIHZhciByMiA9IHRoaXMuX2RlY29tcHJlc3NXb3JrZXIoKTsKICAgICAgICAgIHJldHVybiB0aGlzLl9kYXRhQmluYXJ5IHx8IChyMiA9IHIyLnBpcGUobmV3IGEuVXRmOEVuY29kZVdvcmtlcigpKSksIG8uY3JlYXRlV29ya2VyRnJvbShyMiwgZTIsIHQyKTsKICAgICAgICB9LCBfZGVjb21wcmVzc1dvcmtlcjogZnVuY3Rpb24oKSB7CiAgICAgICAgICByZXR1cm4gdGhpcy5fZGF0YSBpbnN0YW5jZW9mIG8gPyB0aGlzLl9kYXRhLmdldENvbnRlbnRXb3JrZXIoKSA6IHRoaXMuX2RhdGEgaW5zdGFuY2VvZiBoID8gdGhpcy5fZGF0YSA6IG5ldyBpKHRoaXMuX2RhdGEpOwogICAgICAgIH0gfTsKICAgICAgICBmb3IgKHZhciB1ID0gWyJhc1RleHQiLCAiYXNCaW5hcnkiLCAiYXNOb2RlQnVmZmVyIiwgImFzVWludDhBcnJheSIsICJhc0FycmF5QnVmZmVyIl0sIGwgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIHRocm93IG5ldyBFcnJvcigiVGhpcyBtZXRob2QgaGFzIGJlZW4gcmVtb3ZlZCBpbiBKU1ppcCAzLjAsIHBsZWFzZSBjaGVjayB0aGUgdXBncmFkZSBndWlkZS4iKTsKICAgICAgICB9LCBmID0gMDsgZiA8IHUubGVuZ3RoOyBmKyspCiAgICAgICAgICBuLnByb3RvdHlwZVt1W2ZdXSA9IGw7CiAgICAgICAgdC5leHBvcnRzID0gbjsKICAgICAgfSwgeyAiLi9jb21wcmVzc2VkT2JqZWN0IjogMiwgIi4vc3RyZWFtL0RhdGFXb3JrZXIiOiAyNywgIi4vc3RyZWFtL0dlbmVyaWNXb3JrZXIiOiAyOCwgIi4vc3RyZWFtL1N0cmVhbUhlbHBlciI6IDI5LCAiLi91dGY4IjogMzEgfV0sIDM2OiBbZnVuY3Rpb24oZSwgbCwgdCkgewogICAgICAgIChmdW5jdGlvbih0MikgewogICAgICAgICAgdmFyIHIsIG4sIGUyID0gdDIuTXV0YXRpb25PYnNlcnZlciB8fCB0Mi5XZWJLaXRNdXRhdGlvbk9ic2VydmVyOwogICAgICAgICAgaWYgKGUyKSB7CiAgICAgICAgICAgIHZhciBpID0gMCwgcyA9IG5ldyBlMih1KSwgYSA9IHQyLmRvY3VtZW50LmNyZWF0ZVRleHROb2RlKCIiKTsKICAgICAgICAgICAgcy5vYnNlcnZlKGEsIHsgY2hhcmFjdGVyRGF0YTogdHJ1ZSB9KSwgciA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgICAgIGEuZGF0YSA9IGkgPSArK2kgJSAyOwogICAgICAgICAgICB9OwogICAgICAgICAgfSBlbHNlIGlmICh0Mi5zZXRJbW1lZGlhdGUgfHwgdm9pZCAwID09PSB0Mi5NZXNzYWdlQ2hhbm5lbCkKICAgICAgICAgICAgciA9ICJkb2N1bWVudCIgaW4gdDIgJiYgIm9ucmVhZHlzdGF0ZWNoYW5nZSIgaW4gdDIuZG9jdW1lbnQuY3JlYXRlRWxlbWVudCgic2NyaXB0IikgPyBmdW5jdGlvbigpIHsKICAgICAgICAgICAgICB2YXIgZTMgPSB0Mi5kb2N1bWVudC5jcmVhdGVFbGVtZW50KCJzY3JpcHQiKTsKICAgICAgICAgICAgICBlMy5vbnJlYWR5c3RhdGVjaGFuZ2UgPSBmdW5jdGlvbigpIHsKICAgICAgICAgICAgICAgIHUoKSwgZTMub25yZWFkeXN0YXRlY2hhbmdlID0gbnVsbCwgZTMucGFyZW50Tm9kZS5yZW1vdmVDaGlsZChlMyksIGUzID0gbnVsbDsKICAgICAgICAgICAgICB9LCB0Mi5kb2N1bWVudC5kb2N1bWVudEVsZW1lbnQuYXBwZW5kQ2hpbGQoZTMpOwogICAgICAgICAgICB9IDogZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgc2V0VGltZW91dCh1LCAwKTsKICAgICAgICAgICAgfTsKICAgICAgICAgIGVsc2UgewogICAgICAgICAgICB2YXIgbyA9IG5ldyB0Mi5NZXNzYWdlQ2hhbm5lbCgpOwogICAgICAgICAgICBvLnBvcnQxLm9ubWVzc2FnZSA9IHUsIHIgPSBmdW5jdGlvbigpIHsKICAgICAgICAgICAgICBvLnBvcnQyLnBvc3RNZXNzYWdlKDApOwogICAgICAgICAgICB9OwogICAgICAgICAgfQogICAgICAgICAgdmFyIGggPSBbXTsKICAgICAgICAgIGZ1bmN0aW9uIHUoKSB7CiAgICAgICAgICAgIHZhciBlMywgdDM7CiAgICAgICAgICAgIG4gPSB0cnVlOwogICAgICAgICAgICBmb3IgKHZhciByMiA9IGgubGVuZ3RoOyByMjsgKSB7CiAgICAgICAgICAgICAgZm9yICh0MyA9IGgsIGggPSBbXSwgZTMgPSAtMTsgKytlMyA8IHIyOyApCiAgICAgICAgICAgICAgICB0M1tlM10oKTsKICAgICAgICAgICAgICByMiA9IGgubGVuZ3RoOwogICAgICAgICAgICB9CiAgICAgICAgICAgIG4gPSBmYWxzZTsKICAgICAgICAgIH0KICAgICAgICAgIGwuZXhwb3J0cyA9IGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIDEgIT09IGgucHVzaChlMykgfHwgbiB8fCByKCk7CiAgICAgICAgICB9OwogICAgICAgIH0pLmNhbGwodGhpcywgInVuZGVmaW5lZCIgIT0gdHlwZW9mIGNvbW1vbmpzR2xvYmFsID8gY29tbW9uanNHbG9iYWwgOiAidW5kZWZpbmVkIiAhPSB0eXBlb2Ygc2VsZiA/IHNlbGYgOiAidW5kZWZpbmVkIiAhPSB0eXBlb2Ygd2luZG93ID8gd2luZG93IDoge30pOwogICAgICB9LCB7fV0sIDM3OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBpID0gZSgiaW1tZWRpYXRlIik7CiAgICAgICAgZnVuY3Rpb24gdSgpIHsKICAgICAgICB9CiAgICAgICAgdmFyIGwgPSB7fSwgcyA9IFsiUkVKRUNURUQiXSwgYSA9IFsiRlVMRklMTEVEIl0sIG4gPSBbIlBFTkRJTkciXTsKICAgICAgICBmdW5jdGlvbiBvKGUyKSB7CiAgICAgICAgICBpZiAoImZ1bmN0aW9uIiAhPSB0eXBlb2YgZTIpCiAgICAgICAgICAgIHRocm93IG5ldyBUeXBlRXJyb3IoInJlc29sdmVyIG11c3QgYmUgYSBmdW5jdGlvbiIpOwogICAgICAgICAgdGhpcy5zdGF0ZSA9IG4sIHRoaXMucXVldWUgPSBbXSwgdGhpcy5vdXRjb21lID0gdm9pZCAwLCBlMiAhPT0gdSAmJiBkKHRoaXMsIGUyKTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gaChlMiwgdDIsIHIyKSB7CiAgICAgICAgICB0aGlzLnByb21pc2UgPSBlMiwgImZ1bmN0aW9uIiA9PSB0eXBlb2YgdDIgJiYgKHRoaXMub25GdWxmaWxsZWQgPSB0MiwgdGhpcy5jYWxsRnVsZmlsbGVkID0gdGhpcy5vdGhlckNhbGxGdWxmaWxsZWQpLCAiZnVuY3Rpb24iID09IHR5cGVvZiByMiAmJiAodGhpcy5vblJlamVjdGVkID0gcjIsIHRoaXMuY2FsbFJlamVjdGVkID0gdGhpcy5vdGhlckNhbGxSZWplY3RlZCk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIGYodDIsIHIyLCBuMikgewogICAgICAgICAgaShmdW5jdGlvbigpIHsKICAgICAgICAgICAgdmFyIGUyOwogICAgICAgICAgICB0cnkgewogICAgICAgICAgICAgIGUyID0gcjIobjIpOwogICAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICAgIHJldHVybiBsLnJlamVjdCh0MiwgZTMpOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGUyID09PSB0MiA/IGwucmVqZWN0KHQyLCBuZXcgVHlwZUVycm9yKCJDYW5ub3QgcmVzb2x2ZSBwcm9taXNlIHdpdGggaXRzZWxmIikpIDogbC5yZXNvbHZlKHQyLCBlMik7CiAgICAgICAgICB9KTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gYyhlMikgewogICAgICAgICAgdmFyIHQyID0gZTIgJiYgZTIudGhlbjsKICAgICAgICAgIGlmIChlMiAmJiAoIm9iamVjdCIgPT0gdHlwZW9mIGUyIHx8ICJmdW5jdGlvbiIgPT0gdHlwZW9mIGUyKSAmJiAiZnVuY3Rpb24iID09IHR5cGVvZiB0MikKICAgICAgICAgICAgcmV0dXJuIGZ1bmN0aW9uKCkgewogICAgICAgICAgICAgIHQyLmFwcGx5KGUyLCBhcmd1bWVudHMpOwogICAgICAgICAgICB9OwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBkKHQyLCBlMikgewogICAgICAgICAgdmFyIHIyID0gZmFsc2U7CiAgICAgICAgICBmdW5jdGlvbiBuMihlMykgewogICAgICAgICAgICByMiB8fCAocjIgPSB0cnVlLCBsLnJlamVjdCh0MiwgZTMpKTsKICAgICAgICAgIH0KICAgICAgICAgIGZ1bmN0aW9uIGkyKGUzKSB7CiAgICAgICAgICAgIHIyIHx8IChyMiA9IHRydWUsIGwucmVzb2x2ZSh0MiwgZTMpKTsKICAgICAgICAgIH0KICAgICAgICAgIHZhciBzMiA9IHAoZnVuY3Rpb24oKSB7CiAgICAgICAgICAgIGUyKGkyLCBuMik7CiAgICAgICAgICB9KTsKICAgICAgICAgICJlcnJvciIgPT09IHMyLnN0YXR1cyAmJiBuMihzMi52YWx1ZSk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIHAoZTIsIHQyKSB7CiAgICAgICAgICB2YXIgcjIgPSB7fTsKICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgIHIyLnZhbHVlID0gZTIodDIpLCByMi5zdGF0dXMgPSAic3VjY2VzcyI7CiAgICAgICAgICB9IGNhdGNoIChlMykgewogICAgICAgICAgICByMi5zdGF0dXMgPSAiZXJyb3IiLCByMi52YWx1ZSA9IGUzOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIHIyOwogICAgICAgIH0KICAgICAgICAodC5leHBvcnRzID0gbykucHJvdG90eXBlLmZpbmFsbHkgPSBmdW5jdGlvbih0MikgewogICAgICAgICAgaWYgKCJmdW5jdGlvbiIgIT0gdHlwZW9mIHQyKQogICAgICAgICAgICByZXR1cm4gdGhpczsKICAgICAgICAgIHZhciByMiA9IHRoaXMuY29uc3RydWN0b3I7CiAgICAgICAgICByZXR1cm4gdGhpcy50aGVuKGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICAgIHJldHVybiByMi5yZXNvbHZlKHQyKCkpLnRoZW4oZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgcmV0dXJuIGUyOwogICAgICAgICAgICB9KTsKICAgICAgICAgIH0sIGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICAgIHJldHVybiByMi5yZXNvbHZlKHQyKCkpLnRoZW4oZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgdGhyb3cgZTI7CiAgICAgICAgICAgIH0pOwogICAgICAgICAgfSk7CiAgICAgICAgfSwgby5wcm90b3R5cGUuY2F0Y2ggPSBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIHRoaXMudGhlbihudWxsLCBlMik7CiAgICAgICAgfSwgby5wcm90b3R5cGUudGhlbiA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgaWYgKCJmdW5jdGlvbiIgIT0gdHlwZW9mIGUyICYmIHRoaXMuc3RhdGUgPT09IGEgfHwgImZ1bmN0aW9uIiAhPSB0eXBlb2YgdDIgJiYgdGhpcy5zdGF0ZSA9PT0gcykKICAgICAgICAgICAgcmV0dXJuIHRoaXM7CiAgICAgICAgICB2YXIgcjIgPSBuZXcgdGhpcy5jb25zdHJ1Y3Rvcih1KTsKICAgICAgICAgIHRoaXMuc3RhdGUgIT09IG4gPyBmKHIyLCB0aGlzLnN0YXRlID09PSBhID8gZTIgOiB0MiwgdGhpcy5vdXRjb21lKSA6IHRoaXMucXVldWUucHVzaChuZXcgaChyMiwgZTIsIHQyKSk7CiAgICAgICAgICByZXR1cm4gcjI7CiAgICAgICAgfSwgaC5wcm90b3R5cGUuY2FsbEZ1bGZpbGxlZCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBsLnJlc29sdmUodGhpcy5wcm9taXNlLCBlMik7CiAgICAgICAgfSwgaC5wcm90b3R5cGUub3RoZXJDYWxsRnVsZmlsbGVkID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGYodGhpcy5wcm9taXNlLCB0aGlzLm9uRnVsZmlsbGVkLCBlMik7CiAgICAgICAgfSwgaC5wcm90b3R5cGUuY2FsbFJlamVjdGVkID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGwucmVqZWN0KHRoaXMucHJvbWlzZSwgZTIpOwogICAgICAgIH0sIGgucHJvdG90eXBlLm90aGVyQ2FsbFJlamVjdGVkID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGYodGhpcy5wcm9taXNlLCB0aGlzLm9uUmVqZWN0ZWQsIGUyKTsKICAgICAgICB9LCBsLnJlc29sdmUgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiA9IHAoYywgdDIpOwogICAgICAgICAgaWYgKCJlcnJvciIgPT09IHIyLnN0YXR1cykKICAgICAgICAgICAgcmV0dXJuIGwucmVqZWN0KGUyLCByMi52YWx1ZSk7CiAgICAgICAgICB2YXIgbjIgPSByMi52YWx1ZTsKICAgICAgICAgIGlmIChuMikKICAgICAgICAgICAgZChlMiwgbjIpOwogICAgICAgICAgZWxzZSB7CiAgICAgICAgICAgIGUyLnN0YXRlID0gYSwgZTIub3V0Y29tZSA9IHQyOwogICAgICAgICAgICBmb3IgKHZhciBpMiA9IC0xLCBzMiA9IGUyLnF1ZXVlLmxlbmd0aDsgKytpMiA8IHMyOyApCiAgICAgICAgICAgICAgZTIucXVldWVbaTJdLmNhbGxGdWxmaWxsZWQodDIpOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIGUyOwogICAgICAgIH0sIGwucmVqZWN0ID0gZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICBlMi5zdGF0ZSA9IHMsIGUyLm91dGNvbWUgPSB0MjsKICAgICAgICAgIGZvciAodmFyIHIyID0gLTEsIG4yID0gZTIucXVldWUubGVuZ3RoOyArK3IyIDwgbjI7ICkKICAgICAgICAgICAgZTIucXVldWVbcjJdLmNhbGxSZWplY3RlZCh0Mik7CiAgICAgICAgICByZXR1cm4gZTI7CiAgICAgICAgfSwgby5yZXNvbHZlID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmIChlMiBpbnN0YW5jZW9mIHRoaXMpCiAgICAgICAgICAgIHJldHVybiBlMjsKICAgICAgICAgIHJldHVybiBsLnJlc29sdmUobmV3IHRoaXModSksIGUyKTsKICAgICAgICB9LCBvLnJlamVjdCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBuZXcgdGhpcyh1KTsKICAgICAgICAgIHJldHVybiBsLnJlamVjdCh0MiwgZTIpOwogICAgICAgIH0sIG8uYWxsID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHZhciByMiA9IHRoaXM7CiAgICAgICAgICBpZiAoIltvYmplY3QgQXJyYXldIiAhPT0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZy5jYWxsKGUyKSkKICAgICAgICAgICAgcmV0dXJuIHRoaXMucmVqZWN0KG5ldyBUeXBlRXJyb3IoIm11c3QgYmUgYW4gYXJyYXkiKSk7CiAgICAgICAgICB2YXIgbjIgPSBlMi5sZW5ndGgsIGkyID0gZmFsc2U7CiAgICAgICAgICBpZiAoIW4yKQogICAgICAgICAgICByZXR1cm4gdGhpcy5yZXNvbHZlKFtdKTsKICAgICAgICAgIHZhciBzMiA9IG5ldyBBcnJheShuMiksIGEyID0gMCwgdDIgPSAtMSwgbzIgPSBuZXcgdGhpcyh1KTsKICAgICAgICAgIGZvciAoOyArK3QyIDwgbjI7ICkKICAgICAgICAgICAgaDIoZTJbdDJdLCB0Mik7CiAgICAgICAgICByZXR1cm4gbzI7CiAgICAgICAgICBmdW5jdGlvbiBoMihlMywgdDMpIHsKICAgICAgICAgICAgcjIucmVzb2x2ZShlMykudGhlbihmdW5jdGlvbihlNCkgewogICAgICAgICAgICAgIHMyW3QzXSA9IGU0LCArK2EyICE9PSBuMiB8fCBpMiB8fCAoaTIgPSB0cnVlLCBsLnJlc29sdmUobzIsIHMyKSk7CiAgICAgICAgICAgIH0sIGZ1bmN0aW9uKGU0KSB7CiAgICAgICAgICAgICAgaTIgfHwgKGkyID0gdHJ1ZSwgbC5yZWplY3QobzIsIGU0KSk7CiAgICAgICAgICAgIH0pOwogICAgICAgICAgfQogICAgICAgIH0sIG8ucmFjZSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSB0aGlzOwogICAgICAgICAgaWYgKCJbb2JqZWN0IEFycmF5XSIgIT09IE9iamVjdC5wcm90b3R5cGUudG9TdHJpbmcuY2FsbChlMikpCiAgICAgICAgICAgIHJldHVybiB0aGlzLnJlamVjdChuZXcgVHlwZUVycm9yKCJtdXN0IGJlIGFuIGFycmF5IikpOwogICAgICAgICAgdmFyIHIyID0gZTIubGVuZ3RoLCBuMiA9IGZhbHNlOwogICAgICAgICAgaWYgKCFyMikKICAgICAgICAgICAgcmV0dXJuIHRoaXMucmVzb2x2ZShbXSk7CiAgICAgICAgICB2YXIgaTIgPSAtMSwgczIgPSBuZXcgdGhpcyh1KTsKICAgICAgICAgIGZvciAoOyArK2kyIDwgcjI7ICkKICAgICAgICAgICAgYTIgPSBlMltpMl0sIHQyLnJlc29sdmUoYTIpLnRoZW4oZnVuY3Rpb24oZTMpIHsKICAgICAgICAgICAgICBuMiB8fCAobjIgPSB0cnVlLCBsLnJlc29sdmUoczIsIGUzKSk7CiAgICAgICAgICAgIH0sIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgICAgbjIgfHwgKG4yID0gdHJ1ZSwgbC5yZWplY3QoczIsIGUzKSk7CiAgICAgICAgICAgIH0pOwogICAgICAgICAgdmFyIGEyOwogICAgICAgICAgcmV0dXJuIHMyOwogICAgICAgIH07CiAgICAgIH0sIHsgaW1tZWRpYXRlOiAzNiB9XSwgMzg6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIG4gPSB7fTsKICAgICAgICAoMCwgZSgiLi9saWIvdXRpbHMvY29tbW9uIikuYXNzaWduKShuLCBlKCIuL2xpYi9kZWZsYXRlIiksIGUoIi4vbGliL2luZmxhdGUiKSwgZSgiLi9saWIvemxpYi9jb25zdGFudHMiKSksIHQuZXhwb3J0cyA9IG47CiAgICAgIH0sIHsgIi4vbGliL2RlZmxhdGUiOiAzOSwgIi4vbGliL2luZmxhdGUiOiA0MCwgIi4vbGliL3V0aWxzL2NvbW1vbiI6IDQxLCAiLi9saWIvemxpYi9jb25zdGFudHMiOiA0NCB9XSwgMzk6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIGEgPSBlKCIuL3psaWIvZGVmbGF0ZSIpLCBvID0gZSgiLi91dGlscy9jb21tb24iKSwgaCA9IGUoIi4vdXRpbHMvc3RyaW5ncyIpLCBpID0gZSgiLi96bGliL21lc3NhZ2VzIiksIHMgPSBlKCIuL3psaWIvenN0cmVhbSIpLCB1ID0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZywgbCA9IDAsIGYgPSAtMSwgYyA9IDAsIGQgPSA4OwogICAgICAgIGZ1bmN0aW9uIHAoZTIpIHsKICAgICAgICAgIGlmICghKHRoaXMgaW5zdGFuY2VvZiBwKSkKICAgICAgICAgICAgcmV0dXJuIG5ldyBwKGUyKTsKICAgICAgICAgIHRoaXMub3B0aW9ucyA9IG8uYXNzaWduKHsgbGV2ZWw6IGYsIG1ldGhvZDogZCwgY2h1bmtTaXplOiAxNjM4NCwgd2luZG93Qml0czogMTUsIG1lbUxldmVsOiA4LCBzdHJhdGVneTogYywgdG86ICIiIH0sIGUyIHx8IHt9KTsKICAgICAgICAgIHZhciB0MiA9IHRoaXMub3B0aW9uczsKICAgICAgICAgIHQyLnJhdyAmJiAwIDwgdDIud2luZG93Qml0cyA/IHQyLndpbmRvd0JpdHMgPSAtdDIud2luZG93Qml0cyA6IHQyLmd6aXAgJiYgMCA8IHQyLndpbmRvd0JpdHMgJiYgdDIud2luZG93Qml0cyA8IDE2ICYmICh0Mi53aW5kb3dCaXRzICs9IDE2KSwgdGhpcy5lcnIgPSAwLCB0aGlzLm1zZyA9ICIiLCB0aGlzLmVuZGVkID0gZmFsc2UsIHRoaXMuY2h1bmtzID0gW10sIHRoaXMuc3RybSA9IG5ldyBzKCksIHRoaXMuc3RybS5hdmFpbF9vdXQgPSAwOwogICAgICAgICAgdmFyIHIyID0gYS5kZWZsYXRlSW5pdDIodGhpcy5zdHJtLCB0Mi5sZXZlbCwgdDIubWV0aG9kLCB0Mi53aW5kb3dCaXRzLCB0Mi5tZW1MZXZlbCwgdDIuc3RyYXRlZ3kpOwogICAgICAgICAgaWYgKHIyICE9PSBsKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoaVtyMl0pOwogICAgICAgICAgaWYgKHQyLmhlYWRlciAmJiBhLmRlZmxhdGVTZXRIZWFkZXIodGhpcy5zdHJtLCB0Mi5oZWFkZXIpLCB0Mi5kaWN0aW9uYXJ5KSB7CiAgICAgICAgICAgIHZhciBuMjsKICAgICAgICAgICAgaWYgKG4yID0gInN0cmluZyIgPT0gdHlwZW9mIHQyLmRpY3Rpb25hcnkgPyBoLnN0cmluZzJidWYodDIuZGljdGlvbmFyeSkgOiAiW29iamVjdCBBcnJheUJ1ZmZlcl0iID09PSB1LmNhbGwodDIuZGljdGlvbmFyeSkgPyBuZXcgVWludDhBcnJheSh0Mi5kaWN0aW9uYXJ5KSA6IHQyLmRpY3Rpb25hcnksIChyMiA9IGEuZGVmbGF0ZVNldERpY3Rpb25hcnkodGhpcy5zdHJtLCBuMikpICE9PSBsKQogICAgICAgICAgICAgIHRocm93IG5ldyBFcnJvcihpW3IyXSk7CiAgICAgICAgICAgIHRoaXMuX2RpY3Rfc2V0ID0gdHJ1ZTsKICAgICAgICAgIH0KICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiA9IG5ldyBwKHQyKTsKICAgICAgICAgIGlmIChyMi5wdXNoKGUyLCB0cnVlKSwgcjIuZXJyKQogICAgICAgICAgICB0aHJvdyByMi5tc2cgfHwgaVtyMi5lcnJdOwogICAgICAgICAgcmV0dXJuIHIyLnJlc3VsdDsKICAgICAgICB9CiAgICAgICAgcC5wcm90b3R5cGUucHVzaCA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgdmFyIHIyLCBuMiwgaTIgPSB0aGlzLnN0cm0sIHMyID0gdGhpcy5vcHRpb25zLmNodW5rU2l6ZTsKICAgICAgICAgIGlmICh0aGlzLmVuZGVkKQogICAgICAgICAgICByZXR1cm4gZmFsc2U7CiAgICAgICAgICBuMiA9IHQyID09PSB+fnQyID8gdDIgOiB0cnVlID09PSB0MiA/IDQgOiAwLCAic3RyaW5nIiA9PSB0eXBlb2YgZTIgPyBpMi5pbnB1dCA9IGguc3RyaW5nMmJ1ZihlMikgOiAiW29iamVjdCBBcnJheUJ1ZmZlcl0iID09PSB1LmNhbGwoZTIpID8gaTIuaW5wdXQgPSBuZXcgVWludDhBcnJheShlMikgOiBpMi5pbnB1dCA9IGUyLCBpMi5uZXh0X2luID0gMCwgaTIuYXZhaWxfaW4gPSBpMi5pbnB1dC5sZW5ndGg7CiAgICAgICAgICBkbyB7CiAgICAgICAgICAgIGlmICgwID09PSBpMi5hdmFpbF9vdXQgJiYgKGkyLm91dHB1dCA9IG5ldyBvLkJ1ZjgoczIpLCBpMi5uZXh0X291dCA9IDAsIGkyLmF2YWlsX291dCA9IHMyKSwgMSAhPT0gKHIyID0gYS5kZWZsYXRlKGkyLCBuMikpICYmIHIyICE9PSBsKQogICAgICAgICAgICAgIHJldHVybiB0aGlzLm9uRW5kKHIyKSwgISh0aGlzLmVuZGVkID0gdHJ1ZSk7CiAgICAgICAgICAgIDAgIT09IGkyLmF2YWlsX291dCAmJiAoMCAhPT0gaTIuYXZhaWxfaW4gfHwgNCAhPT0gbjIgJiYgMiAhPT0gbjIpIHx8ICgic3RyaW5nIiA9PT0gdGhpcy5vcHRpb25zLnRvID8gdGhpcy5vbkRhdGEoaC5idWYyYmluc3RyaW5nKG8uc2hyaW5rQnVmKGkyLm91dHB1dCwgaTIubmV4dF9vdXQpKSkgOiB0aGlzLm9uRGF0YShvLnNocmlua0J1ZihpMi5vdXRwdXQsIGkyLm5leHRfb3V0KSkpOwogICAgICAgICAgfSB3aGlsZSAoKDAgPCBpMi5hdmFpbF9pbiB8fCAwID09PSBpMi5hdmFpbF9vdXQpICYmIDEgIT09IHIyKTsKICAgICAgICAgIHJldHVybiA0ID09PSBuMiA/IChyMiA9IGEuZGVmbGF0ZUVuZCh0aGlzLnN0cm0pLCB0aGlzLm9uRW5kKHIyKSwgdGhpcy5lbmRlZCA9IHRydWUsIHIyID09PSBsKSA6IDIgIT09IG4yIHx8ICh0aGlzLm9uRW5kKGwpLCAhKGkyLmF2YWlsX291dCA9IDApKTsKICAgICAgICB9LCBwLnByb3RvdHlwZS5vbkRhdGEgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdGhpcy5jaHVua3MucHVzaChlMik7CiAgICAgICAgfSwgcC5wcm90b3R5cGUub25FbmQgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgZTIgPT09IGwgJiYgKCJzdHJpbmciID09PSB0aGlzLm9wdGlvbnMudG8gPyB0aGlzLnJlc3VsdCA9IHRoaXMuY2h1bmtzLmpvaW4oIiIpIDogdGhpcy5yZXN1bHQgPSBvLmZsYXR0ZW5DaHVua3ModGhpcy5jaHVua3MpKSwgdGhpcy5jaHVua3MgPSBbXSwgdGhpcy5lcnIgPSBlMiwgdGhpcy5tc2cgPSB0aGlzLnN0cm0ubXNnOwogICAgICAgIH0sIHIuRGVmbGF0ZSA9IHAsIHIuZGVmbGF0ZSA9IG4sIHIuZGVmbGF0ZVJhdyA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuICh0MiA9IHQyIHx8IHt9KS5yYXcgPSB0cnVlLCBuKGUyLCB0Mik7CiAgICAgICAgfSwgci5nemlwID0gZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICByZXR1cm4gKHQyID0gdDIgfHwge30pLmd6aXAgPSB0cnVlLCBuKGUyLCB0Mik7CiAgICAgICAgfTsKICAgICAgfSwgeyAiLi91dGlscy9jb21tb24iOiA0MSwgIi4vdXRpbHMvc3RyaW5ncyI6IDQyLCAiLi96bGliL2RlZmxhdGUiOiA0NiwgIi4vemxpYi9tZXNzYWdlcyI6IDUxLCAiLi96bGliL3pzdHJlYW0iOiA1MyB9XSwgNDA6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIGMgPSBlKCIuL3psaWIvaW5mbGF0ZSIpLCBkID0gZSgiLi91dGlscy9jb21tb24iKSwgcCA9IGUoIi4vdXRpbHMvc3RyaW5ncyIpLCBtID0gZSgiLi96bGliL2NvbnN0YW50cyIpLCBuID0gZSgiLi96bGliL21lc3NhZ2VzIiksIGkgPSBlKCIuL3psaWIvenN0cmVhbSIpLCBzID0gZSgiLi96bGliL2d6aGVhZGVyIiksIF8gPSBPYmplY3QucHJvdG90eXBlLnRvU3RyaW5nOwogICAgICAgIGZ1bmN0aW9uIGEoZTIpIHsKICAgICAgICAgIGlmICghKHRoaXMgaW5zdGFuY2VvZiBhKSkKICAgICAgICAgICAgcmV0dXJuIG5ldyBhKGUyKTsKICAgICAgICAgIHRoaXMub3B0aW9ucyA9IGQuYXNzaWduKHsgY2h1bmtTaXplOiAxNjM4NCwgd2luZG93Qml0czogMCwgdG86ICIiIH0sIGUyIHx8IHt9KTsKICAgICAgICAgIHZhciB0MiA9IHRoaXMub3B0aW9uczsKICAgICAgICAgIHQyLnJhdyAmJiAwIDw9IHQyLndpbmRvd0JpdHMgJiYgdDIud2luZG93Qml0cyA8IDE2ICYmICh0Mi53aW5kb3dCaXRzID0gLXQyLndpbmRvd0JpdHMsIDAgPT09IHQyLndpbmRvd0JpdHMgJiYgKHQyLndpbmRvd0JpdHMgPSAtMTUpKSwgISgwIDw9IHQyLndpbmRvd0JpdHMgJiYgdDIud2luZG93Qml0cyA8IDE2KSB8fCBlMiAmJiBlMi53aW5kb3dCaXRzIHx8ICh0Mi53aW5kb3dCaXRzICs9IDMyKSwgMTUgPCB0Mi53aW5kb3dCaXRzICYmIHQyLndpbmRvd0JpdHMgPCA0OCAmJiAwID09ICgxNSAmIHQyLndpbmRvd0JpdHMpICYmICh0Mi53aW5kb3dCaXRzIHw9IDE1KSwgdGhpcy5lcnIgPSAwLCB0aGlzLm1zZyA9ICIiLCB0aGlzLmVuZGVkID0gZmFsc2UsIHRoaXMuY2h1bmtzID0gW10sIHRoaXMuc3RybSA9IG5ldyBpKCksIHRoaXMuc3RybS5hdmFpbF9vdXQgPSAwOwogICAgICAgICAgdmFyIHIyID0gYy5pbmZsYXRlSW5pdDIodGhpcy5zdHJtLCB0Mi53aW5kb3dCaXRzKTsKICAgICAgICAgIGlmIChyMiAhPT0gbS5aX09LKQogICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IobltyMl0pOwogICAgICAgICAgdGhpcy5oZWFkZXIgPSBuZXcgcygpLCBjLmluZmxhdGVHZXRIZWFkZXIodGhpcy5zdHJtLCB0aGlzLmhlYWRlcik7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIG8oZTIsIHQyKSB7CiAgICAgICAgICB2YXIgcjIgPSBuZXcgYSh0Mik7CiAgICAgICAgICBpZiAocjIucHVzaChlMiwgdHJ1ZSksIHIyLmVycikKICAgICAgICAgICAgdGhyb3cgcjIubXNnIHx8IG5bcjIuZXJyXTsKICAgICAgICAgIHJldHVybiByMi5yZXN1bHQ7CiAgICAgICAgfQogICAgICAgIGEucHJvdG90eXBlLnB1c2ggPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjIsIGkyLCBzMiwgYTIsIG8yLCBoID0gdGhpcy5zdHJtLCB1ID0gdGhpcy5vcHRpb25zLmNodW5rU2l6ZSwgbCA9IHRoaXMub3B0aW9ucy5kaWN0aW9uYXJ5LCBmID0gZmFsc2U7CiAgICAgICAgICBpZiAodGhpcy5lbmRlZCkKICAgICAgICAgICAgcmV0dXJuIGZhbHNlOwogICAgICAgICAgbjIgPSB0MiA9PT0gfn50MiA/IHQyIDogdHJ1ZSA9PT0gdDIgPyBtLlpfRklOSVNIIDogbS5aX05PX0ZMVVNILCAic3RyaW5nIiA9PSB0eXBlb2YgZTIgPyBoLmlucHV0ID0gcC5iaW5zdHJpbmcyYnVmKGUyKSA6ICJbb2JqZWN0IEFycmF5QnVmZmVyXSIgPT09IF8uY2FsbChlMikgPyBoLmlucHV0ID0gbmV3IFVpbnQ4QXJyYXkoZTIpIDogaC5pbnB1dCA9IGUyLCBoLm5leHRfaW4gPSAwLCBoLmF2YWlsX2luID0gaC5pbnB1dC5sZW5ndGg7CiAgICAgICAgICBkbyB7CiAgICAgICAgICAgIGlmICgwID09PSBoLmF2YWlsX291dCAmJiAoaC5vdXRwdXQgPSBuZXcgZC5CdWY4KHUpLCBoLm5leHRfb3V0ID0gMCwgaC5hdmFpbF9vdXQgPSB1KSwgKHIyID0gYy5pbmZsYXRlKGgsIG0uWl9OT19GTFVTSCkpID09PSBtLlpfTkVFRF9ESUNUICYmIGwgJiYgKG8yID0gInN0cmluZyIgPT0gdHlwZW9mIGwgPyBwLnN0cmluZzJidWYobCkgOiAiW29iamVjdCBBcnJheUJ1ZmZlcl0iID09PSBfLmNhbGwobCkgPyBuZXcgVWludDhBcnJheShsKSA6IGwsIHIyID0gYy5pbmZsYXRlU2V0RGljdGlvbmFyeSh0aGlzLnN0cm0sIG8yKSksIHIyID09PSBtLlpfQlVGX0VSUk9SICYmIHRydWUgPT09IGYgJiYgKHIyID0gbS5aX09LLCBmID0gZmFsc2UpLCByMiAhPT0gbS5aX1NUUkVBTV9FTkQgJiYgcjIgIT09IG0uWl9PSykKICAgICAgICAgICAgICByZXR1cm4gdGhpcy5vbkVuZChyMiksICEodGhpcy5lbmRlZCA9IHRydWUpOwogICAgICAgICAgICBoLm5leHRfb3V0ICYmICgwICE9PSBoLmF2YWlsX291dCAmJiByMiAhPT0gbS5aX1NUUkVBTV9FTkQgJiYgKDAgIT09IGguYXZhaWxfaW4gfHwgbjIgIT09IG0uWl9GSU5JU0ggJiYgbjIgIT09IG0uWl9TWU5DX0ZMVVNIKSB8fCAoInN0cmluZyIgPT09IHRoaXMub3B0aW9ucy50byA/IChpMiA9IHAudXRmOGJvcmRlcihoLm91dHB1dCwgaC5uZXh0X291dCksIHMyID0gaC5uZXh0X291dCAtIGkyLCBhMiA9IHAuYnVmMnN0cmluZyhoLm91dHB1dCwgaTIpLCBoLm5leHRfb3V0ID0gczIsIGguYXZhaWxfb3V0ID0gdSAtIHMyLCBzMiAmJiBkLmFycmF5U2V0KGgub3V0cHV0LCBoLm91dHB1dCwgaTIsIHMyLCAwKSwgdGhpcy5vbkRhdGEoYTIpKSA6IHRoaXMub25EYXRhKGQuc2hyaW5rQnVmKGgub3V0cHV0LCBoLm5leHRfb3V0KSkpKSwgMCA9PT0gaC5hdmFpbF9pbiAmJiAwID09PSBoLmF2YWlsX291dCAmJiAoZiA9IHRydWUpOwogICAgICAgICAgfSB3aGlsZSAoKDAgPCBoLmF2YWlsX2luIHx8IDAgPT09IGguYXZhaWxfb3V0KSAmJiByMiAhPT0gbS5aX1NUUkVBTV9FTkQpOwogICAgICAgICAgcmV0dXJuIHIyID09PSBtLlpfU1RSRUFNX0VORCAmJiAobjIgPSBtLlpfRklOSVNIKSwgbjIgPT09IG0uWl9GSU5JU0ggPyAocjIgPSBjLmluZmxhdGVFbmQodGhpcy5zdHJtKSwgdGhpcy5vbkVuZChyMiksIHRoaXMuZW5kZWQgPSB0cnVlLCByMiA9PT0gbS5aX09LKSA6IG4yICE9PSBtLlpfU1lOQ19GTFVTSCB8fCAodGhpcy5vbkVuZChtLlpfT0spLCAhKGguYXZhaWxfb3V0ID0gMCkpOwogICAgICAgIH0sIGEucHJvdG90eXBlLm9uRGF0YSA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB0aGlzLmNodW5rcy5wdXNoKGUyKTsKICAgICAgICB9LCBhLnByb3RvdHlwZS5vbkVuZCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBlMiA9PT0gbS5aX09LICYmICgic3RyaW5nIiA9PT0gdGhpcy5vcHRpb25zLnRvID8gdGhpcy5yZXN1bHQgPSB0aGlzLmNodW5rcy5qb2luKCIiKSA6IHRoaXMucmVzdWx0ID0gZC5mbGF0dGVuQ2h1bmtzKHRoaXMuY2h1bmtzKSksIHRoaXMuY2h1bmtzID0gW10sIHRoaXMuZXJyID0gZTIsIHRoaXMubXNnID0gdGhpcy5zdHJtLm1zZzsKICAgICAgICB9LCByLkluZmxhdGUgPSBhLCByLmluZmxhdGUgPSBvLCByLmluZmxhdGVSYXcgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHJldHVybiAodDIgPSB0MiB8fCB7fSkucmF3ID0gdHJ1ZSwgbyhlMiwgdDIpOwogICAgICAgIH0sIHIudW5nemlwID0gbzsKICAgICAgfSwgeyAiLi91dGlscy9jb21tb24iOiA0MSwgIi4vdXRpbHMvc3RyaW5ncyI6IDQyLCAiLi96bGliL2NvbnN0YW50cyI6IDQ0LCAiLi96bGliL2d6aGVhZGVyIjogNDcsICIuL3psaWIvaW5mbGF0ZSI6IDQ5LCAiLi96bGliL21lc3NhZ2VzIjogNTEsICIuL3psaWIvenN0cmVhbSI6IDUzIH1dLCA0MTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgbiA9ICJ1bmRlZmluZWQiICE9IHR5cGVvZiBVaW50OEFycmF5ICYmICJ1bmRlZmluZWQiICE9IHR5cGVvZiBVaW50MTZBcnJheSAmJiAidW5kZWZpbmVkIiAhPSB0eXBlb2YgSW50MzJBcnJheTsKICAgICAgICByLmFzc2lnbiA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBmb3IgKHZhciB0MiA9IEFycmF5LnByb3RvdHlwZS5zbGljZS5jYWxsKGFyZ3VtZW50cywgMSk7IHQyLmxlbmd0aDsgKSB7CiAgICAgICAgICAgIHZhciByMiA9IHQyLnNoaWZ0KCk7CiAgICAgICAgICAgIGlmIChyMikgewogICAgICAgICAgICAgIGlmICgib2JqZWN0IiAhPSB0eXBlb2YgcjIpCiAgICAgICAgICAgICAgICB0aHJvdyBuZXcgVHlwZUVycm9yKHIyICsgIm11c3QgYmUgbm9uLW9iamVjdCIpOwogICAgICAgICAgICAgIGZvciAodmFyIG4yIGluIHIyKQogICAgICAgICAgICAgICAgcjIuaGFzT3duUHJvcGVydHkobjIpICYmIChlMltuMl0gPSByMltuMl0pOwogICAgICAgICAgICB9CiAgICAgICAgICB9CiAgICAgICAgICByZXR1cm4gZTI7CiAgICAgICAgfSwgci5zaHJpbmtCdWYgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHJldHVybiBlMi5sZW5ndGggPT09IHQyID8gZTIgOiBlMi5zdWJhcnJheSA/IGUyLnN1YmFycmF5KDAsIHQyKSA6IChlMi5sZW5ndGggPSB0MiwgZTIpOwogICAgICAgIH07CiAgICAgICAgdmFyIGkgPSB7IGFycmF5U2V0OiBmdW5jdGlvbihlMiwgdDIsIHIyLCBuMiwgaTIpIHsKICAgICAgICAgIGlmICh0Mi5zdWJhcnJheSAmJiBlMi5zdWJhcnJheSkKICAgICAgICAgICAgZTIuc2V0KHQyLnN1YmFycmF5KHIyLCByMiArIG4yKSwgaTIpOwogICAgICAgICAgZWxzZQogICAgICAgICAgICBmb3IgKHZhciBzMiA9IDA7IHMyIDwgbjI7IHMyKyspCiAgICAgICAgICAgICAgZTJbaTIgKyBzMl0gPSB0MltyMiArIHMyXTsKICAgICAgICB9LCBmbGF0dGVuQ2h1bmtzOiBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyLCByMiwgbjIsIGkyLCBzMiwgYTsKICAgICAgICAgIGZvciAodDIgPSBuMiA9IDAsIHIyID0gZTIubGVuZ3RoOyB0MiA8IHIyOyB0MisrKQogICAgICAgICAgICBuMiArPSBlMlt0Ml0ubGVuZ3RoOwogICAgICAgICAgZm9yIChhID0gbmV3IFVpbnQ4QXJyYXkobjIpLCB0MiA9IGkyID0gMCwgcjIgPSBlMi5sZW5ndGg7IHQyIDwgcjI7IHQyKyspCiAgICAgICAgICAgIHMyID0gZTJbdDJdLCBhLnNldChzMiwgaTIpLCBpMiArPSBzMi5sZW5ndGg7CiAgICAgICAgICByZXR1cm4gYTsKICAgICAgICB9IH0sIHMgPSB7IGFycmF5U2V0OiBmdW5jdGlvbihlMiwgdDIsIHIyLCBuMiwgaTIpIHsKICAgICAgICAgIGZvciAodmFyIHMyID0gMDsgczIgPCBuMjsgczIrKykKICAgICAgICAgICAgZTJbaTIgKyBzMl0gPSB0MltyMiArIHMyXTsKICAgICAgICB9LCBmbGF0dGVuQ2h1bmtzOiBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIFtdLmNvbmNhdC5hcHBseShbXSwgZTIpOwogICAgICAgIH0gfTsKICAgICAgICByLnNldFR5cGVkID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGUyID8gKHIuQnVmOCA9IFVpbnQ4QXJyYXksIHIuQnVmMTYgPSBVaW50MTZBcnJheSwgci5CdWYzMiA9IEludDMyQXJyYXksIHIuYXNzaWduKHIsIGkpKSA6IChyLkJ1ZjggPSBBcnJheSwgci5CdWYxNiA9IEFycmF5LCByLkJ1ZjMyID0gQXJyYXksIHIuYXNzaWduKHIsIHMpKTsKICAgICAgICB9LCByLnNldFR5cGVkKG4pOwogICAgICB9LCB7fV0sIDQyOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBoID0gZSgiLi9jb21tb24iKSwgaSA9IHRydWUsIHMgPSB0cnVlOwogICAgICAgIHRyeSB7CiAgICAgICAgICBTdHJpbmcuZnJvbUNoYXJDb2RlLmFwcGx5KG51bGwsIFswXSk7CiAgICAgICAgfSBjYXRjaCAoZTIpIHsKICAgICAgICAgIGkgPSBmYWxzZTsKICAgICAgICB9CiAgICAgICAgdHJ5IHsKICAgICAgICAgIFN0cmluZy5mcm9tQ2hhckNvZGUuYXBwbHkobnVsbCwgbmV3IFVpbnQ4QXJyYXkoMSkpOwogICAgICAgIH0gY2F0Y2ggKGUyKSB7CiAgICAgICAgICBzID0gZmFsc2U7CiAgICAgICAgfQogICAgICAgIGZvciAodmFyIHUgPSBuZXcgaC5CdWY4KDI1NiksIG4gPSAwOyBuIDwgMjU2OyBuKyspCiAgICAgICAgICB1W25dID0gMjUyIDw9IG4gPyA2IDogMjQ4IDw9IG4gPyA1IDogMjQwIDw9IG4gPyA0IDogMjI0IDw9IG4gPyAzIDogMTkyIDw9IG4gPyAyIDogMTsKICAgICAgICBmdW5jdGlvbiBsKGUyLCB0MikgewogICAgICAgICAgaWYgKHQyIDwgNjU1MzcgJiYgKGUyLnN1YmFycmF5ICYmIHMgfHwgIWUyLnN1YmFycmF5ICYmIGkpKQogICAgICAgICAgICByZXR1cm4gU3RyaW5nLmZyb21DaGFyQ29kZS5hcHBseShudWxsLCBoLnNocmlua0J1ZihlMiwgdDIpKTsKICAgICAgICAgIGZvciAodmFyIHIyID0gIiIsIG4yID0gMDsgbjIgPCB0MjsgbjIrKykKICAgICAgICAgICAgcjIgKz0gU3RyaW5nLmZyb21DaGFyQ29kZShlMltuMl0pOwogICAgICAgICAgcmV0dXJuIHIyOwogICAgICAgIH0KICAgICAgICB1WzI1NF0gPSB1WzI1NF0gPSAxLCByLnN0cmluZzJidWYgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgdmFyIHQyLCByMiwgbjIsIGkyLCBzMiwgYSA9IGUyLmxlbmd0aCwgbyA9IDA7CiAgICAgICAgICBmb3IgKGkyID0gMDsgaTIgPCBhOyBpMisrKQogICAgICAgICAgICA1NTI5NiA9PSAoNjQ1MTIgJiAocjIgPSBlMi5jaGFyQ29kZUF0KGkyKSkpICYmIGkyICsgMSA8IGEgJiYgNTYzMjAgPT0gKDY0NTEyICYgKG4yID0gZTIuY2hhckNvZGVBdChpMiArIDEpKSkgJiYgKHIyID0gNjU1MzYgKyAocjIgLSA1NTI5NiA8PCAxMCkgKyAobjIgLSA1NjMyMCksIGkyKyspLCBvICs9IHIyIDwgMTI4ID8gMSA6IHIyIDwgMjA0OCA/IDIgOiByMiA8IDY1NTM2ID8gMyA6IDQ7CiAgICAgICAgICBmb3IgKHQyID0gbmV3IGguQnVmOChvKSwgaTIgPSBzMiA9IDA7IHMyIDwgbzsgaTIrKykKICAgICAgICAgICAgNTUyOTYgPT0gKDY0NTEyICYgKHIyID0gZTIuY2hhckNvZGVBdChpMikpKSAmJiBpMiArIDEgPCBhICYmIDU2MzIwID09ICg2NDUxMiAmIChuMiA9IGUyLmNoYXJDb2RlQXQoaTIgKyAxKSkpICYmIChyMiA9IDY1NTM2ICsgKHIyIC0gNTUyOTYgPDwgMTApICsgKG4yIC0gNTYzMjApLCBpMisrKSwgcjIgPCAxMjggPyB0MltzMisrXSA9IHIyIDogKHIyIDwgMjA0OCA/IHQyW3MyKytdID0gMTkyIHwgcjIgPj4+IDYgOiAocjIgPCA2NTUzNiA/IHQyW3MyKytdID0gMjI0IHwgcjIgPj4+IDEyIDogKHQyW3MyKytdID0gMjQwIHwgcjIgPj4+IDE4LCB0MltzMisrXSA9IDEyOCB8IHIyID4+PiAxMiAmIDYzKSwgdDJbczIrK10gPSAxMjggfCByMiA+Pj4gNiAmIDYzKSwgdDJbczIrK10gPSAxMjggfCA2MyAmIHIyKTsKICAgICAgICAgIHJldHVybiB0MjsKICAgICAgICB9LCByLmJ1ZjJiaW5zdHJpbmcgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIGwoZTIsIGUyLmxlbmd0aCk7CiAgICAgICAgfSwgci5iaW5zdHJpbmcyYnVmID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGZvciAodmFyIHQyID0gbmV3IGguQnVmOChlMi5sZW5ndGgpLCByMiA9IDAsIG4yID0gdDIubGVuZ3RoOyByMiA8IG4yOyByMisrKQogICAgICAgICAgICB0MltyMl0gPSBlMi5jaGFyQ29kZUF0KHIyKTsKICAgICAgICAgIHJldHVybiB0MjsKICAgICAgICB9LCByLmJ1ZjJzdHJpbmcgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjIsIGkyLCBzMiwgYSA9IHQyIHx8IGUyLmxlbmd0aCwgbyA9IG5ldyBBcnJheSgyICogYSk7CiAgICAgICAgICBmb3IgKHIyID0gbjIgPSAwOyByMiA8IGE7ICkKICAgICAgICAgICAgaWYgKChpMiA9IGUyW3IyKytdKSA8IDEyOCkKICAgICAgICAgICAgICBvW24yKytdID0gaTI7CiAgICAgICAgICAgIGVsc2UgaWYgKDQgPCAoczIgPSB1W2kyXSkpCiAgICAgICAgICAgICAgb1tuMisrXSA9IDY1NTMzLCByMiArPSBzMiAtIDE7CiAgICAgICAgICAgIGVsc2UgewogICAgICAgICAgICAgIGZvciAoaTIgJj0gMiA9PT0gczIgPyAzMSA6IDMgPT09IHMyID8gMTUgOiA3OyAxIDwgczIgJiYgcjIgPCBhOyApCiAgICAgICAgICAgICAgICBpMiA9IGkyIDw8IDYgfCA2MyAmIGUyW3IyKytdLCBzMi0tOwogICAgICAgICAgICAgIDEgPCBzMiA/IG9bbjIrK10gPSA2NTUzMyA6IGkyIDwgNjU1MzYgPyBvW24yKytdID0gaTIgOiAoaTIgLT0gNjU1MzYsIG9bbjIrK10gPSA1NTI5NiB8IGkyID4+IDEwICYgMTAyMywgb1tuMisrXSA9IDU2MzIwIHwgMTAyMyAmIGkyKTsKICAgICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIGwobywgbjIpOwogICAgICAgIH0sIHIudXRmOGJvcmRlciA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgdmFyIHIyOwogICAgICAgICAgZm9yICgodDIgPSB0MiB8fCBlMi5sZW5ndGgpID4gZTIubGVuZ3RoICYmICh0MiA9IGUyLmxlbmd0aCksIHIyID0gdDIgLSAxOyAwIDw9IHIyICYmIDEyOCA9PSAoMTkyICYgZTJbcjJdKTsgKQogICAgICAgICAgICByMi0tOwogICAgICAgICAgcmV0dXJuIHIyIDwgMCA/IHQyIDogMCA9PT0gcjIgPyB0MiA6IHIyICsgdVtlMltyMl1dID4gdDIgPyByMiA6IHQyOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4vY29tbW9uIjogNDEgfV0sIDQzOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHQuZXhwb3J0cyA9IGZ1bmN0aW9uKGUyLCB0MiwgcjIsIG4pIHsKICAgICAgICAgIGZvciAodmFyIGkgPSA2NTUzNSAmIGUyIHwgMCwgcyA9IGUyID4+PiAxNiAmIDY1NTM1IHwgMCwgYSA9IDA7IDAgIT09IHIyOyApIHsKICAgICAgICAgICAgZm9yIChyMiAtPSBhID0gMmUzIDwgcjIgPyAyZTMgOiByMjsgcyA9IHMgKyAoaSA9IGkgKyB0MltuKytdIHwgMCkgfCAwLCAtLWE7ICkKICAgICAgICAgICAgICA7CiAgICAgICAgICAgIGkgJT0gNjU1MjEsIHMgJT0gNjU1MjE7CiAgICAgICAgICB9CiAgICAgICAgICByZXR1cm4gaSB8IHMgPDwgMTYgfCAwOwogICAgICAgIH07CiAgICAgIH0sIHt9XSwgNDQ6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdC5leHBvcnRzID0geyBaX05PX0ZMVVNIOiAwLCBaX1BBUlRJQUxfRkxVU0g6IDEsIFpfU1lOQ19GTFVTSDogMiwgWl9GVUxMX0ZMVVNIOiAzLCBaX0ZJTklTSDogNCwgWl9CTE9DSzogNSwgWl9UUkVFUzogNiwgWl9PSzogMCwgWl9TVFJFQU1fRU5EOiAxLCBaX05FRURfRElDVDogMiwgWl9FUlJOTzogLTEsIFpfU1RSRUFNX0VSUk9SOiAtMiwgWl9EQVRBX0VSUk9SOiAtMywgWl9CVUZfRVJST1I6IC01LCBaX05PX0NPTVBSRVNTSU9OOiAwLCBaX0JFU1RfU1BFRUQ6IDEsIFpfQkVTVF9DT01QUkVTU0lPTjogOSwgWl9ERUZBVUxUX0NPTVBSRVNTSU9OOiAtMSwgWl9GSUxURVJFRDogMSwgWl9IVUZGTUFOX09OTFk6IDIsIFpfUkxFOiAzLCBaX0ZJWEVEOiA0LCBaX0RFRkFVTFRfU1RSQVRFR1k6IDAsIFpfQklOQVJZOiAwLCBaX1RFWFQ6IDEsIFpfVU5LTk9XTjogMiwgWl9ERUZMQVRFRDogOCB9OwogICAgICB9LCB7fV0sIDQ1OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBvID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICBmb3IgKHZhciBlMiwgdDIgPSBbXSwgcjIgPSAwOyByMiA8IDI1NjsgcjIrKykgewogICAgICAgICAgICBlMiA9IHIyOwogICAgICAgICAgICBmb3IgKHZhciBuID0gMDsgbiA8IDg7IG4rKykKICAgICAgICAgICAgICBlMiA9IDEgJiBlMiA/IDM5ODgyOTIzODQgXiBlMiA+Pj4gMSA6IGUyID4+PiAxOwogICAgICAgICAgICB0MltyMl0gPSBlMjsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiB0MjsKICAgICAgICB9KCk7CiAgICAgICAgdC5leHBvcnRzID0gZnVuY3Rpb24oZTIsIHQyLCByMiwgbikgewogICAgICAgICAgdmFyIGkgPSBvLCBzID0gbiArIHIyOwogICAgICAgICAgZTIgXj0gLTE7CiAgICAgICAgICBmb3IgKHZhciBhID0gbjsgYSA8IHM7IGErKykKICAgICAgICAgICAgZTIgPSBlMiA+Pj4gOCBeIGlbMjU1ICYgKGUyIF4gdDJbYV0pXTsKICAgICAgICAgIHJldHVybiAtMSBeIGUyOwogICAgICAgIH07CiAgICAgIH0sIHt9XSwgNDY6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdmFyIGgsIGMgPSBlKCIuLi91dGlscy9jb21tb24iKSwgdSA9IGUoIi4vdHJlZXMiKSwgZCA9IGUoIi4vYWRsZXIzMiIpLCBwID0gZSgiLi9jcmMzMiIpLCBuID0gZSgiLi9tZXNzYWdlcyIpLCBsID0gMCwgZiA9IDQsIG0gPSAwLCBfID0gLTIsIGcgPSAtMSwgYiA9IDQsIGkgPSAyLCB2ID0gOCwgeSA9IDksIHMgPSAyODYsIGEgPSAzMCwgbyA9IDE5LCB3ID0gMiAqIHMgKyAxLCBrID0gMTUsIHggPSAzLCBTID0gMjU4LCB6ID0gUyArIHggKyAxLCBDID0gNDIsIEUgPSAxMTMsIEEgPSAxLCBJID0gMiwgTyA9IDMsIEIgPSA0OwogICAgICAgIGZ1bmN0aW9uIFIoZTIsIHQyKSB7CiAgICAgICAgICByZXR1cm4gZTIubXNnID0gblt0Ml0sIHQyOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBUKGUyKSB7CiAgICAgICAgICByZXR1cm4gKGUyIDw8IDEpIC0gKDQgPCBlMiA/IDkgOiAwKTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gRChlMikgewogICAgICAgICAgZm9yICh2YXIgdDIgPSBlMi5sZW5ndGg7IDAgPD0gLS10MjsgKQogICAgICAgICAgICBlMlt0Ml0gPSAwOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBGKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBlMi5zdGF0ZSwgcjIgPSB0Mi5wZW5kaW5nOwogICAgICAgICAgcjIgPiBlMi5hdmFpbF9vdXQgJiYgKHIyID0gZTIuYXZhaWxfb3V0KSwgMCAhPT0gcjIgJiYgKGMuYXJyYXlTZXQoZTIub3V0cHV0LCB0Mi5wZW5kaW5nX2J1ZiwgdDIucGVuZGluZ19vdXQsIHIyLCBlMi5uZXh0X291dCksIGUyLm5leHRfb3V0ICs9IHIyLCB0Mi5wZW5kaW5nX291dCArPSByMiwgZTIudG90YWxfb3V0ICs9IHIyLCBlMi5hdmFpbF9vdXQgLT0gcjIsIHQyLnBlbmRpbmcgLT0gcjIsIDAgPT09IHQyLnBlbmRpbmcgJiYgKHQyLnBlbmRpbmdfb3V0ID0gMCkpOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBOKGUyLCB0MikgewogICAgICAgICAgdS5fdHJfZmx1c2hfYmxvY2soZTIsIDAgPD0gZTIuYmxvY2tfc3RhcnQgPyBlMi5ibG9ja19zdGFydCA6IC0xLCBlMi5zdHJzdGFydCAtIGUyLmJsb2NrX3N0YXJ0LCB0MiksIGUyLmJsb2NrX3N0YXJ0ID0gZTIuc3Ryc3RhcnQsIEYoZTIuc3RybSk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFUoZTIsIHQyKSB7CiAgICAgICAgICBlMi5wZW5kaW5nX2J1ZltlMi5wZW5kaW5nKytdID0gdDI7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFAoZTIsIHQyKSB7CiAgICAgICAgICBlMi5wZW5kaW5nX2J1ZltlMi5wZW5kaW5nKytdID0gdDIgPj4+IDggJiAyNTUsIGUyLnBlbmRpbmdfYnVmW2UyLnBlbmRpbmcrK10gPSAyNTUgJiB0MjsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gTChlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjIsIGkyID0gZTIubWF4X2NoYWluX2xlbmd0aCwgczIgPSBlMi5zdHJzdGFydCwgYTIgPSBlMi5wcmV2X2xlbmd0aCwgbzIgPSBlMi5uaWNlX21hdGNoLCBoMiA9IGUyLnN0cnN0YXJ0ID4gZTIud19zaXplIC0geiA/IGUyLnN0cnN0YXJ0IC0gKGUyLndfc2l6ZSAtIHopIDogMCwgdTIgPSBlMi53aW5kb3csIGwyID0gZTIud19tYXNrLCBmMiA9IGUyLnByZXYsIGMyID0gZTIuc3Ryc3RhcnQgKyBTLCBkMiA9IHUyW3MyICsgYTIgLSAxXSwgcDIgPSB1MltzMiArIGEyXTsKICAgICAgICAgIGUyLnByZXZfbGVuZ3RoID49IGUyLmdvb2RfbWF0Y2ggJiYgKGkyID4+PSAyKSwgbzIgPiBlMi5sb29rYWhlYWQgJiYgKG8yID0gZTIubG9va2FoZWFkKTsKICAgICAgICAgIGRvIHsKICAgICAgICAgICAgaWYgKHUyWyhyMiA9IHQyKSArIGEyXSA9PT0gcDIgJiYgdTJbcjIgKyBhMiAtIDFdID09PSBkMiAmJiB1MltyMl0gPT09IHUyW3MyXSAmJiB1MlsrK3IyXSA9PT0gdTJbczIgKyAxXSkgewogICAgICAgICAgICAgIHMyICs9IDIsIHIyKys7CiAgICAgICAgICAgICAgZG8gewogICAgICAgICAgICAgIH0gd2hpbGUgKHUyWysrczJdID09PSB1MlsrK3IyXSAmJiB1MlsrK3MyXSA9PT0gdTJbKytyMl0gJiYgdTJbKytzMl0gPT09IHUyWysrcjJdICYmIHUyWysrczJdID09PSB1MlsrK3IyXSAmJiB1MlsrK3MyXSA9PT0gdTJbKytyMl0gJiYgdTJbKytzMl0gPT09IHUyWysrcjJdICYmIHUyWysrczJdID09PSB1MlsrK3IyXSAmJiB1MlsrK3MyXSA9PT0gdTJbKytyMl0gJiYgczIgPCBjMik7CiAgICAgICAgICAgICAgaWYgKG4yID0gUyAtIChjMiAtIHMyKSwgczIgPSBjMiAtIFMsIGEyIDwgbjIpIHsKICAgICAgICAgICAgICAgIGlmIChlMi5tYXRjaF9zdGFydCA9IHQyLCBvMiA8PSAoYTIgPSBuMikpCiAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgZDIgPSB1MltzMiArIGEyIC0gMV0sIHAyID0gdTJbczIgKyBhMl07CiAgICAgICAgICAgICAgfQogICAgICAgICAgICB9CiAgICAgICAgICB9IHdoaWxlICgodDIgPSBmMlt0MiAmIGwyXSkgPiBoMiAmJiAwICE9IC0taTIpOwogICAgICAgICAgcmV0dXJuIGEyIDw9IGUyLmxvb2thaGVhZCA/IGEyIDogZTIubG9va2FoZWFkOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBqKGUyKSB7CiAgICAgICAgICB2YXIgdDIsIHIyLCBuMiwgaTIsIHMyLCBhMiwgbzIsIGgyLCB1MiwgbDIsIGYyID0gZTIud19zaXplOwogICAgICAgICAgZG8gewogICAgICAgICAgICBpZiAoaTIgPSBlMi53aW5kb3dfc2l6ZSAtIGUyLmxvb2thaGVhZCAtIGUyLnN0cnN0YXJ0LCBlMi5zdHJzdGFydCA+PSBmMiArIChmMiAtIHopKSB7CiAgICAgICAgICAgICAgZm9yIChjLmFycmF5U2V0KGUyLndpbmRvdywgZTIud2luZG93LCBmMiwgZjIsIDApLCBlMi5tYXRjaF9zdGFydCAtPSBmMiwgZTIuc3Ryc3RhcnQgLT0gZjIsIGUyLmJsb2NrX3N0YXJ0IC09IGYyLCB0MiA9IHIyID0gZTIuaGFzaF9zaXplOyBuMiA9IGUyLmhlYWRbLS10Ml0sIGUyLmhlYWRbdDJdID0gZjIgPD0gbjIgPyBuMiAtIGYyIDogMCwgLS1yMjsgKQogICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgIGZvciAodDIgPSByMiA9IGYyOyBuMiA9IGUyLnByZXZbLS10Ml0sIGUyLnByZXZbdDJdID0gZjIgPD0gbjIgPyBuMiAtIGYyIDogMCwgLS1yMjsgKQogICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgIGkyICs9IGYyOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGlmICgwID09PSBlMi5zdHJtLmF2YWlsX2luKQogICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICBpZiAoYTIgPSBlMi5zdHJtLCBvMiA9IGUyLndpbmRvdywgaDIgPSBlMi5zdHJzdGFydCArIGUyLmxvb2thaGVhZCwgdTIgPSBpMiwgbDIgPSB2b2lkIDAsIGwyID0gYTIuYXZhaWxfaW4sIHUyIDwgbDIgJiYgKGwyID0gdTIpLCByMiA9IDAgPT09IGwyID8gMCA6IChhMi5hdmFpbF9pbiAtPSBsMiwgYy5hcnJheVNldChvMiwgYTIuaW5wdXQsIGEyLm5leHRfaW4sIGwyLCBoMiksIDEgPT09IGEyLnN0YXRlLndyYXAgPyBhMi5hZGxlciA9IGQoYTIuYWRsZXIsIG8yLCBsMiwgaDIpIDogMiA9PT0gYTIuc3RhdGUud3JhcCAmJiAoYTIuYWRsZXIgPSBwKGEyLmFkbGVyLCBvMiwgbDIsIGgyKSksIGEyLm5leHRfaW4gKz0gbDIsIGEyLnRvdGFsX2luICs9IGwyLCBsMiksIGUyLmxvb2thaGVhZCArPSByMiwgZTIubG9va2FoZWFkICsgZTIuaW5zZXJ0ID49IHgpCiAgICAgICAgICAgICAgZm9yIChzMiA9IGUyLnN0cnN0YXJ0IC0gZTIuaW5zZXJ0LCBlMi5pbnNfaCA9IGUyLndpbmRvd1tzMl0sIGUyLmluc19oID0gKGUyLmluc19oIDw8IGUyLmhhc2hfc2hpZnQgXiBlMi53aW5kb3dbczIgKyAxXSkgJiBlMi5oYXNoX21hc2s7IGUyLmluc2VydCAmJiAoZTIuaW5zX2ggPSAoZTIuaW5zX2ggPDwgZTIuaGFzaF9zaGlmdCBeIGUyLndpbmRvd1tzMiArIHggLSAxXSkgJiBlMi5oYXNoX21hc2ssIGUyLnByZXZbczIgJiBlMi53X21hc2tdID0gZTIuaGVhZFtlMi5pbnNfaF0sIGUyLmhlYWRbZTIuaW5zX2hdID0gczIsIHMyKyssIGUyLmluc2VydC0tLCAhKGUyLmxvb2thaGVhZCArIGUyLmluc2VydCA8IHgpKTsgKQogICAgICAgICAgICAgICAgOwogICAgICAgICAgfSB3aGlsZSAoZTIubG9va2FoZWFkIDwgeiAmJiAwICE9PSBlMi5zdHJtLmF2YWlsX2luKTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gWihlMiwgdDIpIHsKICAgICAgICAgIGZvciAodmFyIHIyLCBuMjsgOyApIHsKICAgICAgICAgICAgaWYgKGUyLmxvb2thaGVhZCA8IHopIHsKICAgICAgICAgICAgICBpZiAoaihlMiksIGUyLmxvb2thaGVhZCA8IHogJiYgdDIgPT09IGwpCiAgICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgICAgICBpZiAoMCA9PT0gZTIubG9va2FoZWFkKQogICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgIH0KICAgICAgICAgICAgaWYgKHIyID0gMCwgZTIubG9va2FoZWFkID49IHggJiYgKGUyLmluc19oID0gKGUyLmluc19oIDw8IGUyLmhhc2hfc2hpZnQgXiBlMi53aW5kb3dbZTIuc3Ryc3RhcnQgKyB4IC0gMV0pICYgZTIuaGFzaF9tYXNrLCByMiA9IGUyLnByZXZbZTIuc3Ryc3RhcnQgJiBlMi53X21hc2tdID0gZTIuaGVhZFtlMi5pbnNfaF0sIGUyLmhlYWRbZTIuaW5zX2hdID0gZTIuc3Ryc3RhcnQpLCAwICE9PSByMiAmJiBlMi5zdHJzdGFydCAtIHIyIDw9IGUyLndfc2l6ZSAtIHogJiYgKGUyLm1hdGNoX2xlbmd0aCA9IEwoZTIsIHIyKSksIGUyLm1hdGNoX2xlbmd0aCA+PSB4KQogICAgICAgICAgICAgIGlmIChuMiA9IHUuX3RyX3RhbGx5KGUyLCBlMi5zdHJzdGFydCAtIGUyLm1hdGNoX3N0YXJ0LCBlMi5tYXRjaF9sZW5ndGggLSB4KSwgZTIubG9va2FoZWFkIC09IGUyLm1hdGNoX2xlbmd0aCwgZTIubWF0Y2hfbGVuZ3RoIDw9IGUyLm1heF9sYXp5X21hdGNoICYmIGUyLmxvb2thaGVhZCA+PSB4KSB7CiAgICAgICAgICAgICAgICBmb3IgKGUyLm1hdGNoX2xlbmd0aC0tOyBlMi5zdHJzdGFydCsrLCBlMi5pbnNfaCA9IChlMi5pbnNfaCA8PCBlMi5oYXNoX3NoaWZ0IF4gZTIud2luZG93W2UyLnN0cnN0YXJ0ICsgeCAtIDFdKSAmIGUyLmhhc2hfbWFzaywgcjIgPSBlMi5wcmV2W2UyLnN0cnN0YXJ0ICYgZTIud19tYXNrXSA9IGUyLmhlYWRbZTIuaW5zX2hdLCBlMi5oZWFkW2UyLmluc19oXSA9IGUyLnN0cnN0YXJ0LCAwICE9IC0tZTIubWF0Y2hfbGVuZ3RoOyApCiAgICAgICAgICAgICAgICAgIDsKICAgICAgICAgICAgICAgIGUyLnN0cnN0YXJ0Kys7CiAgICAgICAgICAgICAgfSBlbHNlCiAgICAgICAgICAgICAgICBlMi5zdHJzdGFydCArPSBlMi5tYXRjaF9sZW5ndGgsIGUyLm1hdGNoX2xlbmd0aCA9IDAsIGUyLmluc19oID0gZTIud2luZG93W2UyLnN0cnN0YXJ0XSwgZTIuaW5zX2ggPSAoZTIuaW5zX2ggPDwgZTIuaGFzaF9zaGlmdCBeIGUyLndpbmRvd1tlMi5zdHJzdGFydCArIDFdKSAmIGUyLmhhc2hfbWFzazsKICAgICAgICAgICAgZWxzZQogICAgICAgICAgICAgIG4yID0gdS5fdHJfdGFsbHkoZTIsIDAsIGUyLndpbmRvd1tlMi5zdHJzdGFydF0pLCBlMi5sb29rYWhlYWQtLSwgZTIuc3Ryc3RhcnQrKzsKICAgICAgICAgICAgaWYgKG4yICYmIChOKGUyLCBmYWxzZSksIDAgPT09IGUyLnN0cm0uYXZhaWxfb3V0KSkKICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiBlMi5pbnNlcnQgPSBlMi5zdHJzdGFydCA8IHggLSAxID8gZTIuc3Ryc3RhcnQgOiB4IC0gMSwgdDIgPT09IGYgPyAoTihlMiwgdHJ1ZSksIDAgPT09IGUyLnN0cm0uYXZhaWxfb3V0ID8gTyA6IEIpIDogZTIubGFzdF9saXQgJiYgKE4oZTIsIGZhbHNlKSwgMCA9PT0gZTIuc3RybS5hdmFpbF9vdXQpID8gQSA6IEk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFcoZTIsIHQyKSB7CiAgICAgICAgICBmb3IgKHZhciByMiwgbjIsIGkyOyA7ICkgewogICAgICAgICAgICBpZiAoZTIubG9va2FoZWFkIDwgeikgewogICAgICAgICAgICAgIGlmIChqKGUyKSwgZTIubG9va2FoZWFkIDwgeiAmJiB0MiA9PT0gbCkKICAgICAgICAgICAgICAgIHJldHVybiBBOwogICAgICAgICAgICAgIGlmICgwID09PSBlMi5sb29rYWhlYWQpCiAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgfQogICAgICAgICAgICBpZiAocjIgPSAwLCBlMi5sb29rYWhlYWQgPj0geCAmJiAoZTIuaW5zX2ggPSAoZTIuaW5zX2ggPDwgZTIuaGFzaF9zaGlmdCBeIGUyLndpbmRvd1tlMi5zdHJzdGFydCArIHggLSAxXSkgJiBlMi5oYXNoX21hc2ssIHIyID0gZTIucHJldltlMi5zdHJzdGFydCAmIGUyLndfbWFza10gPSBlMi5oZWFkW2UyLmluc19oXSwgZTIuaGVhZFtlMi5pbnNfaF0gPSBlMi5zdHJzdGFydCksIGUyLnByZXZfbGVuZ3RoID0gZTIubWF0Y2hfbGVuZ3RoLCBlMi5wcmV2X21hdGNoID0gZTIubWF0Y2hfc3RhcnQsIGUyLm1hdGNoX2xlbmd0aCA9IHggLSAxLCAwICE9PSByMiAmJiBlMi5wcmV2X2xlbmd0aCA8IGUyLm1heF9sYXp5X21hdGNoICYmIGUyLnN0cnN0YXJ0IC0gcjIgPD0gZTIud19zaXplIC0geiAmJiAoZTIubWF0Y2hfbGVuZ3RoID0gTChlMiwgcjIpLCBlMi5tYXRjaF9sZW5ndGggPD0gNSAmJiAoMSA9PT0gZTIuc3RyYXRlZ3kgfHwgZTIubWF0Y2hfbGVuZ3RoID09PSB4ICYmIDQwOTYgPCBlMi5zdHJzdGFydCAtIGUyLm1hdGNoX3N0YXJ0KSAmJiAoZTIubWF0Y2hfbGVuZ3RoID0geCAtIDEpKSwgZTIucHJldl9sZW5ndGggPj0geCAmJiBlMi5tYXRjaF9sZW5ndGggPD0gZTIucHJldl9sZW5ndGgpIHsKICAgICAgICAgICAgICBmb3IgKGkyID0gZTIuc3Ryc3RhcnQgKyBlMi5sb29rYWhlYWQgLSB4LCBuMiA9IHUuX3RyX3RhbGx5KGUyLCBlMi5zdHJzdGFydCAtIDEgLSBlMi5wcmV2X21hdGNoLCBlMi5wcmV2X2xlbmd0aCAtIHgpLCBlMi5sb29rYWhlYWQgLT0gZTIucHJldl9sZW5ndGggLSAxLCBlMi5wcmV2X2xlbmd0aCAtPSAyOyArK2UyLnN0cnN0YXJ0IDw9IGkyICYmIChlMi5pbnNfaCA9IChlMi5pbnNfaCA8PCBlMi5oYXNoX3NoaWZ0IF4gZTIud2luZG93W2UyLnN0cnN0YXJ0ICsgeCAtIDFdKSAmIGUyLmhhc2hfbWFzaywgcjIgPSBlMi5wcmV2W2UyLnN0cnN0YXJ0ICYgZTIud19tYXNrXSA9IGUyLmhlYWRbZTIuaW5zX2hdLCBlMi5oZWFkW2UyLmluc19oXSA9IGUyLnN0cnN0YXJ0KSwgMCAhPSAtLWUyLnByZXZfbGVuZ3RoOyApCiAgICAgICAgICAgICAgICA7CiAgICAgICAgICAgICAgaWYgKGUyLm1hdGNoX2F2YWlsYWJsZSA9IDAsIGUyLm1hdGNoX2xlbmd0aCA9IHggLSAxLCBlMi5zdHJzdGFydCsrLCBuMiAmJiAoTihlMiwgZmFsc2UpLCAwID09PSBlMi5zdHJtLmF2YWlsX291dCkpCiAgICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgICAgfSBlbHNlIGlmIChlMi5tYXRjaF9hdmFpbGFibGUpIHsKICAgICAgICAgICAgICBpZiAoKG4yID0gdS5fdHJfdGFsbHkoZTIsIDAsIGUyLndpbmRvd1tlMi5zdHJzdGFydCAtIDFdKSkgJiYgTihlMiwgZmFsc2UpLCBlMi5zdHJzdGFydCsrLCBlMi5sb29rYWhlYWQtLSwgMCA9PT0gZTIuc3RybS5hdmFpbF9vdXQpCiAgICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgICAgfSBlbHNlCiAgICAgICAgICAgICAgZTIubWF0Y2hfYXZhaWxhYmxlID0gMSwgZTIuc3Ryc3RhcnQrKywgZTIubG9va2FoZWFkLS07CiAgICAgICAgICB9CiAgICAgICAgICByZXR1cm4gZTIubWF0Y2hfYXZhaWxhYmxlICYmIChuMiA9IHUuX3RyX3RhbGx5KGUyLCAwLCBlMi53aW5kb3dbZTIuc3Ryc3RhcnQgLSAxXSksIGUyLm1hdGNoX2F2YWlsYWJsZSA9IDApLCBlMi5pbnNlcnQgPSBlMi5zdHJzdGFydCA8IHggLSAxID8gZTIuc3Ryc3RhcnQgOiB4IC0gMSwgdDIgPT09IGYgPyAoTihlMiwgdHJ1ZSksIDAgPT09IGUyLnN0cm0uYXZhaWxfb3V0ID8gTyA6IEIpIDogZTIubGFzdF9saXQgJiYgKE4oZTIsIGZhbHNlKSwgMCA9PT0gZTIuc3RybS5hdmFpbF9vdXQpID8gQSA6IEk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIE0oZTIsIHQyLCByMiwgbjIsIGkyKSB7CiAgICAgICAgICB0aGlzLmdvb2RfbGVuZ3RoID0gZTIsIHRoaXMubWF4X2xhenkgPSB0MiwgdGhpcy5uaWNlX2xlbmd0aCA9IHIyLCB0aGlzLm1heF9jaGFpbiA9IG4yLCB0aGlzLmZ1bmMgPSBpMjsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gSCgpIHsKICAgICAgICAgIHRoaXMuc3RybSA9IG51bGwsIHRoaXMuc3RhdHVzID0gMCwgdGhpcy5wZW5kaW5nX2J1ZiA9IG51bGwsIHRoaXMucGVuZGluZ19idWZfc2l6ZSA9IDAsIHRoaXMucGVuZGluZ19vdXQgPSAwLCB0aGlzLnBlbmRpbmcgPSAwLCB0aGlzLndyYXAgPSAwLCB0aGlzLmd6aGVhZCA9IG51bGwsIHRoaXMuZ3ppbmRleCA9IDAsIHRoaXMubWV0aG9kID0gdiwgdGhpcy5sYXN0X2ZsdXNoID0gLTEsIHRoaXMud19zaXplID0gMCwgdGhpcy53X2JpdHMgPSAwLCB0aGlzLndfbWFzayA9IDAsIHRoaXMud2luZG93ID0gbnVsbCwgdGhpcy53aW5kb3dfc2l6ZSA9IDAsIHRoaXMucHJldiA9IG51bGwsIHRoaXMuaGVhZCA9IG51bGwsIHRoaXMuaW5zX2ggPSAwLCB0aGlzLmhhc2hfc2l6ZSA9IDAsIHRoaXMuaGFzaF9iaXRzID0gMCwgdGhpcy5oYXNoX21hc2sgPSAwLCB0aGlzLmhhc2hfc2hpZnQgPSAwLCB0aGlzLmJsb2NrX3N0YXJ0ID0gMCwgdGhpcy5tYXRjaF9sZW5ndGggPSAwLCB0aGlzLnByZXZfbWF0Y2ggPSAwLCB0aGlzLm1hdGNoX2F2YWlsYWJsZSA9IDAsIHRoaXMuc3Ryc3RhcnQgPSAwLCB0aGlzLm1hdGNoX3N0YXJ0ID0gMCwgdGhpcy5sb29rYWhlYWQgPSAwLCB0aGlzLnByZXZfbGVuZ3RoID0gMCwgdGhpcy5tYXhfY2hhaW5fbGVuZ3RoID0gMCwgdGhpcy5tYXhfbGF6eV9tYXRjaCA9IDAsIHRoaXMubGV2ZWwgPSAwLCB0aGlzLnN0cmF0ZWd5ID0gMCwgdGhpcy5nb29kX21hdGNoID0gMCwgdGhpcy5uaWNlX21hdGNoID0gMCwgdGhpcy5keW5fbHRyZWUgPSBuZXcgYy5CdWYxNigyICogdyksIHRoaXMuZHluX2R0cmVlID0gbmV3IGMuQnVmMTYoMiAqICgyICogYSArIDEpKSwgdGhpcy5ibF90cmVlID0gbmV3IGMuQnVmMTYoMiAqICgyICogbyArIDEpKSwgRCh0aGlzLmR5bl9sdHJlZSksIEQodGhpcy5keW5fZHRyZWUpLCBEKHRoaXMuYmxfdHJlZSksIHRoaXMubF9kZXNjID0gbnVsbCwgdGhpcy5kX2Rlc2MgPSBudWxsLCB0aGlzLmJsX2Rlc2MgPSBudWxsLCB0aGlzLmJsX2NvdW50ID0gbmV3IGMuQnVmMTYoayArIDEpLCB0aGlzLmhlYXAgPSBuZXcgYy5CdWYxNigyICogcyArIDEpLCBEKHRoaXMuaGVhcCksIHRoaXMuaGVhcF9sZW4gPSAwLCB0aGlzLmhlYXBfbWF4ID0gMCwgdGhpcy5kZXB0aCA9IG5ldyBjLkJ1ZjE2KDIgKiBzICsgMSksIEQodGhpcy5kZXB0aCksIHRoaXMubF9idWYgPSAwLCB0aGlzLmxpdF9idWZzaXplID0gMCwgdGhpcy5sYXN0X2xpdCA9IDAsIHRoaXMuZF9idWYgPSAwLCB0aGlzLm9wdF9sZW4gPSAwLCB0aGlzLnN0YXRpY19sZW4gPSAwLCB0aGlzLm1hdGNoZXMgPSAwLCB0aGlzLmluc2VydCA9IDAsIHRoaXMuYmlfYnVmID0gMCwgdGhpcy5iaV92YWxpZCA9IDA7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIEcoZTIpIHsKICAgICAgICAgIHZhciB0MjsKICAgICAgICAgIHJldHVybiBlMiAmJiBlMi5zdGF0ZSA/IChlMi50b3RhbF9pbiA9IGUyLnRvdGFsX291dCA9IDAsIGUyLmRhdGFfdHlwZSA9IGksICh0MiA9IGUyLnN0YXRlKS5wZW5kaW5nID0gMCwgdDIucGVuZGluZ19vdXQgPSAwLCB0Mi53cmFwIDwgMCAmJiAodDIud3JhcCA9IC10Mi53cmFwKSwgdDIuc3RhdHVzID0gdDIud3JhcCA/IEMgOiBFLCBlMi5hZGxlciA9IDIgPT09IHQyLndyYXAgPyAwIDogMSwgdDIubGFzdF9mbHVzaCA9IGwsIHUuX3RyX2luaXQodDIpLCBtKSA6IFIoZTIsIF8pOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBLKGUyKSB7CiAgICAgICAgICB2YXIgdDIgPSBHKGUyKTsKICAgICAgICAgIHJldHVybiB0MiA9PT0gbSAmJiBmdW5jdGlvbihlMykgewogICAgICAgICAgICBlMy53aW5kb3dfc2l6ZSA9IDIgKiBlMy53X3NpemUsIEQoZTMuaGVhZCksIGUzLm1heF9sYXp5X21hdGNoID0gaFtlMy5sZXZlbF0ubWF4X2xhenksIGUzLmdvb2RfbWF0Y2ggPSBoW2UzLmxldmVsXS5nb29kX2xlbmd0aCwgZTMubmljZV9tYXRjaCA9IGhbZTMubGV2ZWxdLm5pY2VfbGVuZ3RoLCBlMy5tYXhfY2hhaW5fbGVuZ3RoID0gaFtlMy5sZXZlbF0ubWF4X2NoYWluLCBlMy5zdHJzdGFydCA9IDAsIGUzLmJsb2NrX3N0YXJ0ID0gMCwgZTMubG9va2FoZWFkID0gMCwgZTMuaW5zZXJ0ID0gMCwgZTMubWF0Y2hfbGVuZ3RoID0gZTMucHJldl9sZW5ndGggPSB4IC0gMSwgZTMubWF0Y2hfYXZhaWxhYmxlID0gMCwgZTMuaW5zX2ggPSAwOwogICAgICAgICAgfShlMi5zdGF0ZSksIHQyOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBZKGUyLCB0MiwgcjIsIG4yLCBpMiwgczIpIHsKICAgICAgICAgIGlmICghZTIpCiAgICAgICAgICAgIHJldHVybiBfOwogICAgICAgICAgdmFyIGEyID0gMTsKICAgICAgICAgIGlmICh0MiA9PT0gZyAmJiAodDIgPSA2KSwgbjIgPCAwID8gKGEyID0gMCwgbjIgPSAtbjIpIDogMTUgPCBuMiAmJiAoYTIgPSAyLCBuMiAtPSAxNiksIGkyIDwgMSB8fCB5IDwgaTIgfHwgcjIgIT09IHYgfHwgbjIgPCA4IHx8IDE1IDwgbjIgfHwgdDIgPCAwIHx8IDkgPCB0MiB8fCBzMiA8IDAgfHwgYiA8IHMyKQogICAgICAgICAgICByZXR1cm4gUihlMiwgXyk7CiAgICAgICAgICA4ID09PSBuMiAmJiAobjIgPSA5KTsKICAgICAgICAgIHZhciBvMiA9IG5ldyBIKCk7CiAgICAgICAgICByZXR1cm4gKGUyLnN0YXRlID0gbzIpLnN0cm0gPSBlMiwgbzIud3JhcCA9IGEyLCBvMi5nemhlYWQgPSBudWxsLCBvMi53X2JpdHMgPSBuMiwgbzIud19zaXplID0gMSA8PCBvMi53X2JpdHMsIG8yLndfbWFzayA9IG8yLndfc2l6ZSAtIDEsIG8yLmhhc2hfYml0cyA9IGkyICsgNywgbzIuaGFzaF9zaXplID0gMSA8PCBvMi5oYXNoX2JpdHMsIG8yLmhhc2hfbWFzayA9IG8yLmhhc2hfc2l6ZSAtIDEsIG8yLmhhc2hfc2hpZnQgPSB+figobzIuaGFzaF9iaXRzICsgeCAtIDEpIC8geCksIG8yLndpbmRvdyA9IG5ldyBjLkJ1ZjgoMiAqIG8yLndfc2l6ZSksIG8yLmhlYWQgPSBuZXcgYy5CdWYxNihvMi5oYXNoX3NpemUpLCBvMi5wcmV2ID0gbmV3IGMuQnVmMTYobzIud19zaXplKSwgbzIubGl0X2J1ZnNpemUgPSAxIDw8IGkyICsgNiwgbzIucGVuZGluZ19idWZfc2l6ZSA9IDQgKiBvMi5saXRfYnVmc2l6ZSwgbzIucGVuZGluZ19idWYgPSBuZXcgYy5CdWY4KG8yLnBlbmRpbmdfYnVmX3NpemUpLCBvMi5kX2J1ZiA9IDEgKiBvMi5saXRfYnVmc2l6ZSwgbzIubF9idWYgPSAzICogbzIubGl0X2J1ZnNpemUsIG8yLmxldmVsID0gdDIsIG8yLnN0cmF0ZWd5ID0gczIsIG8yLm1ldGhvZCA9IHIyLCBLKGUyKTsKICAgICAgICB9CiAgICAgICAgaCA9IFtuZXcgTSgwLCAwLCAwLCAwLCBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiA9IDY1NTM1OwogICAgICAgICAgZm9yIChyMiA+IGUyLnBlbmRpbmdfYnVmX3NpemUgLSA1ICYmIChyMiA9IGUyLnBlbmRpbmdfYnVmX3NpemUgLSA1KTsgOyApIHsKICAgICAgICAgICAgaWYgKGUyLmxvb2thaGVhZCA8PSAxKSB7CiAgICAgICAgICAgICAgaWYgKGooZTIpLCAwID09PSBlMi5sb29rYWhlYWQgJiYgdDIgPT09IGwpCiAgICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgICAgICBpZiAoMCA9PT0gZTIubG9va2FoZWFkKQogICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgIH0KICAgICAgICAgICAgZTIuc3Ryc3RhcnQgKz0gZTIubG9va2FoZWFkLCBlMi5sb29rYWhlYWQgPSAwOwogICAgICAgICAgICB2YXIgbjIgPSBlMi5ibG9ja19zdGFydCArIHIyOwogICAgICAgICAgICBpZiAoKDAgPT09IGUyLnN0cnN0YXJ0IHx8IGUyLnN0cnN0YXJ0ID49IG4yKSAmJiAoZTIubG9va2FoZWFkID0gZTIuc3Ryc3RhcnQgLSBuMiwgZTIuc3Ryc3RhcnQgPSBuMiwgTihlMiwgZmFsc2UpLCAwID09PSBlMi5zdHJtLmF2YWlsX291dCkpCiAgICAgICAgICAgICAgcmV0dXJuIEE7CiAgICAgICAgICAgIGlmIChlMi5zdHJzdGFydCAtIGUyLmJsb2NrX3N0YXJ0ID49IGUyLndfc2l6ZSAtIHogJiYgKE4oZTIsIGZhbHNlKSwgMCA9PT0gZTIuc3RybS5hdmFpbF9vdXQpKQogICAgICAgICAgICAgIHJldHVybiBBOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIGUyLmluc2VydCA9IDAsIHQyID09PSBmID8gKE4oZTIsIHRydWUpLCAwID09PSBlMi5zdHJtLmF2YWlsX291dCA/IE8gOiBCKSA6IChlMi5zdHJzdGFydCA+IGUyLmJsb2NrX3N0YXJ0ICYmIChOKGUyLCBmYWxzZSksIGUyLnN0cm0uYXZhaWxfb3V0KSwgQSk7CiAgICAgICAgfSksIG5ldyBNKDQsIDQsIDgsIDQsIFopLCBuZXcgTSg0LCA1LCAxNiwgOCwgWiksIG5ldyBNKDQsIDYsIDMyLCAzMiwgWiksIG5ldyBNKDQsIDQsIDE2LCAxNiwgVyksIG5ldyBNKDgsIDE2LCAzMiwgMzIsIFcpLCBuZXcgTSg4LCAxNiwgMTI4LCAxMjgsIFcpLCBuZXcgTSg4LCAzMiwgMTI4LCAyNTYsIFcpLCBuZXcgTSgzMiwgMTI4LCAyNTgsIDEwMjQsIFcpLCBuZXcgTSgzMiwgMjU4LCAyNTgsIDQwOTYsIFcpXSwgci5kZWZsYXRlSW5pdCA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIFkoZTIsIHQyLCB2LCAxNSwgOCwgMCk7CiAgICAgICAgfSwgci5kZWZsYXRlSW5pdDIgPSBZLCByLmRlZmxhdGVSZXNldCA9IEssIHIuZGVmbGF0ZVJlc2V0S2VlcCA9IEcsIHIuZGVmbGF0ZVNldEhlYWRlciA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgcmV0dXJuIGUyICYmIGUyLnN0YXRlID8gMiAhPT0gZTIuc3RhdGUud3JhcCA/IF8gOiAoZTIuc3RhdGUuZ3poZWFkID0gdDIsIG0pIDogXzsKICAgICAgICB9LCByLmRlZmxhdGUgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjIsIGkyLCBzMjsKICAgICAgICAgIGlmICghZTIgfHwgIWUyLnN0YXRlIHx8IDUgPCB0MiB8fCB0MiA8IDApCiAgICAgICAgICAgIHJldHVybiBlMiA/IFIoZTIsIF8pIDogXzsKICAgICAgICAgIGlmIChuMiA9IGUyLnN0YXRlLCAhZTIub3V0cHV0IHx8ICFlMi5pbnB1dCAmJiAwICE9PSBlMi5hdmFpbF9pbiB8fCA2NjYgPT09IG4yLnN0YXR1cyAmJiB0MiAhPT0gZikKICAgICAgICAgICAgcmV0dXJuIFIoZTIsIDAgPT09IGUyLmF2YWlsX291dCA/IC01IDogXyk7CiAgICAgICAgICBpZiAobjIuc3RybSA9IGUyLCByMiA9IG4yLmxhc3RfZmx1c2gsIG4yLmxhc3RfZmx1c2ggPSB0MiwgbjIuc3RhdHVzID09PSBDKQogICAgICAgICAgICBpZiAoMiA9PT0gbjIud3JhcCkKICAgICAgICAgICAgICBlMi5hZGxlciA9IDAsIFUobjIsIDMxKSwgVShuMiwgMTM5KSwgVShuMiwgOCksIG4yLmd6aGVhZCA/IChVKG4yLCAobjIuZ3poZWFkLnRleHQgPyAxIDogMCkgKyAobjIuZ3poZWFkLmhjcmMgPyAyIDogMCkgKyAobjIuZ3poZWFkLmV4dHJhID8gNCA6IDApICsgKG4yLmd6aGVhZC5uYW1lID8gOCA6IDApICsgKG4yLmd6aGVhZC5jb21tZW50ID8gMTYgOiAwKSksIFUobjIsIDI1NSAmIG4yLmd6aGVhZC50aW1lKSwgVShuMiwgbjIuZ3poZWFkLnRpbWUgPj4gOCAmIDI1NSksIFUobjIsIG4yLmd6aGVhZC50aW1lID4+IDE2ICYgMjU1KSwgVShuMiwgbjIuZ3poZWFkLnRpbWUgPj4gMjQgJiAyNTUpLCBVKG4yLCA5ID09PSBuMi5sZXZlbCA/IDIgOiAyIDw9IG4yLnN0cmF0ZWd5IHx8IG4yLmxldmVsIDwgMiA/IDQgOiAwKSwgVShuMiwgMjU1ICYgbjIuZ3poZWFkLm9zKSwgbjIuZ3poZWFkLmV4dHJhICYmIG4yLmd6aGVhZC5leHRyYS5sZW5ndGggJiYgKFUobjIsIDI1NSAmIG4yLmd6aGVhZC5leHRyYS5sZW5ndGgpLCBVKG4yLCBuMi5nemhlYWQuZXh0cmEubGVuZ3RoID4+IDggJiAyNTUpKSwgbjIuZ3poZWFkLmhjcmMgJiYgKGUyLmFkbGVyID0gcChlMi5hZGxlciwgbjIucGVuZGluZ19idWYsIG4yLnBlbmRpbmcsIDApKSwgbjIuZ3ppbmRleCA9IDAsIG4yLnN0YXR1cyA9IDY5KSA6IChVKG4yLCAwKSwgVShuMiwgMCksIFUobjIsIDApLCBVKG4yLCAwKSwgVShuMiwgMCksIFUobjIsIDkgPT09IG4yLmxldmVsID8gMiA6IDIgPD0gbjIuc3RyYXRlZ3kgfHwgbjIubGV2ZWwgPCAyID8gNCA6IDApLCBVKG4yLCAzKSwgbjIuc3RhdHVzID0gRSk7CiAgICAgICAgICAgIGVsc2UgewogICAgICAgICAgICAgIHZhciBhMiA9IHYgKyAobjIud19iaXRzIC0gOCA8PCA0KSA8PCA4OwogICAgICAgICAgICAgIGEyIHw9ICgyIDw9IG4yLnN0cmF0ZWd5IHx8IG4yLmxldmVsIDwgMiA/IDAgOiBuMi5sZXZlbCA8IDYgPyAxIDogNiA9PT0gbjIubGV2ZWwgPyAyIDogMykgPDwgNiwgMCAhPT0gbjIuc3Ryc3RhcnQgJiYgKGEyIHw9IDMyKSwgYTIgKz0gMzEgLSBhMiAlIDMxLCBuMi5zdGF0dXMgPSBFLCBQKG4yLCBhMiksIDAgIT09IG4yLnN0cnN0YXJ0ICYmIChQKG4yLCBlMi5hZGxlciA+Pj4gMTYpLCBQKG4yLCA2NTUzNSAmIGUyLmFkbGVyKSksIGUyLmFkbGVyID0gMTsKICAgICAgICAgICAgfQogICAgICAgICAgaWYgKDY5ID09PSBuMi5zdGF0dXMpCiAgICAgICAgICAgIGlmIChuMi5nemhlYWQuZXh0cmEpIHsKICAgICAgICAgICAgICBmb3IgKGkyID0gbjIucGVuZGluZzsgbjIuZ3ppbmRleCA8ICg2NTUzNSAmIG4yLmd6aGVhZC5leHRyYS5sZW5ndGgpICYmIChuMi5wZW5kaW5nICE9PSBuMi5wZW5kaW5nX2J1Zl9zaXplIHx8IChuMi5nemhlYWQuaGNyYyAmJiBuMi5wZW5kaW5nID4gaTIgJiYgKGUyLmFkbGVyID0gcChlMi5hZGxlciwgbjIucGVuZGluZ19idWYsIG4yLnBlbmRpbmcgLSBpMiwgaTIpKSwgRihlMiksIGkyID0gbjIucGVuZGluZywgbjIucGVuZGluZyAhPT0gbjIucGVuZGluZ19idWZfc2l6ZSkpOyApCiAgICAgICAgICAgICAgICBVKG4yLCAyNTUgJiBuMi5nemhlYWQuZXh0cmFbbjIuZ3ppbmRleF0pLCBuMi5nemluZGV4Kys7CiAgICAgICAgICAgICAgbjIuZ3poZWFkLmhjcmMgJiYgbjIucGVuZGluZyA+IGkyICYmIChlMi5hZGxlciA9IHAoZTIuYWRsZXIsIG4yLnBlbmRpbmdfYnVmLCBuMi5wZW5kaW5nIC0gaTIsIGkyKSksIG4yLmd6aW5kZXggPT09IG4yLmd6aGVhZC5leHRyYS5sZW5ndGggJiYgKG4yLmd6aW5kZXggPSAwLCBuMi5zdGF0dXMgPSA3Myk7CiAgICAgICAgICAgIH0gZWxzZQogICAgICAgICAgICAgIG4yLnN0YXR1cyA9IDczOwogICAgICAgICAgaWYgKDczID09PSBuMi5zdGF0dXMpCiAgICAgICAgICAgIGlmIChuMi5nemhlYWQubmFtZSkgewogICAgICAgICAgICAgIGkyID0gbjIucGVuZGluZzsKICAgICAgICAgICAgICBkbyB7CiAgICAgICAgICAgICAgICBpZiAobjIucGVuZGluZyA9PT0gbjIucGVuZGluZ19idWZfc2l6ZSAmJiAobjIuZ3poZWFkLmhjcmMgJiYgbjIucGVuZGluZyA+IGkyICYmIChlMi5hZGxlciA9IHAoZTIuYWRsZXIsIG4yLnBlbmRpbmdfYnVmLCBuMi5wZW5kaW5nIC0gaTIsIGkyKSksIEYoZTIpLCBpMiA9IG4yLnBlbmRpbmcsIG4yLnBlbmRpbmcgPT09IG4yLnBlbmRpbmdfYnVmX3NpemUpKSB7CiAgICAgICAgICAgICAgICAgIHMyID0gMTsKICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICBzMiA9IG4yLmd6aW5kZXggPCBuMi5nemhlYWQubmFtZS5sZW5ndGggPyAyNTUgJiBuMi5nemhlYWQubmFtZS5jaGFyQ29kZUF0KG4yLmd6aW5kZXgrKykgOiAwLCBVKG4yLCBzMik7CiAgICAgICAgICAgICAgfSB3aGlsZSAoMCAhPT0gczIpOwogICAgICAgICAgICAgIG4yLmd6aGVhZC5oY3JjICYmIG4yLnBlbmRpbmcgPiBpMiAmJiAoZTIuYWRsZXIgPSBwKGUyLmFkbGVyLCBuMi5wZW5kaW5nX2J1ZiwgbjIucGVuZGluZyAtIGkyLCBpMikpLCAwID09PSBzMiAmJiAobjIuZ3ppbmRleCA9IDAsIG4yLnN0YXR1cyA9IDkxKTsKICAgICAgICAgICAgfSBlbHNlCiAgICAgICAgICAgICAgbjIuc3RhdHVzID0gOTE7CiAgICAgICAgICBpZiAoOTEgPT09IG4yLnN0YXR1cykKICAgICAgICAgICAgaWYgKG4yLmd6aGVhZC5jb21tZW50KSB7CiAgICAgICAgICAgICAgaTIgPSBuMi5wZW5kaW5nOwogICAgICAgICAgICAgIGRvIHsKICAgICAgICAgICAgICAgIGlmIChuMi5wZW5kaW5nID09PSBuMi5wZW5kaW5nX2J1Zl9zaXplICYmIChuMi5nemhlYWQuaGNyYyAmJiBuMi5wZW5kaW5nID4gaTIgJiYgKGUyLmFkbGVyID0gcChlMi5hZGxlciwgbjIucGVuZGluZ19idWYsIG4yLnBlbmRpbmcgLSBpMiwgaTIpKSwgRihlMiksIGkyID0gbjIucGVuZGluZywgbjIucGVuZGluZyA9PT0gbjIucGVuZGluZ19idWZfc2l6ZSkpIHsKICAgICAgICAgICAgICAgICAgczIgPSAxOwogICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgIHMyID0gbjIuZ3ppbmRleCA8IG4yLmd6aGVhZC5jb21tZW50Lmxlbmd0aCA/IDI1NSAmIG4yLmd6aGVhZC5jb21tZW50LmNoYXJDb2RlQXQobjIuZ3ppbmRleCsrKSA6IDAsIFUobjIsIHMyKTsKICAgICAgICAgICAgICB9IHdoaWxlICgwICE9PSBzMik7CiAgICAgICAgICAgICAgbjIuZ3poZWFkLmhjcmMgJiYgbjIucGVuZGluZyA+IGkyICYmIChlMi5hZGxlciA9IHAoZTIuYWRsZXIsIG4yLnBlbmRpbmdfYnVmLCBuMi5wZW5kaW5nIC0gaTIsIGkyKSksIDAgPT09IHMyICYmIChuMi5zdGF0dXMgPSAxMDMpOwogICAgICAgICAgICB9IGVsc2UKICAgICAgICAgICAgICBuMi5zdGF0dXMgPSAxMDM7CiAgICAgICAgICBpZiAoMTAzID09PSBuMi5zdGF0dXMgJiYgKG4yLmd6aGVhZC5oY3JjID8gKG4yLnBlbmRpbmcgKyAyID4gbjIucGVuZGluZ19idWZfc2l6ZSAmJiBGKGUyKSwgbjIucGVuZGluZyArIDIgPD0gbjIucGVuZGluZ19idWZfc2l6ZSAmJiAoVShuMiwgMjU1ICYgZTIuYWRsZXIpLCBVKG4yLCBlMi5hZGxlciA+PiA4ICYgMjU1KSwgZTIuYWRsZXIgPSAwLCBuMi5zdGF0dXMgPSBFKSkgOiBuMi5zdGF0dXMgPSBFKSwgMCAhPT0gbjIucGVuZGluZykgewogICAgICAgICAgICBpZiAoRihlMiksIDAgPT09IGUyLmF2YWlsX291dCkKICAgICAgICAgICAgICByZXR1cm4gbjIubGFzdF9mbHVzaCA9IC0xLCBtOwogICAgICAgICAgfSBlbHNlIGlmICgwID09PSBlMi5hdmFpbF9pbiAmJiBUKHQyKSA8PSBUKHIyKSAmJiB0MiAhPT0gZikKICAgICAgICAgICAgcmV0dXJuIFIoZTIsIC01KTsKICAgICAgICAgIGlmICg2NjYgPT09IG4yLnN0YXR1cyAmJiAwICE9PSBlMi5hdmFpbF9pbikKICAgICAgICAgICAgcmV0dXJuIFIoZTIsIC01KTsKICAgICAgICAgIGlmICgwICE9PSBlMi5hdmFpbF9pbiB8fCAwICE9PSBuMi5sb29rYWhlYWQgfHwgdDIgIT09IGwgJiYgNjY2ICE9PSBuMi5zdGF0dXMpIHsKICAgICAgICAgICAgdmFyIG8yID0gMiA9PT0gbjIuc3RyYXRlZ3kgPyBmdW5jdGlvbihlMywgdDMpIHsKICAgICAgICAgICAgICBmb3IgKHZhciByMzsgOyApIHsKICAgICAgICAgICAgICAgIGlmICgwID09PSBlMy5sb29rYWhlYWQgJiYgKGooZTMpLCAwID09PSBlMy5sb29rYWhlYWQpKSB7CiAgICAgICAgICAgICAgICAgIGlmICh0MyA9PT0gbCkKICAgICAgICAgICAgICAgICAgICByZXR1cm4gQTsKICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICBpZiAoZTMubWF0Y2hfbGVuZ3RoID0gMCwgcjMgPSB1Ll90cl90YWxseShlMywgMCwgZTMud2luZG93W2UzLnN0cnN0YXJ0XSksIGUzLmxvb2thaGVhZC0tLCBlMy5zdHJzdGFydCsrLCByMyAmJiAoTihlMywgZmFsc2UpLCAwID09PSBlMy5zdHJtLmF2YWlsX291dCkpCiAgICAgICAgICAgICAgICAgIHJldHVybiBBOwogICAgICAgICAgICAgIH0KICAgICAgICAgICAgICByZXR1cm4gZTMuaW5zZXJ0ID0gMCwgdDMgPT09IGYgPyAoTihlMywgdHJ1ZSksIDAgPT09IGUzLnN0cm0uYXZhaWxfb3V0ID8gTyA6IEIpIDogZTMubGFzdF9saXQgJiYgKE4oZTMsIGZhbHNlKSwgMCA9PT0gZTMuc3RybS5hdmFpbF9vdXQpID8gQSA6IEk7CiAgICAgICAgICAgIH0objIsIHQyKSA6IDMgPT09IG4yLnN0cmF0ZWd5ID8gZnVuY3Rpb24oZTMsIHQzKSB7CiAgICAgICAgICAgICAgZm9yICh2YXIgcjMsIG4zLCBpMywgczMsIGEzID0gZTMud2luZG93OyA7ICkgewogICAgICAgICAgICAgICAgaWYgKGUzLmxvb2thaGVhZCA8PSBTKSB7CiAgICAgICAgICAgICAgICAgIGlmIChqKGUzKSwgZTMubG9va2FoZWFkIDw9IFMgJiYgdDMgPT09IGwpCiAgICAgICAgICAgICAgICAgICAgcmV0dXJuIEE7CiAgICAgICAgICAgICAgICAgIGlmICgwID09PSBlMy5sb29rYWhlYWQpCiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICBpZiAoZTMubWF0Y2hfbGVuZ3RoID0gMCwgZTMubG9va2FoZWFkID49IHggJiYgMCA8IGUzLnN0cnN0YXJ0ICYmIChuMyA9IGEzW2kzID0gZTMuc3Ryc3RhcnQgLSAxXSkgPT09IGEzWysraTNdICYmIG4zID09PSBhM1srK2kzXSAmJiBuMyA9PT0gYTNbKytpM10pIHsKICAgICAgICAgICAgICAgICAgczMgPSBlMy5zdHJzdGFydCArIFM7CiAgICAgICAgICAgICAgICAgIGRvIHsKICAgICAgICAgICAgICAgICAgfSB3aGlsZSAobjMgPT09IGEzWysraTNdICYmIG4zID09PSBhM1srK2kzXSAmJiBuMyA9PT0gYTNbKytpM10gJiYgbjMgPT09IGEzWysraTNdICYmIG4zID09PSBhM1srK2kzXSAmJiBuMyA9PT0gYTNbKytpM10gJiYgbjMgPT09IGEzWysraTNdICYmIG4zID09PSBhM1srK2kzXSAmJiBpMyA8IHMzKTsKICAgICAgICAgICAgICAgICAgZTMubWF0Y2hfbGVuZ3RoID0gUyAtIChzMyAtIGkzKSwgZTMubWF0Y2hfbGVuZ3RoID4gZTMubG9va2FoZWFkICYmIChlMy5tYXRjaF9sZW5ndGggPSBlMy5sb29rYWhlYWQpOwogICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgaWYgKGUzLm1hdGNoX2xlbmd0aCA+PSB4ID8gKHIzID0gdS5fdHJfdGFsbHkoZTMsIDEsIGUzLm1hdGNoX2xlbmd0aCAtIHgpLCBlMy5sb29rYWhlYWQgLT0gZTMubWF0Y2hfbGVuZ3RoLCBlMy5zdHJzdGFydCArPSBlMy5tYXRjaF9sZW5ndGgsIGUzLm1hdGNoX2xlbmd0aCA9IDApIDogKHIzID0gdS5fdHJfdGFsbHkoZTMsIDAsIGUzLndpbmRvd1tlMy5zdHJzdGFydF0pLCBlMy5sb29rYWhlYWQtLSwgZTMuc3Ryc3RhcnQrKyksIHIzICYmIChOKGUzLCBmYWxzZSksIDAgPT09IGUzLnN0cm0uYXZhaWxfb3V0KSkKICAgICAgICAgICAgICAgICAgcmV0dXJuIEE7CiAgICAgICAgICAgICAgfQogICAgICAgICAgICAgIHJldHVybiBlMy5pbnNlcnQgPSAwLCB0MyA9PT0gZiA/IChOKGUzLCB0cnVlKSwgMCA9PT0gZTMuc3RybS5hdmFpbF9vdXQgPyBPIDogQikgOiBlMy5sYXN0X2xpdCAmJiAoTihlMywgZmFsc2UpLCAwID09PSBlMy5zdHJtLmF2YWlsX291dCkgPyBBIDogSTsKICAgICAgICAgICAgfShuMiwgdDIpIDogaFtuMi5sZXZlbF0uZnVuYyhuMiwgdDIpOwogICAgICAgICAgICBpZiAobzIgIT09IE8gJiYgbzIgIT09IEIgfHwgKG4yLnN0YXR1cyA9IDY2NiksIG8yID09PSBBIHx8IG8yID09PSBPKQogICAgICAgICAgICAgIHJldHVybiAwID09PSBlMi5hdmFpbF9vdXQgJiYgKG4yLmxhc3RfZmx1c2ggPSAtMSksIG07CiAgICAgICAgICAgIGlmIChvMiA9PT0gSSAmJiAoMSA9PT0gdDIgPyB1Ll90cl9hbGlnbihuMikgOiA1ICE9PSB0MiAmJiAodS5fdHJfc3RvcmVkX2Jsb2NrKG4yLCAwLCAwLCBmYWxzZSksIDMgPT09IHQyICYmIChEKG4yLmhlYWQpLCAwID09PSBuMi5sb29rYWhlYWQgJiYgKG4yLnN0cnN0YXJ0ID0gMCwgbjIuYmxvY2tfc3RhcnQgPSAwLCBuMi5pbnNlcnQgPSAwKSkpLCBGKGUyKSwgMCA9PT0gZTIuYXZhaWxfb3V0KSkKICAgICAgICAgICAgICByZXR1cm4gbjIubGFzdF9mbHVzaCA9IC0xLCBtOwogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIHQyICE9PSBmID8gbSA6IG4yLndyYXAgPD0gMCA/IDEgOiAoMiA9PT0gbjIud3JhcCA/IChVKG4yLCAyNTUgJiBlMi5hZGxlciksIFUobjIsIGUyLmFkbGVyID4+IDggJiAyNTUpLCBVKG4yLCBlMi5hZGxlciA+PiAxNiAmIDI1NSksIFUobjIsIGUyLmFkbGVyID4+IDI0ICYgMjU1KSwgVShuMiwgMjU1ICYgZTIudG90YWxfaW4pLCBVKG4yLCBlMi50b3RhbF9pbiA+PiA4ICYgMjU1KSwgVShuMiwgZTIudG90YWxfaW4gPj4gMTYgJiAyNTUpLCBVKG4yLCBlMi50b3RhbF9pbiA+PiAyNCAmIDI1NSkpIDogKFAobjIsIGUyLmFkbGVyID4+PiAxNiksIFAobjIsIDY1NTM1ICYgZTIuYWRsZXIpKSwgRihlMiksIDAgPCBuMi53cmFwICYmIChuMi53cmFwID0gLW4yLndyYXApLCAwICE9PSBuMi5wZW5kaW5nID8gbSA6IDEpOwogICAgICAgIH0sIHIuZGVmbGF0ZUVuZCA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICB2YXIgdDI7CiAgICAgICAgICByZXR1cm4gZTIgJiYgZTIuc3RhdGUgPyAodDIgPSBlMi5zdGF0ZS5zdGF0dXMpICE9PSBDICYmIDY5ICE9PSB0MiAmJiA3MyAhPT0gdDIgJiYgOTEgIT09IHQyICYmIDEwMyAhPT0gdDIgJiYgdDIgIT09IEUgJiYgNjY2ICE9PSB0MiA/IFIoZTIsIF8pIDogKGUyLnN0YXRlID0gbnVsbCwgdDIgPT09IEUgPyBSKGUyLCAtMykgOiBtKSA6IF87CiAgICAgICAgfSwgci5kZWZsYXRlU2V0RGljdGlvbmFyeSA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgdmFyIHIyLCBuMiwgaTIsIHMyLCBhMiwgbzIsIGgyLCB1MiwgbDIgPSB0Mi5sZW5ndGg7CiAgICAgICAgICBpZiAoIWUyIHx8ICFlMi5zdGF0ZSkKICAgICAgICAgICAgcmV0dXJuIF87CiAgICAgICAgICBpZiAoMiA9PT0gKHMyID0gKHIyID0gZTIuc3RhdGUpLndyYXApIHx8IDEgPT09IHMyICYmIHIyLnN0YXR1cyAhPT0gQyB8fCByMi5sb29rYWhlYWQpCiAgICAgICAgICAgIHJldHVybiBfOwogICAgICAgICAgZm9yICgxID09PSBzMiAmJiAoZTIuYWRsZXIgPSBkKGUyLmFkbGVyLCB0MiwgbDIsIDApKSwgcjIud3JhcCA9IDAsIGwyID49IHIyLndfc2l6ZSAmJiAoMCA9PT0gczIgJiYgKEQocjIuaGVhZCksIHIyLnN0cnN0YXJ0ID0gMCwgcjIuYmxvY2tfc3RhcnQgPSAwLCByMi5pbnNlcnQgPSAwKSwgdTIgPSBuZXcgYy5CdWY4KHIyLndfc2l6ZSksIGMuYXJyYXlTZXQodTIsIHQyLCBsMiAtIHIyLndfc2l6ZSwgcjIud19zaXplLCAwKSwgdDIgPSB1MiwgbDIgPSByMi53X3NpemUpLCBhMiA9IGUyLmF2YWlsX2luLCBvMiA9IGUyLm5leHRfaW4sIGgyID0gZTIuaW5wdXQsIGUyLmF2YWlsX2luID0gbDIsIGUyLm5leHRfaW4gPSAwLCBlMi5pbnB1dCA9IHQyLCBqKHIyKTsgcjIubG9va2FoZWFkID49IHg7ICkgewogICAgICAgICAgICBmb3IgKG4yID0gcjIuc3Ryc3RhcnQsIGkyID0gcjIubG9va2FoZWFkIC0gKHggLSAxKTsgcjIuaW5zX2ggPSAocjIuaW5zX2ggPDwgcjIuaGFzaF9zaGlmdCBeIHIyLndpbmRvd1tuMiArIHggLSAxXSkgJiByMi5oYXNoX21hc2ssIHIyLnByZXZbbjIgJiByMi53X21hc2tdID0gcjIuaGVhZFtyMi5pbnNfaF0sIHIyLmhlYWRbcjIuaW5zX2hdID0gbjIsIG4yKyssIC0taTI7ICkKICAgICAgICAgICAgICA7CiAgICAgICAgICAgIHIyLnN0cnN0YXJ0ID0gbjIsIHIyLmxvb2thaGVhZCA9IHggLSAxLCBqKHIyKTsKICAgICAgICAgIH0KICAgICAgICAgIHJldHVybiByMi5zdHJzdGFydCArPSByMi5sb29rYWhlYWQsIHIyLmJsb2NrX3N0YXJ0ID0gcjIuc3Ryc3RhcnQsIHIyLmluc2VydCA9IHIyLmxvb2thaGVhZCwgcjIubG9va2FoZWFkID0gMCwgcjIubWF0Y2hfbGVuZ3RoID0gcjIucHJldl9sZW5ndGggPSB4IC0gMSwgcjIubWF0Y2hfYXZhaWxhYmxlID0gMCwgZTIubmV4dF9pbiA9IG8yLCBlMi5pbnB1dCA9IGgyLCBlMi5hdmFpbF9pbiA9IGEyLCByMi53cmFwID0gczIsIG07CiAgICAgICAgfSwgci5kZWZsYXRlSW5mbyA9ICJwYWtvIGRlZmxhdGUgKGZyb20gTm9kZWNhIHByb2plY3QpIjsKICAgICAgfSwgeyAiLi4vdXRpbHMvY29tbW9uIjogNDEsICIuL2FkbGVyMzIiOiA0MywgIi4vY3JjMzIiOiA0NSwgIi4vbWVzc2FnZXMiOiA1MSwgIi4vdHJlZXMiOiA1MiB9XSwgNDc6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdC5leHBvcnRzID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICB0aGlzLnRleHQgPSAwLCB0aGlzLnRpbWUgPSAwLCB0aGlzLnhmbGFncyA9IDAsIHRoaXMub3MgPSAwLCB0aGlzLmV4dHJhID0gbnVsbCwgdGhpcy5leHRyYV9sZW4gPSAwLCB0aGlzLm5hbWUgPSAiIiwgdGhpcy5jb21tZW50ID0gIiIsIHRoaXMuaGNyYyA9IDAsIHRoaXMuZG9uZSA9IGZhbHNlOwogICAgICAgIH07CiAgICAgIH0sIHt9XSwgNDg6IFtmdW5jdGlvbihlLCB0LCByKSB7CiAgICAgICAgdC5leHBvcnRzID0gZnVuY3Rpb24oZTIsIHQyKSB7CiAgICAgICAgICB2YXIgcjIsIG4sIGksIHMsIGEsIG8sIGgsIHUsIGwsIGYsIGMsIGQsIHAsIG0sIF8sIGcsIGIsIHYsIHksIHcsIGssIHgsIFMsIHosIEM7CiAgICAgICAgICByMiA9IGUyLnN0YXRlLCBuID0gZTIubmV4dF9pbiwgeiA9IGUyLmlucHV0LCBpID0gbiArIChlMi5hdmFpbF9pbiAtIDUpLCBzID0gZTIubmV4dF9vdXQsIEMgPSBlMi5vdXRwdXQsIGEgPSBzIC0gKHQyIC0gZTIuYXZhaWxfb3V0KSwgbyA9IHMgKyAoZTIuYXZhaWxfb3V0IC0gMjU3KSwgaCA9IHIyLmRtYXgsIHUgPSByMi53c2l6ZSwgbCA9IHIyLndoYXZlLCBmID0gcjIud25leHQsIGMgPSByMi53aW5kb3csIGQgPSByMi5ob2xkLCBwID0gcjIuYml0cywgbSA9IHIyLmxlbmNvZGUsIF8gPSByMi5kaXN0Y29kZSwgZyA9ICgxIDw8IHIyLmxlbmJpdHMpIC0gMSwgYiA9ICgxIDw8IHIyLmRpc3RiaXRzKSAtIDE7CiAgICAgICAgICBlOgogICAgICAgICAgICBkbyB7CiAgICAgICAgICAgICAgcCA8IDE1ICYmIChkICs9IHpbbisrXSA8PCBwLCBwICs9IDgsIGQgKz0geltuKytdIDw8IHAsIHAgKz0gOCksIHYgPSBtW2QgJiBnXTsKICAgICAgICAgICAgICB0OgogICAgICAgICAgICAgICAgZm9yICg7IDsgKSB7CiAgICAgICAgICAgICAgICAgIGlmIChkID4+Pj0geSA9IHYgPj4+IDI0LCBwIC09IHksIDAgPT09ICh5ID0gdiA+Pj4gMTYgJiAyNTUpKQogICAgICAgICAgICAgICAgICAgIENbcysrXSA9IDY1NTM1ICYgdjsKICAgICAgICAgICAgICAgICAgZWxzZSB7CiAgICAgICAgICAgICAgICAgICAgaWYgKCEoMTYgJiB5KSkgewogICAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT0gKDY0ICYgeSkpIHsKICAgICAgICAgICAgICAgICAgICAgICAgdiA9IG1bKDY1NTM1ICYgdikgKyAoZCAmICgxIDw8IHkpIC0gMSldOwogICAgICAgICAgICAgICAgICAgICAgICBjb250aW51ZSB0OwogICAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgICAgaWYgKDMyICYgeSkgewogICAgICAgICAgICAgICAgICAgICAgICByMi5tb2RlID0gMTI7CiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBsaXRlcmFsL2xlbmd0aCBjb2RlIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgdyA9IDY1NTM1ICYgdiwgKHkgJj0gMTUpICYmIChwIDwgeSAmJiAoZCArPSB6W24rK10gPDwgcCwgcCArPSA4KSwgdyArPSBkICYgKDEgPDwgeSkgLSAxLCBkID4+Pj0geSwgcCAtPSB5KSwgcCA8IDE1ICYmIChkICs9IHpbbisrXSA8PCBwLCBwICs9IDgsIGQgKz0geltuKytdIDw8IHAsIHAgKz0gOCksIHYgPSBfW2QgJiBiXTsKICAgICAgICAgICAgICAgICAgICByOgogICAgICAgICAgICAgICAgICAgICAgZm9yICg7IDsgKSB7CiAgICAgICAgICAgICAgICAgICAgICAgIGlmIChkID4+Pj0geSA9IHYgPj4+IDI0LCBwIC09IHksICEoMTYgJiAoeSA9IHYgPj4+IDE2ICYgMjU1KSkpIHsKICAgICAgICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PSAoNjQgJiB5KSkgewogICAgICAgICAgICAgICAgICAgICAgICAgICAgdiA9IF9bKDY1NTM1ICYgdikgKyAoZCAmICgxIDw8IHkpIC0gMSldOwogICAgICAgICAgICAgICAgICAgICAgICAgICAgY29udGludWUgcjsKICAgICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImludmFsaWQgZGlzdGFuY2UgY29kZSIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgIGlmIChrID0gNjU1MzUgJiB2LCBwIDwgKHkgJj0gMTUpICYmIChkICs9IHpbbisrXSA8PCBwLCAocCArPSA4KSA8IHkgJiYgKGQgKz0geltuKytdIDw8IHAsIHAgKz0gOCkpLCBoIDwgKGsgKz0gZCAmICgxIDw8IHkpIC0gMSkpIHsKICAgICAgICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBkaXN0YW5jZSB0b28gZmFyIGJhY2siLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgICAgICBpZiAoZCA+Pj49IHksIHAgLT0geSwgKHkgPSBzIC0gYSkgPCBrKSB7CiAgICAgICAgICAgICAgICAgICAgICAgICAgaWYgKGwgPCAoeSA9IGsgLSB5KSAmJiByMi5zYW5lKSB7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBkaXN0YW5jZSB0b28gZmFyIGJhY2siLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICAgICAgICBpZiAoUyA9IGMsICh4ID0gMCkgPT09IGYpIHsKICAgICAgICAgICAgICAgICAgICAgICAgICAgIGlmICh4ICs9IHUgLSB5LCB5IDwgdykgewogICAgICAgICAgICAgICAgICAgICAgICAgICAgICBmb3IgKHcgLT0geTsgQ1tzKytdID0gY1t4KytdLCAtLXk7ICkKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICA7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIHggPSBzIC0gaywgUyA9IEM7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgICAgfSBlbHNlIGlmIChmIDwgeSkgewogICAgICAgICAgICAgICAgICAgICAgICAgICAgaWYgKHggKz0gdSArIGYgLSB5LCAoeSAtPSBmKSA8IHcpIHsKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgZm9yICh3IC09IHk7IENbcysrXSA9IGNbeCsrXSwgLS15OyApCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgICAgICAgICAgICAgICAgICBpZiAoeCA9IDAsIGYgPCB3KSB7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgZm9yICh3IC09IHkgPSBmOyBDW3MrK10gPSBjW3grK10sIC0teTsgKQogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIHggPSBzIC0gaywgUyA9IEM7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICAgICAgICB9IGVsc2UgaWYgKHggKz0gZiAtIHksIHkgPCB3KSB7CiAgICAgICAgICAgICAgICAgICAgICAgICAgICBmb3IgKHcgLT0geTsgQ1tzKytdID0gY1t4KytdLCAtLXk7ICkKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgICAgICAgICAgICAgICAgeCA9IHMgLSBrLCBTID0gQzsKICAgICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgICAgZm9yICg7IDIgPCB3OyApCiAgICAgICAgICAgICAgICAgICAgICAgICAgICBDW3MrK10gPSBTW3grK10sIENbcysrXSA9IFNbeCsrXSwgQ1tzKytdID0gU1t4KytdLCB3IC09IDM7CiAgICAgICAgICAgICAgICAgICAgICAgICAgdyAmJiAoQ1tzKytdID0gU1t4KytdLCAxIDwgdyAmJiAoQ1tzKytdID0gU1t4KytdKSk7CiAgICAgICAgICAgICAgICAgICAgICAgIH0gZWxzZSB7CiAgICAgICAgICAgICAgICAgICAgICAgICAgZm9yICh4ID0gcyAtIGs7IENbcysrXSA9IENbeCsrXSwgQ1tzKytdID0gQ1t4KytdLCBDW3MrK10gPSBDW3grK10sIDIgPCAodyAtPSAzKTsgKQogICAgICAgICAgICAgICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgICAgICAgICAgICAgIHcgJiYgKENbcysrXSA9IENbeCsrXSwgMSA8IHcgJiYgKENbcysrXSA9IENbeCsrXSkpOwogICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgfQogICAgICAgICAgICB9IHdoaWxlIChuIDwgaSAmJiBzIDwgbyk7CiAgICAgICAgICBuIC09IHcgPSBwID4+IDMsIGQgJj0gKDEgPDwgKHAgLT0gdyA8PCAzKSkgLSAxLCBlMi5uZXh0X2luID0gbiwgZTIubmV4dF9vdXQgPSBzLCBlMi5hdmFpbF9pbiA9IG4gPCBpID8gaSAtIG4gKyA1IDogNSAtIChuIC0gaSksIGUyLmF2YWlsX291dCA9IHMgPCBvID8gbyAtIHMgKyAyNTcgOiAyNTcgLSAocyAtIG8pLCByMi5ob2xkID0gZCwgcjIuYml0cyA9IHA7CiAgICAgICAgfTsKICAgICAgfSwge31dLCA0OTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgSSA9IGUoIi4uL3V0aWxzL2NvbW1vbiIpLCBPID0gZSgiLi9hZGxlcjMyIiksIEIgPSBlKCIuL2NyYzMyIiksIFIgPSBlKCIuL2luZmZhc3QiKSwgVCA9IGUoIi4vaW5mdHJlZXMiKSwgRCA9IDEsIEYgPSAyLCBOID0gMCwgVSA9IC0yLCBQID0gMSwgbiA9IDg1MiwgaSA9IDU5MjsKICAgICAgICBmdW5jdGlvbiBMKGUyKSB7CiAgICAgICAgICByZXR1cm4gKGUyID4+PiAyNCAmIDI1NSkgKyAoZTIgPj4+IDggJiA2NTI4MCkgKyAoKDY1MjgwICYgZTIpIDw8IDgpICsgKCgyNTUgJiBlMikgPDwgMjQpOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBzKCkgewogICAgICAgICAgdGhpcy5tb2RlID0gMCwgdGhpcy5sYXN0ID0gZmFsc2UsIHRoaXMud3JhcCA9IDAsIHRoaXMuaGF2ZWRpY3QgPSBmYWxzZSwgdGhpcy5mbGFncyA9IDAsIHRoaXMuZG1heCA9IDAsIHRoaXMuY2hlY2sgPSAwLCB0aGlzLnRvdGFsID0gMCwgdGhpcy5oZWFkID0gbnVsbCwgdGhpcy53Yml0cyA9IDAsIHRoaXMud3NpemUgPSAwLCB0aGlzLndoYXZlID0gMCwgdGhpcy53bmV4dCA9IDAsIHRoaXMud2luZG93ID0gbnVsbCwgdGhpcy5ob2xkID0gMCwgdGhpcy5iaXRzID0gMCwgdGhpcy5sZW5ndGggPSAwLCB0aGlzLm9mZnNldCA9IDAsIHRoaXMuZXh0cmEgPSAwLCB0aGlzLmxlbmNvZGUgPSBudWxsLCB0aGlzLmRpc3Rjb2RlID0gbnVsbCwgdGhpcy5sZW5iaXRzID0gMCwgdGhpcy5kaXN0Yml0cyA9IDAsIHRoaXMubmNvZGUgPSAwLCB0aGlzLm5sZW4gPSAwLCB0aGlzLm5kaXN0ID0gMCwgdGhpcy5oYXZlID0gMCwgdGhpcy5uZXh0ID0gbnVsbCwgdGhpcy5sZW5zID0gbmV3IEkuQnVmMTYoMzIwKSwgdGhpcy53b3JrID0gbmV3IEkuQnVmMTYoMjg4KSwgdGhpcy5sZW5keW4gPSBudWxsLCB0aGlzLmRpc3RkeW4gPSBudWxsLCB0aGlzLnNhbmUgPSAwLCB0aGlzLmJhY2sgPSAwLCB0aGlzLndhcyA9IDA7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIGEoZTIpIHsKICAgICAgICAgIHZhciB0MjsKICAgICAgICAgIHJldHVybiBlMiAmJiBlMi5zdGF0ZSA/ICh0MiA9IGUyLnN0YXRlLCBlMi50b3RhbF9pbiA9IGUyLnRvdGFsX291dCA9IHQyLnRvdGFsID0gMCwgZTIubXNnID0gIiIsIHQyLndyYXAgJiYgKGUyLmFkbGVyID0gMSAmIHQyLndyYXApLCB0Mi5tb2RlID0gUCwgdDIubGFzdCA9IDAsIHQyLmhhdmVkaWN0ID0gMCwgdDIuZG1heCA9IDMyNzY4LCB0Mi5oZWFkID0gbnVsbCwgdDIuaG9sZCA9IDAsIHQyLmJpdHMgPSAwLCB0Mi5sZW5jb2RlID0gdDIubGVuZHluID0gbmV3IEkuQnVmMzIobiksIHQyLmRpc3Rjb2RlID0gdDIuZGlzdGR5biA9IG5ldyBJLkJ1ZjMyKGkpLCB0Mi5zYW5lID0gMSwgdDIuYmFjayA9IC0xLCBOKSA6IFU7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIG8oZTIpIHsKICAgICAgICAgIHZhciB0MjsKICAgICAgICAgIHJldHVybiBlMiAmJiBlMi5zdGF0ZSA/ICgodDIgPSBlMi5zdGF0ZSkud3NpemUgPSAwLCB0Mi53aGF2ZSA9IDAsIHQyLnduZXh0ID0gMCwgYShlMikpIDogVTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gaChlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjI7CiAgICAgICAgICByZXR1cm4gZTIgJiYgZTIuc3RhdGUgPyAobjIgPSBlMi5zdGF0ZSwgdDIgPCAwID8gKHIyID0gMCwgdDIgPSAtdDIpIDogKHIyID0gMSArICh0MiA+PiA0KSwgdDIgPCA0OCAmJiAodDIgJj0gMTUpKSwgdDIgJiYgKHQyIDwgOCB8fCAxNSA8IHQyKSA/IFUgOiAobnVsbCAhPT0gbjIud2luZG93ICYmIG4yLndiaXRzICE9PSB0MiAmJiAobjIud2luZG93ID0gbnVsbCksIG4yLndyYXAgPSByMiwgbjIud2JpdHMgPSB0MiwgbyhlMikpKSA6IFU7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIHUoZTIsIHQyKSB7CiAgICAgICAgICB2YXIgcjIsIG4yOwogICAgICAgICAgcmV0dXJuIGUyID8gKG4yID0gbmV3IHMoKSwgKGUyLnN0YXRlID0gbjIpLndpbmRvdyA9IG51bGwsIChyMiA9IGgoZTIsIHQyKSkgIT09IE4gJiYgKGUyLnN0YXRlID0gbnVsbCksIHIyKSA6IFU7CiAgICAgICAgfQogICAgICAgIHZhciBsLCBmLCBjID0gdHJ1ZTsKICAgICAgICBmdW5jdGlvbiBqKGUyKSB7CiAgICAgICAgICBpZiAoYykgewogICAgICAgICAgICB2YXIgdDI7CiAgICAgICAgICAgIGZvciAobCA9IG5ldyBJLkJ1ZjMyKDUxMiksIGYgPSBuZXcgSS5CdWYzMigzMiksIHQyID0gMDsgdDIgPCAxNDQ7ICkKICAgICAgICAgICAgICBlMi5sZW5zW3QyKytdID0gODsKICAgICAgICAgICAgZm9yICg7IHQyIDwgMjU2OyApCiAgICAgICAgICAgICAgZTIubGVuc1t0MisrXSA9IDk7CiAgICAgICAgICAgIGZvciAoOyB0MiA8IDI4MDsgKQogICAgICAgICAgICAgIGUyLmxlbnNbdDIrK10gPSA3OwogICAgICAgICAgICBmb3IgKDsgdDIgPCAyODg7ICkKICAgICAgICAgICAgICBlMi5sZW5zW3QyKytdID0gODsKICAgICAgICAgICAgZm9yIChUKEQsIGUyLmxlbnMsIDAsIDI4OCwgbCwgMCwgZTIud29yaywgeyBiaXRzOiA5IH0pLCB0MiA9IDA7IHQyIDwgMzI7ICkKICAgICAgICAgICAgICBlMi5sZW5zW3QyKytdID0gNTsKICAgICAgICAgICAgVChGLCBlMi5sZW5zLCAwLCAzMiwgZiwgMCwgZTIud29yaywgeyBiaXRzOiA1IH0pLCBjID0gZmFsc2U7CiAgICAgICAgICB9CiAgICAgICAgICBlMi5sZW5jb2RlID0gbCwgZTIubGVuYml0cyA9IDksIGUyLmRpc3Rjb2RlID0gZiwgZTIuZGlzdGJpdHMgPSA1OwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBaKGUyLCB0MiwgcjIsIG4yKSB7CiAgICAgICAgICB2YXIgaTIsIHMyID0gZTIuc3RhdGU7CiAgICAgICAgICByZXR1cm4gbnVsbCA9PT0gczIud2luZG93ICYmIChzMi53c2l6ZSA9IDEgPDwgczIud2JpdHMsIHMyLnduZXh0ID0gMCwgczIud2hhdmUgPSAwLCBzMi53aW5kb3cgPSBuZXcgSS5CdWY4KHMyLndzaXplKSksIG4yID49IHMyLndzaXplID8gKEkuYXJyYXlTZXQoczIud2luZG93LCB0MiwgcjIgLSBzMi53c2l6ZSwgczIud3NpemUsIDApLCBzMi53bmV4dCA9IDAsIHMyLndoYXZlID0gczIud3NpemUpIDogKG4yIDwgKGkyID0gczIud3NpemUgLSBzMi53bmV4dCkgJiYgKGkyID0gbjIpLCBJLmFycmF5U2V0KHMyLndpbmRvdywgdDIsIHIyIC0gbjIsIGkyLCBzMi53bmV4dCksIChuMiAtPSBpMikgPyAoSS5hcnJheVNldChzMi53aW5kb3csIHQyLCByMiAtIG4yLCBuMiwgMCksIHMyLnduZXh0ID0gbjIsIHMyLndoYXZlID0gczIud3NpemUpIDogKHMyLnduZXh0ICs9IGkyLCBzMi53bmV4dCA9PT0gczIud3NpemUgJiYgKHMyLnduZXh0ID0gMCksIHMyLndoYXZlIDwgczIud3NpemUgJiYgKHMyLndoYXZlICs9IGkyKSkpLCAwOwogICAgICAgIH0KICAgICAgICByLmluZmxhdGVSZXNldCA9IG8sIHIuaW5mbGF0ZVJlc2V0MiA9IGgsIHIuaW5mbGF0ZVJlc2V0S2VlcCA9IGEsIHIuaW5mbGF0ZUluaXQgPSBmdW5jdGlvbihlMikgewogICAgICAgICAgcmV0dXJuIHUoZTIsIDE1KTsKICAgICAgICB9LCByLmluZmxhdGVJbml0MiA9IHUsIHIuaW5mbGF0ZSA9IGZ1bmN0aW9uKGUyLCB0MikgewogICAgICAgICAgdmFyIHIyLCBuMiwgaTIsIHMyLCBhMiwgbzIsIGgyLCB1MiwgbDIsIGYyLCBjMiwgZCwgcCwgbSwgXywgZywgYiwgdiwgeSwgdywgaywgeCwgUywgeiwgQyA9IDAsIEUgPSBuZXcgSS5CdWY4KDQpLCBBID0gWzE2LCAxNywgMTgsIDAsIDgsIDcsIDksIDYsIDEwLCA1LCAxMSwgNCwgMTIsIDMsIDEzLCAyLCAxNCwgMSwgMTVdOwogICAgICAgICAgaWYgKCFlMiB8fCAhZTIuc3RhdGUgfHwgIWUyLm91dHB1dCB8fCAhZTIuaW5wdXQgJiYgMCAhPT0gZTIuYXZhaWxfaW4pCiAgICAgICAgICAgIHJldHVybiBVOwogICAgICAgICAgMTIgPT09IChyMiA9IGUyLnN0YXRlKS5tb2RlICYmIChyMi5tb2RlID0gMTMpLCBhMiA9IGUyLm5leHRfb3V0LCBpMiA9IGUyLm91dHB1dCwgaDIgPSBlMi5hdmFpbF9vdXQsIHMyID0gZTIubmV4dF9pbiwgbjIgPSBlMi5pbnB1dCwgbzIgPSBlMi5hdmFpbF9pbiwgdTIgPSByMi5ob2xkLCBsMiA9IHIyLmJpdHMsIGYyID0gbzIsIGMyID0gaDIsIHggPSBOOwogICAgICAgICAgZToKICAgICAgICAgICAgZm9yICg7IDsgKQogICAgICAgICAgICAgIHN3aXRjaCAocjIubW9kZSkgewogICAgICAgICAgICAgICAgY2FzZSBQOgogICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gcjIud3JhcCkgewogICAgICAgICAgICAgICAgICAgIHIyLm1vZGUgPSAxMzsKICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBmb3IgKDsgbDIgPCAxNjsgKSB7CiAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICBvMi0tLCB1MiArPSBuMltzMisrXSA8PCBsMiwgbDIgKz0gODsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAoMiAmIHIyLndyYXAgJiYgMzU2MTUgPT09IHUyKSB7CiAgICAgICAgICAgICAgICAgICAgRVtyMi5jaGVjayA9IDBdID0gMjU1ICYgdTIsIEVbMV0gPSB1MiA+Pj4gOCAmIDI1NSwgcjIuY2hlY2sgPSBCKHIyLmNoZWNrLCBFLCAyLCAwKSwgbDIgPSB1MiA9IDAsIHIyLm1vZGUgPSAyOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmIChyMi5mbGFncyA9IDAsIHIyLmhlYWQgJiYgKHIyLmhlYWQuZG9uZSA9IGZhbHNlKSwgISgxICYgcjIud3JhcCkgfHwgKCgoMjU1ICYgdTIpIDw8IDgpICsgKHUyID4+IDgpKSAlIDMxKSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImluY29ycmVjdCBoZWFkZXIgY2hlY2siLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKDggIT0gKDE1ICYgdTIpKSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gInVua25vd24gY29tcHJlc3Npb24gbWV0aG9kIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmIChsMiAtPSA0LCBrID0gOCArICgxNSAmICh1MiA+Pj49IDQpKSwgMCA9PT0gcjIud2JpdHMpCiAgICAgICAgICAgICAgICAgICAgcjIud2JpdHMgPSBrOwogICAgICAgICAgICAgICAgICBlbHNlIGlmIChrID4gcjIud2JpdHMpIHsKICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCB3aW5kb3cgc2l6ZSIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi5kbWF4ID0gMSA8PCBrLCBlMi5hZGxlciA9IHIyLmNoZWNrID0gMSwgcjIubW9kZSA9IDUxMiAmIHUyID8gMTAgOiAxMiwgbDIgPSB1MiA9IDA7CiAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgY2FzZSAyOgogICAgICAgICAgICAgICAgICBmb3IgKDsgbDIgPCAxNjsgKSB7CiAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICBvMi0tLCB1MiArPSBuMltzMisrXSA8PCBsMiwgbDIgKz0gODsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAocjIuZmxhZ3MgPSB1MiwgOCAhPSAoMjU1ICYgcjIuZmxhZ3MpKSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gInVua25vd24gY29tcHJlc3Npb24gbWV0aG9kIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmICg1NzM0NCAmIHIyLmZsYWdzKSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gInVua25vd24gaGVhZGVyIGZsYWdzIHNldCIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi5oZWFkICYmIChyMi5oZWFkLnRleHQgPSB1MiA+PiA4ICYgMSksIDUxMiAmIHIyLmZsYWdzICYmIChFWzBdID0gMjU1ICYgdTIsIEVbMV0gPSB1MiA+Pj4gOCAmIDI1NSwgcjIuY2hlY2sgPSBCKHIyLmNoZWNrLCBFLCAyLCAwKSksIGwyID0gdTIgPSAwLCByMi5tb2RlID0gMzsKICAgICAgICAgICAgICAgIGNhc2UgMzoKICAgICAgICAgICAgICAgICAgZm9yICg7IGwyIDwgMzI7ICkgewogICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgcjIuaGVhZCAmJiAocjIuaGVhZC50aW1lID0gdTIpLCA1MTIgJiByMi5mbGFncyAmJiAoRVswXSA9IDI1NSAmIHUyLCBFWzFdID0gdTIgPj4+IDggJiAyNTUsIEVbMl0gPSB1MiA+Pj4gMTYgJiAyNTUsIEVbM10gPSB1MiA+Pj4gMjQgJiAyNTUsIHIyLmNoZWNrID0gQihyMi5jaGVjaywgRSwgNCwgMCkpLCBsMiA9IHUyID0gMCwgcjIubW9kZSA9IDQ7CiAgICAgICAgICAgICAgICBjYXNlIDQ6CiAgICAgICAgICAgICAgICAgIGZvciAoOyBsMiA8IDE2OyApIHsKICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHIyLmhlYWQgJiYgKHIyLmhlYWQueGZsYWdzID0gMjU1ICYgdTIsIHIyLmhlYWQub3MgPSB1MiA+PiA4KSwgNTEyICYgcjIuZmxhZ3MgJiYgKEVbMF0gPSAyNTUgJiB1MiwgRVsxXSA9IHUyID4+PiA4ICYgMjU1LCByMi5jaGVjayA9IEIocjIuY2hlY2ssIEUsIDIsIDApKSwgbDIgPSB1MiA9IDAsIHIyLm1vZGUgPSA1OwogICAgICAgICAgICAgICAgY2FzZSA1OgogICAgICAgICAgICAgICAgICBpZiAoMTAyNCAmIHIyLmZsYWdzKSB7CiAgICAgICAgICAgICAgICAgICAgZm9yICg7IGwyIDwgMTY7ICkgewogICAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgIHIyLmxlbmd0aCA9IHUyLCByMi5oZWFkICYmIChyMi5oZWFkLmV4dHJhX2xlbiA9IHUyKSwgNTEyICYgcjIuZmxhZ3MgJiYgKEVbMF0gPSAyNTUgJiB1MiwgRVsxXSA9IHUyID4+PiA4ICYgMjU1LCByMi5jaGVjayA9IEIocjIuY2hlY2ssIEUsIDIsIDApKSwgbDIgPSB1MiA9IDA7CiAgICAgICAgICAgICAgICAgIH0gZWxzZQogICAgICAgICAgICAgICAgICAgIHIyLmhlYWQgJiYgKHIyLmhlYWQuZXh0cmEgPSBudWxsKTsKICAgICAgICAgICAgICAgICAgcjIubW9kZSA9IDY7CiAgICAgICAgICAgICAgICBjYXNlIDY6CiAgICAgICAgICAgICAgICAgIGlmICgxMDI0ICYgcjIuZmxhZ3MgJiYgKG8yIDwgKGQgPSByMi5sZW5ndGgpICYmIChkID0gbzIpLCBkICYmIChyMi5oZWFkICYmIChrID0gcjIuaGVhZC5leHRyYV9sZW4gLSByMi5sZW5ndGgsIHIyLmhlYWQuZXh0cmEgfHwgKHIyLmhlYWQuZXh0cmEgPSBuZXcgQXJyYXkocjIuaGVhZC5leHRyYV9sZW4pKSwgSS5hcnJheVNldChyMi5oZWFkLmV4dHJhLCBuMiwgczIsIGQsIGspKSwgNTEyICYgcjIuZmxhZ3MgJiYgKHIyLmNoZWNrID0gQihyMi5jaGVjaywgbjIsIGQsIHMyKSksIG8yIC09IGQsIHMyICs9IGQsIHIyLmxlbmd0aCAtPSBkKSwgcjIubGVuZ3RoKSkKICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICByMi5sZW5ndGggPSAwLCByMi5tb2RlID0gNzsKICAgICAgICAgICAgICAgIGNhc2UgNzoKICAgICAgICAgICAgICAgICAgaWYgKDIwNDggJiByMi5mbGFncykgewogICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgZm9yIChkID0gMDsgayA9IG4yW3MyICsgZCsrXSwgcjIuaGVhZCAmJiBrICYmIHIyLmxlbmd0aCA8IDY1NTM2ICYmIChyMi5oZWFkLm5hbWUgKz0gU3RyaW5nLmZyb21DaGFyQ29kZShrKSksIGsgJiYgZCA8IG8yOyApCiAgICAgICAgICAgICAgICAgICAgICA7CiAgICAgICAgICAgICAgICAgICAgaWYgKDUxMiAmIHIyLmZsYWdzICYmIChyMi5jaGVjayA9IEIocjIuY2hlY2ssIG4yLCBkLCBzMikpLCBvMiAtPSBkLCBzMiArPSBkLCBrKQogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgfSBlbHNlCiAgICAgICAgICAgICAgICAgICAgcjIuaGVhZCAmJiAocjIuaGVhZC5uYW1lID0gbnVsbCk7CiAgICAgICAgICAgICAgICAgIHIyLmxlbmd0aCA9IDAsIHIyLm1vZGUgPSA4OwogICAgICAgICAgICAgICAgY2FzZSA4OgogICAgICAgICAgICAgICAgICBpZiAoNDA5NiAmIHIyLmZsYWdzKSB7CiAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICBmb3IgKGQgPSAwOyBrID0gbjJbczIgKyBkKytdLCByMi5oZWFkICYmIGsgJiYgcjIubGVuZ3RoIDwgNjU1MzYgJiYgKHIyLmhlYWQuY29tbWVudCArPSBTdHJpbmcuZnJvbUNoYXJDb2RlKGspKSwgayAmJiBkIDwgbzI7ICkKICAgICAgICAgICAgICAgICAgICAgIDsKICAgICAgICAgICAgICAgICAgICBpZiAoNTEyICYgcjIuZmxhZ3MgJiYgKHIyLmNoZWNrID0gQihyMi5jaGVjaywgbjIsIGQsIHMyKSksIG8yIC09IGQsIHMyICs9IGQsIGspCiAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICB9IGVsc2UKICAgICAgICAgICAgICAgICAgICByMi5oZWFkICYmIChyMi5oZWFkLmNvbW1lbnQgPSBudWxsKTsKICAgICAgICAgICAgICAgICAgcjIubW9kZSA9IDk7CiAgICAgICAgICAgICAgICBjYXNlIDk6CiAgICAgICAgICAgICAgICAgIGlmICg1MTIgJiByMi5mbGFncykgewogICAgICAgICAgICAgICAgICAgIGZvciAoOyBsMiA8IDE2OyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBpZiAodTIgIT09ICg2NTUzNSAmIHIyLmNoZWNrKSkgewogICAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImhlYWRlciBjcmMgbWlzbWF0Y2giLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgbDIgPSB1MiA9IDA7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgcjIuaGVhZCAmJiAocjIuaGVhZC5oY3JjID0gcjIuZmxhZ3MgPj4gOSAmIDEsIHIyLmhlYWQuZG9uZSA9IHRydWUpLCBlMi5hZGxlciA9IHIyLmNoZWNrID0gMCwgcjIubW9kZSA9IDEyOwogICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgIGNhc2UgMTA6CiAgICAgICAgICAgICAgICAgIGZvciAoOyBsMiA8IDMyOyApIHsKICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGUyLmFkbGVyID0gcjIuY2hlY2sgPSBMKHUyKSwgbDIgPSB1MiA9IDAsIHIyLm1vZGUgPSAxMTsKICAgICAgICAgICAgICAgIGNhc2UgMTE6CiAgICAgICAgICAgICAgICAgIGlmICgwID09PSByMi5oYXZlZGljdCkKICAgICAgICAgICAgICAgICAgICByZXR1cm4gZTIubmV4dF9vdXQgPSBhMiwgZTIuYXZhaWxfb3V0ID0gaDIsIGUyLm5leHRfaW4gPSBzMiwgZTIuYXZhaWxfaW4gPSBvMiwgcjIuaG9sZCA9IHUyLCByMi5iaXRzID0gbDIsIDI7CiAgICAgICAgICAgICAgICAgIGUyLmFkbGVyID0gcjIuY2hlY2sgPSAxLCByMi5tb2RlID0gMTI7CiAgICAgICAgICAgICAgICBjYXNlIDEyOgogICAgICAgICAgICAgICAgICBpZiAoNSA9PT0gdDIgfHwgNiA9PT0gdDIpCiAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgIGNhc2UgMTM6CiAgICAgICAgICAgICAgICAgIGlmIChyMi5sYXN0KSB7CiAgICAgICAgICAgICAgICAgICAgdTIgPj4+PSA3ICYgbDIsIGwyIC09IDcgJiBsMiwgcjIubW9kZSA9IDI3OwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGZvciAoOyBsMiA8IDM7ICkgewogICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgc3dpdGNoIChyMi5sYXN0ID0gMSAmIHUyLCBsMiAtPSAxLCAzICYgKHUyID4+Pj0gMSkpIHsKICAgICAgICAgICAgICAgICAgICBjYXNlIDA6CiAgICAgICAgICAgICAgICAgICAgICByMi5tb2RlID0gMTQ7CiAgICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgICBjYXNlIDE6CiAgICAgICAgICAgICAgICAgICAgICBpZiAoaihyMiksIHIyLm1vZGUgPSAyMCwgNiAhPT0gdDIpCiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgICAgdTIgPj4+PSAyLCBsMiAtPSAyOwogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICBjYXNlIDI6CiAgICAgICAgICAgICAgICAgICAgICByMi5tb2RlID0gMTc7CiAgICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgICBjYXNlIDM6CiAgICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBibG9jayB0eXBlIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHUyID4+Pj0gMiwgbDIgLT0gMjsKICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICBjYXNlIDE0OgogICAgICAgICAgICAgICAgICBmb3IgKHUyID4+Pj0gNyAmIGwyLCBsMiAtPSA3ICYgbDI7IGwyIDwgMzI7ICkgewogICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKCg2NTUzNSAmIHUyKSAhPSAodTIgPj4+IDE2IF4gNjU1MzUpKSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImludmFsaWQgc3RvcmVkIGJsb2NrIGxlbmd0aHMiLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKHIyLmxlbmd0aCA9IDY1NTM1ICYgdTIsIGwyID0gdTIgPSAwLCByMi5tb2RlID0gMTUsIDYgPT09IHQyKQogICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICBjYXNlIDE1OgogICAgICAgICAgICAgICAgICByMi5tb2RlID0gMTY7CiAgICAgICAgICAgICAgICBjYXNlIDE2OgogICAgICAgICAgICAgICAgICBpZiAoZCA9IHIyLmxlbmd0aCkgewogICAgICAgICAgICAgICAgICAgIGlmIChvMiA8IGQgJiYgKGQgPSBvMiksIGgyIDwgZCAmJiAoZCA9IGgyKSwgMCA9PT0gZCkKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgSS5hcnJheVNldChpMiwgbjIsIHMyLCBkLCBhMiksIG8yIC09IGQsIHMyICs9IGQsIGgyIC09IGQsIGEyICs9IGQsIHIyLmxlbmd0aCAtPSBkOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHIyLm1vZGUgPSAxMjsKICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICBjYXNlIDE3OgogICAgICAgICAgICAgICAgICBmb3IgKDsgbDIgPCAxNDsgKSB7CiAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICBvMi0tLCB1MiArPSBuMltzMisrXSA8PCBsMiwgbDIgKz0gODsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAocjIubmxlbiA9IDI1NyArICgzMSAmIHUyKSwgdTIgPj4+PSA1LCBsMiAtPSA1LCByMi5uZGlzdCA9IDEgKyAoMzEgJiB1MiksIHUyID4+Pj0gNSwgbDIgLT0gNSwgcjIubmNvZGUgPSA0ICsgKDE1ICYgdTIpLCB1MiA+Pj49IDQsIGwyIC09IDQsIDI4NiA8IHIyLm5sZW4gfHwgMzAgPCByMi5uZGlzdCkgewogICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJ0b28gbWFueSBsZW5ndGggb3IgZGlzdGFuY2Ugc3ltYm9scyIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICBicmVhazsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi5oYXZlID0gMCwgcjIubW9kZSA9IDE4OwogICAgICAgICAgICAgICAgY2FzZSAxODoKICAgICAgICAgICAgICAgICAgZm9yICg7IHIyLmhhdmUgPCByMi5uY29kZTsgKSB7CiAgICAgICAgICAgICAgICAgICAgZm9yICg7IGwyIDwgMzsgKSB7CiAgICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgICBvMi0tLCB1MiArPSBuMltzMisrXSA8PCBsMiwgbDIgKz0gODsKICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgcjIubGVuc1tBW3IyLmhhdmUrK11dID0gNyAmIHUyLCB1MiA+Pj49IDMsIGwyIC09IDM7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgZm9yICg7IHIyLmhhdmUgPCAxOTsgKQogICAgICAgICAgICAgICAgICAgIHIyLmxlbnNbQVtyMi5oYXZlKytdXSA9IDA7CiAgICAgICAgICAgICAgICAgIGlmIChyMi5sZW5jb2RlID0gcjIubGVuZHluLCByMi5sZW5iaXRzID0gNywgUyA9IHsgYml0czogcjIubGVuYml0cyB9LCB4ID0gVCgwLCByMi5sZW5zLCAwLCAxOSwgcjIubGVuY29kZSwgMCwgcjIud29yaywgUyksIHIyLmxlbmJpdHMgPSBTLmJpdHMsIHgpIHsKICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBjb2RlIGxlbmd0aHMgc2V0IiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHIyLmhhdmUgPSAwLCByMi5tb2RlID0gMTk7CiAgICAgICAgICAgICAgICBjYXNlIDE5OgogICAgICAgICAgICAgICAgICBmb3IgKDsgcjIuaGF2ZSA8IHIyLm5sZW4gKyByMi5uZGlzdDsgKSB7CiAgICAgICAgICAgICAgICAgICAgZm9yICg7IGcgPSAoQyA9IHIyLmxlbmNvZGVbdTIgJiAoMSA8PCByMi5sZW5iaXRzKSAtIDFdKSA+Pj4gMTYgJiAyNTUsIGIgPSA2NTUzNSAmIEMsICEoKF8gPSBDID4+PiAyNCkgPD0gbDIpOyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBpZiAoYiA8IDE2KQogICAgICAgICAgICAgICAgICAgICAgdTIgPj4+PSBfLCBsMiAtPSBfLCByMi5sZW5zW3IyLmhhdmUrK10gPSBiOwogICAgICAgICAgICAgICAgICAgIGVsc2UgewogICAgICAgICAgICAgICAgICAgICAgaWYgKDE2ID09PSBiKSB7CiAgICAgICAgICAgICAgICAgICAgICAgIGZvciAoeiA9IF8gKyAyOyBsMiA8IHo7ICkgewogICAgICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICAgICAgaWYgKHUyID4+Pj0gXywgbDIgLT0gXywgMCA9PT0gcjIuaGF2ZSkgewogICAgICAgICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbnZhbGlkIGJpdCBsZW5ndGggcmVwZWF0IiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgIGsgPSByMi5sZW5zW3IyLmhhdmUgLSAxXSwgZCA9IDMgKyAoMyAmIHUyKSwgdTIgPj4+PSAyLCBsMiAtPSAyOwogICAgICAgICAgICAgICAgICAgICAgfSBlbHNlIGlmICgxNyA9PT0gYikgewogICAgICAgICAgICAgICAgICAgICAgICBmb3IgKHogPSBfICsgMzsgbDIgPCB6OyApIHsKICAgICAgICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgIGwyIC09IF8sIGsgPSAwLCBkID0gMyArICg3ICYgKHUyID4+Pj0gXykpLCB1MiA+Pj49IDMsIGwyIC09IDM7CiAgICAgICAgICAgICAgICAgICAgICB9IGVsc2UgewogICAgICAgICAgICAgICAgICAgICAgICBmb3IgKHogPSBfICsgNzsgbDIgPCB6OyApIHsKICAgICAgICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICAgIGwyIC09IF8sIGsgPSAwLCBkID0gMTEgKyAoMTI3ICYgKHUyID4+Pj0gXykpLCB1MiA+Pj49IDcsIGwyIC09IDc7CiAgICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgICBpZiAocjIuaGF2ZSArIGQgPiByMi5ubGVuICsgcjIubmRpc3QpIHsKICAgICAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImludmFsaWQgYml0IGxlbmd0aCByZXBlYXQiLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgICAgZm9yICg7IGQtLTsgKQogICAgICAgICAgICAgICAgICAgICAgICByMi5sZW5zW3IyLmhhdmUrK10gPSBrOwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAoMzAgPT09IHIyLm1vZGUpCiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIGlmICgwID09PSByMi5sZW5zWzI1Nl0pIHsKICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBjb2RlIC0tIG1pc3NpbmcgZW5kLW9mLWJsb2NrIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmIChyMi5sZW5iaXRzID0gOSwgUyA9IHsgYml0czogcjIubGVuYml0cyB9LCB4ID0gVChELCByMi5sZW5zLCAwLCByMi5ubGVuLCByMi5sZW5jb2RlLCAwLCByMi53b3JrLCBTKSwgcjIubGVuYml0cyA9IFMuYml0cywgeCkgewogICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbnZhbGlkIGxpdGVyYWwvbGVuZ3RocyBzZXQiLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKHIyLmRpc3RiaXRzID0gNiwgcjIuZGlzdGNvZGUgPSByMi5kaXN0ZHluLCBTID0geyBiaXRzOiByMi5kaXN0Yml0cyB9LCB4ID0gVChGLCByMi5sZW5zLCByMi5ubGVuLCByMi5uZGlzdCwgcjIuZGlzdGNvZGUsIDAsIHIyLndvcmssIFMpLCByMi5kaXN0Yml0cyA9IFMuYml0cywgeCkgewogICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbnZhbGlkIGRpc3RhbmNlcyBzZXQiLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKHIyLm1vZGUgPSAyMCwgNiA9PT0gdDIpCiAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgIGNhc2UgMjA6CiAgICAgICAgICAgICAgICAgIHIyLm1vZGUgPSAyMTsKICAgICAgICAgICAgICAgIGNhc2UgMjE6CiAgICAgICAgICAgICAgICAgIGlmICg2IDw9IG8yICYmIDI1OCA8PSBoMikgewogICAgICAgICAgICAgICAgICAgIGUyLm5leHRfb3V0ID0gYTIsIGUyLmF2YWlsX291dCA9IGgyLCBlMi5uZXh0X2luID0gczIsIGUyLmF2YWlsX2luID0gbzIsIHIyLmhvbGQgPSB1MiwgcjIuYml0cyA9IGwyLCBSKGUyLCBjMiksIGEyID0gZTIubmV4dF9vdXQsIGkyID0gZTIub3V0cHV0LCBoMiA9IGUyLmF2YWlsX291dCwgczIgPSBlMi5uZXh0X2luLCBuMiA9IGUyLmlucHV0LCBvMiA9IGUyLmF2YWlsX2luLCB1MiA9IHIyLmhvbGQsIGwyID0gcjIuYml0cywgMTIgPT09IHIyLm1vZGUgJiYgKHIyLmJhY2sgPSAtMSk7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgZm9yIChyMi5iYWNrID0gMDsgZyA9IChDID0gcjIubGVuY29kZVt1MiAmICgxIDw8IHIyLmxlbmJpdHMpIC0gMV0pID4+PiAxNiAmIDI1NSwgYiA9IDY1NTM1ICYgQywgISgoXyA9IEMgPj4+IDI0KSA8PSBsMik7ICkgewogICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKGcgJiYgMCA9PSAoMjQwICYgZykpIHsKICAgICAgICAgICAgICAgICAgICBmb3IgKHYgPSBfLCB5ID0gZywgdyA9IGI7IGcgPSAoQyA9IHIyLmxlbmNvZGVbdyArICgodTIgJiAoMSA8PCB2ICsgeSkgLSAxKSA+PiB2KV0pID4+PiAxNiAmIDI1NSwgYiA9IDY1NTM1ICYgQywgISh2ICsgKF8gPSBDID4+PiAyNCkgPD0gbDIpOyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICB1MiA+Pj49IHYsIGwyIC09IHYsIHIyLmJhY2sgKz0gdjsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAodTIgPj4+PSBfLCBsMiAtPSBfLCByMi5iYWNrICs9IF8sIHIyLmxlbmd0aCA9IGIsIDAgPT09IGcpIHsKICAgICAgICAgICAgICAgICAgICByMi5tb2RlID0gMjY7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgaWYgKDMyICYgZykgewogICAgICAgICAgICAgICAgICAgIHIyLmJhY2sgPSAtMSwgcjIubW9kZSA9IDEyOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmICg2NCAmIGcpIHsKICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW52YWxpZCBsaXRlcmFsL2xlbmd0aCBjb2RlIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHIyLmV4dHJhID0gMTUgJiBnLCByMi5tb2RlID0gMjI7CiAgICAgICAgICAgICAgICBjYXNlIDIyOgogICAgICAgICAgICAgICAgICBpZiAocjIuZXh0cmEpIHsKICAgICAgICAgICAgICAgICAgICBmb3IgKHogPSByMi5leHRyYTsgbDIgPCB6OyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICByMi5sZW5ndGggKz0gdTIgJiAoMSA8PCByMi5leHRyYSkgLSAxLCB1MiA+Pj49IHIyLmV4dHJhLCBsMiAtPSByMi5leHRyYSwgcjIuYmFjayArPSByMi5leHRyYTsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi53YXMgPSByMi5sZW5ndGgsIHIyLm1vZGUgPSAyMzsKICAgICAgICAgICAgICAgIGNhc2UgMjM6CiAgICAgICAgICAgICAgICAgIGZvciAoOyBnID0gKEMgPSByMi5kaXN0Y29kZVt1MiAmICgxIDw8IHIyLmRpc3RiaXRzKSAtIDFdKSA+Pj4gMTYgJiAyNTUsIGIgPSA2NTUzNSAmIEMsICEoKF8gPSBDID4+PiAyNCkgPD0gbDIpOyApIHsKICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmICgwID09ICgyNDAgJiBnKSkgewogICAgICAgICAgICAgICAgICAgIGZvciAodiA9IF8sIHkgPSBnLCB3ID0gYjsgZyA9IChDID0gcjIuZGlzdGNvZGVbdyArICgodTIgJiAoMSA8PCB2ICsgeSkgLSAxKSA+PiB2KV0pID4+PiAxNiAmIDI1NSwgYiA9IDY1NTM1ICYgQywgISh2ICsgKF8gPSBDID4+PiAyNCkgPD0gbDIpOyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICB1MiA+Pj49IHYsIGwyIC09IHYsIHIyLmJhY2sgKz0gdjsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICBpZiAodTIgPj4+PSBfLCBsMiAtPSBfLCByMi5iYWNrICs9IF8sIDY0ICYgZykgewogICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbnZhbGlkIGRpc3RhbmNlIGNvZGUiLCByMi5tb2RlID0gMzA7CiAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgcjIub2Zmc2V0ID0gYiwgcjIuZXh0cmEgPSAxNSAmIGcsIHIyLm1vZGUgPSAyNDsKICAgICAgICAgICAgICAgIGNhc2UgMjQ6CiAgICAgICAgICAgICAgICAgIGlmIChyMi5leHRyYSkgewogICAgICAgICAgICAgICAgICAgIGZvciAoeiA9IHIyLmV4dHJhOyBsMiA8IHo7ICkgewogICAgICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IG8yKQogICAgICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICAgICAgbzItLSwgdTIgKz0gbjJbczIrK10gPDwgbDIsIGwyICs9IDg7CiAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgIHIyLm9mZnNldCArPSB1MiAmICgxIDw8IHIyLmV4dHJhKSAtIDEsIHUyID4+Pj0gcjIuZXh0cmEsIGwyIC09IHIyLmV4dHJhLCByMi5iYWNrICs9IHIyLmV4dHJhOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIGlmIChyMi5vZmZzZXQgPiByMi5kbWF4KSB7CiAgICAgICAgICAgICAgICAgICAgZTIubXNnID0gImludmFsaWQgZGlzdGFuY2UgdG9vIGZhciBiYWNrIiwgcjIubW9kZSA9IDMwOwogICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgIHIyLm1vZGUgPSAyNTsKICAgICAgICAgICAgICAgIGNhc2UgMjU6CiAgICAgICAgICAgICAgICAgIGlmICgwID09PSBoMikKICAgICAgICAgICAgICAgICAgICBicmVhayBlOwogICAgICAgICAgICAgICAgICBpZiAoZCA9IGMyIC0gaDIsIHIyLm9mZnNldCA+IGQpIHsKICAgICAgICAgICAgICAgICAgICBpZiAoKGQgPSByMi5vZmZzZXQgLSBkKSA+IHIyLndoYXZlICYmIHIyLnNhbmUpIHsKICAgICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbnZhbGlkIGRpc3RhbmNlIHRvbyBmYXIgYmFjayIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBwID0gZCA+IHIyLnduZXh0ID8gKGQgLT0gcjIud25leHQsIHIyLndzaXplIC0gZCkgOiByMi53bmV4dCAtIGQsIGQgPiByMi5sZW5ndGggJiYgKGQgPSByMi5sZW5ndGgpLCBtID0gcjIud2luZG93OwogICAgICAgICAgICAgICAgICB9IGVsc2UKICAgICAgICAgICAgICAgICAgICBtID0gaTIsIHAgPSBhMiAtIHIyLm9mZnNldCwgZCA9IHIyLmxlbmd0aDsKICAgICAgICAgICAgICAgICAgZm9yIChoMiA8IGQgJiYgKGQgPSBoMiksIGgyIC09IGQsIHIyLmxlbmd0aCAtPSBkOyBpMlthMisrXSA9IG1bcCsrXSwgLS1kOyApCiAgICAgICAgICAgICAgICAgICAgOwogICAgICAgICAgICAgICAgICAwID09PSByMi5sZW5ndGggJiYgKHIyLm1vZGUgPSAyMSk7CiAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgY2FzZSAyNjoKICAgICAgICAgICAgICAgICAgaWYgKDAgPT09IGgyKQogICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgIGkyW2EyKytdID0gcjIubGVuZ3RoLCBoMi0tLCByMi5tb2RlID0gMjE7CiAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgY2FzZSAyNzoKICAgICAgICAgICAgICAgICAgaWYgKHIyLndyYXApIHsKICAgICAgICAgICAgICAgICAgICBmb3IgKDsgbDIgPCAzMjsgKSB7CiAgICAgICAgICAgICAgICAgICAgICBpZiAoMCA9PT0gbzIpCiAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrIGU7CiAgICAgICAgICAgICAgICAgICAgICBvMi0tLCB1MiB8PSBuMltzMisrXSA8PCBsMiwgbDIgKz0gODsKICAgICAgICAgICAgICAgICAgICB9CiAgICAgICAgICAgICAgICAgICAgaWYgKGMyIC09IGgyLCBlMi50b3RhbF9vdXQgKz0gYzIsIHIyLnRvdGFsICs9IGMyLCBjMiAmJiAoZTIuYWRsZXIgPSByMi5jaGVjayA9IHIyLmZsYWdzID8gQihyMi5jaGVjaywgaTIsIGMyLCBhMiAtIGMyKSA6IE8ocjIuY2hlY2ssIGkyLCBjMiwgYTIgLSBjMikpLCBjMiA9IGgyLCAocjIuZmxhZ3MgPyB1MiA6IEwodTIpKSAhPT0gcjIuY2hlY2spIHsKICAgICAgICAgICAgICAgICAgICAgIGUyLm1zZyA9ICJpbmNvcnJlY3QgZGF0YSBjaGVjayIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBsMiA9IHUyID0gMDsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi5tb2RlID0gMjg7CiAgICAgICAgICAgICAgICBjYXNlIDI4OgogICAgICAgICAgICAgICAgICBpZiAocjIud3JhcCAmJiByMi5mbGFncykgewogICAgICAgICAgICAgICAgICAgIGZvciAoOyBsMiA8IDMyOyApIHsKICAgICAgICAgICAgICAgICAgICAgIGlmICgwID09PSBvMikKICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgICAgICAgIG8yLS0sIHUyICs9IG4yW3MyKytdIDw8IGwyLCBsMiArPSA4OwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBpZiAodTIgIT09ICg0Mjk0OTY3Mjk1ICYgcjIudG90YWwpKSB7CiAgICAgICAgICAgICAgICAgICAgICBlMi5tc2cgPSAiaW5jb3JyZWN0IGxlbmd0aCBjaGVjayIsIHIyLm1vZGUgPSAzMDsKICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgICAgICBsMiA9IHUyID0gMDsKICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICByMi5tb2RlID0gMjk7CiAgICAgICAgICAgICAgICBjYXNlIDI5OgogICAgICAgICAgICAgICAgICB4ID0gMTsKICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgIGNhc2UgMzA6CiAgICAgICAgICAgICAgICAgIHggPSAtMzsKICAgICAgICAgICAgICAgICAgYnJlYWsgZTsKICAgICAgICAgICAgICAgIGNhc2UgMzE6CiAgICAgICAgICAgICAgICAgIHJldHVybiAtNDsKICAgICAgICAgICAgICAgIGNhc2UgMzI6CiAgICAgICAgICAgICAgICBkZWZhdWx0OgogICAgICAgICAgICAgICAgICByZXR1cm4gVTsKICAgICAgICAgICAgICB9CiAgICAgICAgICByZXR1cm4gZTIubmV4dF9vdXQgPSBhMiwgZTIuYXZhaWxfb3V0ID0gaDIsIGUyLm5leHRfaW4gPSBzMiwgZTIuYXZhaWxfaW4gPSBvMiwgcjIuaG9sZCA9IHUyLCByMi5iaXRzID0gbDIsIChyMi53c2l6ZSB8fCBjMiAhPT0gZTIuYXZhaWxfb3V0ICYmIHIyLm1vZGUgPCAzMCAmJiAocjIubW9kZSA8IDI3IHx8IDQgIT09IHQyKSkgJiYgWihlMiwgZTIub3V0cHV0LCBlMi5uZXh0X291dCwgYzIgLSBlMi5hdmFpbF9vdXQpID8gKHIyLm1vZGUgPSAzMSwgLTQpIDogKGYyIC09IGUyLmF2YWlsX2luLCBjMiAtPSBlMi5hdmFpbF9vdXQsIGUyLnRvdGFsX2luICs9IGYyLCBlMi50b3RhbF9vdXQgKz0gYzIsIHIyLnRvdGFsICs9IGMyLCByMi53cmFwICYmIGMyICYmIChlMi5hZGxlciA9IHIyLmNoZWNrID0gcjIuZmxhZ3MgPyBCKHIyLmNoZWNrLCBpMiwgYzIsIGUyLm5leHRfb3V0IC0gYzIpIDogTyhyMi5jaGVjaywgaTIsIGMyLCBlMi5uZXh0X291dCAtIGMyKSksIGUyLmRhdGFfdHlwZSA9IHIyLmJpdHMgKyAocjIubGFzdCA/IDY0IDogMCkgKyAoMTIgPT09IHIyLm1vZGUgPyAxMjggOiAwKSArICgyMCA9PT0gcjIubW9kZSB8fCAxNSA9PT0gcjIubW9kZSA/IDI1NiA6IDApLCAoMCA9PSBmMiAmJiAwID09PSBjMiB8fCA0ID09PSB0MikgJiYgeCA9PT0gTiAmJiAoeCA9IC01KSwgeCk7CiAgICAgICAgfSwgci5pbmZsYXRlRW5kID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIGlmICghZTIgfHwgIWUyLnN0YXRlKQogICAgICAgICAgICByZXR1cm4gVTsKICAgICAgICAgIHZhciB0MiA9IGUyLnN0YXRlOwogICAgICAgICAgcmV0dXJuIHQyLndpbmRvdyAmJiAodDIud2luZG93ID0gbnVsbCksIGUyLnN0YXRlID0gbnVsbCwgTjsKICAgICAgICB9LCByLmluZmxhdGVHZXRIZWFkZXIgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMjsKICAgICAgICAgIHJldHVybiBlMiAmJiBlMi5zdGF0ZSA/IDAgPT0gKDIgJiAocjIgPSBlMi5zdGF0ZSkud3JhcCkgPyBVIDogKChyMi5oZWFkID0gdDIpLmRvbmUgPSBmYWxzZSwgTikgOiBVOwogICAgICAgIH0sIHIuaW5mbGF0ZVNldERpY3Rpb25hcnkgPSBmdW5jdGlvbihlMiwgdDIpIHsKICAgICAgICAgIHZhciByMiwgbjIgPSB0Mi5sZW5ndGg7CiAgICAgICAgICByZXR1cm4gZTIgJiYgZTIuc3RhdGUgPyAwICE9PSAocjIgPSBlMi5zdGF0ZSkud3JhcCAmJiAxMSAhPT0gcjIubW9kZSA/IFUgOiAxMSA9PT0gcjIubW9kZSAmJiBPKDEsIHQyLCBuMiwgMCkgIT09IHIyLmNoZWNrID8gLTMgOiBaKGUyLCB0MiwgbjIsIG4yKSA/IChyMi5tb2RlID0gMzEsIC00KSA6IChyMi5oYXZlZGljdCA9IDEsIE4pIDogVTsKICAgICAgICB9LCByLmluZmxhdGVJbmZvID0gInBha28gaW5mbGF0ZSAoZnJvbSBOb2RlY2EgcHJvamVjdCkiOwogICAgICB9LCB7ICIuLi91dGlscy9jb21tb24iOiA0MSwgIi4vYWRsZXIzMiI6IDQzLCAiLi9jcmMzMiI6IDQ1LCAiLi9pbmZmYXN0IjogNDgsICIuL2luZnRyZWVzIjogNTAgfV0sIDUwOiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIHZhciBEID0gZSgiLi4vdXRpbHMvY29tbW9uIiksIEYgPSBbMywgNCwgNSwgNiwgNywgOCwgOSwgMTAsIDExLCAxMywgMTUsIDE3LCAxOSwgMjMsIDI3LCAzMSwgMzUsIDQzLCA1MSwgNTksIDY3LCA4MywgOTksIDExNSwgMTMxLCAxNjMsIDE5NSwgMjI3LCAyNTgsIDAsIDBdLCBOID0gWzE2LCAxNiwgMTYsIDE2LCAxNiwgMTYsIDE2LCAxNiwgMTcsIDE3LCAxNywgMTcsIDE4LCAxOCwgMTgsIDE4LCAxOSwgMTksIDE5LCAxOSwgMjAsIDIwLCAyMCwgMjAsIDIxLCAyMSwgMjEsIDIxLCAxNiwgNzIsIDc4XSwgVSA9IFsxLCAyLCAzLCA0LCA1LCA3LCA5LCAxMywgMTcsIDI1LCAzMywgNDksIDY1LCA5NywgMTI5LCAxOTMsIDI1NywgMzg1LCA1MTMsIDc2OSwgMTAyNSwgMTUzNywgMjA0OSwgMzA3MywgNDA5NywgNjE0NSwgODE5MywgMTIyODksIDE2Mzg1LCAyNDU3NywgMCwgMF0sIFAgPSBbMTYsIDE2LCAxNiwgMTYsIDE3LCAxNywgMTgsIDE4LCAxOSwgMTksIDIwLCAyMCwgMjEsIDIxLCAyMiwgMjIsIDIzLCAyMywgMjQsIDI0LCAyNSwgMjUsIDI2LCAyNiwgMjcsIDI3LCAyOCwgMjgsIDI5LCAyOSwgNjQsIDY0XTsKICAgICAgICB0LmV4cG9ydHMgPSBmdW5jdGlvbihlMiwgdDIsIHIyLCBuLCBpLCBzLCBhLCBvKSB7CiAgICAgICAgICB2YXIgaCwgdSwgbCwgZiwgYywgZCwgcCwgbSwgXywgZyA9IG8uYml0cywgYiA9IDAsIHYgPSAwLCB5ID0gMCwgdyA9IDAsIGsgPSAwLCB4ID0gMCwgUyA9IDAsIHogPSAwLCBDID0gMCwgRSA9IDAsIEEgPSBudWxsLCBJID0gMCwgTyA9IG5ldyBELkJ1ZjE2KDE2KSwgQiA9IG5ldyBELkJ1ZjE2KDE2KSwgUiA9IG51bGwsIFQgPSAwOwogICAgICAgICAgZm9yIChiID0gMDsgYiA8PSAxNTsgYisrKQogICAgICAgICAgICBPW2JdID0gMDsKICAgICAgICAgIGZvciAodiA9IDA7IHYgPCBuOyB2KyspCiAgICAgICAgICAgIE9bdDJbcjIgKyB2XV0rKzsKICAgICAgICAgIGZvciAoayA9IGcsIHcgPSAxNTsgMSA8PSB3ICYmIDAgPT09IE9bd107IHctLSkKICAgICAgICAgICAgOwogICAgICAgICAgaWYgKHcgPCBrICYmIChrID0gdyksIDAgPT09IHcpCiAgICAgICAgICAgIHJldHVybiBpW3MrK10gPSAyMDk3MTUyMCwgaVtzKytdID0gMjA5NzE1MjAsIG8uYml0cyA9IDEsIDA7CiAgICAgICAgICBmb3IgKHkgPSAxOyB5IDwgdyAmJiAwID09PSBPW3ldOyB5KyspCiAgICAgICAgICAgIDsKICAgICAgICAgIGZvciAoayA8IHkgJiYgKGsgPSB5KSwgYiA9IHogPSAxOyBiIDw9IDE1OyBiKyspCiAgICAgICAgICAgIGlmICh6IDw8PSAxLCAoeiAtPSBPW2JdKSA8IDApCiAgICAgICAgICAgICAgcmV0dXJuIC0xOwogICAgICAgICAgaWYgKDAgPCB6ICYmICgwID09PSBlMiB8fCAxICE9PSB3KSkKICAgICAgICAgICAgcmV0dXJuIC0xOwogICAgICAgICAgZm9yIChCWzFdID0gMCwgYiA9IDE7IGIgPCAxNTsgYisrKQogICAgICAgICAgICBCW2IgKyAxXSA9IEJbYl0gKyBPW2JdOwogICAgICAgICAgZm9yICh2ID0gMDsgdiA8IG47IHYrKykKICAgICAgICAgICAgMCAhPT0gdDJbcjIgKyB2XSAmJiAoYVtCW3QyW3IyICsgdl1dKytdID0gdik7CiAgICAgICAgICBpZiAoZCA9IDAgPT09IGUyID8gKEEgPSBSID0gYSwgMTkpIDogMSA9PT0gZTIgPyAoQSA9IEYsIEkgLT0gMjU3LCBSID0gTiwgVCAtPSAyNTcsIDI1NikgOiAoQSA9IFUsIFIgPSBQLCAtMSksIGIgPSB5LCBjID0gcywgUyA9IHYgPSBFID0gMCwgbCA9IC0xLCBmID0gKEMgPSAxIDw8ICh4ID0gaykpIC0gMSwgMSA9PT0gZTIgJiYgODUyIDwgQyB8fCAyID09PSBlMiAmJiA1OTIgPCBDKQogICAgICAgICAgICByZXR1cm4gMTsKICAgICAgICAgIGZvciAoOyA7ICkgewogICAgICAgICAgICBmb3IgKHAgPSBiIC0gUywgXyA9IGFbdl0gPCBkID8gKG0gPSAwLCBhW3ZdKSA6IGFbdl0gPiBkID8gKG0gPSBSW1QgKyBhW3ZdXSwgQVtJICsgYVt2XV0pIDogKG0gPSA5NiwgMCksIGggPSAxIDw8IGIgLSBTLCB5ID0gdSA9IDEgPDwgeDsgaVtjICsgKEUgPj4gUykgKyAodSAtPSBoKV0gPSBwIDw8IDI0IHwgbSA8PCAxNiB8IF8gfCAwLCAwICE9PSB1OyApCiAgICAgICAgICAgICAgOwogICAgICAgICAgICBmb3IgKGggPSAxIDw8IGIgLSAxOyBFICYgaDsgKQogICAgICAgICAgICAgIGggPj49IDE7CiAgICAgICAgICAgIGlmICgwICE9PSBoID8gKEUgJj0gaCAtIDEsIEUgKz0gaCkgOiBFID0gMCwgdisrLCAwID09IC0tT1tiXSkgewogICAgICAgICAgICAgIGlmIChiID09PSB3KQogICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgYiA9IHQyW3IyICsgYVt2XV07CiAgICAgICAgICAgIH0KICAgICAgICAgICAgaWYgKGsgPCBiICYmIChFICYgZikgIT09IGwpIHsKICAgICAgICAgICAgICBmb3IgKDAgPT09IFMgJiYgKFMgPSBrKSwgYyArPSB5LCB6ID0gMSA8PCAoeCA9IGIgLSBTKTsgeCArIFMgPCB3ICYmICEoKHogLT0gT1t4ICsgU10pIDw9IDApOyApCiAgICAgICAgICAgICAgICB4KyssIHogPDw9IDE7CiAgICAgICAgICAgICAgaWYgKEMgKz0gMSA8PCB4LCAxID09PSBlMiAmJiA4NTIgPCBDIHx8IDIgPT09IGUyICYmIDU5MiA8IEMpCiAgICAgICAgICAgICAgICByZXR1cm4gMTsKICAgICAgICAgICAgICBpW2wgPSBFICYgZl0gPSBrIDw8IDI0IHwgeCA8PCAxNiB8IGMgLSBzIHwgMDsKICAgICAgICAgICAgfQogICAgICAgICAgfQogICAgICAgICAgcmV0dXJuIDAgIT09IEUgJiYgKGlbYyArIEVdID0gYiAtIFMgPDwgMjQgfCA2NCA8PCAxNiB8IDApLCBvLmJpdHMgPSBrLCAwOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4uL3V0aWxzL2NvbW1vbiI6IDQxIH1dLCA1MTogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB0LmV4cG9ydHMgPSB7IDI6ICJuZWVkIGRpY3Rpb25hcnkiLCAxOiAic3RyZWFtIGVuZCIsIDA6ICIiLCAiLTEiOiAiZmlsZSBlcnJvciIsICItMiI6ICJzdHJlYW0gZXJyb3IiLCAiLTMiOiAiZGF0YSBlcnJvciIsICItNCI6ICJpbnN1ZmZpY2llbnQgbWVtb3J5IiwgIi01IjogImJ1ZmZlciBlcnJvciIsICItNiI6ICJpbmNvbXBhdGlibGUgdmVyc2lvbiIgfTsKICAgICAgfSwge31dLCA1MjogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB2YXIgaSA9IGUoIi4uL3V0aWxzL2NvbW1vbiIpLCBvID0gMCwgaCA9IDE7CiAgICAgICAgZnVuY3Rpb24gbihlMikgewogICAgICAgICAgZm9yICh2YXIgdDIgPSBlMi5sZW5ndGg7IDAgPD0gLS10MjsgKQogICAgICAgICAgICBlMlt0Ml0gPSAwOwogICAgICAgIH0KICAgICAgICB2YXIgcyA9IDAsIGEgPSAyOSwgdSA9IDI1NiwgbCA9IHUgKyAxICsgYSwgZiA9IDMwLCBjID0gMTksIF8gPSAyICogbCArIDEsIGcgPSAxNSwgZCA9IDE2LCBwID0gNywgbSA9IDI1NiwgYiA9IDE2LCB2ID0gMTcsIHkgPSAxOCwgdyA9IFswLCAwLCAwLCAwLCAwLCAwLCAwLCAwLCAxLCAxLCAxLCAxLCAyLCAyLCAyLCAyLCAzLCAzLCAzLCAzLCA0LCA0LCA0LCA0LCA1LCA1LCA1LCA1LCAwXSwgayA9IFswLCAwLCAwLCAwLCAxLCAxLCAyLCAyLCAzLCAzLCA0LCA0LCA1LCA1LCA2LCA2LCA3LCA3LCA4LCA4LCA5LCA5LCAxMCwgMTAsIDExLCAxMSwgMTIsIDEyLCAxMywgMTNdLCB4ID0gWzAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDAsIDIsIDMsIDddLCBTID0gWzE2LCAxNywgMTgsIDAsIDgsIDcsIDksIDYsIDEwLCA1LCAxMSwgNCwgMTIsIDMsIDEzLCAyLCAxNCwgMSwgMTVdLCB6ID0gbmV3IEFycmF5KDIgKiAobCArIDIpKTsKICAgICAgICBuKHopOwogICAgICAgIHZhciBDID0gbmV3IEFycmF5KDIgKiBmKTsKICAgICAgICBuKEMpOwogICAgICAgIHZhciBFID0gbmV3IEFycmF5KDUxMik7CiAgICAgICAgbihFKTsKICAgICAgICB2YXIgQSA9IG5ldyBBcnJheSgyNTYpOwogICAgICAgIG4oQSk7CiAgICAgICAgdmFyIEkgPSBuZXcgQXJyYXkoYSk7CiAgICAgICAgbihJKTsKICAgICAgICB2YXIgTywgQiwgUiwgVCA9IG5ldyBBcnJheShmKTsKICAgICAgICBmdW5jdGlvbiBEKGUyLCB0MiwgcjIsIG4yLCBpMikgewogICAgICAgICAgdGhpcy5zdGF0aWNfdHJlZSA9IGUyLCB0aGlzLmV4dHJhX2JpdHMgPSB0MiwgdGhpcy5leHRyYV9iYXNlID0gcjIsIHRoaXMuZWxlbXMgPSBuMiwgdGhpcy5tYXhfbGVuZ3RoID0gaTIsIHRoaXMuaGFzX3N0cmVlID0gZTIgJiYgZTIubGVuZ3RoOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBGKGUyLCB0MikgewogICAgICAgICAgdGhpcy5keW5fdHJlZSA9IGUyLCB0aGlzLm1heF9jb2RlID0gMCwgdGhpcy5zdGF0X2Rlc2MgPSB0MjsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gTihlMikgewogICAgICAgICAgcmV0dXJuIGUyIDwgMjU2ID8gRVtlMl0gOiBFWzI1NiArIChlMiA+Pj4gNyldOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBVKGUyLCB0MikgewogICAgICAgICAgZTIucGVuZGluZ19idWZbZTIucGVuZGluZysrXSA9IDI1NSAmIHQyLCBlMi5wZW5kaW5nX2J1ZltlMi5wZW5kaW5nKytdID0gdDIgPj4+IDggJiAyNTU7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFAoZTIsIHQyLCByMikgewogICAgICAgICAgZTIuYmlfdmFsaWQgPiBkIC0gcjIgPyAoZTIuYmlfYnVmIHw9IHQyIDw8IGUyLmJpX3ZhbGlkICYgNjU1MzUsIFUoZTIsIGUyLmJpX2J1ZiksIGUyLmJpX2J1ZiA9IHQyID4+IGQgLSBlMi5iaV92YWxpZCwgZTIuYmlfdmFsaWQgKz0gcjIgLSBkKSA6IChlMi5iaV9idWYgfD0gdDIgPDwgZTIuYmlfdmFsaWQgJiA2NTUzNSwgZTIuYmlfdmFsaWQgKz0gcjIpOwogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBMKGUyLCB0MiwgcjIpIHsKICAgICAgICAgIFAoZTIsIHIyWzIgKiB0Ml0sIHIyWzIgKiB0MiArIDFdKTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gaihlMiwgdDIpIHsKICAgICAgICAgIGZvciAodmFyIHIyID0gMDsgcjIgfD0gMSAmIGUyLCBlMiA+Pj49IDEsIHIyIDw8PSAxLCAwIDwgLS10MjsgKQogICAgICAgICAgICA7CiAgICAgICAgICByZXR1cm4gcjIgPj4+IDE7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFooZTIsIHQyLCByMikgewogICAgICAgICAgdmFyIG4yLCBpMiwgczIgPSBuZXcgQXJyYXkoZyArIDEpLCBhMiA9IDA7CiAgICAgICAgICBmb3IgKG4yID0gMTsgbjIgPD0gZzsgbjIrKykKICAgICAgICAgICAgczJbbjJdID0gYTIgPSBhMiArIHIyW24yIC0gMV0gPDwgMTsKICAgICAgICAgIGZvciAoaTIgPSAwOyBpMiA8PSB0MjsgaTIrKykgewogICAgICAgICAgICB2YXIgbzIgPSBlMlsyICogaTIgKyAxXTsKICAgICAgICAgICAgMCAhPT0gbzIgJiYgKGUyWzIgKiBpMl0gPSBqKHMyW28yXSsrLCBvMikpOwogICAgICAgICAgfQogICAgICAgIH0KICAgICAgICBmdW5jdGlvbiBXKGUyKSB7CiAgICAgICAgICB2YXIgdDI7CiAgICAgICAgICBmb3IgKHQyID0gMDsgdDIgPCBsOyB0MisrKQogICAgICAgICAgICBlMi5keW5fbHRyZWVbMiAqIHQyXSA9IDA7CiAgICAgICAgICBmb3IgKHQyID0gMDsgdDIgPCBmOyB0MisrKQogICAgICAgICAgICBlMi5keW5fZHRyZWVbMiAqIHQyXSA9IDA7CiAgICAgICAgICBmb3IgKHQyID0gMDsgdDIgPCBjOyB0MisrKQogICAgICAgICAgICBlMi5ibF90cmVlWzIgKiB0Ml0gPSAwOwogICAgICAgICAgZTIuZHluX2x0cmVlWzIgKiBtXSA9IDEsIGUyLm9wdF9sZW4gPSBlMi5zdGF0aWNfbGVuID0gMCwgZTIubGFzdF9saXQgPSBlMi5tYXRjaGVzID0gMDsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gTShlMikgewogICAgICAgICAgOCA8IGUyLmJpX3ZhbGlkID8gVShlMiwgZTIuYmlfYnVmKSA6IDAgPCBlMi5iaV92YWxpZCAmJiAoZTIucGVuZGluZ19idWZbZTIucGVuZGluZysrXSA9IGUyLmJpX2J1ZiksIGUyLmJpX2J1ZiA9IDAsIGUyLmJpX3ZhbGlkID0gMDsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gSChlMiwgdDIsIHIyLCBuMikgewogICAgICAgICAgdmFyIGkyID0gMiAqIHQyLCBzMiA9IDIgKiByMjsKICAgICAgICAgIHJldHVybiBlMltpMl0gPCBlMltzMl0gfHwgZTJbaTJdID09PSBlMltzMl0gJiYgbjJbdDJdIDw9IG4yW3IyXTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gRyhlMiwgdDIsIHIyKSB7CiAgICAgICAgICBmb3IgKHZhciBuMiA9IGUyLmhlYXBbcjJdLCBpMiA9IHIyIDw8IDE7IGkyIDw9IGUyLmhlYXBfbGVuICYmIChpMiA8IGUyLmhlYXBfbGVuICYmIEgodDIsIGUyLmhlYXBbaTIgKyAxXSwgZTIuaGVhcFtpMl0sIGUyLmRlcHRoKSAmJiBpMisrLCAhSCh0MiwgbjIsIGUyLmhlYXBbaTJdLCBlMi5kZXB0aCkpOyApCiAgICAgICAgICAgIGUyLmhlYXBbcjJdID0gZTIuaGVhcFtpMl0sIHIyID0gaTIsIGkyIDw8PSAxOwogICAgICAgICAgZTIuaGVhcFtyMl0gPSBuMjsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gSyhlMiwgdDIsIHIyKSB7CiAgICAgICAgICB2YXIgbjIsIGkyLCBzMiwgYTIsIG8yID0gMDsKICAgICAgICAgIGlmICgwICE9PSBlMi5sYXN0X2xpdCkKICAgICAgICAgICAgZm9yICg7IG4yID0gZTIucGVuZGluZ19idWZbZTIuZF9idWYgKyAyICogbzJdIDw8IDggfCBlMi5wZW5kaW5nX2J1ZltlMi5kX2J1ZiArIDIgKiBvMiArIDFdLCBpMiA9IGUyLnBlbmRpbmdfYnVmW2UyLmxfYnVmICsgbzJdLCBvMisrLCAwID09PSBuMiA/IEwoZTIsIGkyLCB0MikgOiAoTChlMiwgKHMyID0gQVtpMl0pICsgdSArIDEsIHQyKSwgMCAhPT0gKGEyID0gd1tzMl0pICYmIFAoZTIsIGkyIC09IElbczJdLCBhMiksIEwoZTIsIHMyID0gTigtLW4yKSwgcjIpLCAwICE9PSAoYTIgPSBrW3MyXSkgJiYgUChlMiwgbjIgLT0gVFtzMl0sIGEyKSksIG8yIDwgZTIubGFzdF9saXQ7ICkKICAgICAgICAgICAgICA7CiAgICAgICAgICBMKGUyLCBtLCB0Mik7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFkoZTIsIHQyKSB7CiAgICAgICAgICB2YXIgcjIsIG4yLCBpMiwgczIgPSB0Mi5keW5fdHJlZSwgYTIgPSB0Mi5zdGF0X2Rlc2Muc3RhdGljX3RyZWUsIG8yID0gdDIuc3RhdF9kZXNjLmhhc19zdHJlZSwgaDIgPSB0Mi5zdGF0X2Rlc2MuZWxlbXMsIHUyID0gLTE7CiAgICAgICAgICBmb3IgKGUyLmhlYXBfbGVuID0gMCwgZTIuaGVhcF9tYXggPSBfLCByMiA9IDA7IHIyIDwgaDI7IHIyKyspCiAgICAgICAgICAgIDAgIT09IHMyWzIgKiByMl0gPyAoZTIuaGVhcFsrK2UyLmhlYXBfbGVuXSA9IHUyID0gcjIsIGUyLmRlcHRoW3IyXSA9IDApIDogczJbMiAqIHIyICsgMV0gPSAwOwogICAgICAgICAgZm9yICg7IGUyLmhlYXBfbGVuIDwgMjsgKQogICAgICAgICAgICBzMlsyICogKGkyID0gZTIuaGVhcFsrK2UyLmhlYXBfbGVuXSA9IHUyIDwgMiA/ICsrdTIgOiAwKV0gPSAxLCBlMi5kZXB0aFtpMl0gPSAwLCBlMi5vcHRfbGVuLS0sIG8yICYmIChlMi5zdGF0aWNfbGVuIC09IGEyWzIgKiBpMiArIDFdKTsKICAgICAgICAgIGZvciAodDIubWF4X2NvZGUgPSB1MiwgcjIgPSBlMi5oZWFwX2xlbiA+PiAxOyAxIDw9IHIyOyByMi0tKQogICAgICAgICAgICBHKGUyLCBzMiwgcjIpOwogICAgICAgICAgZm9yIChpMiA9IGgyOyByMiA9IGUyLmhlYXBbMV0sIGUyLmhlYXBbMV0gPSBlMi5oZWFwW2UyLmhlYXBfbGVuLS1dLCBHKGUyLCBzMiwgMSksIG4yID0gZTIuaGVhcFsxXSwgZTIuaGVhcFstLWUyLmhlYXBfbWF4XSA9IHIyLCBlMi5oZWFwWy0tZTIuaGVhcF9tYXhdID0gbjIsIHMyWzIgKiBpMl0gPSBzMlsyICogcjJdICsgczJbMiAqIG4yXSwgZTIuZGVwdGhbaTJdID0gKGUyLmRlcHRoW3IyXSA+PSBlMi5kZXB0aFtuMl0gPyBlMi5kZXB0aFtyMl0gOiBlMi5kZXB0aFtuMl0pICsgMSwgczJbMiAqIHIyICsgMV0gPSBzMlsyICogbjIgKyAxXSA9IGkyLCBlMi5oZWFwWzFdID0gaTIrKywgRyhlMiwgczIsIDEpLCAyIDw9IGUyLmhlYXBfbGVuOyApCiAgICAgICAgICAgIDsKICAgICAgICAgIGUyLmhlYXBbLS1lMi5oZWFwX21heF0gPSBlMi5oZWFwWzFdLCBmdW5jdGlvbihlMywgdDMpIHsKICAgICAgICAgICAgdmFyIHIzLCBuMywgaTMsIHMzLCBhMywgbzMsIGgzID0gdDMuZHluX3RyZWUsIHUzID0gdDMubWF4X2NvZGUsIGwyID0gdDMuc3RhdF9kZXNjLnN0YXRpY190cmVlLCBmMiA9IHQzLnN0YXRfZGVzYy5oYXNfc3RyZWUsIGMyID0gdDMuc3RhdF9kZXNjLmV4dHJhX2JpdHMsIGQyID0gdDMuc3RhdF9kZXNjLmV4dHJhX2Jhc2UsIHAyID0gdDMuc3RhdF9kZXNjLm1heF9sZW5ndGgsIG0yID0gMDsKICAgICAgICAgICAgZm9yIChzMyA9IDA7IHMzIDw9IGc7IHMzKyspCiAgICAgICAgICAgICAgZTMuYmxfY291bnRbczNdID0gMDsKICAgICAgICAgICAgZm9yIChoM1syICogZTMuaGVhcFtlMy5oZWFwX21heF0gKyAxXSA9IDAsIHIzID0gZTMuaGVhcF9tYXggKyAxOyByMyA8IF87IHIzKyspCiAgICAgICAgICAgICAgcDIgPCAoczMgPSBoM1syICogaDNbMiAqIChuMyA9IGUzLmhlYXBbcjNdKSArIDFdICsgMV0gKyAxKSAmJiAoczMgPSBwMiwgbTIrKyksIGgzWzIgKiBuMyArIDFdID0gczMsIHUzIDwgbjMgfHwgKGUzLmJsX2NvdW50W3MzXSsrLCBhMyA9IDAsIGQyIDw9IG4zICYmIChhMyA9IGMyW24zIC0gZDJdKSwgbzMgPSBoM1syICogbjNdLCBlMy5vcHRfbGVuICs9IG8zICogKHMzICsgYTMpLCBmMiAmJiAoZTMuc3RhdGljX2xlbiArPSBvMyAqIChsMlsyICogbjMgKyAxXSArIGEzKSkpOwogICAgICAgICAgICBpZiAoMCAhPT0gbTIpIHsKICAgICAgICAgICAgICBkbyB7CiAgICAgICAgICAgICAgICBmb3IgKHMzID0gcDIgLSAxOyAwID09PSBlMy5ibF9jb3VudFtzM107ICkKICAgICAgICAgICAgICAgICAgczMtLTsKICAgICAgICAgICAgICAgIGUzLmJsX2NvdW50W3MzXS0tLCBlMy5ibF9jb3VudFtzMyArIDFdICs9IDIsIGUzLmJsX2NvdW50W3AyXS0tLCBtMiAtPSAyOwogICAgICAgICAgICAgIH0gd2hpbGUgKDAgPCBtMik7CiAgICAgICAgICAgICAgZm9yIChzMyA9IHAyOyAwICE9PSBzMzsgczMtLSkKICAgICAgICAgICAgICAgIGZvciAobjMgPSBlMy5ibF9jb3VudFtzM107IDAgIT09IG4zOyApCiAgICAgICAgICAgICAgICAgIHUzIDwgKGkzID0gZTMuaGVhcFstLXIzXSkgfHwgKGgzWzIgKiBpMyArIDFdICE9PSBzMyAmJiAoZTMub3B0X2xlbiArPSAoczMgLSBoM1syICogaTMgKyAxXSkgKiBoM1syICogaTNdLCBoM1syICogaTMgKyAxXSA9IHMzKSwgbjMtLSk7CiAgICAgICAgICAgIH0KICAgICAgICAgIH0oZTIsIHQyKSwgWihzMiwgdTIsIGUyLmJsX2NvdW50KTsKICAgICAgICB9CiAgICAgICAgZnVuY3Rpb24gWChlMiwgdDIsIHIyKSB7CiAgICAgICAgICB2YXIgbjIsIGkyLCBzMiA9IC0xLCBhMiA9IHQyWzFdLCBvMiA9IDAsIGgyID0gNywgdTIgPSA0OwogICAgICAgICAgZm9yICgwID09PSBhMiAmJiAoaDIgPSAxMzgsIHUyID0gMyksIHQyWzIgKiAocjIgKyAxKSArIDFdID0gNjU1MzUsIG4yID0gMDsgbjIgPD0gcjI7IG4yKyspCiAgICAgICAgICAgIGkyID0gYTIsIGEyID0gdDJbMiAqIChuMiArIDEpICsgMV0sICsrbzIgPCBoMiAmJiBpMiA9PT0gYTIgfHwgKG8yIDwgdTIgPyBlMi5ibF90cmVlWzIgKiBpMl0gKz0gbzIgOiAwICE9PSBpMiA/IChpMiAhPT0gczIgJiYgZTIuYmxfdHJlZVsyICogaTJdKyssIGUyLmJsX3RyZWVbMiAqIGJdKyspIDogbzIgPD0gMTAgPyBlMi5ibF90cmVlWzIgKiB2XSsrIDogZTIuYmxfdHJlZVsyICogeV0rKywgczIgPSBpMiwgdTIgPSAobzIgPSAwKSA9PT0gYTIgPyAoaDIgPSAxMzgsIDMpIDogaTIgPT09IGEyID8gKGgyID0gNiwgMykgOiAoaDIgPSA3LCA0KSk7CiAgICAgICAgfQogICAgICAgIGZ1bmN0aW9uIFYoZTIsIHQyLCByMikgewogICAgICAgICAgdmFyIG4yLCBpMiwgczIgPSAtMSwgYTIgPSB0MlsxXSwgbzIgPSAwLCBoMiA9IDcsIHUyID0gNDsKICAgICAgICAgIGZvciAoMCA9PT0gYTIgJiYgKGgyID0gMTM4LCB1MiA9IDMpLCBuMiA9IDA7IG4yIDw9IHIyOyBuMisrKQogICAgICAgICAgICBpZiAoaTIgPSBhMiwgYTIgPSB0MlsyICogKG4yICsgMSkgKyAxXSwgISgrK28yIDwgaDIgJiYgaTIgPT09IGEyKSkgewogICAgICAgICAgICAgIGlmIChvMiA8IHUyKQogICAgICAgICAgICAgICAgZm9yICg7IEwoZTIsIGkyLCBlMi5ibF90cmVlKSwgMCAhPSAtLW8yOyApCiAgICAgICAgICAgICAgICAgIDsKICAgICAgICAgICAgICBlbHNlCiAgICAgICAgICAgICAgICAwICE9PSBpMiA/IChpMiAhPT0gczIgJiYgKEwoZTIsIGkyLCBlMi5ibF90cmVlKSwgbzItLSksIEwoZTIsIGIsIGUyLmJsX3RyZWUpLCBQKGUyLCBvMiAtIDMsIDIpKSA6IG8yIDw9IDEwID8gKEwoZTIsIHYsIGUyLmJsX3RyZWUpLCBQKGUyLCBvMiAtIDMsIDMpKSA6IChMKGUyLCB5LCBlMi5ibF90cmVlKSwgUChlMiwgbzIgLSAxMSwgNykpOwogICAgICAgICAgICAgIHMyID0gaTIsIHUyID0gKG8yID0gMCkgPT09IGEyID8gKGgyID0gMTM4LCAzKSA6IGkyID09PSBhMiA/IChoMiA9IDYsIDMpIDogKGgyID0gNywgNCk7CiAgICAgICAgICAgIH0KICAgICAgICB9CiAgICAgICAgbihUKTsKICAgICAgICB2YXIgcSA9IGZhbHNlOwogICAgICAgIGZ1bmN0aW9uIEooZTIsIHQyLCByMiwgbjIpIHsKICAgICAgICAgIFAoZTIsIChzIDw8IDEpICsgKG4yID8gMSA6IDApLCAzKSwgZnVuY3Rpb24oZTMsIHQzLCByMywgbjMpIHsKICAgICAgICAgICAgTShlMyksIG4zICYmIChVKGUzLCByMyksIFUoZTMsIH5yMykpLCBpLmFycmF5U2V0KGUzLnBlbmRpbmdfYnVmLCBlMy53aW5kb3csIHQzLCByMywgZTMucGVuZGluZyksIGUzLnBlbmRpbmcgKz0gcjM7CiAgICAgICAgICB9KGUyLCB0MiwgcjIsIHRydWUpOwogICAgICAgIH0KICAgICAgICByLl90cl9pbml0ID0gZnVuY3Rpb24oZTIpIHsKICAgICAgICAgIHEgfHwgKGZ1bmN0aW9uKCkgewogICAgICAgICAgICB2YXIgZTMsIHQyLCByMiwgbjIsIGkyLCBzMiA9IG5ldyBBcnJheShnICsgMSk7CiAgICAgICAgICAgIGZvciAobjIgPSByMiA9IDA7IG4yIDwgYSAtIDE7IG4yKyspCiAgICAgICAgICAgICAgZm9yIChJW24yXSA9IHIyLCBlMyA9IDA7IGUzIDwgMSA8PCB3W24yXTsgZTMrKykKICAgICAgICAgICAgICAgIEFbcjIrK10gPSBuMjsKICAgICAgICAgICAgZm9yIChBW3IyIC0gMV0gPSBuMiwgbjIgPSBpMiA9IDA7IG4yIDwgMTY7IG4yKyspCiAgICAgICAgICAgICAgZm9yIChUW24yXSA9IGkyLCBlMyA9IDA7IGUzIDwgMSA8PCBrW24yXTsgZTMrKykKICAgICAgICAgICAgICAgIEVbaTIrK10gPSBuMjsKICAgICAgICAgICAgZm9yIChpMiA+Pj0gNzsgbjIgPCBmOyBuMisrKQogICAgICAgICAgICAgIGZvciAoVFtuMl0gPSBpMiA8PCA3LCBlMyA9IDA7IGUzIDwgMSA8PCBrW24yXSAtIDc7IGUzKyspCiAgICAgICAgICAgICAgICBFWzI1NiArIGkyKytdID0gbjI7CiAgICAgICAgICAgIGZvciAodDIgPSAwOyB0MiA8PSBnOyB0MisrKQogICAgICAgICAgICAgIHMyW3QyXSA9IDA7CiAgICAgICAgICAgIGZvciAoZTMgPSAwOyBlMyA8PSAxNDM7ICkKICAgICAgICAgICAgICB6WzIgKiBlMyArIDFdID0gOCwgZTMrKywgczJbOF0rKzsKICAgICAgICAgICAgZm9yICg7IGUzIDw9IDI1NTsgKQogICAgICAgICAgICAgIHpbMiAqIGUzICsgMV0gPSA5LCBlMysrLCBzMls5XSsrOwogICAgICAgICAgICBmb3IgKDsgZTMgPD0gMjc5OyApCiAgICAgICAgICAgICAgelsyICogZTMgKyAxXSA9IDcsIGUzKyssIHMyWzddKys7CiAgICAgICAgICAgIGZvciAoOyBlMyA8PSAyODc7ICkKICAgICAgICAgICAgICB6WzIgKiBlMyArIDFdID0gOCwgZTMrKywgczJbOF0rKzsKICAgICAgICAgICAgZm9yIChaKHosIGwgKyAxLCBzMiksIGUzID0gMDsgZTMgPCBmOyBlMysrKQogICAgICAgICAgICAgIENbMiAqIGUzICsgMV0gPSA1LCBDWzIgKiBlM10gPSBqKGUzLCA1KTsKICAgICAgICAgICAgTyA9IG5ldyBEKHosIHcsIHUgKyAxLCBsLCBnKSwgQiA9IG5ldyBEKEMsIGssIDAsIGYsIGcpLCBSID0gbmV3IEQobmV3IEFycmF5KDApLCB4LCAwLCBjLCBwKTsKICAgICAgICAgIH0oKSwgcSA9IHRydWUpLCBlMi5sX2Rlc2MgPSBuZXcgRihlMi5keW5fbHRyZWUsIE8pLCBlMi5kX2Rlc2MgPSBuZXcgRihlMi5keW5fZHRyZWUsIEIpLCBlMi5ibF9kZXNjID0gbmV3IEYoZTIuYmxfdHJlZSwgUiksIGUyLmJpX2J1ZiA9IDAsIGUyLmJpX3ZhbGlkID0gMCwgVyhlMik7CiAgICAgICAgfSwgci5fdHJfc3RvcmVkX2Jsb2NrID0gSiwgci5fdHJfZmx1c2hfYmxvY2sgPSBmdW5jdGlvbihlMiwgdDIsIHIyLCBuMikgewogICAgICAgICAgdmFyIGkyLCBzMiwgYTIgPSAwOwogICAgICAgICAgMCA8IGUyLmxldmVsID8gKDIgPT09IGUyLnN0cm0uZGF0YV90eXBlICYmIChlMi5zdHJtLmRhdGFfdHlwZSA9IGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHZhciB0MywgcjMgPSA0MDkzNjI0NDQ3OwogICAgICAgICAgICBmb3IgKHQzID0gMDsgdDMgPD0gMzE7IHQzKyssIHIzID4+Pj0gMSkKICAgICAgICAgICAgICBpZiAoMSAmIHIzICYmIDAgIT09IGUzLmR5bl9sdHJlZVsyICogdDNdKQogICAgICAgICAgICAgICAgcmV0dXJuIG87CiAgICAgICAgICAgIGlmICgwICE9PSBlMy5keW5fbHRyZWVbMThdIHx8IDAgIT09IGUzLmR5bl9sdHJlZVsyMF0gfHwgMCAhPT0gZTMuZHluX2x0cmVlWzI2XSkKICAgICAgICAgICAgICByZXR1cm4gaDsKICAgICAgICAgICAgZm9yICh0MyA9IDMyOyB0MyA8IHU7IHQzKyspCiAgICAgICAgICAgICAgaWYgKDAgIT09IGUzLmR5bl9sdHJlZVsyICogdDNdKQogICAgICAgICAgICAgICAgcmV0dXJuIGg7CiAgICAgICAgICAgIHJldHVybiBvOwogICAgICAgICAgfShlMikpLCBZKGUyLCBlMi5sX2Rlc2MpLCBZKGUyLCBlMi5kX2Rlc2MpLCBhMiA9IGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIHZhciB0MzsKICAgICAgICAgICAgZm9yIChYKGUzLCBlMy5keW5fbHRyZWUsIGUzLmxfZGVzYy5tYXhfY29kZSksIFgoZTMsIGUzLmR5bl9kdHJlZSwgZTMuZF9kZXNjLm1heF9jb2RlKSwgWShlMywgZTMuYmxfZGVzYyksIHQzID0gYyAtIDE7IDMgPD0gdDMgJiYgMCA9PT0gZTMuYmxfdHJlZVsyICogU1t0M10gKyAxXTsgdDMtLSkKICAgICAgICAgICAgICA7CiAgICAgICAgICAgIHJldHVybiBlMy5vcHRfbGVuICs9IDMgKiAodDMgKyAxKSArIDUgKyA1ICsgNCwgdDM7CiAgICAgICAgICB9KGUyKSwgaTIgPSBlMi5vcHRfbGVuICsgMyArIDcgPj4+IDMsIChzMiA9IGUyLnN0YXRpY19sZW4gKyAzICsgNyA+Pj4gMykgPD0gaTIgJiYgKGkyID0gczIpKSA6IGkyID0gczIgPSByMiArIDUsIHIyICsgNCA8PSBpMiAmJiAtMSAhPT0gdDIgPyBKKGUyLCB0MiwgcjIsIG4yKSA6IDQgPT09IGUyLnN0cmF0ZWd5IHx8IHMyID09PSBpMiA/IChQKGUyLCAyICsgKG4yID8gMSA6IDApLCAzKSwgSyhlMiwgeiwgQykpIDogKFAoZTIsIDQgKyAobjIgPyAxIDogMCksIDMpLCBmdW5jdGlvbihlMywgdDMsIHIzLCBuMykgewogICAgICAgICAgICB2YXIgaTM7CiAgICAgICAgICAgIGZvciAoUChlMywgdDMgLSAyNTcsIDUpLCBQKGUzLCByMyAtIDEsIDUpLCBQKGUzLCBuMyAtIDQsIDQpLCBpMyA9IDA7IGkzIDwgbjM7IGkzKyspCiAgICAgICAgICAgICAgUChlMywgZTMuYmxfdHJlZVsyICogU1tpM10gKyAxXSwgMyk7CiAgICAgICAgICAgIFYoZTMsIGUzLmR5bl9sdHJlZSwgdDMgLSAxKSwgVihlMywgZTMuZHluX2R0cmVlLCByMyAtIDEpOwogICAgICAgICAgfShlMiwgZTIubF9kZXNjLm1heF9jb2RlICsgMSwgZTIuZF9kZXNjLm1heF9jb2RlICsgMSwgYTIgKyAxKSwgSyhlMiwgZTIuZHluX2x0cmVlLCBlMi5keW5fZHRyZWUpKSwgVyhlMiksIG4yICYmIE0oZTIpOwogICAgICAgIH0sIHIuX3RyX3RhbGx5ID0gZnVuY3Rpb24oZTIsIHQyLCByMikgewogICAgICAgICAgcmV0dXJuIGUyLnBlbmRpbmdfYnVmW2UyLmRfYnVmICsgMiAqIGUyLmxhc3RfbGl0XSA9IHQyID4+PiA4ICYgMjU1LCBlMi5wZW5kaW5nX2J1ZltlMi5kX2J1ZiArIDIgKiBlMi5sYXN0X2xpdCArIDFdID0gMjU1ICYgdDIsIGUyLnBlbmRpbmdfYnVmW2UyLmxfYnVmICsgZTIubGFzdF9saXRdID0gMjU1ICYgcjIsIGUyLmxhc3RfbGl0KyssIDAgPT09IHQyID8gZTIuZHluX2x0cmVlWzIgKiByMl0rKyA6IChlMi5tYXRjaGVzKyssIHQyLS0sIGUyLmR5bl9sdHJlZVsyICogKEFbcjJdICsgdSArIDEpXSsrLCBlMi5keW5fZHRyZWVbMiAqIE4odDIpXSsrKSwgZTIubGFzdF9saXQgPT09IGUyLmxpdF9idWZzaXplIC0gMTsKICAgICAgICB9LCByLl90cl9hbGlnbiA9IGZ1bmN0aW9uKGUyKSB7CiAgICAgICAgICBQKGUyLCAyLCAzKSwgTChlMiwgbSwgeiksIGZ1bmN0aW9uKGUzKSB7CiAgICAgICAgICAgIDE2ID09PSBlMy5iaV92YWxpZCA/IChVKGUzLCBlMy5iaV9idWYpLCBlMy5iaV9idWYgPSAwLCBlMy5iaV92YWxpZCA9IDApIDogOCA8PSBlMy5iaV92YWxpZCAmJiAoZTMucGVuZGluZ19idWZbZTMucGVuZGluZysrXSA9IDI1NSAmIGUzLmJpX2J1ZiwgZTMuYmlfYnVmID4+PSA4LCBlMy5iaV92YWxpZCAtPSA4KTsKICAgICAgICAgIH0oZTIpOwogICAgICAgIH07CiAgICAgIH0sIHsgIi4uL3V0aWxzL2NvbW1vbiI6IDQxIH1dLCA1MzogW2Z1bmN0aW9uKGUsIHQsIHIpIHsKICAgICAgICB0LmV4cG9ydHMgPSBmdW5jdGlvbigpIHsKICAgICAgICAgIHRoaXMuaW5wdXQgPSBudWxsLCB0aGlzLm5leHRfaW4gPSAwLCB0aGlzLmF2YWlsX2luID0gMCwgdGhpcy50b3RhbF9pbiA9IDAsIHRoaXMub3V0cHV0ID0gbnVsbCwgdGhpcy5uZXh0X291dCA9IDAsIHRoaXMuYXZhaWxfb3V0ID0gMCwgdGhpcy50b3RhbF9vdXQgPSAwLCB0aGlzLm1zZyA9ICIiLCB0aGlzLnN0YXRlID0gbnVsbCwgdGhpcy5kYXRhX3R5cGUgPSAyLCB0aGlzLmFkbGVyID0gMDsKICAgICAgICB9OwogICAgICB9LCB7fV0sIDU0OiBbZnVuY3Rpb24oZSwgdCwgcikgewogICAgICAgIChmdW5jdGlvbihlMikgewogICAgICAgICAgIWZ1bmN0aW9uKHIyLCBuKSB7CiAgICAgICAgICAgIGlmICghcjIuc2V0SW1tZWRpYXRlKSB7CiAgICAgICAgICAgICAgdmFyIGksIHMsIHQyLCBhLCBvID0gMSwgaCA9IHt9LCB1ID0gZmFsc2UsIGwgPSByMi5kb2N1bWVudCwgZTMgPSBPYmplY3QuZ2V0UHJvdG90eXBlT2YgJiYgT2JqZWN0LmdldFByb3RvdHlwZU9mKHIyKTsKICAgICAgICAgICAgICBlMyA9IGUzICYmIGUzLnNldFRpbWVvdXQgPyBlMyA6IHIyLCBpID0gIltvYmplY3QgcHJvY2Vzc10iID09PSB7fS50b1N0cmluZy5jYWxsKHIyLnByb2Nlc3MpID8gZnVuY3Rpb24oZTQpIHsKICAgICAgICAgICAgICAgIHByb2Nlc3MubmV4dFRpY2soZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgICAgIGMoZTQpOwogICAgICAgICAgICAgICAgfSk7CiAgICAgICAgICAgICAgfSA6IGZ1bmN0aW9uKCkgewogICAgICAgICAgICAgICAgaWYgKHIyLnBvc3RNZXNzYWdlICYmICFyMi5pbXBvcnRTY3JpcHRzKSB7CiAgICAgICAgICAgICAgICAgIHZhciBlNCA9IHRydWUsIHQzID0gcjIub25tZXNzYWdlOwogICAgICAgICAgICAgICAgICByZXR1cm4gcjIub25tZXNzYWdlID0gZnVuY3Rpb24oKSB7CiAgICAgICAgICAgICAgICAgICAgZTQgPSBmYWxzZTsKICAgICAgICAgICAgICAgICAgfSwgcjIucG9zdE1lc3NhZ2UoIiIsICIqIiksIHIyLm9ubWVzc2FnZSA9IHQzLCBlNDsKICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICB9KCkgPyAoYSA9ICJzZXRJbW1lZGlhdGUkIiArIE1hdGgucmFuZG9tKCkgKyAiJCIsIHIyLmFkZEV2ZW50TGlzdGVuZXIgPyByMi5hZGRFdmVudExpc3RlbmVyKCJtZXNzYWdlIiwgZCwgZmFsc2UpIDogcjIuYXR0YWNoRXZlbnQoIm9ubWVzc2FnZSIsIGQpLCBmdW5jdGlvbihlNCkgewogICAgICAgICAgICAgICAgcjIucG9zdE1lc3NhZ2UoYSArIGU0LCAiKiIpOwogICAgICAgICAgICAgIH0pIDogcjIuTWVzc2FnZUNoYW5uZWwgPyAoKHQyID0gbmV3IE1lc3NhZ2VDaGFubmVsKCkpLnBvcnQxLm9ubWVzc2FnZSA9IGZ1bmN0aW9uKGU0KSB7CiAgICAgICAgICAgICAgICBjKGU0LmRhdGEpOwogICAgICAgICAgICAgIH0sIGZ1bmN0aW9uKGU0KSB7CiAgICAgICAgICAgICAgICB0Mi5wb3J0Mi5wb3N0TWVzc2FnZShlNCk7CiAgICAgICAgICAgICAgfSkgOiBsICYmICJvbnJlYWR5c3RhdGVjaGFuZ2UiIGluIGwuY3JlYXRlRWxlbWVudCgic2NyaXB0IikgPyAocyA9IGwuZG9jdW1lbnRFbGVtZW50LCBmdW5jdGlvbihlNCkgewogICAgICAgICAgICAgICAgdmFyIHQzID0gbC5jcmVhdGVFbGVtZW50KCJzY3JpcHQiKTsKICAgICAgICAgICAgICAgIHQzLm9ucmVhZHlzdGF0ZWNoYW5nZSA9IGZ1bmN0aW9uKCkgewogICAgICAgICAgICAgICAgICBjKGU0KSwgdDMub25yZWFkeXN0YXRlY2hhbmdlID0gbnVsbCwgcy5yZW1vdmVDaGlsZCh0MyksIHQzID0gbnVsbDsKICAgICAgICAgICAgICAgIH0sIHMuYXBwZW5kQ2hpbGQodDMpOwogICAgICAgICAgICAgIH0pIDogZnVuY3Rpb24oZTQpIHsKICAgICAgICAgICAgICAgIHNldFRpbWVvdXQoYywgMCwgZTQpOwogICAgICAgICAgICAgIH0sIGUzLnNldEltbWVkaWF0ZSA9IGZ1bmN0aW9uKGU0KSB7CiAgICAgICAgICAgICAgICAiZnVuY3Rpb24iICE9IHR5cGVvZiBlNCAmJiAoZTQgPSBuZXcgRnVuY3Rpb24oIiIgKyBlNCkpOwogICAgICAgICAgICAgICAgZm9yICh2YXIgdDMgPSBuZXcgQXJyYXkoYXJndW1lbnRzLmxlbmd0aCAtIDEpLCByMyA9IDA7IHIzIDwgdDMubGVuZ3RoOyByMysrKQogICAgICAgICAgICAgICAgICB0M1tyM10gPSBhcmd1bWVudHNbcjMgKyAxXTsKICAgICAgICAgICAgICAgIHZhciBuMiA9IHsgY2FsbGJhY2s6IGU0LCBhcmdzOiB0MyB9OwogICAgICAgICAgICAgICAgcmV0dXJuIGhbb10gPSBuMiwgaShvKSwgbysrOwogICAgICAgICAgICAgIH0sIGUzLmNsZWFySW1tZWRpYXRlID0gZjsKICAgICAgICAgICAgfQogICAgICAgICAgICBmdW5jdGlvbiBmKGU0KSB7CiAgICAgICAgICAgICAgZGVsZXRlIGhbZTRdOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGZ1bmN0aW9uIGMoZTQpIHsKICAgICAgICAgICAgICBpZiAodSkKICAgICAgICAgICAgICAgIHNldFRpbWVvdXQoYywgMCwgZTQpOwogICAgICAgICAgICAgIGVsc2UgewogICAgICAgICAgICAgICAgdmFyIHQzID0gaFtlNF07CiAgICAgICAgICAgICAgICBpZiAodDMpIHsKICAgICAgICAgICAgICAgICAgdSA9IHRydWU7CiAgICAgICAgICAgICAgICAgIHRyeSB7CiAgICAgICAgICAgICAgICAgICAgIWZ1bmN0aW9uKGU1KSB7CiAgICAgICAgICAgICAgICAgICAgICB2YXIgdDQgPSBlNS5jYWxsYmFjaywgcjMgPSBlNS5hcmdzOwogICAgICAgICAgICAgICAgICAgICAgc3dpdGNoIChyMy5sZW5ndGgpIHsKICAgICAgICAgICAgICAgICAgICAgICAgY2FzZSAwOgogICAgICAgICAgICAgICAgICAgICAgICAgIHQ0KCk7CiAgICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgICAgICAgIGNhc2UgMToKICAgICAgICAgICAgICAgICAgICAgICAgICB0NChyM1swXSk7CiAgICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgICAgICAgIGNhc2UgMjoKICAgICAgICAgICAgICAgICAgICAgICAgICB0NChyM1swXSwgcjNbMV0pOwogICAgICAgICAgICAgICAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgICAgICAgICAgICAgICBjYXNlIDM6CiAgICAgICAgICAgICAgICAgICAgICAgICAgdDQocjNbMF0sIHIzWzFdLCByM1syXSk7CiAgICAgICAgICAgICAgICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICAgICAgICAgICAgICAgIGRlZmF1bHQ6CiAgICAgICAgICAgICAgICAgICAgICAgICAgdDQuYXBwbHkobiwgcjMpOwogICAgICAgICAgICAgICAgICAgICAgfQogICAgICAgICAgICAgICAgICAgIH0odDMpOwogICAgICAgICAgICAgICAgICB9IGZpbmFsbHkgewogICAgICAgICAgICAgICAgICAgIGYoZTQpLCB1ID0gZmFsc2U7CiAgICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICAgIH0KICAgICAgICAgICAgICB9CiAgICAgICAgICAgIH0KICAgICAgICAgICAgZnVuY3Rpb24gZChlNCkgewogICAgICAgICAgICAgIGU0LnNvdXJjZSA9PT0gcjIgJiYgInN0cmluZyIgPT0gdHlwZW9mIGU0LmRhdGEgJiYgMCA9PT0gZTQuZGF0YS5pbmRleE9mKGEpICYmIGMoK2U0LmRhdGEuc2xpY2UoYS5sZW5ndGgpKTsKICAgICAgICAgICAgfQogICAgICAgICAgfSgidW5kZWZpbmVkIiA9PSB0eXBlb2Ygc2VsZiA/IHZvaWQgMCA9PT0gZTIgPyB0aGlzIDogZTIgOiBzZWxmKTsKICAgICAgICB9KS5jYWxsKHRoaXMsICJ1bmRlZmluZWQiICE9IHR5cGVvZiBjb21tb25qc0dsb2JhbCA/IGNvbW1vbmpzR2xvYmFsIDogInVuZGVmaW5lZCIgIT0gdHlwZW9mIHNlbGYgPyBzZWxmIDogInVuZGVmaW5lZCIgIT0gdHlwZW9mIHdpbmRvdyA/IHdpbmRvdyA6IHt9KTsKICAgICAgfSwge31dIH0sIHt9LCBbMTBdKSgxMCk7CiAgICB9KTsKICB9KShqc3ppcF9taW4pOwogIHZhciBqc3ppcF9taW5FeHBvcnRzID0ganN6aXBfbWluLmV4cG9ydHM7CiAgdmFyIEpTWmlwID0gLyogQF9fUFVSRV9fICovIGdldERlZmF1bHRFeHBvcnRGcm9tQ2pzKGpzemlwX21pbkV4cG9ydHMpOwogIC8qKgogICAqIEBsaWNlbnNlCiAgICogQ29weXJpZ2h0IDIwMTkgR29vZ2xlIExMQwogICAqIFNQRFgtTGljZW5zZS1JZGVudGlmaWVyOiBBcGFjaGUtMi4wCiAgICovCiAgY29uc3QgcHJveHlNYXJrZXIgPSBTeW1ib2woIkNvbWxpbmsucHJveHkiKTsKICBjb25zdCBjcmVhdGVFbmRwb2ludCA9IFN5bWJvbCgiQ29tbGluay5lbmRwb2ludCIpOwogIGNvbnN0IHJlbGVhc2VQcm94eSA9IFN5bWJvbCgiQ29tbGluay5yZWxlYXNlUHJveHkiKTsKICBjb25zdCBmaW5hbGl6ZXIgPSBTeW1ib2woIkNvbWxpbmsuZmluYWxpemVyIik7CiAgY29uc3QgdGhyb3dNYXJrZXIgPSBTeW1ib2woIkNvbWxpbmsudGhyb3duIik7CiAgY29uc3QgaXNPYmplY3QgPSAodmFsKSA9PiB0eXBlb2YgdmFsID09PSAib2JqZWN0IiAmJiB2YWwgIT09IG51bGwgfHwgdHlwZW9mIHZhbCA9PT0gImZ1bmN0aW9uIjsKICBjb25zdCBwcm94eVRyYW5zZmVySGFuZGxlciA9IHsKICAgIGNhbkhhbmRsZTogKHZhbCkgPT4gaXNPYmplY3QodmFsKSAmJiB2YWxbcHJveHlNYXJrZXJdLAogICAgc2VyaWFsaXplKG9iaikgewogICAgICBjb25zdCB7IHBvcnQxLCBwb3J0MiB9ID0gbmV3IE1lc3NhZ2VDaGFubmVsKCk7CiAgICAgIGV4cG9zZShvYmosIHBvcnQxKTsKICAgICAgcmV0dXJuIFtwb3J0MiwgW3BvcnQyXV07CiAgICB9LAogICAgZGVzZXJpYWxpemUocG9ydCkgewogICAgICBwb3J0LnN0YXJ0KCk7CiAgICAgIHJldHVybiB3cmFwKHBvcnQpOwogICAgfQogIH07CiAgY29uc3QgdGhyb3dUcmFuc2ZlckhhbmRsZXIgPSB7CiAgICBjYW5IYW5kbGU6ICh2YWx1ZSkgPT4gaXNPYmplY3QodmFsdWUpICYmIHRocm93TWFya2VyIGluIHZhbHVlLAogICAgc2VyaWFsaXplKHsgdmFsdWUgfSkgewogICAgICBsZXQgc2VyaWFsaXplZDsKICAgICAgaWYgKHZhbHVlIGluc3RhbmNlb2YgRXJyb3IpIHsKICAgICAgICBzZXJpYWxpemVkID0gewogICAgICAgICAgaXNFcnJvcjogdHJ1ZSwKICAgICAgICAgIHZhbHVlOiB7CiAgICAgICAgICAgIG1lc3NhZ2U6IHZhbHVlLm1lc3NhZ2UsCiAgICAgICAgICAgIG5hbWU6IHZhbHVlLm5hbWUsCiAgICAgICAgICAgIHN0YWNrOiB2YWx1ZS5zdGFjawogICAgICAgICAgfQogICAgICAgIH07CiAgICAgIH0gZWxzZSB7CiAgICAgICAgc2VyaWFsaXplZCA9IHsgaXNFcnJvcjogZmFsc2UsIHZhbHVlIH07CiAgICAgIH0KICAgICAgcmV0dXJuIFtzZXJpYWxpemVkLCBbXV07CiAgICB9LAogICAgZGVzZXJpYWxpemUoc2VyaWFsaXplZCkgewogICAgICBpZiAoc2VyaWFsaXplZC5pc0Vycm9yKSB7CiAgICAgICAgdGhyb3cgT2JqZWN0LmFzc2lnbihuZXcgRXJyb3Ioc2VyaWFsaXplZC52YWx1ZS5tZXNzYWdlKSwgc2VyaWFsaXplZC52YWx1ZSk7CiAgICAgIH0KICAgICAgdGhyb3cgc2VyaWFsaXplZC52YWx1ZTsKICAgIH0KICB9OwogIGNvbnN0IHRyYW5zZmVySGFuZGxlcnMgPSAvKiBAX19QVVJFX18gKi8gbmV3IE1hcChbCiAgICBbInByb3h5IiwgcHJveHlUcmFuc2ZlckhhbmRsZXJdLAogICAgWyJ0aHJvdyIsIHRocm93VHJhbnNmZXJIYW5kbGVyXQogIF0pOwogIGZ1bmN0aW9uIGlzQWxsb3dlZE9yaWdpbihhbGxvd2VkT3JpZ2lucywgb3JpZ2luKSB7CiAgICBmb3IgKGNvbnN0IGFsbG93ZWRPcmlnaW4gb2YgYWxsb3dlZE9yaWdpbnMpIHsKICAgICAgaWYgKG9yaWdpbiA9PT0gYWxsb3dlZE9yaWdpbiB8fCBhbGxvd2VkT3JpZ2luID09PSAiKiIpIHsKICAgICAgICByZXR1cm4gdHJ1ZTsKICAgICAgfQogICAgICBpZiAoYWxsb3dlZE9yaWdpbiBpbnN0YW5jZW9mIFJlZ0V4cCAmJiBhbGxvd2VkT3JpZ2luLnRlc3Qob3JpZ2luKSkgewogICAgICAgIHJldHVybiB0cnVlOwogICAgICB9CiAgICB9CiAgICByZXR1cm4gZmFsc2U7CiAgfQogIGZ1bmN0aW9uIGV4cG9zZShvYmosIGVwID0gZ2xvYmFsVGhpcywgYWxsb3dlZE9yaWdpbnMgPSBbIioiXSkgewogICAgZXAuYWRkRXZlbnRMaXN0ZW5lcigibWVzc2FnZSIsIGZ1bmN0aW9uIGNhbGxiYWNrKGV2KSB7CiAgICAgIGlmICghZXYgfHwgIWV2LmRhdGEpIHsKICAgICAgICByZXR1cm47CiAgICAgIH0KICAgICAgaWYgKCFpc0FsbG93ZWRPcmlnaW4oYWxsb3dlZE9yaWdpbnMsIGV2Lm9yaWdpbikpIHsKICAgICAgICBjb25zb2xlLndhcm4oYEludmFsaWQgb3JpZ2luICcke2V2Lm9yaWdpbn0nIGZvciBjb21saW5rIHByb3h5YCk7CiAgICAgICAgcmV0dXJuOwogICAgICB9CiAgICAgIGNvbnN0IHsgaWQsIHR5cGUsIHBhdGggfSA9IE9iamVjdC5hc3NpZ24oeyBwYXRoOiBbXSB9LCBldi5kYXRhKTsKICAgICAgY29uc3QgYXJndW1lbnRMaXN0ID0gKGV2LmRhdGEuYXJndW1lbnRMaXN0IHx8IFtdKS5tYXAoZnJvbVdpcmVWYWx1ZSk7CiAgICAgIGxldCByZXR1cm5WYWx1ZTsKICAgICAgdHJ5IHsKICAgICAgICBjb25zdCBwYXJlbnQgPSBwYXRoLnNsaWNlKDAsIC0xKS5yZWR1Y2UoKG9iajIsIHByb3ApID0+IG9iajJbcHJvcF0sIG9iaik7CiAgICAgICAgY29uc3QgcmF3VmFsdWUgPSBwYXRoLnJlZHVjZSgob2JqMiwgcHJvcCkgPT4gb2JqMltwcm9wXSwgb2JqKTsKICAgICAgICBzd2l0Y2ggKHR5cGUpIHsKICAgICAgICAgIGNhc2UgIkdFVCI6CiAgICAgICAgICAgIHsKICAgICAgICAgICAgICByZXR1cm5WYWx1ZSA9IHJhd1ZhbHVlOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgY2FzZSAiU0VUIjoKICAgICAgICAgICAgewogICAgICAgICAgICAgIHBhcmVudFtwYXRoLnNsaWNlKC0xKVswXV0gPSBmcm9tV2lyZVZhbHVlKGV2LmRhdGEudmFsdWUpOwogICAgICAgICAgICAgIHJldHVyblZhbHVlID0gdHJ1ZTsKICAgICAgICAgICAgfQogICAgICAgICAgICBicmVhazsKICAgICAgICAgIGNhc2UgIkFQUExZIjoKICAgICAgICAgICAgewogICAgICAgICAgICAgIHJldHVyblZhbHVlID0gcmF3VmFsdWUuYXBwbHkocGFyZW50LCBhcmd1bWVudExpc3QpOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgY2FzZSAiQ09OU1RSVUNUIjoKICAgICAgICAgICAgewogICAgICAgICAgICAgIGNvbnN0IHZhbHVlID0gbmV3IHJhd1ZhbHVlKC4uLmFyZ3VtZW50TGlzdCk7CiAgICAgICAgICAgICAgcmV0dXJuVmFsdWUgPSBwcm94eSh2YWx1ZSk7CiAgICAgICAgICAgIH0KICAgICAgICAgICAgYnJlYWs7CiAgICAgICAgICBjYXNlICJFTkRQT0lOVCI6CiAgICAgICAgICAgIHsKICAgICAgICAgICAgICBjb25zdCB7IHBvcnQxLCBwb3J0MiB9ID0gbmV3IE1lc3NhZ2VDaGFubmVsKCk7CiAgICAgICAgICAgICAgZXhwb3NlKG9iaiwgcG9ydDIpOwogICAgICAgICAgICAgIHJldHVyblZhbHVlID0gdHJhbnNmZXIocG9ydDEsIFtwb3J0MV0pOwogICAgICAgICAgICB9CiAgICAgICAgICAgIGJyZWFrOwogICAgICAgICAgY2FzZSAiUkVMRUFTRSI6CiAgICAgICAgICAgIHsKICAgICAgICAgICAgICByZXR1cm5WYWx1ZSA9IHZvaWQgMDsKICAgICAgICAgICAgfQogICAgICAgICAgICBicmVhazsKICAgICAgICAgIGRlZmF1bHQ6CiAgICAgICAgICAgIHJldHVybjsKICAgICAgICB9CiAgICAgIH0gY2F0Y2ggKHZhbHVlKSB7CiAgICAgICAgcmV0dXJuVmFsdWUgPSB7IHZhbHVlLCBbdGhyb3dNYXJrZXJdOiAwIH07CiAgICAgIH0KICAgICAgUHJvbWlzZS5yZXNvbHZlKHJldHVyblZhbHVlKS5jYXRjaCgodmFsdWUpID0+IHsKICAgICAgICByZXR1cm4geyB2YWx1ZSwgW3Rocm93TWFya2VyXTogMCB9OwogICAgICB9KS50aGVuKChyZXR1cm5WYWx1ZTIpID0+IHsKICAgICAgICBjb25zdCBbd2lyZVZhbHVlLCB0cmFuc2ZlcmFibGVzXSA9IHRvV2lyZVZhbHVlKHJldHVyblZhbHVlMik7CiAgICAgICAgZXAucG9zdE1lc3NhZ2UoT2JqZWN0LmFzc2lnbihPYmplY3QuYXNzaWduKHt9LCB3aXJlVmFsdWUpLCB7IGlkIH0pLCB0cmFuc2ZlcmFibGVzKTsKICAgICAgICBpZiAodHlwZSA9PT0gIlJFTEVBU0UiKSB7CiAgICAgICAgICBlcC5yZW1vdmVFdmVudExpc3RlbmVyKCJtZXNzYWdlIiwgY2FsbGJhY2spOwogICAgICAgICAgY2xvc2VFbmRQb2ludChlcCk7CiAgICAgICAgICBpZiAoZmluYWxpemVyIGluIG9iaiAmJiB0eXBlb2Ygb2JqW2ZpbmFsaXplcl0gPT09ICJmdW5jdGlvbiIpIHsKICAgICAgICAgICAgb2JqW2ZpbmFsaXplcl0oKTsKICAgICAgICAgIH0KICAgICAgICB9CiAgICAgIH0pLmNhdGNoKChlcnJvcikgPT4gewogICAgICAgIGNvbnN0IFt3aXJlVmFsdWUsIHRyYW5zZmVyYWJsZXNdID0gdG9XaXJlVmFsdWUoewogICAgICAgICAgdmFsdWU6IG5ldyBUeXBlRXJyb3IoIlVuc2VyaWFsaXphYmxlIHJldHVybiB2YWx1ZSIpLAogICAgICAgICAgW3Rocm93TWFya2VyXTogMAogICAgICAgIH0pOwogICAgICAgIGVwLnBvc3RNZXNzYWdlKE9iamVjdC5hc3NpZ24oT2JqZWN0LmFzc2lnbih7fSwgd2lyZVZhbHVlKSwgeyBpZCB9KSwgdHJhbnNmZXJhYmxlcyk7CiAgICAgIH0pOwogICAgfSk7CiAgICBpZiAoZXAuc3RhcnQpIHsKICAgICAgZXAuc3RhcnQoKTsKICAgIH0KICB9CiAgZnVuY3Rpb24gaXNNZXNzYWdlUG9ydChlbmRwb2ludCkgewogICAgcmV0dXJuIGVuZHBvaW50LmNvbnN0cnVjdG9yLm5hbWUgPT09ICJNZXNzYWdlUG9ydCI7CiAgfQogIGZ1bmN0aW9uIGNsb3NlRW5kUG9pbnQoZW5kcG9pbnQpIHsKICAgIGlmIChpc01lc3NhZ2VQb3J0KGVuZHBvaW50KSkKICAgICAgZW5kcG9pbnQuY2xvc2UoKTsKICB9CiAgZnVuY3Rpb24gd3JhcChlcCwgdGFyZ2V0KSB7CiAgICByZXR1cm4gY3JlYXRlUHJveHkoZXAsIFtdLCB0YXJnZXQpOwogIH0KICBmdW5jdGlvbiB0aHJvd0lmUHJveHlSZWxlYXNlZChpc1JlbGVhc2VkKSB7CiAgICBpZiAoaXNSZWxlYXNlZCkgewogICAgICB0aHJvdyBuZXcgRXJyb3IoIlByb3h5IGhhcyBiZWVuIHJlbGVhc2VkIGFuZCBpcyBub3QgdXNlYWJsZSIpOwogICAgfQogIH0KICBmdW5jdGlvbiByZWxlYXNlRW5kcG9pbnQoZXApIHsKICAgIHJldHVybiByZXF1ZXN0UmVzcG9uc2VNZXNzYWdlKGVwLCB7CiAgICAgIHR5cGU6ICJSRUxFQVNFIgogICAgfSkudGhlbigoKSA9PiB7CiAgICAgIGNsb3NlRW5kUG9pbnQoZXApOwogICAgfSk7CiAgfQogIGNvbnN0IHByb3h5Q291bnRlciA9IC8qIEBfX1BVUkVfXyAqLyBuZXcgV2Vha01hcCgpOwogIGNvbnN0IHByb3h5RmluYWxpemVycyA9ICJGaW5hbGl6YXRpb25SZWdpc3RyeSIgaW4gZ2xvYmFsVGhpcyAmJiBuZXcgRmluYWxpemF0aW9uUmVnaXN0cnkoKGVwKSA9PiB7CiAgICBjb25zdCBuZXdDb3VudCA9IChwcm94eUNvdW50ZXIuZ2V0KGVwKSB8fCAwKSAtIDE7CiAgICBwcm94eUNvdW50ZXIuc2V0KGVwLCBuZXdDb3VudCk7CiAgICBpZiAobmV3Q291bnQgPT09IDApIHsKICAgICAgcmVsZWFzZUVuZHBvaW50KGVwKTsKICAgIH0KICB9KTsKICBmdW5jdGlvbiByZWdpc3RlclByb3h5KHByb3h5MiwgZXApIHsKICAgIGNvbnN0IG5ld0NvdW50ID0gKHByb3h5Q291bnRlci5nZXQoZXApIHx8IDApICsgMTsKICAgIHByb3h5Q291bnRlci5zZXQoZXAsIG5ld0NvdW50KTsKICAgIGlmIChwcm94eUZpbmFsaXplcnMpIHsKICAgICAgcHJveHlGaW5hbGl6ZXJzLnJlZ2lzdGVyKHByb3h5MiwgZXAsIHByb3h5Mik7CiAgICB9CiAgfQogIGZ1bmN0aW9uIHVucmVnaXN0ZXJQcm94eShwcm94eTIpIHsKICAgIGlmIChwcm94eUZpbmFsaXplcnMpIHsKICAgICAgcHJveHlGaW5hbGl6ZXJzLnVucmVnaXN0ZXIocHJveHkyKTsKICAgIH0KICB9CiAgZnVuY3Rpb24gY3JlYXRlUHJveHkoZXAsIHBhdGggPSBbXSwgdGFyZ2V0ID0gZnVuY3Rpb24oKSB7CiAgfSkgewogICAgbGV0IGlzUHJveHlSZWxlYXNlZCA9IGZhbHNlOwogICAgY29uc3QgcHJveHkyID0gbmV3IFByb3h5KHRhcmdldCwgewogICAgICBnZXQoX3RhcmdldCwgcHJvcCkgewogICAgICAgIHRocm93SWZQcm94eVJlbGVhc2VkKGlzUHJveHlSZWxlYXNlZCk7CiAgICAgICAgaWYgKHByb3AgPT09IHJlbGVhc2VQcm94eSkgewogICAgICAgICAgcmV0dXJuICgpID0+IHsKICAgICAgICAgICAgdW5yZWdpc3RlclByb3h5KHByb3h5Mik7CiAgICAgICAgICAgIHJlbGVhc2VFbmRwb2ludChlcCk7CiAgICAgICAgICAgIGlzUHJveHlSZWxlYXNlZCA9IHRydWU7CiAgICAgICAgICB9OwogICAgICAgIH0KICAgICAgICBpZiAocHJvcCA9PT0gInRoZW4iKSB7CiAgICAgICAgICBpZiAocGF0aC5sZW5ndGggPT09IDApIHsKICAgICAgICAgICAgcmV0dXJuIHsgdGhlbjogKCkgPT4gcHJveHkyIH07CiAgICAgICAgICB9CiAgICAgICAgICBjb25zdCByID0gcmVxdWVzdFJlc3BvbnNlTWVzc2FnZShlcCwgewogICAgICAgICAgICB0eXBlOiAiR0VUIiwKICAgICAgICAgICAgcGF0aDogcGF0aC5tYXAoKHApID0+IHAudG9TdHJpbmcoKSkKICAgICAgICAgIH0pLnRoZW4oZnJvbVdpcmVWYWx1ZSk7CiAgICAgICAgICByZXR1cm4gci50aGVuLmJpbmQocik7CiAgICAgICAgfQogICAgICAgIHJldHVybiBjcmVhdGVQcm94eShlcCwgWy4uLnBhdGgsIHByb3BdKTsKICAgICAgfSwKICAgICAgc2V0KF90YXJnZXQsIHByb3AsIHJhd1ZhbHVlKSB7CiAgICAgICAgdGhyb3dJZlByb3h5UmVsZWFzZWQoaXNQcm94eVJlbGVhc2VkKTsKICAgICAgICBjb25zdCBbdmFsdWUsIHRyYW5zZmVyYWJsZXNdID0gdG9XaXJlVmFsdWUocmF3VmFsdWUpOwogICAgICAgIHJldHVybiByZXF1ZXN0UmVzcG9uc2VNZXNzYWdlKGVwLCB7CiAgICAgICAgICB0eXBlOiAiU0VUIiwKICAgICAgICAgIHBhdGg6IFsuLi5wYXRoLCBwcm9wXS5tYXAoKHApID0+IHAudG9TdHJpbmcoKSksCiAgICAgICAgICB2YWx1ZQogICAgICAgIH0sIHRyYW5zZmVyYWJsZXMpLnRoZW4oZnJvbVdpcmVWYWx1ZSk7CiAgICAgIH0sCiAgICAgIGFwcGx5KF90YXJnZXQsIF90aGlzQXJnLCByYXdBcmd1bWVudExpc3QpIHsKICAgICAgICB0aHJvd0lmUHJveHlSZWxlYXNlZChpc1Byb3h5UmVsZWFzZWQpOwogICAgICAgIGNvbnN0IGxhc3QgPSBwYXRoW3BhdGgubGVuZ3RoIC0gMV07CiAgICAgICAgaWYgKGxhc3QgPT09IGNyZWF0ZUVuZHBvaW50KSB7CiAgICAgICAgICByZXR1cm4gcmVxdWVzdFJlc3BvbnNlTWVzc2FnZShlcCwgewogICAgICAgICAgICB0eXBlOiAiRU5EUE9JTlQiCiAgICAgICAgICB9KS50aGVuKGZyb21XaXJlVmFsdWUpOwogICAgICAgIH0KICAgICAgICBpZiAobGFzdCA9PT0gImJpbmQiKSB7CiAgICAgICAgICByZXR1cm4gY3JlYXRlUHJveHkoZXAsIHBhdGguc2xpY2UoMCwgLTEpKTsKICAgICAgICB9CiAgICAgICAgY29uc3QgW2FyZ3VtZW50TGlzdCwgdHJhbnNmZXJhYmxlc10gPSBwcm9jZXNzQXJndW1lbnRzKHJhd0FyZ3VtZW50TGlzdCk7CiAgICAgICAgcmV0dXJuIHJlcXVlc3RSZXNwb25zZU1lc3NhZ2UoZXAsIHsKICAgICAgICAgIHR5cGU6ICJBUFBMWSIsCiAgICAgICAgICBwYXRoOiBwYXRoLm1hcCgocCkgPT4gcC50b1N0cmluZygpKSwKICAgICAgICAgIGFyZ3VtZW50TGlzdAogICAgICAgIH0sIHRyYW5zZmVyYWJsZXMpLnRoZW4oZnJvbVdpcmVWYWx1ZSk7CiAgICAgIH0sCiAgICAgIGNvbnN0cnVjdChfdGFyZ2V0LCByYXdBcmd1bWVudExpc3QpIHsKICAgICAgICB0aHJvd0lmUHJveHlSZWxlYXNlZChpc1Byb3h5UmVsZWFzZWQpOwogICAgICAgIGNvbnN0IFthcmd1bWVudExpc3QsIHRyYW5zZmVyYWJsZXNdID0gcHJvY2Vzc0FyZ3VtZW50cyhyYXdBcmd1bWVudExpc3QpOwogICAgICAgIHJldHVybiByZXF1ZXN0UmVzcG9uc2VNZXNzYWdlKGVwLCB7CiAgICAgICAgICB0eXBlOiAiQ09OU1RSVUNUIiwKICAgICAgICAgIHBhdGg6IHBhdGgubWFwKChwKSA9PiBwLnRvU3RyaW5nKCkpLAogICAgICAgICAgYXJndW1lbnRMaXN0CiAgICAgICAgfSwgdHJhbnNmZXJhYmxlcykudGhlbihmcm9tV2lyZVZhbHVlKTsKICAgICAgfQogICAgfSk7CiAgICByZWdpc3RlclByb3h5KHByb3h5MiwgZXApOwogICAgcmV0dXJuIHByb3h5MjsKICB9CiAgZnVuY3Rpb24gbXlGbGF0KGFycikgewogICAgcmV0dXJuIEFycmF5LnByb3RvdHlwZS5jb25jYXQuYXBwbHkoW10sIGFycik7CiAgfQogIGZ1bmN0aW9uIHByb2Nlc3NBcmd1bWVudHMoYXJndW1lbnRMaXN0KSB7CiAgICBjb25zdCBwcm9jZXNzZWQgPSBhcmd1bWVudExpc3QubWFwKHRvV2lyZVZhbHVlKTsKICAgIHJldHVybiBbcHJvY2Vzc2VkLm1hcCgodikgPT4gdlswXSksIG15RmxhdChwcm9jZXNzZWQubWFwKCh2KSA9PiB2WzFdKSldOwogIH0KICBjb25zdCB0cmFuc2ZlckNhY2hlID0gLyogQF9fUFVSRV9fICovIG5ldyBXZWFrTWFwKCk7CiAgZnVuY3Rpb24gdHJhbnNmZXIob2JqLCB0cmFuc2ZlcnMpIHsKICAgIHRyYW5zZmVyQ2FjaGUuc2V0KG9iaiwgdHJhbnNmZXJzKTsKICAgIHJldHVybiBvYmo7CiAgfQogIGZ1bmN0aW9uIHByb3h5KG9iaikgewogICAgcmV0dXJuIE9iamVjdC5hc3NpZ24ob2JqLCB7IFtwcm94eU1hcmtlcl06IHRydWUgfSk7CiAgfQogIGZ1bmN0aW9uIHRvV2lyZVZhbHVlKHZhbHVlKSB7CiAgICBmb3IgKGNvbnN0IFtuYW1lLCBoYW5kbGVyXSBvZiB0cmFuc2ZlckhhbmRsZXJzKSB7CiAgICAgIGlmIChoYW5kbGVyLmNhbkhhbmRsZSh2YWx1ZSkpIHsKICAgICAgICBjb25zdCBbc2VyaWFsaXplZFZhbHVlLCB0cmFuc2ZlcmFibGVzXSA9IGhhbmRsZXIuc2VyaWFsaXplKHZhbHVlKTsKICAgICAgICByZXR1cm4gWwogICAgICAgICAgewogICAgICAgICAgICB0eXBlOiAiSEFORExFUiIsCiAgICAgICAgICAgIG5hbWUsCiAgICAgICAgICAgIHZhbHVlOiBzZXJpYWxpemVkVmFsdWUKICAgICAgICAgIH0sCiAgICAgICAgICB0cmFuc2ZlcmFibGVzCiAgICAgICAgXTsKICAgICAgfQogICAgfQogICAgcmV0dXJuIFsKICAgICAgewogICAgICAgIHR5cGU6ICJSQVciLAogICAgICAgIHZhbHVlCiAgICAgIH0sCiAgICAgIHRyYW5zZmVyQ2FjaGUuZ2V0KHZhbHVlKSB8fCBbXQogICAgXTsKICB9CiAgZnVuY3Rpb24gZnJvbVdpcmVWYWx1ZSh2YWx1ZSkgewogICAgc3dpdGNoICh2YWx1ZS50eXBlKSB7CiAgICAgIGNhc2UgIkhBTkRMRVIiOgogICAgICAgIHJldHVybiB0cmFuc2ZlckhhbmRsZXJzLmdldCh2YWx1ZS5uYW1lKS5kZXNlcmlhbGl6ZSh2YWx1ZS52YWx1ZSk7CiAgICAgIGNhc2UgIlJBVyI6CiAgICAgICAgcmV0dXJuIHZhbHVlLnZhbHVlOwogICAgfQogIH0KICBmdW5jdGlvbiByZXF1ZXN0UmVzcG9uc2VNZXNzYWdlKGVwLCBtc2csIHRyYW5zZmVycykgewogICAgcmV0dXJuIG5ldyBQcm9taXNlKChyZXNvbHZlKSA9PiB7CiAgICAgIGNvbnN0IGlkID0gZ2VuZXJhdGVVVUlEKCk7CiAgICAgIGVwLmFkZEV2ZW50TGlzdGVuZXIoIm1lc3NhZ2UiLCBmdW5jdGlvbiBsKGV2KSB7CiAgICAgICAgaWYgKCFldi5kYXRhIHx8ICFldi5kYXRhLmlkIHx8IGV2LmRhdGEuaWQgIT09IGlkKSB7CiAgICAgICAgICByZXR1cm47CiAgICAgICAgfQogICAgICAgIGVwLnJlbW92ZUV2ZW50TGlzdGVuZXIoIm1lc3NhZ2UiLCBsKTsKICAgICAgICByZXNvbHZlKGV2LmRhdGEpOwogICAgICB9KTsKICAgICAgaWYgKGVwLnN0YXJ0KSB7CiAgICAgICAgZXAuc3RhcnQoKTsKICAgICAgfQogICAgICBlcC5wb3N0TWVzc2FnZShPYmplY3QuYXNzaWduKHsgaWQgfSwgbXNnKSwgdHJhbnNmZXJzKTsKICAgIH0pOwogIH0KICBmdW5jdGlvbiBnZW5lcmF0ZVVVSUQoKSB7CiAgICByZXR1cm4gbmV3IEFycmF5KDQpLmZpbGwoMCkubWFwKCgpID0+IE1hdGguZmxvb3IoTWF0aC5yYW5kb20oKSAqIE51bWJlci5NQVhfU0FGRV9JTlRFR0VSKS50b1N0cmluZygxNikpLmpvaW4oIi0iKTsKICB9CiAgY2xhc3MgRGlzcG9zYWJsZUpTWmlwIHsKICAgIGNvbnN0cnVjdG9yKCkgewogICAgICBfX3B1YmxpY0ZpZWxkKHRoaXMsICJ6aXAiLCBuZXcgSlNaaXAoKSk7CiAgICB9CiAgICBmaWxlKHsgbmFtZSwgZGF0YSB9KSB7CiAgICAgIHRoaXMuemlwLmZpbGUobmFtZSwgZGF0YSk7CiAgICB9CiAgICBmaWxlcyhmaWxlcykgewogICAgICBmaWxlcy5mb3JFYWNoKCh7IG5hbWUsIGRhdGEgfSkgPT4gewogICAgICAgIHRoaXMuemlwLmZpbGUobmFtZSwgZGF0YSk7CiAgICAgIH0pOwogICAgfQogICAgLy8gZXNsaW50LWRpc2FibGUtbmV4dC1saW5lIEB0eXBlc2NyaXB0LWVzbGludC9leHBsaWNpdC1mdW5jdGlvbi1yZXR1cm4tdHlwZQogICAgYXN5bmMgdW56aXBGaWxlKHsgZGF0YSwgcGF0aCwgdHlwZSB9KSB7CiAgICAgIHZhciBfYTsKICAgICAgY29uc3QgemlwID0gYXdhaXQgSlNaaXAubG9hZEFzeW5jKGRhdGEpOwogICAgICByZXR1cm4gKF9hID0gemlwLmZpbGUocGF0aCkpID09IG51bGwgPyB2b2lkIDAgOiBfYS5hc3luYyh0eXBlKTsKICAgIH0KICAgIGFzeW5jIGdlbmVyYXRlQXN5bmMob3B0aW9ucywgb25VcGRhdGUpIHsKICAgICAgY29uc3QgZGF0YSA9IGF3YWl0IHRoaXMuemlwLmdlbmVyYXRlQXN5bmMoeyAuLi5vcHRpb25zLCB0eXBlOiAidWludDhhcnJheSIgfSwgb25VcGRhdGUpOwogICAgICByZXR1cm4gdHJhbnNmZXIoZGF0YSwgW2RhdGEuYnVmZmVyXSk7CiAgICB9CiAgICBnZW5lcmF0ZVN0cmVhbShvcHRpb25zLCBvblVwZGF0ZSwgb25FbmQpIHsKICAgICAgY29uc3Qgc3RyZWFtID0gdGhpcy56aXAuZ2VuZXJhdGVJbnRlcm5hbFN0cmVhbSh7IC4uLm9wdGlvbnMsIHR5cGU6ICJ1aW50OGFycmF5IiB9KTsKICAgICAgY29uc3QgemlwU3RyZWFtID0gbmV3IFJlYWRhYmxlU3RyZWFtKHsKICAgICAgICBzdGFydDogKGNvbnRyb2xsZXIpID0+IHsKICAgICAgICAgIHN0cmVhbS5vbigiZXJyb3IiLCAoZSkgPT4gewogICAgICAgICAgICBjb250cm9sbGVyLmVycm9yKGUpOwogICAgICAgICAgICBvbkVuZCA9PSBudWxsID8gdm9pZCAwIDogb25FbmQoKTsKICAgICAgICAgIH0pOwogICAgICAgICAgc3RyZWFtLm9uKCJlbmQiLCAoKSA9PiB7CiAgICAgICAgICAgIHNldFRpbWVvdXQoKCkgPT4gewogICAgICAgICAgICAgIGNvbnRyb2xsZXIuY2xvc2UoKTsKICAgICAgICAgICAgICBvbkVuZCA9PSBudWxsID8gdm9pZCAwIDogb25FbmQoKTsKICAgICAgICAgICAgfSk7CiAgICAgICAgICB9KTsKICAgICAgICAgIHN0cmVhbS5vbigiZGF0YSIsIChkYXRhLCBtZXRhRGF0YSkgPT4gewogICAgICAgICAgICBjb250cm9sbGVyLmVucXVldWUoZGF0YSk7CiAgICAgICAgICAgIG9uVXBkYXRlID09IG51bGwgPyB2b2lkIDAgOiBvblVwZGF0ZShtZXRhRGF0YSk7CiAgICAgICAgICB9KTsKICAgICAgICAgIHN0cmVhbS5yZXN1bWUoKTsKICAgICAgICB9CiAgICAgIH0pOwogICAgICByZXR1cm4gdHJhbnNmZXIoeyB6aXBTdHJlYW0gfSwgW3ppcFN0cmVhbV0pOwogICAgfQogIH0KICBleHBvc2UoRGlzcG9zYWJsZUpTWmlwKTsKfSkoKTsK";
const blob = typeof window !== "undefined" && window.Blob && new Blob([atob(encodedJs)], { type: "text/javascript;charset=utf-8" });
function WorkerWrapper() {
let objURL;
try {
objURL = blob && (window.URL || window.webkitURL).createObjectURL(blob);
if (!objURL)
throw "";
return new Worker(objURL);
} catch (e) {
return new Worker("data:application/javascript;base64," + encodedJs);
} finally {
objURL && (window.URL || window.webkitURL).revokeObjectURL(objURL);
}
}
const getTransferableData = (files) => files.map(({ data }) => data).filter((data) => typeof data !== "string");
class JSZipWorkerPool {
constructor() {
__publicField(this, "pool", []);
__publicField(this, "waitingQueue", []);
__publicField(this, "unzipFile", async (params) => {
const worker = await this.acquireWorker();
const zip = await new worker.JSZip();
const clean = () => {
zip[releaseProxy]();
this.releaseWorker(worker);
};
try {
return await zip.unzipFile(transfer(params, [params.data]));
} catch (error) {
clean();
throw error;
}
});
for (let id = 0; id < WORKER_THREAD_NUM; id++) {
this.pool.push({
id,
idle: true
});
}
}
async createWorker() {
const worker = new WorkerWrapper();
return wrap(worker);
}
waitIdleWorker() {
return new Promise((resolve2) => {
this.waitingQueue.push(resolve2);
});
}
async acquireWorker() {
let worker = this.pool.find(({ idle }) => idle);
if (!worker)
worker = await this.waitIdleWorker();
if (!worker.JSZip)
worker.JSZip = await this.createWorker();
worker.idle = false;
return worker;
}
releaseWorker(worker) {
worker.idle = true;
if (!this.waitingQueue.length)
return;
const emit2 = removeAt(this.waitingQueue, 0);
emit2(worker);
}
async generateAsync(files, options, onUpdate) {
const worker = await this.acquireWorker();
const zip = await new worker.JSZip();
try {
await zip.files(transfer(files, getTransferableData(files)));
return await zip.generateAsync(
options,
proxy((metaData) => {
if (metaData.currentFile)
onUpdate == null ? void 0 : onUpdate({ workerId: worker.id, ...metaData });
})
);
} finally {
zip[releaseProxy]();
this.releaseWorker(worker);
}
}
async generateStream(files, options, onUpdate) {
const worker = await this.acquireWorker();
const zip = await new worker.JSZip();
try {
await zip.files(transfer(files, getTransferableData(files)));
const { zipStream } = await zip.generateStream(
options,
proxy((metaData) => {
if (metaData.currentFile)
onUpdate == null ? void 0 : onUpdate({ workerId: worker.id, ...metaData });
})
);
return zipStream;
} finally {
zip[releaseProxy]();
this.releaseWorker(worker);
}
}
}
const jszipPool = new JSZipWorkerPool();
class JSZip {
constructor() {
__publicField(this, "files", []);
}
file(name, data) {
this.files.push({ name, data });
}
generateAsync(options, onUpdate) {
const { files } = this;
this.files = [];
return jszipPool.generateAsync(files, options, onUpdate);
}
generateStream(options, onUpdate) {
const { files } = this;
this.files = [];
return jszipPool.generateStream(files, options, onUpdate);
}
}
__publicField(JSZip, "unzipFile", (params) => jszipPool.unzipFile(params));
extendPrototype(localforage);
class DownloadHistory {
constructor(name) {
__publicField(this, "store");
__publicField(this, "ready");
this.name = name;
this.store = localforage.createInstance({
name: "nhentai_helper",
storeName: name
});
this.ready = this.store.ready().then(() => true).catch((e) => {
logger.error(e);
return false;
});
}
async add(key) {
if (!await this.ready)
return;
try {
await this.store.setItem(key, true);
logger.log(`mark "${key}" as downloaded`);
} catch (e) {
logger.error(e);
}
}
async del(key) {
if (!await this.ready)
return;
try {
await this.store.removeItem(key);
logger.log(`unmark "${key}" as downloaded`);
} catch (e) {
logger.error(e);
}
}
async has(key) {
if (!await this.ready)
return false;
try {
return await this.store.getItem(key) === true;
} catch (e) {
logger.error(e);
}
return false;
}
async size() {
if (!await this.ready)
return NaN;
return this.store.length();
}
async import(keys2) {
if (!await this.ready)
throw new Error(`store ${this.name} cannot ready`);
try {
await this.store.setItems(keys2.map((gid2) => ({ key: gid2, value: true })));
} catch (e) {
logger.error(e);
}
}
async export() {
if (!await this.ready)
throw new Error(`store ${this.name} cannot ready`);
return this.store.keys();
}
async clear() {
if (!await this.ready)
return;
await this.store.clear();
}
}
const gidHistory = new DownloadHistory("dl_history_gid");
const enTitleHistory = new DownloadHistory("dl_history_en");
const jpTitleHistory = new DownloadHistory("dl_history");
const prettyTitleHistory = new DownloadHistory("dl_history_pretty");
const normalizeTitle = (title) => title.replace(/\s/g, "");
const getTitleMd5 = (title) => md5(normalizeTitle(title));
const markAsDownloaded = (gid2, { english: english2, japanese: japanese2, pretty } = {}) => {
void gidHistory.add(String(gid2));
if (english2)
void enTitleHistory.add(getTitleMd5(english2));
if (japanese2)
void jpTitleHistory.add(getTitleMd5(japanese2));
if (pretty)
void prettyTitleHistory.add(getTitleMd5(pretty));
};
const unmarkAsDownloaded = (gid2, { english: english2, japanese: japanese2, pretty } = {}) => {
void gidHistory.del(String(gid2));
if (english2)
void enTitleHistory.del(getTitleMd5(english2));
if (japanese2)
void jpTitleHistory.del(getTitleMd5(japanese2));
if (pretty)
void prettyTitleHistory.del(getTitleMd5(pretty));
};
const isDownloadedByGid = (gid2) => gidHistory.has(String(gid2));
const isDownloadedByTitle = async ({
english: english2,
japanese: japanese2,
pretty
} = {}) => {
if (settings.judgeDownloadedByJapanese && japanese2) {
const md5v2 = getTitleMd5(japanese2);
if (await jpTitleHistory.has(md5v2))
return true;
const md5v1 = md5(japanese2);
if (await jpTitleHistory.has(md5v1)) {
void jpTitleHistory.add(md5v2);
void jpTitleHistory.del(md5v1);
return true;
}
}
if (settings.judgeDownloadedByEnglish && english2 && await enTitleHistory.has(getTitleMd5(english2))) {
return true;
}
if (settings.judgeDownloadedByPretty && pretty && await enTitleHistory.has(getTitleMd5(pretty))) {
return true;
}
return false;
};
const getDownloadNumber = () => gidHistory.size();
const EXPORT_HEADER_GID = "gid:";
const EXPORT_HEADER_TITLE_JP = "title:";
const EXPORT_HEADER_TITLE_EN = "title_en:";
const EXPORT_HEADER_TITLE_PRETTY = "title_pretty:";
const EXPORT_SEPARATOR = ",";
const EXPORT_TEXT_FILENAME = "history.txt";
const exportDownloadHistory = async () => {
try {
const gids = await gidHistory.export();
const jpTitles = await jpTitleHistory.export();
const enTitles = await enTitleHistory.export();
const prettyTitles = await prettyTitleHistory.export();
const text = `${EXPORT_HEADER_GID}${gids.join(EXPORT_SEPARATOR)}
${EXPORT_HEADER_TITLE_JP}${jpTitles.join(EXPORT_SEPARATOR)}
${EXPORT_HEADER_TITLE_EN}${enTitles.join(EXPORT_SEPARATOR)}
${EXPORT_HEADER_TITLE_PRETTY}${prettyTitles.join(EXPORT_SEPARATOR)}`;
const zip = new JSZip();
zip.file(EXPORT_TEXT_FILENAME, text);
const data = await zip.generateAsync({
compression: "DEFLATE",
compressionOptions: { level: 9 }
});
const timeStr = dateTimeFormatter.format(Date.now()).replace(/[^\d]/g, "");
const filename = `nhentai-helper-download-history-${timeStr}.zip`;
FileSaver_minExports.saveAs(new File([data], filename, { type: "application/zip" }));
logger.log("export download history", filename);
return true;
} catch (error) {
logger.error(error);
}
return false;
};
const importDownloadHistory = async (data) => {
try {
const str = await JSZip.unzipFile({ data, path: EXPORT_TEXT_FILENAME, type: "string" });
if (!str) {
logger.error("zip doesn't contain file", EXPORT_TEXT_FILENAME);
return false;
}
const lines = str.split("\n");
for (const line of lines) {
if (line.startsWith(EXPORT_HEADER_GID)) {
const gids = line.replace(EXPORT_HEADER_GID, "").split(EXPORT_SEPARATOR);
await gidHistory.import(gids);
} else if (line.startsWith(EXPORT_HEADER_TITLE_JP)) {
const titles = line.replace(EXPORT_HEADER_TITLE_JP, "").split(EXPORT_SEPARATOR);
await jpTitleHistory.import(titles);
} else if (line.startsWith(EXPORT_HEADER_TITLE_EN)) {
const titles = line.replace(EXPORT_HEADER_TITLE_EN, "").split(EXPORT_SEPARATOR);
await enTitleHistory.import(titles);
} else if (line.startsWith(EXPORT_HEADER_TITLE_PRETTY)) {
const titles = line.replace(EXPORT_HEADER_TITLE_PRETTY, "").split(EXPORT_SEPARATOR);
await prettyTitleHistory.import(titles);
}
}
return true;
} catch (error) {
logger.error(error);
}
return false;
};
const clearDownloadHistory = async () => {
try {
await gidHistory.clear();
await enTitleHistory.clear();
await jpTitleHistory.clear();
await prettyTitleHistory.clear();
return true;
} catch (error) {
logger.error(error);
}
return false;
};
const isSameTitleString = (title1, title2) => !!title1 && !!title2 && normalizeTitle(title1) === normalizeTitle(title2);
const isSameTitle = (title1, title2) => {
if (settings.judgeDownloadedByJapanese && isSameTitleString(title1.japanese, title2.japanese)) {
return true;
}
if (settings.judgeDownloadedByEnglish && isSameTitleString(title1.english, title2.english)) {
return true;
}
if (settings.judgeDownloadedByPretty && isSameTitleString(title1.pretty, title2.pretty)) {
return true;
}
return false;
};
const createElement = (tag, props, ...children) => {
if (typeof tag === "function")
return tag(props, ...children);
const element = document.createElement(tag);
Object.entries(props ?? {}).forEach(([name, value]) => {
if (name === "html")
element.innerHTML = value;
else if (name === "class")
element.classList.add(...String(value).split(" "));
else if (name === "style" && typeof value === "object") {
const styleString = Object.entries(value).map(([k, v]) => `${camelCase$1(k)}:${String(v)}`).join(";");
element.setAttribute("style", styleString);
} else if (name.startsWith("on")) {
element.addEventListener(kebabCase$1(name.replace("on", "")), value);
} else
element.setAttribute(name, String(value));
});
children.flat().forEach((child) => {
appendChild(element, child);
});
return element;
};
const appendChild = (parent, child) => {
if (!child)
return;
parent.appendChild(typeof child === "string" ? document.createTextNode(child) : child);
};
const Fragment = (props, ...children) => {
return children;
};
const jsx = { createElement, Fragment };
const readFile = (file) => new Promise((resolve2, reject) => {
const reader = new FileReader();
reader.onload = () => {
resolve2(reader.result);
};
reader.onabort = reject;
reader.onerror = reject;
reader.readAsArrayBuffer(file);
});
const pickFile = (accept) => new Promise((resolve2) => {
const input = /* @__PURE__ */ jsx.createElement(
"input",
{
type: "file",
accept,
onChange: () => {
var _a2;
resolve2((_a2 = input.files) == null ? void 0 : _a2[0]);
}
}
);
input.click();
});
const pickAndReadFile = async (accept) => {
const file = await pickFile(accept);
if (file)
return readFile(file);
};
const showMessage = (params) => ElMessage({ ...params, appendTo: _monkeyWindow.document.body });
const _hoisted_1$1 = { class: "nhentai-helper-setting-help-buttons no-sl" };
const _hoisted_2$1 = ["id"];
const _hoisted_3 = { id: "nhentai-helper-setting-dialog" };
const _hoisted_4 = {
class: "asterisk-example no-sl",
style: { "margin-bottom": "18px" }
};
const _hoisted_5 = { class: "inline-item" };
const _hoisted_6 = { class: "inline-item__name" };
const _hoisted_7 = { class: "inline-item" };
const _hoisted_8 = { class: "inline-item__name" };
const _hoisted_9 = { class: "no-sl" };
const _hoisted_10 = { class: "no-sl" };
const _sfc_main$1 = /* @__PURE__ */ defineComponent({
__name: "SettingsDialog",
setup(__props, { expose: expose2 }) {
startWatchSettings();
const threadNumMarks = {
1: "1",
4: "4",
8: "8",
16: "16",
32: {
label: "32",
style: { whiteSpace: "nowrap" }
}
};
const compressionLevelMarks = {
0: "0",
1: "1",
9: "9"
};
const { t: t2, n, locale } = useI18n();
const show = ref(false);
const downloadedNum = ref(NaN);
const filenameLengthNumber = computed({
get: () => typeof writeableSettings.filenameLength === "number" ? writeableSettings.filenameLength : 0,
set: (val) => {
writeableSettings.filenameLength = val;
}
});
const filenameLengthAuto = computed({
get: () => writeableSettings.filenameLength === "auto",
set: (val) => {
writeableSettings.filenameLength = val ? "auto" : 0;
}
});
const refreshDownloadNum = async () => {
downloadedNum.value = await getDownloadNumber();
};
const open2 = () => {
show.value = true;
refreshDownloadNum();
};
const openHelp = () => {
_monkeyWindow.open(
locale.value === "zh" ? "https://github.com/Tsuk1ko/nhentai-helper/blob/master/README-ZH.md#%E8%AE%BE%E7%BD%AE" : "https://github.com/Tsuk1ko/nhentai-helper/blob/master/README.md#settings",
"_blank"
);
};
const exporting = ref(false);
const importing = ref(false);
const clearing = ref(false);
const showMessageBySucceed = (succeed) => {
showMessage({
type: succeed ? "success" : "error",
message: succeed ? "Succeed" : "Failed, please check console for error message"
});
};
const exportHistory = async () => {
exporting.value = true;
const succeed = await exportDownloadHistory();
exporting.value = false;
showMessageBySucceed(succeed);
};
const importHistory = async () => {
const data = await pickAndReadFile("application/zip");
if (!data)
return;
importing.value = true;
const succeed = await importDownloadHistory(data);
importing.value = false;
refreshDownloadNum();
showMessageBySucceed(succeed);
};
const clearHistory = async () => {
clearing.value = true;
const succeed = await clearDownloadHistory();
clearing.value = false;
refreshDownloadNum();
showMessageBySucceed(succeed);
};
watch(
() => writeableSettings.language,
(val) => {
locale.value = val;
}
);
expose2({ open: open2 });
return (_ctx, _cache) => {
const _component_el_button = ElButton;
const _component_el_option = ElOption;
const _component_el_select = ElSelect;
const _component_el_form_item = ElFormItem;
const _component_el_slider = ElSlider;
const _component_el_switch = ElSwitch;
const _component_el_input = ElInput;
const _component_el_input_number = ElInputNumber;
const _component_el_checkbox = ElCheckbox;
const _component_el_divider = ElDivider;
const _component_el_form = ElForm;
const _component_el_popconfirm = ElPopconfirm;
const _component_el_dialog = ElDialog;
return openBlock(), createBlock(_component_el_dialog, {
modelValue: show.value,
"onUpdate:modelValue": _cache[23] || (_cache[23] = ($event) => show.value = $event),
center: true,
top: "50px"
}, {
header: withCtx(({ titleId, titleClass }) => [
createBaseVNode("div", _hoisted_1$1, [
createVNode(_component_el_button, {
size: "small",
onClick: openHelp
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.helpButton")), 1)
]),
_: 1
})
]),
createBaseVNode("span", {
id: titleId,
class: normalizeClass([titleClass, "no-sl"])
}, toDisplayString$1(unref(t2)("setting.title")), 11, _hoisted_2$1)
]),
default: withCtx(() => [
createBaseVNode("div", _hoisted_3, [
createBaseVNode("div", _hoisted_4, toDisplayString$1(unref(t2)("setting.asteriskTip")), 1),
createVNode(_component_el_form, {
"label-width": "auto",
"label-position": "left"
}, {
default: withCtx(() => [
createVNode(_component_el_form_item, { label: "Language" }, {
default: withCtx(() => [
createVNode(_component_el_select, {
modelValue: unref(writeableSettings).language,
"onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => unref(writeableSettings).language = $event)
}, {
default: withCtx(() => [
createVNode(_component_el_option, {
label: "English",
value: "en"
}),
createVNode(_component_el_option, {
label: "中文",
value: "zh"
})
]),
_: 1
}, 8, ["modelValue"])
]),
_: 1
}),
createVNode(_component_el_form_item, {
class: "m-b-32",
label: unref(t2)("setting.downloadThread")
}, {
default: withCtx(() => [
createVNode(_component_el_slider, {
modelValue: unref(writeableSettings).threadNum,
"onUpdate:modelValue": _cache[1] || (_cache[1] = ($event) => unref(writeableSettings).threadNum = $event),
min: 1,
max: 32,
marks: threadNumMarks
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
class: "refresh-required",
label: unref(t2)("setting.openOnNewTab")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).openOnNewTab,
"onUpdate:modelValue": _cache[2] || (_cache[2] = ($event) => unref(writeableSettings).openOnNewTab = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.compressionFilename")
}, {
default: withCtx(() => [
createVNode(_component_el_input, {
modelValue: unref(writeableSettings).compressionFilename,
"onUpdate:modelValue": _cache[3] || (_cache[3] = ($event) => unref(writeableSettings).compressionFilename = $event),
placeholder: unref(settingDefinitions).compressionFilename.default,
onBlur: _cache[4] || (_cache[4] = ($event) => {
if (!unref(writeableSettings).compressionFilename) {
unref(writeableSettings).compressionFilename = unref(settingDefinitions).compressionFilename.default;
}
})
}, null, 8, ["modelValue", "placeholder"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, { label: "└ {{artist}}" }, {
default: withCtx(() => [
createBaseVNode("div", _hoisted_5, [
createBaseVNode("span", _hoisted_6, toDisplayString$1(unref(t2)("setting.maxNumber")), 1),
createVNode(_component_el_input_number, {
modelValue: unref(writeableSettings).filenameMaxArtistsNumber,
"onUpdate:modelValue": _cache[5] || (_cache[5] = ($event) => unref(writeableSettings).filenameMaxArtistsNumber = $event),
size: "small",
min: 0,
"value-on-clear": unref(settingDefinitions).filenameMaxArtistsNumber.default,
"step-strictly": true,
style: { width: "90px" }
}, null, 8, ["modelValue", "value-on-clear"])
]),
createBaseVNode("div", _hoisted_7, [
createBaseVNode("span", _hoisted_8, toDisplayString$1(unref(t2)("setting.separator")), 1),
createVNode(_component_el_input, {
modelValue: unref(writeableSettings).filenameArtistsSeparator,
"onUpdate:modelValue": _cache[6] || (_cache[6] = ($event) => unref(writeableSettings).filenameArtistsSeparator = $event),
size: "small",
placeholder: unref(settingDefinitions).filenameArtistsSeparator.default,
style: { width: "50px" }
}, null, 8, ["modelValue", "placeholder"])
])
]),
_: 1
}),
createVNode(_component_el_form_item, {
class: "m-b-32",
label: unref(t2)("setting.compressionLevel")
}, {
default: withCtx(() => [
createVNode(_component_el_slider, {
modelValue: unref(writeableSettings).compressionLevel,
"onUpdate:modelValue": _cache[7] || (_cache[7] = ($event) => unref(writeableSettings).compressionLevel = $event),
min: 0,
max: 9,
marks: compressionLevelMarks
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.filenameLength")
}, {
default: withCtx(() => [
createVNode(_component_el_input_number, {
modelValue: unref(filenameLengthNumber),
"onUpdate:modelValue": _cache[8] || (_cache[8] = ($event) => isRef(filenameLengthNumber) ? filenameLengthNumber.value = $event : null),
min: 0,
"value-on-clear": unref(settingDefinitions).filenameLength.default,
"step-strictly": true,
disabled: unref(writeableSettings).filenameLength === "auto"
}, null, 8, ["modelValue", "value-on-clear", "disabled"]),
createVNode(_component_el_checkbox, {
modelValue: unref(filenameLengthAuto),
"onUpdate:modelValue": _cache[9] || (_cache[9] = ($event) => isRef(filenameLengthAuto) ? filenameLengthAuto.value = $event : null),
class: "m-l-16",
label: unref(t2)("common.auto")
}, null, 8, ["modelValue", "label"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.autoCancelDownloadedManga")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).autoCancelDownloadedManga,
"onUpdate:modelValue": _cache[10] || (_cache[10] = ($event) => unref(writeableSettings).autoCancelDownloadedManga = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.autoRetryWhenErrorOccurs")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).autoRetryWhenErrorOccurs,
"onUpdate:modelValue": _cache[11] || (_cache[11] = ($event) => unref(writeableSettings).autoRetryWhenErrorOccurs = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.autoShowAll")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).autoShowAll,
"onUpdate:modelValue": _cache[12] || (_cache[12] = ($event) => unref(writeableSettings).autoShowAll = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
class: "refresh-required",
label: unref(t2)("setting.showIgnoreButton")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).showIgnoreButton,
"onUpdate:modelValue": _cache[13] || (_cache[13] = ($event) => unref(writeableSettings).showIgnoreButton = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.judgeDownloadedMangaByTitle")
}, {
default: withCtx(() => [
createVNode(_component_el_checkbox, {
modelValue: unref(writeableSettings).judgeDownloadedByEnglish,
"onUpdate:modelValue": _cache[14] || (_cache[14] = ($event) => unref(writeableSettings).judgeDownloadedByEnglish = $event),
label: unref(t2)("common.english")
}, null, 8, ["modelValue", "label"]),
createVNode(_component_el_checkbox, {
modelValue: unref(writeableSettings).judgeDownloadedByJapanese,
"onUpdate:modelValue": _cache[15] || (_cache[15] = ($event) => unref(writeableSettings).judgeDownloadedByJapanese = $event),
label: unref(t2)("common.japanese")
}, null, 8, ["modelValue", "label"]),
createVNode(_component_el_checkbox, {
modelValue: unref(writeableSettings).judgeDownloadedByPretty,
"onUpdate:modelValue": _cache[16] || (_cache[16] = ($event) => unref(writeableSettings).judgeDownloadedByPretty = $event),
label: unref(t2)("common.pretty")
}, null, 8, ["modelValue", "label"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_divider, null, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.advanceTitle")), 1)
]),
_: 1
}),
unref(IS_NHENTAI) ? (openBlock(), createBlock(_component_el_form_item, {
key: 0,
label: unref(t2)("setting.nHentaiDownloadHost")
}, {
default: withCtx(() => [
createVNode(_component_el_select, {
modelValue: unref(writeableSettings).nHentaiDownloadHost,
"onUpdate:modelValue": _cache[17] || (_cache[17] = ($event) => unref(writeableSettings).nHentaiDownloadHost = $event),
disabled: !!unref(writeableSettings).customDownloadUrl
}, {
default: withCtx(() => [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(unref(nHentaiDownloadHosts), (host2) => {
return openBlock(), createBlock(_component_el_option, {
key: host2,
label: host2,
value: host2
}, null, 8, ["label", "value"]);
}), 128)),
createVNode(_component_el_option, {
label: unref(t2)("common.random"),
value: "random"
}, null, 8, ["label"]),
createVNode(_component_el_option, {
label: unref(t2)("common.balance"),
value: "balance"
}, null, 8, ["label"])
]),
_: 1
}, 8, ["modelValue", "disabled"])
]),
_: 1
}, 8, ["label"])) : createCommentVNode("", true),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.customDownloadUrl")
}, {
default: withCtx(() => [
createVNode(_component_el_input, {
modelValue: unref(writeableSettings).customDownloadUrl,
"onUpdate:modelValue": _cache[18] || (_cache[18] = ($event) => unref(writeableSettings).customDownloadUrl = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.compressionStreamFiles")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).compressionStreamFiles,
"onUpdate:modelValue": _cache[19] || (_cache[19] = ($event) => unref(writeableSettings).compressionStreamFiles = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.seriesMode")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).seriesMode,
"onUpdate:modelValue": _cache[20] || (_cache[20] = ($event) => unref(writeableSettings).seriesMode = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
createVNode(_component_el_form_item, {
label: unref(t2)("setting.streamDownload")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).streamDownload,
"onUpdate:modelValue": _cache[21] || (_cache[21] = ($event) => unref(writeableSettings).streamDownload = $event),
disabled: unref(DISABLE_STREAM_DOWNLOAD)
}, null, 8, ["modelValue", "disabled"])
]),
_: 1
}, 8, ["label"]),
unref(IS_NHENTAI) ? (openBlock(), createBlock(_component_el_form_item, {
key: 1,
class: "refresh-required",
label: unref(t2)("setting.preventConsoleClearing")
}, {
default: withCtx(() => [
createVNode(_component_el_switch, {
modelValue: unref(writeableSettings).preventConsoleClearing,
"onUpdate:modelValue": _cache[22] || (_cache[22] = ($event) => unref(writeableSettings).preventConsoleClearing = $event)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"])) : createCommentVNode("", true)
]),
_: 1
}),
createVNode(_component_el_divider, null, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.history.title")), 1)
]),
_: 1
}),
createBaseVNode("p", _hoisted_9, toDisplayString$1(unref(t2)("setting.history.downloadedNumberTip", {
num: Number.isNaN(downloadedNum.value) ? downloadedNum.value : unref(n)(downloadedNum.value)
})), 1),
createVNode(_component_el_button, {
type: "primary",
icon: unref(download_default),
disabled: !downloadedNum.value,
loading: exporting.value,
onClick: exportHistory
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.history.export")), 1)
]),
_: 1
}, 8, ["icon", "disabled", "loading"]),
createVNode(_component_el_button, {
type: "primary",
icon: unref(upload_default),
loading: importing.value,
onClick: importHistory
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.history.import")), 1)
]),
_: 1
}, 8, ["icon", "loading"]),
createVNode(_component_el_popconfirm, {
title: unref(t2)("setting.history.clearConfirm"),
"confirm-button-text": unref(t2)("setting.history.clearConfirmYes"),
"cancel-button-text": unref(t2)("setting.history.clearConfirmNo"),
placement: "top",
onConfirm: clearHistory
}, {
reference: withCtx(() => [
createVNode(_component_el_button, {
type: "danger",
icon: unref(delete_default),
loading: clearing.value
}, {
default: withCtx(() => [
createTextVNode(toDisplayString$1(unref(t2)("setting.history.clear")), 1)
]),
_: 1
}, 8, ["icon", "loading"])
]),
_: 1
}, 8, ["title", "confirm-button-text", "cancel-button-text"]),
createBaseVNode("p", _hoisted_10, toDisplayString$1(unref(t2)("setting.history.importTip")), 1)
])
]),
_: 1
}, 8, ["modelValue"]);
};
}
});
const SettingsDialog = /* @__PURE__ */ _export_sfc$1(_sfc_main$1, [["__scopeId", "data-v-0007f4fb"]]);
const compileTemplate = (tpl) => template(tpl, { interpolate: /{{([\s\S]+?)}}/g });
const getDownloadExt = () => {
const ext = last(settings.compressionFilename.split("."));
if (ext)
return ext.toLowerCase();
return "zip";
};
const getCompressionOptions = () => {
return {
streamFiles: settings.compressionStreamFiles,
compression: settings.compressionLevel > 0 ? "DEFLATE" : "STORE",
compressionOptions: { level: settings.compressionLevel }
};
};
const getShowAllBtn = () => new Promise((resolve2, reject) => {
const $btn = $("#show-all-images-button");
if ($btn.length > 0) {
resolve2($btn);
return;
}
const container = document.getElementById("thumbnail-container");
if (!container) {
reject(new Error("Show all button not found"));
return;
}
new MutationObserver((mutations, self2) => {
mutations.forEach(({ addedNodes }) => {
const btnContainer = addedNodes[0];
if ((btnContainer == null ? void 0 : btnContainer.id) === "show-all-images-container") {
self2.disconnect();
resolve2($("#show-all-images-button"));
}
});
}).observe(container, { childList: true });
});
const createMangaDownloadInfo = (gallery2) => ({
gallery: gallery2,
done: 0,
compressing: false,
compressingPercent: "0",
error: false
});
var noty = { exports: {} };
/*
@package NOTY - Dependency-free notification library
@version version: 3.1.4
@contributors https://github.com/needim/noty/graphs/contributors
@documentation Examples and Documentation - http://needim.github.com/noty
@license Licensed under the MIT licenses: http://www.opensource.org/licenses/mit-license.php
*/
(function(module2, exports2) {
(function webpackUniversalModuleDefinition(root2, factory) {
module2.exports = factory();
})(commonjsGlobal, function() {
return (
/******/
function(modules) {
var installedModules = {};
function __webpack_require__(moduleId) {
if (installedModules[moduleId]) {
return installedModules[moduleId].exports;
}
var module3 = installedModules[moduleId] = {
/******/
i: moduleId,
/******/
l: false,
/******/
exports: {}
/******/
};
modules[moduleId].call(module3.exports, module3, module3.exports, __webpack_require__);
module3.l = true;
return module3.exports;
}
__webpack_require__.m = modules;
__webpack_require__.c = installedModules;
__webpack_require__.i = function(value) {
return value;
};
__webpack_require__.d = function(exports3, name, getter) {
if (!__webpack_require__.o(exports3, name)) {
Object.defineProperty(exports3, name, {
/******/
configurable: false,
/******/
enumerable: true,
/******/
get: getter
/******/
});
}
};
__webpack_require__.n = function(module3) {
var getter = module3 && module3.__esModule ? (
/******/
function getDefault() {
return module3["default"];
}
) : (
/******/
function getModuleExports() {
return module3;
}
);
__webpack_require__.d(getter, "a", getter);
return getter;
};
__webpack_require__.o = function(object2, property2) {
return Object.prototype.hasOwnProperty.call(object2, property2);
};
__webpack_require__.p = "";
return __webpack_require__(__webpack_require__.s = 6);
}([
/* 0 */
/***/
function(module3, exports3, __webpack_require__) {
Object.defineProperty(exports3, "__esModule", {
value: true
});
exports3.css = exports3.deepExtend = exports3.animationEndEvents = void 0;
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function(obj) {
return typeof obj;
} : function(obj) {
return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
};
exports3.inArray = inArray;
exports3.stopPropagation = stopPropagation;
exports3.generateID = generateID;
exports3.outerHeight = outerHeight;
exports3.addListener = addListener;
exports3.hasClass = hasClass2;
exports3.addClass = addClass2;
exports3.removeClass = removeClass2;
exports3.remove = remove2;
exports3.classList = classList;
exports3.visibilityChangeFlow = visibilityChangeFlow;
exports3.createAudioElements = createAudioElements;
var _api = __webpack_require__(1);
var API = _interopRequireWildcard(_api);
function _interopRequireWildcard(obj) {
if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key))
newObj[key] = obj[key];
}
}
newObj.default = obj;
return newObj;
}
}
exports3.animationEndEvents = "webkitAnimationEnd mozAnimationEnd MSAnimationEnd oanimationend animationend";
function inArray(needle, haystack, argStrict) {
var key = void 0;
var strict = !!argStrict;
if (strict) {
for (key in haystack) {
if (haystack.hasOwnProperty(key) && haystack[key] === needle) {
return true;
}
}
} else {
for (key in haystack) {
if (haystack.hasOwnProperty(key) && haystack[key] === needle) {
return true;
}
}
}
return false;
}
function stopPropagation(evt) {
evt = evt || window.event;
if (typeof evt.stopPropagation !== "undefined") {
evt.stopPropagation();
} else {
evt.cancelBubble = true;
}
}
exports3.deepExtend = function deepExtend(out) {
out = out || {};
for (var i = 1; i < arguments.length; i++) {
var obj = arguments[i];
if (!obj)
continue;
for (var key in obj) {
if (obj.hasOwnProperty(key)) {
if (Array.isArray(obj[key])) {
out[key] = obj[key];
} else if (_typeof(obj[key]) === "object" && obj[key] !== null) {
out[key] = deepExtend(out[key], obj[key]);
} else {
out[key] = obj[key];
}
}
}
}
return out;
};
function generateID() {
var prefix = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : "";
var id = "noty_" + prefix + "_";
id += "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(/[xy]/g, function(c) {
var r = Math.random() * 16 | 0;
var v = c === "x" ? r : r & 3 | 8;
return v.toString(16);
});
return id;
}
function outerHeight(el) {
var height = el.offsetHeight;
var style = window.getComputedStyle(el);
height += parseInt(style.marginTop) + parseInt(style.marginBottom);
return height;
}
exports3.css = function() {
var cssPrefixes = ["Webkit", "O", "Moz", "ms"];
var cssProps = {};
function camelCase2(string2) {
return string2.replace(/^-ms-/, "ms-").replace(/-([\da-z])/gi, function(match2, letter) {
return letter.toUpperCase();
});
}
function getVendorProp(name) {
var style = document.body.style;
if (name in style)
return name;
var i = cssPrefixes.length;
var capName = name.charAt(0).toUpperCase() + name.slice(1);
var vendorName = void 0;
while (i--) {
vendorName = cssPrefixes[i] + capName;
if (vendorName in style)
return vendorName;
}
return name;
}
function getStyleProp(name) {
name = camelCase2(name);
return cssProps[name] || (cssProps[name] = getVendorProp(name));
}
function applyCss(element, prop, value) {
prop = getStyleProp(prop);
element.style[prop] = value;
}
return function(element, properties) {
var args = arguments;
var prop = void 0;
var value = void 0;
if (args.length === 2) {
for (prop in properties) {
if (properties.hasOwnProperty(prop)) {
value = properties[prop];
if (value !== void 0 && properties.hasOwnProperty(prop)) {
applyCss(element, prop, value);
}
}
}
} else {
applyCss(element, args[1], args[2]);
}
};
}();
function addListener(el, events, cb) {
var useCapture = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : false;
events = events.split(" ");
for (var i = 0; i < events.length; i++) {
if (document.addEventListener) {
el.addEventListener(events[i], cb, useCapture);
} else if (document.attachEvent) {
el.attachEvent("on" + events[i], cb);
}
}
}
function hasClass2(element, name) {
var list = typeof element === "string" ? element : classList(element);
return list.indexOf(" " + name + " ") >= 0;
}
function addClass2(element, name) {
var oldList = classList(element);
var newList = oldList + name;
if (hasClass2(oldList, name))
return;
element.className = newList.substring(1);
}
function removeClass2(element, name) {
var oldList = classList(element);
var newList = void 0;
if (!hasClass2(element, name))
return;
newList = oldList.replace(" " + name + " ", " ");
element.className = newList.substring(1, newList.length - 1);
}
function remove2(element) {
if (element.parentNode) {
element.parentNode.removeChild(element);
}
}
function classList(element) {
return (" " + (element && element.className || "") + " ").replace(/\s+/gi, " ");
}
function visibilityChangeFlow() {
var hidden = void 0;
var visibilityChange = void 0;
if (typeof document.hidden !== "undefined") {
hidden = "hidden";
visibilityChange = "visibilitychange";
} else if (typeof document.msHidden !== "undefined") {
hidden = "msHidden";
visibilityChange = "msvisibilitychange";
} else if (typeof document.webkitHidden !== "undefined") {
hidden = "webkitHidden";
visibilityChange = "webkitvisibilitychange";
}
function onVisibilityChange() {
API.PageHidden = document[hidden];
handleVisibilityChange();
}
function onBlur() {
API.PageHidden = true;
handleVisibilityChange();
}
function onFocus() {
API.PageHidden = false;
handleVisibilityChange();
}
function handleVisibilityChange() {
if (API.PageHidden)
stopAll();
else
resumeAll();
}
function stopAll() {
setTimeout(function() {
Object.keys(API.Store).forEach(function(id) {
if (API.Store.hasOwnProperty(id)) {
if (API.Store[id].options.visibilityControl) {
API.Store[id].stop();
}
}
});
}, 100);
}
function resumeAll() {
setTimeout(function() {
Object.keys(API.Store).forEach(function(id) {
if (API.Store.hasOwnProperty(id)) {
if (API.Store[id].options.visibilityControl) {
API.Store[id].resume();
}
}
});
API.queueRenderAll();
}, 100);
}
if (visibilityChange) {
addListener(document, visibilityChange, onVisibilityChange);
}
addListener(window, "blur", onBlur);
addListener(window, "focus", onFocus);
}
function createAudioElements(ref2) {
if (ref2.hasSound) {
var audioElement = document.createElement("audio");
ref2.options.sounds.sources.forEach(function(s) {
var source = document.createElement("source");
source.src = s;
source.type = "audio/" + getExtension(s);
audioElement.appendChild(source);
});
if (ref2.barDom) {
ref2.barDom.appendChild(audioElement);
} else {
document.querySelector("body").appendChild(audioElement);
}
audioElement.volume = ref2.options.sounds.volume;
if (!ref2.soundPlayed) {
audioElement.play();
ref2.soundPlayed = true;
}
audioElement.onended = function() {
remove2(audioElement);
};
}
}
function getExtension(fileName) {
return fileName.match(/\.([^.]+)$/)[1];
}
},
/* 1 */
/***/
function(module3, exports3, __webpack_require__) {
Object.defineProperty(exports3, "__esModule", {
value: true
});
exports3.Defaults = exports3.Store = exports3.Queues = exports3.DefaultMaxVisible = exports3.docTitle = exports3.DocModalCount = exports3.PageHidden = void 0;
exports3.getQueueCounts = getQueueCounts;
exports3.addToQueue = addToQueue;
exports3.removeFromQueue = removeFromQueue;
exports3.queueRender = queueRender;
exports3.queueRenderAll = queueRenderAll;
exports3.ghostFix = ghostFix;
exports3.build = build;
exports3.hasButtons = hasButtons;
exports3.handleModal = handleModal;
exports3.handleModalClose = handleModalClose;
exports3.queueClose = queueClose;
exports3.dequeueClose = dequeueClose;
exports3.fire = fire;
exports3.openFlow = openFlow;
exports3.closeFlow = closeFlow;
var _utils = __webpack_require__(0);
var Utils = _interopRequireWildcard(_utils);
function _interopRequireWildcard(obj) {
if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key))
newObj[key] = obj[key];
}
}
newObj.default = obj;
return newObj;
}
}
exports3.PageHidden = false;
var DocModalCount = exports3.DocModalCount = 0;
var DocTitleProps = {
originalTitle: null,
count: 0,
changed: false,
timer: -1
};
var docTitle = exports3.docTitle = {
increment: function increment() {
DocTitleProps.count++;
docTitle._update();
},
decrement: function decrement() {
DocTitleProps.count--;
if (DocTitleProps.count <= 0) {
docTitle._clear();
return;
}
docTitle._update();
},
_update: function _update() {
var title = document.title;
if (!DocTitleProps.changed) {
DocTitleProps.originalTitle = title;
document.title = "(" + DocTitleProps.count + ") " + title;
DocTitleProps.changed = true;
} else {
document.title = "(" + DocTitleProps.count + ") " + DocTitleProps.originalTitle;
}
},
_clear: function _clear() {
if (DocTitleProps.changed) {
DocTitleProps.count = 0;
document.title = DocTitleProps.originalTitle;
DocTitleProps.changed = false;
}
}
};
var DefaultMaxVisible = exports3.DefaultMaxVisible = 5;
var Queues = exports3.Queues = {
global: {
maxVisible: DefaultMaxVisible,
queue: []
}
};
var Store = exports3.Store = {};
exports3.Defaults = {
type: "alert",
layout: "topRight",
theme: "mint",
text: "",
timeout: false,
progressBar: true,
closeWith: ["click"],
animation: {
open: "noty_effects_open",
close: "noty_effects_close"
},
id: false,
force: false,
killer: false,
queue: "global",
container: false,
buttons: [],
callbacks: {
beforeShow: null,
onShow: null,
afterShow: null,
onClose: null,
afterClose: null,
onClick: null,
onHover: null,
onTemplate: null
},
sounds: {
sources: [],
volume: 1,
conditions: []
},
titleCount: {
conditions: []
},
modal: false,
visibilityControl: false
/**
* @param {string} queueName
* @return {object}
*/
};
function getQueueCounts() {
var queueName = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : "global";
var count = 0;
var max = DefaultMaxVisible;
if (Queues.hasOwnProperty(queueName)) {
max = Queues[queueName].maxVisible;
Object.keys(Store).forEach(function(i) {
if (Store[i].options.queue === queueName && !Store[i].closed)
count++;
});
}
return {
current: count,
maxVisible: max
};
}
function addToQueue(ref2) {
if (!Queues.hasOwnProperty(ref2.options.queue)) {
Queues[ref2.options.queue] = { maxVisible: DefaultMaxVisible, queue: [] };
}
Queues[ref2.options.queue].queue.push(ref2);
}
function removeFromQueue(ref2) {
if (Queues.hasOwnProperty(ref2.options.queue)) {
var queue2 = [];
Object.keys(Queues[ref2.options.queue].queue).forEach(function(i) {
if (Queues[ref2.options.queue].queue[i].id !== ref2.id) {
queue2.push(Queues[ref2.options.queue].queue[i]);
}
});
Queues[ref2.options.queue].queue = queue2;
}
}
function queueRender() {
var queueName = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : "global";
if (Queues.hasOwnProperty(queueName)) {
var noty2 = Queues[queueName].queue.shift();
if (noty2)
noty2.show();
}
}
function queueRenderAll() {
Object.keys(Queues).forEach(function(queueName) {
queueRender(queueName);
});
}
function ghostFix(ref2) {
var ghostID = Utils.generateID("ghost");
var ghost = document.createElement("div");
ghost.setAttribute("id", ghostID);
Utils.css(ghost, {
height: Utils.outerHeight(ref2.barDom) + "px"
});
ref2.barDom.insertAdjacentHTML("afterend", ghost.outerHTML);
Utils.remove(ref2.barDom);
ghost = document.getElementById(ghostID);
Utils.addClass(ghost, "noty_fix_effects_height");
Utils.addListener(ghost, Utils.animationEndEvents, function() {
Utils.remove(ghost);
});
}
function build(ref2) {
findOrCreateContainer(ref2);
var markup = '<div class="noty_body">' + ref2.options.text + "</div>" + buildButtons(ref2) + '<div class="noty_progressbar"></div>';
ref2.barDom = document.createElement("div");
ref2.barDom.setAttribute("id", ref2.id);
Utils.addClass(ref2.barDom, "noty_bar noty_type__" + ref2.options.type + " noty_theme__" + ref2.options.theme);
ref2.barDom.innerHTML = markup;
fire(ref2, "onTemplate");
}
function hasButtons(ref2) {
return !!(ref2.options.buttons && Object.keys(ref2.options.buttons).length);
}
function buildButtons(ref2) {
if (hasButtons(ref2)) {
var buttons = document.createElement("div");
Utils.addClass(buttons, "noty_buttons");
Object.keys(ref2.options.buttons).forEach(function(key) {
buttons.appendChild(ref2.options.buttons[key].dom);
});
ref2.options.buttons.forEach(function(btn) {
buttons.appendChild(btn.dom);
});
return buttons.outerHTML;
}
return "";
}
function handleModal(ref2) {
if (ref2.options.modal) {
if (DocModalCount === 0) {
createModal();
}
exports3.DocModalCount = DocModalCount += 1;
}
}
function handleModalClose(ref2) {
if (ref2.options.modal && DocModalCount > 0) {
exports3.DocModalCount = DocModalCount -= 1;
if (DocModalCount <= 0) {
var modal = document.querySelector(".noty_modal");
if (modal) {
Utils.removeClass(modal, "noty_modal_open");
Utils.addClass(modal, "noty_modal_close");
Utils.addListener(modal, Utils.animationEndEvents, function() {
Utils.remove(modal);
});
}
}
}
}
function createModal() {
var body = document.querySelector("body");
var modal = document.createElement("div");
Utils.addClass(modal, "noty_modal");
body.insertBefore(modal, body.firstChild);
Utils.addClass(modal, "noty_modal_open");
Utils.addListener(modal, Utils.animationEndEvents, function() {
Utils.removeClass(modal, "noty_modal_open");
});
}
function findOrCreateContainer(ref2) {
if (ref2.options.container) {
ref2.layoutDom = document.querySelector(ref2.options.container);
return;
}
var layoutID = "noty_layout__" + ref2.options.layout;
ref2.layoutDom = document.querySelector("div#" + layoutID);
if (!ref2.layoutDom) {
ref2.layoutDom = document.createElement("div");
ref2.layoutDom.setAttribute("id", layoutID);
ref2.layoutDom.setAttribute("role", "alert");
ref2.layoutDom.setAttribute("aria-live", "polite");
Utils.addClass(ref2.layoutDom, "noty_layout");
document.querySelector("body").appendChild(ref2.layoutDom);
}
}
function queueClose(ref2) {
if (ref2.options.timeout) {
if (ref2.options.progressBar && ref2.progressDom) {
Utils.css(ref2.progressDom, {
transition: "width " + ref2.options.timeout + "ms linear",
width: "0%"
});
}
clearTimeout(ref2.closeTimer);
ref2.closeTimer = setTimeout(function() {
ref2.close();
}, ref2.options.timeout);
}
}
function dequeueClose(ref2) {
if (ref2.options.timeout && ref2.closeTimer) {
clearTimeout(ref2.closeTimer);
ref2.closeTimer = -1;
if (ref2.options.progressBar && ref2.progressDom) {
Utils.css(ref2.progressDom, {
transition: "width 0ms linear",
width: "100%"
});
}
}
}
function fire(ref2, eventName) {
if (ref2.listeners.hasOwnProperty(eventName)) {
ref2.listeners[eventName].forEach(function(cb) {
if (typeof cb === "function") {
cb.apply(ref2);
}
});
}
}
function openFlow(ref2) {
fire(ref2, "afterShow");
queueClose(ref2);
Utils.addListener(ref2.barDom, "mouseenter", function() {
dequeueClose(ref2);
});
Utils.addListener(ref2.barDom, "mouseleave", function() {
queueClose(ref2);
});
}
function closeFlow(ref2) {
delete Store[ref2.id];
ref2.closing = false;
fire(ref2, "afterClose");
Utils.remove(ref2.barDom);
if (ref2.layoutDom.querySelectorAll(".noty_bar").length === 0 && !ref2.options.container) {
Utils.remove(ref2.layoutDom);
}
if (Utils.inArray("docVisible", ref2.options.titleCount.conditions) || Utils.inArray("docHidden", ref2.options.titleCount.conditions)) {
docTitle.decrement();
}
queueRender(ref2.options.queue);
}
},
/* 2 */
/***/
function(module3, exports3, __webpack_require__) {
Object.defineProperty(exports3, "__esModule", {
value: true
});
exports3.NotyButton = void 0;
var _utils = __webpack_require__(0);
var Utils = _interopRequireWildcard(_utils);
function _interopRequireWildcard(obj) {
if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key))
newObj[key] = obj[key];
}
}
newObj.default = obj;
return newObj;
}
}
function _classCallCheck(instance, Constructor) {
if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
}
}
exports3.NotyButton = function NotyButton(html2, classes, cb) {
var _this = this;
var attributes = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
_classCallCheck(this, NotyButton);
this.dom = document.createElement("button");
this.dom.innerHTML = html2;
this.id = attributes.id = attributes.id || Utils.generateID("button");
this.cb = cb;
Object.keys(attributes).forEach(function(propertyName) {
_this.dom.setAttribute(propertyName, attributes[propertyName]);
});
Utils.addClass(this.dom, classes || "noty_btn");
return this;
};
},
/* 3 */
/***/
function(module3, exports3, __webpack_require__) {
Object.defineProperty(exports3, "__esModule", {
value: true
});
var _createClass = function() {
function defineProperties(target, props) {
for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
}
}
return function(Constructor, protoProps, staticProps) {
if (protoProps)
defineProperties(Constructor.prototype, protoProps);
if (staticProps)
defineProperties(Constructor, staticProps);
return Constructor;
};
}();
function _classCallCheck(instance, Constructor) {
if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
}
}
exports3.Push = function() {
function Push() {
var workerPath = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : "/service-worker.js";
_classCallCheck(this, Push);
this.subData = {};
this.workerPath = workerPath;
this.listeners = {
onPermissionGranted: [],
onPermissionDenied: [],
onSubscriptionSuccess: [],
onSubscriptionCancel: [],
onWorkerError: [],
onWorkerSuccess: [],
onWorkerNotSupported: []
};
return this;
}
_createClass(Push, [{
key: "on",
value: function on2(eventName) {
var cb = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : function() {
};
if (typeof cb === "function" && this.listeners.hasOwnProperty(eventName)) {
this.listeners[eventName].push(cb);
}
return this;
}
}, {
key: "fire",
value: function fire(eventName) {
var _this = this;
var params = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : [];
if (this.listeners.hasOwnProperty(eventName)) {
this.listeners[eventName].forEach(function(cb) {
if (typeof cb === "function") {
cb.apply(_this, params);
}
});
}
}
}, {
key: "create",
value: function create() {
console.log("NOT IMPLEMENTED YET");
}
/**
* @return {boolean}
*/
}, {
key: "isSupported",
value: function isSupported() {
var result = false;
try {
result = window.Notification || window.webkitNotifications || navigator.mozNotification || window.external && window.external.msIsSiteMode() !== void 0;
} catch (e) {
}
return result;
}
/**
* @return {string}
*/
}, {
key: "getPermissionStatus",
value: function getPermissionStatus() {
var perm = "default";
if (window.Notification && window.Notification.permissionLevel) {
perm = window.Notification.permissionLevel;
} else if (window.webkitNotifications && window.webkitNotifications.checkPermission) {
switch (window.webkitNotifications.checkPermission()) {
case 1:
perm = "default";
break;
case 0:
perm = "granted";
break;
default:
perm = "denied";
}
} else if (window.Notification && window.Notification.permission) {
perm = window.Notification.permission;
} else if (navigator.mozNotification) {
perm = "granted";
} else if (window.external && window.external.msIsSiteMode() !== void 0) {
perm = window.external.msIsSiteMode() ? "granted" : "default";
}
return perm.toString().toLowerCase();
}
/**
* @return {string}
*/
}, {
key: "getEndpoint",
value: function getEndpoint(subscription) {
var endpoint = subscription.endpoint;
var subscriptionId = subscription.subscriptionId;
if (subscriptionId && endpoint.indexOf(subscriptionId) === -1) {
endpoint += "/" + subscriptionId;
}
return endpoint;
}
/**
* @return {boolean}
*/
}, {
key: "isSWRegistered",
value: function isSWRegistered() {
try {
return navigator.serviceWorker.controller.state === "activated";
} catch (e) {
return false;
}
}
/**
* @return {void}
*/
}, {
key: "unregisterWorker",
value: function unregisterWorker() {
var self2 = this;
if ("serviceWorker" in navigator) {
navigator.serviceWorker.getRegistrations().then(function(registrations) {
var _iteratorNormalCompletion = true;
var _didIteratorError = false;
var _iteratorError = void 0;
try {
for (var _iterator = registrations[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) {
var registration = _step.value;
registration.unregister();
self2.fire("onSubscriptionCancel");
}
} catch (err) {
_didIteratorError = true;
_iteratorError = err;
} finally {
try {
if (!_iteratorNormalCompletion && _iterator.return) {
_iterator.return();
}
} finally {
if (_didIteratorError) {
throw _iteratorError;
}
}
}
});
}
}
/**
* @return {void}
*/
}, {
key: "requestSubscription",
value: function requestSubscription() {
var _this2 = this;
var userVisibleOnly = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : true;
var self2 = this;
var current = this.getPermissionStatus();
var cb = function cb2(result) {
if (result === "granted") {
_this2.fire("onPermissionGranted");
if ("serviceWorker" in navigator) {
navigator.serviceWorker.register(_this2.workerPath).then(function() {
navigator.serviceWorker.ready.then(function(serviceWorkerRegistration) {
self2.fire("onWorkerSuccess");
serviceWorkerRegistration.pushManager.subscribe({
userVisibleOnly
}).then(function(subscription) {
var key = subscription.getKey("p256dh");
var token = subscription.getKey("auth");
self2.subData = {
endpoint: self2.getEndpoint(subscription),
p256dh: key ? window.btoa(String.fromCharCode.apply(null, new Uint8Array(key))) : null,
auth: token ? window.btoa(String.fromCharCode.apply(null, new Uint8Array(token))) : null
};
self2.fire("onSubscriptionSuccess", [self2.subData]);
}).catch(function(err) {
self2.fire("onWorkerError", [err]);
});
});
});
} else {
self2.fire("onWorkerNotSupported");
}
} else if (result === "denied") {
_this2.fire("onPermissionDenied");
_this2.unregisterWorker();
}
};
if (current === "default") {
if (window.Notification && window.Notification.requestPermission) {
window.Notification.requestPermission(cb);
} else if (window.webkitNotifications && window.webkitNotifications.checkPermission) {
window.webkitNotifications.requestPermission(cb);
}
} else {
cb(current);
}
}
}]);
return Push;
}();
},
/* 4 */
/***/
function(module3, exports3, __webpack_require__) {
(function(process2, global2) {
var require2;
/*!
* @overview es6-promise - a tiny implementation of Promises/A+.
* @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)
* @license Licensed under MIT license
* See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE
* @version 4.1.1
*/
(function(global3, factory) {
module3.exports = factory();
})(this, function() {
function objectOrFunction(x) {
var type2 = typeof x;
return x !== null && (type2 === "object" || type2 === "function");
}
function isFunction2(x) {
return typeof x === "function";
}
var _isArray = void 0;
if (Array.isArray) {
_isArray = Array.isArray;
} else {
_isArray = function(x) {
return Object.prototype.toString.call(x) === "[object Array]";
};
}
var isArray2 = _isArray;
var len = 0;
var vertxNext = void 0;
var customSchedulerFn = void 0;
var asap = function asap2(callback, arg) {
queue2[len] = callback;
queue2[len + 1] = arg;
len += 2;
if (len === 2) {
if (customSchedulerFn) {
customSchedulerFn(flush);
} else {
scheduleFlush();
}
}
};
function setScheduler(scheduleFn) {
customSchedulerFn = scheduleFn;
}
function setAsap(asapFn) {
asap = asapFn;
}
var browserWindow = typeof window !== "undefined" ? window : void 0;
var browserGlobal = browserWindow || {};
var BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;
var isNode = typeof self === "undefined" && typeof process2 !== "undefined" && {}.toString.call(process2) === "[object process]";
var isWorker = typeof Uint8ClampedArray !== "undefined" && typeof importScripts !== "undefined" && typeof MessageChannel !== "undefined";
function useNextTick() {
return function() {
return process2.nextTick(flush);
};
}
function useVertxTimer() {
if (typeof vertxNext !== "undefined") {
return function() {
vertxNext(flush);
};
}
return useSetTimeout();
}
function useMutationObserver() {
var iterations = 0;
var observer = new BrowserMutationObserver(flush);
var node = document.createTextNode("");
observer.observe(node, { characterData: true });
return function() {
node.data = iterations = ++iterations % 2;
};
}
function useMessageChannel() {
var channel = new MessageChannel();
channel.port1.onmessage = flush;
return function() {
return channel.port2.postMessage(0);
};
}
function useSetTimeout() {
var globalSetTimeout = setTimeout;
return function() {
return globalSetTimeout(flush, 1);
};
}
var queue2 = new Array(1e3);
function flush() {
for (var i = 0; i < len; i += 2) {
var callback = queue2[i];
var arg = queue2[i + 1];
callback(arg);
queue2[i] = void 0;
queue2[i + 1] = void 0;
}
len = 0;
}
function attemptVertx() {
try {
var r = require2;
var vertx = __webpack_require__(9);
vertxNext = vertx.runOnLoop || vertx.runOnContext;
return useVertxTimer();
} catch (e) {
return useSetTimeout();
}
}
var scheduleFlush = void 0;
if (isNode) {
scheduleFlush = useNextTick();
} else if (BrowserMutationObserver) {
scheduleFlush = useMutationObserver();
} else if (isWorker) {
scheduleFlush = useMessageChannel();
} else if (browserWindow === void 0 && true) {
scheduleFlush = attemptVertx();
} else {
scheduleFlush = useSetTimeout();
}
function then(onFulfillment, onRejection) {
var _arguments = arguments;
var parent = this;
var child = new this.constructor(noop2);
if (child[PROMISE_ID] === void 0) {
makePromise(child);
}
var _state = parent._state;
if (_state) {
(function() {
var callback = _arguments[_state - 1];
asap(function() {
return invokeCallback(_state, child, callback, parent._result);
});
})();
} else {
subscribe(parent, child, onFulfillment, onRejection);
}
return child;
}
function resolve$1(object2) {
var Constructor = this;
if (object2 && typeof object2 === "object" && object2.constructor === Constructor) {
return object2;
}
var promise = new Constructor(noop2);
resolve2(promise, object2);
return promise;
}
var PROMISE_ID = Math.random().toString(36).substring(16);
function noop2() {
}
var PENDING = void 0;
var FULFILLED = 1;
var REJECTED = 2;
var GET_THEN_ERROR = new ErrorObject();
function selfFulfillment() {
return new TypeError("You cannot resolve a promise with itself");
}
function cannotReturnOwn() {
return new TypeError("A promises callback cannot return that same promise.");
}
function getThen(promise) {
try {
return promise.then;
} catch (error) {
GET_THEN_ERROR.error = error;
return GET_THEN_ERROR;
}
}
function tryThen(then$$1, value, fulfillmentHandler, rejectionHandler) {
try {
then$$1.call(value, fulfillmentHandler, rejectionHandler);
} catch (e) {
return e;
}
}
function handleForeignThenable(promise, thenable, then$$1) {
asap(function(promise2) {
var sealed = false;
var error = tryThen(then$$1, thenable, function(value) {
if (sealed) {
return;
}
sealed = true;
if (thenable !== value) {
resolve2(promise2, value);
} else {
fulfill(promise2, value);
}
}, function(reason) {
if (sealed) {
return;
}
sealed = true;
reject(promise2, reason);
}, "Settle: " + (promise2._label || " unknown promise"));
if (!sealed && error) {
sealed = true;
reject(promise2, error);
}
}, promise);
}
function handleOwnThenable(promise, thenable) {
if (thenable._state === FULFILLED) {
fulfill(promise, thenable._result);
} else if (thenable._state === REJECTED) {
reject(promise, thenable._result);
} else {
subscribe(thenable, void 0, function(value) {
return resolve2(promise, value);
}, function(reason) {
return reject(promise, reason);
});
}
}
function handleMaybeThenable(promise, maybeThenable, then$$1) {
if (maybeThenable.constructor === promise.constructor && then$$1 === then && maybeThenable.constructor.resolve === resolve$1) {
handleOwnThenable(promise, maybeThenable);
} else {
if (then$$1 === GET_THEN_ERROR) {
reject(promise, GET_THEN_ERROR.error);
GET_THEN_ERROR.error = null;
} else if (then$$1 === void 0) {
fulfill(promise, maybeThenable);
} else if (isFunction2(then$$1)) {
handleForeignThenable(promise, maybeThenable, then$$1);
} else {
fulfill(promise, maybeThenable);
}
}
}
function resolve2(promise, value) {
if (promise === value) {
reject(promise, selfFulfillment());
} else if (objectOrFunction(value)) {
handleMaybeThenable(promise, value, getThen(value));
} else {
fulfill(promise, value);
}
}
function publishRejection(promise) {
if (promise._onerror) {
promise._onerror(promise._result);
}
publish(promise);
}
function fulfill(promise, value) {
if (promise._state !== PENDING) {
return;
}
promise._result = value;
promise._state = FULFILLED;
if (promise._subscribers.length !== 0) {
asap(publish, promise);
}
}
function reject(promise, reason) {
if (promise._state !== PENDING) {
return;
}
promise._state = REJECTED;
promise._result = reason;
asap(publishRejection, promise);
}
function subscribe(parent, child, onFulfillment, onRejection) {
var _subscribers = parent._subscribers;
var length = _subscribers.length;
parent._onerror = null;
_subscribers[length] = child;
_subscribers[length + FULFILLED] = onFulfillment;
_subscribers[length + REJECTED] = onRejection;
if (length === 0 && parent._state) {
asap(publish, parent);
}
}
function publish(promise) {
var subscribers = promise._subscribers;
var settled = promise._state;
if (subscribers.length === 0) {
return;
}
var child = void 0, callback = void 0, detail = promise._result;
for (var i = 0; i < subscribers.length; i += 3) {
child = subscribers[i];
callback = subscribers[i + settled];
if (child) {
invokeCallback(settled, child, callback, detail);
} else {
callback(detail);
}
}
promise._subscribers.length = 0;
}
function ErrorObject() {
this.error = null;
}
var TRY_CATCH_ERROR = new ErrorObject();
function tryCatch(callback, detail) {
try {
return callback(detail);
} catch (e) {
TRY_CATCH_ERROR.error = e;
return TRY_CATCH_ERROR;
}
}
function invokeCallback(settled, promise, callback, detail) {
var hasCallback = isFunction2(callback), value = void 0, error = void 0, succeeded = void 0, failed = void 0;
if (hasCallback) {
value = tryCatch(callback, detail);
if (value === TRY_CATCH_ERROR) {
failed = true;
error = value.error;
value.error = null;
} else {
succeeded = true;
}
if (promise === value) {
reject(promise, cannotReturnOwn());
return;
}
} else {
value = detail;
succeeded = true;
}
if (promise._state !== PENDING)
;
else if (hasCallback && succeeded) {
resolve2(promise, value);
} else if (failed) {
reject(promise, error);
} else if (settled === FULFILLED) {
fulfill(promise, value);
} else if (settled === REJECTED) {
reject(promise, value);
}
}
function initializePromise(promise, resolver) {
try {
resolver(function resolvePromise(value) {
resolve2(promise, value);
}, function rejectPromise(reason) {
reject(promise, reason);
});
} catch (e) {
reject(promise, e);
}
}
var id = 0;
function nextId() {
return id++;
}
function makePromise(promise) {
promise[PROMISE_ID] = id++;
promise._state = void 0;
promise._result = void 0;
promise._subscribers = [];
}
function Enumerator$1(Constructor, input) {
this._instanceConstructor = Constructor;
this.promise = new Constructor(noop2);
if (!this.promise[PROMISE_ID]) {
makePromise(this.promise);
}
if (isArray2(input)) {
this.length = input.length;
this._remaining = input.length;
this._result = new Array(this.length);
if (this.length === 0) {
fulfill(this.promise, this._result);
} else {
this.length = this.length || 0;
this._enumerate(input);
if (this._remaining === 0) {
fulfill(this.promise, this._result);
}
}
} else {
reject(this.promise, validationError());
}
}
function validationError() {
return new Error("Array Methods must be provided an Array");
}
Enumerator$1.prototype._enumerate = function(input) {
for (var i = 0; this._state === PENDING && i < input.length; i++) {
this._eachEntry(input[i], i);
}
};
Enumerator$1.prototype._eachEntry = function(entry, i) {
var c = this._instanceConstructor;
var resolve$$1 = c.resolve;
if (resolve$$1 === resolve$1) {
var _then = getThen(entry);
if (_then === then && entry._state !== PENDING) {
this._settledAt(entry._state, i, entry._result);
} else if (typeof _then !== "function") {
this._remaining--;
this._result[i] = entry;
} else if (c === Promise$22) {
var promise = new c(noop2);
handleMaybeThenable(promise, entry, _then);
this._willSettleAt(promise, i);
} else {
this._willSettleAt(new c(function(resolve$$12) {
return resolve$$12(entry);
}), i);
}
} else {
this._willSettleAt(resolve$$1(entry), i);
}
};
Enumerator$1.prototype._settledAt = function(state, i, value) {
var promise = this.promise;
if (promise._state === PENDING) {
this._remaining--;
if (state === REJECTED) {
reject(promise, value);
} else {
this._result[i] = value;
}
}
if (this._remaining === 0) {
fulfill(promise, this._result);
}
};
Enumerator$1.prototype._willSettleAt = function(promise, i) {
var enumerator = this;
subscribe(promise, void 0, function(value) {
return enumerator._settledAt(FULFILLED, i, value);
}, function(reason) {
return enumerator._settledAt(REJECTED, i, reason);
});
};
function all$1(entries) {
return new Enumerator$1(this, entries).promise;
}
function race$1(entries) {
var Constructor = this;
if (!isArray2(entries)) {
return new Constructor(function(_, reject2) {
return reject2(new TypeError("You must pass an array to race."));
});
} else {
return new Constructor(function(resolve3, reject2) {
var length = entries.length;
for (var i = 0; i < length; i++) {
Constructor.resolve(entries[i]).then(resolve3, reject2);
}
});
}
}
function reject$1(reason) {
var Constructor = this;
var promise = new Constructor(noop2);
reject(promise, reason);
return promise;
}
function needsResolver() {
throw new TypeError("You must pass a resolver function as the first argument to the promise constructor");
}
function needsNew() {
throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.");
}
function Promise$22(resolver) {
this[PROMISE_ID] = nextId();
this._result = this._state = void 0;
this._subscribers = [];
if (noop2 !== resolver) {
typeof resolver !== "function" && needsResolver();
this instanceof Promise$22 ? initializePromise(this, resolver) : needsNew();
}
}
Promise$22.all = all$1;
Promise$22.race = race$1;
Promise$22.resolve = resolve$1;
Promise$22.reject = reject$1;
Promise$22._setScheduler = setScheduler;
Promise$22._setAsap = setAsap;
Promise$22._asap = asap;
Promise$22.prototype = {
constructor: Promise$22,
/**
The primary way of interacting with a promise is through its `then` method,
which registers callbacks to receive either a promise's eventual value or the
reason why the promise cannot be fulfilled.
```js
findUser().then(function(user){
// user is available
}, function(reason){
// user is unavailable, and you are given the reason why
});
```
Chaining
--------
The return value of `then` is itself a promise. This second, 'downstream'
promise is resolved with the return value of the first promise's fulfillment
or rejection handler, or rejected if the handler throws an exception.
```js
findUser().then(function (user) {
return user.name;
}, function (reason) {
return 'default name';
}).then(function (userName) {
// If `findUser` fulfilled, `userName` will be the user's name, otherwise it
// will be `'default name'`
});
findUser().then(function (user) {
throw new Error('Found user, but still unhappy');
}, function (reason) {
throw new Error('`findUser` rejected and we're unhappy');
}).then(function (value) {
// never reached
}, function (reason) {
// if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.
// If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.
});
```
If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.
```js
findUser().then(function (user) {
throw new PedagogicalException('Upstream error');
}).then(function (value) {
// never reached
}).then(function (value) {
// never reached
}, function (reason) {
// The `PedgagocialException` is propagated all the way down to here
});
```
Assimilation
------------
Sometimes the value you want to propagate to a downstream promise can only be
retrieved asynchronously. This can be achieved by returning a promise in the
fulfillment or rejection handler. The downstream promise will then be pending
until the returned promise is settled. This is called *assimilation*.
```js
findUser().then(function (user) {
return findCommentsByAuthor(user);
}).then(function (comments) {
// The user's comments are now available
});
```
If the assimliated promise rejects, then the downstream promise will also reject.
```js
findUser().then(function (user) {
return findCommentsByAuthor(user);
}).then(function (comments) {
// If `findCommentsByAuthor` fulfills, we'll have the value here
}, function (reason) {
// If `findCommentsByAuthor` rejects, we'll have the reason here
});
```
Simple Example
--------------
Synchronous Example
```javascript
let result;
try {
result = findResult();
// success
} catch(reason) {
// failure
}
```
Errback Example
```js
findResult(function(result, err){
if (err) {
// failure
} else {
// success
}
});
```
Promise Example;
```javascript
findResult().then(function(result){
// success
}, function(reason){
// failure
});
```
Advanced Example
--------------
Synchronous Example
```javascript
let author, books;
try {
author = findAuthor();
books = findBooksByAuthor(author);
// success
} catch(reason) {
// failure
}
```
Errback Example
```js
function foundBooks(books) {
}
function failure(reason) {
}
findAuthor(function(author, err){
if (err) {
failure(err);
// failure
} else {
try {
findBoooksByAuthor(author, function(books, err) {
if (err) {
failure(err);
} else {
try {
foundBooks(books);
} catch(reason) {
failure(reason);
}
}
});
} catch(error) {
failure(err);
}
// success
}
});
```
Promise Example;
```javascript
findAuthor().
then(findBooksByAuthor).
then(function(books){
// found books
}).catch(function(reason){
// something went wrong
});
```
@method then
@param {Function} onFulfilled
@param {Function} onRejected
Useful for tooling.
@return {Promise}
*/
then,
/**
`catch` is simply sugar for `then(undefined, onRejection)` which makes it the same
as the catch block of a try/catch statement.
```js
function findAuthor(){
throw new Error('couldn't find that author');
}
// synchronous
try {
findAuthor();
} catch(reason) {
// something went wrong
}
// async with promises
findAuthor().catch(function(reason){
// something went wrong
});
```
@method catch
@param {Function} onRejection
Useful for tooling.
@return {Promise}
*/
"catch": function _catch(onRejection) {
return this.then(null, onRejection);
}
};
function polyfill$1() {
var local = void 0;
if (typeof global2 !== "undefined") {
local = global2;
} else if (typeof self !== "undefined") {
local = self;
} else {
try {
local = Function("return this")();
} catch (e) {
throw new Error("polyfill failed because global object is unavailable in this environment");
}
}
var P2 = local.Promise;
if (P2) {
var promiseToString = null;
try {
promiseToString = Object.prototype.toString.call(P2.resolve());
} catch (e) {
}
if (promiseToString === "[object Promise]" && !P2.cast) {
return;
}
}
local.Promise = Promise$22;
}
Promise$22.polyfill = polyfill$1;
Promise$22.Promise = Promise$22;
return Promise$22;
});
}).call(exports3, __webpack_require__(7), __webpack_require__(8));
},
/* 5 */
/***/
function(module3, exports3) {
},
/* 6 */
/***/
function(module3, exports3, __webpack_require__) {
Object.defineProperty(exports3, "__esModule", {
value: true
});
var _createClass = function() {
function defineProperties(target, props) {
for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
}
}
return function(Constructor, protoProps, staticProps) {
if (protoProps)
defineProperties(Constructor.prototype, protoProps);
if (staticProps)
defineProperties(Constructor, staticProps);
return Constructor;
};
}();
__webpack_require__(5);
var _es6Promise = __webpack_require__(4);
var _es6Promise2 = _interopRequireDefault(_es6Promise);
var _utils = __webpack_require__(0);
var Utils = _interopRequireWildcard(_utils);
var _api = __webpack_require__(1);
var API = _interopRequireWildcard(_api);
var _button = __webpack_require__(2);
var _push = __webpack_require__(3);
function _interopRequireWildcard(obj) {
if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key))
newObj[key] = obj[key];
}
}
newObj.default = obj;
return newObj;
}
}
function _interopRequireDefault(obj) {
return obj && obj.__esModule ? obj : { default: obj };
}
function _classCallCheck(instance, Constructor) {
if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
}
}
var Noty2 = function() {
function Noty3() {
var options = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
_classCallCheck(this, Noty3);
this.options = Utils.deepExtend({}, API.Defaults, options);
this.id = this.options.id || Utils.generateID("bar");
this.closeTimer = -1;
this.barDom = null;
this.layoutDom = null;
this.progressDom = null;
this.showing = false;
this.shown = false;
this.closed = false;
this.closing = false;
this.killable = this.options.timeout || this.options.closeWith.length > 0;
this.hasSound = this.options.sounds.sources.length > 0;
this.soundPlayed = false;
this.listeners = {
beforeShow: [],
onShow: [],
afterShow: [],
onClose: [],
afterClose: [],
onClick: [],
onHover: [],
onTemplate: []
};
this.promises = {
show: null,
close: null
};
this.on("beforeShow", this.options.callbacks.beforeShow);
this.on("onShow", this.options.callbacks.onShow);
this.on("afterShow", this.options.callbacks.afterShow);
this.on("onClose", this.options.callbacks.onClose);
this.on("afterClose", this.options.callbacks.afterClose);
this.on("onClick", this.options.callbacks.onClick);
this.on("onHover", this.options.callbacks.onHover);
this.on("onTemplate", this.options.callbacks.onTemplate);
return this;
}
_createClass(Noty3, [{
key: "on",
value: function on2(eventName) {
var cb = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : function() {
};
if (typeof cb === "function" && this.listeners.hasOwnProperty(eventName)) {
this.listeners[eventName].push(cb);
}
return this;
}
/**
* @return {Noty}
*/
}, {
key: "show",
value: function show() {
var _this = this;
if (this.options.killer === true) {
Noty3.closeAll();
} else if (typeof this.options.killer === "string") {
Noty3.closeAll(this.options.killer);
}
var queueCounts = API.getQueueCounts(this.options.queue);
if (queueCounts.current >= queueCounts.maxVisible || API.PageHidden && this.options.visibilityControl) {
API.addToQueue(this);
if (API.PageHidden && this.hasSound && Utils.inArray("docHidden", this.options.sounds.conditions)) {
Utils.createAudioElements(this);
}
if (API.PageHidden && Utils.inArray("docHidden", this.options.titleCount.conditions)) {
API.docTitle.increment();
}
return this;
}
API.Store[this.id] = this;
API.fire(this, "beforeShow");
this.showing = true;
if (this.closing) {
this.showing = false;
return this;
}
API.build(this);
API.handleModal(this);
if (this.options.force) {
this.layoutDom.insertBefore(this.barDom, this.layoutDom.firstChild);
} else {
this.layoutDom.appendChild(this.barDom);
}
if (this.hasSound && !this.soundPlayed && Utils.inArray("docVisible", this.options.sounds.conditions)) {
Utils.createAudioElements(this);
}
if (Utils.inArray("docVisible", this.options.titleCount.conditions)) {
API.docTitle.increment();
}
this.shown = true;
this.closed = false;
if (API.hasButtons(this)) {
Object.keys(this.options.buttons).forEach(function(key) {
var btn = _this.barDom.querySelector("#" + _this.options.buttons[key].id);
Utils.addListener(btn, "click", function(e) {
Utils.stopPropagation(e);
_this.options.buttons[key].cb();
});
});
}
this.progressDom = this.barDom.querySelector(".noty_progressbar");
if (Utils.inArray("click", this.options.closeWith)) {
Utils.addClass(this.barDom, "noty_close_with_click");
Utils.addListener(this.barDom, "click", function(e) {
Utils.stopPropagation(e);
API.fire(_this, "onClick");
_this.close();
}, false);
}
Utils.addListener(this.barDom, "mouseenter", function() {
API.fire(_this, "onHover");
}, false);
if (this.options.timeout)
Utils.addClass(this.barDom, "noty_has_timeout");
if (this.options.progressBar) {
Utils.addClass(this.barDom, "noty_has_progressbar");
}
if (Utils.inArray("button", this.options.closeWith)) {
Utils.addClass(this.barDom, "noty_close_with_button");
var closeButton = document.createElement("div");
Utils.addClass(closeButton, "noty_close_button");
closeButton.innerHTML = "×";
this.barDom.appendChild(closeButton);
Utils.addListener(closeButton, "click", function(e) {
Utils.stopPropagation(e);
_this.close();
}, false);
}
API.fire(this, "onShow");
if (this.options.animation.open === null) {
this.promises.show = new _es6Promise2.default(function(resolve2) {
resolve2();
});
} else if (typeof this.options.animation.open === "function") {
this.promises.show = new _es6Promise2.default(this.options.animation.open.bind(this));
} else {
Utils.addClass(this.barDom, this.options.animation.open);
this.promises.show = new _es6Promise2.default(function(resolve2) {
Utils.addListener(_this.barDom, Utils.animationEndEvents, function() {
Utils.removeClass(_this.barDom, _this.options.animation.open);
resolve2();
});
});
}
this.promises.show.then(function() {
var _t2 = _this;
setTimeout(function() {
API.openFlow(_t2);
}, 100);
});
return this;
}
/**
* @return {Noty}
*/
}, {
key: "stop",
value: function stop() {
API.dequeueClose(this);
return this;
}
/**
* @return {Noty}
*/
}, {
key: "resume",
value: function resume() {
API.queueClose(this);
return this;
}
/**
* @param {int|boolean} ms
* @return {Noty}
*/
}, {
key: "setTimeout",
value: function(_setTimeout) {
function setTimeout2(_x) {
return _setTimeout.apply(this, arguments);
}
setTimeout2.toString = function() {
return _setTimeout.toString();
};
return setTimeout2;
}(function(ms) {
this.stop();
this.options.timeout = ms;
if (this.barDom) {
if (this.options.timeout) {
Utils.addClass(this.barDom, "noty_has_timeout");
} else {
Utils.removeClass(this.barDom, "noty_has_timeout");
}
var _t2 = this;
setTimeout(function() {
_t2.resume();
}, 100);
}
return this;
})
/**
* @param {string} html
* @param {boolean} optionsOverride
* @return {Noty}
*/
}, {
key: "setText",
value: function setText(html2) {
var optionsOverride = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : false;
if (this.barDom) {
this.barDom.querySelector(".noty_body").innerHTML = html2;
}
if (optionsOverride)
this.options.text = html2;
return this;
}
/**
* @param {string} type
* @param {boolean} optionsOverride
* @return {Noty}
*/
}, {
key: "setType",
value: function setType(type2) {
var _this2 = this;
var optionsOverride = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : false;
if (this.barDom) {
var classList = Utils.classList(this.barDom).split(" ");
classList.forEach(function(c) {
if (c.substring(0, 11) === "noty_type__") {
Utils.removeClass(_this2.barDom, c);
}
});
Utils.addClass(this.barDom, "noty_type__" + type2);
}
if (optionsOverride)
this.options.type = type2;
return this;
}
/**
* @param {string} theme
* @param {boolean} optionsOverride
* @return {Noty}
*/
}, {
key: "setTheme",
value: function setTheme(theme) {
var _this3 = this;
var optionsOverride = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : false;
if (this.barDom) {
var classList = Utils.classList(this.barDom).split(" ");
classList.forEach(function(c) {
if (c.substring(0, 12) === "noty_theme__") {
Utils.removeClass(_this3.barDom, c);
}
});
Utils.addClass(this.barDom, "noty_theme__" + theme);
}
if (optionsOverride)
this.options.theme = theme;
return this;
}
/**
* @return {Noty}
*/
}, {
key: "close",
value: function close() {
var _this4 = this;
if (this.closed)
return this;
if (!this.shown) {
API.removeFromQueue(this);
return this;
}
API.fire(this, "onClose");
this.closing = true;
if (this.options.animation.close === null) {
this.promises.close = new _es6Promise2.default(function(resolve2) {
resolve2();
});
} else if (typeof this.options.animation.close === "function") {
this.promises.close = new _es6Promise2.default(this.options.animation.close.bind(this));
} else {
Utils.addClass(this.barDom, this.options.animation.close);
this.promises.close = new _es6Promise2.default(function(resolve2) {
Utils.addListener(_this4.barDom, Utils.animationEndEvents, function() {
if (_this4.options.force) {
Utils.remove(_this4.barDom);
} else {
API.ghostFix(_this4);
}
resolve2();
});
});
}
this.promises.close.then(function() {
API.closeFlow(_this4);
API.handleModalClose(_this4);
});
this.closed = true;
return this;
}
// API functions
/**
* @param {boolean|string} queueName
* @return {Noty}
*/
}], [{
key: "closeAll",
value: function closeAll2() {
var queueName = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : false;
Object.keys(API.Store).forEach(function(id) {
if (queueName) {
if (API.Store[id].options.queue === queueName && API.Store[id].killable) {
API.Store[id].close();
}
} else if (API.Store[id].killable) {
API.Store[id].close();
}
});
return this;
}
/**
* @param {Object} obj
* @return {Noty}
*/
}, {
key: "overrideDefaults",
value: function overrideDefaults(obj) {
API.Defaults = Utils.deepExtend({}, API.Defaults, obj);
return this;
}
/**
* @param {int} amount
* @param {string} queueName
* @return {Noty}
*/
}, {
key: "setMaxVisible",
value: function setMaxVisible() {
var amount = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : API.DefaultMaxVisible;
var queueName = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : "global";
if (!API.Queues.hasOwnProperty(queueName)) {
API.Queues[queueName] = { maxVisible: amount, queue: [] };
}
API.Queues[queueName].maxVisible = amount;
return this;
}
/**
* @param {string} innerHtml
* @param {String} classes
* @param {Function} cb
* @param {Object} attributes
* @return {NotyButton}
*/
}, {
key: "button",
value: function button(innerHtml) {
var classes = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : null;
var cb = arguments[2];
var attributes = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
return new _button.NotyButton(innerHtml, classes, cb, attributes);
}
/**
* @return {string}
*/
}, {
key: "version",
value: function version2() {
return "3.1.4";
}
/**
* @param {String} workerPath
* @return {Push}
*/
}, {
key: "Push",
value: function Push(workerPath) {
return new _push.Push(workerPath);
}
}]);
return Noty3;
}();
exports3.default = Noty2;
Utils.visibilityChangeFlow();
module3.exports = exports3["default"];
},
/* 7 */
/***/
function(module3, exports3) {
var process2 = module3.exports = {};
var cachedSetTimeout;
var cachedClearTimeout;
function defaultSetTimout() {
throw new Error("setTimeout has not been defined");
}
function defaultClearTimeout() {
throw new Error("clearTimeout has not been defined");
}
(function() {
try {
if (typeof setTimeout === "function") {
cachedSetTimeout = setTimeout;
} else {
cachedSetTimeout = defaultSetTimout;
}
} catch (e) {
cachedSetTimeout = defaultSetTimout;
}
try {
if (typeof clearTimeout === "function") {
cachedClearTimeout = clearTimeout;
} else {
cachedClearTimeout = defaultClearTimeout;
}
} catch (e) {
cachedClearTimeout = defaultClearTimeout;
}
})();
function runTimeout(fun) {
if (cachedSetTimeout === setTimeout) {
return setTimeout(fun, 0);
}
if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
cachedSetTimeout = setTimeout;
return setTimeout(fun, 0);
}
try {
return cachedSetTimeout(fun, 0);
} catch (e) {
try {
return cachedSetTimeout.call(null, fun, 0);
} catch (e2) {
return cachedSetTimeout.call(this, fun, 0);
}
}
}
function runClearTimeout(marker) {
if (cachedClearTimeout === clearTimeout) {
return clearTimeout(marker);
}
if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
cachedClearTimeout = clearTimeout;
return clearTimeout(marker);
}
try {
return cachedClearTimeout(marker);
} catch (e) {
try {
return cachedClearTimeout.call(null, marker);
} catch (e2) {
return cachedClearTimeout.call(this, marker);
}
}
}
var queue2 = [];
var draining = false;
var currentQueue;
var queueIndex = -1;
function cleanUpNextTick() {
if (!draining || !currentQueue) {
return;
}
draining = false;
if (currentQueue.length) {
queue2 = currentQueue.concat(queue2);
} else {
queueIndex = -1;
}
if (queue2.length) {
drainQueue();
}
}
function drainQueue() {
if (draining) {
return;
}
var timeout = runTimeout(cleanUpNextTick);
draining = true;
var len = queue2.length;
while (len) {
currentQueue = queue2;
queue2 = [];
while (++queueIndex < len) {
if (currentQueue) {
currentQueue[queueIndex].run();
}
}
queueIndex = -1;
len = queue2.length;
}
currentQueue = null;
draining = false;
runClearTimeout(timeout);
}
process2.nextTick = function(fun) {
var args = new Array(arguments.length - 1);
if (arguments.length > 1) {
for (var i = 1; i < arguments.length; i++) {
args[i - 1] = arguments[i];
}
}
queue2.push(new Item(fun, args));
if (queue2.length === 1 && !draining) {
runTimeout(drainQueue);
}
};
function Item(fun, array2) {
this.fun = fun;
this.array = array2;
}
Item.prototype.run = function() {
this.fun.apply(null, this.array);
};
process2.title = "browser";
process2.browser = true;
process2.env = {};
process2.argv = [];
process2.version = "";
process2.versions = {};
function noop2() {
}
process2.on = noop2;
process2.addListener = noop2;
process2.once = noop2;
process2.off = noop2;
process2.removeListener = noop2;
process2.removeAllListeners = noop2;
process2.emit = noop2;
process2.prependListener = noop2;
process2.prependOnceListener = noop2;
process2.listeners = function(name) {
return [];
};
process2.binding = function(name) {
throw new Error("process.binding is not supported");
};
process2.cwd = function() {
return "/";
};
process2.chdir = function(dir) {
throw new Error("process.chdir is not supported");
};
process2.umask = function() {
return 0;
};
},
/* 8 */
/***/
function(module3, exports3) {
var g;
g = function() {
return this;
}();
try {
g = g || Function("return this")() || (1, eval)("this");
} catch (e) {
if (typeof window === "object")
g = window;
}
module3.exports = g;
},
/* 9 */
/***/
function(module3, exports3) {
}
/******/
])
);
});
})(noty);
var notyExports = noty.exports;
const Noty = /* @__PURE__ */ getDefaultExportFromCjs(notyExports);
var ErrorAction = /* @__PURE__ */ ((ErrorAction2) => {
ErrorAction2["GET_INFO"] = "getInfo";
ErrorAction2["DOWNLOAD"] = "download";
return ErrorAction2;
})(ErrorAction || {});
const en = {
common: {
settings: "Settings",
auto: "Auto",
english: "English",
japanese: "Japanese",
chinese: "Chinese",
pretty: "Pretty",
filter: "Filter",
none: "None",
random: "Random",
balance: "Balance"
},
setting: {
title: "@:common.settings",
advanceTitle: "Advance Settings",
helpButton: "Help",
asteriskTip: "means refresh is required to take effect",
downloadThread: "Download thread",
openOnNewTab: "Open on new tab",
compressionFilename: "Compression filename",
maxNumber: "Max number",
separator: "Separator",
compressionLevel: "Compression level",
filenameLength: "Filename length",
autoCancelDownloadedManga: "Auto cancel downloaded manga",
autoRetryWhenErrorOccurs: "Auto retry when error occurs",
autoShowAll: "Auto show all",
showIgnoreButton: 'Show "Ignore" button',
judgeDownloadedMangaByTitle: "Judge downloaded manga by title",
customDownloadUrl: "Custom download URL",
compressionStreamFiles: 'Compression "streamFiles"',
seriesMode: "Series mode",
streamDownload: "Stream download",
preventConsoleClearing: "Prevent console clearing",
nHentaiDownloadHost: "nHentai download host",
history: {
title: "Download History",
downloadedNumberTip: "You have downloaded {num} manga on this site using nHentai Helper.",
import: "Import",
export: "Export",
clear: "Clear",
clearConfirm: "Are you sure?",
clearConfirmYes: "",
// empty will be default text 'Yes'
clearConfirmNo: "",
// empty will be default text 'No'
importTip: "Tip: Import will not clear the existing history, but merges with it."
}
},
dialog: {
yes: "YES",
no: "NO",
action: {
[ErrorAction.GET_INFO]: "getting information",
[ErrorAction.DOWNLOAD]: "downloading"
},
downloadAgainConfirm: ({ named }) => `<i>${named("title")}</i> is already downloaded${named("hasQueue") ? " or in queue" : ""}.<br>Do you want to download again?`,
errorRetryConfirm: (ctx) => `Error occurred while ${getActionText(ctx)}, retry?`,
errorRetryTip: (ctx) => `Error occurred while ${getActionText(ctx)}, retrying...`,
downloadedTip: "<i>{title}</i> is already downloaded or in queue."
},
button: {
download: "Download",
downloading: "Downloading",
compressing: "Compressing"
}
};
const zh = {
common: {
settings: "设置",
auto: "自动",
english: "英文",
japanese: "日文",
chinese: "中文",
pretty: "简略",
filter: "过滤",
none: "无",
random: "随机",
balance: "均衡"
},
setting: {
title: "@:common.settings",
advanceTitle: "进阶设置",
helpButton: "帮助",
asteriskTip: "表示刷新页面才能生效",
downloadThread: "下载线程数",
openOnNewTab: "在新选项卡打开",
compressionFilename: "压缩文件名",
maxNumber: "最大数量",
separator: "分隔符",
compressionLevel: "压缩等级",
filenameLength: "文件名长度",
autoCancelDownloadedManga: "自动取消下载过的本子",
autoRetryWhenErrorOccurs: "发生错误时自动重试",
autoShowAll: "自动显示全部",
showIgnoreButton: "显示“忽略”按钮",
judgeDownloadedMangaByTitle: "用标题判断本子是否下载过",
customDownloadUrl: "自定义下载地址",
compressionStreamFiles: '压缩 "streamFiles" 选项',
seriesMode: "串行模式",
streamDownload: "流式下载",
preventConsoleClearing: "阻止控制台清空",
nHentaiDownloadHost: "nHentai 下载节点",
history: {
title: "下载历史",
downloadedNumberTip: "你在这个站点上已经用 nHentai 助手下载了 {num} 个本子",
import: "导入",
export: "导出",
clear: "清空",
clearConfirm: "真的吗?",
clearConfirmYes: "真的",
clearConfirmNo: "手滑了",
importTip: "提示:导入会将导入的历史记录与现有历史记录合并,不会清空现有历史记录"
}
},
dialog: {
yes: "是的",
no: "算了",
action: {
[ErrorAction.GET_INFO]: "获取信息",
[ErrorAction.DOWNLOAD]: "下载"
},
downloadAgainConfirm: ({ named }) => `《${named("title")}》已下载过${named("hasQueue") ? "或在队列中" : ""},你希望再次下载吗?`,
errorRetryConfirm: (ctx) => `${getActionText(ctx)}发生错误,是否重试?`,
errorRetryTip: (ctx) => `${getActionText(ctx)}发生错误,重试中……`,
downloadedTip: "《{title}》已经下载过或在队列中"
},
button: {
download: "下载",
downloading: "下载中",
compressing: "压缩中"
}
};
const i18n = createI18n({
legacy: false,
locale: settings.language,
fallbackLocale: "en",
messages: { en, zh }
});
const { t: t$1 } = i18n.global;
const notyConfirmOption = {
type: "error",
layout: "bottomRight",
theme: "nest",
timeout: false,
closeWith: []
};
const downloadAgainConfirm = async (title, hasQueue = false) => {
if (hasQueue && settings.autoCancelDownloadedManga) {
downloadedTip(title);
return false;
}
return new Promise((resolve2) => {
const n = new Noty({
...notyConfirmOption,
text: t$1("dialog.downloadAgainConfirm", { title, hasQueue }),
buttons: [
Noty.button(t$1("dialog.yes"), "btn btn-noty-blue btn-noty", () => {
n.close();
resolve2(true);
}),
Noty.button(t$1("dialog.no"), "btn btn-noty-green btn-noty", () => {
n.close();
resolve2(false);
})
]
});
n.show();
});
};
const errorRetryConfirm = (action, noCb, yesCb) => {
if (settings.autoRetryWhenErrorOccurs) {
errorRetryTip(action);
yesCb == null ? void 0 : yesCb();
return;
}
const n = new Noty({
...notyConfirmOption,
text: t$1("dialog.errorRetryConfirm", { action }),
buttons: [
Noty.button(t$1("dialog.no"), "btn btn-noty-blue btn-noty", () => {
n.close();
noCb == null ? void 0 : noCb();
}),
Noty.button(t$1("dialog.yes"), "btn btn-noty-green btn-noty", () => {
n.close();
yesCb == null ? void 0 : yesCb();
})
]
});
n.show();
};
const downloadedTip = (title) => {
new Noty({
type: "info",
layout: "bottomRight",
theme: "nest",
closeWith: [],
timeout: 4e3,
text: t$1("dialog.downloadedTip", { title })
}).show();
};
const errorRetryTip = (action) => {
new Noty({
type: "warning",
layout: "bottomRight",
theme: "nest",
closeWith: [],
timeout: 3e3,
text: t$1("dialog.errorRetryTip", { action })
}).show();
};
var StreamSaver = { exports: {} };
/*! streamsaver. MIT License. Jimmy Wärting <https://jimmy.warting.se/opensource> */
(function(module2) {
((name, definition) => {
module2.exports = definition();
})("streamSaver", () => {
const global2 = typeof window === "object" ? window : this;
if (!global2.HTMLElement)
console.warn("streamsaver is meant to run on browsers main thread");
let mitmTransporter = null;
let supportsTransferable = false;
const test = (fn2) => {
try {
fn2();
} catch (e) {
}
};
const ponyfill = global2.WebStreamsPolyfill || {};
const isSecureContext = global2.isSecureContext;
let useBlobFallback = /constructor/i.test(global2.HTMLElement) || !!global2.safari || !!global2.WebKitPoint;
const downloadStrategy = isSecureContext || "MozAppearance" in document.documentElement.style ? "iframe" : "navigate";
const streamSaver = {
createWriteStream,
WritableStream: global2.WritableStream || ponyfill.WritableStream,
supported: true,
version: { full: "2.0.5", major: 2, minor: 0, dot: 5 },
mitm: "https://jimmywarting.github.io/StreamSaver.js/mitm.html?version=2.0.0"
};
function makeIframe(src) {
if (!src)
throw new Error("meh");
const iframe = document.createElement("iframe");
iframe.hidden = true;
iframe.src = src;
iframe.loaded = false;
iframe.name = "iframe";
iframe.isIframe = true;
iframe.postMessage = (...args) => iframe.contentWindow.postMessage(...args);
iframe.addEventListener("load", () => {
iframe.loaded = true;
}, { once: true });
document.body.appendChild(iframe);
return iframe;
}
function makePopup(src) {
const options = "width=200,height=100";
const delegate = document.createDocumentFragment();
const popup = {
frame: global2.open(src, "popup", options),
loaded: false,
isIframe: false,
isPopup: true,
remove() {
popup.frame.close();
},
addEventListener(...args) {
delegate.addEventListener(...args);
},
dispatchEvent(...args) {
delegate.dispatchEvent(...args);
},
removeEventListener(...args) {
delegate.removeEventListener(...args);
},
postMessage(...args) {
popup.frame.postMessage(...args);
}
};
const onReady = (evt) => {
if (evt.source === popup.frame) {
popup.loaded = true;
global2.removeEventListener("message", onReady);
popup.dispatchEvent(new Event("load"));
}
};
global2.addEventListener("message", onReady);
return popup;
}
try {
new Response(new ReadableStream());
if (isSecureContext && !("serviceWorker" in navigator)) {
useBlobFallback = true;
}
} catch (err) {
useBlobFallback = true;
}
test(() => {
const { readable } = new TransformStream();
const mc = new MessageChannel();
mc.port1.postMessage(readable, [readable]);
mc.port1.close();
mc.port2.close();
supportsTransferable = true;
Object.defineProperty(streamSaver, "TransformStream", {
configurable: false,
writable: false,
value: TransformStream
});
});
function loadTransporter() {
if (!mitmTransporter) {
mitmTransporter = isSecureContext ? makeIframe(streamSaver.mitm) : makePopup(streamSaver.mitm);
}
}
function createWriteStream(filename, options, size2) {
let opts = {
size: null,
pathname: null,
writableStrategy: void 0,
readableStrategy: void 0
};
let bytesWritten = 0;
let downloadUrl = null;
let channel = null;
let ts = null;
if (Number.isFinite(options)) {
[size2, options] = [options, size2];
console.warn("[StreamSaver] Deprecated pass an object as 2nd argument when creating a write stream");
opts.size = size2;
opts.writableStrategy = options;
} else if (options && options.highWaterMark) {
console.warn("[StreamSaver] Deprecated pass an object as 2nd argument when creating a write stream");
opts.size = size2;
opts.writableStrategy = options;
} else {
opts = options || {};
}
if (!useBlobFallback) {
loadTransporter();
channel = new MessageChannel();
filename = encodeURIComponent(filename.replace(/\//g, ":")).replace(/['()]/g, escape).replace(/\*/g, "%2A");
const response = {
transferringReadable: supportsTransferable,
pathname: opts.pathname || Math.random().toString().slice(-6) + "/" + filename,
headers: {
"Content-Type": "application/octet-stream; charset=utf-8",
"Content-Disposition": "attachment; filename*=UTF-8''" + filename
}
};
if (opts.size) {
response.headers["Content-Length"] = opts.size;
}
const args = [response, "*", [channel.port2]];
if (supportsTransferable) {
const transformer = downloadStrategy === "iframe" ? void 0 : {
// This transformer & flush method is only used by insecure context.
transform(chunk, controller) {
if (!(chunk instanceof Uint8Array)) {
throw new TypeError("Can only write Uint8Arrays");
}
bytesWritten += chunk.length;
controller.enqueue(chunk);
if (downloadUrl) {
location.href = downloadUrl;
downloadUrl = null;
}
},
flush() {
if (downloadUrl) {
location.href = downloadUrl;
}
}
};
ts = new streamSaver.TransformStream(
transformer,
opts.writableStrategy,
opts.readableStrategy
);
const readableStream = ts.readable;
channel.port1.postMessage({ readableStream }, [readableStream]);
}
channel.port1.onmessage = (evt) => {
if (evt.data.download) {
if (downloadStrategy === "navigate") {
mitmTransporter.remove();
mitmTransporter = null;
if (bytesWritten) {
location.href = evt.data.download;
} else {
downloadUrl = evt.data.download;
}
} else {
if (mitmTransporter.isPopup) {
mitmTransporter.remove();
mitmTransporter = null;
if (downloadStrategy === "iframe") {
makeIframe(streamSaver.mitm);
}
}
makeIframe(evt.data.download);
}
} else if (evt.data.abort) {
chunks = [];
channel.port1.postMessage("abort");
channel.port1.onmessage = null;
channel.port1.close();
channel.port2.close();
channel = null;
}
};
if (mitmTransporter.loaded) {
mitmTransporter.postMessage(...args);
} else {
mitmTransporter.addEventListener("load", () => {
mitmTransporter.postMessage(...args);
}, { once: true });
}
}
let chunks = [];
return !useBlobFallback && ts && ts.writable || new streamSaver.WritableStream({
write(chunk) {
if (!(chunk instanceof Uint8Array)) {
throw new TypeError("Can only write Uint8Arrays");
}
if (useBlobFallback) {
chunks.push(chunk);
return;
}
channel.port1.postMessage(chunk);
bytesWritten += chunk.length;
if (downloadUrl) {
location.href = downloadUrl;
downloadUrl = null;
}
},
close() {
if (useBlobFallback) {
const blob2 = new Blob(chunks, { type: "application/octet-stream; charset=utf-8" });
const link = document.createElement("a");
link.href = URL.createObjectURL(blob2);
link.download = filename;
link.click();
} else {
channel.port1.postMessage("end");
}
},
abort() {
chunks = [];
channel.port1.postMessage("abort");
channel.port1.onmessage = null;
channel.port1.close();
channel.port2.close();
channel = null;
}
}, opts.writableStrategy);
}
return streamSaver;
});
})(StreamSaver);
var StreamSaverExports = StreamSaver.exports;
class MultiThread {
constructor(tasks, taskFunc, params) {
__publicField(this, "threads", []);
__publicField(this, "taskIndex", 0);
__publicField(this, "started", false);
__publicField(this, "aborted", false);
this.tasks = tasks;
this.taskFunc = taskFunc;
this.params = params;
}
startThread(threadId) {
let abortFunc;
const threadPromise = (async () => {
while (true) {
if (this.aborted)
break;
const i = this.taskIndex++;
if (i >= this.tasks.length)
break;
const { abort, promise } = this.taskFunc(this.tasks[i], threadId, this.params);
abortFunc = abort;
await promise;
}
})();
return {
abort: () => abortFunc == null ? void 0 : abortFunc(),
promise: threadPromise
};
}
start() {
if (this.started)
throw new Error("Multi-thread started.");
this.started = true;
for (let threadId = 0; threadId < settings.threadNum; threadId++) {
this.threads.push(this.startThread(threadId));
}
return {
abort: () => {
this.aborted = true;
this.threads.forEach(({ abort }) => abort());
},
promise: Promise.all(this.threads.map(({ promise }) => promise)).then()
};
}
}
class RequestAbortError extends Error {
constructor(url) {
super(`Request abort ${url}`);
}
}
const isAbortError = (e) => e instanceof RequestAbortError;
const request = (url, responseType, retry = 3) => {
let abortFunc;
const dataPromise = new Promise((resolve2, reject) => {
try {
const req = _GM_xmlhttpRequest({
method: "GET",
url,
responseType,
onerror: (e) => {
if (retry === 0) {
logger.error("Network error", url, e);
reject(e);
} else {
logger.warn("Network error, retry", url, e);
setTimeout(() => {
const { abort, dataPromise: dataPromise2 } = request(url, responseType, retry - 1);
abortFunc = abort;
resolve2(dataPromise2);
}, 1e3);
}
},
onload: (r) => {
const { status, response } = r;
if (status === 200)
resolve2(response);
else if (retry === 0)
reject(r);
else {
logger.warn("Request error, retry", status, url, r);
setTimeout(() => {
const { abort, dataPromise: dataPromise2 } = request(url, responseType, retry - 1);
abortFunc = abort;
resolve2(dataPromise2);
}, 1e3);
}
}
});
abortFunc = () => {
req.abort();
logger.log("Request abort", url);
reject(new RequestAbortError(url));
};
} catch (error) {
reject(error);
}
});
return {
abort: () => abortFunc == null ? void 0 : abortFunc(),
dataPromise
};
};
const getText = (url) => request(url).dataPromise;
const fetchJSON = (url) => fetch(url).then((r) => r.json());
class Counter {
constructor(keys2) {
__publicField(this, "countMap", {});
__publicField(this, "countKeys");
if (!keys2.length)
throw new Error("Counter no key");
this.countKeys = [...keys2];
this.countKeys.forEach((key) => {
this.countMap[key] = 0;
});
}
add(key) {
this.countMap[key]++;
}
del(key) {
this.countMap[key]--;
}
getMin() {
return minBy(this.countKeys, (key) => this.countMap[key]);
}
}
var NHentaiImgExt = /* @__PURE__ */ ((NHentaiImgExt2) => {
NHentaiImgExt2["j"] = "jpg";
NHentaiImgExt2["p"] = "png";
NHentaiImgExt2["g"] = "gif";
return NHentaiImgExt2;
})(NHentaiImgExt || {});
const nHentaiImgExtReversed = invert$1(NHentaiImgExt);
const getTypeFromExt = (ext) => nHentaiImgExtReversed[ext.toLowerCase()];
const nHentaiDownloadHostCounter = new Counter(nHentaiDownloadHosts);
const getNHentaiDownloadHost = () => {
switch (settings.nHentaiDownloadHost) {
case NHentaiDownloadHostSpecial.RANDOM:
return sample(nHentaiDownloadHosts);
case NHentaiDownloadHostSpecial.BALANCE:
return nHentaiDownloadHostCounter.getMin();
default:
return settings.nHentaiDownloadHost;
}
};
const getMediaDownloadUrl = IS_NHENTAI ? (mid, filename) => `https://${getNHentaiDownloadHost()}/galleries/${mid}/${filename}` : IS_NHENTAI_TO ? (mid, filename) => `https://cdn.nload.xyz/galleries/${mid}/${filename}` : (mid, filename) => `https://cdn.nhentai.xxx/g/${mid}/${filename}`;
const getGalleryFromApi = (gid2) => {
const url = `https://nhentai.net/api/gallery/${gid2}`;
return fetchJSON(url);
};
const getGalleryFromWebpage = async (gid) => {
var _a2;
let doc = document;
if (!IS_PAGE_MANGA_DETAIL) {
const html = await getText(`/g/${gid}`);
const match = (_a2 = /gallery(\(\{[\s\S]+\}\));/.exec(html)) == null ? void 0 : _a2[1];
if (match) {
try {
const gallery = eval(match);
gallery.id = Number(gid);
} catch {
logger.warn("get gallery by eval failed");
}
}
const parser = new DOMParser();
doc = parser.parseFromString(html, "text/html");
}
const $doc = $(doc.body);
const english = $doc.find("#info h1").text();
const japanese = $doc.find("#info h2").text();
const pages = [];
let mediaId = "";
$doc.find("#thumbnail-container img").each((i, img) => {
const src = img.dataset.src ?? img.src;
const match2 = /\/(\d+)\/(\d+)t?\.(\w+)/.exec(src);
if (!match2)
return;
const [, mid, index2, ext] = match2;
if (!mediaId)
mediaId = mid;
const t2 = getTypeFromExt(ext);
if (!t2)
return;
pages[Number(index2) - 1] = { t: t2 };
});
if (!english && !japanese || !mediaId || !pages.length) {
throw new Error("Get gallery info error.");
}
const $artistTags = $("#tags .tag-container:contains(Artists:) .tag > .name");
const artists = filter(Array.from($artistTags).map((el) => el.innerText.trim()));
const tags = artists.map((name) => ({ type: "artist", name }));
return {
id: Number(gid),
media_id: mediaId,
title: {
english: english || japanese,
japanese: japanese || english,
pretty: ""
},
images: {
pages
},
tags
};
};
const getCFNameArtists = (tags2) => {
const artists2 = map(
tags2.filter(({ name, type: type2 }) => type2 === "artist" && name),
"name"
);
if (!artists2.length)
return "none";
const maxNum = settings.filenameMaxArtistsNumber;
if (maxNum && artists2.length > maxNum)
return "various";
return artists2.join(settings.filenameArtistsSeparator);
};
const getGallery = async (gid2) => {
const gallery2 = IS_NHENTAI ? await getGalleryFromApi(gid2) : await getGalleryFromWebpage(gid2);
logger.log("gallery", gallery2);
return gallery2;
};
const getGalleryInfo = async (gid2) => {
const {
id,
media_id,
title,
images: { pages: pages2 },
num_pages,
tags: tags2
} = await (async () => {
var _a2;
if (gid2)
return getGallery(gid2);
const gidFromUrl = (_a2 = /^\/g\/(\d+)/.exec(location.pathname)) == null ? void 0 : _a2[1];
const localGallery = _unsafeWindow._gallery ?? _unsafeWindow.gallery;
if (localGallery) {
if (gidFromUrl)
localGallery.id = Number(gidFromUrl);
return localGallery;
}
if (gidFromUrl)
return getGallery(gidFromUrl);
throw new Error("Cannot get gallery info.");
})();
const { english: english2, japanese: japanese2, pretty } = title;
const infoPages = (Array.isArray(pages2) ? pages2 : Object.values(pages2)).map(
(img, i) => ({ i: i + 1, t: NHentaiImgExt[img.t] })
);
const info = {
gid: id,
mid: media_id,
title,
pages: infoPages,
cfName: compileTemplate(settings.compressionFilename)({
english: english2 || japanese2,
japanese: japanese2 || english2,
pretty: pretty || english2 || japanese2,
id,
pages: num_pages,
artist: getCFNameArtists(tags2)
}).replace(/[/\\:*?"<>|]/g, "")
};
logger.log("info", info);
return info;
};
const downloadGalleryByInfo = async (info, { progressDisplayController, rangeCheckers } = {}) => {
info.done = 0;
let { mid, pages: pages2, cfName } = info.gallery;
if (rangeCheckers == null ? void 0 : rangeCheckers.length) {
pages2 = pages2.filter(({ i }) => rangeCheckers.some((check) => check(i)));
}
let aborted = false;
info.cancel = () => {
aborted = true;
progressDisplayController == null ? void 0 : progressDisplayController.reset();
};
progressDisplayController == null ? void 0 : progressDisplayController.bindInfo(info);
progressDisplayController == null ? void 0 : progressDisplayController.updateProgress();
const zip = new JSZip();
const downloadTask = (page, threadID, { filenameLength, customDownloadUrl }) => {
if (info.error)
return { abort: () => {
}, promise: Promise.resolve() };
const url = customDownloadUrl ? compileTemplate(customDownloadUrl)({ mid, index: page.i, ext: page.t }) : getMediaDownloadUrl(mid, `${page.i}.${page.t}`);
logger.log(`[${threadID}] ${url}`);
const isUsingCounter = IS_NHENTAI && !customDownloadUrl && settings.nHentaiDownloadHost === NHentaiDownloadHostSpecial.BALANCE;
const counterKey = isUsingCounter ? new URL(url).host : "";
if (isUsingCounter) {
nHentaiDownloadHostCounter.add(counterKey);
}
const { abort: abort2, dataPromise } = request(url, "arraybuffer");
return {
abort: () => {
logger.log(`[${threadID}] abort`);
abort2();
},
promise: dataPromise.then(async (data) => {
if (data) {
zip.file(`${String(page.i).padStart(filenameLength || 0, "0")}.${page.t}`, data);
}
info.done++;
progressDisplayController == null ? void 0 : progressDisplayController.updateProgress();
}).catch((e) => {
if (isAbortError(e))
return;
info.error = true;
throw e;
}).finally(() => {
if (isUsingCounter) {
nHentaiDownloadHostCounter.del(counterKey);
}
})
};
};
const multiThread = new MultiThread(pages2, downloadTask, {
filenameLength: settings.filenameLength === "auto" ? Math.ceil(Math.log10(Math.max(...pages2.map(({ i }) => Number(i))))) : settings.filenameLength,
customDownloadUrl: settings.customDownloadUrl
});
const { abort, promise } = multiThread.start();
info.cancel = () => {
aborted = true;
abort();
progressDisplayController == null ? void 0 : progressDisplayController.reset();
};
if (!aborted)
await promise;
if (aborted)
return;
return async () => {
info.compressing = true;
progressDisplayController == null ? void 0 : progressDisplayController.updateProgress();
logger.log("start compressing", cfName);
let lastZipFile = "";
const onCompressionUpdate = ({ workerId, percent, currentFile }) => {
if (lastZipFile !== currentFile && currentFile) {
lastZipFile = currentFile;
logger.log(`[${workerId}] compressing ${percent.toFixed(2)}%`, currentFile);
}
info.compressingPercent = percent.toFixed(2);
progressDisplayController == null ? void 0 : progressDisplayController.updateProgress();
};
if (settings.streamDownload) {
logger.log("stream mode on");
const fileStream = StreamSaverExports.createWriteStream(cfName);
const zipStream = await zip.generateStream(getCompressionOptions(), onCompressionUpdate);
await zipStream.pipeTo(fileStream);
} else {
const data = await zip.generateAsync(getCompressionOptions(), onCompressionUpdate);
FileSaver_minExports.saveAs(new File([data], cfName, { type: "application/zip" }));
}
logger.log("completed", cfName);
progressDisplayController == null ? void 0 : progressDisplayController.complete();
progressDisplayController == null ? void 0 : progressDisplayController.unbindInfo();
};
};
const addDownloadGalleryTask = (gallery2, { progressDisplayController, markGalleryDownloaded } = {}) => {
const info = reactive(createMangaDownloadInfo(gallery2));
info.cancel = () => {
progressDisplayController == null ? void 0 : progressDisplayController.reset();
};
dlQueue.push(async () => {
const zipFunc = await downloadGalleryByInfo(info, { progressDisplayController }).catch((e) => {
progressDisplayController == null ? void 0 : progressDisplayController.error();
errorRetryConfirm(
ErrorAction.DOWNLOAD,
() => {
dlQueue.skipFromError().catch(logger.error);
},
() => {
info.error = false;
dlQueue.restartFromError().catch(logger.error);
}
);
throw e;
});
if (zipFunc) {
zipQueue.push(async () => {
try {
await zipFunc();
markAsDownloaded(gallery2.gid, gallery2.title);
markGalleryDownloaded == null ? void 0 : markGalleryDownloaded();
} catch (error) {
if (!error)
logger.warn("user abort stream download");
logger.error(error);
progressDisplayController == null ? void 0 : progressDisplayController.error();
}
}, info);
zipQueue.start().catch(logger.error);
}
}, info);
dlQueue.start().catch(logger.error);
};
const { t } = i18n.global;
class ProgressDisplayController {
constructor(enableHeadTxt = false, docTitle) {
__publicField(this, "downloadBtn");
__publicField(this, "btnTxt");
__publicField(this, "info");
this.enableHeadTxt = enableHeadTxt;
this.docTitle = docTitle;
this.btnTxt = /* @__PURE__ */ jsx.createElement("span", { class: "download-zip-txt" }, this.defaultBtnText());
this.downloadBtn = /* @__PURE__ */ jsx.createElement("button", { class: "btn btn-secondary nhentai-helper-btn download-zip-btn" }, /* @__PURE__ */ jsx.createElement("i", { class: "fa fa-download" }), " ", this.btnTxt);
}
get compressingHeadText() {
return this.enableHeadTxt ? `${t("button.compressing")} ${getDownloadExt()} ` : "";
}
get downloadingHeadText() {
return this.enableHeadTxt ? `${t("button.downloading")} ${getDownloadExt()} ` : "";
}
defaultBtnText(suffix) {
if (!this.enableHeadTxt)
return suffix ?? "";
return `${t("button.download")} ${getDownloadExt()}${suffix ? ` ${suffix}` : ""}`;
}
bindInfo(info) {
this.info = info;
}
unbindInfo() {
this.info = void 0;
}
lockBtn(text) {
this.downloadBtn.setAttribute("disabled", "disabled");
if (text)
this.btnTxt.innerText = text;
}
releaseBtn() {
this.downloadBtn.removeAttribute("disabled");
}
complete() {
this.setDocTitle("✓");
this.btnTxt.innerText = this.defaultBtnText("✓");
this.releaseBtn();
}
reset() {
this.setDocTitle();
this.btnTxt.innerText = this.defaultBtnText();
this.releaseBtn();
}
error() {
this.releaseBtn();
this.btnTxt.innerText = "Error";
this.setDocTitle("×");
}
updateProgress() {
if (!this.info)
return;
const { done, compressing, compressingPercent } = this.info;
if (compressing) {
this.setDocTitle(`${compressingPercent}%`);
this.btnTxt.innerText = `${this.compressingHeadText}${compressingPercent}%`;
} else {
const total = this.info.gallery.pages.length;
this.setDocTitle(`${done}/${total}`);
this.btnTxt.innerText = `${this.downloadingHeadText}${done}/${total}`;
}
}
setDocTitle(prefix) {
if (!this.docTitle)
return;
document.title = prefix ? `[${prefix}] ${this.docTitle}` : this.docTitle;
}
}
class IgnoreController {
constructor(text = true, status = false) {
__publicField(this, "ignoreBtn");
__publicField(this, "icon");
__publicField(this, "text");
this.status = status;
this.icon = /* @__PURE__ */ jsx.createElement("i", { class: this.iconClass });
if (text)
this.text = /* @__PURE__ */ jsx.createElement("span", null, this.btnText);
this.ignoreBtn = /* @__PURE__ */ jsx.createElement("button", { class: "btn btn-secondary nhentai-helper-btn ignore-btn" }, this.icon, " ", this.text);
}
setStatus(status) {
this.status = status;
this.updateBtn();
}
getStatus() {
return this.status;
}
get iconClass() {
return this.status ? "fa fa-eye-slash" : "fa fa-eye";
}
get btnText() {
return this.status ? "Unignore this" : "Ignore this";
}
updateBtn() {
this.icon.className = this.iconClass;
if (this.text)
this.text.innerText = this.btnText;
}
}
const initDetailPage = async () => {
const progressDisplayController = new ProgressDisplayController(true, document.title);
const { downloadBtn } = progressDisplayController;
const pagesInput = /* @__PURE__ */ jsx.createElement("input", { class: "pages-input", placeholder: "Download pages (e.g. 1-10,12,14,18-)" });
$("#info > .buttons").append(downloadBtn).after(pagesInput);
let ignoreController;
if (settings.showIgnoreButton) {
const gallery2 = await getGalleryInfo();
const isDownloaded = await isDownloadedByGid(gallery2.gid);
ignoreController = new IgnoreController(true, isDownloaded);
const { ignoreBtn } = ignoreController;
ignoreBtn.addEventListener("click", () => {
const ignore = ignoreController.getStatus();
if (ignore)
unmarkAsDownloaded(gallery2.gid, gallery2.title);
else
markAsDownloaded(gallery2.gid, gallery2.title);
ignoreController.setStatus(!ignore);
});
$("#info > .buttons").append(ignoreBtn);
}
downloadBtn.addEventListener("click", async () => {
var _a2;
const gallery2 = await getGalleryInfo();
const rangeCheckers = pagesInput.value.split(",").filter((range2) => !Number.isNaN(parseInt(range2))).map((range2) => {
const [start, end2] = range2.split("-").map((num) => parseInt(num));
if (typeof end2 === "undefined")
return (page) => page === start;
else if (Number.isNaN(end2))
return (page) => page >= start;
else
return (page) => start <= page && page <= end2;
});
progressDisplayController.lockBtn();
try {
const downloaded = await isDownloadedByGid(gallery2.gid) || await isDownloadedByTitle(gallery2.title);
if (downloaded && !await downloadAgainConfirm(gallery2.title.japanese || gallery2.title.english)) {
progressDisplayController.reset();
markAsDownloaded(gallery2.gid, gallery2.title);
ignoreController == null ? void 0 : ignoreController.setStatus(true);
return;
}
await ((_a2 = await downloadGalleryByInfo(createMangaDownloadInfo(gallery2), {
progressDisplayController,
rangeCheckers
})) == null ? void 0 : _a2());
markAsDownloaded(gallery2.gid, gallery2.title);
ignoreController == null ? void 0 : ignoreController.setStatus(true);
} catch (error) {
progressDisplayController.error();
logger.error(error);
}
});
applyAutoShowAll();
};
const applyAutoShowAll = () => {
if (settings.autoShowAll) {
getShowAllBtn().then(($btn) => $btn.trigger("click")).catch(logger.error);
}
};
function tryOnScopeDispose(fn2) {
if (getCurrentScope()) {
onScopeDispose(fn2);
return true;
}
return false;
}
function toValue(r) {
return typeof r === "function" ? r() : unref(r);
}
const isClient = typeof window !== "undefined";
const noop = () => {
};
function createFilterWrapper(filter2, fn2) {
function wrapper(...args) {
return new Promise((resolve2, reject) => {
Promise.resolve(filter2(() => fn2.apply(this, args), { fn: fn2, thisArg: this, args })).then(resolve2).catch(reject);
});
}
return wrapper;
}
const bypassFilter = (invoke) => {
return invoke();
};
function pausableFilter(extendFilter = bypassFilter) {
const isActive = ref(true);
function pause() {
isActive.value = false;
}
function resume() {
isActive.value = true;
}
const eventFilter = (...args) => {
if (isActive.value)
extendFilter(...args);
};
return { isActive: readonly(isActive), pause, resume, eventFilter };
}
var __getOwnPropSymbols$8 = Object.getOwnPropertySymbols;
var __hasOwnProp$8 = Object.prototype.hasOwnProperty;
var __propIsEnum$8 = Object.prototype.propertyIsEnumerable;
var __objRest$5 = (source, exclude) => {
var target = {};
for (var prop in source)
if (__hasOwnProp$8.call(source, prop) && exclude.indexOf(prop) < 0)
target[prop] = source[prop];
if (source != null && __getOwnPropSymbols$8)
for (var prop of __getOwnPropSymbols$8(source)) {
if (exclude.indexOf(prop) < 0 && __propIsEnum$8.call(source, prop))
target[prop] = source[prop];
}
return target;
};
function watchWithFilter(source, cb, options = {}) {
const _a2 = options, {
eventFilter = bypassFilter
} = _a2, watchOptions = __objRest$5(_a2, [
"eventFilter"
]);
return watch(
source,
createFilterWrapper(
eventFilter,
cb
),
watchOptions
);
}
var __defProp$2 = Object.defineProperty;
var __defProps$2 = Object.defineProperties;
var __getOwnPropDescs$2 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$2 = Object.getOwnPropertySymbols;
var __hasOwnProp$2 = Object.prototype.hasOwnProperty;
var __propIsEnum$2 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$2 = (obj, key, value) => key in obj ? __defProp$2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$2 = (a, b) => {
for (var prop in b || (b = {}))
if (__hasOwnProp$2.call(b, prop))
__defNormalProp$2(a, prop, b[prop]);
if (__getOwnPropSymbols$2)
for (var prop of __getOwnPropSymbols$2(b)) {
if (__propIsEnum$2.call(b, prop))
__defNormalProp$2(a, prop, b[prop]);
}
return a;
};
var __spreadProps$2 = (a, b) => __defProps$2(a, __getOwnPropDescs$2(b));
var __objRest$1 = (source, exclude) => {
var target = {};
for (var prop in source)
if (__hasOwnProp$2.call(source, prop) && exclude.indexOf(prop) < 0)
target[prop] = source[prop];
if (source != null && __getOwnPropSymbols$2)
for (var prop of __getOwnPropSymbols$2(source)) {
if (exclude.indexOf(prop) < 0 && __propIsEnum$2.call(source, prop))
target[prop] = source[prop];
}
return target;
};
function watchPausable(source, cb, options = {}) {
const _a2 = options, {
eventFilter: filter2
} = _a2, watchOptions = __objRest$1(_a2, [
"eventFilter"
]);
const { eventFilter, pause, resume, isActive } = pausableFilter(filter2);
const stop = watchWithFilter(
source,
cb,
__spreadProps$2(__spreadValues$2({}, watchOptions), {
eventFilter
})
);
return { stop, pause, resume, isActive };
}
function unrefElement(elRef) {
var _a2;
const plain = toValue(elRef);
return (_a2 = plain == null ? void 0 : plain.$el) != null ? _a2 : plain;
}
const defaultWindow = isClient ? window : void 0;
function useEventListener(...args) {
let target;
let events;
let listeners;
let options;
if (typeof args[0] === "string" || Array.isArray(args[0])) {
[events, listeners, options] = args;
target = defaultWindow;
} else {
[target, events, listeners, options] = args;
}
if (!target)
return noop;
if (!Array.isArray(events))
events = [events];
if (!Array.isArray(listeners))
listeners = [listeners];
const cleanups = [];
const cleanup = () => {
cleanups.forEach((fn2) => fn2());
cleanups.length = 0;
};
const register = (el, event, listener, options2) => {
el.addEventListener(event, listener, options2);
return () => el.removeEventListener(event, listener, options2);
};
const stopWatch = watch(
() => [unrefElement(target), toValue(options)],
([el, options2]) => {
cleanup();
if (!el)
return;
cleanups.push(
...events.flatMap((event) => {
return listeners.map((listener) => register(el, event, listener, options2));
})
);
},
{ immediate: true, flush: "post" }
);
const stop = () => {
stopWatch();
cleanup();
};
tryOnScopeDispose(stop);
return stop;
}
const _global = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
const globalKey = "__vueuse_ssr_handlers__";
const handlers = /* @__PURE__ */ getHandlers();
function getHandlers() {
if (!(globalKey in _global))
_global[globalKey] = _global[globalKey] || {};
return _global[globalKey];
}
function getSSRHandler(key, fallback) {
return handlers[key] || fallback;
}
function guessSerializerType(rawInit) {
return rawInit == null ? "any" : rawInit instanceof Set ? "set" : rawInit instanceof Map ? "map" : rawInit instanceof Date ? "date" : typeof rawInit === "boolean" ? "boolean" : typeof rawInit === "string" ? "string" : typeof rawInit === "object" ? "object" : !Number.isNaN(rawInit) ? "number" : "any";
}
var __defProp$k = Object.defineProperty;
var __getOwnPropSymbols$n = Object.getOwnPropertySymbols;
var __hasOwnProp$n = Object.prototype.hasOwnProperty;
var __propIsEnum$n = Object.prototype.propertyIsEnumerable;
var __defNormalProp$k = (obj, key, value) => key in obj ? __defProp$k(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$k = (a, b) => {
for (var prop in b || (b = {}))
if (__hasOwnProp$n.call(b, prop))
__defNormalProp$k(a, prop, b[prop]);
if (__getOwnPropSymbols$n)
for (var prop of __getOwnPropSymbols$n(b)) {
if (__propIsEnum$n.call(b, prop))
__defNormalProp$k(a, prop, b[prop]);
}
return a;
};
const StorageSerializers = {
boolean: {
read: (v) => v === "true",
write: (v) => String(v)
},
object: {
read: (v) => JSON.parse(v),
write: (v) => JSON.stringify(v)
},
number: {
read: (v) => Number.parseFloat(v),
write: (v) => String(v)
},
any: {
read: (v) => v,
write: (v) => String(v)
},
string: {
read: (v) => v,
write: (v) => String(v)
},
map: {
read: (v) => new Map(JSON.parse(v)),
write: (v) => JSON.stringify(Array.from(v.entries()))
},
set: {
read: (v) => new Set(JSON.parse(v)),
write: (v) => JSON.stringify(Array.from(v))
},
date: {
read: (v) => new Date(v),
write: (v) => v.toISOString()
}
};
const customStorageEventName = "vueuse-storage";
function useStorage(key, defaults, storage, options = {}) {
var _a2;
const {
flush = "pre",
deep = true,
listenToStorageChanges = true,
writeDefaults = true,
mergeDefaults = false,
shallow,
window: window2 = defaultWindow,
eventFilter,
onError = (e) => {
console.error(e);
}
} = options;
const data = (shallow ? shallowRef : ref)(defaults);
if (!storage) {
try {
storage = getSSRHandler("getDefaultStorage", () => {
var _a22;
return (_a22 = defaultWindow) == null ? void 0 : _a22.localStorage;
})();
} catch (e) {
onError(e);
}
}
if (!storage)
return data;
const rawInit = toValue(defaults);
const type2 = guessSerializerType(rawInit);
const serializer = (_a2 = options.serializer) != null ? _a2 : StorageSerializers[type2];
const { pause: pauseWatch, resume: resumeWatch } = watchPausable(
data,
() => write(data.value),
{ flush, deep, eventFilter }
);
if (window2 && listenToStorageChanges) {
useEventListener(window2, "storage", update);
useEventListener(window2, customStorageEventName, updateFromCustomEvent);
}
update();
return data;
function write(v) {
try {
if (v == null) {
storage.removeItem(key);
} else {
const serialized = serializer.write(v);
const oldValue = storage.getItem(key);
if (oldValue !== serialized) {
storage.setItem(key, serialized);
if (window2) {
window2.dispatchEvent(new CustomEvent(customStorageEventName, {
detail: {
key,
oldValue,
newValue: serialized,
storageArea: storage
}
}));
}
}
}
} catch (e) {
onError(e);
}
}
function read(event) {
const rawValue = event ? event.newValue : storage.getItem(key);
if (rawValue == null) {
if (writeDefaults && rawInit !== null)
storage.setItem(key, serializer.write(rawInit));
return rawInit;
} else if (!event && mergeDefaults) {
const value = serializer.read(rawValue);
if (typeof mergeDefaults === "function")
return mergeDefaults(value, rawInit);
else if (type2 === "object" && !Array.isArray(value))
return __spreadValues$k(__spreadValues$k({}, rawInit), value);
return value;
} else if (typeof rawValue !== "string") {
return rawValue;
} else {
return serializer.read(rawValue);
}
}
function updateFromCustomEvent(event) {
update(event.detail);
}
function update(event) {
if (event && event.storageArea !== storage)
return;
if (event && event.key == null) {
data.value = rawInit;
return;
}
if (event && event.key !== key)
return;
pauseWatch();
try {
data.value = read(event);
} catch (e) {
onError(e);
} finally {
if (event)
nextTick(resumeWatch);
else
resumeWatch();
}
}
}
function useSessionStorage(key, initialValue, options = {}) {
const { window: window2 = defaultWindow } = options;
return useStorage(key, initialValue, window2 == null ? void 0 : window2.sessionStorage, options);
}
const _hoisted_1 = { class: "language-filter" };
const _hoisted_2 = ["value"];
const _sfc_main = /* @__PURE__ */ defineComponent({
__name: "LanguageFilter",
setup(__props, { expose: expose2 }) {
const { t: t2 } = i18n.global;
const languageFilter = useSessionStorage("languageFilter", "0", { listenToStorageChanges: false });
const options = IS_NHENTAI_TO ? [
["none", "0"],
["japanese", "2"],
["english", "19"],
["chinese", "10197"]
] : [
["none", "0"],
["japanese", "6346"],
["english", "12227"],
["chinese", "29963"]
];
watch(
languageFilter,
(val) => {
filterLanguage(val);
},
{ immediate: true }
);
expose2({
filterLanguage: ($node) => {
filterLanguage(languageFilter.value, $node);
}
});
return (_ctx, _cache) => {
return openBlock(), createElementBlock("li", _hoisted_1, [
createTextVNode(toDisplayString$1(unref(t2)("common.filter")) + " ", 1),
withDirectives(createBaseVNode("select", {
"onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => isRef(languageFilter) ? languageFilter.value = $event : null)
}, [
(openBlock(true), createElementBlock(Fragment$1, null, renderList(unref(options), ([key, val]) => {
return openBlock(), createElementBlock("option", {
key,
value: val
}, toDisplayString$1(unref(t2)(`common.${key}`)), 9, _hoisted_2);
}), 128))
], 512), [
[vModelSelect, unref(languageFilter)]
])
]);
};
}
});
const LanguageFilter = /* @__PURE__ */ _export_sfc$1(_sfc_main, [["__scopeId", "data-v-6873bccd"]]);
const filterLanguage = (tag, $node) => {
const getNode = $node ? (selector) => $node.find(selector) : (selector) => $(selector);
if (tag === "0")
getNode(".gallery").removeClass("hidden");
else {
getNode(`.gallery[data-tags~=${tag}]`).removeClass("hidden");
getNode(`.gallery:not([data-tags~=${tag}])`).addClass("hidden");
}
};
const mountLanguageFilter = () => {
var _a2;
const menuLeft = document.querySelector("ul.menu.left");
if (!menuLeft)
return {};
const vnode = h(LanguageFilter);
render(vnode, menuLeft);
return ((_a2 = vnode.component) == null ? void 0 : _a2.exposed) ?? {};
};
const initListPage = () => {
$(".gallery").each(initGallery);
const { filterLanguage: filterLanguage2 } = mountLanguageFilter();
initShortcut();
restoreDownloadQueue();
const contentEl = $("#content")[0];
if (contentEl) {
new MutationObserver((mutations) => {
mutations.forEach(({ addedNodes }) => {
addedNodes.forEach((node) => {
const $el = $(node);
$el.find(".gallery").each(initGallery);
filterLanguage2 == null ? void 0 : filterLanguage2($el);
});
});
}).observe(contentEl, { childList: true });
}
};
const initShortcut = () => {
$(document).on("keydown", (event) => {
switch (event.key) {
case "ArrowLeft":
$(".pagination .previous").trigger("click");
break;
case "ArrowRight":
$(".pagination .next").trigger("click");
break;
}
});
};
const restoreDownloadQueue = () => {
const galleriesJson = sessionStorage.getItem("downloadQueue");
if (!galleriesJson)
return;
try {
const galleries = JSON.parse(galleriesJson);
for (const gallery2 of galleries) {
addDownloadGalleryTask(gallery2);
}
} catch (error) {
logger.error(error);
}
};
const initGallery = function() {
var _a2;
const $gallery = $(this);
if ($gallery.attr("init"))
return;
$gallery.attr("init", "true");
const $a = $gallery.find("a.cover");
if (settings.openOnNewTab)
$a.attr("target", "_blank");
const gid2 = (_a2 = /\/g\/([0-9]+)/.exec($a.attr("href"))) == null ? void 0 : _a2[1];
if (!gid2)
return;
const enTitle = $gallery.find(".caption").text().trim();
const progressDisplayController = new ProgressDisplayController();
const { downloadBtn } = progressDisplayController;
$gallery.append(downloadBtn);
let ignoreController;
let galleryTitle;
const markGalleryDownloaded = () => {
$gallery.addClass("downloaded");
ignoreController == null ? void 0 : ignoreController.setStatus(true);
};
const unmarkGalleryDownloaded = () => {
$gallery.removeClass("downloaded");
ignoreController == null ? void 0 : ignoreController.setStatus(false);
};
void Promise.all([isDownloadedByGid(gid2), isDownloadedByTitle({ english: enTitle })]).then(
([gidDownloaded, titleDownloaded]) => {
const downloaded = gidDownloaded || titleDownloaded;
if (downloaded)
markGalleryDownloaded();
if (settings.showIgnoreButton) {
ignoreController = new IgnoreController(false, downloaded);
const { ignoreBtn } = ignoreController;
ignoreBtn.addEventListener("click", () => {
const ignore = ignoreController.getStatus();
if (ignore) {
unmarkGalleryDownloaded();
unmarkAsDownloaded(gid2, galleryTitle);
} else {
markGalleryDownloaded();
markAsDownloaded(gid2, galleryTitle);
}
});
$gallery.append(ignoreBtn);
}
}
);
let gallery2;
let skipDownloadedCheck = false;
const startDownload = async () => {
if (!settings.autoCancelDownloadedManga) {
progressDisplayController.lockBtn("Wait");
}
if (!skipDownloadedCheck && await isDownloadedByGid(gid2)) {
const title = $gallery.find(".caption").text();
if (!await downloadAgainConfirm(title, true)) {
progressDisplayController.reset();
markGalleryDownloaded();
return;
}
skipDownloadedCheck = true;
}
if (settings.autoCancelDownloadedManga) {
progressDisplayController.lockBtn("Wait");
}
if (!gallery2) {
try {
gallery2 = await getGalleryInfo(gid2);
galleryTitle = gallery2.title;
} catch (error) {
logger.error(error);
progressDisplayController.error();
errorRetryConfirm(ErrorAction.GET_INFO, void 0, startDownload);
return;
}
}
if (!skipDownloadedCheck) {
if (await isDownloadedByTitle(gallery2.title) && !await downloadAgainConfirm(gallery2.title.japanese || gallery2.title.english, true)) {
progressDisplayController.reset();
markAsDownloaded(gid2, gallery2.title);
markGalleryDownloaded();
return;
}
if (dlQueue.queue.some(
({
info: {
gallery: { title }
}
}) => isSameTitle(title, gallery2.title)
) && !await downloadAgainConfirm(gallery2.title.japanese || gallery2.title.english, true)) {
progressDisplayController.reset();
return;
}
}
addDownloadGalleryTask(gallery2, { progressDisplayController, markGalleryDownloaded });
};
downloadBtn.addEventListener("click", startDownload);
};
class StyleInjector {
constructor(style) {
__publicField(this, "styleNode");
this.styleNode = /* @__PURE__ */ jsx.createElement("style", null, style);
}
inject() {
document.head.append(this.styleNode);
}
remove() {
this.styleNode.remove();
}
}
const initOnlineViewPage = () => {
if (!IS_NHENTAI)
initViewMode();
};
const initViewMode = () => {
const style = new StyleInjector(
"#image-container img{width:auto;max-width:calc(100vw - 20px);max-height:100vh}"
);
const viewModeText = ["[off]", "[on]"];
let viewMode = _GM_getValue("online_view_mode", 0);
applyOnlineViewStyle(!!viewMode, style);
const btnText = /* @__PURE__ */ jsx.createElement("span", null, viewModeText[viewMode]);
const btn = /* @__PURE__ */ jsx.createElement("button", { id: "online-view-mode-btn", class: "btn btn-secondary" }, "100% view height ", btnText);
btn.addEventListener("click", () => {
viewMode = 1 - viewMode;
_GM_setValue("online_view_mode", viewMode);
btnText.innerText = viewModeText[viewMode];
applyOnlineViewStyle(!!viewMode, style);
});
$("#page-container").prepend(btn);
};
const applyOnlineViewStyle = (enable, style) => {
if (enable)
style.inject();
else
style.remove();
};
const initPage = () => {
if (IS_PAGE_MANGA_LIST) {
initListPage();
applyPjax();
} else if (IS_PAGE_MANGA_DETAIL)
initDetailPage().catch(logger.error);
else if (IS_PAGE_ONLINE_VIEW)
initOnlineViewPage();
};
const applyPjax = () => {
$(document).pjax(".pagination a, .sort a", {
container: "#content",
fragment: "#content",
timeout: 1e4
});
$(document).on("pjax:end", () => {
$(".pagination a").each(function() {
const $this = $(this);
const href = $this.attr("href");
const isPathname = href.startsWith("/");
const url = isPathname ? new URL(href, location.origin) : new URL(href);
url.searchParams.delete("_pjax");
$this.attr("href", isPathname ? `${url.pathname}${url.search}` : url.href);
});
applyLazyLoad();
});
};
const applyLazyLoad = () => {
const { _n_app } = _unsafeWindow;
if (_n_app) {
_n_app.install_lazy_loader();
_n_app.install_blacklisting();
}
};
const createAppAndMount = (component, appInitFunc) => {
const el = document.createElement("div");
document.body.append(el);
const app = createApp(component);
appInitFunc == null ? void 0 : appInitFunc(app);
return app.mount(el);
};
const initSettingsDialogApp = functionOnce(
() => createAppAndMount(SettingsDialog, (app) => {
app.use(i18n);
})
);
const openSettingsDialog = () => {
const dialog = initSettingsDialogApp();
dialog.open();
};
createAppAndMount(_sfc_main$B);
initPage();
_GM_registerMenuCommand(i18n.global.t("common.settings"), openSettingsDialog);
}
});
require_main_001();
})();